{ "edges": [ { "id": "Import CSV 1 Parse SMILES 1", "source": "Import CSV 1", "sourceHandle": "output", "target": "Parse SMILES 1", "targetHandle": "bundle" }, { "id": "Parse SMILES 1 Graph from molecule similarity 1", "source": "Parse SMILES 1", "sourceHandle": "output", "target": "Graph from molecule similarity 1", "targetHandle": "bundle" }, { "id": "Graph from molecule similarity 1 Visualize graph 1", "source": "Graph from molecule similarity 1", "sourceHandle": "output", "target": "Visualize graph 1", "targetHandle": "graph" }, { "id": "Graph from molecule similarity 1 Cypher 1", "source": "Graph from molecule similarity 1", "sourceHandle": "output", "target": "Cypher 1", "targetHandle": "bundle" }, { "id": "Cypher 1 View tables 1", "source": "Cypher 1", "sourceHandle": "output", "target": "View tables 1", "targetHandle": "bundle" } ], "env": "LynxKite Graph Analytics", "nodes": [ { "data": { "__execution_delay": 0.0, "collapsed": null, "display": null, "error": null, "input_metadata": [], "meta": { "color": "orange", "inputs": [], "name": "Import CSV", "outputs": [ { "name": "output", "position": "right", "type": { "type": "None" } } ], "params": [ { "default": null, "name": "filename", "type": { "type": "" } }, { "default": "", "name": "columns", "type": { "type": "" } }, { "default": "", "name": "separator", "type": { "type": "" } } ], "type": "basic" }, "params": { "columns": "", "filename": "uploads/drug_target_data_sample.csv", "separator": "" }, "status": "done", "title": "Import CSV" }, "dragHandle": ".bg-primary", "height": 200.0, "id": "Import CSV 1", "position": { "x": 300.92214591096035, "y": 1018.8292637889027 }, "type": "basic", "width": 200.0 }, { "data": { "display": null, "error": null, "input_metadata": [ { "dataframes": { "df": { "columns": [ "ACCESSION", "ACTION_TYPE", "ACT_COMMENT", "ACT_SOURCE", "ACT_SOURCE_URL", "ACT_TYPE", "ACT_UNIT", "ACT_VALUE", "DRUG_NAME", "GENE", "INN", "InChI", "InChIKey", "MOA", "MOA_SOURCE", "MOA_SOURCE_URL", "ORGANISM", "RELATION", "SMILES", "STRUCT_ID", "SWISSPROT", "TARGET_CLASS", "TARGET_NAME", "TDL", "Unnamed: 0" ] } }, "other": {}, "relations": [] } ], "meta": { "color": "orange", "inputs": [ { "name": "bundle", "position": "left", "type": { "type": "" } } ], "name": "Parse SMILES", "outputs": [ { "name": "output", "position": "right", "type": { "type": "None" } } ], "params": [ { "default": "df", "name": "table", "type": { "type": "" } }, { "default": "SMILES", "name": "smiles_column", "type": { "type": "" } }, { "default": "mols", "name": "save_as", "type": { "type": "" } } ], "type": "basic" }, "params": { "save_as": "mols", "smiles_column": "SMILES", "table": "df" }, "status": "done", "title": "Parse SMILES" }, "dragHandle": ".bg-primary", "height": 200.0, "id": "Parse SMILES 1", "position": { "x": 580.5892989328847, "y": 1012.8823965480503 }, "type": "basic", "width": 200.0 }, { "data": { "__execution_delay": 0.0, "collapsed": null, "display": null, "error": null, "input_metadata": [ { "dataframes": { "df": { "columns": [ "ACCESSION", "ACTION_TYPE", "ACT_COMMENT", "ACT_SOURCE", "ACT_SOURCE_URL", "ACT_TYPE", "ACT_UNIT", "ACT_VALUE", "DRUG_NAME", "GENE", "INN", "InChI", "InChIKey", "MOA", "MOA_SOURCE", "MOA_SOURCE_URL", "ORGANISM", "RELATION", "SMILES", "STRUCT_ID", "SWISSPROT", "TARGET_CLASS", "TARGET_NAME", "TDL", "Unnamed: 0", "mols" ] } }, "other": {}, "relations": [] } ], "meta": { "color": "orange", "inputs": [ { "name": "bundle", "position": "left", "type": { "type": "" } } ], "name": "Graph from molecule similarity", "outputs": [ { "name": "output", "position": "right", "type": { "type": "None" } } ], "params": [ { "default": "df", "name": "table", "type": { "type": "" } }, { "default": "mols", "name": "mols_column", "type": { "type": "" } }, { "default": 10, "name": "average_degree", "type": { "type": "" } } ], "type": "basic" }, "params": { "average_degree": "3", "mols_column": "mols", "table": "df" }, "status": "done", "title": "Graph from molecule similarity" }, "dragHandle": ".bg-primary", "height": 200.0, "id": "Graph from molecule similarity 1", "position": { "x": 926.4337192214458, "y": 1014.4451876264845 }, "type": "basic", "width": 200.0 }, { "data": { "__execution_delay": 0.0, "collapsed": null, "display": { "animationDuration": 500, "animationEasingUpdate": "quinticInOut", "series": [ { "data": [ { "id": "0", "itemStyle": { "color": "#a6cee3" }, "label": { "show": true }, "name": "phencyclidine", "symbolSize": 22.360679774997894, "value": "Torpedo californica", "x": 0.10782539581500938, "y": -0.23839701129914528 }, { "id": "1", "itemStyle": { "color": "#1f78b4" }, "label": { "show": true }, "name": "triazolam", "symbolSize": 22.360679774997894, "value": "Homo sapiens", "x": -0.10748868396434766, "y": 0.19422487376381423 }, { "id": "2", "itemStyle": { "color": "#1f78b4" }, "label": { "show": true }, "name": "gentian violet", "symbolSize": 22.360679774997894, "value": "Homo sapiens", "x": 0.32091925175898867, "y": 0.37711363327258846 }, { "id": "3", "itemStyle": { "color": "#1f78b4" }, "label": { "show": true }, "name": "ipratropium", "symbolSize": 22.360679774997894, "value": "Homo sapiens", "x": 0.6787440363904107, "y": -0.24483461144842011 }, { "id": "4", "itemStyle": { "color": "#1f78b4" }, "label": { "show": true }, "name": "deoxycholic acid", "symbolSize": 22.360679774997894, "value": "Homo sapiens", "x": -1.0, "y": -0.08810688428883728 } ], "emphasis": { "focus": "adjacency", "lineStyle": { "width": 10 } }, "label": { "formatter": "{b}", "position": "top" }, "lineStyle": { "color": "gray", "curveness": 0.3 }, "links": [ { "lineStyle": { "color": "#440154" }, "source": "3", "target": "4", "value": "0.8481012658227848" }, { "lineStyle": { "color": "#3a538b" }, "source": "0", "target": "1", "value": "0.8813559322033898" }, { "lineStyle": { "color": "#3a538b" }, "source": "0", "target": "4", "value": "0.8813559322033898" }, { "lineStyle": { "color": "#26818e" }, "source": "0", "target": "3", "value": "0.9047619047619048" }, { "lineStyle": { "color": "#23898d" }, "source": "1", "target": "2", "value": "0.9090909090909091" }, { "lineStyle": { "color": "#1ea087" }, "source": "1", "target": "3", "value": "0.921875" }, { "lineStyle": { "color": "#3ebc73" }, "source": "0", "target": "2", "value": "0.9375" }, { "lineStyle": { "color": "#4fc369" }, "source": "1", "target": "4", "value": "0.9420289855072463" }, { "lineStyle": { "color": "#9fd938" }, "source": "2", "target": "4", "value": "0.9589041095890412" }, { "lineStyle": { "color": "#fde724" }, "source": "2", "target": "3", "value": "0.9775280898876404" } ], "type": "graph" } ], "tooltip": { "show": true } }, "error": null, "input_metadata": [ { "dataframes": { "edges": { "columns": [ "similarity", "source", "target" ] }, "nodes": { "columns": [ "ACCESSION", "ACTION_TYPE", "ACT_COMMENT", "ACT_SOURCE", "ACT_SOURCE_URL", "ACT_TYPE", "ACT_UNIT", "ACT_VALUE", "DRUG_NAME", "GENE", "INN", "InChI", "InChIKey", "MOA", "MOA_SOURCE", "MOA_SOURCE_URL", "ORGANISM", "RELATION", "SMILES", "STRUCT_ID", "SWISSPROT", "TARGET_CLASS", "TARGET_NAME", "TDL", "Unnamed: 0", "mols" ] } }, "other": {}, "relations": [ { "df": "edges", "name": null, "source_column": "source", "source_key": "id", "source_table": "nodes", "target_column": "target", "target_key": "id", "target_table": "nodes" } ] } ], "meta": { "color": "orange", "inputs": [ { "name": "graph", "position": "left", "type": { "type": "" } } ], "name": "Visualize graph", "outputs": [], "params": [ { "default": null, "name": "color_nodes_by", "type": { "format": "node attribute" } }, { "default": null, "name": "label_by", "type": { "format": "node attribute" } }, { "default": null, "name": "color_edges_by", "type": { "format": "edge attribute" } } ], "type": "visualization" }, "params": { "color_edges_by": "similarity", "color_nodes_by": "ORGANISM", "label_by": "DRUG_NAME" }, "status": "done", "title": "Visualize graph" }, "dragHandle": ".bg-primary", "height": 314.0, "id": "Visualize graph 1", "position": { "x": 1254.2277640235457, "y": 931.9705991370125 }, "type": "visualization", "width": 407.0 }, { "data": { "__execution_delay": 0.0, "collapsed": null, "display": null, "error": null, "input_metadata": [ { "dataframes": { "edges": { "columns": [ "similarity", "source", "target" ] }, "nodes": { "columns": [ "ACCESSION", "ACTION_TYPE", "ACT_COMMENT", "ACT_SOURCE", "ACT_SOURCE_URL", "ACT_TYPE", "ACT_UNIT", "ACT_VALUE", "DRUG_NAME", "GENE", "INN", "InChI", "InChIKey", "MOA", "MOA_SOURCE", "MOA_SOURCE_URL", "ORGANISM", "RELATION", "SMILES", "STRUCT_ID", "SWISSPROT", "TARGET_CLASS", "TARGET_NAME", "TDL", "Unnamed: 0", "mols" ] } }, "other": {}, "relations": [ { "df": "edges", "name": null, "source_column": "source", "source_key": "id", "source_table": "nodes", "target_column": "target", "target_key": "id", "target_table": "nodes" } ] } ], "meta": { "color": "orange", "inputs": [ { "name": "bundle", "position": "left", "type": { "type": "" } } ], "name": "Cypher", "outputs": [ { "name": "output", "position": "right", "type": { "type": "None" } } ], "params": [ { "default": null, "name": "query", "type": { "format": "textarea" } }, { "default": "result", "name": "save_as", "type": { "type": "" } } ], "type": "basic" }, "params": { "query": "MATCH\n (a {ORGANISM: \"Homo sapiens\"})\n -[r]->\n (b {ORGANISM: \"Homo sapiens\"})\nWHERE\n r.similarity > 0.9\nRETURN a.DRUG_NAME, b.DRUG_NAME", "save_as": "result" }, "status": "done", "title": "Cypher" }, "dragHandle": ".bg-primary", "height": 267.0, "id": "Cypher 1", "position": { "x": 1209.2024653849007, "y": 1567.9825632648467 }, "type": "basic", "width": 434.0 }, { "data": { "__execution_delay": null, "collapsed": null, "display": { "dataframes": { "edges": { "columns": [ "source", "target", "similarity" ], "data": [ [ 3.0, 4.0, 0.8481012658227848 ], [ 0.0, 1.0, 0.8813559322033898 ], [ 0.0, 4.0, 0.8813559322033898 ], [ 0.0, 3.0, 0.9047619047619048 ], [ 1.0, 2.0, 0.9090909090909091 ], [ 1.0, 3.0, 0.921875 ], [ 0.0, 2.0, 0.9375 ], [ 1.0, 4.0, 0.9420289855072463 ], [ 2.0, 4.0, 0.9589041095890412 ], [ 2.0, 3.0, 0.9775280898876404 ] ] }, "nodes": { "columns": [ "Unnamed: 0", "DRUG_NAME", "STRUCT_ID", "TARGET_NAME", "TARGET_CLASS", "ACCESSION", "GENE", "SWISSPROT", "ACT_VALUE", "ACT_UNIT", "ACT_TYPE", "ACT_COMMENT", "ACT_SOURCE", "RELATION", "MOA", "MOA_SOURCE", "ACT_SOURCE_URL", "MOA_SOURCE_URL", "ACTION_TYPE", "TDL", "ORGANISM", "SMILES", "InChI", "InChIKey", "INN", "mols" ], "data": [ [ 9737, "phencyclidine", 2121, "Acetylcholine receptor subunit alpha", "Ion channel", "P02710", "CHRNA1", "ACHA_TORCA", 6.66, NaN, "IC50", "Displacement of [3H]PCP from nAChR in Torpedo nobiliana electric organs membranes in presence of 100 uM carbachol by scintillation counting method", "CHEMBL", "=", NaN, "nan", NaN, "nan", "nan", "nan", "Torpedo californica", "C1CCN(CC1)C1(CCCCC1)C1=CC=CC=C1", "InChI=1S/C17H25N/c1-4-10-16(11-5-1)17(12-6-2-7-13-17)18-14-8-3-9-15-18/h1,4-5,10-11H,2-3,6-9,12-15H2", "JTJMJGYZQZDUJJ-UHFFFAOYSA-N", "phencyclidine", "" ], [ 12934, "triazolam", 2729, "GABA A receptor alpha-3/beta-2/gamma-2", "Ion channel", "P18507|P34903|P47870", "GABRG2|GABRA3|GABRB2", "GBRG2_HUMAN|GBRA3_HUMAN|GBRB2_HUMAN", 8.876, NaN, "Ki", "nan", "WOMBAT-PK", "=", 1.0, "CHEMBL", NaN, "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL646", "POSITIVE ALLOSTERIC MODULATOR", "Tclin|Tclin|Tclin|Tclin|Tclin|Tclin|Tclin|Tclin|Tclin", "Homo sapiens", "CC1=NN=C2CN=C(C3=CC(Cl)=CC=C3N12)C1=C(Cl)C=CC=C1", "InChI=1S/C17H12Cl2N4/c1-10-21-22-16-9-20-17(12-4-2-3-5-14(12)19)13-8-11(18)6-7-15(13)23(10)16/h2-8H,9H2,1H3", "JOFWLTCLBGQGBO-UHFFFAOYSA-N", "triazolam", "" ], [ 15266, "gentian violet", 4138, "D(2) dopamine receptor", "GPCR", "P14416", "DRD2", "DRD2_HUMAN", 5.975, NaN, "Ki", "DRUGMATRIX: Dopamine D2L radioligand binding (ligand: [3H] Spiperone)", "DRUG MATRIX", "=", NaN, "nan", NaN, "nan", "nan", "Tclin", "Homo