file_name
large_stringlengths
4
69
prefix
large_stringlengths
0
26.7k
suffix
large_stringlengths
0
24.8k
middle
large_stringlengths
0
2.12k
fim_type
large_stringclasses
4 values
multi.rs
// Copyright 2021 Twitter, Inc. // Licensed under the Apache License, Version 2.0 // http://www.apache.org/licenses/LICENSE-2.0 //! The multi-threaded worker, which is used when there are multiple worker //! threads configured. This worker parses buffers to produce requests, sends //! the requests to the storage worker. Responses from the storage worker are //! then serialized onto the session buffer. use super::*; use crate::poll::Poll; use crate::QUEUE_RETRIES; use common::signal::Signal; use config::WorkerConfig; use core::marker::PhantomData; use core::time::Duration; use entrystore::EntryStore; use mio::event::Event; use mio::{Events, Token, Waker}; use protocol_common::{Compose, Execute, Parse, ParseError}; use queues::TrackedItem; use session::Session; use std::io::{BufRead, Write}; use std::sync::Arc; const WAKER_TOKEN: Token = Token(usize::MAX); const STORAGE_THREAD_ID: usize = 0; /// A builder for the request/response worker which communicates to the storage /// thread over a queue. pub struct MultiWorkerBuilder<Storage, Parser, Request, Response> { nevent: usize, parser: Parser,
_storage: PhantomData<Storage>, _request: PhantomData<Request>, _response: PhantomData<Response>, } impl<Storage, Parser, Request, Response> MultiWorkerBuilder<Storage, Parser, Request, Response> { /// Create a new builder from the provided config and parser. pub fn new<T: WorkerConfig>(config: &T, parser: Parser) -> Result<Self, std::io::Error> { let poll = Poll::new().map_err(|e| { error!("{}", e); std::io::Error::new(std::io::ErrorKind::Other, "Failed to create epoll instance") })?; Ok(Self { poll, nevent: config.worker().nevent(), timeout: Duration::from_millis(config.worker().timeout() as u64), _request: PhantomData, _response: PhantomData, _storage: PhantomData, parser, }) } /// Get the waker that is registered to the epoll instance. pub(crate) fn waker(&self) -> Arc<Waker> { self.poll.waker() } /// Converts the builder into a `MultiWorker` by providing the queues that /// are necessary for communication between components. pub fn build( self, signal_queue: Queues<(), Signal>, session_queue: Queues<(), Session>, storage_queue: Queues<TokenWrapper<Request>, WrappedResult<Request, Response>>, ) -> MultiWorker<Storage, Parser, Request, Response> { MultiWorker { nevent: self.nevent, parser: self.parser, poll: self.poll, timeout: self.timeout, signal_queue, _storage: PhantomData, storage_queue, session_queue, } } } /// Represents a finalized request/response worker which is ready to be run. pub struct MultiWorker<Storage, Parser, Request, Response> { nevent: usize, parser: Parser, poll: Poll, timeout: Duration, session_queue: Queues<(), Session>, signal_queue: Queues<(), Signal>, _storage: PhantomData<Storage>, storage_queue: Queues<TokenWrapper<Request>, WrappedResult<Request, Response>>, } impl<Storage, Parser, Request, Response> MultiWorker<Storage, Parser, Request, Response> where Parser: Parse<Request>, Response: Compose, Storage: Execute<Request, Response> + EntryStore, { /// Run the worker in a loop, handling new events. pub fn run(&mut self) { // these are buffers which are re-used in each loop iteration to receive // events and queue messages let mut events = Events::with_capacity(self.nevent); let mut responses = Vec::with_capacity(QUEUE_CAPACITY); let mut sessions = Vec::with_capacity(QUEUE_CAPACITY); loop { WORKER_EVENT_LOOP.increment(); // get events with timeout if self.poll.poll(&mut events, self.timeout).is_err() { error!("Error polling"); } let timestamp = Instant::now(); let count = events.iter().count(); WORKER_EVENT_TOTAL.add(count as _); if count == self.nevent { WORKER_EVENT_MAX_REACHED.increment(); } else { WORKER_EVENT_DEPTH.increment(timestamp, count as _, 1); } // process all events for event in events.iter() { match event.token() { WAKER_TOKEN => { self.handle_new_sessions(&mut sessions); self.handle_storage_queue(&mut responses); // check if we received any signals from the admin thread while let Some(signal) = self.signal_queue.try_recv().map(|v| v.into_inner()) { match signal { Signal::FlushAll => {} Signal::Shutdown => { // if we received a shutdown, we can return // and stop processing events return; } } } } _ => { self.handle_event(event, timestamp); } } } // wakes the storage thread if necessary let _ = self.storage_queue.wake(); } } fn handle_event(&mut self, event: &Event, timestamp: Instant) { let token = event.token(); // handle error events first if event.is_error() { WORKER_EVENT_ERROR.increment(); self.handle_error(token); } // handle write events before read events to reduce write buffer // growth if there is also a readable event if event.is_writable() { WORKER_EVENT_WRITE.increment(); self.do_write(token); } // read events are handled last if event.is_readable() { WORKER_EVENT_READ.increment(); if let Ok(session) = self.poll.get_mut_session(token) { session.set_timestamp(timestamp); } let _ = self.do_read(token); } if let Ok(session) = self.poll.get_mut_session(token) { if session.read_pending() > 0 { trace!( "session: {:?} has {} bytes pending in read buffer", session, session.read_pending() ); } if session.write_pending() > 0 { trace!( "session: {:?} has {} bytes pending in write buffer", session, session.read_pending() ); } } } fn handle_session_read(&mut self, token: Token) -> Result<(), std::io::Error> { let session = self.poll.get_mut_session(token)?; match self.parser.parse(session.buffer()) { Ok(request) => { let consumed = request.consumed(); let request = request.into_inner(); trace!("parsed request for sesion: {:?}", session); session.consume(consumed); let mut message = TokenWrapper::new(request, token); for retry in 0..QUEUE_RETRIES { if let Err(m) = self.storage_queue.try_send_to(STORAGE_THREAD_ID, message) { if (retry + 1) == QUEUE_RETRIES { error!("queue full trying to send message to storage thread"); let _ = self.poll.close_session(token); } // try to wake storage thread let _ = self.storage_queue.wake(); message = m; } else { break; } } Ok(()) } Err(ParseError::Incomplete) => { trace!("incomplete request for session: {:?}", session); Err(std::io::Error::new( std::io::ErrorKind::WouldBlock, "incomplete request", )) } Err(_) => { debug!("bad request for session: {:?}", session); trace!("session: {:?} read buffer: {:?}", session, session.buffer()); let _ = self.poll.close_session(token); Err(std::io::Error::new( std::io::ErrorKind::Other, "bad request", )) } } } fn handle_storage_queue( &mut self, responses: &mut Vec<TrackedItem<WrappedResult<Request, Response>>>, ) { trace!("handling event for storage queue"); // process all storage queue responses self.storage_queue.try_recv_all(responses); for message in responses.drain(..).map(|v| v.into_inner()) { let token = message.token(); let mut reregister = false; if let Ok(session) = self.poll.get_mut_session(token) { let result = message.into_inner(); trace!("composing response for session: {:?}", session); result.compose(session); session.finalize_response(); // if we have pending writes, we should attempt to flush the session // now. if we still have pending bytes, we should re-register to // remove the read interest. if session.write_pending() > 0 { let _ = session.flush(); if session.write_pending() > 0 { reregister = true; } } if session.read_pending() > 0 && self.handle_session_read(token).is_ok() { let _ = self.storage_queue.wake(); } } if reregister { self.poll.reregister(token); } } let _ = self.storage_queue.wake(); } fn handle_new_sessions(&mut self, sessions: &mut Vec<TrackedItem<Session>>) { self.session_queue.try_recv_all(sessions); for session in sessions.drain(..).map(|v| v.into_inner()) { let pending = session.read_pending(); trace!( "new session: {:?} with {} bytes pending in read buffer", session, pending ); if let Ok(token) = self.poll.add_session(session) { if pending > 0 { // handle any pending data immediately if self.handle_data(token).is_err() { self.handle_error(token); } } } } } } impl<Storage, Parser, Request, Response> EventLoop for MultiWorker<Storage, Parser, Request, Response> where Parser: Parse<Request>, Response: Compose, Storage: Execute<Request, Response> + EntryStore, { fn handle_data(&mut self, token: Token) -> Result<(), std::io::Error> { let _ = self.handle_session_read(token); Ok(()) } fn poll(&mut self) -> &mut Poll { &mut self.poll } }
poll: Poll, timeout: Duration,
random_line_split
multi.rs
// Copyright 2021 Twitter, Inc. // Licensed under the Apache License, Version 2.0 // http://www.apache.org/licenses/LICENSE-2.0 //! The multi-threaded worker, which is used when there are multiple worker //! threads configured. This worker parses buffers to produce requests, sends //! the requests to the storage worker. Responses from the storage worker are //! then serialized onto the session buffer. use super::*; use crate::poll::Poll; use crate::QUEUE_RETRIES; use common::signal::Signal; use config::WorkerConfig; use core::marker::PhantomData; use core::time::Duration; use entrystore::EntryStore; use mio::event::Event; use mio::{Events, Token, Waker}; use protocol_common::{Compose, Execute, Parse, ParseError}; use queues::TrackedItem; use session::Session; use std::io::{BufRead, Write}; use std::sync::Arc; const WAKER_TOKEN: Token = Token(usize::MAX); const STORAGE_THREAD_ID: usize = 0; /// A builder for the request/response worker which communicates to the storage /// thread over a queue. pub struct MultiWorkerBuilder<Storage, Parser, Request, Response> { nevent: usize, parser: Parser, poll: Poll, timeout: Duration, _storage: PhantomData<Storage>, _request: PhantomData<Request>, _response: PhantomData<Response>, } impl<Storage, Parser, Request, Response> MultiWorkerBuilder<Storage, Parser, Request, Response> { /// Create a new builder from the provided config and parser. pub fn new<T: WorkerConfig>(config: &T, parser: Parser) -> Result<Self, std::io::Error> { let poll = Poll::new().map_err(|e| { error!("{}", e); std::io::Error::new(std::io::ErrorKind::Other, "Failed to create epoll instance") })?; Ok(Self { poll, nevent: config.worker().nevent(), timeout: Duration::from_millis(config.worker().timeout() as u64), _request: PhantomData, _response: PhantomData, _storage: PhantomData, parser, }) } /// Get the waker that is registered to the epoll instance. pub(crate) fn waker(&self) -> Arc<Waker> { self.poll.waker() } /// Converts the builder into a `MultiWorker` by providing the queues that /// are necessary for communication between components. pub fn build( self, signal_queue: Queues<(), Signal>, session_queue: Queues<(), Session>, storage_queue: Queues<TokenWrapper<Request>, WrappedResult<Request, Response>>, ) -> MultiWorker<Storage, Parser, Request, Response> { MultiWorker { nevent: self.nevent, parser: self.parser, poll: self.poll, timeout: self.timeout, signal_queue, _storage: PhantomData, storage_queue, session_queue, } } } /// Represents a finalized request/response worker which is ready to be run. pub struct MultiWorker<Storage, Parser, Request, Response> { nevent: usize, parser: Parser, poll: Poll, timeout: Duration, session_queue: Queues<(), Session>, signal_queue: Queues<(), Signal>, _storage: PhantomData<Storage>, storage_queue: Queues<TokenWrapper<Request>, WrappedResult<Request, Response>>, } impl<Storage, Parser, Request, Response> MultiWorker<Storage, Parser, Request, Response> where Parser: Parse<Request>, Response: Compose, Storage: Execute<Request, Response> + EntryStore, { /// Run the worker in a loop, handling new events. pub fn run(&mut self) { // these are buffers which are re-used in each loop iteration to receive // events and queue messages let mut events = Events::with_capacity(self.nevent); let mut responses = Vec::with_capacity(QUEUE_CAPACITY); let mut sessions = Vec::with_capacity(QUEUE_CAPACITY); loop { WORKER_EVENT_LOOP.increment(); // get events with timeout if self.poll.poll(&mut events, self.timeout).is_err() { error!("Error polling"); } let timestamp = Instant::now(); let count = events.iter().count(); WORKER_EVENT_TOTAL.add(count as _); if count == self.nevent { WORKER_EVENT_MAX_REACHED.increment(); } else { WORKER_EVENT_DEPTH.increment(timestamp, count as _, 1); } // process all events for event in events.iter() { match event.token() { WAKER_TOKEN => { self.handle_new_sessions(&mut sessions); self.handle_storage_queue(&mut responses); // check if we received any signals from the admin thread while let Some(signal) = self.signal_queue.try_recv().map(|v| v.into_inner()) { match signal { Signal::FlushAll => {} Signal::Shutdown => { // if we received a shutdown, we can return // and stop processing events return; } } } } _ => { self.handle_event(event, timestamp); } } } // wakes the storage thread if necessary let _ = self.storage_queue.wake(); } } fn handle_event(&mut self, event: &Event, timestamp: Instant) { let token = event.token(); // handle error events first if event.is_error()
// handle write events before read events to reduce write buffer // growth if there is also a readable event if event.is_writable() { WORKER_EVENT_WRITE.increment(); self.do_write(token); } // read events are handled last if event.is_readable() { WORKER_EVENT_READ.increment(); if let Ok(session) = self.poll.get_mut_session(token) { session.set_timestamp(timestamp); } let _ = self.do_read(token); } if let Ok(session) = self.poll.get_mut_session(token) { if session.read_pending() > 0 { trace!( "session: {:?} has {} bytes pending in read buffer", session, session.read_pending() ); } if session.write_pending() > 0 { trace!( "session: {:?} has {} bytes pending in write buffer", session, session.read_pending() ); } } } fn handle_session_read(&mut self, token: Token) -> Result<(), std::io::Error> { let session = self.poll.get_mut_session(token)?; match self.parser.parse(session.buffer()) { Ok(request) => { let consumed = request.consumed(); let request = request.into_inner(); trace!("parsed request for sesion: {:?}", session); session.consume(consumed); let mut message = TokenWrapper::new(request, token); for retry in 0..QUEUE_RETRIES { if let Err(m) = self.storage_queue.try_send_to(STORAGE_THREAD_ID, message) { if (retry + 1) == QUEUE_RETRIES { error!("queue full trying to send message to storage thread"); let _ = self.poll.close_session(token); } // try to wake storage thread let _ = self.storage_queue.wake(); message = m; } else { break; } } Ok(()) } Err(ParseError::Incomplete) => { trace!("incomplete request for session: {:?}", session); Err(std::io::Error::new( std::io::ErrorKind::WouldBlock, "incomplete request", )) } Err(_) => { debug!("bad request for session: {:?}", session); trace!("session: {:?} read buffer: {:?}", session, session.buffer()); let _ = self.poll.close_session(token); Err(std::io::Error::new( std::io::ErrorKind::Other, "bad request", )) } } } fn handle_storage_queue( &mut self, responses: &mut Vec<TrackedItem<WrappedResult<Request, Response>>>, ) { trace!("handling event for storage queue"); // process all storage queue responses self.storage_queue.try_recv_all(responses); for message in responses.drain(..).map(|v| v.into_inner()) { let token = message.token(); let mut reregister = false; if let Ok(session) = self.poll.get_mut_session(token) { let result = message.into_inner(); trace!("composing response for session: {:?}", session); result.compose(session); session.finalize_response(); // if we have pending writes, we should attempt to flush the session // now. if we still have pending bytes, we should re-register to // remove the read interest. if session.write_pending() > 0 { let _ = session.flush(); if session.write_pending() > 0 { reregister = true; } } if session.read_pending() > 0 && self.handle_session_read(token).is_ok() { let _ = self.storage_queue.wake(); } } if reregister { self.poll.reregister(token); } } let _ = self.storage_queue.wake(); } fn handle_new_sessions(&mut self, sessions: &mut Vec<TrackedItem<Session>>) { self.session_queue.try_recv_all(sessions); for session in sessions.drain(..).map(|v| v.into_inner()) { let pending = session.read_pending(); trace!( "new session: {:?} with {} bytes pending in read buffer", session, pending ); if let Ok(token) = self.poll.add_session(session) { if pending > 0 { // handle any pending data immediately if self.handle_data(token).is_err() { self.handle_error(token); } } } } } } impl<Storage, Parser, Request, Response> EventLoop for MultiWorker<Storage, Parser, Request, Response> where Parser: Parse<Request>, Response: Compose, Storage: Execute<Request, Response> + EntryStore, { fn handle_data(&mut self, token: Token) -> Result<(), std::io::Error> { let _ = self.handle_session_read(token); Ok(()) } fn poll(&mut self) -> &mut Poll { &mut self.poll } }
{ WORKER_EVENT_ERROR.increment(); self.handle_error(token); }
conditional_block
multi.rs
// Copyright 2021 Twitter, Inc. // Licensed under the Apache License, Version 2.0 // http://www.apache.org/licenses/LICENSE-2.0 //! The multi-threaded worker, which is used when there are multiple worker //! threads configured. This worker parses buffers to produce requests, sends //! the requests to the storage worker. Responses from the storage worker are //! then serialized onto the session buffer. use super::*; use crate::poll::Poll; use crate::QUEUE_RETRIES; use common::signal::Signal; use config::WorkerConfig; use core::marker::PhantomData; use core::time::Duration; use entrystore::EntryStore; use mio::event::Event; use mio::{Events, Token, Waker}; use protocol_common::{Compose, Execute, Parse, ParseError}; use queues::TrackedItem; use session::Session; use std::io::{BufRead, Write}; use std::sync::Arc; const WAKER_TOKEN: Token = Token(usize::MAX); const STORAGE_THREAD_ID: usize = 0; /// A builder for the request/response worker which communicates to the storage /// thread over a queue. pub struct MultiWorkerBuilder<Storage, Parser, Request, Response> { nevent: usize, parser: Parser, poll: Poll, timeout: Duration, _storage: PhantomData<Storage>, _request: PhantomData<Request>, _response: PhantomData<Response>, } impl<Storage, Parser, Request, Response> MultiWorkerBuilder<Storage, Parser, Request, Response> { /// Create a new builder from the provided config and parser. pub fn new<T: WorkerConfig>(config: &T, parser: Parser) -> Result<Self, std::io::Error> { let poll = Poll::new().map_err(|e| { error!("{}", e); std::io::Error::new(std::io::ErrorKind::Other, "Failed to create epoll instance") })?; Ok(Self { poll, nevent: config.worker().nevent(), timeout: Duration::from_millis(config.worker().timeout() as u64), _request: PhantomData, _response: PhantomData, _storage: PhantomData, parser, }) } /// Get the waker that is registered to the epoll instance. pub(crate) fn waker(&self) -> Arc<Waker> { self.poll.waker() } /// Converts the builder into a `MultiWorker` by providing the queues that /// are necessary for communication between components. pub fn build( self, signal_queue: Queues<(), Signal>, session_queue: Queues<(), Session>, storage_queue: Queues<TokenWrapper<Request>, WrappedResult<Request, Response>>, ) -> MultiWorker<Storage, Parser, Request, Response>
} /// Represents a finalized request/response worker which is ready to be run. pub struct MultiWorker<Storage, Parser, Request, Response> { nevent: usize, parser: Parser, poll: Poll, timeout: Duration, session_queue: Queues<(), Session>, signal_queue: Queues<(), Signal>, _storage: PhantomData<Storage>, storage_queue: Queues<TokenWrapper<Request>, WrappedResult<Request, Response>>, } impl<Storage, Parser, Request, Response> MultiWorker<Storage, Parser, Request, Response> where Parser: Parse<Request>, Response: Compose, Storage: Execute<Request, Response> + EntryStore, { /// Run the worker in a loop, handling new events. pub fn run(&mut self) { // these are buffers which are re-used in each loop iteration to receive // events and queue messages let mut events = Events::with_capacity(self.nevent); let mut responses = Vec::with_capacity(QUEUE_CAPACITY); let mut sessions = Vec::with_capacity(QUEUE_CAPACITY); loop { WORKER_EVENT_LOOP.increment(); // get events with timeout if self.poll.poll(&mut events, self.timeout).is_err() { error!("Error polling"); } let timestamp = Instant::now(); let count = events.iter().count(); WORKER_EVENT_TOTAL.add(count as _); if count == self.nevent { WORKER_EVENT_MAX_REACHED.increment(); } else { WORKER_EVENT_DEPTH.increment(timestamp, count as _, 1); } // process all events for event in events.iter() { match event.token() { WAKER_TOKEN => { self.handle_new_sessions(&mut sessions); self.handle_storage_queue(&mut responses); // check if we received any signals from the admin thread while let Some(signal) = self.signal_queue.try_recv().map(|v| v.into_inner()) { match signal { Signal::FlushAll => {} Signal::Shutdown => { // if we received a shutdown, we can return // and stop processing events return; } } } } _ => { self.handle_event(event, timestamp); } } } // wakes the storage thread if necessary let _ = self.storage_queue.wake(); } } fn handle_event(&mut self, event: &Event, timestamp: Instant) { let token = event.token(); // handle error events first if event.is_error() { WORKER_EVENT_ERROR.increment(); self.handle_error(token); } // handle write events before read events to reduce write buffer // growth if there is also a readable event if event.is_writable() { WORKER_EVENT_WRITE.increment(); self.do_write(token); } // read events are handled last if event.is_readable() { WORKER_EVENT_READ.increment(); if let Ok(session) = self.poll.get_mut_session(token) { session.set_timestamp(timestamp); } let _ = self.do_read(token); } if let Ok(session) = self.poll.get_mut_session(token) { if session.read_pending() > 0 { trace!( "session: {:?} has {} bytes pending in read buffer", session, session.read_pending() ); } if session.write_pending() > 0 { trace!( "session: {:?} has {} bytes pending in write buffer", session, session.read_pending() ); } } } fn handle_session_read(&mut self, token: Token) -> Result<(), std::io::Error> { let session = self.poll.get_mut_session(token)?; match self.parser.parse(session.buffer()) { Ok(request) => { let consumed = request.consumed(); let request = request.into_inner(); trace!("parsed request for sesion: {:?}", session); session.consume(consumed); let mut message = TokenWrapper::new(request, token); for retry in 0..QUEUE_RETRIES { if let Err(m) = self.storage_queue.try_send_to(STORAGE_THREAD_ID, message) { if (retry + 1) == QUEUE_RETRIES { error!("queue full trying to send message to storage thread"); let _ = self.poll.close_session(token); } // try to wake storage thread let _ = self.storage_queue.wake(); message = m; } else { break; } } Ok(()) } Err(ParseError::Incomplete) => { trace!("incomplete request for session: {:?}", session); Err(std::io::Error::new( std::io::ErrorKind::WouldBlock, "incomplete request", )) } Err(_) => { debug!("bad request for session: {:?}", session); trace!("session: {:?} read buffer: {:?}", session, session.buffer()); let _ = self.poll.close_session(token); Err(std::io::Error::new( std::io::ErrorKind::Other, "bad request", )) } } } fn handle_storage_queue( &mut self, responses: &mut Vec<TrackedItem<WrappedResult<Request, Response>>>, ) { trace!("handling event for storage queue"); // process all storage queue responses self.storage_queue.try_recv_all(responses); for message in responses.drain(..).map(|v| v.into_inner()) { let token = message.token(); let mut reregister = false; if let Ok(session) = self.poll.get_mut_session(token) { let result = message.into_inner(); trace!("composing response for session: {:?}", session); result.compose(session); session.finalize_response(); // if we have pending writes, we should attempt to flush the session // now. if we still have pending bytes, we should re-register to // remove the read interest. if session.write_pending() > 0 { let _ = session.flush(); if session.write_pending() > 0 { reregister = true; } } if session.read_pending() > 0 && self.handle_session_read(token).is_ok() { let _ = self.storage_queue.wake(); } } if reregister { self.poll.reregister(token); } } let _ = self.storage_queue.wake(); } fn handle_new_sessions(&mut self, sessions: &mut Vec<TrackedItem<Session>>) { self.session_queue.try_recv_all(sessions); for session in sessions.drain(..).map(|v| v.into_inner()) { let pending = session.read_pending(); trace!( "new session: {:?} with {} bytes pending in read buffer", session, pending ); if let Ok(token) = self.poll.add_session(session) { if pending > 0 { // handle any pending data immediately if self.handle_data(token).is_err() { self.handle_error(token); } } } } } } impl<Storage, Parser, Request, Response> EventLoop for MultiWorker<Storage, Parser, Request, Response> where Parser: Parse<Request>, Response: Compose, Storage: Execute<Request, Response> + EntryStore, { fn handle_data(&mut self, token: Token) -> Result<(), std::io::Error> { let _ = self.handle_session_read(token); Ok(()) } fn poll(&mut self) -> &mut Poll { &mut self.poll } }
{ MultiWorker { nevent: self.nevent, parser: self.parser, poll: self.poll, timeout: self.timeout, signal_queue, _storage: PhantomData, storage_queue, session_queue, } }
identifier_body
multi.rs
// Copyright 2021 Twitter, Inc. // Licensed under the Apache License, Version 2.0 // http://www.apache.org/licenses/LICENSE-2.0 //! The multi-threaded worker, which is used when there are multiple worker //! threads configured. This worker parses buffers to produce requests, sends //! the requests to the storage worker. Responses from the storage worker are //! then serialized onto the session buffer. use super::*; use crate::poll::Poll; use crate::QUEUE_RETRIES; use common::signal::Signal; use config::WorkerConfig; use core::marker::PhantomData; use core::time::Duration; use entrystore::EntryStore; use mio::event::Event; use mio::{Events, Token, Waker}; use protocol_common::{Compose, Execute, Parse, ParseError}; use queues::TrackedItem; use session::Session; use std::io::{BufRead, Write}; use std::sync::Arc; const WAKER_TOKEN: Token = Token(usize::MAX); const STORAGE_THREAD_ID: usize = 0; /// A builder for the request/response worker which communicates to the storage /// thread over a queue. pub struct MultiWorkerBuilder<Storage, Parser, Request, Response> { nevent: usize, parser: Parser, poll: Poll, timeout: Duration, _storage: PhantomData<Storage>, _request: PhantomData<Request>, _response: PhantomData<Response>, } impl<Storage, Parser, Request, Response> MultiWorkerBuilder<Storage, Parser, Request, Response> { /// Create a new builder from the provided config and parser. pub fn new<T: WorkerConfig>(config: &T, parser: Parser) -> Result<Self, std::io::Error> { let poll = Poll::new().map_err(|e| { error!("{}", e); std::io::Error::new(std::io::ErrorKind::Other, "Failed to create epoll instance") })?; Ok(Self { poll, nevent: config.worker().nevent(), timeout: Duration::from_millis(config.worker().timeout() as u64), _request: PhantomData, _response: PhantomData, _storage: PhantomData, parser, }) } /// Get the waker that is registered to the epoll instance. pub(crate) fn waker(&self) -> Arc<Waker> { self.poll.waker() } /// Converts the builder into a `MultiWorker` by providing the queues that /// are necessary for communication between components. pub fn build( self, signal_queue: Queues<(), Signal>, session_queue: Queues<(), Session>, storage_queue: Queues<TokenWrapper<Request>, WrappedResult<Request, Response>>, ) -> MultiWorker<Storage, Parser, Request, Response> { MultiWorker { nevent: self.nevent, parser: self.parser, poll: self.poll, timeout: self.timeout, signal_queue, _storage: PhantomData, storage_queue, session_queue, } } } /// Represents a finalized request/response worker which is ready to be run. pub struct MultiWorker<Storage, Parser, Request, Response> { nevent: usize, parser: Parser, poll: Poll, timeout: Duration, session_queue: Queues<(), Session>, signal_queue: Queues<(), Signal>, _storage: PhantomData<Storage>, storage_queue: Queues<TokenWrapper<Request>, WrappedResult<Request, Response>>, } impl<Storage, Parser, Request, Response> MultiWorker<Storage, Parser, Request, Response> where Parser: Parse<Request>, Response: Compose, Storage: Execute<Request, Response> + EntryStore, { /// Run the worker in a loop, handling new events. pub fn run(&mut self) { // these are buffers which are re-used in each loop iteration to receive // events and queue messages let mut events = Events::with_capacity(self.nevent); let mut responses = Vec::with_capacity(QUEUE_CAPACITY); let mut sessions = Vec::with_capacity(QUEUE_CAPACITY); loop { WORKER_EVENT_LOOP.increment(); // get events with timeout if self.poll.poll(&mut events, self.timeout).is_err() { error!("Error polling"); } let timestamp = Instant::now(); let count = events.iter().count(); WORKER_EVENT_TOTAL.add(count as _); if count == self.nevent { WORKER_EVENT_MAX_REACHED.increment(); } else { WORKER_EVENT_DEPTH.increment(timestamp, count as _, 1); } // process all events for event in events.iter() { match event.token() { WAKER_TOKEN => { self.handle_new_sessions(&mut sessions); self.handle_storage_queue(&mut responses); // check if we received any signals from the admin thread while let Some(signal) = self.signal_queue.try_recv().map(|v| v.into_inner()) { match signal { Signal::FlushAll => {} Signal::Shutdown => { // if we received a shutdown, we can return // and stop processing events return; } } } } _ => { self.handle_event(event, timestamp); } } } // wakes the storage thread if necessary let _ = self.storage_queue.wake(); } } fn handle_event(&mut self, event: &Event, timestamp: Instant) { let token = event.token(); // handle error events first if event.is_error() { WORKER_EVENT_ERROR.increment(); self.handle_error(token); } // handle write events before read events to reduce write buffer // growth if there is also a readable event if event.is_writable() { WORKER_EVENT_WRITE.increment(); self.do_write(token); } // read events are handled last if event.is_readable() { WORKER_EVENT_READ.increment(); if let Ok(session) = self.poll.get_mut_session(token) { session.set_timestamp(timestamp); } let _ = self.do_read(token); } if let Ok(session) = self.poll.get_mut_session(token) { if session.read_pending() > 0 { trace!( "session: {:?} has {} bytes pending in read buffer", session, session.read_pending() ); } if session.write_pending() > 0 { trace!( "session: {:?} has {} bytes pending in write buffer", session, session.read_pending() ); } } } fn handle_session_read(&mut self, token: Token) -> Result<(), std::io::Error> { let session = self.poll.get_mut_session(token)?; match self.parser.parse(session.buffer()) { Ok(request) => { let consumed = request.consumed(); let request = request.into_inner(); trace!("parsed request for sesion: {:?}", session); session.consume(consumed); let mut message = TokenWrapper::new(request, token); for retry in 0..QUEUE_RETRIES { if let Err(m) = self.storage_queue.try_send_to(STORAGE_THREAD_ID, message) { if (retry + 1) == QUEUE_RETRIES { error!("queue full trying to send message to storage thread"); let _ = self.poll.close_session(token); } // try to wake storage thread let _ = self.storage_queue.wake(); message = m; } else { break; } } Ok(()) } Err(ParseError::Incomplete) => { trace!("incomplete request for session: {:?}", session); Err(std::io::Error::new( std::io::ErrorKind::WouldBlock, "incomplete request", )) } Err(_) => { debug!("bad request for session: {:?}", session); trace!("session: {:?} read buffer: {:?}", session, session.buffer()); let _ = self.poll.close_session(token); Err(std::io::Error::new( std::io::ErrorKind::Other, "bad request", )) } } } fn handle_storage_queue( &mut self, responses: &mut Vec<TrackedItem<WrappedResult<Request, Response>>>, ) { trace!("handling event for storage queue"); // process all storage queue responses self.storage_queue.try_recv_all(responses); for message in responses.drain(..).map(|v| v.into_inner()) { let token = message.token(); let mut reregister = false; if let Ok(session) = self.poll.get_mut_session(token) { let result = message.into_inner(); trace!("composing response for session: {:?}", session); result.compose(session); session.finalize_response(); // if we have pending writes, we should attempt to flush the session // now. if we still have pending bytes, we should re-register to // remove the read interest. if session.write_pending() > 0 { let _ = session.flush(); if session.write_pending() > 0 { reregister = true; } } if session.read_pending() > 0 && self.handle_session_read(token).is_ok() { let _ = self.storage_queue.wake(); } } if reregister { self.poll.reregister(token); } } let _ = self.storage_queue.wake(); } fn
(&mut self, sessions: &mut Vec<TrackedItem<Session>>) { self.session_queue.try_recv_all(sessions); for session in sessions.drain(..).map(|v| v.into_inner()) { let pending = session.read_pending(); trace!( "new session: {:?} with {} bytes pending in read buffer", session, pending ); if let Ok(token) = self.poll.add_session(session) { if pending > 0 { // handle any pending data immediately if self.handle_data(token).is_err() { self.handle_error(token); } } } } } } impl<Storage, Parser, Request, Response> EventLoop for MultiWorker<Storage, Parser, Request, Response> where Parser: Parse<Request>, Response: Compose, Storage: Execute<Request, Response> + EntryStore, { fn handle_data(&mut self, token: Token) -> Result<(), std::io::Error> { let _ = self.handle_session_read(token); Ok(()) } fn poll(&mut self) -> &mut Poll { &mut self.poll } }
handle_new_sessions
identifier_name
wasm.rs
gui_wasm"; pub const DEFAULT_TARGET_CRATE: &str = "app/gui"; #[derive( clap::ArgEnum, Clone, Copy, Debug, Default, strum::Display, strum::EnumString, PartialEq, Eq )] #[strum(serialize_all = "kebab-case")] pub enum ProfilingLevel { #[default] Objective, Task, Detail, Debug, } #[derive( clap::ArgEnum, Clone, Copy, Debug, Default, strum::Display, strum::EnumString, PartialEq, Eq )] #[strum(serialize_all = "kebab-case")] pub enum LogLevel { Error, #[default] Warn, Info, Debug, Trace, } #[derive(clap::ArgEnum, Clone, Copy, Debug, PartialEq, Eq, strum::Display, strum::AsRefStr)] #[strum(serialize_all = "kebab-case")] pub enum Profile { Dev, Profile, Release, // Production, } impl From<Profile> for wasm_pack::Profile { fn from(profile: Profile) -> Self { match profile { Profile::Dev => Self::Dev, Profile::Profile => Self::Profile, Profile::Release => Self::Release, // Profile::Production => Self::Release, } } } impl Profile { pub fn should_check_size(self) -> bool { match self { Profile::Dev => false, Profile::Profile => false, Profile::Release => true, // Profile::Production => true, } } pub fn extra_rust_options(self) -> Vec<String> { match self { // Profile::Production => ["-Clto=fat", "-Ccodegen-units=1", "-Cincremental=false"] // .into_iter() // .map(ToString::to_string) // .collect(), Profile::Dev | Profile::Profile | Profile::Release => vec![], } } pub fn optimization_level(self) -> wasm_opt::OptimizationLevel { match self { Profile::Dev => wasm_opt::OptimizationLevel::O0, Profile::Profile => wasm_opt::OptimizationLevel::O, Profile::Release => wasm_opt::OptimizationLevel::O3, } } } #[derive(Clone, Derivative)] #[derivative(Debug)] pub struct BuildInput { /// Path to the crate to be compiled to WAM. Relative to the repository root. pub crate_path: PathBuf, pub wasm_opt_options: Vec<String>, pub skip_wasm_opt: bool, pub extra_cargo_options: Vec<String>, pub profile: Profile, pub profiling_level: Option<ProfilingLevel>, pub log_level: LogLevel, pub uncollapsed_log_level: LogLevel, pub wasm_size_limit: Option<byte_unit::Byte>, pub system_shader_tools: bool, } impl BuildInput { pub async fn perhaps_check_size(&self, wasm_path: impl AsRef<Path>) -> Result { let compressed_size = compressed_size(&wasm_path).await?.get_appropriate_unit(true); info!("Compressed size of {} is {}.", wasm_path.as_ref().display(), compressed_size); if let Some(wasm_size_limit) = self.wasm_size_limit { let wasm_size_limit = wasm_size_limit.get_appropriate_unit(true); if!self.profile.should_check_size() { warn!("Skipping size check because profile is '{}'.", self.profile,); } else if self.profiling_level.unwrap_or_default()!= ProfilingLevel::Objective { // TODO? additional leeway as sanity check warn!( "Skipping size check because profiling level is {:?} rather than {}.", self.profiling_level, ProfilingLevel::Objective ); } else { ensure!( compressed_size < wasm_size_limit, "Compressed WASM size ~{} ({} bytes) exceeds the limit of {} ({} bytes).", compressed_size, compressed_size.get_byte(), wasm_size_limit, wasm_size_limit.get_byte(), ) } } Ok(()) } } #[derive(Clone, Copy, Debug, PartialEq, Eq)] pub struct Wasm; #[async_trait] impl IsTarget for Wasm { type BuildInput = BuildInput; type Artifact = Artifact; fn artifact_name(&self) -> String { WASM_ARTIFACT_NAME.into() } fn adapt_artifact(self, path: impl AsRef<Path>) -> BoxFuture<'static, Result<Self::Artifact>> { ready(Ok(Artifact::new(path.as_ref()))).boxed() } fn build_internal( &self, context: Context, job: BuildTargetJob<Self>, ) -> BoxFuture<'static, Result<Self::Artifact>>
log_level, uncollapsed_log_level, wasm_size_limit: _wasm_size_limit, system_shader_tools, } = &inner; // NOTE: We cannot trust locally installed version of shader tools to be correct. // Those binaries have no reliable versioning, and existing common distributions (e.g. // Vulkan SDK) contain old builds with bugs that impact our shaders. By default, we have // to force usage of our own distribution built on our CI. if *system_shader_tools { ShaderTools.install_if_missing(&cache).await?; } else { ShaderTools.install(&cache).await?; } cache::goodie::binaryen::Binaryen { version: BINARYEN_VERSION_TO_INSTALL } .install_if_missing(&cache) .await?; info!("Building wasm."); let temp_dir = tempdir()?; let temp_dist = RepoRootDistWasm::new_root(temp_dir.path()); ensogl_pack::build( ensogl_pack::WasmPackOutputs { out_dir: temp_dist.path.clone(), out_name: OUTPUT_NAME.into(), }, |args| { let mut command = WasmPack.cmd()?; command .current_dir(&repo_root) .kill_on_drop(true) .env_remove(ide_ci::programs::rustup::env::RUSTUP_TOOLCHAIN.name()) .build() .arg(wasm_pack::Profile::from(*profile)) .target(wasm_pack::Target::Web) .output_directory(args.out_dir) .output_name(args.out_name) .arg(crate_path) .arg("--") .apply(&cargo::Color::Always) .args(extra_cargo_options); if let Some(profiling_level) = profiling_level { command.set_env(env::ENSO_MAX_PROFILING_LEVEL, &profiling_level)?; } command.set_env(env::ENSO_MAX_LOG_LEVEL, &log_level)?; command.set_env(env::ENSO_MAX_UNCOLLAPSED_LOG_LEVEL, &uncollapsed_log_level)?; Ok(command) }, ) .await?; Self::finalize_wasm(wasm_opt_options, *skip_wasm_opt, *profile, &temp_dist).await?; ide_ci::fs::create_dir_if_missing(&destination)?; let ret = RepoRootDistWasm::new_root(&destination); ide_ci::fs::copy(&temp_dist, &ret)?; inner.perhaps_check_size(&ret.pkg_opt_wasm).await?; Ok(Artifact(ret)) } .instrument(span) .boxed() } } #[derive(Clone, Derivative)] #[derivative(Debug)] pub struct WatchInput { pub cargo_watch_options: Vec<String>, } impl IsWatchable for Wasm { type Watcher = crate::project::Watcher<Self, Child>; type WatchInput = WatchInput; fn watch( &self, context: Context, job: WatchTargetJob<Self>, ) -> BoxFuture<'static, Result<Self::Watcher>> { let span = debug_span!("Watching WASM.",?job).entered(); // The esbuild watcher must succeed in its first build, or it will prematurely exit. // See the issue: https://github.com/evanw/esbuild/issues/1063 // // Because of this, we run first build of wasm manually, rather through cargo-watch. // After it is completed, the cargo-watch gets spawned and this method yields the watcher. // This forces esbuild watcher (whose setup requires the watcher artifacts) to wait until // all wasm build outputs are in place, so the build won't crash. // // In general, much neater workaround should be possible, if we stop relying on cargo-watch // and do the WASM watch directly in the build script. let first_build_job = self .build(context.clone(), job.build.clone()) .instrument(debug_span!("Initial single build of WASM before setting up cargo-watch.")); async move { let first_build_output = first_build_job.await?; let WatchTargetJob { watch_input: WatchInput { cargo_watch_options: cargo_watch_flags }, build: WithDestination { inner, destination }, } = job; let BuildInput { crate_path, wasm_opt_options, skip_wasm_opt, extra_cargo_options, profile, profiling_level, log_level, uncollapsed_log_level, wasm_size_limit, system_shader_tools: _, } = inner; let current_exe = std::env::current_exe()?; // cargo-watch apparently cannot handle verbatim path prefix. We remove it and hope for // the best. let current_exe = current_exe.without_verbatim_prefix(); let mut watch_cmd = Cargo.cmd()?; let (watch_cmd_name, mut watch_cmd_opts) = match std::env::var("USE_CARGO_WATCH_PLUS") { Ok(_) => ("watch-plus", vec!["--why"]), Err(_) => ("watch", vec![]), }; watch_cmd_opts.push("--ignore"); watch_cmd_opts.push("README.md"); watch_cmd .kill_on_drop(true) .current_dir(&context.repo_root) .arg(watch_cmd_name) .args(watch_cmd_opts) .args(cargo_watch_flags) .arg("--"); // === Build Script top-level options === watch_cmd // TODO [mwu] // This is not nice, as this module should not be aware of the CLI // parsing/generation. Rather than using `cargo watch` this should // be implemented directly in Rust. .arg(current_exe) .arg("--skip-version-check") // We already checked in the parent process. .args(["--cache-path", context.cache.path().as_str()]) .args(["--upload-artifacts", context.upload_artifacts.to_string().as_str()]) .args(["--repo-path", context.repo_root.as_str()]); // === Build Script command and its options === watch_cmd .arg("wasm") .arg("build") .args(["--crate-path", crate_path.as_str()]) .args(["--wasm-output-path", destination.as_str()]) .args(["--wasm-profile", profile.as_ref()]); if let Some(profiling_level) = profiling_level { watch_cmd.args(["--profiling-level", profiling_level.to_string().as_str()]); } watch_cmd.args(["--wasm-log-level", log_level.to_string().as_str()]); watch_cmd .args(["--wasm-uncollapsed-log-level", uncollapsed_log_level.to_string().as_str()]); for wasm_opt_option in wasm_opt_options { watch_cmd.args(["--wasm-opt-option", &wasm_opt_option]); } if skip_wasm_opt { watch_cmd.args(["--skip-wasm-opt"]); } if let Some(wasm_size_limit) = wasm_size_limit { watch_cmd.args(["--wasm-size-limit", wasm_size_limit.to_string().as_str()]); } else { watch_cmd.args(["--wasm-size-limit", "0"]); } // === cargo-watch options === watch_cmd.arg("--").args(extra_cargo_options); let watch_process = watch_cmd.spawn_intercepting()?; let artifact = Artifact(RepoRootDistWasm::new_root(&destination)); ensure!( artifact == first_build_output, "First build output does not match general watch build output. First build output: \ {first_build_output:?}, general watch build output: {artifact:?}", ); Ok(Self::Watcher { artifact, watch_process }) } .instrument(span.exit()) .boxed() } } #[derive(Clone, Debug, Display, PartialEq, Eq)] pub struct Artifact(pub RepoRootDistWasm); impl Artifact { pub fn new(path: impl Into<PathBuf>) -> Self { Self(RepoRootDistWasm::new_root(path)) } /// The main JS bundle to load WASM and JS wasm-pack bundles. pub fn ensogl_app(&self) -> &Path { &self.0.index_js } /// Files that should be shipped in the Gui bundle. pub fn files_to_ship(&self) -> Vec<&Path> { // We explicitly deconstruct object, so when new fields are added, we will be forced to // consider whether they should be shipped or not. let RepoRootDistWasm { path: _, dynamic_assets, index_js: _, index_d_ts: _, index_js_map: _, pkg_js, pkg_js_map, pkg_wasm: _, pkg_opt_wasm, } = &self.0; vec![ dynamic_assets.as_path(), pkg_js.as_path(), pkg_js_map.as_path(), pkg_opt_wasm.as_path(), ] } pub fn symlink_ensogl_dist(&self, linked_dist: &RepoRootTargetEnsoglPackLinkedDist) -> Result { ide_ci::fs::remove_symlink_dir_if_exists(linked_dist)?; ide_ci::fs::symlink_auto(self, linked_dist) } } impl AsRef<Path> for Artifact { fn as_ref(&self) -> &Path { self.0.as_path() } } impl IsArtifact for Artifact {} impl Wasm { pub async fn check(&self) -> Result { Cargo .cmd()? .apply(&cargo::Command::Check) .apply(&cargo::Options::Workspace) .apply(&cargo::Options::Package(INTEGRATION_TESTS_CRATE_NAME.into())) .apply(&cargo::Options::AllTargets) .run_ok() .await } pub async fn test(&self, repo_root: PathBuf, wasm: &[test::Browser], native: bool) -> Result { async fn maybe_run<Fut: Future<Output = Result>>( name: &str, enabled: bool, f: impl (FnOnce() -> Fut), ) -> Result { if enabled { info!("Will run {name} tests."); f().await.context(format!("Running {name} tests.")) } else { info!("Skipping {name} tests."); Ok(()) } } maybe_run("native", native, async || { Cargo .cmd()? .current_dir(repo_root.clone()) .apply(&cargo::Command::Test) .apply(&cargo::Options::Workspace) // Color needs to be passed to tests themselves separately. // See: https://github.com/rust-lang/cargo/issues/1983 .arg("--") .apply(&cargo::Color::Always) .run_ok() .await }) .await?; maybe_run("wasm",!wasm.is_empty(), || test::test_all(repo_root.clone(), wasm)).await?; Ok(()) } pub async fn integration_test( &self, source_root: PathBuf, _project_manager: Option<Child>, headless: bool, additional_options: Vec<String>, wasm_timeout: Option<Duration>, ) -> Result { info!("Running Rust WASM test suite."); use wasm_pack::TestFlags::*; WasmPack .cmd()? .current_dir(source_root) .set_env_opt( env
{ let Context { octocrab: _, cache, upload_artifacts: _, repo_root } = context; let WithDestination { inner, destination } = job; let span = info_span!("Building WASM.", repo = %repo_root.display(), crate = %inner.crate_path.display(), cargo_opts = ?inner.extra_cargo_options ); async move { // Old wasm-pack does not pass trailing `build` command arguments to the Cargo. // We want to be able to pass --profile this way. WasmPack.require_present_that(VersionReq::parse(">=0.10.1")?).await?; let BuildInput { crate_path, wasm_opt_options, skip_wasm_opt, extra_cargo_options, profile, profiling_level,
identifier_body
wasm.rs
"gui_wasm"; pub const DEFAULT_TARGET_CRATE: &str = "app/gui"; #[derive( clap::ArgEnum, Clone, Copy, Debug, Default, strum::Display, strum::EnumString, PartialEq, Eq )] #[strum(serialize_all = "kebab-case")] pub enum ProfilingLevel { #[default] Objective, Task, Detail, Debug, } #[derive( clap::ArgEnum, Clone, Copy, Debug, Default, strum::Display, strum::EnumString, PartialEq, Eq )] #[strum(serialize_all = "kebab-case")] pub enum LogLevel { Error, #[default] Warn, Info, Debug, Trace, } #[derive(clap::ArgEnum, Clone, Copy, Debug, PartialEq, Eq, strum::Display, strum::AsRefStr)] #[strum(serialize_all = "kebab-case")] pub enum Profile { Dev, Profile, Release, // Production, } impl From<Profile> for wasm_pack::Profile { fn from(profile: Profile) -> Self { match profile { Profile::Dev => Self::Dev, Profile::Profile => Self::Profile, Profile::Release => Self::Release, // Profile::Production => Self::Release, } } } impl Profile { pub fn should_check_size(self) -> bool { match self { Profile::Dev => false, Profile::Profile => false, Profile::Release => true, // Profile::Production => true, } } pub fn extra_rust_options(self) -> Vec<String> { match self { // Profile::Production => ["-Clto=fat", "-Ccodegen-units=1", "-Cincremental=false"] // .into_iter() // .map(ToString::to_string) // .collect(), Profile::Dev | Profile::Profile | Profile::Release => vec![], } } pub fn optimization_level(self) -> wasm_opt::OptimizationLevel { match self { Profile::Dev => wasm_opt::OptimizationLevel::O0, Profile::Profile => wasm_opt::OptimizationLevel::O, Profile::Release => wasm_opt::OptimizationLevel::O3, } } } #[derive(Clone, Derivative)] #[derivative(Debug)] pub struct BuildInput { /// Path to the crate to be compiled to WAM. Relative to the repository root. pub crate_path: PathBuf, pub wasm_opt_options: Vec<String>, pub skip_wasm_opt: bool, pub extra_cargo_options: Vec<String>, pub profile: Profile, pub profiling_level: Option<ProfilingLevel>, pub log_level: LogLevel, pub uncollapsed_log_level: LogLevel, pub wasm_size_limit: Option<byte_unit::Byte>, pub system_shader_tools: bool, } impl BuildInput { pub async fn perhaps_check_size(&self, wasm_path: impl AsRef<Path>) -> Result { let compressed_size = compressed_size(&wasm_path).await?.get_appropriate_unit(true);
if!self.profile.should_check_size() { warn!("Skipping size check because profile is '{}'.", self.profile,); } else if self.profiling_level.unwrap_or_default()!= ProfilingLevel::Objective { // TODO? additional leeway as sanity check warn!( "Skipping size check because profiling level is {:?} rather than {}.", self.profiling_level, ProfilingLevel::Objective ); } else { ensure!( compressed_size < wasm_size_limit, "Compressed WASM size ~{} ({} bytes) exceeds the limit of {} ({} bytes).", compressed_size, compressed_size.get_byte(), wasm_size_limit, wasm_size_limit.get_byte(), ) } } Ok(()) } } #[derive(Clone, Copy, Debug, PartialEq, Eq)] pub struct Wasm; #[async_trait] impl IsTarget for Wasm { type BuildInput = BuildInput; type Artifact = Artifact; fn artifact_name(&self) -> String { WASM_ARTIFACT_NAME.into() } fn adapt_artifact(self, path: impl AsRef<Path>) -> BoxFuture<'static, Result<Self::Artifact>> { ready(Ok(Artifact::new(path.as_ref()))).boxed() } fn build_internal( &self, context: Context, job: BuildTargetJob<Self>, ) -> BoxFuture<'static, Result<Self::Artifact>> { let Context { octocrab: _, cache, upload_artifacts: _, repo_root } = context; let WithDestination { inner, destination } = job; let span = info_span!("Building WASM.", repo = %repo_root.display(), crate = %inner.crate_path.display(), cargo_opts =?inner.extra_cargo_options ); async move { // Old wasm-pack does not pass trailing `build` command arguments to the Cargo. // We want to be able to pass --profile this way. WasmPack.require_present_that(VersionReq::parse(">=0.10.1")?).await?; let BuildInput { crate_path, wasm_opt_options, skip_wasm_opt, extra_cargo_options, profile, profiling_level, log_level, uncollapsed_log_level, wasm_size_limit: _wasm_size_limit, system_shader_tools, } = &inner; // NOTE: We cannot trust locally installed version of shader tools to be correct. // Those binaries have no reliable versioning, and existing common distributions (e.g. // Vulkan SDK) contain old builds with bugs that impact our shaders. By default, we have // to force usage of our own distribution built on our CI. if *system_shader_tools { ShaderTools.install_if_missing(&cache).await?; } else { ShaderTools.install(&cache).await?; } cache::goodie::binaryen::Binaryen { version: BINARYEN_VERSION_TO_INSTALL } .install_if_missing(&cache) .await?; info!("Building wasm."); let temp_dir = tempdir()?; let temp_dist = RepoRootDistWasm::new_root(temp_dir.path()); ensogl_pack::build( ensogl_pack::WasmPackOutputs { out_dir: temp_dist.path.clone(), out_name: OUTPUT_NAME.into(), }, |args| { let mut command = WasmPack.cmd()?; command .current_dir(&repo_root) .kill_on_drop(true) .env_remove(ide_ci::programs::rustup::env::RUSTUP_TOOLCHAIN.name()) .build() .arg(wasm_pack::Profile::from(*profile)) .target(wasm_pack::Target::Web) .output_directory(args.out_dir) .output_name(args.out_name) .arg(crate_path) .arg("--") .apply(&cargo::Color::Always) .args(extra_cargo_options); if let Some(profiling_level) = profiling_level { command.set_env(env::ENSO_MAX_PROFILING_LEVEL, &profiling_level)?; } command.set_env(env::ENSO_MAX_LOG_LEVEL, &log_level)?; command.set_env(env::ENSO_MAX_UNCOLLAPSED_LOG_LEVEL, &uncollapsed_log_level)?; Ok(command) }, ) .await?; Self::finalize_wasm(wasm_opt_options, *skip_wasm_opt, *profile, &temp_dist).await?; ide_ci::fs::create_dir_if_missing(&destination)?; let ret = RepoRootDistWasm::new_root(&destination); ide_ci::fs::copy(&temp_dist, &ret)?; inner.perhaps_check_size(&ret.pkg_opt_wasm).await?; Ok(Artifact(ret)) } .instrument(span) .boxed() } } #[derive(Clone, Derivative)] #[derivative(Debug)] pub struct WatchInput { pub cargo_watch_options: Vec<String>, } impl IsWatchable for Wasm { type Watcher = crate::project::Watcher<Self, Child>; type WatchInput = WatchInput; fn watch( &self, context: Context, job: WatchTargetJob<Self>, ) -> BoxFuture<'static, Result<Self::Watcher>> { let span = debug_span!("Watching WASM.",?job).entered(); // The esbuild watcher must succeed in its first build, or it will prematurely exit. // See the issue: https://github.com/evanw/esbuild/issues/1063 // // Because of this, we run first build of wasm manually, rather through cargo-watch. // After it is completed, the cargo-watch gets spawned and this method yields the watcher. // This forces esbuild watcher (whose setup requires the watcher artifacts) to wait until // all wasm build outputs are in place, so the build won't crash. // // In general, much neater workaround should be possible, if we stop relying on cargo-watch // and do the WASM watch directly in the build script. let first_build_job = self .build(context.clone(), job.build.clone()) .instrument(debug_span!("Initial single build of WASM before setting up cargo-watch.")); async move { let first_build_output = first_build_job.await?; let WatchTargetJob { watch_input: WatchInput { cargo_watch_options: cargo_watch_flags }, build: WithDestination { inner, destination }, } = job; let BuildInput { crate_path, wasm_opt_options, skip_wasm_opt, extra_cargo_options, profile, profiling_level, log_level, uncollapsed_log_level, wasm_size_limit, system_shader_tools: _, } = inner; let current_exe = std::env::current_exe()?; // cargo-watch apparently cannot handle verbatim path prefix. We remove it and hope for // the best. let current_exe = current_exe.without_verbatim_prefix(); let mut watch_cmd = Cargo.cmd()?; let (watch_cmd_name, mut watch_cmd_opts) = match std::env::var("USE_CARGO_WATCH_PLUS") { Ok(_) => ("watch-plus", vec!["--why"]), Err(_) => ("watch", vec![]), }; watch_cmd_opts.push("--ignore"); watch_cmd_opts.push("README.md"); watch_cmd .kill_on_drop(true) .current_dir(&context.repo_root) .arg(watch_cmd_name) .args(watch_cmd_opts) .args(cargo_watch_flags) .arg("--"); // === Build Script top-level options === watch_cmd // TODO [mwu] // This is not nice, as this module should not be aware of the CLI // parsing/generation. Rather than using `cargo watch` this should // be implemented directly in Rust. .arg(current_exe) .arg("--skip-version-check") // We already checked in the parent process. .args(["--cache-path", context.cache.path().as_str()]) .args(["--upload-artifacts", context.upload_artifacts.to_string().as_str()]) .args(["--repo-path", context.repo_root.as_str()]); // === Build Script command and its options === watch_cmd .arg("wasm") .arg("build") .args(["--crate-path", crate_path.as_str()]) .args(["--wasm-output-path", destination.as_str()]) .args(["--wasm-profile", profile.as_ref()]); if let Some(profiling_level) = profiling_level { watch_cmd.args(["--profiling-level", profiling_level.to_string().as_str()]); } watch_cmd.args(["--wasm-log-level", log_level.to_string().as_str()]); watch_cmd .args(["--wasm-uncollapsed-log-level", uncollapsed_log_level.to_string().as_str()]); for wasm_opt_option in wasm_opt_options { watch_cmd.args(["--wasm-opt-option", &wasm_opt_option]); } if skip_wasm_opt { watch_cmd.args(["--skip-wasm-opt"]); } if let Some(wasm_size_limit) = wasm_size_limit { watch_cmd.args(["--wasm-size-limit", wasm_size_limit.to_string().as_str()]); } else { watch_cmd.args(["--wasm-size-limit", "0"]); } // === cargo-watch options === watch_cmd.arg("--").args(extra_cargo_options); let watch_process = watch_cmd.spawn_intercepting()?; let artifact = Artifact(RepoRootDistWasm::new_root(&destination)); ensure!( artifact == first_build_output, "First build output does not match general watch build output. First build output: \ {first_build_output:?}, general watch build output: {artifact:?}", ); Ok(Self::Watcher { artifact, watch_process }) } .instrument(span.exit()) .boxed() } } #[derive(Clone, Debug, Display, PartialEq, Eq)] pub struct Artifact(pub RepoRootDistWasm); impl Artifact { pub fn new(path: impl Into<PathBuf>) -> Self { Self(RepoRootDistWasm::new_root(path)) } /// The main JS bundle to load WASM and JS wasm-pack bundles. pub fn ensogl_app(&self) -> &Path { &self.0.index_js } /// Files that should be shipped in the Gui bundle. pub fn files_to_ship(&self) -> Vec<&Path> { // We explicitly deconstruct object, so when new fields are added, we will be forced to // consider whether they should be shipped or not. let RepoRootDistWasm { path: _, dynamic_assets, index_js: _, index_d_ts: _, index_js_map: _, pkg_js, pkg_js_map, pkg_wasm: _, pkg_opt_wasm, } = &self.0; vec![ dynamic_assets.as_path(), pkg_js.as_path(), pkg_js_map.as_path(), pkg_opt_wasm.as_path(), ] } pub fn symlink_ensogl_dist(&self, linked_dist: &RepoRootTargetEnsoglPackLinkedDist) -> Result { ide_ci::fs::remove_symlink_dir_if_exists(linked_dist)?; ide_ci::fs::symlink_auto(self, linked_dist) } } impl AsRef<Path> for Artifact { fn as_ref(&self) -> &Path { self.0.as_path() } } impl IsArtifact for Artifact {} impl Wasm { pub async fn check(&self) -> Result { Cargo .cmd()? .apply(&cargo::Command::Check) .apply(&cargo::Options::Workspace) .apply(&cargo::Options::Package(INTEGRATION_TESTS_CRATE_NAME.into())) .apply(&cargo::Options::AllTargets) .run_ok() .await } pub async fn test(&self, repo_root: PathBuf, wasm: &[test::Browser], native: bool) -> Result { async fn maybe_run<Fut: Future<Output = Result>>( name: &str, enabled: bool, f: impl (FnOnce() -> Fut), ) -> Result { if enabled { info!("Will run {name} tests."); f().await.context(format!("Running {name} tests.")) } else { info!("Skipping {name} tests."); Ok(()) } } maybe_run("native", native, async || { Cargo .cmd()? .current_dir(repo_root.clone()) .apply(&cargo::Command::Test) .apply(&cargo::Options::Workspace) // Color needs to be passed to tests themselves separately. // See: https://github.com/rust-lang/cargo/issues/1983 .arg("--") .apply(&cargo::Color::Always) .run_ok() .await }) .await?; maybe_run("wasm",!wasm.is_empty(), || test::test_all(repo_root.clone(), wasm)).await?; Ok(()) } pub async fn integration_test( &self, source_root: PathBuf, _project_manager: Option<Child>, headless: bool, additional_options: Vec<String>, wasm_timeout: Option<Duration>, ) -> Result { info!("Running Rust WASM test suite."); use wasm_pack::TestFlags::*; WasmPack .cmd()? .current_dir(source_root) .set_env_opt( env::W
info!("Compressed size of {} is {}.", wasm_path.as_ref().display(), compressed_size); if let Some(wasm_size_limit) = self.wasm_size_limit { let wasm_size_limit = wasm_size_limit.get_appropriate_unit(true);
random_line_split
wasm.rs
gui_wasm"; pub const DEFAULT_TARGET_CRATE: &str = "app/gui"; #[derive( clap::ArgEnum, Clone, Copy, Debug, Default, strum::Display, strum::EnumString, PartialEq, Eq )] #[strum(serialize_all = "kebab-case")] pub enum ProfilingLevel { #[default] Objective, Task, Detail, Debug, } #[derive( clap::ArgEnum, Clone, Copy, Debug, Default, strum::Display, strum::EnumString, PartialEq, Eq )] #[strum(serialize_all = "kebab-case")] pub enum LogLevel { Error, #[default] Warn, Info, Debug, Trace, } #[derive(clap::ArgEnum, Clone, Copy, Debug, PartialEq, Eq, strum::Display, strum::AsRefStr)] #[strum(serialize_all = "kebab-case")] pub enum Profile { Dev, Profile, Release, // Production, } impl From<Profile> for wasm_pack::Profile { fn from(profile: Profile) -> Self { match profile { Profile::Dev => Self::Dev, Profile::Profile => Self::Profile, Profile::Release => Self::Release, // Profile::Production => Self::Release, } } } impl Profile { pub fn should_check_size(self) -> bool { match self { Profile::Dev => false, Profile::Profile => false, Profile::Release => true, // Profile::Production => true, } } pub fn extra_rust_options(self) -> Vec<String> { match self { // Profile::Production => ["-Clto=fat", "-Ccodegen-units=1", "-Cincremental=false"] // .into_iter() // .map(ToString::to_string) // .collect(), Profile::Dev | Profile::Profile | Profile::Release => vec![], } } pub fn optimization_level(self) -> wasm_opt::OptimizationLevel { match self { Profile::Dev => wasm_opt::OptimizationLevel::O0, Profile::Profile => wasm_opt::OptimizationLevel::O, Profile::Release => wasm_opt::OptimizationLevel::O3, } } } #[derive(Clone, Derivative)] #[derivative(Debug)] pub struct BuildInput { /// Path to the crate to be compiled to WAM. Relative to the repository root. pub crate_path: PathBuf, pub wasm_opt_options: Vec<String>, pub skip_wasm_opt: bool, pub extra_cargo_options: Vec<String>, pub profile: Profile, pub profiling_level: Option<ProfilingLevel>, pub log_level: LogLevel, pub uncollapsed_log_level: LogLevel, pub wasm_size_limit: Option<byte_unit::Byte>, pub system_shader_tools: bool, } impl BuildInput { pub async fn perhaps_check_size(&self, wasm_path: impl AsRef<Path>) -> Result { let compressed_size = compressed_size(&wasm_path).await?.get_appropriate_unit(true); info!("Compressed size of {} is {}.", wasm_path.as_ref().display(), compressed_size); if let Some(wasm_size_limit) = self.wasm_size_limit { let wasm_size_limit = wasm_size_limit.get_appropriate_unit(true); if!self.profile.should_check_size() { warn!("Skipping size check because profile is '{}'.", self.profile,); } else if self.profiling_level.unwrap_or_default()!= ProfilingLevel::Objective { // TODO? additional leeway as sanity check warn!( "Skipping size check because profiling level is {:?} rather than {}.", self.profiling_level, ProfilingLevel::Objective ); } else { ensure!( compressed_size < wasm_size_limit, "Compressed WASM size ~{} ({} bytes) exceeds the limit of {} ({} bytes).", compressed_size, compressed_size.get_byte(), wasm_size_limit, wasm_size_limit.get_byte(), ) } } Ok(()) } } #[derive(Clone, Copy, Debug, PartialEq, Eq)] pub struct Wasm; #[async_trait] impl IsTarget for Wasm { type BuildInput = BuildInput; type Artifact = Artifact; fn artifact_name(&self) -> String { WASM_ARTIFACT_NAME.into() } fn adapt_artifact(self, path: impl AsRef<Path>) -> BoxFuture<'static, Result<Self::Artifact>> { ready(Ok(Artifact::new(path.as_ref()))).boxed() } fn build_internal( &self, context: Context, job: BuildTargetJob<Self>, ) -> BoxFuture<'static, Result<Self::Artifact>> { let Context { octocrab: _, cache, upload_artifacts: _, repo_root } = context; let WithDestination { inner, destination } = job; let span = info_span!("Building WASM.", repo = %repo_root.display(), crate = %inner.crate_path.display(), cargo_opts =?inner.extra_cargo_options ); async move { // Old wasm-pack does not pass trailing `build` command arguments to the Cargo. // We want to be able to pass --profile this way. WasmPack.require_present_that(VersionReq::parse(">=0.10.1")?).await?; let BuildInput { crate_path, wasm_opt_options, skip_wasm_opt, extra_cargo_options, profile, profiling_level, log_level, uncollapsed_log_level, wasm_size_limit: _wasm_size_limit, system_shader_tools, } = &inner; // NOTE: We cannot trust locally installed version of shader tools to be correct. // Those binaries have no reliable versioning, and existing common distributions (e.g. // Vulkan SDK) contain old builds with bugs that impact our shaders. By default, we have // to force usage of our own distribution built on our CI. if *system_shader_tools { ShaderTools.install_if_missing(&cache).await?; } else { ShaderTools.install(&cache).await?; } cache::goodie::binaryen::Binaryen { version: BINARYEN_VERSION_TO_INSTALL } .install_if_missing(&cache) .await?; info!("Building wasm."); let temp_dir = tempdir()?; let temp_dist = RepoRootDistWasm::new_root(temp_dir.path()); ensogl_pack::build( ensogl_pack::WasmPackOutputs { out_dir: temp_dist.path.clone(), out_name: OUTPUT_NAME.into(), }, |args| { let mut command = WasmPack.cmd()?; command .current_dir(&repo_root) .kill_on_drop(true) .env_remove(ide_ci::programs::rustup::env::RUSTUP_TOOLCHAIN.name()) .build() .arg(wasm_pack::Profile::from(*profile)) .target(wasm_pack::Target::Web) .output_directory(args.out_dir) .output_name(args.out_name) .arg(crate_path) .arg("--") .apply(&cargo::Color::Always) .args(extra_cargo_options); if let Some(profiling_level) = profiling_level { command.set_env(env::ENSO_MAX_PROFILING_LEVEL, &profiling_level)?; } command.set_env(env::ENSO_MAX_LOG_LEVEL, &log_level)?; command.set_env(env::ENSO_MAX_UNCOLLAPSED_LOG_LEVEL, &uncollapsed_log_level)?; Ok(command) }, ) .await?; Self::finalize_wasm(wasm_opt_options, *skip_wasm_opt, *profile, &temp_dist).await?; ide_ci::fs::create_dir_if_missing(&destination)?; let ret = RepoRootDistWasm::new_root(&destination); ide_ci::fs::copy(&temp_dist, &ret)?; inner.perhaps_check_size(&ret.pkg_opt_wasm).await?; Ok(Artifact(ret)) } .instrument(span) .boxed() } } #[derive(Clone, Derivative)] #[derivative(Debug)] pub struct WatchInput { pub cargo_watch_options: Vec<String>, } impl IsWatchable for Wasm { type Watcher = crate::project::Watcher<Self, Child>; type WatchInput = WatchInput; fn watch( &self, context: Context, job: WatchTargetJob<Self>, ) -> BoxFuture<'static, Result<Self::Watcher>> { let span = debug_span!("Watching WASM.",?job).entered(); // The esbuild watcher must succeed in its first build, or it will prematurely exit. // See the issue: https://github.com/evanw/esbuild/issues/1063 // // Because of this, we run first build of wasm manually, rather through cargo-watch. // After it is completed, the cargo-watch gets spawned and this method yields the watcher. // This forces esbuild watcher (whose setup requires the watcher artifacts) to wait until // all wasm build outputs are in place, so the build won't crash. // // In general, much neater workaround should be possible, if we stop relying on cargo-watch // and do the WASM watch directly in the build script. let first_build_job = self .build(context.clone(), job.build.clone()) .instrument(debug_span!("Initial single build of WASM before setting up cargo-watch.")); async move { let first_build_output = first_build_job.await?; let WatchTargetJob { watch_input: WatchInput { cargo_watch_options: cargo_watch_flags }, build: WithDestination { inner, destination }, } = job; let BuildInput { crate_path, wasm_opt_options, skip_wasm_opt, extra_cargo_options, profile, profiling_level, log_level, uncollapsed_log_level, wasm_size_limit, system_shader_tools: _, } = inner; let current_exe = std::env::current_exe()?; // cargo-watch apparently cannot handle verbatim path prefix. We remove it and hope for // the best. let current_exe = current_exe.without_verbatim_prefix(); let mut watch_cmd = Cargo.cmd()?; let (watch_cmd_name, mut watch_cmd_opts) = match std::env::var("USE_CARGO_WATCH_PLUS") { Ok(_) => ("watch-plus", vec!["--why"]), Err(_) => ("watch", vec![]), }; watch_cmd_opts.push("--ignore"); watch_cmd_opts.push("README.md"); watch_cmd .kill_on_drop(true) .current_dir(&context.repo_root) .arg(watch_cmd_name) .args(watch_cmd_opts) .args(cargo_watch_flags) .arg("--"); // === Build Script top-level options === watch_cmd // TODO [mwu] // This is not nice, as this module should not be aware of the CLI // parsing/generation. Rather than using `cargo watch` this should // be implemented directly in Rust. .arg(current_exe) .arg("--skip-version-check") // We already checked in the parent process. .args(["--cache-path", context.cache.path().as_str()]) .args(["--upload-artifacts", context.upload_artifacts.to_string().as_str()]) .args(["--repo-path", context.repo_root.as_str()]); // === Build Script command and its options === watch_cmd .arg("wasm") .arg("build") .args(["--crate-path", crate_path.as_str()]) .args(["--wasm-output-path", destination.as_str()]) .args(["--wasm-profile", profile.as_ref()]); if let Some(profiling_level) = profiling_level { watch_cmd.args(["--profiling-level", profiling_level.to_string().as_str()]); } watch_cmd.args(["--wasm-log-level", log_level.to_string().as_str()]); watch_cmd .args(["--wasm-uncollapsed-log-level", uncollapsed_log_level.to_string().as_str()]); for wasm_opt_option in wasm_opt_options { watch_cmd.args(["--wasm-opt-option", &wasm_opt_option]); } if skip_wasm_opt { watch_cmd.args(["--skip-wasm-opt"]); } if let Some(wasm_size_limit) = wasm_size_limit { watch_cmd.args(["--wasm-size-limit", wasm_size_limit.to_string().as_str()]); } else { watch_cmd.args(["--wasm-size-limit", "0"]); } // === cargo-watch options === watch_cmd.arg("--").args(extra_cargo_options); let watch_process = watch_cmd.spawn_intercepting()?; let artifact = Artifact(RepoRootDistWasm::new_root(&destination)); ensure!( artifact == first_build_output, "First build output does not match general watch build output. First build output: \ {first_build_output:?}, general watch build output: {artifact:?}", ); Ok(Self::Watcher { artifact, watch_process }) } .instrument(span.exit()) .boxed() } } #[derive(Clone, Debug, Display, PartialEq, Eq)] pub struct Artifact(pub RepoRootDistWasm); impl Artifact { pub fn new(path: impl Into<PathBuf>) -> Self { Self(RepoRootDistWasm::new_root(path)) } /// The main JS bundle to load WASM and JS wasm-pack bundles. pub fn ensogl_app(&self) -> &Path { &self.0.index_js } /// Files that should be shipped in the Gui bundle. pub fn files_to_ship(&self) -> Vec<&Path> { // We explicitly deconstruct object, so when new fields are added, we will be forced to // consider whether they should be shipped or not. let RepoRootDistWasm { path: _, dynamic_assets, index_js: _, index_d_ts: _, index_js_map: _, pkg_js, pkg_js_map, pkg_wasm: _, pkg_opt_wasm, } = &self.0; vec![ dynamic_assets.as_path(), pkg_js.as_path(), pkg_js_map.as_path(), pkg_opt_wasm.as_path(), ] } pub fn symlink_ensogl_dist(&self, linked_dist: &RepoRootTargetEnsoglPackLinkedDist) -> Result { ide_ci::fs::remove_symlink_dir_if_exists(linked_dist)?; ide_ci::fs::symlink_auto(self, linked_dist) } } impl AsRef<Path> for Artifact { fn as_ref(&self) -> &Path { self.0.as_path() } } impl IsArtifact for Artifact {} impl Wasm { pub async fn
(&self) -> Result { Cargo .cmd()? .apply(&cargo::Command::Check) .apply(&cargo::Options::Workspace) .apply(&cargo::Options::Package(INTEGRATION_TESTS_CRATE_NAME.into())) .apply(&cargo::Options::AllTargets) .run_ok() .await } pub async fn test(&self, repo_root: PathBuf, wasm: &[test::Browser], native: bool) -> Result { async fn maybe_run<Fut: Future<Output = Result>>( name: &str, enabled: bool, f: impl (FnOnce() -> Fut), ) -> Result { if enabled { info!("Will run {name} tests."); f().await.context(format!("Running {name} tests.")) } else { info!("Skipping {name} tests."); Ok(()) } } maybe_run("native", native, async || { Cargo .cmd()? .current_dir(repo_root.clone()) .apply(&cargo::Command::Test) .apply(&cargo::Options::Workspace) // Color needs to be passed to tests themselves separately. // See: https://github.com/rust-lang/cargo/issues/1983 .arg("--") .apply(&cargo::Color::Always) .run_ok() .await }) .await?; maybe_run("wasm",!wasm.is_empty(), || test::test_all(repo_root.clone(), wasm)).await?; Ok(()) } pub async fn integration_test( &self, source_root: PathBuf, _project_manager: Option<Child>, headless: bool, additional_options: Vec<String>, wasm_timeout: Option<Duration>, ) -> Result { info!("Running Rust WASM test suite."); use wasm_pack::TestFlags::*; WasmPack .cmd()? .current_dir(source_root) .set_env_opt( env
check
identifier_name
wasm.rs
#[derive(Clone, Derivative)] #[derivative(Debug)] pub struct BuildInput { /// Path to the crate to be compiled to WAM. Relative to the repository root. pub crate_path: PathBuf, pub wasm_opt_options: Vec<String>, pub skip_wasm_opt: bool, pub extra_cargo_options: Vec<String>, pub profile: Profile, pub profiling_level: Option<ProfilingLevel>, pub log_level: LogLevel, pub uncollapsed_log_level: LogLevel, pub wasm_size_limit: Option<byte_unit::Byte>, pub system_shader_tools: bool, } impl BuildInput { pub async fn perhaps_check_size(&self, wasm_path: impl AsRef<Path>) -> Result { let compressed_size = compressed_size(&wasm_path).await?.get_appropriate_unit(true); info!("Compressed size of {} is {}.", wasm_path.as_ref().display(), compressed_size); if let Some(wasm_size_limit) = self.wasm_size_limit { let wasm_size_limit = wasm_size_limit.get_appropriate_unit(true); if!self.profile.should_check_size() { warn!("Skipping size check because profile is '{}'.", self.profile,); } else if self.profiling_level.unwrap_or_default()!= ProfilingLevel::Objective { // TODO? additional leeway as sanity check warn!( "Skipping size check because profiling level is {:?} rather than {}.", self.profiling_level, ProfilingLevel::Objective ); } else { ensure!( compressed_size < wasm_size_limit, "Compressed WASM size ~{} ({} bytes) exceeds the limit of {} ({} bytes).", compressed_size, compressed_size.get_byte(), wasm_size_limit, wasm_size_limit.get_byte(), ) } } Ok(()) } } #[derive(Clone, Copy, Debug, PartialEq, Eq)] pub struct Wasm; #[async_trait] impl IsTarget for Wasm { type BuildInput = BuildInput; type Artifact = Artifact; fn artifact_name(&self) -> String { WASM_ARTIFACT_NAME.into() } fn adapt_artifact(self, path: impl AsRef<Path>) -> BoxFuture<'static, Result<Self::Artifact>> { ready(Ok(Artifact::new(path.as_ref()))).boxed() } fn build_internal( &self, context: Context, job: BuildTargetJob<Self>, ) -> BoxFuture<'static, Result<Self::Artifact>> { let Context { octocrab: _, cache, upload_artifacts: _, repo_root } = context; let WithDestination { inner, destination } = job; let span = info_span!("Building WASM.", repo = %repo_root.display(), crate = %inner.crate_path.display(), cargo_opts =?inner.extra_cargo_options ); async move { // Old wasm-pack does not pass trailing `build` command arguments to the Cargo. // We want to be able to pass --profile this way. WasmPack.require_present_that(VersionReq::parse(">=0.10.1")?).await?; let BuildInput { crate_path, wasm_opt_options, skip_wasm_opt, extra_cargo_options, profile, profiling_level, log_level, uncollapsed_log_level, wasm_size_limit: _wasm_size_limit, system_shader_tools, } = &inner; // NOTE: We cannot trust locally installed version of shader tools to be correct. // Those binaries have no reliable versioning, and existing common distributions (e.g. // Vulkan SDK) contain old builds with bugs that impact our shaders. By default, we have // to force usage of our own distribution built on our CI. if *system_shader_tools { ShaderTools.install_if_missing(&cache).await?; } else { ShaderTools.install(&cache).await?; } cache::goodie::binaryen::Binaryen { version: BINARYEN_VERSION_TO_INSTALL } .install_if_missing(&cache) .await?; info!("Building wasm."); let temp_dir = tempdir()?; let temp_dist = RepoRootDistWasm::new_root(temp_dir.path()); ensogl_pack::build( ensogl_pack::WasmPackOutputs { out_dir: temp_dist.path.clone(), out_name: OUTPUT_NAME.into(), }, |args| { let mut command = WasmPack.cmd()?; command .current_dir(&repo_root) .kill_on_drop(true) .env_remove(ide_ci::programs::rustup::env::RUSTUP_TOOLCHAIN.name()) .build() .arg(wasm_pack::Profile::from(*profile)) .target(wasm_pack::Target::Web) .output_directory(args.out_dir) .output_name(args.out_name) .arg(crate_path) .arg("--") .apply(&cargo::Color::Always) .args(extra_cargo_options); if let Some(profiling_level) = profiling_level { command.set_env(env::ENSO_MAX_PROFILING_LEVEL, &profiling_level)?; } command.set_env(env::ENSO_MAX_LOG_LEVEL, &log_level)?; command.set_env(env::ENSO_MAX_UNCOLLAPSED_LOG_LEVEL, &uncollapsed_log_level)?; Ok(command) }, ) .await?; Self::finalize_wasm(wasm_opt_options, *skip_wasm_opt, *profile, &temp_dist).await?; ide_ci::fs::create_dir_if_missing(&destination)?; let ret = RepoRootDistWasm::new_root(&destination); ide_ci::fs::copy(&temp_dist, &ret)?; inner.perhaps_check_size(&ret.pkg_opt_wasm).await?; Ok(Artifact(ret)) } .instrument(span) .boxed() } } #[derive(Clone, Derivative)] #[derivative(Debug)] pub struct WatchInput { pub cargo_watch_options: Vec<String>, } impl IsWatchable for Wasm { type Watcher = crate::project::Watcher<Self, Child>; type WatchInput = WatchInput; fn watch( &self, context: Context, job: WatchTargetJob<Self>, ) -> BoxFuture<'static, Result<Self::Watcher>> { let span = debug_span!("Watching WASM.",?job).entered(); // The esbuild watcher must succeed in its first build, or it will prematurely exit. // See the issue: https://github.com/evanw/esbuild/issues/1063 // // Because of this, we run first build of wasm manually, rather through cargo-watch. // After it is completed, the cargo-watch gets spawned and this method yields the watcher. // This forces esbuild watcher (whose setup requires the watcher artifacts) to wait until // all wasm build outputs are in place, so the build won't crash. // // In general, much neater workaround should be possible, if we stop relying on cargo-watch // and do the WASM watch directly in the build script. let first_build_job = self .build(context.clone(), job.build.clone()) .instrument(debug_span!("Initial single build of WASM before setting up cargo-watch.")); async move { let first_build_output = first_build_job.await?; let WatchTargetJob { watch_input: WatchInput { cargo_watch_options: cargo_watch_flags }, build: WithDestination { inner, destination }, } = job; let BuildInput { crate_path, wasm_opt_options, skip_wasm_opt, extra_cargo_options, profile, profiling_level, log_level, uncollapsed_log_level, wasm_size_limit, system_shader_tools: _, } = inner; let current_exe = std::env::current_exe()?; // cargo-watch apparently cannot handle verbatim path prefix. We remove it and hope for // the best. let current_exe = current_exe.without_verbatim_prefix(); let mut watch_cmd = Cargo.cmd()?; let (watch_cmd_name, mut watch_cmd_opts) = match std::env::var("USE_CARGO_WATCH_PLUS") { Ok(_) => ("watch-plus", vec!["--why"]), Err(_) => ("watch", vec![]), }; watch_cmd_opts.push("--ignore"); watch_cmd_opts.push("README.md"); watch_cmd .kill_on_drop(true) .current_dir(&context.repo_root) .arg(watch_cmd_name) .args(watch_cmd_opts) .args(cargo_watch_flags) .arg("--"); // === Build Script top-level options === watch_cmd // TODO [mwu] // This is not nice, as this module should not be aware of the CLI // parsing/generation. Rather than using `cargo watch` this should // be implemented directly in Rust. .arg(current_exe) .arg("--skip-version-check") // We already checked in the parent process. .args(["--cache-path", context.cache.path().as_str()]) .args(["--upload-artifacts", context.upload_artifacts.to_string().as_str()]) .args(["--repo-path", context.repo_root.as_str()]); // === Build Script command and its options === watch_cmd .arg("wasm") .arg("build") .args(["--crate-path", crate_path.as_str()]) .args(["--wasm-output-path", destination.as_str()]) .args(["--wasm-profile", profile.as_ref()]); if let Some(profiling_level) = profiling_level { watch_cmd.args(["--profiling-level", profiling_level.to_string().as_str()]); } watch_cmd.args(["--wasm-log-level", log_level.to_string().as_str()]); watch_cmd .args(["--wasm-uncollapsed-log-level", uncollapsed_log_level.to_string().as_str()]); for wasm_opt_option in wasm_opt_options { watch_cmd.args(["--wasm-opt-option", &wasm_opt_option]); } if skip_wasm_opt { watch_cmd.args(["--skip-wasm-opt"]); } if let Some(wasm_size_limit) = wasm_size_limit { watch_cmd.args(["--wasm-size-limit", wasm_size_limit.to_string().as_str()]); } else { watch_cmd.args(["--wasm-size-limit", "0"]); } // === cargo-watch options === watch_cmd.arg("--").args(extra_cargo_options); let watch_process = watch_cmd.spawn_intercepting()?; let artifact = Artifact(RepoRootDistWasm::new_root(&destination)); ensure!( artifact == first_build_output, "First build output does not match general watch build output. First build output: \ {first_build_output:?}, general watch build output: {artifact:?}", ); Ok(Self::Watcher { artifact, watch_process }) } .instrument(span.exit()) .boxed() } } #[derive(Clone, Debug, Display, PartialEq, Eq)] pub struct Artifact(pub RepoRootDistWasm); impl Artifact { pub fn new(path: impl Into<PathBuf>) -> Self { Self(RepoRootDistWasm::new_root(path)) } /// The main JS bundle to load WASM and JS wasm-pack bundles. pub fn ensogl_app(&self) -> &Path { &self.0.index_js } /// Files that should be shipped in the Gui bundle. pub fn files_to_ship(&self) -> Vec<&Path> { // We explicitly deconstruct object, so when new fields are added, we will be forced to // consider whether they should be shipped or not. let RepoRootDistWasm { path: _, dynamic_assets, index_js: _, index_d_ts: _, index_js_map: _, pkg_js, pkg_js_map, pkg_wasm: _, pkg_opt_wasm, } = &self.0; vec![ dynamic_assets.as_path(), pkg_js.as_path(), pkg_js_map.as_path(), pkg_opt_wasm.as_path(), ] } pub fn symlink_ensogl_dist(&self, linked_dist: &RepoRootTargetEnsoglPackLinkedDist) -> Result { ide_ci::fs::remove_symlink_dir_if_exists(linked_dist)?; ide_ci::fs::symlink_auto(self, linked_dist) } } impl AsRef<Path> for Artifact { fn as_ref(&self) -> &Path { self.0.as_path() } } impl IsArtifact for Artifact {} impl Wasm { pub async fn check(&self) -> Result { Cargo .cmd()? .apply(&cargo::Command::Check) .apply(&cargo::Options::Workspace) .apply(&cargo::Options::Package(INTEGRATION_TESTS_CRATE_NAME.into())) .apply(&cargo::Options::AllTargets) .run_ok() .await } pub async fn test(&self, repo_root: PathBuf, wasm: &[test::Browser], native: bool) -> Result { async fn maybe_run<Fut: Future<Output = Result>>( name: &str, enabled: bool, f: impl (FnOnce() -> Fut), ) -> Result { if enabled { info!("Will run {name} tests."); f().await.context(format!("Running {name} tests.")) } else { info!("Skipping {name} tests."); Ok(()) } } maybe_run("native", native, async || { Cargo .cmd()? .current_dir(repo_root.clone()) .apply(&cargo::Command::Test) .apply(&cargo::Options::Workspace) // Color needs to be passed to tests themselves separately. // See: https://github.com/rust-lang/cargo/issues/1983 .arg("--") .apply(&cargo::Color::Always) .run_ok() .await }) .await?; maybe_run("wasm",!wasm.is_empty(), || test::test_all(repo_root.clone(), wasm)).await?; Ok(()) } pub async fn integration_test( &self, source_root: PathBuf, _project_manager: Option<Child>, headless: bool, additional_options: Vec<String>, wasm_timeout: Option<Duration>, ) -> Result { info!("Running Rust WASM test suite."); use wasm_pack::TestFlags::*; WasmPack .cmd()? .current_dir(source_root) .set_env_opt( env::WASM_BINDGEN_TEST_TIMEOUT, wasm_timeout.map(|d| d.as_secs()).as_ref(), )? .test() .apply_opt(headless.then_some(&Headless)) .apply(&test::BROWSER_FOR_WASM_TESTS) .arg("integration-test") .arg("--profile=integration-test") .args(additional_options) .run_ok() .await // PM will be automatically killed by dropping the handle. } /// Process "raw" WASM (as compiled) by optionally invoking wasm-opt. pub async fn finalize_wasm( wasm_opt_options: &[String], skip_wasm_opt: bool, profile: Profile, temp_dist: &RepoRootDistWasm, ) -> Result { let should_call_wasm_opt = { if profile == Profile::Dev { debug!("Skipping wasm-opt invocation, as it is not part of profile {profile}."); false } else if skip_wasm_opt { debug!("Skipping wasm-opt invocation, as it was explicitly requested."); false } else { true } }; if should_call_wasm_opt
{ let mut wasm_opt_command = WasmOpt.cmd()?; let has_custom_opt_level = wasm_opt_options.iter().any(|opt| { wasm_opt::OptimizationLevel::from_str(opt.trim_start_matches('-')).is_ok() }); if !has_custom_opt_level { wasm_opt_command.apply(&profile.optimization_level()); } wasm_opt_command .args(wasm_opt_options) .arg(&temp_dist.pkg_wasm) .apply(&wasm_opt::Output(&temp_dist.pkg_opt_wasm)) .run_ok() .await?; }
conditional_block
server.rs
use std::thread; use std::collections::HashSet; use std::net::SocketAddr; use std::collections::VecDeque; use std::io::BufReader; // MIO use mio::tcp::{listen, TcpListener, TcpStream}; use mio::util::Slab; use mio::Socket; use mio::buf::{RingBuf}; use mio::{Interest, PollOpt, NonBlock, Token, EventLoop, Handler, ReadHint}; use mio::buf::Buf; use mio::{TryRead, TryWrite}; use rand::{self, Rng}; // Data structures. use store::Store; use replica::{Replica, Emit, Broadcast}; use state_machine::StateMachine; // Cap'n Proto use capnp::serialize_packed; use capnp::{ MessageBuilder, MessageReader, ReaderOptions, MallocMessageBuilder, OwnedSpaceMessageReader, }; use messages_capnp::{ rpc_request, rpc_response, client_request, client_response, request_vote_response, append_entries_response, append_entries_request, }; use super::{Error, Result}; // MIO Tokens const ELECTION_TIMEOUT: Token = Token(0); const HEARTBEAT_TIMEOUT: Token = Token(1); const LISTENER: Token = Token(2); const ELECTION_MIN: u64 = 150; const ELECTION_MAX: u64 = 300; const HEARTBEAT_DURATION: u64 = 50; const RINGBUF_SIZE: usize = 4096; /// The Raft Distributed Consensus Algorithm requires two RPC calls to be available: /// /// * `append_entries` which is used as both a heartbeat (with no payload) and the primary /// interface for requests. /// * `request_vote` which is used by candidates during campaigns to obtain a vote. /// /// A `Server` acts as a replicated state machine. The server's role in the cluster depends on it's /// own status. It will maintain both volatile state (which can be safely lost) and persistent /// state (which must be carefully stored and kept safe). /// /// Currently, the `Server` API is not well defined. **We are looking for feedback and suggestions.** pub struct Server<S, M> where S: Store, M: StateMachine { replica: Replica<S, M>, // Channels and Sockets listener: NonBlock<TcpListener>, connections: Slab<Connection>, } /// The implementation of the Server. In most use cases, creating a `Server` should just be /// done via `::new()`. impl<S, M> Server<S, M> where S: Store, M: StateMachine { /// Creates a new Raft node with the cluster members specified. /// /// # Arguments /// /// * `addr` - The address of the new node. /// * `peers` - The address of all peers in the Raft cluster. /// * `store` - The persitent log store. /// * `state_machine` - The client state machine to which client commands will be applied. pub fn spawn(addr: SocketAddr, peers: HashSet<SocketAddr>, store: S, state_machine: M) { debug!("Spawning Server"); // Create an event loop let mut event_loop = EventLoop::<Server<S, M>>::new().unwrap(); // Setup the socket, make it not block. let listener = listen(&addr).unwrap(); listener.set_reuseaddr(true).unwrap(); event_loop.register(&listener, LISTENER).unwrap(); let timeout = rand::thread_rng().gen_range::<u64>(ELECTION_MIN, ELECTION_MAX); event_loop.timeout_ms(ELECTION_TIMEOUT, timeout).unwrap(); event_loop.timeout_ms(HEARTBEAT_TIMEOUT, HEARTBEAT_DURATION).unwrap(); let replica = Replica::new(addr, peers, store, state_machine); // Fire up the thread. thread::Builder::new().name(format!("Server {}", addr)).spawn(move || { let mut raft_node = Server { listener: listener, replica: replica, connections: Slab::new_starting_at(Token(2), 128), }; event_loop.run(&mut raft_node).unwrap(); }).unwrap(); } } impl<S, M> Handler for Server<S, M> where S: Store, M: StateMachine { type Message = RingBuf; type Timeout = Token; /// A registered IoHandle has available writing space. fn writable(&mut self, reactor: &mut EventLoop<Server<S, M>>, token: Token) { debug!("Writeable"); match token { ELECTION_TIMEOUT => unreachable!(), HEARTBEAT_TIMEOUT => unreachable!(), LISTENER => unreachable!(), tok => { self.connections[tok].writable(reactor, &mut self.replica).unwrap(); } } } /// A registered IoHandle has available data to read fn readable(&mut self, reactor: &mut EventLoop<Server<S, M>>, token: Token, _hint: ReadHint) { debug!("Readable"); match token { ELECTION_TIMEOUT => unreachable!(), HEARTBEAT_TIMEOUT => unreachable!(), LISTENER => { let stream = match self.listener.accept().unwrap() { Some(s) => s, None => return, // Socket isn't quite ready. }; // Result<Option<_>,_> let conn = Connection::new(stream); let tok = self.connections.insert(conn) .ok().expect("Could not add connection to slab."); // Register the connection self.connections[tok].token = tok; reactor.register_opt(&self.connections[tok].stream, tok, Interest::readable(), PollOpt::edge() | PollOpt::oneshot()) .ok().expect("Could not register socket with event loop."); }, tok => { self.connections[tok].readable(reactor, &mut self.replica).unwrap(); } } } /// A registered timer has expired. This is either: /// /// * An election timeout, when a `Follower` node has waited too long for a heartbeat and doing /// to become a `Candidate`. /// * A heartbeat timeout, when the `Leader` node needs to refresh it's authority over the /// followers. Initializes and sends an `AppendEntries` request to all followers. fn timeout(&mut self, reactor: &mut EventLoop<Server<S, M>>, token: Token) { debug!("Timeout"); let mut message = MallocMessageBuilder::new_default(); let mut send_message = None; match token { ELECTION_TIMEOUT => { let request = message.init_root::<rpc_request::Builder>(); send_message = self.replica.election_timeout(request.init_request_vote()); // Set timeout. let timeout = rand::thread_rng().gen_range::<u64>(ELECTION_MIN, ELECTION_MAX); reactor.timeout_ms(ELECTION_TIMEOUT, timeout).unwrap(); }, HEARTBEAT_TIMEOUT => { let request = message.init_root::<rpc_request::Builder>(); send_message = self.replica.heartbeat_timeout(request.init_append_entries()); // Set Timeout reactor.timeout_ms(HEARTBEAT_TIMEOUT, HEARTBEAT_DURATION).unwrap(); }, _ => unreachable!(), } // Send if necessary. match send_message { Some(Broadcast) => { let mut buf = RingBuf::new(RINGBUF_SIZE); serialize_packed::write_message( &mut buf, &mut message ).unwrap(); for connection in self.connections.iter_mut() { connection.add_write(buf.clone()); } }, None => (), } } } struct Connection { stream: NonBlock<TcpStream>, token: Token, interest: Interest, current_read: BufReader<RingBuf>, current_write: BufReader<RingBuf>, next_write: VecDeque<RingBuf>, } impl Connection { /// Note: The caller must manually assign `token` to what is desired. fn new(sock: NonBlock<TcpStream>) -> Connection { Connection { stream: sock, token: Token(0), // Effectively a `null`. This needs to be assigned by the caller. interest: Interest::hup(), current_read: BufReader::new(RingBuf::new(4096)), current_write: BufReader::new(RingBuf::new(4096)), next_write: VecDeque::with_capacity(10), } } /// A registered IoHandle has available writing space. fn
<S, M>(&mut self, event_loop: &mut EventLoop<Server<S, M>>, replica: &mut Replica<S,M>) -> Result<()> where S: Store, M: StateMachine { // Attempt to write data. // The `current_write` buffer will be advanced based on how much we wrote. match self.stream.write(self.current_write.get_mut()) { Ok(None) => { // This is a buffer flush. WOULDBLOCK self.interest.insert(Interest::writable()); }, Ok(Some(r)) => { // We managed to write data! match (self.current_write.get_ref().has_remaining(), self.next_write.is_empty()) { // Need to write more of what we have. (true, _) => (), // Need to roll over. (false, false) => self.current_write = BufReader::new(self.next_write.pop_front().unwrap()), // We're done writing for now. (false, true) => self.interest.remove(Interest::writable()), } }, Err(e) => return Err(Error::from(e)), } match event_loop.reregister(&self.stream, self.token, self.interest, PollOpt::edge() | PollOpt::oneshot()) { Ok(()) => Ok(()), Err(e) => Err(Error::from(e)), } } /// A registered IoHandle has available data to read. /// This does not necessarily mean that there is an entire packed item on the stream. We could /// get some, all of it, or none. We'll use the buffer to read in until we can find one. fn readable<S, M>(&mut self, event_loop: &mut EventLoop<Server<S, M>>, replica: &mut Replica<S,M>) -> Result<()> where S: Store, M: StateMachine { let mut read = 0; match self.stream.read(self.current_read.get_mut()) { Ok(Some(r)) => { // Just read `r` bytes. read = r; }, Ok(None) => panic!("We just got readable, but were unable to read from the socket?"), Err(e) => return Err(Error::from(e)), }; if read > 0 { match serialize_packed::read_message(&mut self.current_read, ReaderOptions::new()) { // We have something reasonably interesting in the buffer! Ok(reader) => { self.handle_reader(reader, event_loop, replica); }, // It's not read entirely yet. // Should roll back, pending changes to bytes upstream. // TODO: This was fixed. Err(_) => unimplemented!(), } } match event_loop.reregister(&self.stream, self.token, self.interest, PollOpt::edge()) { Ok(()) => Ok(()), Err(e) => Err(Error::from(e)), } } /// This is called when there is a full reader available in the buffer. /// It handles what to do with the data. fn handle_reader<S, M>(&mut self, reader: OwnedSpaceMessageReader, event_loop: &mut EventLoop<Server<S, M>>, replica: &mut Replica<S,M>) where S: Store, M: StateMachine { let mut builder_message = MallocMessageBuilder::new_default(); let from = self.stream.peer_addr().unwrap(); if let Ok(request) = reader.get_root::<rpc_request::Reader>() { match request.which().unwrap() { // TODO: Move these into replica? rpc_request::Which::AppendEntries(Ok(call)) => { let builder = builder_message.init_root::<append_entries_response::Builder>(); match replica.append_entries_request(from, call, builder) { Some(Emit) => { // Special Cirsumstance Detection unimplemented!(); }, None => (), } }, rpc_request::Which::RequestVote(Ok(call)) => { let respond = { let builder = builder_message.init_root::<request_vote_response::Builder>(); replica.request_vote_request(from, call, builder) }; match respond { Some(Emit) => { // TODO self.emit(builder_message); }, None => (), } }, _ => unimplemented!(), }; } else if let Ok(response) = reader.get_root::<rpc_response::Reader>() { // We won't be responding. This is already a response. match response.which().unwrap() { rpc_response::Which::AppendEntries(Ok(call)) => { let respond = { let builder = builder_message.init_root::<append_entries_request::Builder>(); replica.append_entries_response(from, call, builder) }; match respond { Some(Emit) => { // TODO self.emit(builder_message); }, None => (), } }, rpc_response::Which::RequestVote(Ok(call)) => { let respond = { let builder = builder_message.init_root::<append_entries_request::Builder>(); replica.request_vote_response(from, call, builder) }; match respond { Some(Broadcast) => { // Won an election! self.broadcast(builder_message); }, None => (), } }, _ => unimplemented!(), } } else if let Ok(client_req) = reader.get_root::<client_request::Reader>() { let mut should_die = false; // We will be responding. match client_req.which().unwrap() { client_request::Which::Append(Ok(call)) => { let respond = { let builder = builder_message.init_root::<client_response::Builder>(); replica.client_append(from, call, builder) }; match respond { Some(emit) => { self.emit(builder_message); }, None => (), } }, client_request::Which::Die(Ok(call)) => { should_die = true; let mut builder = builder_message.init_root::<client_response::Builder>(); builder.set_success(()); self.interest.insert(Interest::writable()); debug!("Got a Die request from Client({}). Reason: {}", from, call); }, client_request::Which::LeaderRefresh(()) => { let respond = { let builder = builder_message.init_root::<client_response::Builder>(); replica.client_leader_refresh(from, builder) }; match respond { Some(Emit) => { self.emit(builder_message); }, None => (), } }, _ => unimplemented!(), }; // Do this here so that we can send the response. if should_die { panic!("Got a Die request."); } } else { // It's something we don't understand. unimplemented!(); } } fn broadcast(&mut self, builder: MallocMessageBuilder) { unimplemented!(); } /// Push the new message into `self.next_write`. This does not actually send the message, it /// just queues it up. pub fn emit(&mut self, mut builder: MallocMessageBuilder) { let mut buf = RingBuf::new(RINGBUF_SIZE); serialize_packed::write_message( &mut buf, &mut builder ).unwrap(); self.add_write(buf); } /// This queues a byte buffer into the write queue. This is used primarily when message has /// already been packed. pub fn add_write(&mut self, buf: RingBuf) { self.next_write.push_back(buf); } }
writable
identifier_name
server.rs
use std::thread; use std::collections::HashSet; use std::net::SocketAddr; use std::collections::VecDeque; use std::io::BufReader; // MIO use mio::tcp::{listen, TcpListener, TcpStream}; use mio::util::Slab; use mio::Socket; use mio::buf::{RingBuf}; use mio::{Interest, PollOpt, NonBlock, Token, EventLoop, Handler, ReadHint}; use mio::buf::Buf; use mio::{TryRead, TryWrite}; use rand::{self, Rng}; // Data structures. use store::Store; use replica::{Replica, Emit, Broadcast}; use state_machine::StateMachine; // Cap'n Proto use capnp::serialize_packed; use capnp::{ MessageBuilder, MessageReader, ReaderOptions, MallocMessageBuilder, OwnedSpaceMessageReader, }; use messages_capnp::{ rpc_request, rpc_response, client_request, client_response, request_vote_response, append_entries_response, append_entries_request, }; use super::{Error, Result}; // MIO Tokens const ELECTION_TIMEOUT: Token = Token(0); const HEARTBEAT_TIMEOUT: Token = Token(1); const LISTENER: Token = Token(2); const ELECTION_MIN: u64 = 150; const ELECTION_MAX: u64 = 300; const HEARTBEAT_DURATION: u64 = 50; const RINGBUF_SIZE: usize = 4096; /// The Raft Distributed Consensus Algorithm requires two RPC calls to be available: /// /// * `append_entries` which is used as both a heartbeat (with no payload) and the primary /// interface for requests. /// * `request_vote` which is used by candidates during campaigns to obtain a vote. /// /// A `Server` acts as a replicated state machine. The server's role in the cluster depends on it's /// own status. It will maintain both volatile state (which can be safely lost) and persistent /// state (which must be carefully stored and kept safe). /// /// Currently, the `Server` API is not well defined. **We are looking for feedback and suggestions.** pub struct Server<S, M> where S: Store, M: StateMachine { replica: Replica<S, M>, // Channels and Sockets listener: NonBlock<TcpListener>, connections: Slab<Connection>, } /// The implementation of the Server. In most use cases, creating a `Server` should just be /// done via `::new()`. impl<S, M> Server<S, M> where S: Store, M: StateMachine { /// Creates a new Raft node with the cluster members specified. /// /// # Arguments /// /// * `addr` - The address of the new node. /// * `peers` - The address of all peers in the Raft cluster. /// * `store` - The persitent log store. /// * `state_machine` - The client state machine to which client commands will be applied. pub fn spawn(addr: SocketAddr, peers: HashSet<SocketAddr>, store: S, state_machine: M) { debug!("Spawning Server"); // Create an event loop let mut event_loop = EventLoop::<Server<S, M>>::new().unwrap(); // Setup the socket, make it not block. let listener = listen(&addr).unwrap(); listener.set_reuseaddr(true).unwrap(); event_loop.register(&listener, LISTENER).unwrap(); let timeout = rand::thread_rng().gen_range::<u64>(ELECTION_MIN, ELECTION_MAX); event_loop.timeout_ms(ELECTION_TIMEOUT, timeout).unwrap(); event_loop.timeout_ms(HEARTBEAT_TIMEOUT, HEARTBEAT_DURATION).unwrap(); let replica = Replica::new(addr, peers, store, state_machine); // Fire up the thread. thread::Builder::new().name(format!("Server {}", addr)).spawn(move || { let mut raft_node = Server { listener: listener, replica: replica, connections: Slab::new_starting_at(Token(2), 128), }; event_loop.run(&mut raft_node).unwrap(); }).unwrap(); } } impl<S, M> Handler for Server<S, M> where S: Store, M: StateMachine { type Message = RingBuf; type Timeout = Token; /// A registered IoHandle has available writing space. fn writable(&mut self, reactor: &mut EventLoop<Server<S, M>>, token: Token) { debug!("Writeable"); match token { ELECTION_TIMEOUT => unreachable!(), HEARTBEAT_TIMEOUT => unreachable!(), LISTENER => unreachable!(), tok => { self.connections[tok].writable(reactor, &mut self.replica).unwrap(); } } } /// A registered IoHandle has available data to read fn readable(&mut self, reactor: &mut EventLoop<Server<S, M>>, token: Token, _hint: ReadHint) { debug!("Readable"); match token { ELECTION_TIMEOUT => unreachable!(), HEARTBEAT_TIMEOUT => unreachable!(), LISTENER => { let stream = match self.listener.accept().unwrap() { Some(s) => s, None => return, // Socket isn't quite ready. }; // Result<Option<_>,_> let conn = Connection::new(stream); let tok = self.connections.insert(conn) .ok().expect("Could not add connection to slab."); // Register the connection self.connections[tok].token = tok; reactor.register_opt(&self.connections[tok].stream, tok, Interest::readable(), PollOpt::edge() | PollOpt::oneshot()) .ok().expect("Could not register socket with event loop."); }, tok => { self.connections[tok].readable(reactor, &mut self.replica).unwrap(); } } } /// A registered timer has expired. This is either: /// /// * An election timeout, when a `Follower` node has waited too long for a heartbeat and doing /// to become a `Candidate`. /// * A heartbeat timeout, when the `Leader` node needs to refresh it's authority over the /// followers. Initializes and sends an `AppendEntries` request to all followers. fn timeout(&mut self, reactor: &mut EventLoop<Server<S, M>>, token: Token) { debug!("Timeout"); let mut message = MallocMessageBuilder::new_default(); let mut send_message = None; match token { ELECTION_TIMEOUT => { let request = message.init_root::<rpc_request::Builder>(); send_message = self.replica.election_timeout(request.init_request_vote()); // Set timeout. let timeout = rand::thread_rng().gen_range::<u64>(ELECTION_MIN, ELECTION_MAX); reactor.timeout_ms(ELECTION_TIMEOUT, timeout).unwrap(); }, HEARTBEAT_TIMEOUT => { let request = message.init_root::<rpc_request::Builder>(); send_message = self.replica.heartbeat_timeout(request.init_append_entries()); // Set Timeout reactor.timeout_ms(HEARTBEAT_TIMEOUT, HEARTBEAT_DURATION).unwrap(); }, _ => unreachable!(), } // Send if necessary. match send_message { Some(Broadcast) => { let mut buf = RingBuf::new(RINGBUF_SIZE); serialize_packed::write_message( &mut buf, &mut message ).unwrap(); for connection in self.connections.iter_mut() { connection.add_write(buf.clone()); } }, None => (), } } } struct Connection { stream: NonBlock<TcpStream>, token: Token, interest: Interest, current_read: BufReader<RingBuf>, current_write: BufReader<RingBuf>, next_write: VecDeque<RingBuf>, } impl Connection { /// Note: The caller must manually assign `token` to what is desired. fn new(sock: NonBlock<TcpStream>) -> Connection { Connection { stream: sock, token: Token(0), // Effectively a `null`. This needs to be assigned by the caller. interest: Interest::hup(), current_read: BufReader::new(RingBuf::new(4096)), current_write: BufReader::new(RingBuf::new(4096)), next_write: VecDeque::with_capacity(10), } } /// A registered IoHandle has available writing space. fn writable<S, M>(&mut self, event_loop: &mut EventLoop<Server<S, M>>, replica: &mut Replica<S,M>) -> Result<()> where S: Store, M: StateMachine { // Attempt to write data. // The `current_write` buffer will be advanced based on how much we wrote. match self.stream.write(self.current_write.get_mut()) { Ok(None) => { // This is a buffer flush. WOULDBLOCK self.interest.insert(Interest::writable()); }, Ok(Some(r)) => { // We managed to write data! match (self.current_write.get_ref().has_remaining(), self.next_write.is_empty()) { // Need to write more of what we have. (true, _) => (), // Need to roll over. (false, false) => self.current_write = BufReader::new(self.next_write.pop_front().unwrap()), // We're done writing for now. (false, true) => self.interest.remove(Interest::writable()), } }, Err(e) => return Err(Error::from(e)), } match event_loop.reregister(&self.stream, self.token, self.interest, PollOpt::edge() | PollOpt::oneshot()) { Ok(()) => Ok(()), Err(e) => Err(Error::from(e)), } } /// A registered IoHandle has available data to read. /// This does not necessarily mean that there is an entire packed item on the stream. We could /// get some, all of it, or none. We'll use the buffer to read in until we can find one.