sapiens", "CN(C)C1=CC=C(C=C1)C(C1=CC=C(C=C1)N(C)C)=C1C=CC(C=C1)=[N+](C)C", "InChI=1S/C25H30N3/c1-26(2)22-13-7-19(8-14-22)25(20-9-15-23(16-10-20)27(3)4)21-11-17-24(18-12-21)28(5)6/h7-18H,1-6H3/q+1", "LGLFFNDHMLKUMI-UHFFFAOYSA-N", "gentian violet", "" ], [ 6488, "ipratropium", 1475, "Muscarinic acetylcholine receptor M1", "GPCR", "P11229", "CHRM1", "ACM1_HUMAN", 9.31, NaN, "Ki", "nan", "WOMBAT-PK", "=", NaN, "nan", NaN, "nan", "nan", "Tclin", "Homo sapiens", "CC(C)[N+]1(C)[C@H]2CC[C@@H]1C[C@@H](C2)OC(=O)C(CO)C1=CC=CC=C1", "InChI=1S/C20H30NO3/c1-14(2)21(3)16-9-10-17(21)12-18(11-16)24-20(23)19(13-22)15-7-5-4-6-8-15/h4-8,14,16-19,22H,9-13H2,1-3H3/q+1/t16-,17+,18+,19?,21?", "OEXHQOGQTVQTAT-BHIXFJMTSA-N", "ipratropium", "" ], [ 17453, "deoxycholic acid", 4988, "G-protein coupled bile acid receptor 1", "GPCR", "Q8TDU6", "GPBAR1", "GPBAR_HUMAN", 6.2, NaN, "EC50", "nan", "IUPHAR", "=", NaN, "nan", NaN, "nan", "AGONIST", "Tchem", "Homo sapiens", "C[C@H](CCC(O)=O)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3C[C@H](O)[C@]12C", "InChI=1S/C24H40O4/c1-14(4-9-22(27)28)18-7-8-19-17-6-5-15-12-16(25)10-11-23(15,2)20(17)13-21(26)24(18,19)3/h14-21,25-26H,4-13H2,1-3H3,(H,27,28)/t14-,15-,16-,17+,18-,19+,20+,21+,23+,24-/m1/s1", "KXGVEGMKQFWNSR-LLQZFEROSA-N", "deoxycholic acid", "" ] ] }, "result": { "columns": [ "a.DRUG_NAME", "b.DRUG_NAME" ], "data": [ [ "triazolam", "gentian violet" ], [ "triazolam", "ipratropium" ], [ "triazolam", "deoxycholic acid" ], [ "gentian violet", "deoxycholic acid" ], [ "gentian violet", "ipratropium" ] ] } }, "other": {}, "relations": [ { "df": "edges", "name": null, "source_column": "source", "source_key": "id", "source_table": "nodes", "target_column": "target", "target_key": "id", "target_table": "nodes" } ] }, "error": null, "input_metadata": [ { "dataframes": { "edges": { "columns": [ "similarity", "source", "target" ] }, "nodes": { "columns": [ "ACCESSION", "ACTION_TYPE", "ACT_COMMENT", "ACT_SOURCE", "ACT_SOURCE_URL", "ACT_TYPE", "ACT_UNIT", "ACT_VALUE", "DRUG_NAME", "GENE", "INN", "InChI", "InChIKey", "MOA", "MOA_SOURCE", "MOA_SOURCE_URL", "ORGANISM", "RELATION", "SMILES", "STRUCT_ID", "SWISSPROT", "TARGET_CLASS", "TARGET_NAME", "TDL", "Unnamed: 0", "mols" ] }, "result": { "columns": [ "a.DRUG_NAME", "b.DRUG_NAME" ] } }, "other": {}, "relations": [ { "df": "edges", "name": null, "source_column": "source", "source_key": "id", "source_table": "nodes", "target_column": "target", "target_key": "id", "target_table": "nodes" } ] } ], "meta": { "color": "orange", "inputs": [ { "name": "bundle", "position": "left", "type": { "type": "" } } ], "name": "View tables", "outputs": [], "params": [ { "default": 100, "name": "limit", "type": { "type": "" } } ], "type": "table_view" }, "params": { "_tables_open": { "result": true }, "limit": 100.0 }, "status": "done", "title": "View tables" }, "dragHandle": ".bg-primary", "height": 295.0, "id": "View tables 1", "position": { "x": 1817.1767094971015, "y": 1459.025582190881 }, "type": "table_view", "width": 322.0 } ] }