-> Result<()> where S: Store, M: StateMachine { let mut read = 0; match self.stream.read(self.current_read.get_mut()) { Ok(Some(r)) => { // Just read `r` bytes. read = r; }, Ok(None) => panic!("We just got readable, but were unable to read from the socket?"), Err(e) => return Err(Error::from(e)), }; if read > 0 { match serialize_packed::read_message(&mut self.current_read, ReaderOptions::new()) { // We have something reasonably interesting in the buffer! Ok(reader) => { self.handle_reader(reader, event_loop, replica); }, // It's not read entirely yet. // Should roll back, pending changes to bytes upstream. // TODO: This was fixed. Err(_) => unimplemented!(), } } match event_loop.reregister(&self.stream, self.token, self.interest, PollOpt::edge()) { Ok(()) => Ok(()), Err(e) => Err(Error::from(e)), } } /// This is called when there is a full reader available in the buffer. /// It handles what to do with the data. fn handle_reader<S, M>(&mut self, reader: OwnedSpaceMessageReader, event_loop: &mut EventLoop<Server<S, M>>, replica: &mut Replica<S,M>) where S: Store, M: StateMachine { let mut builder_message = MallocMessageBuilder::new_default(); let from = self.stream.peer_addr().unwrap(); if let Ok(request) = reader.get_root::<rpc_request::Reader>() { match request.which().unwrap() { // TODO: Move these into replica? rpc_request::Which::AppendEntries(Ok(call)) => { let builder = builder_message.init_root::<append_entries_response::Builder>(); match replica.append_entries_request(from, call, builder) { Some(Emit) => { // Special Cirsumstance Detection unimplemented!(); }, None => (), } }, rpc_request::Which::RequestVote(Ok(call)) => { let respond = { let builder = builder_message.init_root::<request_vote_response::Builder>(); replica.request_vote_request(from, call, builder) }; match respond { Some(Emit) => { // TODO self.emit(builder_message); }, None => (), } }, _ => unimplemented!(), }; } else if let Ok(response) = reader.get_root::<rpc_response::Reader>() { // We won't be responding. This is already a response. match response.which().unwrap() { rpc_response::Which::AppendEntries(Ok(call)) => { let respond = { let builder = builder_message.init_root::<append_entries_request::Builder>(); replica.append_entries_response(from, call, builder) }; match respond { Some(Emit) => { // TODO self.emit(builder_message); }, None => (), } }, rpc_response::Which::RequestVote(Ok(call)) => { let respond = { let builder = builder_message.init_root::<append_entries_request::Builder>(); replica.request_vote_response(from, call, builder) }; match respond { Some(Broadcast) => { // Won an election! self.broadcast(builder_message); }, None => (), } }, _ => unimplemented!(), } } else if let Ok(client_req) = reader.get_root::<client_request::Reader>() { let mut should_die = false; // We will be responding. match client_req.which().unwrap() { client_request::Which::Append(Ok(call)) => { let respond = { let builder = builder_message.init_root::<client_response::Builder>(); replica.client_append(from, call, builder) }; match respond { Some(emit) => { self.emit(builder_message); }, None => (), } }, client_request::Which::Die(Ok(call)) => { should_die = true; let mut builder = builder_message.init_root::<client_response::Builder>(); builder.set_success(()); self.interest.insert(Interest::writable()); debug!("Got a Die request from Client({}). Reason: {}", from, call); }, client_request::Which::LeaderRefresh(()) => { let respond = { let builder = builder_message.init_root::<client_response::Builder>(); replica.client_leader_refresh(from, builder) }; match respond { Some(Emit) => { self.emit(builder_message); }, None => (), } }, _ => unimplemented!(), }; // Do this here so that we can send the response. if should_die { panic!("Got a Die request."); } } else { // It's something we don't understand. unimplemented!(); } } fn broadcast(&mut self, builder: MallocMessageBuilder) { unimplemented!(); } /// Push the new message into `self.next_write`. This does not actually send the message, it /// just queues it up. pub fn emit(&mut self, mut builder: MallocMessageBuilder) { let mut buf = RingBuf::new(RINGBUF_SIZE); serialize_packed::write_message( &mut buf, &mut builder ).unwrap(); self.add_write(buf); } /// This queues a byte buffer into the write queue. This is used primarily when message has /// already been packed. pub fn add_write(&mut self, buf: RingBuf) { self.next_write.push_back(buf); } }
fn readable<S, M>(&mut self, event_loop: &mut EventLoop<Server<S, M>>, replica: &mut Replica<S,M>)
random_line_split
server.rs
use std::thread; use std::collections::HashSet; use std::net::SocketAddr; use std::collections::VecDeque; use std::io::BufReader; // MIO use mio::tcp::{listen, TcpListener, TcpStream}; use mio::util::Slab; use mio::Socket; use mio::buf::{RingBuf}; use mio::{Interest, PollOpt, NonBlock, Token, EventLoop, Handler, ReadHint}; use mio::buf::Buf; use mio::{TryRead, TryWrite}; use rand::{self, Rng}; // Data structures. use store::Store; use replica::{Replica, Emit, Broadcast}; use state_machine::StateMachine; // Cap'n Proto use capnp::serialize_packed; use capnp::{ MessageBuilder, MessageReader, ReaderOptions, MallocMessageBuilder, OwnedSpaceMessageReader, }; use messages_capnp::{ rpc_request, rpc_response, client_request, client_response, request_vote_response, append_entries_response, append_entries_request, }; use super::{Error, Result}; // MIO Tokens const ELECTION_TIMEOUT: Token = Token(0); const HEARTBEAT_TIMEOUT: Token = Token(1); const LISTENER: Token = Token(2); const ELECTION_MIN: u64 = 150; const ELECTION_MAX: u64 = 300; const HEARTBEAT_DURATION: u64 = 50; const RINGBUF_SIZE: usize = 4096; /// The Raft Distributed Consensus Algorithm requires two RPC calls to be available: /// /// * `append_entries` which is used as both a heartbeat (with no payload) and the primary /// interface for requests. /// * `request_vote` which is used by candidates during campaigns to obtain a vote. /// /// A `Server` acts as a replicated state machine. The server's role in the cluster depends on it's /// own status. It will maintain both volatile state (which can be safely lost) and persistent /// state (which must be carefully stored and kept safe). /// /// Currently, the `Server` API is not well defined. **We are looking for feedback and suggestions.** pub struct Server<S, M> where S: Store, M: StateMachine { replica: Replica<S, M>, // Channels and Sockets listener: NonBlock<TcpListener>, connections: Slab<Connection>, } /// The implementation of the Server. In most use cases, creating a `Server` should just be /// done via `::new()`. impl<S, M> Server<S, M> where S: Store, M: StateMachine { /// Creates a new Raft node with the cluster members specified. /// /// # Arguments /// /// * `addr` - The address of the new node. /// * `peers` - The address of all peers in the Raft cluster. /// * `store` - The persitent log store. /// * `state_machine` - The client state machine to which client commands will be applied. pub fn spawn(addr: SocketAddr, peers: HashSet<SocketAddr>, store: S, state_machine: M) { debug!("Spawning Server"); // Create an event loop let mut event_loop = EventLoop::<Server<S, M>>::new().unwrap(); // Setup the socket, make it not block. let listener = listen(&addr).unwrap(); listener.set_reuseaddr(true).unwrap(); event_loop.register(&listener, LISTENER).unwrap(); let timeout = rand::thread_rng().gen_range::<u64>(ELECTION_MIN, ELECTION_MAX); event_loop.timeout_ms(ELECTION_TIMEOUT, timeout).unwrap(); event_loop.timeout_ms(HEARTBEAT_TIMEOUT, HEARTBEAT_DURATION).unwrap(); let replica = Replica::new(addr, peers, store, state_machine); // Fire up the thread. thread::Builder::new().name(format!("Server {}", addr)).spawn(move || { let mut raft_node = Server { listener: listener, replica: replica, connections: Slab::new_starting_at(Token(2), 128), }; event_loop.run(&mut raft_node).unwrap(); }).unwrap(); } } impl<S, M> Handler for Server<S, M> where S: Store, M: StateMachine { type Message = RingBuf; type Timeout = Token; /// A registered IoHandle has available writing space. fn writable(&mut self, reactor: &mut EventLoop<Server<S, M>>, token: Token) { debug!("Writeable"); match token { ELECTION_TIMEOUT => unreachable!(), HEARTBEAT_TIMEOUT => unreachable!(), LISTENER => unreachable!(), tok => { self.connections[tok].writable(reactor, &mut self.replica).unwrap(); } } } /// A registered IoHandle has available data to read fn readable(&mut self, reactor: &mut EventLoop<Server<S, M>>, token: Token, _hint: ReadHint) { debug!("Readable"); match token { ELECTION_TIMEOUT => unreachable!(), HEARTBEAT_TIMEOUT => unreachable!(), LISTENER => { let stream = match self.listener.accept().unwrap() { Some(s) => s, None => return, // Socket isn't quite ready. }; // Result<Option<_>,_> let conn = Connection::new(stream); let tok = self.connections.insert(conn) .ok().expect("Could not add connection to slab."); // Register the connection self.connections[tok].token = tok; reactor.register_opt(&self.connections[tok].stream, tok, Interest::readable(), PollOpt::edge() | PollOpt::oneshot()) .ok().expect("Could not register socket with event loop."); }, tok => { self.connections[tok].readable(reactor, &mut self.replica).unwrap(); } } } /// A registered timer has expired. This is either: /// /// * An election timeout, when a `Follower` node has waited too long for a heartbeat and doing /// to become a `Candidate`. /// * A heartbeat timeout, when the `Leader` node needs to refresh it's authority over the /// followers. Initializes and sends an `AppendEntries` request to all followers. fn timeout(&mut self, reactor: &mut EventLoop<Server<S, M>>, token: Token) { debug!("Timeout"); let mut message = MallocMessageBuilder::new_default(); let mut send_message = None; match token { ELECTION_TIMEOUT => { let request = message.init_root::<rpc_request::Builder>(); send_message = self.replica.election_timeout(request.init_request_vote()); // Set timeout. let timeout = rand::thread_rng().gen_range::<u64>(ELECTION_MIN, ELECTION_MAX); reactor.timeout_ms(ELECTION_TIMEOUT, timeout).unwrap(); }, HEARTBEAT_TIMEOUT => { let request = message.init_root::<rpc_request::Builder>(); send_message = self.replica.heartbeat_timeout(request.init_append_entries()); // Set Timeout reactor.timeout_ms(HEARTBEAT_TIMEOUT, HEARTBEAT_DURATION).unwrap(); }, _ => unreachable!(), } // Send if necessary. match send_message { Some(Broadcast) => { let mut buf = RingBuf::new(RINGBUF_SIZE); serialize_packed::write_message( &mut buf, &mut message ).unwrap(); for connection in self.connections.iter_mut() { connection.add_write(buf.clone()); } }, None => (), } } } struct Connection { stream: NonBlock<TcpStream>, token: Token, interest: Interest, current_read: BufReader<RingBuf>, current_write: BufReader<RingBuf>, next_write: VecDeque<RingBuf>, } impl Connection { /// Note: The caller must manually assign `token` to what is desired. fn new(sock: NonBlock<TcpStream>) -> Connection { Connection { stream: sock, token: Token(0), // Effectively a `null`. This needs to be assigned by the caller. interest: Interest::hup(), current_read: BufReader::new(RingBuf::new(4096)), current_write: BufReader::new(RingBuf::new(4096)), next_write: VecDeque::with_capacity(10), } } /// A registered IoHandle has available writing space. fn writable<S, M>(&mut self, event_loop: &mut EventLoop<Server<S, M>>, replica: &mut Replica<S,M>) -> Result<()> where S: Store, M: StateMachine { // Attempt to write data. // The `current_write` buffer will be advanced based on how much we wrote. match self.stream.write(self.current_write.get_mut()) { Ok(None) => { // This is a buffer flush. WOULDBLOCK self.interest.insert(Interest::writable()); }, Ok(Some(r)) => { // We managed to write data! match (self.current_write.get_ref().has_remaining(), self.next_write.is_empty()) { // Need to write more of what we have. (true, _) => (), // Need to roll over. (false, false) => self.current_write = BufReader::new(self.next_write.pop_front().unwrap()), // We're done writing for now. (false, true) => self.interest.remove(Interest::writable()), } }, Err(e) => return Err(Error::from(e)), } match event_loop.reregister(&self.stream, self.token, self.interest, PollOpt::edge() | PollOpt::oneshot()) { Ok(()) => Ok(()), Err(e) => Err(Error::from(e)), } } /// A registered IoHandle has available data to read. /// This does not necessarily mean that there is an entire packed item on the stream. We could /// get some, all of it, or none. We'll use the buffer to read in until we can find one. fn readable<S, M>(&mut self, event_loop: &mut EventLoop<Server<S, M>>, replica: &mut Replica<S,M>) -> Result<()> where S: Store, M: StateMachine { let mut read = 0; match self.stream.read(self.current_read.get_mut()) { Ok(Some(r)) => { // Just read `r` bytes. read = r; }, Ok(None) => panic!("We just got readable, but were unable to read from the socket?"), Err(e) => return Err(Error::from(e)), }; if read > 0 { match serialize_packed::read_message(&mut self.current_read, ReaderOptions::new()) { // We have something reasonably interesting in the buffer! Ok(reader) => { self.handle_reader(reader, event_loop, replica); }, // It's not read entirely yet. // Should roll back, pending changes to bytes upstream. // TODO: This was fixed. Err(_) => unimplemented!(), } } match event_loop.reregister(&self.stream, self.token, self.interest, PollOpt::edge()) { Ok(()) => Ok(()), Err(e) => Err(Error::from(e)), } } /// This is called when there is a full reader available in the buffer. /// It handles what to do with the data. fn handle_reader<S, M>(&mut self, reader: OwnedSpaceMessageReader, event_loop: &mut EventLoop<Server<S, M>>, replica: &mut Replica<S,M>) where S: Store, M: StateMachine { let mut builder_message = MallocMessageBuilder::new_default(); let from = self.stream.peer_addr().unwrap(); if let Ok(request) = reader.get_root::<rpc_request::Reader>() { match request.which().unwrap() { // TODO: Move these into replica? rpc_request::Which::AppendEntries(Ok(call)) => { let builder = builder_message.init_root::<append_entries_response::Builder>(); match replica.append_entries_request(from, call, builder) { Some(Emit) => { // Special Cirsumstance Detection unimplemented!(); }, None => (), } }, rpc_request::Which::RequestVote(Ok(call)) => { let respond = { let builder = builder_message.init_root::<request_vote_response::Builder>(); replica.request_vote_request(from, call, builder) }; match respond { Some(Emit) => { // TODO self.emit(builder_message); }, None => (), } }, _ => unimplemented!(), }; } else if let Ok(response) = reader.get_root::<rpc_response::Reader>() { // We won't be responding. This is already a response. match response.which().unwrap() { rpc_response::Which::AppendEntries(Ok(call)) => { let respond = { let builder = builder_message.init_root::<append_entries_request::Builder>(); replica.append_entries_response(from, call, builder) }; match respond { Some(Emit) => { // TODO self.emit(builder_message); }, None => (), } }, rpc_response::Which::RequestVote(Ok(call)) => { let respond = { let builder = builder_message.init_root::<append_entries_request::Builder>(); replica.request_vote_response(from, call, builder) }; match respond { Some(Broadcast) =>
, None => (), } }, _ => unimplemented!(), } } else if let Ok(client_req) = reader.get_root::<client_request::Reader>() { let mut should_die = false; // We will be responding. match client_req.which().unwrap() { client_request::Which::Append(Ok(call)) => { let respond = { let builder = builder_message.init_root::<client_response::Builder>(); replica.client_append(from, call, builder) }; match respond { Some(emit) => { self.emit(builder_message); }, None => (), } }, client_request::Which::Die(Ok(call)) => { should_die = true; let mut builder = builder_message.init_root::<client_response::Builder>(); builder.set_success(()); self.interest.insert(Interest::writable()); debug!("Got a Die request from Client({}). Reason: {}", from, call); }, client_request::Which::LeaderRefresh(()) => { let respond = { let builder = builder_message.init_root::<client_response::Builder>(); replica.client_leader_refresh(from, builder) }; match respond { Some(Emit) => { self.emit(builder_message); }, None => (), } }, _ => unimplemented!(), }; // Do this here so that we can send the response. if should_die { panic!("Got a Die request."); } } else { // It's something we don't understand. unimplemented!(); } } fn broadcast(&mut self, builder: MallocMessageBuilder) { unimplemented!(); } /// Push the new message into `self.next_write`. This does not actually send the message, it /// just queues it up. pub fn emit(&mut self, mut builder: MallocMessageBuilder) { let mut buf = RingBuf::new(RINGBUF_SIZE); serialize_packed::write_message( &mut buf, &mut builder ).unwrap(); self.add_write(buf); } /// This queues a byte buffer into the write queue. This is used primarily when message has /// already been packed. pub fn add_write(&mut self, buf: RingBuf) { self.next_write.push_back(buf); } }
{ // Won an election! self.broadcast(builder_message); }
conditional_block
group.rs
left * q.j, -left * q.i, q.w, ], )) } /// Computes the [direct sum](https://en.wikipedia.org/wiki/Block_matrix#Direct_sum) /// of two matrices. fn direct_sum(mat1: Matrix<f64>, mat2: Matrix<f64>) -> Matrix<f64> { let dim1 = mat1.nrows(); let dim = dim1 + mat2.nrows(); Matrix::from_fn(dim, dim, |i, j| { if i < dim1 { if j < dim1 { mat1[(i, j)] } else { 0.0 } } else if j >= dim1 { mat2[(i - dim1, j - dim1)] } else { 0.0 } }) } /// An iterator such that `dyn` objects using it can be cloned. Used to get /// around orphan rules. trait GroupIter: Iterator<Item = Matrix<f64>> + dyn_clone::DynClone {} impl<T: Iterator<Item = Matrix<f64>> + dyn_clone::DynClone> GroupIter for T {} dyn_clone::clone_trait_object!(GroupIter); /// A [group](https://en.wikipedia.org/wiki/Group_(mathematics)) of matrices, /// acting on a space of a certain dimension. #[derive(Clone)] pub struct Group { /// The dimension of the matrices of the group. Stored separately so that /// the iterator doesn't have to be peekable. dim: usize, /// The underlying iterator, which actually outputs the matrices. iter: Box<dyn GroupIter>, } impl Iterator for Group { type Item = Matrix<f64>; fn next(&mut self) -> Option<Self::Item> { self.iter.next() } } impl Group { /// Gets all of the elements of the group. Consumes the iterator. pub fn elements(self) -> Vec<Matrix<f64>> { self.collect() } /// Gets the number of elements of the group. Consumes the iterators. pub fn order(self) -> usize { self.count() } pub fn from_gens(dim: usize, gens: Vec<Matrix<f64>>) -> Self { Self { dim, iter: Box::new(GenIter::new(dim, gens)), } } /// Buils the rotation subgroup of a group. pub fn rotations(self) -> Self { // The determinant might not be exactly 1, so we're extra lenient and // just test for positive determinants. Self { dim: self.dim, iter: Box::new(self.filter(|el| el.determinant() > 0.0)), } } /// Builds an iterator over the set of either left or a right quaternions /// from a 3D group. **These won't actually generate a group,** as they /// don't contain central inversion. fn quaternions(self, left: bool) -> Box<dyn GroupIter> { if self.dim!= 3 { panic!("Quaternions can only be generated from 3D matrices."); } Box::new( self.rotations() .map(move |el| quat_to_mat(mat_to_quat(el), left)), ) } /// Returns the swirl symmetry group of two 3D groups. pub fn swirl(g: Self, h: Self) -> Self { if g.dim!= 3 { panic!("g must be a group of 3D matrices."); } if h.dim!= 3 { panic!("h must be a group of 3D matrices."); } Self { dim: 4, iter: Box::new( itertools::iproduct!(g.quaternions(true), h.quaternions(false)) .map(|(mat1, mat2)| { let mat = mat1 * mat2; std::iter::once(mat.clone()).chain(std::iter::once(-mat)) }) .flatten(), ), } } /// Returns a new group whose elements have all been generated already, so /// that they can be used multiple times quickly. pub fn cache(self) -> Self { self.elements().into() } /// Returns the exact same group, but now asserts that each generated /// element has the appropriate dimension. Used for debugging purposes. pub fn debug(self) -> Self
/// Generates the trivial group of a certain dimension. pub fn trivial(dim: usize) -> Self { Self { dim, iter: Box::new(std::iter::once(Matrix::identity(dim, dim))), } } /// Generates the group with the identity and a central inversion of a /// certain dimension. pub fn central_inv(dim: usize) -> Self { Self { dim, iter: Box::new( vec![Matrix::identity(dim, dim), -Matrix::identity(dim, dim)].into_iter(), ), } } /// Generates a step prism group from a base group and a homomorphism into /// another group. pub fn step(g: Self, f: impl Fn(Matrix<f64>) -> Matrix<f64> + Clone +'static) -> Self { let dim = g.dim * 2; Self { dim, iter: Box::new(g.map(move |mat| { let clone = mat.clone(); direct_sum(clone, f(mat)) })), } } /// Generates a Coxeter group from its [`CoxMatrix`], or returns `None` if /// the group doesn't fit as a matrix group in spherical space. pub fn cox_group(cox: CoxMatrix) -> Option<Self> { Some(Self { dim: cox.nrows(), iter: Box::new(GenIter::from_cox_mat(cox)?), }) } /// Generates the direct product of two groups. Uses the specified function /// to uniquely map the ordered pairs of matrices into other matrices. pub fn fn_product( g: Self, h: Self, dim: usize, product: (impl Fn((Matrix<f64>, Matrix<f64>)) -> Matrix<f64> + Clone +'static), ) -> Self { Self { dim, iter: Box::new(itertools::iproduct!(g, h).map(product)), } } /// Returns the group determined by all products between elements of the /// first and the second group. **Is meant only for groups that commute with /// one another.** pub fn matrix_product(g: Self, h: Self) -> Option<Self> { // The two matrices must have the same size. if g.dim!= h.dim { return None; } let dim = g.dim; Some(Self::fn_product(g, h, dim, |(mat1, mat2)| mat1 * mat2)) } /// Calculates the direct product of two groups. Pairs of matrices are then /// mapped to their direct sum. pub fn direct_product(g: Self, h: Self) -> Self { let dim = g.dim + h.dim; Self::fn_product(g, h, dim, |(mat1, mat2)| direct_sum(mat1, mat2)) } /// Generates the [wreath product](https://en.wikipedia.org/wiki/Wreath_product) /// of two symmetry groups. pub fn wreath(g: Self, h: Self) -> Self { let h = h.elements(); let h_len = h.len(); let g_dim = g.dim; let dim = g_dim * h_len; // Indexes each element in h. let mut h_indices = BTreeMap::new(); for (i, h_el) in h.iter().enumerate() { h_indices.insert(OrdMatrix::new(h_el.clone()), i); } // Converts h into a permutation group. let mut permutations = Vec::with_capacity(h_len); for h_el_1 in &h { let mut perm = Vec::with_capacity(h.len()); for h_el_2 in &h { perm.push( *h_indices .get(&OrdMatrix::new(h_el_1 * h_el_2)) .expect("h is not a valid group!"), ); } permutations.push(perm); } // Computes the direct product of g with itself |h| times. let g_prod = vec![&g; h_len - 1] .into_iter() .cloned() .fold(g.clone(), |acc, g| Group::direct_product(g, acc)); Self { dim, iter: Box::new( g_prod .map(move |g_el| { let mut matrices = Vec::new(); for perm in &permutations { let mut new_el = Matrix::zeros(dim, dim); // Permutes the blocks on the diagonal of g_el. for (i, &j) in perm.iter().enumerate() { for x in 0..g_dim { for y in 0..g_dim { new_el[(i * g_dim + x, j * g_dim + y)] = g_el[(i * g_dim + x, i * g_dim + y)]; } } } matrices.push(new_el); } matrices.into_iter() }) .flatten(), ), } } /// Generates the orbit of a point under a given symmetry group. pub fn orbit(self, p: Point) -> Vec<Point> { let mut points = BTreeSet::new(); for m in self { points.insert(OrdPoint::new(m * &p)); } points.into_iter().map(|x| x.0).collect() } /// Generates a polytope as the convex hull of the orbit of a point under a /// given symmetry group. pub fn into_polytope(self, p: Point) -> Concrete { convex::convex_hull(self.orbit(p)) } } impl From<Vec<Matrix<f64>>> for Group { fn from(elements: Vec<Matrix<f64>>) -> Self { Self { dim: elements .get(0) .expect("Group must have at least one element.") .nrows(), iter: Box::new(elements.into_iter()), } } } /// The result of trying to get the next element in a group. pub enum GroupNext { /// We've already found all elements of the group. None, /// We found an element we had found previously. Repeat, /// We found a new element. New(Matrix<f64>), } #[allow(clippy::upper_case_acronyms)] type MatrixMN<R, C> = nalgebra::Matrix<f64, R, C, VecStorage<f64, R, C>>; #[derive(Clone, Debug)] #[allow(clippy::upper_case_acronyms)] /// A matrix ordered by fuzzy lexicographic ordering. Used to quickly /// determine whether an element in a [`GenIter`](GenIter) is a /// duplicate. pub struct OrdMatrixMN<R: Dim, C: Dim>(pub MatrixMN<R, C>) where VecStorage<f64, R, C>: Storage<f64, R, C>; impl<R: Dim, C: Dim> std::ops::Deref for OrdMatrixMN<R, C> where VecStorage<f64, R, C>: Storage<f64, R, C>, { type Target = MatrixMN<R, C>; fn deref(&self) -> &Self::Target { &self.0 } } impl<R: Dim, C: Dim> std::ops::DerefMut for OrdMatrixMN<R, C> where VecStorage<f64, R, C>: Storage<f64, R, C>, { fn deref_mut(&mut self) -> &mut Self::Target { &mut self.0 } } impl<R: Dim, C: Dim> PartialEq for OrdMatrixMN<R, C> where VecStorage<f64, R, C>: Storage<f64, R, C>, { fn eq(&self, other: &Self) -> bool { let mut other = other.iter(); for x in self.iter() { let y = other.next().unwrap(); if abs_diff_ne!(x, y, epsilon = EPS) { return false; } } true } } impl<R: Dim, C: Dim> Eq for OrdMatrixMN<R, C> where VecStorage<f64, R, C>: Storage<f64, R, C> {} impl<R: Dim, C: Dim> PartialOrd for OrdMatrixMN<R, C> where VecStorage<f64, R, C>: Storage<f64, R, C>, { fn partial_cmp(&self, other: &Self) -> Option<std::cmp::Ordering> { let mut other = other.iter(); for x in self.iter() { let y = other.next().unwrap(); if abs_diff_ne!(x, y, epsilon = EPS) { return x.partial_cmp(y); } } Some(std::cmp::Ordering::Equal) } } impl<R: Dim, C: Dim> Ord for OrdMatrixMN<R, C> where VecStorage<f64, R, C>: Storage<f64, R, C>, { fn cmp(&self, other: &Self) -> std::cmp::Ordering { self.partial_cmp(other).unwrap() } } impl<R: Dim, C: Dim> OrdMatrixMN<R, C> where VecStorage<f64, R, C>: Storage<f64, R, C>, { pub fn new(mat: MatrixMN<R, C>) -> Self { Self(mat) } } type OrdMatrix = OrdMatrixMN<Dynamic, Dynamic>; type OrdPoint = OrdMatrixMN<Dynamic, U1>; /// An iterator for a `Group` [generated](https://en.wikipedia.org/wiki/Generator_(mathematics)) /// by a set of floating point matrices. Its elements are built in a BFS order. /// It contains a lookup table, used to figure out whether an element has /// already been found or not, as well as a queue to store the next elements. #[derive(Clone)] pub struct GenIter { /// The number of dimensions the group acts on. pub dim: usize, /// The generators for the group. pub gens: Vec<Matrix<f64>>, /// Stores the elements that have been generated and that can still be /// generated again. Is integral for the algorithm to work, as without it, /// duplicate group elements will just keep generating forever. elements: BTreeMap<OrdMatrix, usize>, /// Stores the elements that haven't yet been processed. queue: VecDeque<OrdMatrix>, /// Stores the index in (`generators`)[GenGroup.generators] of the generator /// that's being checked. All previous once will have already been /// multiplied to the right of the current element. Quirk of the current /// data structure, subject to change. gen_idx: usize, } impl Iterator for GenIter { type Item = Matrix<f64>; fn next(&mut self) -> Option<Self::Item> { loop { match self.try_next() { GroupNext::None => return None, GroupNext::Repeat => {} GroupNext::New(el) => return Some(el), }; } } } /// Determines whether two matrices are "approximately equal" elementwise. fn matrix_approx(mat1: &Matrix<f64>, mat2: &Matrix<f64>) -> bool { const EPS: f64 = 1e-4; let mat1 = mat1.iter(); let mut mat2 = mat2.iter(); for x in mat1 { let y = mat2.next().expect("Matrices don't have the same size!"); if abs_diff_ne!(x, y, epsilon = EPS) { return false; } } true } /// Builds a reflection matrix from a given vector. pub fn refl_mat(n: Vector<f64>) -> Matrix<f64> { let dim = n.nrows(); let nn = n.norm_squared(); // Reflects every basis vector, builds a matrix from all of their images. Matrix::from_columns( &Matrix::identity(dim, dim) .column_iter() .map(|v| v - (2.0 * v.dot(&n) / nn) * &n) .collect::<Vec<_>>(), ) } impl GenIter { /// Builds a new group from a set of generators. fn new(dim: usize, gens: Vec<Matrix<f64>>) -> Self { // Initializes the queue with only the identity matrix. let mut queue = VecDeque::new(); queue.push_back(OrdMatrix::new(Matrix::identity(dim, dim))); // We say that the identity has been found zero times. This is a special // case that ensures that neither the identity is queued nor found // twice. let mut elements = BTreeMap::new(); elements.insert(OrdMatrix::new(Matrix::identity(dim, dim)), 0); Self { dim, gens, elements, queue, gen_idx: 0, } } /// Inserts a new element into the group. Returns whether the element is new. fn insert(&mut self, el: Matrix<f64>) -> bool { let el = OrdMatrix::new(el); // If the element has been found before. if let Some(value) = self.elements.insert(el.clone(), 1) { // Bumps the value by 1, or removes the element if this is the last // time we'll find the element. if value!= self.gens.len() - 1 { self.elements.insert(el, value + 1); } else { self.elements.remove(&el); } // The element is a repeat, except in the special case of the // identity. value == 0 } // If the element is new, we add it to the queue as well. else { self.queue.push_back(el); true } } /// Gets the next element and the next generator to attempt to multiply. /// Advances the iterator. fn next_el_gen(&mut self) -> Option<[Matrix<f64>; 2]> { let el = self.queue.front()?.0.clone(); let gen = self.gens[self.gen_idx].clone(); // Advances the indices. self.gen_idx += 1; if self.gen_idx == self.gens.len() { self.gen_idx = 0; self.queue.pop_front(); } Some([el, gen]) } /// Multiplies the current element times the current generator, determines /// if it is a new element. Advances the iterator. fn try_next(&mut self) -> GroupNext { // If there's a next element and generator. if let Some([el, gen]) = self.next_el_gen() { let new_el = el * gen; // If the group element is new. if self.insert(new_el.clone()) { GroupNext::New(new_el) } // If we found a repeat. else { GroupNext::Repeat } } // If we already went through the entire group. else { GroupNext::None } } pub fn from_cox_mat(cox: CoxMatrix) -> Option<Self> { const EPS: f64 = 1e-6; let dim = cox.nrows(); let mut generators = Vec::with_capacity(dim); // Builds each generator from the top down as a triangular matrix, so // that the dot products match the values in the Coxeter matrix. for i in 0..dim { let mut gen_i = Vector::from
{ let dim = self.dim; Self { dim, iter: Box::new(self.map(move |x| { let msg = "Size of matrix does not match expected dimension."; assert_eq!(x.nrows(), dim, "{}", msg); assert_eq!(x.ncols(), dim, "{}", msg); x })), } }
identifier_body
group.rs
, left * q.j, -left * q.i, q.w, ], )) } /// Computes the [direct sum](https://en.wikipedia.org/wiki/Block_matrix#Direct_sum) /// of two matrices. fn direct_sum(mat1: Matrix<f64>, mat2: Matrix<f64>) -> Matrix<f64> { let dim1 = mat1.nrows(); let dim = dim1 + mat2.nrows(); Matrix::from_fn(dim, dim, |i, j| { if i < dim1 { if j < dim1 { mat1[(i, j)] } else { 0.0 } } else if j >= dim1 { mat2[(i - dim1, j - dim1)] } else { 0.0 } }) } /// An iterator such that `dyn` objects using it can be cloned. Used to get /// around orphan rules. trait GroupIter: Iterator<Item = Matrix<f64>> + dyn_clone::DynClone {} impl<T: Iterator<Item = Matrix<f64>> + dyn_clone::DynClone> GroupIter for T {} dyn_clone::clone_trait_object!(GroupIter); /// A [group](https://en.wikipedia.org/wiki/Group_(mathematics)) of matrices, /// acting on a space of a certain dimension. #[derive(Clone)] pub struct Group { /// The dimension of the matrices of the group. Stored separately so that /// the iterator doesn't have to be peekable. dim: usize, /// The underlying iterator, which actually outputs the matrices. iter: Box<dyn GroupIter>, } impl Iterator for Group { type Item = Matrix<f64>; fn next(&mut self) -> Option<Self::Item> { self.iter.next() } } impl Group { /// Gets all of the elements of the group. Consumes the iterator. pub fn elements(self) -> Vec<Matrix<f64>> { self.collect() } /// Gets the number of elements of the group. Consumes the iterators. pub fn order(self) -> usize { self.count() } pub fn from_gens(dim: usize, gens: Vec<Matrix<f64>>) -> Self { Self { dim, iter: Box::new(GenIter::new(dim, gens)), } } /// Buils the rotation subgroup of a group. pub fn rotations(self) -> Self { // The determinant might not be exactly 1, so we're extra lenient and // just test for positive determinants. Self { dim: self.dim, iter: Box::new(self.filter(|el| el.determinant() > 0.0)), } } /// Builds an iterator over the set of either left or a right quaternions /// from a 3D group. **These won't actually generate a group,** as they /// don't contain central inversion. fn quaternions(self, left: bool) -> Box<dyn GroupIter> { if self.dim!= 3 { panic!("Quaternions can only be generated from 3D matrices."); } Box::new( self.rotations() .map(move |el| quat_to_mat(mat_to_quat(el), left)), ) } /// Returns the swirl symmetry group of two 3D groups. pub fn swirl(g: Self, h: Self) -> Self { if g.dim!= 3 { panic!("g must be a group of 3D matrices."); } if h.dim!= 3 { panic!("h must be a group of 3D matrices."); } Self { dim: 4, iter: Box::new( itertools::iproduct!(g.quaternions(true), h.quaternions(false)) .map(|(mat1, mat2)| { let mat = mat1 * mat2; std::iter::once(mat.clone()).chain(std::iter::once(-mat)) }) .flatten(), ), } } /// Returns a new group whose elements have all been generated already, so /// that they can be used multiple times quickly. pub fn cache(self) -> Self { self.elements().into() } /// Returns the exact same group, but now asserts that each generated /// element has the appropriate dimension. Used for debugging purposes. pub fn debug(self) -> Self { let dim = self.dim; Self { dim, iter: Box::new(self.map(move |x| { let msg = "Size of matrix does not match expected dimension."; assert_eq!(x.nrows(), dim, "{}", msg); assert_eq!(x.ncols(), dim, "{}", msg); x })), } } /// Generates the trivial group of a certain dimension. pub fn trivial(dim: usize) -> Self { Self { dim, iter: Box::new(std::iter::once(Matrix::identity(dim, dim))), } } /// Generates the group with the identity and a central inversion of a /// certain dimension. pub fn central_inv(dim: usize) -> Self { Self { dim, iter: Box::new( vec![Matrix::identity(dim, dim), -Matrix::identity(dim, dim)].into_iter(), ), } } /// Generates a step prism group from a base group and a homomorphism into /// another group. pub fn step(g: Self, f: impl Fn(Matrix<f64>) -> Matrix<f64> + Clone +'static) -> Self { let dim = g.dim * 2; Self { dim, iter: Box::new(g.map(move |mat| { let clone = mat.clone(); direct_sum(clone, f(mat)) })), } } /// Generates a Coxeter group from its [`CoxMatrix`], or returns `None` if /// the group doesn't fit as a matrix group in spherical space. pub fn cox_group(cox: CoxMatrix) -> Option<Self> { Some(Self { dim: cox.nrows(), iter: Box::new(GenIter::from_cox_mat(cox)?), }) } /// Generates the direct product of two groups. Uses the specified function /// to uniquely map the ordered pairs of matrices into other matrices. pub fn fn_product( g: Self, h: Self, dim: usize, product: (impl Fn((Matrix<f64>, Matrix<f64>)) -> Matrix<f64> + Clone +'static), ) -> Self { Self { dim, iter: Box::new(itertools::iproduct!(g, h).map(product)), } } /// Returns the group determined by all products between elements of the /// first and the second group. **Is meant only for groups that commute with /// one another.** pub fn matrix_product(g: Self, h: Self) -> Option<Self> { // The two matrices must have the same size. if g.dim!= h.dim { return None; } let dim = g.dim; Some(Self::fn_product(g, h, dim, |(mat1, mat2)| mat1 * mat2)) } /// Calculates the direct product of two groups. Pairs of matrices are then /// mapped to their direct sum. pub fn direct_product(g: Self, h: Self) -> Self { let dim = g.dim + h.dim; Self::fn_product(g, h, dim, |(mat1, mat2)| direct_sum(mat1, mat2)) } /// Generates the [wreath product](https://en.wikipedia.org/wiki/Wreath_product) /// of two symmetry groups. pub fn wreath(g: Self, h: Self) -> Self { let h = h.elements(); let h_len = h.len(); let g_dim = g.dim; let dim = g_dim * h_len; // Indexes each element in h. let mut h_indices = BTreeMap::new(); for (i, h_el) in h.iter().enumerate() { h_indices.insert(OrdMatrix::new(h_el.clone()), i); } // Converts h into a permutation group. let mut permutations = Vec::with_capacity(h_len); for h_el_1 in &h { let mut perm = Vec::with_capacity(h.len()); for h_el_2 in &h { perm.push( *h_indices .get(&OrdMatrix::new(h_el_1 * h_el_2)) .expect("h is not a valid group!"), ); } permutations.push(perm); } // Computes the direct product of g with itself |h| times. let g_prod = vec![&g; h_len - 1] .into_iter() .cloned() .fold(g.clone(), |acc, g| Group::direct_product(g, acc)); Self { dim, iter: Box::new( g_prod .map(move |g_el| { let mut matrices = Vec::new(); for perm in &permutations { let mut new_el = Matrix::zeros(dim, dim); // Permutes the blocks on the diagonal of g_el. for (i, &j) in perm.iter().enumerate() { for x in 0..g_dim { for y in 0..g_dim { new_el[(i * g_dim + x, j * g_dim + y)] = g_el[(i * g_dim + x, i * g_dim + y)]; } } } matrices.push(new_el); } matrices.into_iter() }) .flatten(), ), } } /// Generates the orbit of a point under a given symmetry group. pub fn orbit(self, p: Point) -> Vec<Point> { let mut points = BTreeSet::new(); for m in self { points.insert(OrdPoint::new(m * &p)); } points.into_iter().map(|x| x.0).collect() } /// Generates a polytope as the convex hull of the orbit of a point under a /// given symmetry group. pub fn into_polytope(self, p: Point) -> Concrete { convex::convex_hull(self.orbit(p)) } } impl From<Vec<Matrix<f64>>> for Group { fn from(elements: Vec<Matrix<f64>>) -> Self { Self { dim: elements .get(0) .expect("Group must have at least one element.") .nrows(), iter: Box::new(elements.into_iter()), } } } /// The result of trying to get the next element in a group. pub enum GroupNext { /// We've already found all elements of the group. None, /// We found an element we had found previously. Repeat, /// We found a new element. New(Matrix<f64>), } #[allow(clippy::upper_case_acronyms)] type MatrixMN<R, C> = nalgebra::Matrix<f64, R, C, VecStorage<f64, R, C>>; #[derive(Clone, Debug)] #[allow(clippy::upper_case_acronyms)] /// A matrix ordered by fuzzy lexicographic ordering. Used to quickly /// determine whether an element in a [`GenIter`](GenIter) is a /// duplicate. pub struct OrdMatrixMN<R: Dim, C: Dim>(pub MatrixMN<R, C>) where VecStorage<f64, R, C>: Storage<f64, R, C>; impl<R: Dim, C: Dim> std::ops::Deref for OrdMatrixMN<R, C> where VecStorage<f64, R, C>: Storage<f64, R, C>, { type Target = MatrixMN<R, C>; fn deref(&self) -> &Self::Target { &self.0 } } impl<R: Dim, C: Dim> std::ops::DerefMut for OrdMatrixMN<R, C> where VecStorage<f64, R, C>: Storage<f64, R, C>, { fn deref_mut(&mut self) -> &mut Self::Target { &mut self.0 } } impl<R: Dim, C: Dim> PartialEq for OrdMatrixMN<R, C> where VecStorage<f64, R, C>: Storage<f64, R, C>, { fn eq(&self, other: &Self) -> bool { let mut other = other.iter(); for x in self.iter() { let y = other.next().unwrap(); if abs_diff_ne!(x, y, epsilon = EPS) { return false; } } true } } impl<R: Dim, C: Dim> Eq for OrdMatrixMN<R, C> where VecStorage<f64, R, C>: Storage<f64, R, C> {} impl<R: Dim, C: Dim> PartialOrd for OrdMatrixMN<R, C> where VecStorage<f64, R, C>: Storage<f64, R, C>, { fn partial_cmp(&self, other: &Self) -> Option<std::cmp::Ordering> { let mut other = other.iter(); for x in self.iter() { let y = other.next().unwrap(); if abs_diff_ne!(x, y, epsilon = EPS) { return x.partial_cmp(y); } } Some(std::cmp::Ordering::Equal) } } impl<R: Dim, C: Dim> Ord for OrdMatrixMN<R, C> where VecStorage<f64, R, C>: Storage<f64, R, C>, { fn cmp(&self, other: &Self) -> std::cmp::Ordering { self.partial_cmp(other).unwrap() } } impl<R: Dim, C: Dim> OrdMatrixMN<R, C> where VecStorage<f64, R, C>: Storage<f64, R, C>, { pub fn new(mat: MatrixMN<R, C>) -> Self { Self(mat) } } type OrdMatrix = OrdMatrixMN<Dynamic, Dynamic>; type OrdPoint = OrdMatrixMN<Dynamic, U1>; /// An iterator for a `Group` [generated](https://en.wikipedia.org/wiki/Generator_(mathematics)) /// by a set of floating point matrices. Its elements are built in a BFS order. /// It contains a lookup table, used to figure out whether an element has /// already been found or not, as well as a queue to store the next elements. #[derive(Clone)] pub struct GenIter { /// The number of dimensions the group acts on. pub dim: usize, /// The generators for the group. pub gens: Vec<Matrix<f64>>, /// Stores the elements that have been generated and that can still be /// generated again. Is integral for the algorithm to work, as without it, /// duplicate group elements will just keep generating forever. elements: BTreeMap<OrdMatrix, usize>, /// Stores the elements that haven't yet been processed. queue: VecDeque<OrdMatrix>, /// Stores the index in (`generators`)[GenGroup.generators] of the generator /// that's being checked. All previous once will have already been /// multiplied to the right of the current element. Quirk of the current /// data structure, subject to change. gen_idx: usize, } impl Iterator for GenIter { type Item = Matrix<f64>; fn next(&mut self) -> Option<Self::Item> { loop { match self.try_next() { GroupNext::None => return None, GroupNext::Repeat => {} GroupNext::New(el) => return Some(el), }; } } } /// Determines whether two matrices are "approximately equal" elementwise. fn matrix_approx(mat1: &Matrix<f64>, mat2: &Matrix<f64>) -> bool { const EPS: f64 = 1e-4; let mat1 = mat1.iter(); let mut mat2 = mat2.iter(); for x in mat1 { let y = mat2.next().expect("Matrices don't have the same size!"); if abs_diff_ne!(x, y, epsilon = EPS) { return false; } } true } /// Builds a reflection matrix from a given vector. pub fn refl_mat(n: Vector<f64>) -> Matrix<f64> { let dim = n.nrows();
let nn = n.norm_squared(); // Reflects every basis vector, builds a matrix from all of their images. Matrix::from_columns( &Matrix::identity(dim, dim) .column_iter() .map(|v| v - (2.0 * v.dot(&n) / nn) * &n) .collect::<Vec<_>>(), ) } impl GenIter { /// Builds a new group from a set of generators. fn new(dim: usize, gens: Vec<Matrix<f64>>) -> Self { // Initializes the queue with only the identity matrix. let mut queue = VecDeque::new(); queue.push_back(OrdMatrix::new(Matrix::identity(dim, dim))); // We say that the identity has been found zero times. This is a special // case that ensures that neither the identity is queued nor found // twice. let mut elements = BTreeMap::new(); elements.insert(OrdMatrix::new(Matrix::identity(dim, dim)), 0); Self { dim, gens, elements, queue, gen_idx: 0, } } /// Inserts a new element into the group. Returns whether the element is new. fn insert(&mut self, el: Matrix<f64>) -> bool { let el = OrdMatrix::new(el); // If the element has been found before. if let Some(value) = self.elements.insert(el.clone(), 1) { // Bumps the value by 1, or removes the element if this is the last // time we'll find the element. if value!= self.gens.len() - 1 { self.elements.insert(el, value + 1); } else { self.elements.remove(&el); } // The element is a repeat, except in the special case of the // identity. value == 0 } // If the element is new, we add it to the queue as well. else { self.queue.push_back(el); true } } /// Gets the next element and the next generator to attempt to multiply. /// Advances the iterator. fn next_el_gen(&mut self) -> Option<[Matrix<f64>; 2]> { let el = self.queue.front()?.0.clone(); let gen = self.gens[self.gen_idx].clone(); // Advances the indices. self.gen_idx += 1; if self.gen_idx == self.gens.len() { self.gen_idx = 0; self.queue.pop_front(); } Some([el, gen]) } /// Multiplies the current element times the current generator, determines /// if it is a new element. Advances the iterator. fn try_next(&mut self) -> GroupNext { // If there's a next element and generator. if let Some([el, gen]) = self.next_el_gen() { let new_el = el * gen; // If the group element is new. if self.insert(new_el.clone()) { GroupNext::New(new_el) } // If we found a repeat. else { GroupNext::Repeat } } // If we already went through the entire group. else { GroupNext::None } } pub fn from_cox_mat(cox: CoxMatrix) -> Option<Self> { const EPS: f64 = 1e-6; let dim = cox.nrows(); let mut generators = Vec::with_capacity(dim); // Builds each generator from the top down as a triangular matrix, so // that the dot products match the values in the Coxeter matrix. for i in 0..dim { let mut gen_i = Vector::from_
random_line_split
group.rs
left * q.j, -left * q.i, q.w, ], )) } /// Computes the [direct sum](https://en.wikipedia.org/wiki/Block_matrix#Direct_sum) /// of two matrices. fn direct_sum(mat1: Matrix<f64>, mat2: Matrix<f64>) -> Matrix<f64> { let dim1 = mat1.nrows(); let dim = dim1 + mat2.nrows(); Matrix::from_fn(dim, dim, |i, j| { if i < dim1 { if j < dim1 { mat1[(i, j)] } else { 0.0 } } else if j >= dim1 { mat2[(i - dim1, j - dim1)] } else { 0.0 } }) } /// An iterator such that `dyn` objects using it can be cloned. Used to get /// around orphan rules. trait GroupIter: Iterator<Item = Matrix<f64>> + dyn_clone::DynClone {} impl<T: Iterator<Item = Matrix<f64>> + dyn_clone::DynClone> GroupIter for T {} dyn_clone::clone_trait_object!(GroupIter); /// A [group](https://en.wikipedia.org/wiki/Group_(mathematics)) of matrices, /// acting on a space of a certain dimension. #[derive(Clone)] pub struct Group { /// The dimension of the matrices of the group. Stored separately so that /// the iterator doesn't have to be peekable. dim: usize, /// The underlying iterator, which actually outputs the matrices. iter: Box<dyn GroupIter>, } impl Iterator for Group { type Item = Matrix<f64>; fn next(&mut self) -> Option<Self::Item> { self.iter.next() } } impl Group { /// Gets all of the elements of the group. Consumes the iterator. pub fn elements(self) -> Vec<Matrix<f64>> { self.collect() } /// Gets the number of elements of the group. Consumes the iterators. pub fn order(self) -> usize { self.count() } pub fn from_gens(dim: usize, gens: Vec<Matrix<f64>>) -> Self { Self { dim, iter: Box::new(GenIter::new(dim, gens)), } } /// Buils the rotation subgroup of a group. pub fn rotations(self) -> Self { // The determinant might not be exactly 1, so we're extra lenient and // just test for positive determinants. Self { dim: self.dim, iter: Box::new(self.filter(|el| el.determinant() > 0.0)), } } /// Builds an iterator over the set of either left or a right quaternions /// from a 3D group. **These won't actually generate a group,** as they /// don't contain central inversion. fn
(self, left: bool) -> Box<dyn GroupIter> { if self.dim!= 3 { panic!("Quaternions can only be generated from 3D matrices."); } Box::new( self.rotations() .map(move |el| quat_to_mat(mat_to_quat(el), left)), ) } /// Returns the swirl symmetry group of two 3D groups. pub fn swirl(g: Self, h: Self) -> Self { if g.dim!= 3 { panic!("g must be a group of 3D matrices."); } if h.dim!= 3 { panic!("h must be a group of 3D matrices."); } Self { dim: 4, iter: Box::new( itertools::iproduct!(g.quaternions(true), h.quaternions(false)) .map(|(mat1, mat2)| { let mat = mat1 * mat2; std::iter::once(mat.clone()).chain(std::iter::once(-mat)) }) .flatten(), ), } } /// Returns a new group whose elements have all been generated already, so /// that they can be used multiple times quickly. pub fn cache(self) -> Self { self.elements().into() } /// Returns the exact same group, but now asserts that each generated /// element has the appropriate dimension. Used for debugging purposes. pub fn debug(self) -> Self { let dim = self.dim; Self { dim, iter: Box::new(self.map(move |x| { let msg = "Size of matrix does not match expected dimension."; assert_eq!(x.nrows(), dim, "{}", msg); assert_eq!(x.ncols(), dim, "{}", msg); x })), } } /// Generates the trivial group of a certain dimension. pub fn trivial(dim: usize) -> Self { Self { dim, iter: Box::new(std::iter::once(Matrix::identity(dim, dim))), } } /// Generates the group with the identity and a central inversion of a /// certain dimension. pub fn central_inv(dim: usize) -> Self { Self { dim, iter: Box::new( vec![Matrix::identity(dim, dim), -Matrix::identity(dim, dim)].into_iter(), ), } } /// Generates a step prism group from a base group and a homomorphism into /// another group. pub fn step(g: Self, f: impl Fn(Matrix<f64>) -> Matrix<f64> + Clone +'static) -> Self { let dim = g.dim * 2; Self { dim, iter: Box::new(g.map(move |mat| { let clone = mat.clone(); direct_sum(clone, f(mat)) })), } } /// Generates a Coxeter group from its [`CoxMatrix`], or returns `None` if /// the group doesn't fit as a matrix group in spherical space. pub fn cox_group(cox: CoxMatrix) -> Option<Self> { Some(Self { dim: cox.nrows(), iter: Box::new(GenIter::from_cox_mat(cox)?), }) } /// Generates the direct product of two groups. Uses the specified function /// to uniquely map the ordered pairs of matrices into other matrices. pub fn fn_product( g: Self, h: Self, dim: usize, product: (impl Fn((Matrix<f64>, Matrix<f64>)) -> Matrix<f64> + Clone +'static), ) -> Self { Self { dim, iter: Box::new(itertools::iproduct!(g, h).map(product)), } } /// Returns the group determined by all products between elements of the /// first and the second group. **Is meant only for groups that commute with /// one another.** pub fn matrix_product(g: Self, h: Self) -> Option<Self> { // The two matrices must have the same size. if g.dim!= h.dim { return None; } let dim = g.dim; Some(Self::fn_product(g, h, dim, |(mat1, mat2)| mat1 * mat2)) } /// Calculates the direct product of two groups. Pairs of matrices are then /// mapped to their direct sum. pub fn direct_product(g: Self, h: Self) -> Self { let dim = g.dim + h.dim; Self::fn_product(g, h, dim, |(mat1, mat2)| direct_sum(mat1, mat2)) } /// Generates the [wreath product](https://en.wikipedia.org/wiki/Wreath_product) /// of two symmetry groups. pub fn wreath(g: Self, h: Self) -> Self { let h = h.elements(); let h_len = h.len(); let g_dim = g.dim; let dim = g_dim * h_len; // Indexes each element in h. let mut h_indices = BTreeMap::new(); for (i, h_el) in h.iter().enumerate() { h_indices.insert(OrdMatrix::new(h_el.clone()), i); } // Converts h into a permutation group. let mut permutations = Vec::with_capacity(h_len); for h_el_1 in &h { let mut perm = Vec::with_capacity(h.len()); for h_el_2 in &h { perm.push( *h_indices .get(&OrdMatrix::new(h_el_1 * h_el_2)) .expect("h is not a valid group!"), ); } permutations.push(perm); } // Computes the direct product of g with itself |h| times. let g_prod = vec![&g; h_len - 1] .into_iter() .cloned() .fold(g.clone(), |acc, g| Group::direct_product(g, acc)); Self { dim, iter: Box::new( g_prod .map(move |g_el| { let mut matrices = Vec::new(); for perm in &permutations { let mut new_el = Matrix::zeros(dim, dim); // Permutes the blocks on the diagonal of g_el. for (i, &j) in perm.iter().enumerate() { for x in 0..g_dim { for y in 0..g_dim { new_el[(i * g_dim + x, j * g_dim + y)] = g_el[(i * g_dim + x, i * g_dim + y)]; } } } matrices.push(new_el); } matrices.into_iter() }) .flatten(), ), } } /// Generates the orbit of a point under a given symmetry group. pub fn orbit(self, p: Point) -> Vec<Point> { let mut points = BTreeSet::new(); for m in self { points.insert(OrdPoint::new(m * &p)); } points.into_iter().map(|x| x.0).collect() } /// Generates a polytope as the convex hull of the orbit of a point under a /// given symmetry group. pub fn into_polytope(self, p: Point) -> Concrete { convex::convex_hull(self.orbit(p)) } } impl From<Vec<Matrix<f64>>> for Group { fn from(elements: Vec<Matrix<f64>>) -> Self { Self { dim: elements .get(0) .expect("Group must have at least one element.") .nrows(), iter: Box::new(elements.into_iter()), } } } /// The result of trying to get the next element in a group. pub enum GroupNext { /// We've already found all elements of the group. None, /// We found an element we had found previously. Repeat, /// We found a new element. New(Matrix<f64>), } #[allow(clippy::upper_case_acronyms)] type MatrixMN<R, C> = nalgebra::Matrix<f64, R, C, VecStorage<f64, R, C>>; #[derive(Clone, Debug)] #[allow(clippy::upper_case_acronyms)] /// A matrix ordered by fuzzy lexicographic ordering. Used to quickly /// determine whether an element in a [`GenIter`](GenIter) is a /// duplicate. pub struct OrdMatrixMN<R: Dim, C: Dim>(pub MatrixMN<R, C>) where VecStorage<f64, R, C>: Storage<f64, R, C>; impl<R: Dim, C: Dim> std::ops::Deref for OrdMatrixMN<R, C> where VecStorage<f64, R, C>: Storage<f64, R, C>, { type Target = MatrixMN<R, C>; fn deref(&self) -> &Self::Target { &self.0 } } impl<R: Dim, C: Dim> std::ops::DerefMut for OrdMatrixMN<R, C> where VecStorage<f64, R, C>: Storage<f64, R, C>, { fn deref_mut(&mut self) -> &mut Self::Target { &mut self.0 } } impl<R: Dim, C: Dim> PartialEq for OrdMatrixMN<R, C> where VecStorage<f64, R, C>: Storage<f64, R, C>, { fn eq(&self, other: &Self) -> bool { let mut other = other.iter(); for x in self.iter() { let y = other.next().unwrap(); if abs_diff_ne!(x, y, epsilon = EPS) { return false; } } true } } impl<R: Dim, C: Dim> Eq for OrdMatrixMN<R, C> where VecStorage<f64, R, C>: Storage<f64, R, C> {} impl<R: Dim, C: Dim> PartialOrd for OrdMatrixMN<R, C> where VecStorage<f64, R, C>: Storage<f64, R, C>, { fn partial_cmp(&self, other: &Self) -> Option<std::cmp::Ordering> { let mut other = other.iter(); for x in self.iter() { let y = other.next().unwrap(); if abs_diff_ne!(x, y, epsilon = EPS) { return x.partial_cmp(y); } } Some(std::cmp::Ordering::Equal) } } impl<R: Dim, C: Dim> Ord for OrdMatrixMN<R, C> where VecStorage<f64, R, C>: Storage<f64, R, C>, { fn cmp(&self, other: &Self) -> std::cmp::Ordering { self.partial_cmp(other).unwrap() } } impl<R: Dim, C: Dim> OrdMatrixMN<R, C> where VecStorage<f64, R, C>: Storage<f64, R, C>, { pub fn new(mat: MatrixMN<R, C>) -> Self { Self(mat) } } type OrdMatrix = OrdMatrixMN<Dynamic, Dynamic>; type OrdPoint = OrdMatrixMN<Dynamic, U1>; /// An iterator for a `Group` [generated](https://en.wikipedia.org/wiki/Generator_(mathematics)) /// by a set of floating point matrices. Its elements are built in a BFS order. /// It contains a lookup table, used to figure out whether an element has /// already been found or not, as well as a queue to store the next elements. #[derive(Clone)] pub struct GenIter { /// The number of dimensions the group acts on. pub dim: usize, /// The generators for the group. pub gens: Vec<Matrix<f64>>, /// Stores the elements that have been generated and that can still be /// generated again. Is integral for the algorithm to work, as without it, /// duplicate group elements will just keep generating forever. elements: BTreeMap<OrdMatrix, usize>, /// Stores the elements that haven't yet been processed. queue: VecDeque<OrdMatrix>, /// Stores the index in (`generators`)[GenGroup.generators] of the generator /// that's being checked. All previous once will have already been /// multiplied to the right of the current element. Quirk of the current /// data structure, subject to change. gen_idx: usize, } impl Iterator for GenIter { type Item = Matrix<f64>; fn next(&mut self) -> Option<Self::Item> { loop { match self.try_next() { GroupNext::None => return None, GroupNext::Repeat => {} GroupNext::New(el) => return Some(el), }; } } } /// Determines whether two matrices are "approximately equal" elementwise. fn matrix_approx(mat1: &Matrix<f64>, mat2: &Matrix<f64>) -> bool { const EPS: f64 = 1e-4; let mat1 = mat1.iter(); let mut mat2 = mat2.iter(); for x in mat1 { let y = mat2.next().expect("Matrices don't have the same size!"); if abs_diff_ne!(x, y, epsilon = EPS) { return false; } } true } /// Builds a reflection matrix from a given vector. pub fn refl_mat(n: Vector<f64>) -> Matrix<f64> { let dim = n.nrows(); let nn = n.norm_squared(); // Reflects every basis vector, builds a matrix from all of their images. Matrix::from_columns( &Matrix::identity(dim, dim) .column_iter() .map(|v| v - (2.0 * v.dot(&n) / nn) * &n) .collect::<Vec<_>>(), ) } impl GenIter { /// Builds a new group from a set of generators. fn new(dim: usize, gens: Vec<Matrix<f64>>) -> Self { // Initializes the queue with only the identity matrix. let mut queue = VecDeque::new(); queue.push_back(OrdMatrix::new(Matrix::identity(dim, dim))); // We say that the identity has been found zero times. This is a special // case that ensures that neither the identity is queued nor found // twice. let mut elements = BTreeMap::new(); elements.insert(OrdMatrix::new(Matrix::identity(dim, dim)), 0); Self { dim, gens, elements, queue, gen_idx: 0, } } /// Inserts a new element into the group. Returns whether the element is new. fn insert(&mut self, el: Matrix<f64>) -> bool { let el = OrdMatrix::new(el); // If the element has been found before. if let Some(value) = self.elements.insert(el.clone(), 1) { // Bumps the value by 1, or removes the element if this is the last // time we'll find the element. if value!= self.gens.len() - 1 { self.elements.insert(el, value + 1); } else { self.elements.remove(&el); } // The element is a repeat, except in the special case of the // identity. value == 0 } // If the element is new, we add it to the queue as well. else { self.queue.push_back(el); true } } /// Gets the next element and the next generator to attempt to multiply. /// Advances the iterator. fn next_el_gen(&mut self) -> Option<[Matrix<f64>; 2]> { let el = self.queue.front()?.0.clone(); let gen = self.gens[self.gen_idx].clone(); // Advances the indices. self.gen_idx += 1; if self.gen_idx == self.gens.len() { self.gen_idx = 0; self.queue.pop_front(); } Some([el, gen]) } /// Multiplies the current element times the current generator, determines /// if it is a new element. Advances the iterator. fn try_next(&mut self) -> GroupNext { // If there's a next element and generator. if let Some([el, gen]) = self.next_el_gen() { let new_el = el * gen; // If the group element is new. if self.insert(new_el.clone()) { GroupNext::New(new_el) } // If we found a repeat. else { GroupNext::Repeat } } // If we already went through the entire group. else { GroupNext::None } } pub fn from_cox_mat(cox: CoxMatrix) -> Option<Self> { const EPS: f64 = 1e-6; let dim = cox.nrows(); let mut generators = Vec::with_capacity(dim); // Builds each generator from the top down as a triangular matrix, so // that the dot products match the values in the Coxeter matrix. for i in 0..dim { let mut gen_i = Vector::from
quaternions
identifier_name
task.rs
use notifier::Notifier; use sender::Sender; use futures::{self, future, Future, Async}; use futures::executor::{self, Spawn}; use std::{fmt, mem, panic, ptr}; use std::cell::Cell; use std::sync::Arc; use std::sync::atomic::{self, AtomicUsize, AtomicPtr}; use std::sync::atomic::Ordering::{AcqRel, Acquire, Release, Relaxed}; #[cfg(feature = "unstable-futures")] use futures2; pub(crate) struct Task { ptr: *mut Inner, } #[derive(Debug)] pub(crate) struct Queue { head: AtomicPtr<Inner>, tail: Cell<*mut Inner>, stub: Box<Inner>, } #[derive(Debug)] pub(crate) enum Poll { Empty, Inconsistent, Data(Task), } #[derive(Debug)] pub(crate) enum Run { Idle, Schedule, Complete, } type BoxFuture = Box<Future<Item = (), Error = ()> + Send +'static>; #[cfg(feature = "unstable-futures")] type BoxFuture2 = Box<futures2::Future<Item = (), Error = futures2::Never> + Send>; enum TaskFuture { Futures1(Spawn<BoxFuture>), #[cfg(feature = "unstable-futures")] Futures2 { tls: futures2::task::LocalMap, waker: futures2::task::Waker, fut: BoxFuture2, } } struct Inner { // Next pointer in the queue that submits tasks to a worker. next: AtomicPtr<Inner>, // Task state state: AtomicUsize, // Number of outstanding references to the task ref_count: AtomicUsize, // Store the future at the head of the struct // // The future is dropped immediately when it transitions to Complete future: Option<TaskFuture>, } #[derive(Debug, Clone, Copy, Eq, PartialEq)] enum State { /// Task is currently idle Idle, /// Task is currently running Running, /// Task is currently running, but has been notified that it must run again. Notified, /// Task has been scheduled Scheduled, /// Task is complete Complete, } // ===== impl Task ===== impl Task { /// Create a new task handle pub fn new(future: BoxFuture) -> Task { let task_fut = TaskFuture::Futures1(executor::spawn(future)); let inner = Box::new(Inner { next: AtomicPtr::new(ptr::null_mut()), state: AtomicUsize::new(State::new().into()), ref_count: AtomicUsize::new(1), future: Some(task_fut), }); Task { ptr: Box::into_raw(inner) } } /// Create a new task handle for a futures 0.2 future #[cfg(feature = "unstable-futures")] pub fn new2<F>(fut: BoxFuture2, make_waker: F) -> Task where F: FnOnce(usize) -> futures2::task::Waker { let mut inner = Box::new(Inner { next: AtomicPtr::new(ptr::null_mut()), state: AtomicUsize::new(State::new().into()), ref_count: AtomicUsize::new(1), future: None, }); let waker = make_waker((&*inner) as *const _ as usize); let tls = futures2::task::LocalMap::new(); inner.future = Some(TaskFuture::Futures2 { waker, tls, fut }); Task { ptr: Box::into_raw(inner) } } /// Transmute a u64 to a Task pub unsafe fn from_notify_id(unpark_id: usize) -> Task { mem::transmute(unpark_id) } /// Transmute a u64 to a task ref pub unsafe fn from_notify_id_ref<'a>(unpark_id: &'a usize) -> &'a Task { mem::transmute(unpark_id) } /// Execute the task returning `Run::Schedule` if the task needs to be /// scheduled again. pub fn run(&self, unpark: &Arc<Notifier>, exec: &mut Sender) -> Run { use self::State::*; // Transition task to running state. At this point, the task must be // scheduled. let actual: State = self.inner().state.compare_and_swap( Scheduled.into(), Running.into(), AcqRel).into(); trace!("running; state={:?}", actual); match actual { Scheduled => {}, _ => panic!("unexpected task state; {:?}", actual), } trace!("Task::run; state={:?}", State::from(self.inner().state.load(Relaxed))); let fut = &mut self.inner_mut().future; // This block deals with the future panicking while being polled. // // If the future panics, then the drop handler must be called such that // `thread::panicking() -> true`. To do this, the future is dropped from // within the catch_unwind block. let res = panic::catch_unwind(panic::AssertUnwindSafe(|| { struct Guard<'a>(&'a mut Option<TaskFuture>, bool); impl<'a> Drop for Guard<'a> { fn drop(&mut self) { // This drops the future if self.1 { let _ = self.0.take(); } } } let mut g = Guard(fut, true); let ret = g.0.as_mut().unwrap() .poll(unpark, self.ptr as usize, exec); g.1 = false; ret })); match res { Ok(Ok(Async::Ready(_))) | Ok(Err(_)) | Err(_) => { trace!(" -> task complete"); // Drop the future self.inner_mut().drop_future(); // Transition to the completed state self.inner().state.store(State::Complete.into(), Release); Run::Complete } Ok(Ok(Async::NotReady)) => { trace!(" -> not ready"); // Attempt to transition from Running -> Idle, if successful, // then the task does not need to be scheduled again. If the CAS // fails, then the task has been unparked concurrent to running, // in which case it transitions immediately back to scheduled // and we return `true`. let prev: State = self.inner().state.compare_and_swap( Running.into(), Idle.into(), AcqRel).into(); match prev { Running => Run::Idle, Notified => { self.inner().state.store(Scheduled.into(), Release); Run::Schedule } _ => unreachable!(), } } } } /// Transition the task state to scheduled. /// /// Returns `true` if the caller is permitted to schedule the task. pub fn schedule(&self) -> bool { use self::State::*; loop { let actual = self.inner().state.compare_and_swap( Idle.into(), Scheduled.into(), AcqRel).into(); match actual { Idle => return true, Running => { let actual = self.inner().state.compare_and_swap( Running.into(), Notified.into(), AcqRel).into(); match actual { Idle => continue, _ => return false, } } Complete | Notified | Scheduled => return false, } } } #[inline] fn inner(&self) -> &Inner { unsafe { &*self.ptr } } #[inline] fn inner_mut(&self) -> &mut Inner { unsafe { &mut *self.ptr } } } impl fmt::Debug for Task { fn
(&self, fmt: &mut fmt::Formatter) -> fmt::Result { fmt.debug_struct("Task") .field("inner", self.inner()) .finish() } } impl Clone for Task { fn clone(&self) -> Task { use std::isize; const MAX_REFCOUNT: usize = (isize::MAX) as usize; // Using a relaxed ordering is alright here, as knowledge of the // original reference prevents other threads from erroneously deleting // the object. // // As explained in the [Boost documentation][1], Increasing the // reference counter can always be done with memory_order_relaxed: New // references to an object can only be formed from an existing // reference, and passing an existing reference from one thread to // another must already provide any required synchronization. // // [1]: (www.boost.org/doc/libs/1_55_0/doc/html/atomic/usage_examples.html) let old_size = self.inner().ref_count.fetch_add(1, Relaxed); // However we need to guard against massive refcounts in case someone // is `mem::forget`ing Arcs. If we don't do this the count can overflow // and users will use-after free. We racily saturate to `isize::MAX` on // the assumption that there aren't ~2 billion threads incrementing // the reference count at once. This branch will never be taken in // any realistic program. // // We abort because such a program is incredibly degenerate, and we // don't care to support it. if old_size > MAX_REFCOUNT { // TODO: abort panic!(); } Task { ptr: self.ptr } } } impl Drop for Task { fn drop(&mut self) { // Because `fetch_sub` is already atomic, we do not need to synchronize // with other threads unless we are going to delete the object. This // same logic applies to the below `fetch_sub` to the `weak` count. if self.inner().ref_count.fetch_sub(1, Release)!= 1 { return; } // This fence is needed to prevent reordering of use of the data and // deletion of the data. Because it is marked `Release`, the decreasing // of the reference count synchronizes with this `Acquire` fence. This // means that use of the data happens before decreasing the reference // count, which happens before this fence, which happens before the // deletion of the data. // // As explained in the [Boost documentation][1], // // > It is important to enforce any possible access to the object in one // > thread (through an existing reference) to *happen before* deleting // > the object in a different thread. This is achieved by a "release" // > operation after dropping a reference (any access to the object // > through this reference must obviously happened before), and an // > "acquire" operation before deleting the object. // // [1]: (www.boost.org/doc/libs/1_55_0/doc/html/atomic/usage_examples.html) atomic::fence(Acquire); unsafe { let _ = Box::from_raw(self.ptr); } } } unsafe impl Send for Task {} // ===== impl Inner ===== impl Inner { fn stub() -> Inner { Inner { next: AtomicPtr::new(ptr::null_mut()), state: AtomicUsize::new(State::stub().into()), ref_count: AtomicUsize::new(0), future: Some(TaskFuture::Futures1(executor::spawn(Box::new(future::empty())))), } } fn drop_future(&mut self) { let _ = self.future.take(); } } impl Drop for Inner { fn drop(&mut self) { self.drop_future(); } } impl fmt::Debug for Inner { fn fmt(&self, fmt: &mut fmt::Formatter) -> fmt::Result { fmt.debug_struct("Inner") .field("next", &self.next) .field("state", &self.state) .field("ref_count", &self.ref_count) .field("future", &"Spawn<BoxFuture>") .finish() } } // ===== impl Queue ===== impl Queue { pub fn new() -> Queue { let stub = Box::new(Inner::stub()); let ptr = &*stub as *const _ as *mut _; Queue { head: AtomicPtr::new(ptr), tail: Cell::new(ptr), stub: stub, } } pub fn push(&self, handle: Task) { unsafe { self.push2(handle.ptr); // Forgetting the handle is necessary to avoid the ref dec mem::forget(handle); } } unsafe fn push2(&self, handle: *mut Inner) { // Set the next pointer. This does not require an atomic operation as // this node is not accessible. The write will be flushed with the next // operation (*handle).next = AtomicPtr::new(ptr::null_mut()); // Update the head to point to the new node. We need to see the previous // node in order to update the next pointer as well as release `handle` // to any other threads calling `push`. let prev = self.head.swap(handle, AcqRel); // Release `handle` to the consume end. (*prev).next.store(handle, Release); } pub unsafe fn poll(&self) -> Poll { let mut tail = self.tail.get(); let mut next = (*tail).next.load(Acquire); let stub = &*self.stub as *const _ as *mut _; if tail == stub { if next.is_null() { return Poll::Empty; } self.tail.set(next); tail = next; next = (*next).next.load(Acquire); } if!next.is_null() { self.tail.set(next); // No ref_count inc is necessary here as this poll is paired // with a `push` which "forgets" the handle. return Poll::Data(Task { ptr: tail, }); } if self.head.load(Acquire)!= tail { return Poll::Inconsistent; } self.push2(stub); next = (*tail).next.load(Acquire); if!next.is_null() { self.tail.set(next); return Poll::Data(Task { ptr: tail, }); } Poll::Inconsistent } } // ===== impl State ===== impl State { /// Returns the initial task state. /// /// Tasks start in the scheduled state as they are immediately scheduled on /// creation. fn new() -> State { State::Scheduled } fn stub() -> State { State::Idle } } impl From<usize> for State { fn from(src: usize) -> Self { use self::State::*; match src { 0 => Idle, 1 => Running, 2 => Notified, 3 => Scheduled, 4 => Complete, _ => unreachable!(), } } } impl From<State> for usize { fn from(src: State) -> Self { use self::State::*; match src { Idle => 0, Running => 1, Notified => 2, Scheduled => 3, Complete => 4, } } } // ===== impl TaskFuture ===== impl TaskFuture { #[allow(unused_variables)] fn poll(&mut self, unpark: &Arc<Notifier>, id: usize, exec: &mut Sender) -> futures::Poll<(), ()> { match *self { TaskFuture::Futures1(ref mut fut) => fut.poll_future_notify(unpark, id), #[cfg(feature = "unstable-futures")] TaskFuture::Futures2 { ref mut fut, ref waker, ref mut tls } => { let mut cx = futures2::task::Context::new(tls, waker, exec); match fut.poll(&mut cx).unwrap() { futures2::Async::Pending => Ok(Async::NotReady), futures2::Async::Ready(x) => Ok(Async::Ready(x)), } } } } }
fmt
identifier_name
task.rs
use notifier::Notifier; use sender::Sender; use futures::{self, future, Future, Async}; use futures::executor::{self, Spawn}; use std::{fmt, mem, panic, ptr}; use std::cell::Cell; use std::sync::Arc; use std::sync::atomic::{self, AtomicUsize, AtomicPtr}; use std::sync::atomic::Ordering::{AcqRel, Acquire, Release, Relaxed}; #[cfg(feature = "unstable-futures")] use futures2; pub(crate) struct Task { ptr: *mut Inner, } #[derive(Debug)] pub(crate) struct Queue { head: AtomicPtr<Inner>, tail: Cell<*mut Inner>, stub: Box<Inner>, } #[derive(Debug)] pub(crate) enum Poll { Empty, Inconsistent, Data(Task), } #[derive(Debug)] pub(crate) enum Run { Idle, Schedule, Complete, } type BoxFuture = Box<Future<Item = (), Error = ()> + Send +'static>; #[cfg(feature = "unstable-futures")] type BoxFuture2 = Box<futures2::Future<Item = (), Error = futures2::Never> + Send>; enum TaskFuture { Futures1(Spawn<BoxFuture>), #[cfg(feature = "unstable-futures")] Futures2 { tls: futures2::task::LocalMap, waker: futures2::task::Waker, fut: BoxFuture2, } } struct Inner { // Next pointer in the queue that submits tasks to a worker. next: AtomicPtr<Inner>, // Task state state: AtomicUsize, // Number of outstanding references to the task ref_count: AtomicUsize, // Store the future at the head of the struct // // The future is dropped immediately when it transitions to Complete future: Option<TaskFuture>, } #[derive(Debug, Clone, Copy, Eq, PartialEq)] enum State { /// Task is currently idle Idle, /// Task is currently running Running, /// Task is currently running, but has been notified that it must run again. Notified, /// Task has been scheduled Scheduled, /// Task is complete Complete, } // ===== impl Task ===== impl Task { /// Create a new task handle pub fn new(future: BoxFuture) -> Task { let task_fut = TaskFuture::Futures1(executor::spawn(future)); let inner = Box::new(Inner { next: AtomicPtr::new(ptr::null_mut()), state: AtomicUsize::new(State::new().into()), ref_count: AtomicUsize::new(1), future: Some(task_fut), }); Task { ptr: Box::into_raw(inner) } } /// Create a new task handle for a futures 0.2 future #[cfg(feature = "unstable-futures")] pub fn new2<F>(fut: BoxFuture2, make_waker: F) -> Task where F: FnOnce(usize) -> futures2::task::Waker { let mut inner = Box::new(Inner { next: AtomicPtr::new(ptr::null_mut()), state: AtomicUsize::new(State::new().into()), ref_count: AtomicUsize::new(1), future: None, }); let waker = make_waker((&*inner) as *const _ as usize); let tls = futures2::task::LocalMap::new(); inner.future = Some(TaskFuture::Futures2 { waker, tls, fut }); Task { ptr: Box::into_raw(inner) } } /// Transmute a u64 to a Task pub unsafe fn from_notify_id(unpark_id: usize) -> Task { mem::transmute(unpark_id) } /// Transmute a u64 to a task ref pub unsafe fn from_notify_id_ref<'a>(unpark_id: &'a usize) -> &'a Task { mem::transmute(unpark_id) } /// Execute the task returning `Run::Schedule` if the task needs to be /// scheduled again. pub fn run(&self, unpark: &Arc<Notifier>, exec: &mut Sender) -> Run { use self::State::*; // Transition task to running state. At this point, the task must be // scheduled. let actual: State = self.inner().state.compare_and_swap( Scheduled.into(), Running.into(), AcqRel).into(); trace!("running; state={:?}", actual); match actual { Scheduled => {}, _ => panic!("unexpected task state; {:?}", actual), } trace!("Task::run; state={:?}", State::from(self.inner().state.load(Relaxed))); let fut = &mut self.inner_mut().future; // This block deals with the future panicking while being polled. // // If the future panics, then the drop handler must be called such that // `thread::panicking() -> true`. To do this, the future is dropped from // within the catch_unwind block. let res = panic::catch_unwind(panic::AssertUnwindSafe(|| { struct Guard<'a>(&'a mut Option<TaskFuture>, bool); impl<'a> Drop for Guard<'a> { fn drop(&mut self) { // This drops the future if self.1 { let _ = self.0.take(); } } } let mut g = Guard(fut, true); let ret = g.0.as_mut().unwrap() .poll(unpark, self.ptr as usize, exec); g.1 = false; ret })); match res { Ok(Ok(Async::Ready(_))) | Ok(Err(_)) | Err(_) => { trace!(" -> task complete"); // Drop the future self.inner_mut().drop_future(); // Transition to the completed state self.inner().state.store(State::Complete.into(), Release); Run::Complete } Ok(Ok(Async::NotReady)) => { trace!(" -> not ready"); // Attempt to transition from Running -> Idle, if successful, // then the task does not need to be scheduled again. If the CAS // fails, then the task has been unparked concurrent to running, // in which case it transitions immediately back to scheduled // and we return `true`. let prev: State = self.inner().state.compare_and_swap( Running.into(), Idle.into(), AcqRel).into(); match prev { Running => Run::Idle, Notified => { self.inner().state.store(Scheduled.into(), Release); Run::Schedule } _ => unreachable!(), } } } } /// Transition the task state to scheduled. /// /// Returns `true` if the caller is permitted to schedule the task. pub fn schedule(&self) -> bool { use self::State::*; loop { let actual = self.inner().state.compare_and_swap( Idle.into(), Scheduled.into(), AcqRel).into(); match actual { Idle => return true, Running => { let actual = self.inner().state.compare_and_swap( Running.into(), Notified.into(), AcqRel).into(); match actual { Idle => continue, _ => return false, } } Complete | Notified | Scheduled => return false, } } } #[inline] fn inner(&self) -> &Inner { unsafe { &*self.ptr } } #[inline] fn inner_mut(&self) -> &mut Inner { unsafe { &mut *self.ptr } } } impl fmt::Debug for Task { fn fmt(&self, fmt: &mut fmt::Formatter) -> fmt::Result { fmt.debug_struct("Task") .field("inner", self.inner()) .finish() } } impl Clone for Task { fn clone(&self) -> Task { use std::isize; const MAX_REFCOUNT: usize = (isize::MAX) as usize; // Using a relaxed ordering is alright here, as knowledge of the // original reference prevents other threads from erroneously deleting // the object. // // As explained in the [Boost documentation][1], Increasing the // reference counter can always be done with memory_order_relaxed: New // references to an object can only be formed from an existing // reference, and passing an existing reference from one thread to // another must already provide any required synchronization. // // [1]: (www.boost.org/doc/libs/1_55_0/doc/html/atomic/usage_examples.html) let old_size = self.inner().ref_count.fetch_add(1, Relaxed); // However we need to guard against massive refcounts in case someone // is `mem::forget`ing Arcs. If we don't do this the count can overflow // and users will use-after free. We racily saturate to `isize::MAX` on // the assumption that there aren't ~2 billion threads incrementing // the reference count at once. This branch will never be taken in // any realistic program. // // We abort because such a program is incredibly degenerate, and we // don't care to support it. if old_size > MAX_REFCOUNT { // TODO: abort panic!(); } Task { ptr: self.ptr } } } impl Drop for Task { fn drop(&mut self) { // Because `fetch_sub` is already atomic, we do not need to synchronize // with other threads unless we are going to delete the object. This // same logic applies to the below `fetch_sub` to the `weak` count. if self.inner().ref_count.fetch_sub(1, Release)!= 1 { return; } // This fence is needed to prevent reordering of use of the data and // deletion of the data. Because it is marked `Release`, the decreasing // of the reference count synchronizes with this `Acquire` fence. This // means that use of the data happens before decreasing the reference // count, which happens before this fence, which happens before the // deletion of the data. // // As explained in the [Boost documentation][1], // // > It is important to enforce any possible access to the object in one // > thread (through an existing reference) to *happen before* deleting // > the object in a different thread. This is achieved by a "release" // > operation after dropping a reference (any access to the object // > through this reference must obviously happened before), and an // > "acquire" operation before deleting the object. // // [1]: (www.boost.org/doc/libs/1_55_0/doc/html/atomic/usage_examples.html) atomic::fence(Acquire); unsafe { let _ = Box::from_raw(self.ptr); } } } unsafe impl Send for Task {} // ===== impl Inner ===== impl Inner { fn stub() -> Inner { Inner { next: AtomicPtr::new(ptr::null_mut()), state: AtomicUsize::new(State::stub().into()), ref_count: AtomicUsize::new(0), future: Some(TaskFuture::Futures1(executor::spawn(Box::new(future::empty())))), } } fn drop_future(&mut self) { let _ = self.future.take(); } } impl Drop for Inner { fn drop(&mut self) { self.drop_future(); } } impl fmt::Debug for Inner { fn fmt(&self, fmt: &mut fmt::Formatter) -> fmt::Result { fmt.debug_struct("Inner") .field("next", &self.next) .field("state", &self.state) .field("ref_count", &self.ref_count) .field("future", &"Spawn<BoxFuture>") .finish() } } // ===== impl Queue ===== impl Queue { pub fn new() -> Queue { let stub = Box::new(Inner::stub()); let ptr = &*stub as *const _ as *mut _; Queue { head: AtomicPtr::new(ptr), tail: Cell::new(ptr), stub: stub, } } pub fn push(&self, handle: Task) { unsafe { self.push2(handle.ptr); // Forgetting the handle is necessary to avoid the ref dec mem::forget(handle); } } unsafe fn push2(&self, handle: *mut Inner) { // Set the next pointer. This does not require an atomic operation as // this node is not accessible. The write will be flushed with the next // operation (*handle).next = AtomicPtr::new(ptr::null_mut()); // Update the head to point to the new node. We need to see the previous // node in order to update the next pointer as well as release `handle` // to any other threads calling `push`. let prev = self.head.swap(handle, AcqRel); // Release `handle` to the consume end. (*prev).next.store(handle, Release); } pub unsafe fn poll(&self) -> Poll { let mut tail = self.tail.get(); let mut next = (*tail).next.load(Acquire); let stub = &*self.stub as *const _ as *mut _; if tail == stub { if next.is_null() { return Poll::Empty; } self.tail.set(next); tail = next; next = (*next).next.load(Acquire); } if!next.is_null() { self.tail.set(next); // No ref_count inc is necessary here as this poll is paired // with a `push` which "forgets" the handle. return Poll::Data(Task { ptr: tail, }); } if self.head.load(Acquire)!= tail { return Poll::Inconsistent; } self.push2(stub); next = (*tail).next.load(Acquire); if!next.is_null() { self.tail.set(next); return Poll::Data(Task { ptr: tail, }); } Poll::Inconsistent } } // ===== impl State ===== impl State { /// Returns the initial task state. /// /// Tasks start in the scheduled state as they are immediately scheduled on /// creation. fn new() -> State { State::Scheduled } fn stub() -> State
} impl From<usize> for State { fn from(src: usize) -> Self { use self::State::*; match src { 0 => Idle, 1 => Running, 2 => Notified, 3 => Scheduled, 4 => Complete, _ => unreachable!(), } } } impl From<State> for usize { fn from(src: State) -> Self { use self::State::*; match src { Idle => 0, Running => 1, Notified => 2, Scheduled => 3, Complete => 4, } } } // ===== impl TaskFuture ===== impl TaskFuture { #[allow(unused_variables)] fn poll(&mut self, unpark: &Arc<Notifier>, id: usize, exec: &mut Sender) -> futures::Poll<(), ()> { match *self { TaskFuture::Futures1(ref mut fut) => fut.poll_future_notify(unpark, id), #[cfg(feature = "unstable-futures")] TaskFuture::Futures2 { ref mut fut, ref waker, ref mut tls } => { let mut cx = futures2::task::Context::new(tls, waker, exec); match fut.poll(&mut cx).unwrap() { futures2::Async::Pending => Ok(Async::NotReady), futures2::Async::Ready(x) => Ok(Async::Ready(x)), } } } } }
{ State::Idle }
identifier_body
task.rs
use notifier::Notifier; use sender::Sender; use futures::{self, future, Future, Async}; use futures::executor::{self, Spawn}; use std::{fmt, mem, panic, ptr}; use std::cell::Cell; use std::sync::Arc; use std::sync::atomic::{self, AtomicUsize, AtomicPtr}; use std::sync::atomic::Ordering::{AcqRel, Acquire, Release, Relaxed}; #[cfg(feature = "unstable-futures")] use futures2; pub(crate) struct Task { ptr: *mut Inner, } #[derive(Debug)] pub(crate) struct Queue { head: AtomicPtr<Inner>, tail: Cell<*mut Inner>, stub: Box<Inner>, } #[derive(Debug)] pub(crate) enum Poll { Empty, Inconsistent, Data(Task), } #[derive(Debug)] pub(crate) enum Run { Idle, Schedule, Complete, } type BoxFuture = Box<Future<Item = (), Error = ()> + Send +'static>; #[cfg(feature = "unstable-futures")] type BoxFuture2 = Box<futures2::Future<Item = (), Error = futures2::Never> + Send>; enum TaskFuture { Futures1(Spawn<BoxFuture>), #[cfg(feature = "unstable-futures")] Futures2 { tls: futures2::task::LocalMap, waker: futures2::task::Waker, fut: BoxFuture2, } } struct Inner { // Next pointer in the queue that submits tasks to a worker. next: AtomicPtr<Inner>, // Task state state: AtomicUsize, // Number of outstanding references to the task ref_count: AtomicUsize, // Store the future at the head of the struct // // The future is dropped immediately when it transitions to Complete future: Option<TaskFuture>, } #[derive(Debug, Clone, Copy, Eq, PartialEq)] enum State { /// Task is currently idle Idle, /// Task is currently running Running, /// Task is currently running, but has been notified that it must run again. Notified, /// Task has been scheduled Scheduled, /// Task is complete Complete, } // ===== impl Task ===== impl Task { /// Create a new task handle pub fn new(future: BoxFuture) -> Task { let task_fut = TaskFuture::Futures1(executor::spawn(future)); let inner = Box::new(Inner { next: AtomicPtr::new(ptr::null_mut()), state: AtomicUsize::new(State::new().into()), ref_count: AtomicUsize::new(1), future: Some(task_fut), }); Task { ptr: Box::into_raw(inner) } } /// Create a new task handle for a futures 0.2 future #[cfg(feature = "unstable-futures")] pub fn new2<F>(fut: BoxFuture2, make_waker: F) -> Task where F: FnOnce(usize) -> futures2::task::Waker { let mut inner = Box::new(Inner { next: AtomicPtr::new(ptr::null_mut()), state: AtomicUsize::new(State::new().into()), ref_count: AtomicUsize::new(1), future: None, }); let waker = make_waker((&*inner) as *const _ as usize); let tls = futures2::task::LocalMap::new(); inner.future = Some(TaskFuture::Futures2 { waker, tls, fut }); Task { ptr: Box::into_raw(inner) } } /// Transmute a u64 to a Task pub unsafe fn from_notify_id(unpark_id: usize) -> Task { mem::transmute(unpark_id) } /// Transmute a u64 to a task ref pub unsafe fn from_notify_id_ref<'a>(unpark_id: &'a usize) -> &'a Task { mem::transmute(unpark_id) } /// Execute the task returning `Run::Schedule` if the task needs to be /// scheduled again. pub fn run(&self, unpark: &Arc<Notifier>, exec: &mut Sender) -> Run { use self::State::*; // Transition task to running state. At this point, the task must be // scheduled. let actual: State = self.inner().state.compare_and_swap( Scheduled.into(), Running.into(), AcqRel).into(); trace!("running; state={:?}", actual); match actual { Scheduled => {}, _ => panic!("unexpected task state; {:?}", actual), } trace!("Task::run; state={:?}", State::from(self.inner().state.load(Relaxed))); let fut = &mut self.inner_mut().future; // This block deals with the future panicking while being polled. // // If the future panics, then the drop handler must be called such that // `thread::panicking() -> true`. To do this, the future is dropped from // within the catch_unwind block. let res = panic::catch_unwind(panic::AssertUnwindSafe(|| { struct Guard<'a>(&'a mut Option<TaskFuture>, bool); impl<'a> Drop for Guard<'a> { fn drop(&mut self) { // This drops the future if self.1 { let _ = self.0.take(); } } } let mut g = Guard(fut, true); let ret = g.0.as_mut().unwrap() .poll(unpark, self.ptr as usize, exec); g.1 = false; ret })); match res { Ok(Ok(Async::Ready(_))) | Ok(Err(_)) | Err(_) => { trace!(" -> task complete"); // Drop the future self.inner_mut().drop_future(); // Transition to the completed state self.inner().state.store(State::Complete.into(), Release); Run::Complete } Ok(Ok(Async::NotReady)) => { trace!(" -> not ready"); // Attempt to transition from Running -> Idle, if successful, // then the task does not need to be scheduled again. If the CAS // fails, then the task has been unparked concurrent to running, // in which case it transitions immediately back to scheduled // and we return `true`. let prev: State = self.inner().state.compare_and_swap( Running.into(), Idle.into(), AcqRel).into(); match prev { Running => Run::Idle, Notified => { self.inner().state.store(Scheduled.into(), Release); Run::Schedule } _ => unreachable!(), } } } } /// Transition the task state to scheduled. /// /// Returns `true` if the caller is permitted to schedule the task. pub fn schedule(&self) -> bool { use self::State::*; loop { let actual = self.inner().state.compare_and_swap( Idle.into(), Scheduled.into(), AcqRel).into(); match actual { Idle => return true, Running => { let actual = self.inner().state.compare_and_swap( Running.into(), Notified.into(), AcqRel).into(); match actual { Idle => continue, _ => return false, } } Complete | Notified | Scheduled => return false, } } } #[inline] fn inner(&self) -> &Inner { unsafe { &*self.ptr } } #[inline] fn inner_mut(&self) -> &mut Inner { unsafe { &mut *self.ptr } } } impl fmt::Debug for Task { fn fmt(&self, fmt: &mut fmt::Formatter) -> fmt::Result { fmt.debug_struct("Task") .field("inner", self.inner()) .finish() } } impl Clone for Task { fn clone(&self) -> Task { use std::isize; const MAX_REFCOUNT: usize = (isize::MAX) as usize; // Using a relaxed ordering is alright here, as knowledge of the // original reference prevents other threads from erroneously deleting // the object. // // As explained in the [Boost documentation][1], Increasing the // reference counter can always be done with memory_order_relaxed: New // references to an object can only be formed from an existing // reference, and passing an existing reference from one thread to // another must already provide any required synchronization. // // [1]: (www.boost.org/doc/libs/1_55_0/doc/html/atomic/usage_examples.html) let old_size = self.inner().ref_count.fetch_add(1, Relaxed); // However we need to guard against massive refcounts in case someone // is `mem::forget`ing Arcs. If we don't do this the count can overflow // and users will use-after free. We racily saturate to `isize::MAX` on // the assumption that there aren't ~2 billion threads incrementing // the reference count at once. This branch will never be taken in // any realistic program. // // We abort because such a program is incredibly degenerate, and we // don't care to support it. if old_size > MAX_REFCOUNT { // TODO: abort panic!(); } Task { ptr: self.ptr } } } impl Drop for Task { fn drop(&mut self) { // Because `fetch_sub` is already atomic, we do not need to synchronize // with other threads unless we are going to delete the object. This // same logic applies to the below `fetch_sub` to the `weak` count. if self.inner().ref_count.fetch_sub(1, Release)!= 1 { return; } // This fence is needed to prevent reordering of use of the data and // deletion of the data. Because it is marked `Release`, the decreasing // of the reference count synchronizes with this `Acquire` fence. This // means that use of the data happens before decreasing the reference // count, which happens before this fence, which happens before the // deletion of the data. // // As explained in the [Boost documentation][1], // // > It is important to enforce any possible access to the object in one // > thread (through an existing reference) to *happen before* deleting // > the object in a different thread. This is achieved by a "release" // > operation after dropping a reference (any access to the object // > through this reference must obviously happened before), and an // > "acquire" operation before deleting the object. // // [1]: (www.boost.org/doc/libs/1_55_0/doc/html/atomic/usage_examples.html) atomic::fence(Acquire); unsafe { let _ = Box::from_raw(self.ptr); } } } unsafe impl Send for Task {}
impl Inner { fn stub() -> Inner { Inner { next: AtomicPtr::new(ptr::null_mut()), state: AtomicUsize::new(State::stub().into()), ref_count: AtomicUsize::new(0), future: Some(TaskFuture::Futures1(executor::spawn(Box::new(future::empty())))), } } fn drop_future(&mut self) { let _ = self.future.take(); } } impl Drop for Inner { fn drop(&mut self) { self.drop_future(); } } impl fmt::Debug for Inner { fn fmt(&self, fmt: &mut fmt::Formatter) -> fmt::Result { fmt.debug_struct("Inner") .field("next", &self.next) .field("state", &self.state) .field("ref_count", &self.ref_count) .field("future", &"Spawn<BoxFuture>") .finish() } } // ===== impl Queue ===== impl Queue { pub fn new() -> Queue { let stub = Box::new(Inner::stub()); let ptr = &*stub as *const _ as *mut _; Queue { head: AtomicPtr::new(ptr), tail: Cell::new(ptr), stub: stub, } } pub fn push(&self, handle: Task) { unsafe { self.push2(handle.ptr); // Forgetting the handle is necessary to avoid the ref dec mem::forget(handle); } } unsafe fn push2(&self, handle: *mut Inner) { // Set the next pointer. This does not require an atomic operation as // this node is not accessible. The write will be flushed with the next // operation (*handle).next = AtomicPtr::new(ptr::null_mut()); // Update the head to point to the new node. We need to see the previous // node in order to update the next pointer as well as release `handle` // to any other threads calling `push`. let prev = self.head.swap(handle, AcqRel); // Release `handle` to the consume end. (*prev).next.store(handle, Release); } pub unsafe fn poll(&self) -> Poll { let mut tail = self.tail.get(); let mut next = (*tail).next.load(Acquire); let stub = &*self.stub as *const _ as *mut _; if tail == stub { if next.is_null() { return Poll::Empty; } self.tail.set(next); tail = next; next = (*next).next.load(Acquire); } if!next.is_null() { self.tail.set(next); // No ref_count inc is necessary here as this poll is paired // with a `push` which "forgets" the handle. return Poll::Data(Task { ptr: tail, }); } if self.head.load(Acquire)!= tail { return Poll::Inconsistent; } self.push2(stub); next = (*tail).next.load(Acquire); if!next.is_null() { self.tail.set(next); return Poll::Data(Task { ptr: tail, }); } Poll::Inconsistent } } // ===== impl State ===== impl State { /// Returns the initial task state. /// /// Tasks start in the scheduled state as they are immediately scheduled on /// creation. fn new() -> State { State::Scheduled } fn stub() -> State { State::Idle } } impl From<usize> for State { fn from(src: usize) -> Self { use self::State::*; match src { 0 => Idle, 1 => Running, 2 => Notified, 3 => Scheduled, 4 => Complete, _ => unreachable!(), } } } impl From<State> for usize { fn from(src: State) -> Self { use self::State::*; match src { Idle => 0, Running => 1, Notified => 2, Scheduled => 3, Complete => 4, } } } // ===== impl TaskFuture ===== impl TaskFuture { #[allow(unused_variables)] fn poll(&mut self, unpark: &Arc<Notifier>, id: usize, exec: &mut Sender) -> futures::Poll<(), ()> { match *self { TaskFuture::Futures1(ref mut fut) => fut.poll_future_notify(unpark, id), #[cfg(feature = "unstable-futures")] TaskFuture::Futures2 { ref mut fut, ref waker, ref mut tls } => { let mut cx = futures2::task::Context::new(tls, waker, exec); match fut.poll(&mut cx).unwrap() { futures2::Async::Pending => Ok(Async::NotReady), futures2::Async::Ready(x) => Ok(Async::Ready(x)), } } } } }
// ===== impl Inner =====
random_line_split
file_hook.rs
use std::ffi::CStr; use std::ptr::null_mut; use arrayvec::ArrayVec; use lazy_static::lazy_static; use libc::c_void; use super::scr; use super::thiscall::Thiscall; pub fn open_file_hook( out: *mut scr::FileHandle, path: *const u8, params: *const scr::OpenParams, orig: unsafe extern fn( *mut scr::FileHandle, *const u8, *const scr::OpenParams, ) -> *mut scr::FileHandle, ) -> *mut scr::FileHandle { unsafe { let mut buffer = ArrayVec::new(); let real = real_path(path, params, &mut buffer); if let Some(path) = real { let is_sd = (*params).file_type == 1; if!is_sd { if let Some(patched) = check_dummied_out_hd(path) { memory_buffer_to_bw_file_handle(patched, out); return out; } } } orig(out, path, params) } } static DUMMY_ANIM: &[u8] = include_bytes!("../../files/dummy.anim"); static DUMMY_DDSGRP: &[u8] = &[0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0x10]; static DUMMY_SKINS: &[u8] = br#"{"skins":[]}"#; fn check_dummied_out_hd(path: &[u8]) -> Option<&'static [u8]> { if path.ends_with(b".anim") { // Avoid touching tileset/foliage.anim if path.starts_with(b"anim/") { return Some(DUMMY_ANIM); } } else if path.ends_with(b".dds") { // Font dds files are used (only) in SD, but they aren't loaded // on file param SD. if!path.starts_with(b"font/") { // Anim happens to have a dds inside it :) let dummy_dds = &DUMMY_ANIM[0x174..]; return Some(dummy_dds); } } else if path.ends_with(b".dds.vr4") { return Some(DUMMY_DDSGRP); } else if path.ends_with(b".dds.grp") { // Avoid tileset.dds.grps, they need their frames if path.starts_with(b"unit/") || path.starts_with(b"effect/") { return Some(DUMMY_DDSGRP); } } else if path == b"anim/skins.json" { return Some(DUMMY_SKINS); } None } /// If `params` has a file extension set, it will override whatever /// extension `path` has. /// /// Why it is done like that, I have no idea. /// /// This function also normalizes to ascii lowercase and replaces any '\\' with '/' unsafe fn real_path<'a>( path: *const u8, params: *const scr::OpenParams, buffer: &'a mut ArrayVec<[u8; 256]>, ) -> Option<&'a [u8]> { let c_path = CStr::from_ptr(path as *const i8); let c_path = c_path.to_bytes(); let alt_extension = if (*params).extension.is_null() { None } else { Some(CStr::from_ptr((*params).extension as *const i8)) }; let c_path_for_switched_extension = match alt_extension.is_some() { true => match c_path.iter().rev().position(|&x| x == b'.') { Some(period) => &c_path[..c_path.len() - period - 1], None => c_path, }, false => c_path, }; if let Err(_) = buffer.try_extend_from_slice(c_path_for_switched_extension) { return None; } if let Some(ext) = alt_extension { if let Err(_) = buffer.try_extend_from_slice(ext.to_bytes()) { return None; } } let slice = &mut buffer[..]; for val in slice.iter_mut() { match *val { b'A'..= b'Z' => { *val = b'a' + (*val - b'A'); } b'\\' => { *val = b'/'; } _ => (), } } Some(slice) } unsafe fn memory_buffer_to_bw_file_handle(buffer: &'static [u8], handle: *mut scr::FileHandle) { let inner = Box::new(FileAllocation { file: FileState { buffer, pos: 0, }, read: scr::FileRead { vtable: &*FILE_READ_VTABLE, inner: null_mut(), }, peek: scr::FilePeek { vtable: &*FILE_PEEK_VTABLE, inner: null_mut(), }, metadata: scr::FileMetadata { vtable: &*FILE_METADATA_VTABLE, inner: null_mut(), }, }); let inner_ptr = Box::into_raw(inner); (*inner_ptr).metadata.inner = inner_ptr as *mut c_void; (*inner_ptr).peek.inner = inner_ptr as *mut c_void; (*inner_ptr).read.inner = inner_ptr as *mut c_void; let close_callback = scr::Function { vtable: &*FUNCTION_VTABLE, inner: inner_ptr as *mut c_void, }; *handle = scr::FileHandle { vtable: &*FILE_HANDLE_VTABLE1, vtable2: &*FILE_HANDLE_VTABLE2, vtable3: &*FILE_HANDLE_VTABLE3, metadata: &mut (*inner_ptr).metadata, peek: &mut (*inner_ptr).peek, read: &mut (*inner_ptr).read, file_ok: 1, close_callback, }; } struct FileAllocation { file: FileState, read: scr::FileRead, peek: scr::FilePeek, metadata: scr::FileMetadata, } struct FileState { buffer: &'static [u8], pos: u32, } lazy_static! { static ref FILE_HANDLE_VTABLE1: scr::V_FileHandle1 = scr::V_FileHandle1 { destroy: Thiscall::new(file_handle_destroy_nop), read: Thiscall::new(read_file_wrap), skip: Thiscall::new(skip_wrap), safety_padding: [0; 0x20], }; static ref FILE_HANDLE_VTABLE2: scr::V_FileHandle2 = scr::V_FileHandle2 { unk0: [0; 1], peek: Thiscall::new(peek_wrap), safety_padding: [0; 0x20], }; static ref FILE_HANDLE_VTABLE3: scr::V_FileHandle3 = scr::V_FileHandle3 { unk0: [0; 1], tell: Thiscall::new(tell_wrap), seek: Thiscall::new(seek_wrap), file_size: Thiscall::new(file_size_wrap), safety_padding: [0; 0x20], }; static ref FILE_METADATA_VTABLE: scr::V_FileMetadata = scr::V_FileMetadata { unk0: [0; 1], tell: Thiscall::new(tell), seek: Thiscall::new(seek), file_size: Thiscall::new(file_size), safety_padding: [0; 0x20], }; static ref FILE_READ_VTABLE: scr::V_FileRead = scr::V_FileRead { destroy: 0, read: Thiscall::new(read_file), skip: Thiscall::new(skip), safety_padding: [0; 0x20], }; static ref FILE_PEEK_VTABLE: scr::V_FilePeek = scr::V_FilePeek { destroy: 0, peek: Thiscall::new(peek), safety_padding: [0; 0x20], }; static ref FUNCTION_VTABLE: scr::V_Function = scr::V_Function { destroy_inner: Thiscall::new(function_nop_destory), invoke: Thiscall::new(close_file), get_sizes: Thiscall::new(function_object_size), copy: Thiscall::new(function_copy), copy2: Thiscall::new(function_copy), safety_padding: [0; 0x20], }; } unsafe extern fn file_handle_destroy_nop(_file: *mut scr::FileHandle, _dyn_free: u32) { } unsafe extern fn function_nop_destory(_file: *mut scr::Function, _unk: u32) { } unsafe extern fn function_object_size( _file: *mut scr::Function, size: *mut u32, ) { *size = 0xc; *size.add(1) = 0x4; *(size.add(2) as *mut u8) = 0x1; } unsafe extern fn function_copy(this: *mut scr::Function, other: *mut scr::Function) { *other = *this; } unsafe extern fn read_file_wrap(file: *mut scr::FileHandle, out: *mut u8, size: u32) -> u32 { let read = (*file).read; let vtable = (*read).vtable; (*vtable).read.call3(read, out, size) } unsafe extern fn skip_wrap(file: *mut scr::FileHandle, size: u32)
unsafe extern fn read_file(file: *mut scr::FileRead, out: *mut u8, size: u32) -> u32 { let file = (*file).inner as *mut FileAllocation; let buf = std::slice::from_raw_parts_mut(out, size as usize); (*file).file.read(buf) } unsafe extern fn skip(file: *mut scr::FileRead, size: u32) { let file = (*file).inner as *mut FileAllocation; let pos = (*file).file.tell(); (*file).file.seek(pos.saturating_add(size)); } unsafe extern fn peek_wrap(file: *mut c_void, out: *mut u8, size: u32) -> u32 { let file = (file as usize - 4) as *mut scr::FileHandle; let peek = (*file).peek; let vtable = (*peek).vtable; (*vtable).peek.call3(peek, out, size) } unsafe extern fn peek(file: *mut scr::FilePeek, out: *mut u8, size: u32) -> u32 { let file = (*file).inner as *mut FileAllocation; let buf = std::slice::from_raw_parts_mut(out, size as usize); let old_pos = (*file).file.tell(); let result = (*file).file.read(buf); (*file).file.seek(old_pos); result } unsafe extern fn tell_wrap(file: *mut c_void) -> u32 { let file = (file as usize - 8) as *mut scr::FileHandle; let metadata = (*file).metadata; let vtable = (*metadata).vtable; (*vtable).tell.call1(metadata) } unsafe extern fn seek_wrap(file: *mut c_void, pos: u32) { let file = (file as usize - 8) as *mut scr::FileHandle; let metadata = (*file).metadata; let vtable = (*metadata).vtable; (*vtable).seek.call2(metadata, pos) } unsafe extern fn file_size_wrap(file: *mut c_void) -> u32 { let file = (file as usize - 8) as *mut scr::FileHandle; let metadata = (*file).metadata; let vtable = (*metadata).vtable; (*vtable).file_size.call1(metadata) } unsafe extern fn tell(file: *mut scr::FileMetadata) -> u32 { let file = (*file).inner as *mut FileAllocation; (*file).file.tell() } unsafe extern fn seek(file: *mut scr::FileMetadata, pos: u32) { let file = (*file).inner as *mut FileAllocation; (*file).file.seek(pos); } unsafe extern fn file_size(file: *mut scr::FileMetadata) -> u32 { let file = (*file).inner as *mut FileAllocation; (*file).file.size() } unsafe extern fn close_file(this: *mut scr::Function) { let file = (*this).inner as *mut FileAllocation; // Hopefully ok? Box::from_raw(file); } impl FileState { pub fn tell(&self) -> u32 { self.pos } pub fn seek(&mut self, pos: u32) { self.pos = pos; } pub fn size(&self) -> u32 { self.buffer.len() as u32 } pub fn read(&mut self, out: &mut [u8]) -> u32 { let buffer = &self.buffer[self.pos as usize..]; let read_len = out.len().min(buffer.len()); (&mut out[..read_len]).copy_from_slice(&buffer[..read_len]); self.pos += read_len as u32; read_len as u32 } }
{ let read = (*file).read; let vtable = (*read).vtable; (*vtable).skip.call2(read, size) }
identifier_body
file_hook.rs
use std::ffi::CStr; use std::ptr::null_mut; use arrayvec::ArrayVec; use lazy_static::lazy_static; use libc::c_void; use super::scr; use super::thiscall::Thiscall; pub fn open_file_hook( out: *mut scr::FileHandle, path: *const u8, params: *const scr::OpenParams, orig: unsafe extern fn( *mut scr::FileHandle, *const u8, *const scr::OpenParams, ) -> *mut scr::FileHandle, ) -> *mut scr::FileHandle { unsafe { let mut buffer = ArrayVec::new(); let real = real_path(path, params, &mut buffer); if let Some(path) = real { let is_sd = (*params).file_type == 1; if!is_sd { if let Some(patched) = check_dummied_out_hd(path) { memory_buffer_to_bw_file_handle(patched, out); return out; } } } orig(out, path, params) } } static DUMMY_ANIM: &[u8] = include_bytes!("../../files/dummy.anim"); static DUMMY_DDSGRP: &[u8] = &[0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0x10]; static DUMMY_SKINS: &[u8] = br#"{"skins":[]}"#; fn check_dummied_out_hd(path: &[u8]) -> Option<&'static [u8]> { if path.ends_with(b".anim") { // Avoid touching tileset/foliage.anim if path.starts_with(b"anim/") { return Some(DUMMY_ANIM); } } else if path.ends_with(b".dds") { // Font dds files are used (only) in SD, but they aren't loaded // on file param SD. if!path.starts_with(b"font/") { // Anim happens to have a dds inside it :) let dummy_dds = &DUMMY_ANIM[0x174..]; return Some(dummy_dds); } } else if path.ends_with(b".dds.vr4") { return Some(DUMMY_DDSGRP); } else if path.ends_with(b".dds.grp") { // Avoid tileset.dds.grps, they need their frames if path.starts_with(b"unit/") || path.starts_with(b"effect/") { return Some(DUMMY_DDSGRP); } } else if path == b"anim/skins.json" { return Some(DUMMY_SKINS); } None } /// If `params` has a file extension set, it will override whatever /// extension `path` has. /// /// Why it is done like that, I have no idea. /// /// This function also normalizes to ascii lowercase and replaces any '\\' with '/' unsafe fn real_path<'a>( path: *const u8, params: *const scr::OpenParams, buffer: &'a mut ArrayVec<[u8; 256]>, ) -> Option<&'a [u8]> { let c_path = CStr::from_ptr(path as *const i8); let c_path = c_path.to_bytes(); let alt_extension = if (*params).extension.is_null() { None } else { Some(CStr::from_ptr((*params).extension as *const i8)) };
true => match c_path.iter().rev().position(|&x| x == b'.') { Some(period) => &c_path[..c_path.len() - period - 1], None => c_path, }, false => c_path, }; if let Err(_) = buffer.try_extend_from_slice(c_path_for_switched_extension) { return None; } if let Some(ext) = alt_extension { if let Err(_) = buffer.try_extend_from_slice(ext.to_bytes()) { return None; } } let slice = &mut buffer[..]; for val in slice.iter_mut() { match *val { b'A'..= b'Z' => { *val = b'a' + (*val - b'A'); } b'\\' => { *val = b'/'; } _ => (), } } Some(slice) } unsafe fn memory_buffer_to_bw_file_handle(buffer: &'static [u8], handle: *mut scr::FileHandle) { let inner = Box::new(FileAllocation { file: FileState { buffer, pos: 0, }, read: scr::FileRead { vtable: &*FILE_READ_VTABLE, inner: null_mut(), }, peek: scr::FilePeek { vtable: &*FILE_PEEK_VTABLE, inner: null_mut(), }, metadata: scr::FileMetadata { vtable: &*FILE_METADATA_VTABLE, inner: null_mut(), }, }); let inner_ptr = Box::into_raw(inner); (*inner_ptr).metadata.inner = inner_ptr as *mut c_void; (*inner_ptr).peek.inner = inner_ptr as *mut c_void; (*inner_ptr).read.inner = inner_ptr as *mut c_void; let close_callback = scr::Function { vtable: &*FUNCTION_VTABLE, inner: inner_ptr as *mut c_void, }; *handle = scr::FileHandle { vtable: &*FILE_HANDLE_VTABLE1, vtable2: &*FILE_HANDLE_VTABLE2, vtable3: &*FILE_HANDLE_VTABLE3, metadata: &mut (*inner_ptr).metadata, peek: &mut (*inner_ptr).peek, read: &mut (*inner_ptr).read, file_ok: 1, close_callback, }; } struct FileAllocation { file: FileState, read: scr::FileRead, peek: scr::FilePeek, metadata: scr::FileMetadata, } struct FileState { buffer: &'static [u8], pos: u32, } lazy_static! { static ref FILE_HANDLE_VTABLE1: scr::V_FileHandle1 = scr::V_FileHandle1 { destroy: Thiscall::new(file_handle_destroy_nop), read: Thiscall::new(read_file_wrap), skip: Thiscall::new(skip_wrap), safety_padding: [0; 0x20], }; static ref FILE_HANDLE_VTABLE2: scr::V_FileHandle2 = scr::V_FileHandle2 { unk0: [0; 1], peek: Thiscall::new(peek_wrap), safety_padding: [0; 0x20], }; static ref FILE_HANDLE_VTABLE3: scr::V_FileHandle3 = scr::V_FileHandle3 { unk0: [0; 1], tell: Thiscall::new(tell_wrap), seek: Thiscall::new(seek_wrap), file_size: Thiscall::new(file_size_wrap), safety_padding: [0; 0x20], }; static ref FILE_METADATA_VTABLE: scr::V_FileMetadata = scr::V_FileMetadata { unk0: [0; 1], tell: Thiscall::new(tell), seek: Thiscall::new(seek), file_size: Thiscall::new(file_size), safety_padding: [0; 0x20], }; static ref FILE_READ_VTABLE: scr::V_FileRead = scr::V_FileRead { destroy: 0, read: Thiscall::new(read_file), skip: Thiscall::new(skip), safety_padding: [0; 0x20], }; static ref FILE_PEEK_VTABLE: scr::V_FilePeek = scr::V_FilePeek { destroy: 0, peek: Thiscall::new(peek), safety_padding: [0; 0x20], }; static ref FUNCTION_VTABLE: scr::V_Function = scr::V_Function { destroy_inner: Thiscall::new(function_nop_destory), invoke: Thiscall::new(close_file), get_sizes: Thiscall::new(function_object_size), copy: Thiscall::new(function_copy), copy2: Thiscall::new(function_copy), safety_padding: [0; 0x20], }; } unsafe extern fn file_handle_destroy_nop(_file: *mut scr::FileHandle, _dyn_free: u32) { } unsafe extern fn function_nop_destory(_file: *mut scr::Function, _unk: u32) { } unsafe extern fn function_object_size( _file: *mut scr::Function, size: *mut u32, ) { *size = 0xc; *size.add(1) = 0x4; *(size.add(2) as *mut u8) = 0x1; } unsafe extern fn function_copy(this: *mut scr::Function, other: *mut scr::Function) { *other = *this; } unsafe extern fn read_file_wrap(file: *mut scr::FileHandle, out: *mut u8, size: u32) -> u32 { let read = (*file).read; let vtable = (*read).vtable; (*vtable).read.call3(read, out, size) } unsafe extern fn skip_wrap(file: *mut scr::FileHandle, size: u32) { let read = (*file).read; let vtable = (*read).vtable; (*vtable).skip.call2(read, size) } unsafe extern fn read_file(file: *mut scr::FileRead, out: *mut u8, size: u32) -> u32 { let file = (*file).inner as *mut FileAllocation; let buf = std::slice::from_raw_parts_mut(out, size as usize); (*file).file.read(buf) } unsafe extern fn skip(file: *mut scr::FileRead, size: u32) { let file = (*file).inner as *mut FileAllocation; let pos = (*file).file.tell(); (*file).file.seek(pos.saturating_add(size)); } unsafe extern fn peek_wrap(file: *mut c_void, out: *mut u8, size: u32) -> u32 { let file = (file as usize - 4) as *mut scr::FileHandle; let peek = (*file).peek; let vtable = (*peek).vtable; (*vtable).peek.call3(peek, out, size) } unsafe extern fn peek(file: *mut scr::FilePeek, out: *mut u8, size: u32) -> u32 { let file = (*file).inner as *mut FileAllocation; let buf = std::slice::from_raw_parts_mut(out, size as usize); let old_pos = (*file).file.tell(); let result = (*file).file.read(buf); (*file).file.seek(old_pos); result } unsafe extern fn tell_wrap(file: *mut c_void) -> u32 { let file = (file as usize - 8) as *mut scr::FileHandle; let metadata = (*file).metadata; let vtable = (*metadata).vtable; (*vtable).tell.call1(metadata) } unsafe extern fn seek_wrap(file: *mut c_void, pos: u32) { let file = (file as usize - 8) as *mut scr::FileHandle; let metadata = (*file).metadata; let vtable = (*metadata).vtable; (*vtable).seek.call2(metadata, pos) } unsafe extern fn file_size_wrap(file: *mut c_void) -> u32 { let file = (file as usize - 8) as *mut scr::FileHandle; let metadata = (*file).metadata; let vtable = (*metadata).vtable; (*vtable).file_size.call1(metadata) } unsafe extern fn tell(file: *mut scr::FileMetadata) -> u32 { let file = (*file).inner as *mut FileAllocation; (*file).file.tell() } unsafe extern fn seek(file: *mut scr::FileMetadata, pos: u32) { let file = (*file).inner as *mut FileAllocation; (*file).file.seek(pos); } unsafe extern fn file_size(file: *mut scr::FileMetadata) -> u32 { let file = (*file).inner as *mut FileAllocation; (*file).file.size() } unsafe extern fn close_file(this: *mut scr::Function) { let file = (*this).inner as *mut FileAllocation; // Hopefully ok? Box::from_raw(file); } impl FileState { pub fn tell(&self) -> u32 { self.pos } pub fn seek(&mut self, pos: u32) { self.pos = pos; } pub fn size(&self) -> u32 { self.buffer.len() as u32 } pub fn read(&mut self, out: &mut [u8]) -> u32 { let buffer = &self.buffer[self.pos as usize..]; let read_len = out.len().min(buffer.len()); (&mut out[..read_len]).copy_from_slice(&buffer[..read_len]); self.pos += read_len as u32; read_len as u32 } }
let c_path_for_switched_extension = match alt_extension.is_some() {
random_line_split
file_hook.rs
use std::ffi::CStr; use std::ptr::null_mut; use arrayvec::ArrayVec; use lazy_static::lazy_static; use libc::c_void; use super::scr; use super::thiscall::Thiscall; pub fn open_file_hook( out: *mut scr::FileHandle, path: *const u8, params: *const scr::OpenParams, orig: unsafe extern fn( *mut scr::FileHandle, *const u8, *const scr::OpenParams, ) -> *mut scr::FileHandle, ) -> *mut scr::FileHandle { unsafe { let mut buffer = ArrayVec::new(); let real = real_path(path, params, &mut buffer); if let Some(path) = real { let is_sd = (*params).file_type == 1; if!is_sd { if let Some(patched) = check_dummied_out_hd(path) { memory_buffer_to_bw_file_handle(patched, out); return out; } } } orig(out, path, params) } } static DUMMY_ANIM: &[u8] = include_bytes!("../../files/dummy.anim"); static DUMMY_DDSGRP: &[u8] = &[0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0x10]; static DUMMY_SKINS: &[u8] = br#"{"skins":[]}"#; fn check_dummied_out_hd(path: &[u8]) -> Option<&'static [u8]> { if path.ends_with(b".anim") { // Avoid touching tileset/foliage.anim if path.starts_with(b"anim/") { return Some(DUMMY_ANIM); } } else if path.ends_with(b".dds") { // Font dds files are used (only) in SD, but they aren't loaded // on file param SD. if!path.starts_with(b"font/") { // Anim happens to have a dds inside it :) let dummy_dds = &DUMMY_ANIM[0x174..]; return Some(dummy_dds); } } else if path.ends_with(b".dds.vr4") { return Some(DUMMY_DDSGRP); } else if path.ends_with(b".dds.grp") { // Avoid tileset.dds.grps, they need their frames if path.starts_with(b"unit/") || path.starts_with(b"effect/") { return Some(DUMMY_DDSGRP); } } else if path == b"anim/skins.json" { return Some(DUMMY_SKINS); } None } /// If `params` has a file extension set, it will override whatever /// extension `path` has. /// /// Why it is done like that, I have no idea. /// /// This function also normalizes to ascii lowercase and replaces any '\\' with '/' unsafe fn real_path<'a>( path: *const u8, params: *const scr::OpenParams, buffer: &'a mut ArrayVec<[u8; 256]>, ) -> Option<&'a [u8]> { let c_path = CStr::from_ptr(path as *const i8); let c_path = c_path.to_bytes(); let alt_extension = if (*params).extension.is_null() { None } else { Some(CStr::from_ptr((*params).extension as *const i8)) }; let c_path_for_switched_extension = match alt_extension.is_some() { true => match c_path.iter().rev().position(|&x| x == b'.') { Some(period) => &c_path[..c_path.len() - period - 1], None => c_path, }, false => c_path, }; if let Err(_) = buffer.try_extend_from_slice(c_path_for_switched_extension) { return None; } if let Some(ext) = alt_extension { if let Err(_) = buffer.try_extend_from_slice(ext.to_bytes()) { return None; } } let slice = &mut buffer[..]; for val in slice.iter_mut() { match *val { b'A'..= b'Z' => { *val = b'a' + (*val - b'A'); } b'\\' => { *val = b'/'; } _ => (), } } Some(slice) } unsafe fn
(buffer: &'static [u8], handle: *mut scr::FileHandle) { let inner = Box::new(FileAllocation { file: FileState { buffer, pos: 0, }, read: scr::FileRead { vtable: &*FILE_READ_VTABLE, inner: null_mut(), }, peek: scr::FilePeek { vtable: &*FILE_PEEK_VTABLE, inner: null_mut(), }, metadata: scr::FileMetadata { vtable: &*FILE_METADATA_VTABLE, inner: null_mut(), }, }); let inner_ptr = Box::into_raw(inner); (*inner_ptr).metadata.inner = inner_ptr as *mut c_void; (*inner_ptr).peek.inner = inner_ptr as *mut c_void; (*inner_ptr).read.inner = inner_ptr as *mut c_void; let close_callback = scr::Function { vtable: &*FUNCTION_VTABLE, inner: inner_ptr as *mut c_void, }; *handle = scr::FileHandle { vtable: &*FILE_HANDLE_VTABLE1, vtable2: &*FILE_HANDLE_VTABLE2, vtable3: &*FILE_HANDLE_VTABLE3, metadata: &mut (*inner_ptr).metadata, peek: &mut (*inner_ptr).peek, read: &mut (*inner_ptr).read, file_ok: 1, close_callback, }; } struct FileAllocation { file: FileState, read: scr::FileRead, peek: scr::FilePeek, metadata: scr::FileMetadata, } struct FileState { buffer: &'static [u8], pos: u32, } lazy_static! { static ref FILE_HANDLE_VTABLE1: scr::V_FileHandle1 = scr::V_FileHandle1 { destroy: Thiscall::new(file_handle_destroy_nop), read: Thiscall::new(read_file_wrap), skip: Thiscall::new(skip_wrap), safety_padding: [0; 0x20], }; static ref FILE_HANDLE_VTABLE2: scr::V_FileHandle2 = scr::V_FileHandle2 { unk0: [0; 1], peek: Thiscall::new(peek_wrap), safety_padding: [0; 0x20], }; static ref FILE_HANDLE_VTABLE3: scr::V_FileHandle3 = scr::V_FileHandle3 { unk0: [0; 1], tell: Thiscall::new(tell_wrap), seek: Thiscall::new(seek_wrap), file_size: Thiscall::new(file_size_wrap), safety_padding: [0; 0x20], }; static ref FILE_METADATA_VTABLE: scr::V_FileMetadata = scr::V_FileMetadata { unk0: [0; 1], tell: Thiscall::new(tell), seek: Thiscall::new(seek), file_size: Thiscall::new(file_size), safety_padding: [0; 0x20], }; static ref FILE_READ_VTABLE: scr::V_FileRead = scr::V_FileRead { destroy: 0, read: Thiscall::new(read_file), skip: Thiscall::new(skip), safety_padding: [0; 0x20], }; static ref FILE_PEEK_VTABLE: scr::V_FilePeek = scr::V_FilePeek { destroy: 0, peek: Thiscall::new(peek), safety_padding: [0; 0x20], }; static ref FUNCTION_VTABLE: scr::V_Function = scr::V_Function { destroy_inner: Thiscall::new(function_nop_destory), invoke: Thiscall::new(close_file), get_sizes: Thiscall::new(function_object_size), copy: Thiscall::new(function_copy), copy2: Thiscall::new(function_copy), safety_padding: [0; 0x20], }; } unsafe extern fn file_handle_destroy_nop(_file: *mut scr::FileHandle, _dyn_free: u32) { } unsafe extern fn function_nop_destory(_file: *mut scr::Function, _unk: u32) { } unsafe extern fn function_object_size( _file: *mut scr::Function, size: *mut u32, ) { *size = 0xc; *size.add(1) = 0x4; *(size.add(2) as *mut u8) = 0x1; } unsafe extern fn function_copy(this: *mut scr::Function, other: *mut scr::Function) { *other = *this; } unsafe extern fn read_file_wrap(file: *mut scr::FileHandle, out: *mut u8, size: u32) -> u32 { let read = (*file).read; let vtable = (*read).vtable; (*vtable).read.call3(read, out, size) } unsafe extern fn skip_wrap(file: *mut scr::FileHandle, size: u32) { let read = (*file).read; let vtable = (*read).vtable; (*vtable).skip.call2(read, size) } unsafe extern fn read_file(file: *mut scr::FileRead, out: *mut u8, size: u32) -> u32 { let file = (*file).inner as *mut FileAllocation; let buf = std::slice::from_raw_parts_mut(out, size as usize); (*file).file.read(buf) } unsafe extern fn skip(file: *mut scr::FileRead, size: u32) { let file = (*file).inner as *mut FileAllocation; let pos = (*file).file.tell(); (*file).file.seek(pos.saturating_add(size)); } unsafe extern fn peek_wrap(file: *mut c_void, out: *mut u8, size: u32) -> u32 { let file = (file as usize - 4) as *mut scr::FileHandle; let peek = (*file).peek; let vtable = (*peek).vtable; (*vtable).peek.call3(peek, out, size) } unsafe extern fn peek(file: *mut scr::FilePeek, out: *mut u8, size: u32) -> u32 { let file = (*file).inner as *mut FileAllocation; let buf = std::slice::from_raw_parts_mut(out, size as usize); let old_pos = (*file).file.tell(); let result = (*file).file.read(buf); (*file).file.seek(old_pos); result } unsafe extern fn tell_wrap(file: *mut c_void) -> u32 { let file = (file as usize - 8) as *mut scr::FileHandle; let metadata = (*file).metadata; let vtable = (*metadata).vtable; (*vtable).tell.call1(metadata) } unsafe extern fn seek_wrap(file: *mut c_void, pos: u32) { let file = (file as usize - 8) as *mut scr::FileHandle; let metadata = (*file).metadata; let vtable = (*metadata).vtable; (*vtable).seek.call2(metadata, pos) } unsafe extern fn file_size_wrap(file: *mut c_void) -> u32 { let file = (file as usize - 8) as *mut scr::FileHandle; let metadata = (*file).metadata; let vtable = (*metadata).vtable; (*vtable).file_size.call1(metadata) } unsafe extern fn tell(file: *mut scr::FileMetadata) -> u32 { let file = (*file).inner as *mut FileAllocation; (*file).file.tell() } unsafe extern fn seek(file: *mut scr::FileMetadata, pos: u32) { let file = (*file).inner as *mut FileAllocation; (*file).file.seek(pos); } unsafe extern fn file_size(file: *mut scr::FileMetadata) -> u32 { let file = (*file).inner as *mut FileAllocation; (*file).file.size() } unsafe extern fn close_file(this: *mut scr::Function) { let file = (*this).inner as *mut FileAllocation; // Hopefully ok? Box::from_raw(file); } impl FileState { pub fn tell(&self) -> u32 { self.pos } pub fn seek(&mut self, pos: u32) { self.pos = pos; } pub fn size(&self) -> u32 { self.buffer.len() as u32 } pub fn read(&mut self, out: &mut [u8]) -> u32 { let buffer = &self.buffer[self.pos as usize..]; let read_len = out.len().min(buffer.len()); (&mut out[..read_len]).copy_from_slice(&buffer[..read_len]); self.pos += read_len as u32; read_len as u32 } }
memory_buffer_to_bw_file_handle
identifier_name
net.rs
// Copyright 2020 - developers of the `grammers` project. // // Licensed under the Apache License, Version 2.0 <LICENSE-APACHE or // https://www.apache.org/licenses/LICENSE-2.0> or the MIT license // <LICENSE-MIT or https://opensource.org/licenses/MIT>, at your // option. This file may not be copied, modified, or distributed // except according to those terms. pub use super::updates::UpdateIter; use super::{Client, ClientHandle, Config, Request, Step}; use futures::future::FutureExt as _; use futures::{future, pin_mut}; use grammers_mtproto::{mtp, transport}; use grammers_mtsender::{self as sender, AuthorizationError, InvocationError, Sender}; use grammers_tl_types::{self as tl, Deserializable}; use log::info; use std::net::Ipv4Addr; use tokio::sync::{mpsc, oneshot}; /// Socket addresses to Telegram datacenters, where the index into this array /// represents the data center ID. /// /// The addresses were obtained from the `static` addresses through a call to /// `functions::help::GetConfig`. const DC_ADDRESSES: [(Ipv4Addr, u16); 6] = [ (Ipv4Addr::new(149, 154, 167, 51), 443), // default (2) (Ipv4Addr::new(149, 154, 175, 53), 443), (Ipv4Addr::new(149, 154, 167, 51), 443), (Ipv4Addr::new(149, 154, 175, 100), 443), (Ipv4Addr::new(149, 154, 167, 92), 443), (Ipv4Addr::new(91, 108, 56, 190), 443), ]; pub(crate) async fn connect_sender( dc_id: i32, config: &mut Config, ) -> Result<Sender<transport::Full, mtp::Encrypted>, AuthorizationError> { let transport = transport::Full::new(); let addr = DC_ADDRESSES[dc_id as usize]; let mut sender = if let Some(auth_key) = config.session.auth_key.as_ref() { info!( "creating a new sender with existing auth key to dc {} {:?}", dc_id, addr ); sender::connect_with_auth(transport, addr, auth_key.clone()).await? } else { info!( "creating a new sender and auth key in dc {} {:?}", dc_id, addr ); let sender = sender::connect(transport, addr).await?; config.session.auth_key = Some(sender.auth_key().clone()); config.session.save()?; sender }; // TODO handle -404 (we had a previously-valid authkey, but server no longer knows about it) // TODO all up-to-date server addresses should be stored in the session for future initial connections let _remote_config = sender .invoke(&tl::functions::InvokeWithLayer { layer: tl::LAYER, query: tl::functions::InitConnection { api_id: config.api_id, device_model: config.params.device_model.clone(), system_version: config.params.system_version.clone(), app_version: config.params.app_version.clone(), system_lang_code: config.params.system_lang_code.clone(), lang_pack: "".into(), lang_code: config.params.lang_code.clone(), proxy: None, params: None, query: tl::functions::help::GetConfig {}, }, }) .await?; // TODO use the dc id from the config as "this dc", not the input dc id config.session.user_dc = Some(dc_id); config.session.save()?; Ok(sender) } /// Method implementations directly related with network connectivity. impl Client { /// Creates and returns a new client instance upon successful connection to Telegram. /// /// If the session in the configuration did not have an authorization key, a new one /// will be created and the session will be saved with it. /// /// The connection will be initialized with the data from the input configuration. /// /// # Examples /// /// ``` /// use grammers_client::{Client, Config}; /// use grammers_session::Session; /// /// // Note: these are example values and are not actually valid. /// // Obtain your own with the developer's phone at https://my.telegram.org. /// const API_ID: i32 = 932939; /// const API_HASH: &str = "514727c32270b9eb8cc16daf17e21e57"; /// /// # async fn f(mut client: Client) -> Result<(), Box<dyn std::error::Error>> { /// let client = Client::connect(Config { /// session: Session::load_or_create("hello-world.session")?, /// api_id: API_ID, /// api_hash: API_HASH.to_string(), /// params: Default::default(), /// }).await?; /// # Ok(()) /// # } /// ``` pub async fn connect(mut config: Config) -> Result<Self, AuthorizationError> { let sender = connect_sender(config.session.user_dc.unwrap_or(0), &mut config).await?; // TODO Sender doesn't have a way to handle backpressure yet let (handle_tx, handle_rx) = mpsc::unbounded_channel(); Ok(Self { sender, config, handle_tx, handle_rx, }) } /// Invoke a raw API call without the need to use a [`Client::handle`] or having to repeatedly /// call [`Client::step`]. This directly sends the request to Telegram's servers. /// /// Using function definitions corresponding to a different layer is likely to cause the /// responses to the request to not be understood. /// /// <div class="stab unstable"> /// /// **Warning**: this method is **not** part of the stability guarantees of semantic /// versioning. It **may** break during *minor* version changes (but not on patch version /// changes). Use with care. /// /// </div> /// /// # Examples /// /// ``` /// # async fn f(mut client: grammers_client::Client) -> Result<(), Box<dyn std::error::Error>> { /// use grammers_tl_types as tl; /// /// dbg!(client.invoke(&tl::functions::Ping { ping_id: 0 }).await?); /// # Ok(()) /// # } /// ``` pub async fn invoke<R: tl::RemoteCall>( &mut self, request: &R, ) -> Result<R::Return, InvocationError> { self.sender.invoke(request).await } /// Return a new [`ClientHandle`] that can be used to invoke remote procedure calls. /// /// # Examples /// /// ``` /// use tokio::task; /// /// # async fn f(mut client: grammers_client::Client) -> Result<(), Box<dyn std::error::Error>> { /// // Obtain a handle. After this you can obtain more by using `client_handle.clone()`. /// let mut client_handle = client.handle(); /// /// // Run the network loop. This is necessary, or no network events will be processed! /// let network_handle = task::spawn(async move { client.run_until_disconnected().await }); /// /// // Use the `client_handle` to your heart's content, maybe you just want to disconnect: /// client_handle.disconnect().await; /// /// // Joining on the spawned task lets us access the result from `run_until_disconnected`, /// // so we can verify everything went fine. You could also just drop this though. /// network_handle.await?; /// # Ok(()) /// # } /// pub fn handle(&self) -> ClientHandle { ClientHandle { tx: self.handle_tx.clone(), } } /// Perform a single network step or processing of incoming requests via handles. /// /// If a server message is received, requests enqueued via the [`ClientHandle`]s may have /// their result delivered via a channel, and a (possibly empty) list of updates will be /// returned. /// /// The other return values are graceful disconnection, or a read error. /// /// Most commonly, you will want to use the higher-level abstraction [`Client::next_updates`] /// instead. /// /// # Examples /// /// ``` /// # async fn f(mut client: grammers_client::Client) -> Result<(), Box<dyn std::error::Error>> { /// use grammers_client::NetworkStep; /// /// loop { /// // Process network events forever until we gracefully disconnect or get an error. /// match client.step().await? { /// NetworkStep::Connected {.. } => continue, /// NetworkStep::Disconnected => break, /// } /// } /// # Ok(()) /// # } /// ``` pub async fn step(&mut self) -> Result<Step, sender::ReadError> { let (network, request) = { let network = self.sender.step(); let request = self.handle_rx.recv(); pin_mut!(network); pin_mut!(request); match future::select(network, request).await { future::Either::Left((network, request)) => { let request = request.now_or_never(); (Some(network), request) } future::Either::Right((request, network)) => { let network = network.now_or_never(); (network, Some(request)) } } }; if let Some(request) = request { let request = request.expect("mpsc returned None"); match request { Request::Rpc { request, response } => { // Channel will return `Err` if the `ClientHandle` lost interest, just drop the error. drop(response.send(self.sender.enqueue_body(request))); } Request::Disconnect { response } => { // Channel will return `Err` if the `ClientHandle` lost interest, just drop the error. drop(response.send(())); return Ok(Step::Disconnected); } } } // TODO request cancellation if this is Err // (perhaps a method on the sender to cancel_all) Ok(Step::Connected { updates: if let Some(updates) = network { updates? } else { Vec::new() }, }) } /// Run the client by repeatedly calling [`Client::step`] until a graceful disconnection /// occurs, or a network error occurs. Incoming updates are ignored and simply dropped. /// instead. /// /// # Examples /// /// ``` /// # async fn f(mut client: grammers_client::Client) -> Result<(), Box<dyn std::error::Error>> { /// client.run_until_disconnected().await?; /// # Ok(()) /// # } /// ``` pub async fn run_until_disconnected(mut self) -> Result<(), sender::ReadError> { loop { match self.step().await? { Step::Connected {.. } => continue, Step::Disconnected => break Ok(()), } } } } /// Method implementations directly related with network connectivity. impl ClientHandle { /// Invoke a raw API call. /// /// Using function definitions corresponding to a different layer is likely to cause the /// responses to the request to not be understood. /// /// <div class="stab unstable"> /// /// **Warning**: this method is **not** part of the stability guarantees of semantic /// versioning. It **may** break during *minor* version changes (but not on patch version /// changes). Use with care. /// /// </div> /// /// # Examples /// /// ``` /// # async fn f(mut client: grammers_client::ClientHandle) -> Result<(), Box<dyn std::error::Error>> { /// use grammers_tl_types as tl; /// /// dbg!(client.invoke(&tl::functions::Ping { ping_id: 0 }).await?); /// # Ok(()) /// # } /// ``` pub async fn invoke<R: tl::RemoteCall>( &mut self, request: &R, ) -> Result<R::Return, InvocationError> { let (response, rx) = oneshot::channel(); // TODO add a test this (using handle with client dropped) if let Err(_) = self.tx.send(Request::Rpc { request: request.to_bytes(), response, }) { // `Client` was dropped, can no longer send requests return Err(InvocationError::Dropped); } // First receive the `oneshot::Receiver` with from the `Client`, // then `await` on that to receive the response body for the request. if let Ok(response) = rx.await { if let Ok(result) = response.await { match result { Ok(body) => R::Return::from_bytes(&body).map_err(|e| e.into()), Err(e) => Err(e), } } else { // `Sender` dropped, won't be receiving a response for this Err(InvocationError::Dropped) } } else { // `Client` dropped, won't be receiving a response for this Err(InvocationError::Dropped) } } /// Gracefully tell the [`Client`] that created this handle to disconnect and stop receiving /// things from the network. /// /// If the client has already been dropped (and thus disconnected), this method does nothing. /// /// # Examples /// /// ``` /// # async fn f(mut client: grammers_client::ClientHandle) { /// client.disconnect().await; /// # } /// ``` pub async fn disconnect(&mut self) { let (response, rx) = oneshot::channel(); if let Ok(_) = self.tx.send(Request::Disconnect { response }) { // It's fine to drop errors here, it means the channel was dropped by the `Client`. drop(rx.await); } else
} }
{ // `Client` is already dropped, no need to disconnect again. }
conditional_block
net.rs
// Copyright 2020 - developers of the `grammers` project. // // Licensed under the Apache License, Version 2.0 <LICENSE-APACHE or // https://www.apache.org/licenses/LICENSE-2.0> or the MIT license // <LICENSE-MIT or https://opensource.org/licenses/MIT>, at your // option. This file may not be copied, modified, or distributed // except according to those terms. pub use super::updates::UpdateIter; use super::{Client, ClientHandle, Config, Request, Step}; use futures::future::FutureExt as _; use futures::{future, pin_mut}; use grammers_mtproto::{mtp, transport}; use grammers_mtsender::{self as sender, AuthorizationError, InvocationError, Sender}; use grammers_tl_types::{self as tl, Deserializable}; use log::info; use std::net::Ipv4Addr; use tokio::sync::{mpsc, oneshot}; /// Socket addresses to Telegram datacenters, where the index into this array /// represents the data center ID. /// /// The addresses were obtained from the `static` addresses through a call to /// `functions::help::GetConfig`. const DC_ADDRESSES: [(Ipv4Addr, u16); 6] = [ (Ipv4Addr::new(149, 154, 167, 51), 443), // default (2) (Ipv4Addr::new(149, 154, 175, 53), 443), (Ipv4Addr::new(149, 154, 167, 51), 443), (Ipv4Addr::new(149, 154, 175, 100), 443), (Ipv4Addr::new(149, 154, 167, 92), 443), (Ipv4Addr::new(91, 108, 56, 190), 443), ]; pub(crate) async fn connect_sender( dc_id: i32, config: &mut Config, ) -> Result<Sender<transport::Full, mtp::Encrypted>, AuthorizationError> { let transport = transport::Full::new(); let addr = DC_ADDRESSES[dc_id as usize]; let mut sender = if let Some(auth_key) = config.session.auth_key.as_ref() { info!( "creating a new sender with existing auth key to dc {} {:?}", dc_id, addr ); sender::connect_with_auth(transport, addr, auth_key.clone()).await? } else { info!( "creating a new sender and auth key in dc {} {:?}", dc_id, addr ); let sender = sender::connect(transport, addr).await?; config.session.auth_key = Some(sender.auth_key().clone()); config.session.save()?; sender }; // TODO handle -404 (we had a previously-valid authkey, but server no longer knows about it) // TODO all up-to-date server addresses should be stored in the session for future initial connections let _remote_config = sender .invoke(&tl::functions::InvokeWithLayer { layer: tl::LAYER, query: tl::functions::InitConnection { api_id: config.api_id, device_model: config.params.device_model.clone(), system_version: config.params.system_version.clone(), app_version: config.params.app_version.clone(), system_lang_code: config.params.system_lang_code.clone(), lang_pack: "".into(), lang_code: config.params.lang_code.clone(), proxy: None, params: None, query: tl::functions::help::GetConfig {}, }, }) .await?; // TODO use the dc id from the config as "this dc", not the input dc id config.session.user_dc = Some(dc_id); config.session.save()?; Ok(sender) } /// Method implementations directly related with network connectivity. impl Client { /// Creates and returns a new client instance upon successful connection to Telegram. /// /// If the session in the configuration did not have an authorization key, a new one /// will be created and the session will be saved with it. /// /// The connection will be initialized with the data from the input configuration. /// /// # Examples /// /// ``` /// use grammers_client::{Client, Config}; /// use grammers_session::Session; /// /// // Note: these are example values and are not actually valid. /// // Obtain your own with the developer's phone at https://my.telegram.org. /// const API_ID: i32 = 932939; /// const API_HASH: &str = "514727c32270b9eb8cc16daf17e21e57"; /// /// # async fn f(mut client: Client) -> Result<(), Box<dyn std::error::Error>> { /// let client = Client::connect(Config { /// session: Session::load_or_create("hello-world.session")?, /// api_id: API_ID, /// api_hash: API_HASH.to_string(), /// params: Default::default(), /// }).await?; /// # Ok(()) /// # } /// ``` pub async fn connect(mut config: Config) -> Result<Self, AuthorizationError> { let sender = connect_sender(config.session.user_dc.unwrap_or(0), &mut config).await?; // TODO Sender doesn't have a way to handle backpressure yet let (handle_tx, handle_rx) = mpsc::unbounded_channel(); Ok(Self { sender, config, handle_tx, handle_rx, }) } /// Invoke a raw API call without the need to use a [`Client::handle`] or having to repeatedly /// call [`Client::step`]. This directly sends the request to Telegram's servers. /// /// Using function definitions corresponding to a different layer is likely to cause the /// responses to the request to not be understood. /// /// <div class="stab unstable"> /// /// **Warning**: this method is **not** part of the stability guarantees of semantic /// versioning. It **may** break during *minor* version changes (but not on patch version /// changes). Use with care. /// /// </div> /// /// # Examples /// /// ``` /// # async fn f(mut client: grammers_client::Client) -> Result<(), Box<dyn std::error::Error>> { /// use grammers_tl_types as tl; /// /// dbg!(client.invoke(&tl::functions::Ping { ping_id: 0 }).await?); /// # Ok(()) /// # } /// ``` pub async fn invoke<R: tl::RemoteCall>( &mut self, request: &R, ) -> Result<R::Return, InvocationError> { self.sender.invoke(request).await } /// Return a new [`ClientHandle`] that can be used to invoke remote procedure calls. /// /// # Examples /// /// ``` /// use tokio::task; /// /// # async fn f(mut client: grammers_client::Client) -> Result<(), Box<dyn std::error::Error>> { /// // Obtain a handle. After this you can obtain more by using `client_handle.clone()`. /// let mut client_handle = client.handle(); /// /// // Run the network loop. This is necessary, or no network events will be processed! /// let network_handle = task::spawn(async move { client.run_until_disconnected().await }); /// /// // Use the `client_handle` to your heart's content, maybe you just want to disconnect: /// client_handle.disconnect().await; /// /// // Joining on the spawned task lets us access the result from `run_until_disconnected`, /// // so we can verify everything went fine. You could also just drop this though. /// network_handle.await?; /// # Ok(()) /// # } /// pub fn handle(&self) -> ClientHandle { ClientHandle { tx: self.handle_tx.clone(), } } /// Perform a single network step or processing of incoming requests via handles. /// /// If a server message is received, requests enqueued via the [`ClientHandle`]s may have /// their result delivered via a channel, and a (possibly empty) list of updates will be /// returned. /// /// The other return values are graceful disconnection, or a read error. /// /// Most commonly, you will want to use the higher-level abstraction [`Client::next_updates`] /// instead. /// /// # Examples /// /// ``` /// # async fn f(mut client: grammers_client::Client) -> Result<(), Box<dyn std::error::Error>> { /// use grammers_client::NetworkStep; /// /// loop { /// // Process network events forever until we gracefully disconnect or get an error. /// match client.step().await? { /// NetworkStep::Connected {.. } => continue, /// NetworkStep::Disconnected => break, /// } /// } /// # Ok(()) /// # } /// ``` pub async fn step(&mut self) -> Result<Step, sender::ReadError> { let (network, request) = { let network = self.sender.step(); let request = self.handle_rx.recv(); pin_mut!(network); pin_mut!(request); match future::select(network, request).await { future::Either::Left((network, request)) => { let request = request.now_or_never(); (Some(network), request) } future::Either::Right((request, network)) => { let network = network.now_or_never(); (network, Some(request)) } } }; if let Some(request) = request { let request = request.expect("mpsc returned None"); match request { Request::Rpc { request, response } => { // Channel will return `Err` if the `ClientHandle` lost interest, just drop the error. drop(response.send(self.sender.enqueue_body(request))); } Request::Disconnect { response } => { // Channel will return `Err` if the `ClientHandle` lost interest, just drop the error. drop(response.send(())); return Ok(Step::Disconnected); } } } // TODO request cancellation if this is Err // (perhaps a method on the sender to cancel_all) Ok(Step::Connected { updates: if let Some(updates) = network { updates? } else { Vec::new() }, }) } /// Run the client by repeatedly calling [`Client::step`] until a graceful disconnection /// occurs, or a network error occurs. Incoming updates are ignored and simply dropped. /// instead. /// /// # Examples /// /// ``` /// # async fn f(mut client: grammers_client::Client) -> Result<(), Box<dyn std::error::Error>> { /// client.run_until_disconnected().await?; /// # Ok(()) /// # } /// ``` pub async fn run_until_disconnected(mut self) -> Result<(), sender::ReadError> { loop { match self.step().await? { Step::Connected {.. } => continue, Step::Disconnected => break Ok(()), } } } } /// Method implementations directly related with network connectivity. impl ClientHandle { /// Invoke a raw API call. /// /// Using function definitions corresponding to a different layer is likely to cause the /// responses to the request to not be understood. /// /// <div class="stab unstable"> /// /// **Warning**: this method is **not** part of the stability guarantees of semantic /// versioning. It **may** break during *minor* version changes (but not on patch version /// changes). Use with care. /// /// </div> /// /// # Examples /// /// ``` /// # async fn f(mut client: grammers_client::ClientHandle) -> Result<(), Box<dyn std::error::Error>> { /// use grammers_tl_types as tl; /// /// dbg!(client.invoke(&tl::functions::Ping { ping_id: 0 }).await?); /// # Ok(()) /// # } /// ``` pub async fn
<R: tl::RemoteCall>( &mut self, request: &R, ) -> Result<R::Return, InvocationError> { let (response, rx) = oneshot::channel(); // TODO add a test this (using handle with client dropped) if let Err(_) = self.tx.send(Request::Rpc { request: request.to_bytes(), response, }) { // `Client` was dropped, can no longer send requests return Err(InvocationError::Dropped); } // First receive the `oneshot::Receiver` with from the `Client`, // then `await` on that to receive the response body for the request. if let Ok(response) = rx.await { if let Ok(result) = response.await { match result { Ok(body) => R::Return::from_bytes(&body).map_err(|e| e.into()), Err(e) => Err(e), } } else { // `Sender` dropped, won't be receiving a response for this Err(InvocationError::Dropped) } } else { // `Client` dropped, won't be receiving a response for this Err(InvocationError::Dropped) } } /// Gracefully tell the [`Client`] that created this handle to disconnect and stop receiving /// things from the network. /// /// If the client has already been dropped (and thus disconnected), this method does nothing. /// /// # Examples /// /// ``` /// # async fn f(mut client: grammers_client::ClientHandle) { /// client.disconnect().await; /// # } /// ``` pub async fn disconnect(&mut self) { let (response, rx) = oneshot::channel(); if let Ok(_) = self.tx.send(Request::Disconnect { response }) { // It's fine to drop errors here, it means the channel was dropped by the `Client`. drop(rx.await); } else { // `Client` is already dropped, no need to disconnect again. } } }
invoke
identifier_name
net.rs
// Copyright 2020 - developers of the `grammers` project. // // Licensed under the Apache License, Version 2.0 <LICENSE-APACHE or // https://www.apache.org/licenses/LICENSE-2.0> or the MIT license // <LICENSE-MIT or https://opensource.org/licenses/MIT>, at your // option. This file may not be copied, modified, or distributed // except according to those terms. pub use super::updates::UpdateIter; use super::{Client, ClientHandle, Config, Request, Step}; use futures::future::FutureExt as _; use futures::{future, pin_mut}; use grammers_mtproto::{mtp, transport}; use grammers_mtsender::{self as sender, AuthorizationError, InvocationError, Sender}; use grammers_tl_types::{self as tl, Deserializable}; use log::info; use std::net::Ipv4Addr; use tokio::sync::{mpsc, oneshot}; /// Socket addresses to Telegram datacenters, where the index into this array /// represents the data center ID. /// /// The addresses were obtained from the `static` addresses through a call to /// `functions::help::GetConfig`. const DC_ADDRESSES: [(Ipv4Addr, u16); 6] = [ (Ipv4Addr::new(149, 154, 167, 51), 443), // default (2) (Ipv4Addr::new(149, 154, 175, 53), 443), (Ipv4Addr::new(149, 154, 167, 51), 443), (Ipv4Addr::new(149, 154, 175, 100), 443), (Ipv4Addr::new(149, 154, 167, 92), 443), (Ipv4Addr::new(91, 108, 56, 190), 443), ]; pub(crate) async fn connect_sender( dc_id: i32, config: &mut Config, ) -> Result<Sender<transport::Full, mtp::Encrypted>, AuthorizationError> { let transport = transport::Full::new(); let addr = DC_ADDRESSES[dc_id as usize]; let mut sender = if let Some(auth_key) = config.session.auth_key.as_ref() { info!( "creating a new sender with existing auth key to dc {} {:?}", dc_id, addr ); sender::connect_with_auth(transport, addr, auth_key.clone()).await? } else { info!( "creating a new sender and auth key in dc {} {:?}", dc_id, addr ); let sender = sender::connect(transport, addr).await?; config.session.auth_key = Some(sender.auth_key().clone()); config.session.save()?; sender }; // TODO handle -404 (we had a previously-valid authkey, but server no longer knows about it) // TODO all up-to-date server addresses should be stored in the session for future initial connections let _remote_config = sender .invoke(&tl::functions::InvokeWithLayer { layer: tl::LAYER, query: tl::functions::InitConnection { api_id: config.api_id, device_model: config.params.device_model.clone(), system_version: config.params.system_version.clone(), app_version: config.params.app_version.clone(), system_lang_code: config.params.system_lang_code.clone(), lang_pack: "".into(), lang_code: config.params.lang_code.clone(), proxy: None, params: None, query: tl::functions::help::GetConfig {}, }, }) .await?; // TODO use the dc id from the config as "this dc", not the input dc id config.session.user_dc = Some(dc_id); config.session.save()?; Ok(sender) } /// Method implementations directly related with network connectivity. impl Client { /// Creates and returns a new client instance upon successful connection to Telegram. /// /// If the session in the configuration did not have an authorization key, a new one /// will be created and the session will be saved with it. /// /// The connection will be initialized with the data from the input configuration. /// /// # Examples /// /// ``` /// use grammers_client::{Client, Config}; /// use grammers_session::Session; /// /// // Note: these are example values and are not actually valid. /// // Obtain your own with the developer's phone at https://my.telegram.org. /// const API_ID: i32 = 932939; /// const API_HASH: &str = "514727c32270b9eb8cc16daf17e21e57"; /// /// # async fn f(mut client: Client) -> Result<(), Box<dyn std::error::Error>> { /// let client = Client::connect(Config { /// session: Session::load_or_create("hello-world.session")?, /// api_id: API_ID, /// api_hash: API_HASH.to_string(), /// params: Default::default(), /// }).await?; /// # Ok(()) /// # } /// ``` pub async fn connect(mut config: Config) -> Result<Self, AuthorizationError> { let sender = connect_sender(config.session.user_dc.unwrap_or(0), &mut config).await?; // TODO Sender doesn't have a way to handle backpressure yet let (handle_tx, handle_rx) = mpsc::unbounded_channel(); Ok(Self { sender, config, handle_tx, handle_rx, }) } /// Invoke a raw API call without the need to use a [`Client::handle`] or having to repeatedly /// call [`Client::step`]. This directly sends the request to Telegram's servers. /// /// Using function definitions corresponding to a different layer is likely to cause the /// responses to the request to not be understood. /// /// <div class="stab unstable"> /// /// **Warning**: this method is **not** part of the stability guarantees of semantic /// versioning. It **may** break during *minor* version changes (but not on patch version /// changes). Use with care. /// /// </div> /// /// # Examples /// /// ``` /// # async fn f(mut client: grammers_client::Client) -> Result<(), Box<dyn std::error::Error>> { /// use grammers_tl_types as tl; /// /// dbg!(client.invoke(&tl::functions::Ping { ping_id: 0 }).await?); /// # Ok(()) /// # } /// ``` pub async fn invoke<R: tl::RemoteCall>( &mut self, request: &R, ) -> Result<R::Return, InvocationError> { self.sender.invoke(request).await } /// Return a new [`ClientHandle`] that can be used to invoke remote procedure calls. /// /// # Examples /// /// ``` /// use tokio::task; /// /// # async fn f(mut client: grammers_client::Client) -> Result<(), Box<dyn std::error::Error>> { /// // Obtain a handle. After this you can obtain more by using `client_handle.clone()`. /// let mut client_handle = client.handle(); /// /// // Run the network loop. This is necessary, or no network events will be processed! /// let network_handle = task::spawn(async move { client.run_until_disconnected().await }); /// /// // Use the `client_handle` to your heart's content, maybe you just want to disconnect: /// client_handle.disconnect().await; /// /// // Joining on the spawned task lets us access the result from `run_until_disconnected`, /// // so we can verify everything went fine. You could also just drop this though. /// network_handle.await?; /// # Ok(()) /// # } /// pub fn handle(&self) -> ClientHandle { ClientHandle { tx: self.handle_tx.clone(), } } /// Perform a single network step or processing of incoming requests via handles. /// /// If a server message is received, requests enqueued via the [`ClientHandle`]s may have /// their result delivered via a channel, and a (possibly empty) list of updates will be /// returned. /// /// The other return values are graceful disconnection, or a read error. /// /// Most commonly, you will want to use the higher-level abstraction [`Client::next_updates`] /// instead. /// /// # Examples /// /// ``` /// # async fn f(mut client: grammers_client::Client) -> Result<(), Box<dyn std::error::Error>> { /// use grammers_client::NetworkStep; /// /// loop { /// // Process network events forever until we gracefully disconnect or get an error. /// match client.step().await? { /// NetworkStep::Connected {.. } => continue, /// NetworkStep::Disconnected => break, /// } /// } /// # Ok(()) /// # } /// ``` pub async fn step(&mut self) -> Result<Step, sender::ReadError> { let (network, request) = { let network = self.sender.step(); let request = self.handle_rx.recv(); pin_mut!(network); pin_mut!(request); match future::select(network, request).await { future::Either::Left((network, request)) => { let request = request.now_or_never(); (Some(network), request) } future::Either::Right((request, network)) => { let network = network.now_or_never(); (network, Some(request)) } } }; if let Some(request) = request { let request = request.expect("mpsc returned None"); match request { Request::Rpc { request, response } => { // Channel will return `Err` if the `ClientHandle` lost interest, just drop the error. drop(response.send(self.sender.enqueue_body(request))); } Request::Disconnect { response } => { // Channel will return `Err` if the `ClientHandle` lost interest, just drop the error. drop(response.send(())); return Ok(Step::Disconnected); } } } // TODO request cancellation if this is Err // (perhaps a method on the sender to cancel_all) Ok(Step::Connected { updates: if let Some(updates) = network { updates? } else { Vec::new() }, }) } /// Run the client by repeatedly calling [`Client::step`] until a graceful disconnection /// occurs, or a network error occurs. Incoming updates are ignored and simply dropped. /// instead. /// /// # Examples /// /// ``` /// # async fn f(mut client: grammers_client::Client) -> Result<(), Box<dyn std::error::Error>> { /// client.run_until_disconnected().await?; /// # Ok(()) /// # } /// ``` pub async fn run_until_disconnected(mut self) -> Result<(), sender::ReadError> { loop { match self.step().await? { Step::Connected {.. } => continue, Step::Disconnected => break Ok(()), } } } } /// Method implementations directly related with network connectivity. impl ClientHandle { /// Invoke a raw API call. /// /// Using function definitions corresponding to a different layer is likely to cause the /// responses to the request to not be understood. /// /// <div class="stab unstable"> /// /// **Warning**: this method is **not** part of the stability guarantees of semantic /// versioning. It **may** break during *minor* version changes (but not on patch version /// changes). Use with care. /// /// </div> /// /// # Examples /// /// ``` /// # async fn f(mut client: grammers_client::ClientHandle) -> Result<(), Box<dyn std::error::Error>> { /// use grammers_tl_types as tl; /// /// dbg!(client.invoke(&tl::functions::Ping { ping_id: 0 }).await?); /// # Ok(()) /// # } /// ``` pub async fn invoke<R: tl::RemoteCall>( &mut self, request: &R, ) -> Result<R::Return, InvocationError> { let (response, rx) = oneshot::channel(); // TODO add a test this (using handle with client dropped) if let Err(_) = self.tx.send(Request::Rpc { request: request.to_bytes(), response, }) { // `Client` was dropped, can no longer send requests return Err(InvocationError::Dropped); } // First receive the `oneshot::Receiver` with from the `Client`, // then `await` on that to receive the response body for the request. if let Ok(response) = rx.await { if let Ok(result) = response.await { match result { Ok(body) => R::Return::from_bytes(&body).map_err(|e| e.into()), Err(e) => Err(e), } } else { // `Sender` dropped, won't be receiving a response for this Err(InvocationError::Dropped) } } else { // `Client` dropped, won't be receiving a response for this Err(InvocationError::Dropped) } } /// Gracefully tell the [`Client`] that created this handle to disconnect and stop receiving /// things from the network. /// /// If the client has already been dropped (and thus disconnected), this method does nothing. /// /// # Examples /// /// ``` /// # async fn f(mut client: grammers_client::ClientHandle) { /// client.disconnect().await; /// # } /// ``` pub async fn disconnect(&mut self) { let (response, rx) = oneshot::channel(); if let Ok(_) = self.tx.send(Request::Disconnect { response }) { // It's fine to drop errors here, it means the channel was dropped by the `Client`. drop(rx.await); } else { // `Client` is already dropped, no need to disconnect again.
} }
}
random_line_split
net.rs
// Copyright 2020 - developers of the `grammers` project. // // Licensed under the Apache License, Version 2.0 <LICENSE-APACHE or // https://www.apache.org/licenses/LICENSE-2.0> or the MIT license // <LICENSE-MIT or https://opensource.org/licenses/MIT>, at your // option. This file may not be copied, modified, or distributed // except according to those terms. pub use super::updates::UpdateIter; use super::{Client, ClientHandle, Config, Request, Step}; use futures::future::FutureExt as _; use futures::{future, pin_mut}; use grammers_mtproto::{mtp, transport}; use grammers_mtsender::{self as sender, AuthorizationError, InvocationError, Sender}; use grammers_tl_types::{self as tl, Deserializable}; use log::info; use std::net::Ipv4Addr; use tokio::sync::{mpsc, oneshot}; /// Socket addresses to Telegram datacenters, where the index into this array /// represents the data center ID. /// /// The addresses were obtained from the `static` addresses through a call to /// `functions::help::GetConfig`. const DC_ADDRESSES: [(Ipv4Addr, u16); 6] = [ (Ipv4Addr::new(149, 154, 167, 51), 443), // default (2) (Ipv4Addr::new(149, 154, 175, 53), 443), (Ipv4Addr::new(149, 154, 167, 51), 443), (Ipv4Addr::new(149, 154, 175, 100), 443), (Ipv4Addr::new(149, 154, 167, 92), 443), (Ipv4Addr::new(91, 108, 56, 190), 443), ]; pub(crate) async fn connect_sender( dc_id: i32, config: &mut Config, ) -> Result<Sender<transport::Full, mtp::Encrypted>, AuthorizationError>
sender }; // TODO handle -404 (we had a previously-valid authkey, but server no longer knows about it) // TODO all up-to-date server addresses should be stored in the session for future initial connections let _remote_config = sender .invoke(&tl::functions::InvokeWithLayer { layer: tl::LAYER, query: tl::functions::InitConnection { api_id: config.api_id, device_model: config.params.device_model.clone(), system_version: config.params.system_version.clone(), app_version: config.params.app_version.clone(), system_lang_code: config.params.system_lang_code.clone(), lang_pack: "".into(), lang_code: config.params.lang_code.clone(), proxy: None, params: None, query: tl::functions::help::GetConfig {}, }, }) .await?; // TODO use the dc id from the config as "this dc", not the input dc id config.session.user_dc = Some(dc_id); config.session.save()?; Ok(sender) } /// Method implementations directly related with network connectivity. impl Client { /// Creates and returns a new client instance upon successful connection to Telegram. /// /// If the session in the configuration did not have an authorization key, a new one /// will be created and the session will be saved with it. /// /// The connection will be initialized with the data from the input configuration. /// /// # Examples /// /// ``` /// use grammers_client::{Client, Config}; /// use grammers_session::Session; /// /// // Note: these are example values and are not actually valid. /// // Obtain your own with the developer's phone at https://my.telegram.org. /// const API_ID: i32 = 932939; /// const API_HASH: &str = "514727c32270b9eb8cc16daf17e21e57"; /// /// # async fn f(mut client: Client) -> Result<(), Box<dyn std::error::Error>> { /// let client = Client::connect(Config { /// session: Session::load_or_create("hello-world.session")?, /// api_id: API_ID, /// api_hash: API_HASH.to_string(), /// params: Default::default(), /// }).await?; /// # Ok(()) /// # } /// ``` pub async fn connect(mut config: Config) -> Result<Self, AuthorizationError> { let sender = connect_sender(config.session.user_dc.unwrap_or(0), &mut config).await?; // TODO Sender doesn't have a way to handle backpressure yet let (handle_tx, handle_rx) = mpsc::unbounded_channel(); Ok(Self { sender, config, handle_tx, handle_rx, }) } /// Invoke a raw API call without the need to use a [`Client::handle`] or having to repeatedly /// call [`Client::step`]. This directly sends the request to Telegram's servers. /// /// Using function definitions corresponding to a different layer is likely to cause the /// responses to the request to not be understood. /// /// <div class="stab unstable"> /// /// **Warning**: this method is **not** part of the stability guarantees of semantic /// versioning. It **may** break during *minor* version changes (but not on patch version /// changes). Use with care. /// /// </div> /// /// # Examples /// /// ``` /// # async fn f(mut client: grammers_client::Client) -> Result<(), Box<dyn std::error::Error>> { /// use grammers_tl_types as tl; /// /// dbg!(client.invoke(&tl::functions::Ping { ping_id: 0 }).await?); /// # Ok(()) /// # } /// ``` pub async fn invoke<R: tl::RemoteCall>( &mut self, request: &R, ) -> Result<R::Return, InvocationError> { self.sender.invoke(request).await } /// Return a new [`ClientHandle`] that can be used to invoke remote procedure calls. /// /// # Examples /// /// ``` /// use tokio::task; /// /// # async fn f(mut client: grammers_client::Client) -> Result<(), Box<dyn std::error::Error>> { /// // Obtain a handle. After this you can obtain more by using `client_handle.clone()`. /// let mut client_handle = client.handle(); /// /// // Run the network loop. This is necessary, or no network events will be processed! /// let network_handle = task::spawn(async move { client.run_until_disconnected().await }); /// /// // Use the `client_handle` to your heart's content, maybe you just want to disconnect: /// client_handle.disconnect().await; /// /// // Joining on the spawned task lets us access the result from `run_until_disconnected`, /// // so we can verify everything went fine. You could also just drop this though. /// network_handle.await?; /// # Ok(()) /// # } /// pub fn handle(&self) -> ClientHandle { ClientHandle { tx: self.handle_tx.clone(), } } /// Perform a single network step or processing of incoming requests via handles. /// /// If a server message is received, requests enqueued via the [`ClientHandle`]s may have /// their result delivered via a channel, and a (possibly empty) list of updates will be /// returned. /// /// The other return values are graceful disconnection, or a read error. /// /// Most commonly, you will want to use the higher-level abstraction [`Client::next_updates`] /// instead. /// /// # Examples /// /// ``` /// # async fn f(mut client: grammers_client::Client) -> Result<(), Box<dyn std::error::Error>> { /// use grammers_client::NetworkStep; /// /// loop { /// // Process network events forever until we gracefully disconnect or get an error. /// match client.step().await? { /// NetworkStep::Connected {.. } => continue, /// NetworkStep::Disconnected => break, /// } /// } /// # Ok(()) /// # } /// ``` pub async fn step(&mut self) -> Result<Step, sender::ReadError> { let (network, request) = { let network = self.sender.step(); let request = self.handle_rx.recv(); pin_mut!(network); pin_mut!(request); match future::select(network, request).await { future::Either::Left((network, request)) => { let request = request.now_or_never(); (Some(network), request) } future::Either::Right((request, network)) => { let network = network.now_or_never(); (network, Some(request)) } } }; if let Some(request) = request { let request = request.expect("mpsc returned None"); match request { Request::Rpc { request, response } => { // Channel will return `Err` if the `ClientHandle` lost interest, just drop the error. drop(response.send(self.sender.enqueue_body(request))); } Request::Disconnect { response } => { // Channel will return `Err` if the `ClientHandle` lost interest, just drop the error. drop(response.send(())); return Ok(Step::Disconnected); } } } // TODO request cancellation if this is Err // (perhaps a method on the sender to cancel_all) Ok(Step::Connected { updates: if let Some(updates) = network { updates? } else { Vec::new() }, }) } /// Run the client by repeatedly calling [`Client::step`] until a graceful disconnection /// occurs, or a network error occurs. Incoming updates are ignored and simply dropped. /// instead. /// /// # Examples /// /// ``` /// # async fn f(mut client: grammers_client::Client) -> Result<(), Box<dyn std::error::Error>> { /// client.run_until_disconnected().await?; /// # Ok(()) /// # } /// ``` pub async fn run_until_disconnected(mut self) -> Result<(), sender::ReadError> { loop { match self.step().await? { Step::Connected {.. } => continue, Step::Disconnected => break Ok(()), } } } } /// Method implementations directly related with network connectivity. impl ClientHandle { /// Invoke a raw API call. /// /// Using function definitions corresponding to a different layer is likely to cause the /// responses to the request to not be understood. /// /// <div class="stab unstable"> /// /// **Warning**: this method is **not** part of the stability guarantees of semantic /// versioning. It **may** break during *minor* version changes (but not on patch version /// changes). Use with care. /// /// </div> /// /// # Examples /// /// ``` /// # async fn f(mut client: grammers_client::ClientHandle) -> Result<(), Box<dyn std::error::Error>> { /// use grammers_tl_types as tl; /// /// dbg!(client.invoke(&tl::functions::Ping { ping_id: 0 }).await?); /// # Ok(()) /// # } /// ``` pub async fn invoke<R: tl::RemoteCall>( &mut self, request: &R, ) -> Result<R::Return, InvocationError> { let (response, rx) = oneshot::channel(); // TODO add a test this (using handle with client dropped) if let Err(_) = self.tx.send(Request::Rpc { request: request.to_bytes(), response, }) { // `Client` was dropped, can no longer send requests return Err(InvocationError::Dropped); } // First receive the `oneshot::Receiver` with from the `Client`, // then `await` on that to receive the response body for the request. if let Ok(response) = rx.await { if let Ok(result) = response.await { match result { Ok(body) => R::Return::from_bytes(&body).map_err(|e| e.into()), Err(e) => Err(e), } } else { // `Sender` dropped, won't be receiving a response for this Err(InvocationError::Dropped) } } else { // `Client` dropped, won't be receiving a response for this Err(InvocationError::Dropped) } } /// Gracefully tell the [`Client`] that created this handle to disconnect and stop receiving /// things from the network. /// /// If the client has already been dropped (and thus disconnected), this method does nothing. /// /// # Examples /// /// ``` /// # async fn f(mut client: grammers_client::ClientHandle) { /// client.disconnect().await; /// # } /// ``` pub async fn disconnect(&mut self) { let (response, rx) = oneshot::channel(); if let Ok(_) = self.tx.send(Request::Disconnect { response }) { // It's fine to drop errors here, it means the channel was dropped by the `Client`. drop(rx.await); } else { // `Client` is already dropped, no need to disconnect again. } } }
{ let transport = transport::Full::new(); let addr = DC_ADDRESSES[dc_id as usize]; let mut sender = if let Some(auth_key) = config.session.auth_key.as_ref() { info!( "creating a new sender with existing auth key to dc {} {:?}", dc_id, addr ); sender::connect_with_auth(transport, addr, auth_key.clone()).await? } else { info!( "creating a new sender and auth key in dc {} {:?}", dc_id, addr ); let sender = sender::connect(transport, addr).await?; config.session.auth_key = Some(sender.auth_key().clone()); config.session.save()?;
identifier_body
main.rs
use crate::{ config::{save_config, Config}, repo::Repo, }; use anyhow::{anyhow, bail, Context, Result}; use clap::{AppSettings, Clap}; use lazy_static::lazy_static; use regex::Regex; use std::env; use std::io::{self, Read}; use url::Url; mod config; mod git; mod github; mod gitlab; mod repo; lazy_static! { static ref API_SOURCE_REGEX: Regex = Regex::new(r"(?P<alias>^\w+)(@(?P<ref>\w+))?:(?P<script>.+)$").unwrap(); static ref GIT_SOURCE_REGEX: Regex = Regex::new(r"^(?P<repo>((git|ssh|http(s)?)|(git@[\w\.]+))(:(//)?)([\w\./\-~]+)(\.git)?(/)?)(@(?P<ref>\w+))?:(?P<script>.+)$") .unwrap(); } #[derive(Clap, Debug)] #[clap(author, about, version)] #[clap(global_setting = AppSettings::ColoredHelp)] #[clap(setting = AppSettings::DeriveDisplayOrder)] #[clap(setting = AppSettings::SubcommandRequiredElseHelp)] struct Opts { #[clap(subcommand)] command: Command, } const SCRIPT_HELP: &'static str = r"Script identifier for a script from a repository For saved repos: `<repo>[@ref]:<script_path>` Example: `myscripts:hello.bash` Example (w/ ref): `myscripts@v1.0:hello.bash` For git repos: `git@<repo_url>[@ref]:<script_path>` Example: `git@github.com:user/myscripts:hello.bash` Example (w/ ref): `git@github.com:user/myscripts@main:hello.bash` "; #[derive(Clap, Debug)] enum Command { /// Read and modify locally saved repositories Repo { #[clap(subcommand)] command: RepoCommand, }, /// Run a script using the locally installed bash shell Run { /// Force a fresh download of the script (only for raw git repositories) #[clap(short, long)] fresh: bool, #[clap(about = "Script to run", long_about = SCRIPT_HELP)] script: String, /// Args to be passed to the script #[clap(about = "Args to be passed to the script")] args: Vec<String>, }, /// Import a script and print it to stdout Import { #[clap(short, long)] fresh: bool, #[clap(about = "Script to import", long_about = SCRIPT_HELP)] script: String, }, } #[derive(Clap, Debug)] enum RepoCommand { /// List all locally saved repositories #[clap(alias = "ls")] List, /// Add a repository to the local repository list Add { /// Local alias for the repository to add name: String, /// URI of the repository to add uri: String, /// Username for the repository (if required) #[clap(long, short)] username: Option<String>, /// Password or token for the repository (if required) #[clap(long, short)] password: Option<String>, /// Reads the password from the given environment variable when the repo is used #[clap(long)] password_env: Option<String>, /// Reads the password or token from stdin #[clap(long)] password_stdin: bool, }, /// Remove a repository from the local repository list #[clap(alias = "rm")] Remove { /// Local alias for the repository to remove name: String, }, } #[derive(PartialEq)] pub enum Password { Saved(String), FromEnv(String, String), None, } #[tokio::main] async fn main() -> Result<()> { openssl_probe::init_ssl_cert_env_vars(); let mut config = config::load_config().await?; match Opts::parse().command { Command::Repo { command } => match command { RepoCommand::List => { if config.repo.is_empty() { println!("No Saved repositories."); return Ok(()); } println!("Saved repositories:"); for (k, v) in config.repo { println!(" {} ({} | {})", k, v.provider(), v.readable()); } } RepoCommand::Add { name, uri, username, password, password_env, password_stdin, } => { if config.repo.contains_key(&name) { bail!("A repository with the name `{}` already exists", &name); } let password_for_parse = match (password, password_env, password_stdin) { (Some(pass), _, _) => Password::Saved(pass), (_, Some(var), _) => Password::FromEnv(var.clone(), env::var(var)?), (_, _, true) => { let mut buf = String::new(); io::stdin().read_to_string(&mut buf)?; Password::Saved(buf) } _ => Password::None, }; let repo = validate_api_repo(&uri, username, password_for_parse).await?; config.repo.insert(name.clone(), repo); save_config(&config) .await .context("Failed to save updated config")?; println!("Repo `{}` was successfully added", &name); } RepoCommand::Remove { name } => { if!config.repo.contains_key(&name) { bail!("Repo `{}` was not found", &name); } config.repo.remove(&name); save_config(&config) .await .context("Failed to save updated config")?; println!("Repo `{}` was removed", &name); } }, Command::Run { script, args, fresh, } => { let src = ScriptSource::parse(&script, ScriptAction::Run)?; src.validate_script_name(&config)?; let contents = src.fetch_script_contents(&config, fresh).await?; let args = args.iter().map(|s| &**s).collect(); // TODO(happens): Find a way to propagate the actual exit code // instead of simply returning 0/1 depending on the script. // This should cover most use cases if you just want to know // if the script failed, but until `std::process::Termination` // is stabilized, it seems unsafe to use `std::process::exit` // since we're using a tokio main. let exit = repo::run_script(&contents, args).await?; if!exit.success() { bail!(""); } } Command::Import { script, fresh } => { let src = ScriptSource::parse(&script, ScriptAction::Import)?; src.validate_script_name(&config)?; let contents = src.fetch_script_contents(&config, fresh).await?; repo::import_script(&contents).await?; } }; Ok(()) } enum ScriptAction { Run, Import, } pub struct ScriptSource { repo: String, source_type: SourceType, script_name: String, rref: Option<String>, action: ScriptAction, } enum
{ Git, Saved, } impl ScriptSource { fn parse(script: &str, action: ScriptAction) -> Result<ScriptSource> { if let Some(matches) = API_SOURCE_REGEX.captures(script) { let repo = matches .name("alias") .expect("No alias matched") .as_str() .to_owned(); let script_name = matches .name("script") .expect("No script name matched") .as_str() .to_owned(); let rref = matches.name("ref").map(|rref| rref.as_str().to_owned()); return Ok(Self { source_type: SourceType::Saved, repo, script_name, rref, action, }); } if let Some(matches) = GIT_SOURCE_REGEX.captures(script) { let repo = matches .name("repo") .expect("No repo matched") .as_str() .to_owned(); let script_name = matches .name("script") .expect("No script name matched") .as_str() .to_owned(); let rref = matches.name("ref").map(|rref| rref.as_str().to_owned()); return Ok(Self { source_type: SourceType::Git, repo, script_name, rref, action, }); } bail!("Script source could not be parsed") } fn validate_script_name(&self, config: &Config) -> Result<()> { if config.require_bash_extension.is_none() && config.require_lib_extension.is_none() { return Ok(()); } let expected = match ( &config.require_bash_extension, &config.require_lib_extension, &self.action, ) { (Some(ref ext), _, &ScriptAction::Run) => ext, (_, Some(ext), &ScriptAction::Import) => ext, _ => unreachable!(), }; if!self.script_name.ends_with(expected) { bail!("Expected script name to end with `{}`", expected); } Ok(()) } async fn fetch_script_contents(&self, config: &config::Config, fresh: bool) -> Result<String> { let repo = match self.source_type { SourceType::Saved => config .repo .get(&self.repo) .ok_or(anyhow!("Repo `{}` was not found", &self.repo))? .box_clone(), SourceType::Git => git::GitRepo::from_src(&self), }; let rref = self.rref.clone().unwrap_or("HEAD".to_owned()); Ok(repo.fetch_script(&self.script_name, &rref, fresh).await?) } } async fn validate_api_repo( uri: &str, username: Option<String>, password: Password, ) -> Result<Box<dyn Repo>> { let mut maybe_parsed: Option<Url> = None; // Check if we've been given a raw gitlab or github url without scheme if uri.starts_with("gitlab.com") || uri.starts_with("github.com") { let with_scheme = format!("https://{}", uri); maybe_parsed = Some(Url::parse(&with_scheme)?); } // Try parsing the url manually otherwise let mut parsed = match maybe_parsed { Some(parsed) => parsed, None => Url::parse(uri)?, }; if parsed.cannot_be_a_base() { bail!("Repo URI was not recognized"); } // Enforce https let _ = parsed.set_scheme("https"); match parsed.host_str() { Some("gitlab.com") => Ok(gitlab::fetch_project(&parsed, password).await?), Some("github.com") => Ok(github::fetch_project(&parsed, username, password).await?), Some(_) => bail!("No provider recognized for passed URI"), None => bail!("No host on passed URI"), } }
SourceType
identifier_name
main.rs
use crate::{ config::{save_config, Config}, repo::Repo, }; use anyhow::{anyhow, bail, Context, Result}; use clap::{AppSettings, Clap}; use lazy_static::lazy_static; use regex::Regex; use std::env; use std::io::{self, Read}; use url::Url; mod config; mod git; mod github; mod gitlab; mod repo; lazy_static! { static ref API_SOURCE_REGEX: Regex = Regex::new(r"(?P<alias>^\w+)(@(?P<ref>\w+))?:(?P<script>.+)$").unwrap(); static ref GIT_SOURCE_REGEX: Regex = Regex::new(r"^(?P<repo>((git|ssh|http(s)?)|(git@[\w\.]+))(:(//)?)([\w\./\-~]+)(\.git)?(/)?)(@(?P<ref>\w+))?:(?P<script>.+)$") .unwrap(); } #[derive(Clap, Debug)] #[clap(author, about, version)] #[clap(global_setting = AppSettings::ColoredHelp)] #[clap(setting = AppSettings::DeriveDisplayOrder)] #[clap(setting = AppSettings::SubcommandRequiredElseHelp)] struct Opts { #[clap(subcommand)] command: Command, } const SCRIPT_HELP: &'static str = r"Script identifier for a script from a repository For saved repos: `<repo>[@ref]:<script_path>` Example: `myscripts:hello.bash` Example (w/ ref): `myscripts@v1.0:hello.bash` For git repos: `git@<repo_url>[@ref]:<script_path>` Example: `git@github.com:user/myscripts:hello.bash` Example (w/ ref): `git@github.com:user/myscripts@main:hello.bash` "; #[derive(Clap, Debug)] enum Command { /// Read and modify locally saved repositories Repo { #[clap(subcommand)] command: RepoCommand, }, /// Run a script using the locally installed bash shell Run { /// Force a fresh download of the script (only for raw git repositories) #[clap(short, long)] fresh: bool, #[clap(about = "Script to run", long_about = SCRIPT_HELP)] script: String, /// Args to be passed to the script #[clap(about = "Args to be passed to the script")] args: Vec<String>, }, /// Import a script and print it to stdout Import { #[clap(short, long)] fresh: bool, #[clap(about = "Script to import", long_about = SCRIPT_HELP)] script: String, }, } #[derive(Clap, Debug)] enum RepoCommand { /// List all locally saved repositories #[clap(alias = "ls")] List, /// Add a repository to the local repository list Add { /// Local alias for the repository to add name: String, /// URI of the repository to add uri: String, /// Username for the repository (if required) #[clap(long, short)] username: Option<String>, /// Password or token for the repository (if required) #[clap(long, short)] password: Option<String>, /// Reads the password from the given environment variable when the repo is used #[clap(long)] password_env: Option<String>, /// Reads the password or token from stdin #[clap(long)] password_stdin: bool, }, /// Remove a repository from the local repository list #[clap(alias = "rm")] Remove { /// Local alias for the repository to remove name: String, }, } #[derive(PartialEq)] pub enum Password { Saved(String), FromEnv(String, String), None, } #[tokio::main] async fn main() -> Result<()> { openssl_probe::init_ssl_cert_env_vars(); let mut config = config::load_config().await?; match Opts::parse().command { Command::Repo { command } => match command { RepoCommand::List => { if config.repo.is_empty() { println!("No Saved repositories."); return Ok(()); } println!("Saved repositories:"); for (k, v) in config.repo { println!(" {} ({} | {})", k, v.provider(), v.readable()); } } RepoCommand::Add { name, uri, username, password, password_env, password_stdin, } => { if config.repo.contains_key(&name) { bail!("A repository with the name `{}` already exists", &name); } let password_for_parse = match (password, password_env, password_stdin) { (Some(pass), _, _) => Password::Saved(pass), (_, Some(var), _) => Password::FromEnv(var.clone(), env::var(var)?), (_, _, true) => { let mut buf = String::new(); io::stdin().read_to_string(&mut buf)?; Password::Saved(buf) } _ => Password::None, }; let repo = validate_api_repo(&uri, username, password_for_parse).await?; config.repo.insert(name.clone(), repo); save_config(&config) .await .context("Failed to save updated config")?; println!("Repo `{}` was successfully added", &name); } RepoCommand::Remove { name } => { if!config.repo.contains_key(&name) { bail!("Repo `{}` was not found", &name); } config.repo.remove(&name); save_config(&config) .await .context("Failed to save updated config")?; println!("Repo `{}` was removed", &name); } }, Command::Run { script, args, fresh, } => { let src = ScriptSource::parse(&script, ScriptAction::Run)?; src.validate_script_name(&config)?; let contents = src.fetch_script_contents(&config, fresh).await?; let args = args.iter().map(|s| &**s).collect(); // TODO(happens): Find a way to propagate the actual exit code // instead of simply returning 0/1 depending on the script. // This should cover most use cases if you just want to know // if the script failed, but until `std::process::Termination` // is stabilized, it seems unsafe to use `std::process::exit` // since we're using a tokio main. let exit = repo::run_script(&contents, args).await?; if!exit.success() { bail!(""); } } Command::Import { script, fresh } => { let src = ScriptSource::parse(&script, ScriptAction::Import)?; src.validate_script_name(&config)?; let contents = src.fetch_script_contents(&config, fresh).await?; repo::import_script(&contents).await?; } }; Ok(()) } enum ScriptAction { Run, Import, } pub struct ScriptSource { repo: String, source_type: SourceType, script_name: String, rref: Option<String>, action: ScriptAction, } enum SourceType { Git, Saved, } impl ScriptSource { fn parse(script: &str, action: ScriptAction) -> Result<ScriptSource> { if let Some(matches) = API_SOURCE_REGEX.captures(script) { let repo = matches .name("alias") .expect("No alias matched") .as_str() .to_owned(); let script_name = matches .name("script") .expect("No script name matched") .as_str() .to_owned(); let rref = matches.name("ref").map(|rref| rref.as_str().to_owned()); return Ok(Self { source_type: SourceType::Saved, repo, script_name, rref, action, }); } if let Some(matches) = GIT_SOURCE_REGEX.captures(script) { let repo = matches .name("repo") .expect("No repo matched") .as_str() .to_owned(); let script_name = matches .name("script") .expect("No script name matched") .as_str() .to_owned(); let rref = matches.name("ref").map(|rref| rref.as_str().to_owned()); return Ok(Self { source_type: SourceType::Git, repo, script_name, rref, action, }); } bail!("Script source could not be parsed") } fn validate_script_name(&self, config: &Config) -> Result<()> { if config.require_bash_extension.is_none() && config.require_lib_extension.is_none() { return Ok(()); } let expected = match ( &config.require_bash_extension, &config.require_lib_extension, &self.action, ) { (Some(ref ext), _, &ScriptAction::Run) => ext, (_, Some(ext), &ScriptAction::Import) => ext, _ => unreachable!(), }; if!self.script_name.ends_with(expected) { bail!("Expected script name to end with `{}`", expected); } Ok(()) } async fn fetch_script_contents(&self, config: &config::Config, fresh: bool) -> Result<String> { let repo = match self.source_type { SourceType::Saved => config .repo
SourceType::Git => git::GitRepo::from_src(&self), }; let rref = self.rref.clone().unwrap_or("HEAD".to_owned()); Ok(repo.fetch_script(&self.script_name, &rref, fresh).await?) } } async fn validate_api_repo( uri: &str, username: Option<String>, password: Password, ) -> Result<Box<dyn Repo>> { let mut maybe_parsed: Option<Url> = None; // Check if we've been given a raw gitlab or github url without scheme if uri.starts_with("gitlab.com") || uri.starts_with("github.com") { let with_scheme = format!("https://{}", uri); maybe_parsed = Some(Url::parse(&with_scheme)?); } // Try parsing the url manually otherwise let mut parsed = match maybe_parsed { Some(parsed) => parsed, None => Url::parse(uri)?, }; if parsed.cannot_be_a_base() { bail!("Repo URI was not recognized"); } // Enforce https let _ = parsed.set_scheme("https"); match parsed.host_str() { Some("gitlab.com") => Ok(gitlab::fetch_project(&parsed, password).await?), Some("github.com") => Ok(github::fetch_project(&parsed, username, password).await?), Some(_) => bail!("No provider recognized for passed URI"), None => bail!("No host on passed URI"), } }
.get(&self.repo) .ok_or(anyhow!("Repo `{}` was not found", &self.repo))? .box_clone(),
random_line_split
main.rs
use crate::{ config::{save_config, Config}, repo::Repo, }; use anyhow::{anyhow, bail, Context, Result}; use clap::{AppSettings, Clap}; use lazy_static::lazy_static; use regex::Regex; use std::env; use std::io::{self, Read}; use url::Url; mod config; mod git; mod github; mod gitlab; mod repo; lazy_static! { static ref API_SOURCE_REGEX: Regex = Regex::new(r"(?P<alias>^\w+)(@(?P<ref>\w+))?:(?P<script>.+)$").unwrap(); static ref GIT_SOURCE_REGEX: Regex = Regex::new(r"^(?P<repo>((git|ssh|http(s)?)|(git@[\w\.]+))(:(//)?)([\w\./\-~]+)(\.git)?(/)?)(@(?P<ref>\w+))?:(?P<script>.+)$") .unwrap(); } #[derive(Clap, Debug)] #[clap(author, about, version)] #[clap(global_setting = AppSettings::ColoredHelp)] #[clap(setting = AppSettings::DeriveDisplayOrder)] #[clap(setting = AppSettings::SubcommandRequiredElseHelp)] struct Opts { #[clap(subcommand)] command: Command, } const SCRIPT_HELP: &'static str = r"Script identifier for a script from a repository For saved repos: `<repo>[@ref]:<script_path>` Example: `myscripts:hello.bash` Example (w/ ref): `myscripts@v1.0:hello.bash` For git repos: `git@<repo_url>[@ref]:<script_path>` Example: `git@github.com:user/myscripts:hello.bash` Example (w/ ref): `git@github.com:user/myscripts@main:hello.bash` "; #[derive(Clap, Debug)] enum Command { /// Read and modify locally saved repositories Repo { #[clap(subcommand)] command: RepoCommand, }, /// Run a script using the locally installed bash shell Run { /// Force a fresh download of the script (only for raw git repositories) #[clap(short, long)] fresh: bool, #[clap(about = "Script to run", long_about = SCRIPT_HELP)] script: String, /// Args to be passed to the script #[clap(about = "Args to be passed to the script")] args: Vec<String>, }, /// Import a script and print it to stdout Import { #[clap(short, long)] fresh: bool, #[clap(about = "Script to import", long_about = SCRIPT_HELP)] script: String, }, } #[derive(Clap, Debug)] enum RepoCommand { /// List all locally saved repositories #[clap(alias = "ls")] List, /// Add a repository to the local repository list Add { /// Local alias for the repository to add name: String, /// URI of the repository to add uri: String, /// Username for the repository (if required) #[clap(long, short)] username: Option<String>, /// Password or token for the repository (if required) #[clap(long, short)] password: Option<String>, /// Reads the password from the given environment variable when the repo is used #[clap(long)] password_env: Option<String>, /// Reads the password or token from stdin #[clap(long)] password_stdin: bool, }, /// Remove a repository from the local repository list #[clap(alias = "rm")] Remove { /// Local alias for the repository to remove name: String, }, } #[derive(PartialEq)] pub enum Password { Saved(String), FromEnv(String, String), None, } #[tokio::main] async fn main() -> Result<()> { openssl_probe::init_ssl_cert_env_vars(); let mut config = config::load_config().await?; match Opts::parse().command { Command::Repo { command } => match command { RepoCommand::List => { if config.repo.is_empty() { println!("No Saved repositories."); return Ok(()); } println!("Saved repositories:"); for (k, v) in config.repo { println!(" {} ({} | {})", k, v.provider(), v.readable()); } } RepoCommand::Add { name, uri, username, password, password_env, password_stdin, } =>
.context("Failed to save updated config")?; println!("Repo `{}` was successfully added", &name); } RepoCommand::Remove { name } => { if!config.repo.contains_key(&name) { bail!("Repo `{}` was not found", &name); } config.repo.remove(&name); save_config(&config) .await .context("Failed to save updated config")?; println!("Repo `{}` was removed", &name); } }, Command::Run { script, args, fresh, } => { let src = ScriptSource::parse(&script, ScriptAction::Run)?; src.validate_script_name(&config)?; let contents = src.fetch_script_contents(&config, fresh).await?; let args = args.iter().map(|s| &**s).collect(); // TODO(happens): Find a way to propagate the actual exit code // instead of simply returning 0/1 depending on the script. // This should cover most use cases if you just want to know // if the script failed, but until `std::process::Termination` // is stabilized, it seems unsafe to use `std::process::exit` // since we're using a tokio main. let exit = repo::run_script(&contents, args).await?; if!exit.success() { bail!(""); } } Command::Import { script, fresh } => { let src = ScriptSource::parse(&script, ScriptAction::Import)?; src.validate_script_name(&config)?; let contents = src.fetch_script_contents(&config, fresh).await?; repo::import_script(&contents).await?; } }; Ok(()) } enum ScriptAction { Run, Import, } pub struct ScriptSource { repo: String, source_type: SourceType, script_name: String, rref: Option<String>, action: ScriptAction, } enum SourceType { Git, Saved, } impl ScriptSource { fn parse(script: &str, action: ScriptAction) -> Result<ScriptSource> { if let Some(matches) = API_SOURCE_REGEX.captures(script) { let repo = matches .name("alias") .expect("No alias matched") .as_str() .to_owned(); let script_name = matches .name("script") .expect("No script name matched") .as_str() .to_owned(); let rref = matches.name("ref").map(|rref| rref.as_str().to_owned()); return Ok(Self { source_type: SourceType::Saved, repo, script_name, rref, action, }); } if let Some(matches) = GIT_SOURCE_REGEX.captures(script) { let repo = matches .name("repo") .expect("No repo matched") .as_str() .to_owned(); let script_name = matches .name("script") .expect("No script name matched") .as_str() .to_owned(); let rref = matches.name("ref").map(|rref| rref.as_str().to_owned()); return Ok(Self { source_type: SourceType::Git, repo, script_name, rref, action, }); } bail!("Script source could not be parsed") } fn validate_script_name(&self, config: &Config) -> Result<()> { if config.require_bash_extension.is_none() && config.require_lib_extension.is_none() { return Ok(()); } let expected = match ( &config.require_bash_extension, &config.require_lib_extension, &self.action, ) { (Some(ref ext), _, &ScriptAction::Run) => ext, (_, Some(ext), &ScriptAction::Import) => ext, _ => unreachable!(), }; if!self.script_name.ends_with(expected) { bail!("Expected script name to end with `{}`", expected); } Ok(()) } async fn fetch_script_contents(&self, config: &config::Config, fresh: bool) -> Result<String> { let repo = match self.source_type { SourceType::Saved => config .repo .get(&self.repo) .ok_or(anyhow!("Repo `{}` was not found", &self.repo))? .box_clone(), SourceType::Git => git::GitRepo::from_src(&self), }; let rref = self.rref.clone().unwrap_or("HEAD".to_owned()); Ok(repo.fetch_script(&self.script_name, &rref, fresh).await?) } } async fn validate_api_repo( uri: &str, username: Option<String>, password: Password, ) -> Result<Box<dyn Repo>> { let mut maybe_parsed: Option<Url> = None; // Check if we've been given a raw gitlab or github url without scheme if uri.starts_with("gitlab.com") || uri.starts_with("github.com") { let with_scheme = format!("https://{}", uri); maybe_parsed = Some(Url::parse(&with_scheme)?); } // Try parsing the url manually otherwise let mut parsed = match maybe_parsed { Some(parsed) => parsed, None => Url::parse(uri)?, }; if parsed.cannot_be_a_base() { bail!("Repo URI was not recognized"); } // Enforce https let _ = parsed.set_scheme("https"); match parsed.host_str() { Some("gitlab.com") => Ok(gitlab::fetch_project(&parsed, password).await?), Some("github.com") => Ok(github::fetch_project(&parsed, username, password).await?), Some(_) => bail!("No provider recognized for passed URI"), None => bail!("No host on passed URI"), } }
{ if config.repo.contains_key(&name) { bail!("A repository with the name `{}` already exists", &name); } let password_for_parse = match (password, password_env, password_stdin) { (Some(pass), _, _) => Password::Saved(pass), (_, Some(var), _) => Password::FromEnv(var.clone(), env::var(var)?), (_, _, true) => { let mut buf = String::new(); io::stdin().read_to_string(&mut buf)?; Password::Saved(buf) } _ => Password::None, }; let repo = validate_api_repo(&uri, username, password_for_parse).await?; config.repo.insert(name.clone(), repo); save_config(&config) .await
conditional_block
ledger_manager.rs
use crate::crypto::hash::{H256, Hashable}; use crate::blockchain::Blockchain; use crate::block::Content; use crate::transaction::SignedTransaction; use crate::utxo::UtxoState; use std::collections::{HashMap, HashSet}; use std::thread; use std::time::{SystemTime, UNIX_EPOCH, Duration}; use std::sync::{Arc, Mutex}; use statrs::distribution::{Discrete, Poisson, Univariate}; use log::debug; //state required by ledger-manager pub struct LedgerManagerState { pub last_level_processed: u32, pub leader_sequence: Vec<H256>, pub proposer_blocks_processed: HashSet<H256>, pub tx_confirmed: HashSet<H256>, pub tx_count: usize, } //ledger-manager will periodically loop and confirm the transactions pub struct LedgerManager { pub ledger_manager_state: LedgerManagerState, pub blockchain: Arc<Mutex<Blockchain>>, pub utxo_state: Arc<Mutex<UtxoState>>, pub voter_depth_k: u32, } impl LedgerManager { pub fn new(blockchain: &Arc<Mutex<Blockchain>>, utxo_state: &Arc<Mutex<UtxoState>>, k: u32) -> Self { let ledger_manager_state = LedgerManagerState{ last_level_processed: 1, proposer_blocks_processed: HashSet::new(), leader_sequence: Vec::new(), tx_confirmed: HashSet::new(), tx_count: 0, }; LedgerManager { ledger_manager_state: ledger_manager_state, blockchain: Arc::clone(blockchain), utxo_state: Arc::clone(utxo_state), voter_depth_k: k, } } pub fn start(mut self) { thread::Builder::new() .name("ledger_manager".to_string()) .spawn(move || { self.ledger_manager_loop(); }) .unwrap(); } //Three Steps //1. Get the leader sequence //2. Get Transaction sequence //3. Sanitize Tx and update UTXO state //All 3 steps are done in the loop // fn ledger_manager_loop(&mut self) { loop{ //Step 1 //let leader_sequence = self.get_leader_sequence(); //This one uses the algorithm described in Prism Paper let leader_sequence = self.get_confirmed_leader_sequence(); //Step 2 let tx_sequence = self.get_transaction_sequence(&leader_sequence); //Step 3 self.confirm_transactions(&tx_sequence); thread::sleep(Duration::from_secs(1)); } } fn get_leader_sequence(&mut self) -> Vec<H256> { let locked_blockchain = self.blockchain.lock().unwrap(); let mut leader_sequence: Vec<H256> = vec![]; //TODO: This is a workaround for now till we have some DS which asserts that //all voter chains at a particular level has voted // level2votes: how many votes have been casted at level i let level_start = self.ledger_manager_state.last_level_processed + 1; let level_end = locked_blockchain.proposer_depth + 1; for level in level_start..level_end { let proposers = &locked_blockchain.level2allproposers[&level]; let mut max_vote_count = 0; let mut leader: H256 = [0; 32].into(); //Assumption: if a vote for proposer not present, assumed to be 0 //When above TODO is done, then this will not be needed or modified accordingly for proposer in proposers { if locked_blockchain.proposer2votecount.contains_key(proposer) { let vote_count = locked_blockchain.proposer2votecount[proposer]; if vote_count > max_vote_count { max_vote_count = vote_count; leader = *proposer; } } } //break out as there is no point going forward as no leader found at this level if max_vote_count == 0 { break; } println!("Adding leader at level {}, leader hash: {:?}, max votes: {}", level, leader, max_vote_count); leader_sequence.push(leader); self.ledger_manager_state.leader_sequence.push(leader); println!("Leader sequence: {:?}", self.ledger_manager_state.leader_sequence); self.ledger_manager_state.last_level_processed = level; } leader_sequence } fn get_confirmed_leader_sequence(&mut self) -> Vec<H256> { let mut leader_sequence: Vec<H256> = vec![]; //Locking Blockchain to get proposer_depth currently. Then dropping the lock //Will be holding locj for each level processing inside the subroutine let locked_blockchain = self.blockchain.lock().unwrap(); let level_start = self.ledger_manager_state.last_level_processed + 1; let level_end = locked_blockchain.proposer_depth + 1; drop(locked_blockchain); for level in level_start..level_end { let leader: Option<H256> = self.confirm_leader(level); match leader { Some(leader_hash) => { println!("Adding leader at level {}, leader hash: {:?}", level, leader_hash); leader_sequence.push(leader_hash); // self.ledger_manager_state.leader_sequence.push(leader_hash); // println!("Leader sequence: {:?}", self.ledger_manager_state.leader_sequence); self.ledger_manager_state.last_level_processed = level; } None => { println!("Unable to confirm leader at level {}", level); println!("Returning from get_confirmed_leader_sequence func"); break; // TODO: Will this break out of loop?? } } } leader_sequence } //we use the confirmation policy from https://arxiv.org/abs/1810.08092 //This function is heavily borrowed from implementation provided in the actual Prism codebase //https://github.com/yangl1996/prism-rust/ fn confirm_leader(&mut self, level: u32) -> Option<H256> { let locked_blockchain = self.blockchain.lock().unwrap(); let proposer_blocks = &locked_blockchain.level2allproposers[&level]; let mut new_leader: Option<H256> = None; let num_voter_chains: u32 = locked_blockchain.num_voter_chains; // for each proposer count the number of confirmed votes i.e. votes that are k-deep (2-deep). let mut num_confirmed_votes: HashMap<H256, u32> = HashMap::new(); for block in proposer_blocks { if locked_blockchain.proposer2voterinfo.contains_key(block)
} num_confirmed_votes.insert(*block, total_k_deep_votes); } } for (proposer, votes) in num_confirmed_votes.iter() { println!("proposer {:?} votes {}", proposer, *votes); if *votes > (num_voter_chains / 2) { new_leader = Some(*proposer); break; } } new_leader } // needs to process parent as well fn get_transaction_sequence(&mut self, leader_sequence: &Vec<H256>) -> Vec<SignedTransaction> { let locked_blockchain = self.blockchain.lock().unwrap(); let mut tx_sequence: Vec<SignedTransaction> = Vec::new(); //TODO: Should we do it recusrively? Like should we also see references to //proposer references of leader? //TODO: Also we should refactor it later for leader in leader_sequence { let leader_block = &locked_blockchain.proposer_chain[leader].block; //processing parent and proposer refs let mut proposer_refs_to_process: Vec<H256> = Vec::new(); let mut leader_txs: Vec<SignedTransaction> = Vec::new(); match &leader_block.content { Content::Proposer(content) => { // parent and proposer_refs of leader let parent = &content.parent_hash; let proposer_refs = &content.proposer_refs; if!self.ledger_manager_state.proposer_blocks_processed.contains(parent) { proposer_refs_to_process.push(*parent); } for proposer_ref in proposer_refs { if!self.ledger_manager_state.proposer_blocks_processed.contains(proposer_ref) { proposer_refs_to_process.push(*proposer_ref); } } //txs of leader leader_txs = content.transactions.clone(); } _ => { } } //TODO: Do we have to do match in this and previous loop as we know it will always //match to Proposer(content). Can we unwrap?? for proposer_ref in &proposer_refs_to_process { let proposer_block = &locked_blockchain.proposer_chain[proposer_ref].block; match &proposer_block.content { Content::Proposer(content) => { tx_sequence.append(&mut content.transactions.clone()); } _ => { } } self.ledger_manager_state.proposer_blocks_processed.insert(*proposer_ref); } //appending leader txs finally //adding leader to proposer_blocks_processed tx_sequence.append(&mut leader_txs); self.ledger_manager_state.proposer_blocks_processed.insert(*leader); } tx_sequence } fn confirm_transactions(&mut self, tx_sequence: &Vec<SignedTransaction>) { self.ledger_manager_state.tx_count += tx_sequence.len(); // println!("Number of transactions considered yet {}", self.ledger_manager_state.tx_count); let mut locked_utxostate = self.utxo_state.lock().unwrap(); for tx in tx_sequence { //if already processed continue if self.ledger_manager_state.tx_confirmed.contains(&tx.hash()) { println!("DUPLICATE TXS! Already confirmed"); continue; } //check for validity //if valid, update utxo_state and add to confirmed transactions if locked_utxostate.is_tx_valid(tx){ locked_utxostate.update_state(tx); self.ledger_manager_state.tx_confirmed.insert(tx.hash()); println!("Confirmed trans hash {} at {}", tx.hash(), SystemTime::now().duration_since(UNIX_EPOCH).unwrap().as_micros()); // Print UTXO state // locked_utxostate.print(); } } drop(locked_utxostate); } }
{ //TODO: We might also need number of voter blocks at a particular level of a voter chain //This is not urgent as we can **assume**, there is one block at each level let voters_info = &locked_blockchain.proposer2voterinfo[block]; if voters_info.len() < (num_voter_chains as usize / 2) { println!("number of votes for {:?} is {}", block, voters_info.len()); continue; } let mut total_k_deep_votes: u32 = 0; for (voter_chain, voter_block) in voters_info { let voter_block_level = locked_blockchain.voter_chains[(*voter_chain-1) as usize][voter_block].level; let voter_chain_level = locked_blockchain.voter_depths[(*voter_chain-1) as usize]; let this_vote_depth = voter_chain_level - voter_block_level; if this_vote_depth >= self.voter_depth_k { total_k_deep_votes += 1; }
conditional_block
ledger_manager.rs
use crate::crypto::hash::{H256, Hashable}; use crate::blockchain::Blockchain; use crate::block::Content; use crate::transaction::SignedTransaction; use crate::utxo::UtxoState; use std::collections::{HashMap, HashSet}; use std::thread; use std::time::{SystemTime, UNIX_EPOCH, Duration}; use std::sync::{Arc, Mutex}; use statrs::distribution::{Discrete, Poisson, Univariate}; use log::debug; //state required by ledger-manager pub struct
{ pub last_level_processed: u32, pub leader_sequence: Vec<H256>, pub proposer_blocks_processed: HashSet<H256>, pub tx_confirmed: HashSet<H256>, pub tx_count: usize, } //ledger-manager will periodically loop and confirm the transactions pub struct LedgerManager { pub ledger_manager_state: LedgerManagerState, pub blockchain: Arc<Mutex<Blockchain>>, pub utxo_state: Arc<Mutex<UtxoState>>, pub voter_depth_k: u32, } impl LedgerManager { pub fn new(blockchain: &Arc<Mutex<Blockchain>>, utxo_state: &Arc<Mutex<UtxoState>>, k: u32) -> Self { let ledger_manager_state = LedgerManagerState{ last_level_processed: 1, proposer_blocks_processed: HashSet::new(), leader_sequence: Vec::new(), tx_confirmed: HashSet::new(), tx_count: 0, }; LedgerManager { ledger_manager_state: ledger_manager_state, blockchain: Arc::clone(blockchain), utxo_state: Arc::clone(utxo_state), voter_depth_k: k, } } pub fn start(mut self) { thread::Builder::new() .name("ledger_manager".to_string()) .spawn(move || { self.ledger_manager_loop(); }) .unwrap(); } //Three Steps //1. Get the leader sequence //2. Get Transaction sequence //3. Sanitize Tx and update UTXO state //All 3 steps are done in the loop // fn ledger_manager_loop(&mut self) { loop{ //Step 1 //let leader_sequence = self.get_leader_sequence(); //This one uses the algorithm described in Prism Paper let leader_sequence = self.get_confirmed_leader_sequence(); //Step 2 let tx_sequence = self.get_transaction_sequence(&leader_sequence); //Step 3 self.confirm_transactions(&tx_sequence); thread::sleep(Duration::from_secs(1)); } } fn get_leader_sequence(&mut self) -> Vec<H256> { let locked_blockchain = self.blockchain.lock().unwrap(); let mut leader_sequence: Vec<H256> = vec![]; //TODO: This is a workaround for now till we have some DS which asserts that //all voter chains at a particular level has voted // level2votes: how many votes have been casted at level i let level_start = self.ledger_manager_state.last_level_processed + 1; let level_end = locked_blockchain.proposer_depth + 1; for level in level_start..level_end { let proposers = &locked_blockchain.level2allproposers[&level]; let mut max_vote_count = 0; let mut leader: H256 = [0; 32].into(); //Assumption: if a vote for proposer not present, assumed to be 0 //When above TODO is done, then this will not be needed or modified accordingly for proposer in proposers { if locked_blockchain.proposer2votecount.contains_key(proposer) { let vote_count = locked_blockchain.proposer2votecount[proposer]; if vote_count > max_vote_count { max_vote_count = vote_count; leader = *proposer; } } } //break out as there is no point going forward as no leader found at this level if max_vote_count == 0 { break; } println!("Adding leader at level {}, leader hash: {:?}, max votes: {}", level, leader, max_vote_count); leader_sequence.push(leader); self.ledger_manager_state.leader_sequence.push(leader); println!("Leader sequence: {:?}", self.ledger_manager_state.leader_sequence); self.ledger_manager_state.last_level_processed = level; } leader_sequence } fn get_confirmed_leader_sequence(&mut self) -> Vec<H256> { let mut leader_sequence: Vec<H256> = vec![]; //Locking Blockchain to get proposer_depth currently. Then dropping the lock //Will be holding locj for each level processing inside the subroutine let locked_blockchain = self.blockchain.lock().unwrap(); let level_start = self.ledger_manager_state.last_level_processed + 1; let level_end = locked_blockchain.proposer_depth + 1; drop(locked_blockchain); for level in level_start..level_end { let leader: Option<H256> = self.confirm_leader(level); match leader { Some(leader_hash) => { println!("Adding leader at level {}, leader hash: {:?}", level, leader_hash); leader_sequence.push(leader_hash); // self.ledger_manager_state.leader_sequence.push(leader_hash); // println!("Leader sequence: {:?}", self.ledger_manager_state.leader_sequence); self.ledger_manager_state.last_level_processed = level; } None => { println!("Unable to confirm leader at level {}", level); println!("Returning from get_confirmed_leader_sequence func"); break; // TODO: Will this break out of loop?? } } } leader_sequence } //we use the confirmation policy from https://arxiv.org/abs/1810.08092 //This function is heavily borrowed from implementation provided in the actual Prism codebase //https://github.com/yangl1996/prism-rust/ fn confirm_leader(&mut self, level: u32) -> Option<H256> { let locked_blockchain = self.blockchain.lock().unwrap(); let proposer_blocks = &locked_blockchain.level2allproposers[&level]; let mut new_leader: Option<H256> = None; let num_voter_chains: u32 = locked_blockchain.num_voter_chains; // for each proposer count the number of confirmed votes i.e. votes that are k-deep (2-deep). let mut num_confirmed_votes: HashMap<H256, u32> = HashMap::new(); for block in proposer_blocks { if locked_blockchain.proposer2voterinfo.contains_key(block) { //TODO: We might also need number of voter blocks at a particular level of a voter chain //This is not urgent as we can **assume**, there is one block at each level let voters_info = &locked_blockchain.proposer2voterinfo[block]; if voters_info.len() < (num_voter_chains as usize / 2) { println!("number of votes for {:?} is {}", block, voters_info.len()); continue; } let mut total_k_deep_votes: u32 = 0; for (voter_chain, voter_block) in voters_info { let voter_block_level = locked_blockchain.voter_chains[(*voter_chain-1) as usize][voter_block].level; let voter_chain_level = locked_blockchain.voter_depths[(*voter_chain-1) as usize]; let this_vote_depth = voter_chain_level - voter_block_level; if this_vote_depth >= self.voter_depth_k { total_k_deep_votes += 1; } } num_confirmed_votes.insert(*block, total_k_deep_votes); } } for (proposer, votes) in num_confirmed_votes.iter() { println!("proposer {:?} votes {}", proposer, *votes); if *votes > (num_voter_chains / 2) { new_leader = Some(*proposer); break; } } new_leader } // needs to process parent as well fn get_transaction_sequence(&mut self, leader_sequence: &Vec<H256>) -> Vec<SignedTransaction> { let locked_blockchain = self.blockchain.lock().unwrap(); let mut tx_sequence: Vec<SignedTransaction> = Vec::new(); //TODO: Should we do it recusrively? Like should we also see references to //proposer references of leader? //TODO: Also we should refactor it later for leader in leader_sequence { let leader_block = &locked_blockchain.proposer_chain[leader].block; //processing parent and proposer refs let mut proposer_refs_to_process: Vec<H256> = Vec::new(); let mut leader_txs: Vec<SignedTransaction> = Vec::new(); match &leader_block.content { Content::Proposer(content) => { // parent and proposer_refs of leader let parent = &content.parent_hash; let proposer_refs = &content.proposer_refs; if!self.ledger_manager_state.proposer_blocks_processed.contains(parent) { proposer_refs_to_process.push(*parent); } for proposer_ref in proposer_refs { if!self.ledger_manager_state.proposer_blocks_processed.contains(proposer_ref) { proposer_refs_to_process.push(*proposer_ref); } } //txs of leader leader_txs = content.transactions.clone(); } _ => { } } //TODO: Do we have to do match in this and previous loop as we know it will always //match to Proposer(content). Can we unwrap?? for proposer_ref in &proposer_refs_to_process { let proposer_block = &locked_blockchain.proposer_chain[proposer_ref].block; match &proposer_block.content { Content::Proposer(content) => { tx_sequence.append(&mut content.transactions.clone()); } _ => { } } self.ledger_manager_state.proposer_blocks_processed.insert(*proposer_ref); } //appending leader txs finally //adding leader to proposer_blocks_processed tx_sequence.append(&mut leader_txs); self.ledger_manager_state.proposer_blocks_processed.insert(*leader); } tx_sequence } fn confirm_transactions(&mut self, tx_sequence: &Vec<SignedTransaction>) { self.ledger_manager_state.tx_count += tx_sequence.len(); // println!("Number of transactions considered yet {}", self.ledger_manager_state.tx_count); let mut locked_utxostate = self.utxo_state.lock().unwrap(); for tx in tx_sequence { //if already processed continue if self.ledger_manager_state.tx_confirmed.contains(&tx.hash()) { println!("DUPLICATE TXS! Already confirmed"); continue; } //check for validity //if valid, update utxo_state and add to confirmed transactions if locked_utxostate.is_tx_valid(tx){ locked_utxostate.update_state(tx); self.ledger_manager_state.tx_confirmed.insert(tx.hash()); println!("Confirmed trans hash {} at {}", tx.hash(), SystemTime::now().duration_since(UNIX_EPOCH).unwrap().as_micros()); // Print UTXO state // locked_utxostate.print(); } } drop(locked_utxostate); } }
LedgerManagerState
identifier_name
ledger_manager.rs
use crate::crypto::hash::{H256, Hashable}; use crate::blockchain::Blockchain; use crate::block::Content; use crate::transaction::SignedTransaction; use crate::utxo::UtxoState; use std::collections::{HashMap, HashSet}; use std::thread; use std::time::{SystemTime, UNIX_EPOCH, Duration}; use std::sync::{Arc, Mutex}; use statrs::distribution::{Discrete, Poisson, Univariate}; use log::debug; //state required by ledger-manager pub struct LedgerManagerState { pub last_level_processed: u32, pub leader_sequence: Vec<H256>, pub proposer_blocks_processed: HashSet<H256>, pub tx_confirmed: HashSet<H256>, pub tx_count: usize, } //ledger-manager will periodically loop and confirm the transactions pub struct LedgerManager { pub ledger_manager_state: LedgerManagerState, pub blockchain: Arc<Mutex<Blockchain>>, pub utxo_state: Arc<Mutex<UtxoState>>, pub voter_depth_k: u32, } impl LedgerManager { pub fn new(blockchain: &Arc<Mutex<Blockchain>>, utxo_state: &Arc<Mutex<UtxoState>>, k: u32) -> Self { let ledger_manager_state = LedgerManagerState{ last_level_processed: 1, proposer_blocks_processed: HashSet::new(), leader_sequence: Vec::new(), tx_confirmed: HashSet::new(), tx_count: 0, }; LedgerManager { ledger_manager_state: ledger_manager_state, blockchain: Arc::clone(blockchain), utxo_state: Arc::clone(utxo_state), voter_depth_k: k, } } pub fn start(mut self) { thread::Builder::new() .name("ledger_manager".to_string()) .spawn(move || { self.ledger_manager_loop(); }) .unwrap(); } //Three Steps //1. Get the leader sequence //2. Get Transaction sequence //3. Sanitize Tx and update UTXO state //All 3 steps are done in the loop // fn ledger_manager_loop(&mut self)
fn get_leader_sequence(&mut self) -> Vec<H256> { let locked_blockchain = self.blockchain.lock().unwrap(); let mut leader_sequence: Vec<H256> = vec![]; //TODO: This is a workaround for now till we have some DS which asserts that //all voter chains at a particular level has voted // level2votes: how many votes have been casted at level i let level_start = self.ledger_manager_state.last_level_processed + 1; let level_end = locked_blockchain.proposer_depth + 1; for level in level_start..level_end { let proposers = &locked_blockchain.level2allproposers[&level]; let mut max_vote_count = 0; let mut leader: H256 = [0; 32].into(); //Assumption: if a vote for proposer not present, assumed to be 0 //When above TODO is done, then this will not be needed or modified accordingly for proposer in proposers { if locked_blockchain.proposer2votecount.contains_key(proposer) { let vote_count = locked_blockchain.proposer2votecount[proposer]; if vote_count > max_vote_count { max_vote_count = vote_count; leader = *proposer; } } } //break out as there is no point going forward as no leader found at this level if max_vote_count == 0 { break; } println!("Adding leader at level {}, leader hash: {:?}, max votes: {}", level, leader, max_vote_count); leader_sequence.push(leader); self.ledger_manager_state.leader_sequence.push(leader); println!("Leader sequence: {:?}", self.ledger_manager_state.leader_sequence); self.ledger_manager_state.last_level_processed = level; } leader_sequence } fn get_confirmed_leader_sequence(&mut self) -> Vec<H256> { let mut leader_sequence: Vec<H256> = vec![]; //Locking Blockchain to get proposer_depth currently. Then dropping the lock //Will be holding locj for each level processing inside the subroutine let locked_blockchain = self.blockchain.lock().unwrap(); let level_start = self.ledger_manager_state.last_level_processed + 1; let level_end = locked_blockchain.proposer_depth + 1; drop(locked_blockchain); for level in level_start..level_end { let leader: Option<H256> = self.confirm_leader(level); match leader { Some(leader_hash) => { println!("Adding leader at level {}, leader hash: {:?}", level, leader_hash); leader_sequence.push(leader_hash); // self.ledger_manager_state.leader_sequence.push(leader_hash); // println!("Leader sequence: {:?}", self.ledger_manager_state.leader_sequence); self.ledger_manager_state.last_level_processed = level; } None => { println!("Unable to confirm leader at level {}", level); println!("Returning from get_confirmed_leader_sequence func"); break; // TODO: Will this break out of loop?? } } } leader_sequence } //we use the confirmation policy from https://arxiv.org/abs/1810.08092 //This function is heavily borrowed from implementation provided in the actual Prism codebase //https://github.com/yangl1996/prism-rust/ fn confirm_leader(&mut self, level: u32) -> Option<H256> { let locked_blockchain = self.blockchain.lock().unwrap(); let proposer_blocks = &locked_blockchain.level2allproposers[&level]; let mut new_leader: Option<H256> = None; let num_voter_chains: u32 = locked_blockchain.num_voter_chains; // for each proposer count the number of confirmed votes i.e. votes that are k-deep (2-deep). let mut num_confirmed_votes: HashMap<H256, u32> = HashMap::new(); for block in proposer_blocks { if locked_blockchain.proposer2voterinfo.contains_key(block) { //TODO: We might also need number of voter blocks at a particular level of a voter chain //This is not urgent as we can **assume**, there is one block at each level let voters_info = &locked_blockchain.proposer2voterinfo[block]; if voters_info.len() < (num_voter_chains as usize / 2) { println!("number of votes for {:?} is {}", block, voters_info.len()); continue; } let mut total_k_deep_votes: u32 = 0; for (voter_chain, voter_block) in voters_info { let voter_block_level = locked_blockchain.voter_chains[(*voter_chain-1) as usize][voter_block].level; let voter_chain_level = locked_blockchain.voter_depths[(*voter_chain-1) as usize]; let this_vote_depth = voter_chain_level - voter_block_level; if this_vote_depth >= self.voter_depth_k { total_k_deep_votes += 1; } } num_confirmed_votes.insert(*block, total_k_deep_votes); } } for (proposer, votes) in num_confirmed_votes.iter() { println!("proposer {:?} votes {}", proposer, *votes); if *votes > (num_voter_chains / 2) { new_leader = Some(*proposer); break; } } new_leader } // needs to process parent as well fn get_transaction_sequence(&mut self, leader_sequence: &Vec<H256>) -> Vec<SignedTransaction> { let locked_blockchain = self.blockchain.lock().unwrap(); let mut tx_sequence: Vec<SignedTransaction> = Vec::new(); //TODO: Should we do it recusrively? Like should we also see references to //proposer references of leader? //TODO: Also we should refactor it later for leader in leader_sequence { let leader_block = &locked_blockchain.proposer_chain[leader].block; //processing parent and proposer refs let mut proposer_refs_to_process: Vec<H256> = Vec::new(); let mut leader_txs: Vec<SignedTransaction> = Vec::new(); match &leader_block.content { Content::Proposer(content) => { // parent and proposer_refs of leader let parent = &content.parent_hash; let proposer_refs = &content.proposer_refs; if!self.ledger_manager_state.proposer_blocks_processed.contains(parent) { proposer_refs_to_process.push(*parent); } for proposer_ref in proposer_refs { if!self.ledger_manager_state.proposer_blocks_processed.contains(proposer_ref) { proposer_refs_to_process.push(*proposer_ref); } } //txs of leader leader_txs = content.transactions.clone(); } _ => { } } //TODO: Do we have to do match in this and previous loop as we know it will always //match to Proposer(content). Can we unwrap?? for proposer_ref in &proposer_refs_to_process { let proposer_block = &locked_blockchain.proposer_chain[proposer_ref].block; match &proposer_block.content { Content::Proposer(content) => { tx_sequence.append(&mut content.transactions.clone()); } _ => { } } self.ledger_manager_state.proposer_blocks_processed.insert(*proposer_ref); } //appending leader txs finally //adding leader to proposer_blocks_processed tx_sequence.append(&mut leader_txs); self.ledger_manager_state.proposer_blocks_processed.insert(*leader); } tx_sequence } fn confirm_transactions(&mut self, tx_sequence: &Vec<SignedTransaction>) { self.ledger_manager_state.tx_count += tx_sequence.len(); // println!("Number of transactions considered yet {}", self.ledger_manager_state.tx_count); let mut locked_utxostate = self.utxo_state.lock().unwrap(); for tx in tx_sequence { //if already processed continue if self.ledger_manager_state.tx_confirmed.contains(&tx.hash()) { println!("DUPLICATE TXS! Already confirmed"); continue; } //check for validity //if valid, update utxo_state and add to confirmed transactions if locked_utxostate.is_tx_valid(tx){ locked_utxostate.update_state(tx); self.ledger_manager_state.tx_confirmed.insert(tx.hash()); println!("Confirmed trans hash {} at {}", tx.hash(), SystemTime::now().duration_since(UNIX_EPOCH).unwrap().as_micros()); // Print UTXO state // locked_utxostate.print(); } } drop(locked_utxostate); } }
{ loop{ //Step 1 //let leader_sequence = self.get_leader_sequence(); //This one uses the algorithm described in Prism Paper let leader_sequence = self.get_confirmed_leader_sequence(); //Step 2 let tx_sequence = self.get_transaction_sequence(&leader_sequence); //Step 3 self.confirm_transactions(&tx_sequence); thread::sleep(Duration::from_secs(1)); } }
identifier_body
ledger_manager.rs
use crate::crypto::hash::{H256, Hashable}; use crate::blockchain::Blockchain; use crate::block::Content; use crate::transaction::SignedTransaction; use crate::utxo::UtxoState; use std::collections::{HashMap, HashSet}; use std::thread; use std::time::{SystemTime, UNIX_EPOCH, Duration}; use std::sync::{Arc, Mutex}; use statrs::distribution::{Discrete, Poisson, Univariate}; use log::debug; //state required by ledger-manager pub struct LedgerManagerState { pub last_level_processed: u32, pub leader_sequence: Vec<H256>, pub proposer_blocks_processed: HashSet<H256>, pub tx_confirmed: HashSet<H256>, pub tx_count: usize, } //ledger-manager will periodically loop and confirm the transactions pub struct LedgerManager { pub ledger_manager_state: LedgerManagerState, pub blockchain: Arc<Mutex<Blockchain>>, pub utxo_state: Arc<Mutex<UtxoState>>, pub voter_depth_k: u32, } impl LedgerManager { pub fn new(blockchain: &Arc<Mutex<Blockchain>>, utxo_state: &Arc<Mutex<UtxoState>>, k: u32) -> Self { let ledger_manager_state = LedgerManagerState{ last_level_processed: 1, proposer_blocks_processed: HashSet::new(), leader_sequence: Vec::new(), tx_confirmed: HashSet::new(), tx_count: 0, }; LedgerManager { ledger_manager_state: ledger_manager_state, blockchain: Arc::clone(blockchain), utxo_state: Arc::clone(utxo_state), voter_depth_k: k, } } pub fn start(mut self) { thread::Builder::new() .name("ledger_manager".to_string()) .spawn(move || { self.ledger_manager_loop(); }) .unwrap(); } //Three Steps //1. Get the leader sequence //2. Get Transaction sequence //3. Sanitize Tx and update UTXO state //All 3 steps are done in the loop // fn ledger_manager_loop(&mut self) { loop{ //Step 1 //let leader_sequence = self.get_leader_sequence(); //This one uses the algorithm described in Prism Paper let leader_sequence = self.get_confirmed_leader_sequence(); //Step 2 let tx_sequence = self.get_transaction_sequence(&leader_sequence); //Step 3 self.confirm_transactions(&tx_sequence); thread::sleep(Duration::from_secs(1)); } } fn get_leader_sequence(&mut self) -> Vec<H256> { let locked_blockchain = self.blockchain.lock().unwrap(); let mut leader_sequence: Vec<H256> = vec![]; //TODO: This is a workaround for now till we have some DS which asserts that //all voter chains at a particular level has voted // level2votes: how many votes have been casted at level i let level_start = self.ledger_manager_state.last_level_processed + 1; let level_end = locked_blockchain.proposer_depth + 1; for level in level_start..level_end { let proposers = &locked_blockchain.level2allproposers[&level]; let mut max_vote_count = 0; let mut leader: H256 = [0; 32].into(); //Assumption: if a vote for proposer not present, assumed to be 0 //When above TODO is done, then this will not be needed or modified accordingly for proposer in proposers { if locked_blockchain.proposer2votecount.contains_key(proposer) { let vote_count = locked_blockchain.proposer2votecount[proposer]; if vote_count > max_vote_count { max_vote_count = vote_count; leader = *proposer; } } } //break out as there is no point going forward as no leader found at this level if max_vote_count == 0 { break; } println!("Adding leader at level {}, leader hash: {:?}, max votes: {}", level, leader, max_vote_count); leader_sequence.push(leader); self.ledger_manager_state.leader_sequence.push(leader); println!("Leader sequence: {:?}", self.ledger_manager_state.leader_sequence); self.ledger_manager_state.last_level_processed = level; } leader_sequence } fn get_confirmed_leader_sequence(&mut self) -> Vec<H256> { let mut leader_sequence: Vec<H256> = vec![]; //Locking Blockchain to get proposer_depth currently. Then dropping the lock //Will be holding locj for each level processing inside the subroutine let locked_blockchain = self.blockchain.lock().unwrap(); let level_start = self.ledger_manager_state.last_level_processed + 1; let level_end = locked_blockchain.proposer_depth + 1; drop(locked_blockchain); for level in level_start..level_end { let leader: Option<H256> = self.confirm_leader(level); match leader { Some(leader_hash) => { println!("Adding leader at level {}, leader hash: {:?}", level, leader_hash); leader_sequence.push(leader_hash); // self.ledger_manager_state.leader_sequence.push(leader_hash); // println!("Leader sequence: {:?}", self.ledger_manager_state.leader_sequence); self.ledger_manager_state.last_level_processed = level; } None => { println!("Unable to confirm leader at level {}", level); println!("Returning from get_confirmed_leader_sequence func"); break; // TODO: Will this break out of loop?? } } } leader_sequence } //we use the confirmation policy from https://arxiv.org/abs/1810.08092 //This function is heavily borrowed from implementation provided in the actual Prism codebase //https://github.com/yangl1996/prism-rust/ fn confirm_leader(&mut self, level: u32) -> Option<H256> { let locked_blockchain = self.blockchain.lock().unwrap(); let proposer_blocks = &locked_blockchain.level2allproposers[&level]; let mut new_leader: Option<H256> = None; let num_voter_chains: u32 = locked_blockchain.num_voter_chains; // for each proposer count the number of confirmed votes i.e. votes that are k-deep (2-deep). let mut num_confirmed_votes: HashMap<H256, u32> = HashMap::new(); for block in proposer_blocks { if locked_blockchain.proposer2voterinfo.contains_key(block) { //TODO: We might also need number of voter blocks at a particular level of a voter chain //This is not urgent as we can **assume**, there is one block at each level let voters_info = &locked_blockchain.proposer2voterinfo[block]; if voters_info.len() < (num_voter_chains as usize / 2) { println!("number of votes for {:?} is {}", block, voters_info.len()); continue; } let mut total_k_deep_votes: u32 = 0; for (voter_chain, voter_block) in voters_info { let voter_block_level = locked_blockchain.voter_chains[(*voter_chain-1) as usize][voter_block].level; let voter_chain_level = locked_blockchain.voter_depths[(*voter_chain-1) as usize]; let this_vote_depth = voter_chain_level - voter_block_level; if this_vote_depth >= self.voter_depth_k { total_k_deep_votes += 1; } } num_confirmed_votes.insert(*block, total_k_deep_votes); } } for (proposer, votes) in num_confirmed_votes.iter() { println!("proposer {:?} votes {}", proposer, *votes); if *votes > (num_voter_chains / 2) { new_leader = Some(*proposer); break; } } new_leader } // needs to process parent as well fn get_transaction_sequence(&mut self, leader_sequence: &Vec<H256>) -> Vec<SignedTransaction> { let locked_blockchain = self.blockchain.lock().unwrap(); let mut tx_sequence: Vec<SignedTransaction> = Vec::new(); //TODO: Should we do it recusrively? Like should we also see references to //proposer references of leader? //TODO: Also we should refactor it later for leader in leader_sequence { let leader_block = &locked_blockchain.proposer_chain[leader].block; //processing parent and proposer refs let mut proposer_refs_to_process: Vec<H256> = Vec::new(); let mut leader_txs: Vec<SignedTransaction> = Vec::new(); match &leader_block.content { Content::Proposer(content) => { // parent and proposer_refs of leader let parent = &content.parent_hash; let proposer_refs = &content.proposer_refs; if!self.ledger_manager_state.proposer_blocks_processed.contains(parent) { proposer_refs_to_process.push(*parent); } for proposer_ref in proposer_refs { if!self.ledger_manager_state.proposer_blocks_processed.contains(proposer_ref) { proposer_refs_to_process.push(*proposer_ref); } } //txs of leader leader_txs = content.transactions.clone(); } _ => { } } //TODO: Do we have to do match in this and previous loop as we know it will always //match to Proposer(content). Can we unwrap?? for proposer_ref in &proposer_refs_to_process { let proposer_block = &locked_blockchain.proposer_chain[proposer_ref].block; match &proposer_block.content { Content::Proposer(content) => { tx_sequence.append(&mut content.transactions.clone()); } _ => { } } self.ledger_manager_state.proposer_blocks_processed.insert(*proposer_ref); } //appending leader txs finally //adding leader to proposer_blocks_processed tx_sequence.append(&mut leader_txs);
} fn confirm_transactions(&mut self, tx_sequence: &Vec<SignedTransaction>) { self.ledger_manager_state.tx_count += tx_sequence.len(); // println!("Number of transactions considered yet {}", self.ledger_manager_state.tx_count); let mut locked_utxostate = self.utxo_state.lock().unwrap(); for tx in tx_sequence { //if already processed continue if self.ledger_manager_state.tx_confirmed.contains(&tx.hash()) { println!("DUPLICATE TXS! Already confirmed"); continue; } //check for validity //if valid, update utxo_state and add to confirmed transactions if locked_utxostate.is_tx_valid(tx){ locked_utxostate.update_state(tx); self.ledger_manager_state.tx_confirmed.insert(tx.hash()); println!("Confirmed trans hash {} at {}", tx.hash(), SystemTime::now().duration_since(UNIX_EPOCH).unwrap().as_micros()); // Print UTXO state // locked_utxostate.print(); } } drop(locked_utxostate); } }
self.ledger_manager_state.proposer_blocks_processed.insert(*leader); } tx_sequence
random_line_split
rtc_api.rs
#![allow(dead_code)] use bitflags::*; #[derive(Debug, rkyv::Archive, rkyv::Serialize, rkyv::Deserialize, Copy, Clone)] pub enum Weekday { Sunday, Monday, Tuesday, Wednesday, Thursday, Friday, Saturday, } impl Default for Weekday { fn default() -> Self { Weekday::Sunday } } #[derive(Debug, rkyv::Archive, rkyv::Serialize, rkyv::Deserialize)] pub enum TimeUnits { Seconds, Minutes, Hours, } #[derive(Debug, rkyv::Archive, rkyv::Serialize, rkyv::Deserialize, Copy, Clone, Default)] pub struct DateTime { pub seconds: u8, pub minutes: u8, pub hours: u8, pub days: u8, pub months: u8, pub years: u8, pub weekday: Weekday, } #[derive(Debug, rkyv::Archive, rkyv::Serialize, rkyv::Deserialize, Copy, Clone, Default)] pub struct RtcSessionOffset { pub rtc_seconds: u64, pub ticktimer_ms: u64, } pub const BLOCKING_I2C_TIMEOUT_MS: u64 = 50; pub const ABRTCMC_I2C_ADR: u8 = 0x68; pub const ABRTCMC_CONTROL1: u8 = 0x00; bitflags! { pub struct Control1: u8 { const CORRECTION_INT = 0b0000_0001; const ALARM_INT = 0b0000_0010; const SECONDS_INT = 0b0000_0100; const HR_MODE_12 = 0b0000_1000; const SOFT_RESET = 0b0001_0000; const STOP = 0b0010_0000; } } pub const ABRTCMC_CONTROL2: u8 = 0x01; bitflags! { pub struct Control2: u8 { const COUNTDOWN_B_INT = 0b0000_0001; const COUNTDOWN_A_INT = 0b0000_0010; const WATCHDOG_A_INT = 0b0000_0100; const ALARM_HAPPENED = 0b0000_1000; const SECONDS_HAPPENED= 0b0001_0000; const COUNTB_HAPPENED = 0b0010_0000; const COUNTA_HAPPENED = 0b0100_0000; const WATCHA_HAPPENED = 0b1000_0000; } } pub const ABRTCMC_CONTROL3: u8 = 0x02; bitflags! { pub struct Control3: u8 { const BATTLOW_INT = 0b0000_0001; const BATTSWITCH_INT = 0b0000_0010; const BATTLOW_STAT = 0b0000_0100; const BATTSW_HAPPENED = 0b0000_1000; const BATT_STD_BL_EN = 0b0000_0000; const BATT_DIR_BL_EN = 0b0010_0000; const BATT_DIS_BL_EN = 0b0100_0000; const BATT_STD_BL_DIS = 0b1000_0000; const BATT_DIR_BL_DIS = 0b1010_0000; const BATT_DI_BL_DIS = 0b1110_0000; } } pub const ABRTCMC_SECONDS: u8 = 0x3; bitflags! { pub struct Seconds: u8 { const SECONDS_BCD = 0b0111_1111; const CORRUPTED = 0b1000_0000; } } pub const ABRTCMC_MINUTES: u8 = 0x4; // no bitflags, minutes are BCD whole register pub const ABRTCMC_HOURS: u8 = 0x5; bitflags! { pub struct Hours: u8 { const HR12_HOURS_BCD = 0b0001_1111; const HR12_PM_FLAG = 0b0010_0000; const HR24_HOURS_BCD = 0b0011_1111; } } pub const ABRTCMC_DAYS: u8 = 0x6; // no bitflags, days are BCD whole register pub const ABRTCMC_WEEKDAYS: u8 = 0x7; bitflags! { pub struct Weekdays: u8 { const SUNDAY = 0b000; const MONDAY = 0b001; const TUESDAY = 0b010; const WEDNESDAY= 0b011; const THURSDAY = 0b100; const FRIDAY = 0b101; const SATURDAY = 0b110; } } pub const ABRTCMC_MONTHS: u8 = 0x8; bitflags! { pub struct Months: u8 { // BCD "months" const JANUARY = 0b0_0001; const FEBRUARY = 0b0_0010; const MARCH = 0b0_0011; const APRIL = 0b0_0100; const MAY = 0b0_0101; const JUNE = 0b0_0110; const JULY = 0b0_0111; const AUGUST = 0b0_1000; const SEPTEMBER = 0b0_1001; const OCTOBER = 0b1_0000; const NOVEMBER = 0b1_0001; const DECEMBER = 0b1_0010; } } pub const ABRTCMC_YEARS: u8 = 0x9; // no bitflags, years are 00-99 in BCD format pub const ABRTCMC_MINUTE_ALARM: u8 = 0xA; pub const ABRTCMC_HOUR_ALARM: u8 = 0xB; pub const ABRTCMC_DAY_ALARM: u8 = 0xC; pub const ABRTCMC_WEEKDAY_ALARM: u8 = 0xD; bitflags! { pub struct Alarm: u8 { const ENABLE = 0b1000_0000; // all others code minute/hour/day/weekday in BCD LSBs const HR12_PM_FLAG = 0b0010_0000; // only used in hours alarm, 12-hour mode } } pub const ABRTCMC_CONFIG: u8 = 0xF; bitflags! { pub struct Config: u8 { const TIMER_B_ENABLE = 0b0000_0001; const TIMER_A_WATCHDOG = 0b0000_0100; const TIMER_A_COUNTDWN = 0b0000_0010; const TIMER_A_DISABLE = 0b0000_0000; const TIMER_A_DISABLE2 = 0b0000_0110; const CLKOUT_32768_HZ = 0b0000_0000; const CLKOUT_16384_HZ = 0b0000_1000; const CLKOUT_8192_HZ = 0b0001_0000; const CLKOUT_4096_HZ = 0b0001_1000; const CLKOUT_1024_HZ = 0b0010_0000; const CLKOUT_32_HZ = 0b0010_1000; const CLKOUT_1_HZ = 0b0011_0000; const CLKOUT_DISABLE = 0b0011_1000; const TIMERB_INT_PULSED = 0b0100_0000; const TIMERA_SECONDS_INT_PULSED = 0b1000_0000; } } pub const ABRTCMC_TIMERA_CLK: u8 = 0x10; pub const ABRTCMC_TIMERB_CLK: u8 = 0x12; bitflags! { pub struct TimerClk: u8 { const CLK_3600_S = 0b0000_0100; const CLK_60_S = 0b0000_0011; const CLK_1_S = 0b0000_0010; const CLK_64_HZ = 0b0000_0001; // 15.625ms const CLK_4096_HZ = 0b0000_0000; // 0.2441ms const PULSE_46_MS = 0b0000_0000; const PULSE_62_MS = 0b0001_0000; const PULSE_78_MS = 0b0010_0000; const PULSE_93_MS = 0b0011_0000; const PULSE_125_MS = 0b0100_0000; const PULSE_156_MS = 0b0101_0000; const PULSE_187_MS = 0b0110_0000; const PULSE_218_MS = 0b0111_0000; } } pub const ABRTCMC_TIMERA: u8 = 0x11; // no bitflags, register is timer period in seconds, and the period is N / (source clock frequency) pub const ABRTCMC_TIMERB: u8 = 0x13; // no bitflags, register is timer period in seconds, and the period is N / (source clock frequency) /// This function takes the raw &[u8] as returned by the RTC I2C low level read function /// and converts it to a number of seconds. All hardware RTC readings are based off of the /// BCD equivalent of Jan 1 2000, 00:00:00, but keep in mind this is just an internal representation. /// We turn this into a u64 number of seconds because what we really want out of the hardware RTC /// is _just_ a count of seconds from some arbitrary but fixed start point, that we anchor through other /// algorithms to UTC. pub fn
(settings: &[u8]) -> Option<u64> { const CTL3: usize = 0; const SECS: usize = 1; const MINS: usize = 2; const HOURS: usize = 3; const DAYS: usize = 4; // note 5 is skipped - this is weekdays, and is unused const MONTHS: usize = 6; const YEARS: usize = 7; if ((settings[CTL3] & 0xE0)!= crate::RTC_PWR_MODE) // power switchover setting should be initialized || (settings[SECS] & 0x80!= 0) { // clock integrity should be guaranteed log::error!("RTC is in an uninitialized state!, {:x?}", settings); return None; } // this is a secondary check -- I have seen RTC return nonsense time results before // so this is an extra check above and beyond what's in the datasheet if (to_binary(settings[SECS]) > 59) || (to_binary(settings[MINS]) > 59) || (to_binary(settings[HOURS]) > 23) // 24 hour mode is default and assumed || (to_binary(settings[DAYS]) > 31) || (to_binary(settings[DAYS]) == 0) || (to_binary(settings[MONTHS]) > 12) || (to_binary(settings[MONTHS]) == 0) || (to_binary(settings[YEARS]) > 99) { log::error!("RTC has invalid digits!: {:?}", settings); return None; } let mut total_secs: u64 = 0; total_secs += to_binary(settings[SECS]) as u64; total_secs += to_binary(settings[MINS]) as u64 * 60; total_secs += to_binary(settings[HOURS]) as u64 * 3600; const SECS_PER_DAY: u64 = 86400; // DAYS is checked to be 1-31, so, it's safe to subtract 1 here total_secs += (to_binary(settings[DAYS]) as u64 - 1) * SECS_PER_DAY; // this will iterate from 0 through 11; december never has an offset added, because its contribution is directly measured in DAYS for month in 0..to_binary(settings[MONTHS]) { match month { 0 => total_secs += 0u64, 1 => total_secs += 31u64 * SECS_PER_DAY, 2 => { // per spec sheet: 1) If the year counter contains a value which is exactly divisible by 4 (including the year 00), // the AB-RTCMC-32.768kHz-B5ZE-S3 compensates for leap years by adding a 29th day to February. if (to_binary(settings[YEARS]) % 4) == 0 { total_secs += 29u64 * SECS_PER_DAY; } else { total_secs += 28u64 * SECS_PER_DAY; }; }, 3 => total_secs += 31u64 * SECS_PER_DAY, 4 => total_secs += 30u64 * SECS_PER_DAY, 5 => total_secs += 31u64 * SECS_PER_DAY, 6 => total_secs += 30u64 * SECS_PER_DAY, 7 => total_secs += 31u64 * SECS_PER_DAY, 8 => total_secs += 31u64 * SECS_PER_DAY, 9 => total_secs += 30u64 * SECS_PER_DAY, 10 => total_secs += 31u64 * SECS_PER_DAY, 11 => total_secs += 30u64 * SECS_PER_DAY, // December shoud never be encountered in this loop since it's right-exclusive _ => panic!("RTC code has an internal error, months encountered an 'impossible' value"), } } // figure out what the last round multiple of leap years was before the current time let last_leap = (to_binary(settings[YEARS]) - to_binary(settings[YEARS]) % 4) as u64; // now add the contributions of all these prior years total_secs += (last_leap / 4) * (365 * 3 + 366) * SECS_PER_DAY; // now add the contributions of any years since the last round multiple of leap years if to_binary(settings[YEARS]) % 4!= 0 { // account for the leap year total_secs += 366 * SECS_PER_DAY; // now account for successive years total_secs += 365 * (((to_binary(settings[YEARS]) % 4) - 1) as u64) * SECS_PER_DAY; } Some(total_secs) } pub fn to_binary(bcd: u8) -> u8 { (bcd & 0xf) + ((bcd >> 4) * 10) }
rtc_to_seconds
identifier_name
rtc_api.rs
#![allow(dead_code)] use bitflags::*; #[derive(Debug, rkyv::Archive, rkyv::Serialize, rkyv::Deserialize, Copy, Clone)] pub enum Weekday { Sunday, Monday, Tuesday, Wednesday, Thursday, Friday, Saturday, } impl Default for Weekday { fn default() -> Self { Weekday::Sunday } } #[derive(Debug, rkyv::Archive, rkyv::Serialize, rkyv::Deserialize)] pub enum TimeUnits { Seconds, Minutes, Hours, } #[derive(Debug, rkyv::Archive, rkyv::Serialize, rkyv::Deserialize, Copy, Clone, Default)] pub struct DateTime { pub seconds: u8, pub minutes: u8, pub hours: u8, pub days: u8, pub months: u8, pub years: u8, pub weekday: Weekday, } #[derive(Debug, rkyv::Archive, rkyv::Serialize, rkyv::Deserialize, Copy, Clone, Default)] pub struct RtcSessionOffset { pub rtc_seconds: u64, pub ticktimer_ms: u64, } pub const BLOCKING_I2C_TIMEOUT_MS: u64 = 50; pub const ABRTCMC_I2C_ADR: u8 = 0x68; pub const ABRTCMC_CONTROL1: u8 = 0x00; bitflags! { pub struct Control1: u8 { const CORRECTION_INT = 0b0000_0001; const ALARM_INT = 0b0000_0010; const SECONDS_INT = 0b0000_0100; const HR_MODE_12 = 0b0000_1000; const SOFT_RESET = 0b0001_0000; const STOP = 0b0010_0000; } } pub const ABRTCMC_CONTROL2: u8 = 0x01; bitflags! { pub struct Control2: u8 { const COUNTDOWN_B_INT = 0b0000_0001; const COUNTDOWN_A_INT = 0b0000_0010; const WATCHDOG_A_INT = 0b0000_0100; const ALARM_HAPPENED = 0b0000_1000; const SECONDS_HAPPENED= 0b0001_0000; const COUNTB_HAPPENED = 0b0010_0000; const COUNTA_HAPPENED = 0b0100_0000; const WATCHA_HAPPENED = 0b1000_0000; } } pub const ABRTCMC_CONTROL3: u8 = 0x02; bitflags! { pub struct Control3: u8 { const BATTLOW_INT = 0b0000_0001; const BATTSWITCH_INT = 0b0000_0010; const BATTLOW_STAT = 0b0000_0100; const BATTSW_HAPPENED = 0b0000_1000; const BATT_STD_BL_EN = 0b0000_0000; const BATT_DIR_BL_EN = 0b0010_0000; const BATT_DIS_BL_EN = 0b0100_0000; const BATT_STD_BL_DIS = 0b1000_0000; const BATT_DIR_BL_DIS = 0b1010_0000; const BATT_DI_BL_DIS = 0b1110_0000; } } pub const ABRTCMC_SECONDS: u8 = 0x3; bitflags! { pub struct Seconds: u8 { const SECONDS_BCD = 0b0111_1111; const CORRUPTED = 0b1000_0000; } } pub const ABRTCMC_MINUTES: u8 = 0x4; // no bitflags, minutes are BCD whole register pub const ABRTCMC_HOURS: u8 = 0x5; bitflags! { pub struct Hours: u8 { const HR12_HOURS_BCD = 0b0001_1111; const HR12_PM_FLAG = 0b0010_0000; const HR24_HOURS_BCD = 0b0011_1111; } } pub const ABRTCMC_DAYS: u8 = 0x6; // no bitflags, days are BCD whole register pub const ABRTCMC_WEEKDAYS: u8 = 0x7; bitflags! { pub struct Weekdays: u8 { const SUNDAY = 0b000; const MONDAY = 0b001; const TUESDAY = 0b010; const WEDNESDAY= 0b011; const THURSDAY = 0b100; const FRIDAY = 0b101; const SATURDAY = 0b110; } } pub const ABRTCMC_MONTHS: u8 = 0x8; bitflags! { pub struct Months: u8 { // BCD "months" const JANUARY = 0b0_0001; const FEBRUARY = 0b0_0010; const MARCH = 0b0_0011; const APRIL = 0b0_0100; const MAY = 0b0_0101; const JUNE = 0b0_0110; const JULY = 0b0_0111; const AUGUST = 0b0_1000; const SEPTEMBER = 0b0_1001; const OCTOBER = 0b1_0000; const NOVEMBER = 0b1_0001; const DECEMBER = 0b1_0010; } } pub const ABRTCMC_YEARS: u8 = 0x9; // no bitflags, years are 00-99 in BCD format pub const ABRTCMC_MINUTE_ALARM: u8 = 0xA; pub const ABRTCMC_HOUR_ALARM: u8 = 0xB; pub const ABRTCMC_DAY_ALARM: u8 = 0xC; pub const ABRTCMC_WEEKDAY_ALARM: u8 = 0xD; bitflags! { pub struct Alarm: u8 { const ENABLE = 0b1000_0000; // all others code minute/hour/day/weekday in BCD LSBs const HR12_PM_FLAG = 0b0010_0000; // only used in hours alarm, 12-hour mode } } pub const ABRTCMC_CONFIG: u8 = 0xF; bitflags! { pub struct Config: u8 { const TIMER_B_ENABLE = 0b0000_0001; const TIMER_A_WATCHDOG = 0b0000_0100; const TIMER_A_COUNTDWN = 0b0000_0010; const TIMER_A_DISABLE = 0b0000_0000; const TIMER_A_DISABLE2 = 0b0000_0110; const CLKOUT_32768_HZ = 0b0000_0000; const CLKOUT_16384_HZ = 0b0000_1000; const CLKOUT_8192_HZ = 0b0001_0000; const CLKOUT_4096_HZ = 0b0001_1000; const CLKOUT_1024_HZ = 0b0010_0000; const CLKOUT_32_HZ = 0b0010_1000; const CLKOUT_1_HZ = 0b0011_0000; const CLKOUT_DISABLE = 0b0011_1000; const TIMERB_INT_PULSED = 0b0100_0000; const TIMERA_SECONDS_INT_PULSED = 0b1000_0000; } } pub const ABRTCMC_TIMERA_CLK: u8 = 0x10; pub const ABRTCMC_TIMERB_CLK: u8 = 0x12; bitflags! { pub struct TimerClk: u8 { const CLK_3600_S = 0b0000_0100; const CLK_60_S = 0b0000_0011; const CLK_1_S = 0b0000_0010; const CLK_64_HZ = 0b0000_0001; // 15.625ms const CLK_4096_HZ = 0b0000_0000; // 0.2441ms const PULSE_46_MS = 0b0000_0000; const PULSE_62_MS = 0b0001_0000; const PULSE_78_MS = 0b0010_0000; const PULSE_93_MS = 0b0011_0000; const PULSE_125_MS = 0b0100_0000; const PULSE_156_MS = 0b0101_0000; const PULSE_187_MS = 0b0110_0000; const PULSE_218_MS = 0b0111_0000; } } pub const ABRTCMC_TIMERA: u8 = 0x11; // no bitflags, register is timer period in seconds, and the period is N / (source clock frequency) pub const ABRTCMC_TIMERB: u8 = 0x13; // no bitflags, register is timer period in seconds, and the period is N / (source clock frequency) /// This function takes the raw &[u8] as returned by the RTC I2C low level read function /// and converts it to a number of seconds. All hardware RTC readings are based off of the /// BCD equivalent of Jan 1 2000, 00:00:00, but keep in mind this is just an internal representation. /// We turn this into a u64 number of seconds because what we really want out of the hardware RTC /// is _just_ a count of seconds from some arbitrary but fixed start point, that we anchor through other /// algorithms to UTC. pub fn rtc_to_seconds(settings: &[u8]) -> Option<u64> { const CTL3: usize = 0; const SECS: usize = 1; const MINS: usize = 2; const HOURS: usize = 3; const DAYS: usize = 4; // note 5 is skipped - this is weekdays, and is unused const MONTHS: usize = 6; const YEARS: usize = 7; if ((settings[CTL3] & 0xE0)!= crate::RTC_PWR_MODE) // power switchover setting should be initialized || (settings[SECS] & 0x80!= 0) { // clock integrity should be guaranteed log::error!("RTC is in an uninitialized state!, {:x?}", settings); return None; } // this is a secondary check -- I have seen RTC return nonsense time results before // so this is an extra check above and beyond what's in the datasheet if (to_binary(settings[SECS]) > 59) || (to_binary(settings[MINS]) > 59) || (to_binary(settings[HOURS]) > 23) // 24 hour mode is default and assumed || (to_binary(settings[DAYS]) > 31) || (to_binary(settings[DAYS]) == 0) || (to_binary(settings[MONTHS]) > 12) || (to_binary(settings[MONTHS]) == 0) || (to_binary(settings[YEARS]) > 99) { log::error!("RTC has invalid digits!: {:?}", settings); return None; } let mut total_secs: u64 = 0; total_secs += to_binary(settings[SECS]) as u64; total_secs += to_binary(settings[MINS]) as u64 * 60; total_secs += to_binary(settings[HOURS]) as u64 * 3600; const SECS_PER_DAY: u64 = 86400; // DAYS is checked to be 1-31, so, it's safe to subtract 1 here total_secs += (to_binary(settings[DAYS]) as u64 - 1) * SECS_PER_DAY; // this will iterate from 0 through 11; december never has an offset added, because its contribution is directly measured in DAYS for month in 0..to_binary(settings[MONTHS]) { match month { 0 => total_secs += 0u64, 1 => total_secs += 31u64 * SECS_PER_DAY, 2 => { // per spec sheet: 1) If the year counter contains a value which is exactly divisible by 4 (including the year 00), // the AB-RTCMC-32.768kHz-B5ZE-S3 compensates for leap years by adding a 29th day to February. if (to_binary(settings[YEARS]) % 4) == 0 { total_secs += 29u64 * SECS_PER_DAY; } else { total_secs += 28u64 * SECS_PER_DAY; }; }, 3 => total_secs += 31u64 * SECS_PER_DAY, 4 => total_secs += 30u64 * SECS_PER_DAY, 5 => total_secs += 31u64 * SECS_PER_DAY, 6 => total_secs += 30u64 * SECS_PER_DAY, 7 => total_secs += 31u64 * SECS_PER_DAY, 8 => total_secs += 31u64 * SECS_PER_DAY, 9 => total_secs += 30u64 * SECS_PER_DAY, 10 => total_secs += 31u64 * SECS_PER_DAY, 11 => total_secs += 30u64 * SECS_PER_DAY, // December shoud never be encountered in this loop since it's right-exclusive _ => panic!("RTC code has an internal error, months encountered an 'impossible' value"), } } // figure out what the last round multiple of leap years was before the current time let last_leap = (to_binary(settings[YEARS]) - to_binary(settings[YEARS]) % 4) as u64; // now add the contributions of all these prior years total_secs += (last_leap / 4) * (365 * 3 + 366) * SECS_PER_DAY; // now add the contributions of any years since the last round multiple of leap years if to_binary(settings[YEARS]) % 4!= 0 { // account for the leap year total_secs += 366 * SECS_PER_DAY; // now account for successive years total_secs += 365 * (((to_binary(settings[YEARS]) % 4) - 1) as u64) * SECS_PER_DAY; } Some(total_secs)
pub fn to_binary(bcd: u8) -> u8 { (bcd & 0xf) + ((bcd >> 4) * 10) }
}
random_line_split
mod.rs
//! Extensions to [`Target`](super::Target) which add support for various //! subsets of the GDB Remote Serial Protocol. //! //! ### Note: Missing Protocol Extensions //! //! `gdbstub`'s development is guided by the needs of its contributors, with //! new features being added on an "as-needed" basis. //! //! If there's a GDB protocol extensions you're interested in that hasn't been //! implemented in `gdbstub` yet, (e.g: remote filesystem access, tracepoint //! support, etc...), consider opening an issue / filing a PR on GitHub! //! //! Check out the [GDB Remote Configuration Docs](https://sourceware.org/gdb/onlinedocs/gdb/Remote-Configuration.html) //! for a table of GDB commands + their corresponding Remote Serial Protocol //! packets. //! //! ## How Protocol Extensions Work - Inlineable Dyn Extension Traits (IDETs) //! //! The GDB protocol is massive, and contains all sorts of optional //! functionality. In the early versions of `gdbstub`, the `Target` trait //! directly had a method for _every single protocol extension_, which if taken
//! methods! //! //! Aside from the cognitive complexity of having so many methods on a single //! trait, this approach had numerous other drawbacks as well: //! //! - Implementations that did not implement all available protocol extensions //! still had to "pay" for the unused packet parsing/handler code, resulting //! in substantial code bloat, even on `no_std` platforms. //! - `GdbStub`'s internal implementation needed to include _runtime_ checks to //! deal with incorrectly implemented `Target`s. //! - No way to enforce "mutually-dependent" trait methods at compile-time. //! - e.g: When implementing hardware breakpoint extensions, targets //! _must_ implement both the `add_breakpoint` and //! `remove_breakpoints` methods. //! - No way to enforce "mutually-exclusive" trait methods at compile-time. //! - e.g: The `resume` method for single-threaded targets has a much //! simpler API than for multi-threaded targets, but it would be //! incorrect for a target to implement both. //! //! At first blush, it seems the the solution to all these issues is obvious: //! simply tie each protocol extension to a `cargo` feature! And yes, while //! would would indeed work, there would be several serious ergonomic drawbacks: //! //! - There would be _hundreds_ of individual feature flags that would need to //! be toggled by end users. //! - It would be functionally impossible to _test_ all permutations of //! enabled/disabled cargo features. //! - A single binary would need to rely on some [non-trivial `cargo`-fu](https://github.com/rust-lang/cargo/issues/674) //! in order to have multiple `Target` implementations in a single binary. //! //! After much experimentation and iteration, `gdbstub` ended up taking a //! radically different approach to implementing and enumerating available //! features, using a technique called **Inlineable Dyn Extension Traits**. //! //! > _Author's note:_ As far as I can tell, this isn't a very well-known trick, //! or at the very least, I've personally never encountered any library that //! uses this sort of API. As such, I've decided to be a bit cheeky and give it //! a name! At some point, I'm hoping to write a standalone blog post which //! further explores this technique, comparing it to other/existing approaches, //! and diving into details of the how the compiler optimizes this sort of code. //! In fact, I've already got a [very rough github repo](https://github.com/daniel5151/optional-trait-methods) with some of my //! findings. //! //! So, what are "Inlineable Dyn Extension Traits"? Well, let's break it down: //! //! - **Extension Traits** - A common [Rust convention](https://rust-lang.github.io/rfcs/0445-extension-trait-conventions.html#what-is-an-extension-trait) //! to extend the functionality of a Trait, _without_ modifying the original //! trait. //! - **Dyn** - Alludes to the use of Dynamic Dispatch via [Trait Objects](https://doc.rust-lang.org/book/ch17-02-trait-objects.html). //! - **Inlineable** - Alludes to the fact that this approach can be easily //! inlined, making it a truly zero-cost abstraction. //! //! In a nutshell, Inlineable Dyn Extension Traits (or IDETs) are an abuse of //! the Rust trait system + modern compiler optimizations to emulate zero-cost, //! runtime-enumerable optional trait methods! //! //! #### Technical overview //! //! The basic principles behind Inlineable Dyn Extension Traits are best //! explained though example: //! //! Lets say we want to add an optional protocol extension described by an //! `ProtocolExt` trait to a base `Protocol` trait. How would we do that using //! IDETs? //! //! - (library) Define a `trait ProtocolExt: Protocol {... }` which includes //! all the methods required by the protocol extension: //! - _Note:_ Making `ProtocolExt` a subtrait of `Protocol` is not strictly //! required, but it does enable transparently using `Protocol`'s //! associated types as part of `ProtocolExt`'s method definitions. //! //! ```rust,ignore //! /// `foo` and `bar` are mutually-dependent methods. //! trait ProtocolExt: Protocol { //! fn foo(&self); //! // can use associated types in method signature! //! fn bar(&mut self) -> Result<(), Self::Error>; //! } //! ``` //! //! - (library) "Associate" the `ProtocolExt` extension trait to the original //! `Protocol` trait by adding a new `Protocol` method that "downcasts" `self` //! into a `&mut dyn ProtocolExt`. //! //! ```rust,ignore //! trait Protocol { //! //... other methods... //! //! // Optional extension //! #[inline(always)] //! fn get_protocol_ext(&mut self) -> Option<ProtocolExtOps<Self>> { //! // disabled by default //! None //! } //! //! // Mutually-exclusive extensions //! fn get_ext_a_or_b(&mut self) -> EitherOrExt<Self::Arch, Self::Error>; //! } //! //! // Using a typedef for readability //! type ProtocolExtOps<T> = //! &'a mut dyn ProtocolExt<Arch = <T as Protocol>::Arch, Error = <T as Protocol>::Error>; //! //! enum EitherOrExt<A, E> { //! ProtocolExtA(&'a mut dyn ProtocolExtA<Arch = A, Error = E>), //! ProtocolExtB(&'a mut dyn ProtocolExtB<Arch = A, Error = E>), //! } //! ``` //! //! - (user) Implements the `ProtocolExt` extension for their target (just like //! a normal trait). //! //! ```rust,ignore //! impl ProtocolExt for MyTarget { //! fn foo(&self) {... } //! fn bar(&mut self) -> Result<(), Self::Error> {... } //! } //! ``` //! //! - (user) Implements the base `Protocol` trait, overriding the //! `get_protocol_ext` method to return `Some(self)`, which will effectively //! "enable" the extension. //! //! ```rust,ignore //! impl Protocol for MyTarget { //! // Optional extension //! #[inline(always)] //! fn get_protocol_ext(&mut self) -> Option<ProtocolExtOps<Self>> { //! Some(self) // will not compile unless `MyTarget` also implements `ProtocolExt` //! } //! //! // Mutually-exclusive extensions //! #[inline(always)] //! fn get_ext_a_or_b(&mut self) -> EitherOrExt<Self::Arch, Self::Error> { //! EitherOrExt::ProtocolExtA(self) //! } //! } //! ``` //! //! > Please note the use of `#[inline(always)]` when enabling IDET methods. //! While LLVM is usually smart enough to inline single-level IDETs (such as in //! the example above), nested IDETs will often require a bit of "help" from the //! `inline` directive to be correctly optimized. //! //! Now, here's where IDETs really shine: If the user didn't implement //! `ProtocolExt`, but _did_ try to enable the feature by overriding //! `get_protocol_ext` to return `Some(self)`, they'll get a compile-time error //! that looks something like this: //! //! ```text //! error[E0277]: the trait bound `MyTarget: ProtocolExt` is not satisfied //! --> path/to/implementation.rs:44:14 //! | //! 44 | Some(self) //! | ^^^^ the trait `ProtocolExt` is not implemented for `MyTarget` //! | //! = note: required for the cast to the object type `dyn ProtocolExt<Arch =..., Error =...>` //! ``` //! //! The Rust compiler is preventing you from enabling a feature you haven't //! implemented _at compile time!_ //! //! - (library) Is able to _query_ whether or not an extension is available, //! _without_ having to actually invoke any method on the target! //! //! ```rust,ignore //! fn execute_protocol(mut target: impl Target) { //! match target.get_protocol_ext() { //! Some(ops) => ops.foo(), //! None => { /* fallback when not enabled */ } //! } //! } //! ``` //! //! This is already pretty cool, but what's _even cooler_ is that if you take a //! look at the generated assembly of a monomorphized `execute_protocol` method //! (e.g: using godbolt.org), you'll find that the compiler is able to //! efficiently inline and devirtualize _all_ the calls to `get_protocol_ext` //! method, which in-turn allows the dead-code-eliminator to work its magic, and //! remove the unused branches from the generated code! i.e: If a target //! implemention didn't implement the `ProtocolExt` extension, then that `match` //! statement in `execute_protocol` would simply turn into a noop! //! //! If IDETs are something you're interested in, consider checking out //! [daniel5151/optional-trait-methods](https://github.com/daniel5151/optional-trait-methods) //! for some sample code that shows off the power of IDETs. It's not //! particularly polished, but it does includes code snippets which can be //! pasted into godbolt.org directly to confirm the optimizations described //! above, and a brief writeup which compares / contrasts alternatives to IDETs. //! //! Long story short: Optimizing compilers really are magic! //! //! #### Summary: The Benefits of IDETs //! //! IDETs solve the numerous issues and shortcomings that arise from the //! traditional single trait + "optional" methods approach: //! //! - **Compile-time enforcement of mutually-dependent methods** //! - By grouping mutually-dependent methods behind a single extension trait //! and marking them all as required methods, the Rust compiler is able to //! catch missing mutually-dependent methods at compile time, with no need //! for any runtime checks! //! - **Compile-time enforcement of mutually-exclusive methods** //! - By grouping mutually-exclusive methods behind two extension traits, and //! wrapping those in an `enum`, the API is able to document //! mutually-exclusive functions _at the type-level_, in-turn enabling the //! library to omit any runtime checks! //! - _Note:_ Strictly speaking, this isn't really compile time //! "enforcement", as there's nothing stopping an "adversarial" //! implementation from implementing both sets of methods, and then //! "flipping" between the two at runtime. Nonetheless, it serves as a good //! guardrail. //! - **Enforce dead-code-elimination _without_ `cargo` feature flags** //! - This is a really awesome trick: by wrapping code in a `if //! target.get_protocol_ext().is_some()` block, it's possible to specify //! _arbitrary_ blocks of code to be feature-dependent! //! - This is used to great effect in `gdbstub` to optimize-out any packet //! parsing / handler code for unimplemented protocol extensions. macro_rules! doc_comment { ($x:expr, $($tt:tt)*) => { #[doc = $x] $($tt)* }; } macro_rules! define_ext { ($extname:ident, $exttrait:ident) => { doc_comment! { concat!("See [`", stringify!($exttrait), "`](trait.", stringify!($exttrait), ".html)."), pub type $extname<'a, T> = &'a mut dyn $exttrait<Arch = <T as Target>::Arch, Error = <T as Target>::Error>; } }; } pub mod base; pub mod breakpoints; pub mod catch_syscalls; pub mod extended_mode; pub mod memory_map; pub mod monitor_cmd; pub mod section_offsets; pub mod target_description_xml_override;
//! to the extreme, would have resulted in literally _hundreds_ of associated
random_line_split
main.rs
extern crate cgmath; extern crate euclid; extern crate gleam; extern crate glutin; extern crate image; extern crate lodepng; extern crate offscreen_gl_context; #[macro_use] extern crate vulkano; extern crate vulkano_win; extern crate winit; use euclid::Size2D; use gleam::gl; use offscreen_gl_context::{ColorAttachmentType, GLContext, GLContextAttributes, NativeGLContext}; use std::time::Duration; use vulkano_win::VkSurfaceBuild; use std::cell::Cell; struct GlHandles { pub vao: Cell<gl::GLuint>, pub vbos: Cell<[gl::GLuint; 2]>, pub program: Cell<gl::GLuint>, pub scale: Cell<f32>, } impl GlHandles { fn new() -> GlHandles { GlHandles { vao: Cell::new(0 as gl::GLuint), vbos: Cell::new([0,0]), program: Cell::new(0 as gl::GLuint), scale: Cell::new(0.0), } } } const CLEAR_COLOR: (f32, f32, f32, f32) = (0.0, 0.2, 0.3, 1.0); const WIN_WIDTH: i32 = 256; const WIN_HEIGTH: i32 = 256; const VS_SHADER: &'static str = " #version 150 core in vec2 a_Pos; in vec3 a_Color; uniform mat4 scale; out vec4 v_Color; void main() {
gl_Position = scale * vec4(0.5 * a_Pos, 0.0, 1.0); } "; const FS_SHADER: &'static str = " #version 150 core in vec4 v_Color; out vec4 Target0; void main() { Target0 = v_Color; } "; const VERTICES: &'static [[f32;2];3] = &[ [-1.0, -0.57], [ 1.0, -0.57], [ 0.0, 1.15] ]; const COLORS: &'static [[f32;3];3] = &[ [1.0, 0.0, 0.0], [0.0, 1.0, 0.0], [0.0, 0.0, 1.0] ]; fn add_shader(program: gl::GLuint, src: &str, ty: gl::GLenum) { let id = unsafe { gl::CreateShader(ty) }; if id == (0 as gl::GLuint) { panic!("Failed to create shader type: {:?}", ty); } let mut source = Vec::new(); source.extend_from_slice(src.as_bytes()); gl::shader_source(id, &[&source[..]]); gl::compile_shader(id); let log = gl::get_shader_info_log(id); if gl::get_shader_iv(id, gl::COMPILE_STATUS) == (0 as gl::GLint) { panic!("Failed to compile shader:\n{}", log); } else { if!log.is_empty() { println!("Warnings detected on shader:\n{}", log); } gl::attach_shader(program, id); } } fn compile_shaders(handles: &GlHandles) { handles.program.set(gl::create_program()); if handles.program.get() == (0 as gl::GLuint) { panic!("Failed to create shader program"); } add_shader(handles.program.get(), VS_SHADER, gl::VERTEX_SHADER); add_shader(handles.program.get(), FS_SHADER, gl::FRAGMENT_SHADER); gl::link_program(handles.program.get()); if gl::get_program_iv(handles.program.get(), gl::LINK_STATUS) == (0 as gl::GLint) { let error_log = gl::get_program_info_log(handles.program.get()); panic!("Failed to link shader program: \n{}", error_log); } gl::validate_program(handles.program.get()); if gl::get_program_iv(handles.program.get(), gl::VALIDATE_STATUS) == (0 as gl::GLint) { let error_log = gl::get_program_info_log(handles.program.get()); panic!("Failed to validate shader program: \n{}", error_log); } gl::use_program(handles.program.get()); } fn gl_draw(handles: &GlHandles) { gl::clear_color(CLEAR_COLOR.0, CLEAR_COLOR.1, CLEAR_COLOR.2, CLEAR_COLOR.3); gl::clear(gl::COLOR_BUFFER_BIT); gl::bind_buffer(gl::ARRAY_BUFFER, handles.vbos.get()[0]); gl::buffer_data(gl::ARRAY_BUFFER, VERTICES, gl::STATIC_DRAW); gl::vertex_attrib_pointer(0 as gl::GLuint, 2, gl::FLOAT, false, 0 as gl::GLint, 0); gl::enable_vertex_attrib_array(0 as gl::GLuint); gl::bind_buffer(gl::ARRAY_BUFFER, handles.vbos.get()[1]); gl::buffer_data(gl::ARRAY_BUFFER, COLORS, gl::STATIC_DRAW); gl::vertex_attrib_pointer(1 as gl::GLuint, 3, gl::FLOAT, false, 0 as gl::GLint, 0); gl::enable_vertex_attrib_array(1 as gl::GLuint); handles.scale.set(handles.scale.get() + 0.01); let scale = handles.scale.get(); let rot_matrix = [ scale.cos(), -1.0 * scale.sin(), 0.0, 0.0, scale.sin(), scale.cos(), 0.0, 0.0, 0.0, 0.0, 1.0, 0.0, 0.0, 0.0, 0.0, 1.0 ]; let scale_pos = gl::get_uniform_location(handles.program.get(), "scale"); gl::uniform_matrix_4fv(scale_pos, false, &rot_matrix); gl::draw_arrays(gl::TRIANGLES, 0, 3); } pub fn main() { gl::load_with(|s| GLContext::<NativeGLContext>::get_proc_address(s) as *const _); let offscreen_ctx = GLContext::<NativeGLContext>::new(Size2D::new(256, 256), GLContextAttributes::default(), ColorAttachmentType::Renderbuffer, None).unwrap(); offscreen_ctx.make_current().unwrap(); let handles: GlHandles = GlHandles::new(); // Create VAO and VBOs handles.vao.set(gl::gen_vertex_arrays(1)[0]); gl::bind_vertex_array(handles.vao.get()); let buffer_ids = gl::gen_buffers(2); handles.vbos.set([buffer_ids[0], buffer_ids[1]]); compile_shaders(&handles); // Create FBO and bind it let fbo = gl::gen_framebuffers(1)[0]; gl::bind_framebuffer(gl::FRAMEBUFFER, fbo); let extensions = vulkano_win::required_extensions(); let instance = vulkano::instance::Instance::new(None, &extensions, &[]).expect("failed to create instance"); let physical = vulkano::instance::PhysicalDevice::enumerate(&instance) .next().expect("no device available"); println!("Using device: {} (type: {:?})", physical.name(), physical.ty()); let window = winit::WindowBuilder::new().build_vk_surface(&instance).unwrap(); let queue = physical.queue_families().find(|q| q.supports_graphics() && window.surface().is_supported(q).unwrap_or(false)) .expect("couldn't find a graphical queue family"); let device_ext = vulkano::device::DeviceExtensions { khr_swapchain: true, .. vulkano::device::DeviceExtensions::none() }; let (device, mut queues) = vulkano::device::Device::new(&physical, physical.supported_features(), &device_ext, [(queue, 0.5)].iter().cloned()) .expect("failed to create device"); let queue = queues.next().unwrap(); let (swapchain, images) = { let caps = window.surface().get_capabilities(&physical).expect("failed to get surface capabilities"); let dimensions = caps.current_extent.unwrap_or([WIN_WIDTH as u32, WIN_HEIGTH as u32]); let present = caps.present_modes.iter().next().unwrap(); let usage = caps.supported_usage_flags; vulkano::swapchain::Swapchain::new(&device, &window.surface(), caps.min_image_count, vulkano::format::B8G8R8A8Srgb, dimensions, 1, &usage, &queue, vulkano::swapchain::SurfaceTransform::Identity, vulkano::swapchain::CompositeAlpha::Opaque, present, true, None).expect("failed to create swapchain") }; #[derive(Debug, Clone)] struct Vertex { position: [f32; 2] } impl_vertex!(Vertex, position); let vertex_buffer = vulkano::buffer::cpu_access::CpuAccessibleBuffer::<[Vertex]> ::from_iter(&device, &vulkano::buffer::BufferUsage::all(), Some(queue.family()), [ Vertex { position: [-0.5, -0.5 ] }, Vertex { position: [-0.5, 0.5 ] }, Vertex { position: [ 0.5, -0.5 ] }, Vertex { position: [ 0.5, 0.5 ] }, ].iter().cloned()).expect("failed to create buffer"); mod vs { include!{concat!(env!("OUT_DIR"), "/shaders/src/shader/image_vs.glsl")} } let vs = vs::Shader::load(&device).expect("failed to create shader module"); mod fs { include!{concat!(env!("OUT_DIR"), "/shaders/src/shader/image_fs.glsl")} } let fs = fs::Shader::load(&device).expect("failed to create shader module"); mod renderpass { single_pass_renderpass!{ attachments: { color: { load: Clear, store: Store, format: ::vulkano::format::B8G8R8A8Srgb, } }, pass: { color: [color], depth_stencil: {} } } } let renderpass = renderpass::CustomRenderPass::new(&device, &renderpass::Formats { color: (vulkano::format::B8G8R8A8Srgb, 1) }).unwrap(); let texture = vulkano::image::immutable::ImmutableImage::new(&device, vulkano::image::Dimensions::Dim2d { width: WIN_WIDTH as u32, height: WIN_HEIGTH as u32 }, vulkano::format::R8G8B8A8Unorm, Some(queue.family())).unwrap(); let sampler = vulkano::sampler::Sampler::new(&device, vulkano::sampler::Filter::Linear, vulkano::sampler::Filter::Linear, vulkano::sampler::MipmapMode::Nearest, vulkano::sampler::SamplerAddressMode::Repeat, vulkano::sampler::SamplerAddressMode::Repeat, vulkano::sampler::SamplerAddressMode::Repeat, 0.0, 1.0, 0.0, 0.0).unwrap(); let descriptor_pool = vulkano::descriptor::descriptor_set::DescriptorPool::new(&device); mod pipeline_layout { pipeline_layout!{ set0: { tex: CombinedImageSampler } } } let pipeline_layout = pipeline_layout::CustomPipeline::new(&device).unwrap(); let set = pipeline_layout::set0::Set::new(&descriptor_pool, &pipeline_layout, &pipeline_layout::set0::Descriptors { tex: (&sampler, &texture) }); let pipeline = vulkano::pipeline::GraphicsPipeline::new(&device, vulkano::pipeline::GraphicsPipelineParams { vertex_input: vulkano::pipeline::vertex::SingleBufferDefinition::new(), vertex_shader: vs.main_entry_point(), input_assembly: vulkano::pipeline::input_assembly::InputAssembly { topology: vulkano::pipeline::input_assembly::PrimitiveTopology::TriangleStrip, primitive_restart_enable: false, }, tessellation: None, geometry_shader: None, viewport: vulkano::pipeline::viewport::ViewportsState::Fixed { data: vec![( vulkano::pipeline::viewport::Viewport { origin: [0.0, 0.0], depth_range: 0.0.. 1.0, dimensions: [images[0].dimensions()[0] as f32, images[0].dimensions()[1] as f32], }, vulkano::pipeline::viewport::Scissor::irrelevant() )], }, raster: Default::default(), multisample: vulkano::pipeline::multisample::Multisample::disabled(), fragment_shader: fs.main_entry_point(), depth_stencil: vulkano::pipeline::depth_stencil::DepthStencil::disabled(), blend: vulkano::pipeline::blend::Blend::pass_through(), layout: &pipeline_layout, render_pass: vulkano::framebuffer::Subpass::from(&renderpass, 0).unwrap(), }).unwrap(); let framebuffers = images.iter().map(|image| { let attachments = renderpass::AList { color: &image, }; vulkano::framebuffer::Framebuffer::new(&renderpass, [images[0].dimensions()[0], images[0].dimensions()[1], 1], attachments).unwrap() }).collect::<Vec<_>>(); 'main: loop { // Draw in the FBO and read the pixel data from it gl_draw(&handles); // Create renderbuffer for color data let color_render_buffer = gl::gen_renderbuffers(1)[0]; gl::bind_renderbuffer(gl::RENDERBUFFER, color_render_buffer); gl::renderbuffer_storage(gl::RENDERBUFFER, gl::RGBA, WIN_WIDTH, WIN_HEIGTH); gl::framebuffer_renderbuffer(gl::FRAMEBUFFER, gl::COLOR_ATTACHMENT0, gl::RENDERBUFFER, color_render_buffer); if gl::check_frame_buffer_status(gl::FRAMEBUFFER)!= gl::FRAMEBUFFER_COMPLETE { panic!("Something went wrong :/."); } let pixel_data = gl::read_pixels(0, 0, WIN_WIDTH, WIN_HEIGTH, gl::RGBA, gl::UNSIGNED_BYTE); let pixel_buffer = { let image_data_chunks = pixel_data.chunks(4).map(|c| [c[0], c[1], c[2], c[3]]); vulkano::buffer::cpu_access::CpuAccessibleBuffer::<[[u8;4]]> ::from_iter(&device, &vulkano::buffer::BufferUsage::all(), Some(queue.family()), image_data_chunks) .expect("failed to create buffer") }; let command_buffers = framebuffers.iter().map(|framebuffer| { vulkano::command_buffer::PrimaryCommandBufferBuilder::new(&device, queue.family()) .copy_buffer_to_color_image(&pixel_buffer, &texture, 0, 0.. 1, [0, 0, 0], [texture.dimensions().width(), texture.dimensions().height(), 1]) //.clear_color_image(&texture, [0.0, 1.0, 0.0, 1.0]) .draw_inline(&renderpass, &framebuffer, renderpass::ClearValues { color: [0.0, 0.0, 1.0, 1.0] }) .draw(&pipeline, &vertex_buffer, &vulkano::command_buffer::DynamicState::none(), &set, &()) .draw_end() .build() }).collect::<Vec<_>>(); let image_num = swapchain.acquire_next_image(Duration::new(10, 0)).unwrap(); vulkano::command_buffer::submit(&command_buffers[image_num], &queue).unwrap(); swapchain.present(&queue, image_num).unwrap(); for ev in window.window().poll_events() { match ev { winit::Event::Closed => break'main, _ => () } } } // Free gl resources gl::use_program(0); gl::disable_vertex_attrib_array(0); gl::disable_vertex_attrib_array(1); gl::disable_vertex_attrib_array(2); // gl::detach_shader(handles.program.get(), vertexshader); // gl::detach_shader(handles.program.get(), fragmentshader); // gl::delete_shader(vertexshader); // gl::delete_shader(fragmentshader); gl::delete_program(handles.program.get()); gl::delete_buffers(&handles.vbos.get()); gl::delete_vertex_arrays(&[handles.vao.get()]); }
v_Color = vec4(a_Color, 1.0);
random_line_split
main.rs
extern crate cgmath; extern crate euclid; extern crate gleam; extern crate glutin; extern crate image; extern crate lodepng; extern crate offscreen_gl_context; #[macro_use] extern crate vulkano; extern crate vulkano_win; extern crate winit; use euclid::Size2D; use gleam::gl; use offscreen_gl_context::{ColorAttachmentType, GLContext, GLContextAttributes, NativeGLContext}; use std::time::Duration; use vulkano_win::VkSurfaceBuild; use std::cell::Cell; struct GlHandles { pub vao: Cell<gl::GLuint>, pub vbos: Cell<[gl::GLuint; 2]>, pub program: Cell<gl::GLuint>, pub scale: Cell<f32>, } impl GlHandles { fn
() -> GlHandles { GlHandles { vao: Cell::new(0 as gl::GLuint), vbos: Cell::new([0,0]), program: Cell::new(0 as gl::GLuint), scale: Cell::new(0.0), } } } const CLEAR_COLOR: (f32, f32, f32, f32) = (0.0, 0.2, 0.3, 1.0); const WIN_WIDTH: i32 = 256; const WIN_HEIGTH: i32 = 256; const VS_SHADER: &'static str = " #version 150 core in vec2 a_Pos; in vec3 a_Color; uniform mat4 scale; out vec4 v_Color; void main() { v_Color = vec4(a_Color, 1.0); gl_Position = scale * vec4(0.5 * a_Pos, 0.0, 1.0); } "; const FS_SHADER: &'static str = " #version 150 core in vec4 v_Color; out vec4 Target0; void main() { Target0 = v_Color; } "; const VERTICES: &'static [[f32;2];3] = &[ [-1.0, -0.57], [ 1.0, -0.57], [ 0.0, 1.15] ]; const COLORS: &'static [[f32;3];3] = &[ [1.0, 0.0, 0.0], [0.0, 1.0, 0.0], [0.0, 0.0, 1.0] ]; fn add_shader(program: gl::GLuint, src: &str, ty: gl::GLenum) { let id = unsafe { gl::CreateShader(ty) }; if id == (0 as gl::GLuint) { panic!("Failed to create shader type: {:?}", ty); } let mut source = Vec::new(); source.extend_from_slice(src.as_bytes()); gl::shader_source(id, &[&source[..]]); gl::compile_shader(id); let log = gl::get_shader_info_log(id); if gl::get_shader_iv(id, gl::COMPILE_STATUS) == (0 as gl::GLint) { panic!("Failed to compile shader:\n{}", log); } else { if!log.is_empty() { println!("Warnings detected on shader:\n{}", log); } gl::attach_shader(program, id); } } fn compile_shaders(handles: &GlHandles) { handles.program.set(gl::create_program()); if handles.program.get() == (0 as gl::GLuint) { panic!("Failed to create shader program"); } add_shader(handles.program.get(), VS_SHADER, gl::VERTEX_SHADER); add_shader(handles.program.get(), FS_SHADER, gl::FRAGMENT_SHADER); gl::link_program(handles.program.get()); if gl::get_program_iv(handles.program.get(), gl::LINK_STATUS) == (0 as gl::GLint) { let error_log = gl::get_program_info_log(handles.program.get()); panic!("Failed to link shader program: \n{}", error_log); } gl::validate_program(handles.program.get()); if gl::get_program_iv(handles.program.get(), gl::VALIDATE_STATUS) == (0 as gl::GLint) { let error_log = gl::get_program_info_log(handles.program.get()); panic!("Failed to validate shader program: \n{}", error_log); } gl::use_program(handles.program.get()); } fn gl_draw(handles: &GlHandles) { gl::clear_color(CLEAR_COLOR.0, CLEAR_COLOR.1, CLEAR_COLOR.2, CLEAR_COLOR.3); gl::clear(gl::COLOR_BUFFER_BIT); gl::bind_buffer(gl::ARRAY_BUFFER, handles.vbos.get()[0]); gl::buffer_data(gl::ARRAY_BUFFER, VERTICES, gl::STATIC_DRAW); gl::vertex_attrib_pointer(0 as gl::GLuint, 2, gl::FLOAT, false, 0 as gl::GLint, 0); gl::enable_vertex_attrib_array(0 as gl::GLuint); gl::bind_buffer(gl::ARRAY_BUFFER, handles.vbos.get()[1]); gl::buffer_data(gl::ARRAY_BUFFER, COLORS, gl::STATIC_DRAW); gl::vertex_attrib_pointer(1 as gl::GLuint, 3, gl::FLOAT, false, 0 as gl::GLint, 0); gl::enable_vertex_attrib_array(1 as gl::GLuint); handles.scale.set(handles.scale.get() + 0.01); let scale = handles.scale.get(); let rot_matrix = [ scale.cos(), -1.0 * scale.sin(), 0.0, 0.0, scale.sin(), scale.cos(), 0.0, 0.0, 0.0, 0.0, 1.0, 0.0, 0.0, 0.0, 0.0, 1.0 ]; let scale_pos = gl::get_uniform_location(handles.program.get(), "scale"); gl::uniform_matrix_4fv(scale_pos, false, &rot_matrix); gl::draw_arrays(gl::TRIANGLES, 0, 3); } pub fn main() { gl::load_with(|s| GLContext::<NativeGLContext>::get_proc_address(s) as *const _); let offscreen_ctx = GLContext::<NativeGLContext>::new(Size2D::new(256, 256), GLContextAttributes::default(), ColorAttachmentType::Renderbuffer, None).unwrap(); offscreen_ctx.make_current().unwrap(); let handles: GlHandles = GlHandles::new(); // Create VAO and VBOs handles.vao.set(gl::gen_vertex_arrays(1)[0]); gl::bind_vertex_array(handles.vao.get()); let buffer_ids = gl::gen_buffers(2); handles.vbos.set([buffer_ids[0], buffer_ids[1]]); compile_shaders(&handles); // Create FBO and bind it let fbo = gl::gen_framebuffers(1)[0]; gl::bind_framebuffer(gl::FRAMEBUFFER, fbo); let extensions = vulkano_win::required_extensions(); let instance = vulkano::instance::Instance::new(None, &extensions, &[]).expect("failed to create instance"); let physical = vulkano::instance::PhysicalDevice::enumerate(&instance) .next().expect("no device available"); println!("Using device: {} (type: {:?})", physical.name(), physical.ty()); let window = winit::WindowBuilder::new().build_vk_surface(&instance).unwrap(); let queue = physical.queue_families().find(|q| q.supports_graphics() && window.surface().is_supported(q).unwrap_or(false)) .expect("couldn't find a graphical queue family"); let device_ext = vulkano::device::DeviceExtensions { khr_swapchain: true, .. vulkano::device::DeviceExtensions::none() }; let (device, mut queues) = vulkano::device::Device::new(&physical, physical.supported_features(), &device_ext, [(queue, 0.5)].iter().cloned()) .expect("failed to create device"); let queue = queues.next().unwrap(); let (swapchain, images) = { let caps = window.surface().get_capabilities(&physical).expect("failed to get surface capabilities"); let dimensions = caps.current_extent.unwrap_or([WIN_WIDTH as u32, WIN_HEIGTH as u32]); let present = caps.present_modes.iter().next().unwrap(); let usage = caps.supported_usage_flags; vulkano::swapchain::Swapchain::new(&device, &window.surface(), caps.min_image_count, vulkano::format::B8G8R8A8Srgb, dimensions, 1, &usage, &queue, vulkano::swapchain::SurfaceTransform::Identity, vulkano::swapchain::CompositeAlpha::Opaque, present, true, None).expect("failed to create swapchain") }; #[derive(Debug, Clone)] struct Vertex { position: [f32; 2] } impl_vertex!(Vertex, position); let vertex_buffer = vulkano::buffer::cpu_access::CpuAccessibleBuffer::<[Vertex]> ::from_iter(&device, &vulkano::buffer::BufferUsage::all(), Some(queue.family()), [ Vertex { position: [-0.5, -0.5 ] }, Vertex { position: [-0.5, 0.5 ] }, Vertex { position: [ 0.5, -0.5 ] }, Vertex { position: [ 0.5, 0.5 ] }, ].iter().cloned()).expect("failed to create buffer"); mod vs { include!{concat!(env!("OUT_DIR"), "/shaders/src/shader/image_vs.glsl")} } let vs = vs::Shader::load(&device).expect("failed to create shader module"); mod fs { include!{concat!(env!("OUT_DIR"), "/shaders/src/shader/image_fs.glsl")} } let fs = fs::Shader::load(&device).expect("failed to create shader module"); mod renderpass { single_pass_renderpass!{ attachments: { color: { load: Clear, store: Store, format: ::vulkano::format::B8G8R8A8Srgb, } }, pass: { color: [color], depth_stencil: {} } } } let renderpass = renderpass::CustomRenderPass::new(&device, &renderpass::Formats { color: (vulkano::format::B8G8R8A8Srgb, 1) }).unwrap(); let texture = vulkano::image::immutable::ImmutableImage::new(&device, vulkano::image::Dimensions::Dim2d { width: WIN_WIDTH as u32, height: WIN_HEIGTH as u32 }, vulkano::format::R8G8B8A8Unorm, Some(queue.family())).unwrap(); let sampler = vulkano::sampler::Sampler::new(&device, vulkano::sampler::Filter::Linear, vulkano::sampler::Filter::Linear, vulkano::sampler::MipmapMode::Nearest, vulkano::sampler::SamplerAddressMode::Repeat, vulkano::sampler::SamplerAddressMode::Repeat, vulkano::sampler::SamplerAddressMode::Repeat, 0.0, 1.0, 0.0, 0.0).unwrap(); let descriptor_pool = vulkano::descriptor::descriptor_set::DescriptorPool::new(&device); mod pipeline_layout { pipeline_layout!{ set0: { tex: CombinedImageSampler } } } let pipeline_layout = pipeline_layout::CustomPipeline::new(&device).unwrap(); let set = pipeline_layout::set0::Set::new(&descriptor_pool, &pipeline_layout, &pipeline_layout::set0::Descriptors { tex: (&sampler, &texture) }); let pipeline = vulkano::pipeline::GraphicsPipeline::new(&device, vulkano::pipeline::GraphicsPipelineParams { vertex_input: vulkano::pipeline::vertex::SingleBufferDefinition::new(), vertex_shader: vs.main_entry_point(), input_assembly: vulkano::pipeline::input_assembly::InputAssembly { topology: vulkano::pipeline::input_assembly::PrimitiveTopology::TriangleStrip, primitive_restart_enable: false, }, tessellation: None, geometry_shader: None, viewport: vulkano::pipeline::viewport::ViewportsState::Fixed { data: vec![( vulkano::pipeline::viewport::Viewport { origin: [0.0, 0.0], depth_range: 0.0.. 1.0, dimensions: [images[0].dimensions()[0] as f32, images[0].dimensions()[1] as f32], }, vulkano::pipeline::viewport::Scissor::irrelevant() )], }, raster: Default::default(), multisample: vulkano::pipeline::multisample::Multisample::disabled(), fragment_shader: fs.main_entry_point(), depth_stencil: vulkano::pipeline::depth_stencil::DepthStencil::disabled(), blend: vulkano::pipeline::blend::Blend::pass_through(), layout: &pipeline_layout, render_pass: vulkano::framebuffer::Subpass::from(&renderpass, 0).unwrap(), }).unwrap(); let framebuffers = images.iter().map(|image| { let attachments = renderpass::AList { color: &image, }; vulkano::framebuffer::Framebuffer::new(&renderpass, [images[0].dimensions()[0], images[0].dimensions()[1], 1], attachments).unwrap() }).collect::<Vec<_>>(); 'main: loop { // Draw in the FBO and read the pixel data from it gl_draw(&handles); // Create renderbuffer for color data let color_render_buffer = gl::gen_renderbuffers(1)[0]; gl::bind_renderbuffer(gl::RENDERBUFFER, color_render_buffer); gl::renderbuffer_storage(gl::RENDERBUFFER, gl::RGBA, WIN_WIDTH, WIN_HEIGTH); gl::framebuffer_renderbuffer(gl::FRAMEBUFFER, gl::COLOR_ATTACHMENT0, gl::RENDERBUFFER, color_render_buffer); if gl::check_frame_buffer_status(gl::FRAMEBUFFER)!= gl::FRAMEBUFFER_COMPLETE { panic!("Something went wrong :/."); } let pixel_data = gl::read_pixels(0, 0, WIN_WIDTH, WIN_HEIGTH, gl::RGBA, gl::UNSIGNED_BYTE); let pixel_buffer = { let image_data_chunks = pixel_data.chunks(4).map(|c| [c[0], c[1], c[2], c[3]]); vulkano::buffer::cpu_access::CpuAccessibleBuffer::<[[u8;4]]> ::from_iter(&device, &vulkano::buffer::BufferUsage::all(), Some(queue.family()), image_data_chunks) .expect("failed to create buffer") }; let command_buffers = framebuffers.iter().map(|framebuffer| { vulkano::command_buffer::PrimaryCommandBufferBuilder::new(&device, queue.family()) .copy_buffer_to_color_image(&pixel_buffer, &texture, 0, 0.. 1, [0, 0, 0], [texture.dimensions().width(), texture.dimensions().height(), 1]) //.clear_color_image(&texture, [0.0, 1.0, 0.0, 1.0]) .draw_inline(&renderpass, &framebuffer, renderpass::ClearValues { color: [0.0, 0.0, 1.0, 1.0] }) .draw(&pipeline, &vertex_buffer, &vulkano::command_buffer::DynamicState::none(), &set, &()) .draw_end() .build() }).collect::<Vec<_>>(); let image_num = swapchain.acquire_next_image(Duration::new(10, 0)).unwrap(); vulkano::command_buffer::submit(&command_buffers[image_num], &queue).unwrap(); swapchain.present(&queue, image_num).unwrap(); for ev in window.window().poll_events() { match ev { winit::Event::Closed => break'main, _ => () } } } // Free gl resources gl::use_program(0); gl::disable_vertex_attrib_array(0); gl::disable_vertex_attrib_array(1); gl::disable_vertex_attrib_array(2); // gl::detach_shader(handles.program.get(), vertexshader); // gl::detach_shader(handles.program.get(), fragmentshader); // gl::delete_shader(vertexshader); // gl::delete_shader(fragmentshader); gl::delete_program(handles.program.get()); gl::delete_buffers(&handles.vbos.get()); gl::delete_vertex_arrays(&[handles.vao.get()]); }
new
identifier_name
main.rs
extern crate cgmath; extern crate euclid; extern crate gleam; extern crate glutin; extern crate image; extern crate lodepng; extern crate offscreen_gl_context; #[macro_use] extern crate vulkano; extern crate vulkano_win; extern crate winit; use euclid::Size2D; use gleam::gl; use offscreen_gl_context::{ColorAttachmentType, GLContext, GLContextAttributes, NativeGLContext}; use std::time::Duration; use vulkano_win::VkSurfaceBuild; use std::cell::Cell; struct GlHandles { pub vao: Cell<gl::GLuint>, pub vbos: Cell<[gl::GLuint; 2]>, pub program: Cell<gl::GLuint>, pub scale: Cell<f32>, } impl GlHandles { fn new() -> GlHandles { GlHandles { vao: Cell::new(0 as gl::GLuint), vbos: Cell::new([0,0]), program: Cell::new(0 as gl::GLuint), scale: Cell::new(0.0), } } } const CLEAR_COLOR: (f32, f32, f32, f32) = (0.0, 0.2, 0.3, 1.0); const WIN_WIDTH: i32 = 256; const WIN_HEIGTH: i32 = 256; const VS_SHADER: &'static str = " #version 150 core in vec2 a_Pos; in vec3 a_Color; uniform mat4 scale; out vec4 v_Color; void main() { v_Color = vec4(a_Color, 1.0); gl_Position = scale * vec4(0.5 * a_Pos, 0.0, 1.0); } "; const FS_SHADER: &'static str = " #version 150 core in vec4 v_Color; out vec4 Target0; void main() { Target0 = v_Color; } "; const VERTICES: &'static [[f32;2];3] = &[ [-1.0, -0.57], [ 1.0, -0.57], [ 0.0, 1.15] ]; const COLORS: &'static [[f32;3];3] = &[ [1.0, 0.0, 0.0], [0.0, 1.0, 0.0], [0.0, 0.0, 1.0] ]; fn add_shader(program: gl::GLuint, src: &str, ty: gl::GLenum) { let id = unsafe { gl::CreateShader(ty) }; if id == (0 as gl::GLuint) { panic!("Failed to create shader type: {:?}", ty); } let mut source = Vec::new(); source.extend_from_slice(src.as_bytes()); gl::shader_source(id, &[&source[..]]); gl::compile_shader(id); let log = gl::get_shader_info_log(id); if gl::get_shader_iv(id, gl::COMPILE_STATUS) == (0 as gl::GLint) { panic!("Failed to compile shader:\n{}", log); } else
} fn compile_shaders(handles: &GlHandles) { handles.program.set(gl::create_program()); if handles.program.get() == (0 as gl::GLuint) { panic!("Failed to create shader program"); } add_shader(handles.program.get(), VS_SHADER, gl::VERTEX_SHADER); add_shader(handles.program.get(), FS_SHADER, gl::FRAGMENT_SHADER); gl::link_program(handles.program.get()); if gl::get_program_iv(handles.program.get(), gl::LINK_STATUS) == (0 as gl::GLint) { let error_log = gl::get_program_info_log(handles.program.get()); panic!("Failed to link shader program: \n{}", error_log); } gl::validate_program(handles.program.get()); if gl::get_program_iv(handles.program.get(), gl::VALIDATE_STATUS) == (0 as gl::GLint) { let error_log = gl::get_program_info_log(handles.program.get()); panic!("Failed to validate shader program: \n{}", error_log); } gl::use_program(handles.program.get()); } fn gl_draw(handles: &GlHandles) { gl::clear_color(CLEAR_COLOR.0, CLEAR_COLOR.1, CLEAR_COLOR.2, CLEAR_COLOR.3); gl::clear(gl::COLOR_BUFFER_BIT); gl::bind_buffer(gl::ARRAY_BUFFER, handles.vbos.get()[0]); gl::buffer_data(gl::ARRAY_BUFFER, VERTICES, gl::STATIC_DRAW); gl::vertex_attrib_pointer(0 as gl::GLuint, 2, gl::FLOAT, false, 0 as gl::GLint, 0); gl::enable_vertex_attrib_array(0 as gl::GLuint); gl::bind_buffer(gl::ARRAY_BUFFER, handles.vbos.get()[1]); gl::buffer_data(gl::ARRAY_BUFFER, COLORS, gl::STATIC_DRAW); gl::vertex_attrib_pointer(1 as gl::GLuint, 3, gl::FLOAT, false, 0 as gl::GLint, 0); gl::enable_vertex_attrib_array(1 as gl::GLuint); handles.scale.set(handles.scale.get() + 0.01); let scale = handles.scale.get(); let rot_matrix = [ scale.cos(), -1.0 * scale.sin(), 0.0, 0.0, scale.sin(), scale.cos(), 0.0, 0.0, 0.0, 0.0, 1.0, 0.0, 0.0, 0.0, 0.0, 1.0 ]; let scale_pos = gl::get_uniform_location(handles.program.get(), "scale"); gl::uniform_matrix_4fv(scale_pos, false, &rot_matrix); gl::draw_arrays(gl::TRIANGLES, 0, 3); } pub fn main() { gl::load_with(|s| GLContext::<NativeGLContext>::get_proc_address(s) as *const _); let offscreen_ctx = GLContext::<NativeGLContext>::new(Size2D::new(256, 256), GLContextAttributes::default(), ColorAttachmentType::Renderbuffer, None).unwrap(); offscreen_ctx.make_current().unwrap(); let handles: GlHandles = GlHandles::new(); // Create VAO and VBOs handles.vao.set(gl::gen_vertex_arrays(1)[0]); gl::bind_vertex_array(handles.vao.get()); let buffer_ids = gl::gen_buffers(2); handles.vbos.set([buffer_ids[0], buffer_ids[1]]); compile_shaders(&handles); // Create FBO and bind it let fbo = gl::gen_framebuffers(1)[0]; gl::bind_framebuffer(gl::FRAMEBUFFER, fbo); let extensions = vulkano_win::required_extensions(); let instance = vulkano::instance::Instance::new(None, &extensions, &[]).expect("failed to create instance"); let physical = vulkano::instance::PhysicalDevice::enumerate(&instance) .next().expect("no device available"); println!("Using device: {} (type: {:?})", physical.name(), physical.ty()); let window = winit::WindowBuilder::new().build_vk_surface(&instance).unwrap(); let queue = physical.queue_families().find(|q| q.supports_graphics() && window.surface().is_supported(q).unwrap_or(false)) .expect("couldn't find a graphical queue family"); let device_ext = vulkano::device::DeviceExtensions { khr_swapchain: true, .. vulkano::device::DeviceExtensions::none() }; let (device, mut queues) = vulkano::device::Device::new(&physical, physical.supported_features(), &device_ext, [(queue, 0.5)].iter().cloned()) .expect("failed to create device"); let queue = queues.next().unwrap(); let (swapchain, images) = { let caps = window.surface().get_capabilities(&physical).expect("failed to get surface capabilities"); let dimensions = caps.current_extent.unwrap_or([WIN_WIDTH as u32, WIN_HEIGTH as u32]); let present = caps.present_modes.iter().next().unwrap(); let usage = caps.supported_usage_flags; vulkano::swapchain::Swapchain::new(&device, &window.surface(), caps.min_image_count, vulkano::format::B8G8R8A8Srgb, dimensions, 1, &usage, &queue, vulkano::swapchain::SurfaceTransform::Identity, vulkano::swapchain::CompositeAlpha::Opaque, present, true, None).expect("failed to create swapchain") }; #[derive(Debug, Clone)] struct Vertex { position: [f32; 2] } impl_vertex!(Vertex, position); let vertex_buffer = vulkano::buffer::cpu_access::CpuAccessibleBuffer::<[Vertex]> ::from_iter(&device, &vulkano::buffer::BufferUsage::all(), Some(queue.family()), [ Vertex { position: [-0.5, -0.5 ] }, Vertex { position: [-0.5, 0.5 ] }, Vertex { position: [ 0.5, -0.5 ] }, Vertex { position: [ 0.5, 0.5 ] }, ].iter().cloned()).expect("failed to create buffer"); mod vs { include!{concat!(env!("OUT_DIR"), "/shaders/src/shader/image_vs.glsl")} } let vs = vs::Shader::load(&device).expect("failed to create shader module"); mod fs { include!{concat!(env!("OUT_DIR"), "/shaders/src/shader/image_fs.glsl")} } let fs = fs::Shader::load(&device).expect("failed to create shader module"); mod renderpass { single_pass_renderpass!{ attachments: { color: { load: Clear, store: Store, format: ::vulkano::format::B8G8R8A8Srgb, } }, pass: { color: [color], depth_stencil: {} } } } let renderpass = renderpass::CustomRenderPass::new(&device, &renderpass::Formats { color: (vulkano::format::B8G8R8A8Srgb, 1) }).unwrap(); let texture = vulkano::image::immutable::ImmutableImage::new(&device, vulkano::image::Dimensions::Dim2d { width: WIN_WIDTH as u32, height: WIN_HEIGTH as u32 }, vulkano::format::R8G8B8A8Unorm, Some(queue.family())).unwrap(); let sampler = vulkano::sampler::Sampler::new(&device, vulkano::sampler::Filter::Linear, vulkano::sampler::Filter::Linear, vulkano::sampler::MipmapMode::Nearest, vulkano::sampler::SamplerAddressMode::Repeat, vulkano::sampler::SamplerAddressMode::Repeat, vulkano::sampler::SamplerAddressMode::Repeat, 0.0, 1.0, 0.0, 0.0).unwrap(); let descriptor_pool = vulkano::descriptor::descriptor_set::DescriptorPool::new(&device); mod pipeline_layout { pipeline_layout!{ set0: { tex: CombinedImageSampler } } } let pipeline_layout = pipeline_layout::CustomPipeline::new(&device).unwrap(); let set = pipeline_layout::set0::Set::new(&descriptor_pool, &pipeline_layout, &pipeline_layout::set0::Descriptors { tex: (&sampler, &texture) }); let pipeline = vulkano::pipeline::GraphicsPipeline::new(&device, vulkano::pipeline::GraphicsPipelineParams { vertex_input: vulkano::pipeline::vertex::SingleBufferDefinition::new(), vertex_shader: vs.main_entry_point(), input_assembly: vulkano::pipeline::input_assembly::InputAssembly { topology: vulkano::pipeline::input_assembly::PrimitiveTopology::TriangleStrip, primitive_restart_enable: false, }, tessellation: None, geometry_shader: None, viewport: vulkano::pipeline::viewport::ViewportsState::Fixed { data: vec![( vulkano::pipeline::viewport::Viewport { origin: [0.0, 0.0], depth_range: 0.0.. 1.0, dimensions: [images[0].dimensions()[0] as f32, images[0].dimensions()[1] as f32], }, vulkano::pipeline::viewport::Scissor::irrelevant() )], }, raster: Default::default(), multisample: vulkano::pipeline::multisample::Multisample::disabled(), fragment_shader: fs.main_entry_point(), depth_stencil: vulkano::pipeline::depth_stencil::DepthStencil::disabled(), blend: vulkano::pipeline::blend::Blend::pass_through(), layout: &pipeline_layout, render_pass: vulkano::framebuffer::Subpass::from(&renderpass, 0).unwrap(), }).unwrap(); let framebuffers = images.iter().map(|image| { let attachments = renderpass::AList { color: &image, }; vulkano::framebuffer::Framebuffer::new(&renderpass, [images[0].dimensions()[0], images[0].dimensions()[1], 1], attachments).unwrap() }).collect::<Vec<_>>(); 'main: loop { // Draw in the FBO and read the pixel data from it gl_draw(&handles); // Create renderbuffer for color data let color_render_buffer = gl::gen_renderbuffers(1)[0]; gl::bind_renderbuffer(gl::RENDERBUFFER, color_render_buffer); gl::renderbuffer_storage(gl::RENDERBUFFER, gl::RGBA, WIN_WIDTH, WIN_HEIGTH); gl::framebuffer_renderbuffer(gl::FRAMEBUFFER, gl::COLOR_ATTACHMENT0, gl::RENDERBUFFER, color_render_buffer); if gl::check_frame_buffer_status(gl::FRAMEBUFFER)!= gl::FRAMEBUFFER_COMPLETE { panic!("Something went wrong :/."); } let pixel_data = gl::read_pixels(0, 0, WIN_WIDTH, WIN_HEIGTH, gl::RGBA, gl::UNSIGNED_BYTE); let pixel_buffer = { let image_data_chunks = pixel_data.chunks(4).map(|c| [c[0], c[1], c[2], c[3]]); vulkano::buffer::cpu_access::CpuAccessibleBuffer::<[[u8;4]]> ::from_iter(&device, &vulkano::buffer::BufferUsage::all(), Some(queue.family()), image_data_chunks) .expect("failed to create buffer") }; let command_buffers = framebuffers.iter().map(|framebuffer| { vulkano::command_buffer::PrimaryCommandBufferBuilder::new(&device, queue.family()) .copy_buffer_to_color_image(&pixel_buffer, &texture, 0, 0.. 1, [0, 0, 0], [texture.dimensions().width(), texture.dimensions().height(), 1]) //.clear_color_image(&texture, [0.0, 1.0, 0.0, 1.0]) .draw_inline(&renderpass, &framebuffer, renderpass::ClearValues { color: [0.0, 0.0, 1.0, 1.0] }) .draw(&pipeline, &vertex_buffer, &vulkano::command_buffer::DynamicState::none(), &set, &()) .draw_end() .build() }).collect::<Vec<_>>(); let image_num = swapchain.acquire_next_image(Duration::new(10, 0)).unwrap(); vulkano::command_buffer::submit(&command_buffers[image_num], &queue).unwrap(); swapchain.present(&queue, image_num).unwrap(); for ev in window.window().poll_events() { match ev { winit::Event::Closed => break'main, _ => () } } } // Free gl resources gl::use_program(0); gl::disable_vertex_attrib_array(0); gl::disable_vertex_attrib_array(1); gl::disable_vertex_attrib_array(2); // gl::detach_shader(handles.program.get(), vertexshader); // gl::detach_shader(handles.program.get(), fragmentshader); // gl::delete_shader(vertexshader); // gl::delete_shader(fragmentshader); gl::delete_program(handles.program.get()); gl::delete_buffers(&handles.vbos.get()); gl::delete_vertex_arrays(&[handles.vao.get()]); }
{ if !log.is_empty() { println!("Warnings detected on shader:\n{}", log); } gl::attach_shader(program, id); }
conditional_block
types.rs
extern crate "rustc-serialize" as rustc_serialize; extern crate uuid; use uuid::Uuid; use rustc_serialize::{json, Encodable, Decodable}; use rustc_serialize::base64::{ToBase64, FromBase64, Config, CharacterSet, Newline}; use types::NodeState::{Leader, Follower, Candidate}; use types::TransactionState::{Polling, Accepted, Rejected}; use std::fs::{File, OpenOptions}; use std::fs; use std::str; use std::str::StrExt; use std::io; use std::io::{Write, ReadExt, Seek}; use std::old_io::IoError; use std::marker; /// Persistent state /// **Must be updated to stable storage before RPC response.** pub struct
<T: Encodable + Decodable + Send + Clone> { current_term: u64, voted_for: Option<u64>, // request_vote cares if this is `None` log: File, last_index: u64, // The last index of the file. last_term: u64, // The last index of the file. marker: marker::PhantomData<T>, // A marker... Because of // https://github.com/rust-lang/rfcs/blob/master/text/0738-variance.md#the-corner-case-unused-parameters-and-parameters-that-are-only-used-unsafely } impl<T: Encodable + Decodable + Send + Clone> PersistentState<T> { pub fn new(current_term: u64, log_path: Path) -> PersistentState<T> { let mut open_opts = OpenOptions::new(); open_opts.read(true); open_opts.write(true); open_opts.create(true); let mut file = open_opts.open(&log_path).unwrap(); write!(&mut file, "{:20} {:20}\n", current_term, 0).unwrap(); PersistentState { current_term: current_term, voted_for: None, log: file, last_index: 0, last_term: 0, marker: marker::PhantomData, } } /// Gets the `last_index` which you can use to make append requests with. pub fn get_last_index(&self) -> u64 { self.last_index } pub fn get_last_term(&self) -> u64 { self.last_term } /// Gets the `current_term` which is used for request vote. pub fn get_current_term(&self) -> u64 { self.current_term } /// Sets the current_term. **This should reflect on stable storage.** pub fn set_current_term(&mut self, new: u64) -> io::Result<()> { // The first line is the header with `current_term`, `voted_for`. self.log.seek(io::SeekFrom::Start(0)); // Take the start. self.current_term = new; // TODO: What do we do about the none case? write!(&mut self.log, "{:20} {:20}\n", self.current_term, self.voted_for.unwrap_or(0)) } /// Increments the current_term. **This should reflect on stable storage.** pub fn inc_current_term(&mut self) { self.current_term += 1 } /// Gets the `voted_for`. pub fn get_voted_for(&mut self) -> Option<u64> { self.voted_for } /// Sets the `voted_for. **This should reflect on stable storage.** pub fn set_voted_for(&mut self, new: Option<u64>) -> io::Result<()> { // The first line is the header with `current_term`, `voted_for`. self.log.seek(io::SeekFrom::Start(0)); // Take the start. self.voted_for = new; // TODO: What do we do about the none case? write!(&mut self.log, "{:20} {:20}\n", self.current_term, self.voted_for.unwrap_or(0)) } pub fn append_entries(&mut self, prev_log_index: u64, prev_log_term: u64, entries: Vec<(u64, T)>) -> io::Result<()> { // TODO: No checking of `prev_log_index` & `prev_log_term` yet... Do we need to? let position = try!(self.move_to(prev_log_index + 1)); let number = entries.len(); let last_term = entries[entries.len() -1].0; try!(self.purge_from_bytes(position)); // Update `last_log_index` later. // TODO: Possibly purge. for (term, entry) in entries { // TODO: I don't like the "doubling" here. How can we do this better? write!(&mut self.log, "{} {}\n", term, PersistentState::encode(entry)); } self.last_index = if prev_log_index == 0 { number as u64 - 1 } else { prev_log_index + number as u64 }; self.last_term = last_term; Ok(()) } fn encode(entry: T) -> String { let json_encoded = json::encode(&entry) .unwrap(); // TODO: Don't unwrap. json_encoded.as_bytes().to_base64(Config { char_set: CharacterSet::UrlSafe, newline: Newline::LF, pad: false, line_length: None, }) } fn decode(bytes: String) -> Result<T, rustc_serialize::json::DecoderError> { let based = bytes.from_base64() .ok().expect("Decoding error. log likely corrupt."); let string = str::from_utf8(based.as_slice()) .unwrap(); json::decode::<T>(string) } /// Returns the number of bytes containing `line` lines. /// TODO: Cache? fn move_to(&mut self, line: u64) -> io::Result<u64> { // Gotcha: The first line is NOT a log entry. let mut lines_read = 0u64; self.log.seek(io::SeekFrom::Start(0)); // Take the start. // Go until we've reached `from` new lines. let _ = self.log.by_ref().chars().skip_while(|opt| { match *opt { Ok(val) => { if val == '\n' { lines_read += 1; if lines_read > line { // Greater than here because the first line is a bust. false // At right location. } else { true // Not done yet, more lines to go. } } else { true // Not a new line. } }, _ => false // At EOF. Nothing to purge. } }).next(); // Side effects. self.log.seek(io::SeekFrom::Current(0)) // Where are we? } /// Do *not* invoke this unless you update the `last_index`! fn purge_from_bytes(&mut self, from_bytes: u64) -> io::Result<()> { self.log.set_len(from_bytes) // Chop off the file at the given position. } /// Removes all entries from `from` to the last entry, inclusively. pub fn purge_from_index(&mut self, from_line: u64) -> io::Result<()> { let position = try!(self.move_to(from_line)); self.last_index = from_line - 1; self.purge_from_bytes(position) } pub fn retrieve_entries(&mut self, start: u64, end: u64) -> io::Result<Vec<(u64, T)>> { let position = self.move_to(start); let mut index = start; let mut out = vec![]; let mut read_in = self.log.by_ref() .chars() .take_while(|val| val.is_ok()) .filter_map(|val| val.ok()); // We don't really care about issues here. for index in range(start, end +1) { let mut chars = read_in.by_ref() .take_while(|&val| val!= '\n') .collect::<String>(); if chars.len() == 0 { continue; } let entry = try!(parse_entry::<T>(chars)); out.push(entry); } Ok(out) } pub fn retrieve_entry(&mut self, index: u64) -> io::Result<(u64, T)> { let position = self.move_to(index); let mut chars = self.log.by_ref() .chars() .take_while(|val| val.is_ok()) .filter_map(|val| val.ok()) // We don't really care about issues here. .take_while(|&val| val!= '\n').collect::<String>(); parse_entry::<T>(chars) } } fn parse_entry<T: Encodable + Decodable + Send + Clone>(val: String) -> io::Result<(u64, T)> { let mut splits = val.split(' '); let term = { let chunk = splits.next() .and_then(|v| v.parse::<u64>().ok()); match chunk { Some(v) => v, None => return Err(io::Error::new(io::ErrorKind::InvalidInput, "Could not parse term.", None)), } }; let encoded = { let chunk = splits.next(); match chunk { Some(v) => v, None => return Err(io::Error::new(io::ErrorKind::InvalidInput, "Could not parse encoded data.", None)), } }; let decoded: T = PersistentState::decode(encoded.to_string()) .ok().expect("Could not unwrap log entry."); Ok((term, decoded)) } /// Volatile state #[derive(Copy)] pub struct VolatileState { pub commit_index: u64, pub last_applied: u64 } /// Leader Only /// **Reinitialized after election.** #[derive(PartialEq, Eq, Clone)] pub struct LeaderState { pub next_index: Vec<u64>, pub match_index: Vec<u64> } /// Nodes can either be: /// /// * A `Follower`, which replicates AppendEntries requests and votes for it's leader. /// * A `Leader`, which leads the cluster by serving incoming requests, ensuring data is /// replicated, and issuing heartbeats.. /// * A `Candidate`, which campaigns in an election and may become a `Leader` (if it gets enough /// votes) or a `Follower`, if it hears from a `Leader`. #[derive(PartialEq, Eq, Clone)] pub enum NodeState { Follower, Leader(LeaderState), Candidate(Vec<Transaction>), } #[derive(PartialEq, Eq, Clone)] pub struct Transaction { pub uuid: Uuid, pub state: TransactionState, } /// Used to signify the state of of a Request/Response pair. This is only needed /// on the original sender... not on the reciever. #[derive(PartialEq, Eq, Copy, Clone)] pub enum TransactionState { Polling, Accepted, Rejected, } #[test] fn test_persistent_state() { let path = Path::new("/tmp/test_path"); fs::remove_file(&path.clone()); let mut state = PersistentState::new(0, path.clone()); // Add 0, 1 assert_eq!(state.append_entries(0, 0, vec![(0, "Zero".to_string()), (1, "One".to_string())]), Ok(())); // Check index. assert_eq!(state.get_last_index(), 1); // Check 0 assert_eq!(state.retrieve_entry(0), Ok((0, "Zero".to_string()))); // Check 0, 1 assert_eq!(state.retrieve_entries(0, 1), Ok(vec![(0, "Zero".to_string()), (1, "One".to_string()) ])); // Check 1 assert_eq!(state.retrieve_entry(1), Ok((1, "One".to_string()))); // Add 2, 3 assert_eq!(state.append_entries(1, 2, vec![(2, "Two".to_string()), (3, "Three".to_string())]), Ok(())); assert_eq!(state.get_last_index(), 3); // Check 2, 3 assert_eq!(state.retrieve_entries(2, 3), Ok(vec![(2, "Two".to_string()), (3, "Three".to_string()) ])); // Remove 2, 3 assert_eq!(state.purge_from_index(2), Ok(())); assert_eq!(state.get_last_index(), 1); // Check 3,4 are removed, and that code handles lack of entry gracefully. assert_eq!(state.retrieve_entries(0, 4), Ok(vec![(0, "Zero".to_string()), (1, "One".to_string()) ])); // Add 2,3,4. assert_eq!(state.append_entries(1, 2, vec![(2, "Two".to_string()), (3, "Three".to_string()), (4, "Four".to_string())]), Ok(())); assert_eq!(state.get_last_index(), 4); // Add 2,3 again. (4 should be purged) assert_eq!(state.append_entries(1, 2, vec![(2, "Two".to_string()), (3, "Three".to_string())]), Ok(())); assert_eq!(state.get_last_index(), 3); fs::remove_file(&path.clone()); }
PersistentState
identifier_name
types.rs
extern crate "rustc-serialize" as rustc_serialize; extern crate uuid; use uuid::Uuid; use rustc_serialize::{json, Encodable, Decodable}; use rustc_serialize::base64::{ToBase64, FromBase64, Config, CharacterSet, Newline}; use types::NodeState::{Leader, Follower, Candidate}; use types::TransactionState::{Polling, Accepted, Rejected}; use std::fs::{File, OpenOptions}; use std::fs; use std::str; use std::str::StrExt; use std::io; use std::io::{Write, ReadExt, Seek}; use std::old_io::IoError; use std::marker; /// Persistent state /// **Must be updated to stable storage before RPC response.** pub struct PersistentState<T: Encodable + Decodable + Send + Clone> { current_term: u64, voted_for: Option<u64>, // request_vote cares if this is `None` log: File, last_index: u64, // The last index of the file. last_term: u64, // The last index of the file. marker: marker::PhantomData<T>, // A marker... Because of // https://github.com/rust-lang/rfcs/blob/master/text/0738-variance.md#the-corner-case-unused-parameters-and-parameters-that-are-only-used-unsafely } impl<T: Encodable + Decodable + Send + Clone> PersistentState<T> { pub fn new(current_term: u64, log_path: Path) -> PersistentState<T> { let mut open_opts = OpenOptions::new(); open_opts.read(true); open_opts.write(true); open_opts.create(true); let mut file = open_opts.open(&log_path).unwrap(); write!(&mut file, "{:20} {:20}\n", current_term, 0).unwrap(); PersistentState { current_term: current_term, voted_for: None, log: file, last_index: 0, last_term: 0, marker: marker::PhantomData, } } /// Gets the `last_index` which you can use to make append requests with. pub fn get_last_index(&self) -> u64 { self.last_index } pub fn get_last_term(&self) -> u64 { self.last_term } /// Gets the `current_term` which is used for request vote. pub fn get_current_term(&self) -> u64 { self.current_term } /// Sets the current_term. **This should reflect on stable storage.** pub fn set_current_term(&mut self, new: u64) -> io::Result<()> { // The first line is the header with `current_term`, `voted_for`. self.log.seek(io::SeekFrom::Start(0)); // Take the start. self.current_term = new; // TODO: What do we do about the none case? write!(&mut self.log, "{:20} {:20}\n", self.current_term, self.voted_for.unwrap_or(0)) } /// Increments the current_term. **This should reflect on stable storage.** pub fn inc_current_term(&mut self) { self.current_term += 1 } /// Gets the `voted_for`. pub fn get_voted_for(&mut self) -> Option<u64> { self.voted_for } /// Sets the `voted_for. **This should reflect on stable storage.** pub fn set_voted_for(&mut self, new: Option<u64>) -> io::Result<()> { // The first line is the header with `current_term`, `voted_for`. self.log.seek(io::SeekFrom::Start(0)); // Take the start. self.voted_for = new; // TODO: What do we do about the none case? write!(&mut self.log, "{:20} {:20}\n", self.current_term, self.voted_for.unwrap_or(0)) } pub fn append_entries(&mut self, prev_log_index: u64, prev_log_term: u64, entries: Vec<(u64, T)>) -> io::Result<()> { // TODO: No checking of `prev_log_index` & `prev_log_term` yet... Do we need to? let position = try!(self.move_to(prev_log_index + 1)); let number = entries.len(); let last_term = entries[entries.len() -1].0; try!(self.purge_from_bytes(position)); // Update `last_log_index` later. // TODO: Possibly purge. for (term, entry) in entries { // TODO: I don't like the "doubling" here. How can we do this better? write!(&mut self.log, "{} {}\n", term, PersistentState::encode(entry)); } self.last_index = if prev_log_index == 0 { number as u64 - 1 } else { prev_log_index + number as u64 }; self.last_term = last_term; Ok(()) } fn encode(entry: T) -> String { let json_encoded = json::encode(&entry) .unwrap(); // TODO: Don't unwrap. json_encoded.as_bytes().to_base64(Config { char_set: CharacterSet::UrlSafe, newline: Newline::LF, pad: false, line_length: None, }) } fn decode(bytes: String) -> Result<T, rustc_serialize::json::DecoderError> { let based = bytes.from_base64() .ok().expect("Decoding error. log likely corrupt."); let string = str::from_utf8(based.as_slice()) .unwrap(); json::decode::<T>(string) } /// Returns the number of bytes containing `line` lines. /// TODO: Cache? fn move_to(&mut self, line: u64) -> io::Result<u64> { // Gotcha: The first line is NOT a log entry. let mut lines_read = 0u64; self.log.seek(io::SeekFrom::Start(0)); // Take the start. // Go until we've reached `from` new lines. let _ = self.log.by_ref().chars().skip_while(|opt| { match *opt { Ok(val) => { if val == '\n' { lines_read += 1; if lines_read > line { // Greater than here because the first line is a bust. false // At right location. } else { true // Not done yet, more lines to go. } } else { true // Not a new line. } }, _ => false // At EOF. Nothing to purge. } }).next(); // Side effects. self.log.seek(io::SeekFrom::Current(0)) // Where are we? } /// Do *not* invoke this unless you update the `last_index`! fn purge_from_bytes(&mut self, from_bytes: u64) -> io::Result<()> { self.log.set_len(from_bytes) // Chop off the file at the given position. } /// Removes all entries from `from` to the last entry, inclusively. pub fn purge_from_index(&mut self, from_line: u64) -> io::Result<()> { let position = try!(self.move_to(from_line)); self.last_index = from_line - 1; self.purge_from_bytes(position) } pub fn retrieve_entries(&mut self, start: u64, end: u64) -> io::Result<Vec<(u64, T)>> { let position = self.move_to(start); let mut index = start; let mut out = vec![]; let mut read_in = self.log.by_ref() .chars() .take_while(|val| val.is_ok()) .filter_map(|val| val.ok()); // We don't really care about issues here. for index in range(start, end +1) { let mut chars = read_in.by_ref() .take_while(|&val| val!= '\n') .collect::<String>(); if chars.len() == 0 { continue; } let entry = try!(parse_entry::<T>(chars)); out.push(entry); } Ok(out) } pub fn retrieve_entry(&mut self, index: u64) -> io::Result<(u64, T)> { let position = self.move_to(index); let mut chars = self.log.by_ref() .chars() .take_while(|val| val.is_ok()) .filter_map(|val| val.ok()) // We don't really care about issues here. .take_while(|&val| val!= '\n').collect::<String>(); parse_entry::<T>(chars) } } fn parse_entry<T: Encodable + Decodable + Send + Clone>(val: String) -> io::Result<(u64, T)> { let mut splits = val.split(' '); let term = { let chunk = splits.next() .and_then(|v| v.parse::<u64>().ok()); match chunk { Some(v) => v, None => return Err(io::Error::new(io::ErrorKind::InvalidInput, "Could not parse term.", None)), } }; let encoded = { let chunk = splits.next(); match chunk { Some(v) => v, None => return Err(io::Error::new(io::ErrorKind::InvalidInput, "Could not parse encoded data.", None)), } }; let decoded: T = PersistentState::decode(encoded.to_string()) .ok().expect("Could not unwrap log entry."); Ok((term, decoded)) } /// Volatile state #[derive(Copy)] pub struct VolatileState { pub commit_index: u64, pub last_applied: u64 } /// Leader Only /// **Reinitialized after election.** #[derive(PartialEq, Eq, Clone)] pub struct LeaderState { pub next_index: Vec<u64>, pub match_index: Vec<u64> } /// Nodes can either be: /// /// * A `Follower`, which replicates AppendEntries requests and votes for it's leader. /// * A `Leader`, which leads the cluster by serving incoming requests, ensuring data is /// replicated, and issuing heartbeats.. /// * A `Candidate`, which campaigns in an election and may become a `Leader` (if it gets enough /// votes) or a `Follower`, if it hears from a `Leader`. #[derive(PartialEq, Eq, Clone)] pub enum NodeState { Follower, Leader(LeaderState), Candidate(Vec<Transaction>), } #[derive(PartialEq, Eq, Clone)] pub struct Transaction { pub uuid: Uuid, pub state: TransactionState, } /// Used to signify the state of of a Request/Response pair. This is only needed /// on the original sender... not on the reciever. #[derive(PartialEq, Eq, Copy, Clone)] pub enum TransactionState { Polling, Accepted, Rejected, } #[test] fn test_persistent_state() { let path = Path::new("/tmp/test_path"); fs::remove_file(&path.clone()); let mut state = PersistentState::new(0, path.clone()); // Add 0, 1 assert_eq!(state.append_entries(0, 0, vec![(0, "Zero".to_string()), (1, "One".to_string())]), Ok(())); // Check index. assert_eq!(state.get_last_index(), 1); // Check 0 assert_eq!(state.retrieve_entry(0), Ok((0, "Zero".to_string()))); // Check 0, 1 assert_eq!(state.retrieve_entries(0, 1), Ok(vec![(0, "Zero".to_string()), (1, "One".to_string()) ])); // Check 1 assert_eq!(state.retrieve_entry(1), Ok((1, "One".to_string()))); // Add 2, 3 assert_eq!(state.append_entries(1, 2, vec![(2, "Two".to_string()), (3, "Three".to_string())]), Ok(())); assert_eq!(state.get_last_index(), 3); // Check 2, 3 assert_eq!(state.retrieve_entries(2, 3), Ok(vec![(2, "Two".to_string()), (3, "Three".to_string()) ])); // Remove 2, 3 assert_eq!(state.purge_from_index(2), Ok(())); assert_eq!(state.get_last_index(), 1); // Check 3,4 are removed, and that code handles lack of entry gracefully. assert_eq!(state.retrieve_entries(0, 4), Ok(vec![(0, "Zero".to_string()), (1, "One".to_string()) ])); // Add 2,3,4. assert_eq!(state.append_entries(1, 2, vec![(2, "Two".to_string()),
// Add 2,3 again. (4 should be purged) assert_eq!(state.append_entries(1, 2, vec![(2, "Two".to_string()), (3, "Three".to_string())]), Ok(())); assert_eq!(state.get_last_index(), 3); fs::remove_file(&path.clone()); }
(3, "Three".to_string()), (4, "Four".to_string())]), Ok(())); assert_eq!(state.get_last_index(), 4);
random_line_split
types.rs
extern crate "rustc-serialize" as rustc_serialize; extern crate uuid; use uuid::Uuid; use rustc_serialize::{json, Encodable, Decodable}; use rustc_serialize::base64::{ToBase64, FromBase64, Config, CharacterSet, Newline}; use types::NodeState::{Leader, Follower, Candidate}; use types::TransactionState::{Polling, Accepted, Rejected}; use std::fs::{File, OpenOptions}; use std::fs; use std::str; use std::str::StrExt; use std::io; use std::io::{Write, ReadExt, Seek}; use std::old_io::IoError; use std::marker; /// Persistent state /// **Must be updated to stable storage before RPC response.** pub struct PersistentState<T: Encodable + Decodable + Send + Clone> { current_term: u64, voted_for: Option<u64>, // request_vote cares if this is `None` log: File, last_index: u64, // The last index of the file. last_term: u64, // The last index of the file. marker: marker::PhantomData<T>, // A marker... Because of // https://github.com/rust-lang/rfcs/blob/master/text/0738-variance.md#the-corner-case-unused-parameters-and-parameters-that-are-only-used-unsafely } impl<T: Encodable + Decodable + Send + Clone> PersistentState<T> { pub fn new(current_term: u64, log_path: Path) -> PersistentState<T> { let mut open_opts = OpenOptions::new(); open_opts.read(true); open_opts.write(true); open_opts.create(true); let mut file = open_opts.open(&log_path).unwrap(); write!(&mut file, "{:20} {:20}\n", current_term, 0).unwrap(); PersistentState { current_term: current_term, voted_for: None, log: file, last_index: 0, last_term: 0, marker: marker::PhantomData, } } /// Gets the `last_index` which you can use to make append requests with. pub fn get_last_index(&self) -> u64 { self.last_index } pub fn get_last_term(&self) -> u64 { self.last_term } /// Gets the `current_term` which is used for request vote. pub fn get_current_term(&self) -> u64 { self.current_term } /// Sets the current_term. **This should reflect on stable storage.** pub fn set_current_term(&mut self, new: u64) -> io::Result<()> { // The first line is the header with `current_term`, `voted_for`. self.log.seek(io::SeekFrom::Start(0)); // Take the start. self.current_term = new; // TODO: What do we do about the none case? write!(&mut self.log, "{:20} {:20}\n", self.current_term, self.voted_for.unwrap_or(0)) } /// Increments the current_term. **This should reflect on stable storage.** pub fn inc_current_term(&mut self) { self.current_term += 1 } /// Gets the `voted_for`. pub fn get_voted_for(&mut self) -> Option<u64> { self.voted_for } /// Sets the `voted_for. **This should reflect on stable storage.** pub fn set_voted_for(&mut self, new: Option<u64>) -> io::Result<()> { // The first line is the header with `current_term`, `voted_for`. self.log.seek(io::SeekFrom::Start(0)); // Take the start. self.voted_for = new; // TODO: What do we do about the none case? write!(&mut self.log, "{:20} {:20}\n", self.current_term, self.voted_for.unwrap_or(0)) } pub fn append_entries(&mut self, prev_log_index: u64, prev_log_term: u64, entries: Vec<(u64, T)>) -> io::Result<()> { // TODO: No checking of `prev_log_index` & `prev_log_term` yet... Do we need to? let position = try!(self.move_to(prev_log_index + 1)); let number = entries.len(); let last_term = entries[entries.len() -1].0; try!(self.purge_from_bytes(position)); // Update `last_log_index` later. // TODO: Possibly purge. for (term, entry) in entries { // TODO: I don't like the "doubling" here. How can we do this better? write!(&mut self.log, "{} {}\n", term, PersistentState::encode(entry)); } self.last_index = if prev_log_index == 0 { number as u64 - 1 } else
; self.last_term = last_term; Ok(()) } fn encode(entry: T) -> String { let json_encoded = json::encode(&entry) .unwrap(); // TODO: Don't unwrap. json_encoded.as_bytes().to_base64(Config { char_set: CharacterSet::UrlSafe, newline: Newline::LF, pad: false, line_length: None, }) } fn decode(bytes: String) -> Result<T, rustc_serialize::json::DecoderError> { let based = bytes.from_base64() .ok().expect("Decoding error. log likely corrupt."); let string = str::from_utf8(based.as_slice()) .unwrap(); json::decode::<T>(string) } /// Returns the number of bytes containing `line` lines. /// TODO: Cache? fn move_to(&mut self, line: u64) -> io::Result<u64> { // Gotcha: The first line is NOT a log entry. let mut lines_read = 0u64; self.log.seek(io::SeekFrom::Start(0)); // Take the start. // Go until we've reached `from` new lines. let _ = self.log.by_ref().chars().skip_while(|opt| { match *opt { Ok(val) => { if val == '\n' { lines_read += 1; if lines_read > line { // Greater than here because the first line is a bust. false // At right location. } else { true // Not done yet, more lines to go. } } else { true // Not a new line. } }, _ => false // At EOF. Nothing to purge. } }).next(); // Side effects. self.log.seek(io::SeekFrom::Current(0)) // Where are we? } /// Do *not* invoke this unless you update the `last_index`! fn purge_from_bytes(&mut self, from_bytes: u64) -> io::Result<()> { self.log.set_len(from_bytes) // Chop off the file at the given position. } /// Removes all entries from `from` to the last entry, inclusively. pub fn purge_from_index(&mut self, from_line: u64) -> io::Result<()> { let position = try!(self.move_to(from_line)); self.last_index = from_line - 1; self.purge_from_bytes(position) } pub fn retrieve_entries(&mut self, start: u64, end: u64) -> io::Result<Vec<(u64, T)>> { let position = self.move_to(start); let mut index = start; let mut out = vec![]; let mut read_in = self.log.by_ref() .chars() .take_while(|val| val.is_ok()) .filter_map(|val| val.ok()); // We don't really care about issues here. for index in range(start, end +1) { let mut chars = read_in.by_ref() .take_while(|&val| val!= '\n') .collect::<String>(); if chars.len() == 0 { continue; } let entry = try!(parse_entry::<T>(chars)); out.push(entry); } Ok(out) } pub fn retrieve_entry(&mut self, index: u64) -> io::Result<(u64, T)> { let position = self.move_to(index); let mut chars = self.log.by_ref() .chars() .take_while(|val| val.is_ok()) .filter_map(|val| val.ok()) // We don't really care about issues here. .take_while(|&val| val!= '\n').collect::<String>(); parse_entry::<T>(chars) } } fn parse_entry<T: Encodable + Decodable + Send + Clone>(val: String) -> io::Result<(u64, T)> { let mut splits = val.split(' '); let term = { let chunk = splits.next() .and_then(|v| v.parse::<u64>().ok()); match chunk { Some(v) => v, None => return Err(io::Error::new(io::ErrorKind::InvalidInput, "Could not parse term.", None)), } }; let encoded = { let chunk = splits.next(); match chunk { Some(v) => v, None => return Err(io::Error::new(io::ErrorKind::InvalidInput, "Could not parse encoded data.", None)), } }; let decoded: T = PersistentState::decode(encoded.to_string()) .ok().expect("Could not unwrap log entry."); Ok((term, decoded)) } /// Volatile state #[derive(Copy)] pub struct VolatileState { pub commit_index: u64, pub last_applied: u64 } /// Leader Only /// **Reinitialized after election.** #[derive(PartialEq, Eq, Clone)] pub struct LeaderState { pub next_index: Vec<u64>, pub match_index: Vec<u64> } /// Nodes can either be: /// /// * A `Follower`, which replicates AppendEntries requests and votes for it's leader. /// * A `Leader`, which leads the cluster by serving incoming requests, ensuring data is /// replicated, and issuing heartbeats.. /// * A `Candidate`, which campaigns in an election and may become a `Leader` (if it gets enough /// votes) or a `Follower`, if it hears from a `Leader`. #[derive(PartialEq, Eq, Clone)] pub enum NodeState { Follower, Leader(LeaderState), Candidate(Vec<Transaction>), } #[derive(PartialEq, Eq, Clone)] pub struct Transaction { pub uuid: Uuid, pub state: TransactionState, } /// Used to signify the state of of a Request/Response pair. This is only needed /// on the original sender... not on the reciever. #[derive(PartialEq, Eq, Copy, Clone)] pub enum TransactionState { Polling, Accepted, Rejected, } #[test] fn test_persistent_state() { let path = Path::new("/tmp/test_path"); fs::remove_file(&path.clone()); let mut state = PersistentState::new(0, path.clone()); // Add 0, 1 assert_eq!(state.append_entries(0, 0, vec![(0, "Zero".to_string()), (1, "One".to_string())]), Ok(())); // Check index. assert_eq!(state.get_last_index(), 1); // Check 0 assert_eq!(state.retrieve_entry(0), Ok((0, "Zero".to_string()))); // Check 0, 1 assert_eq!(state.retrieve_entries(0, 1), Ok(vec![(0, "Zero".to_string()), (1, "One".to_string()) ])); // Check 1 assert_eq!(state.retrieve_entry(1), Ok((1, "One".to_string()))); // Add 2, 3 assert_eq!(state.append_entries(1, 2, vec![(2, "Two".to_string()), (3, "Three".to_string())]), Ok(())); assert_eq!(state.get_last_index(), 3); // Check 2, 3 assert_eq!(state.retrieve_entries(2, 3), Ok(vec![(2, "Two".to_string()), (3, "Three".to_string()) ])); // Remove 2, 3 assert_eq!(state.purge_from_index(2), Ok(())); assert_eq!(state.get_last_index(), 1); // Check 3,4 are removed, and that code handles lack of entry gracefully. assert_eq!(state.retrieve_entries(0, 4), Ok(vec![(0, "Zero".to_string()), (1, "One".to_string()) ])); // Add 2,3,4. assert_eq!(state.append_entries(1, 2, vec![(2, "Two".to_string()), (3, "Three".to_string()), (4, "Four".to_string())]), Ok(())); assert_eq!(state.get_last_index(), 4); // Add 2,3 again. (4 should be purged) assert_eq!(state.append_entries(1, 2, vec![(2, "Two".to_string()), (3, "Three".to_string())]), Ok(())); assert_eq!(state.get_last_index(), 3); fs::remove_file(&path.clone()); }
{ prev_log_index + number as u64 }
conditional_block
feature_table.rs
//! # Feature Table //! //! Data model and parsers for the DDBJ/ENA/GenBank Feature Table. //! //! See: http://www.insdc.org/files/feature_table.html use nom::{ IResult, branch::{ alt, }, bytes::complete::{ tag, take_while_m_n, take_while, take_while1, }, character::{ is_alphanumeric, }, combinator::{ cut, map, opt, verify, }, error::{ ParseError, }, multi::{ // many1, separated_list, }, sequence::{ tuple, }, }; use super::parser::Nommed; #[derive(Debug, PartialEq, Eq)] pub struct FeatureTable { features: Vec<FeatureRecord> } #[derive(Debug, PartialEq, Eq)] pub struct FeatureRecord { key: String, location: LocOp, qualifiers: Vec<Qualifier> } // impl <'a, E : ParseError<&'a str>> Nommed<&'a str, E> for FeatureRecord { // fn nom(input: &'a str) -> IResult<&'a str, FeatureRecord, E> { // } // } /// An ID that's valid within the feature table. /// /// This is: /// * At least one letter /// * Upper case, lower case letters /// * Numbers 0..9 /// * Underscore (_) /// * Hyphen (-) /// * Single quote (') /// * Asterisk (*) /// The maximum length is 20 characters. #[derive(Debug, PartialEq, Eq)] pub struct FtString(String); // litle utility for ranges. // // Note: couldn't use 'a'..='b' because this is an iterator, so doesn't // implement `Copy`. #[derive(Clone, Copy)] struct Interval<T>(T, T); impl <T : PartialOrd> Interval<T> { fn contains(&self, e: &T) -> bool { self.0 <= *e && *e <= self.1 } } impl <'a, E : ParseError<&'a str>> Nommed<&'a str, E> for FtString { fn nom(input: &'a str) -> IResult<&'a str, FtString, E> { let uc = Interval('A', 'Z'); let lc = Interval('a', 'z'); let di = Interval('0', '9'); let misc = "_-'*"; let ft_char = { move |c: char| uc.contains(&c) || lc.contains(&c) || di.contains(&c) || misc.contains(c) }; let alpha = { move |c: char| uc.contains(&c) || lc.contains(&c) }; map( verify( take_while_m_n(1, 20, ft_char), move |s: &str| s.chars().any(alpha) ), |s: &str| FtString(s.to_string()) )(input) } } #[derive(Debug, PartialEq, Eq)] pub struct Qualifier { name: FtString, value: Option<QualifierValue> } impl <'a, E : ParseError<&'a str>> Nommed<&'a str, E> for Qualifier { fn nom(input: &'a str) -> IResult<&'a str, Qualifier, E> { let parse_name = map(tuple((tag("/"), FtString::nom)), |(_, n)| n); let parse_value = map(tuple((tag("="), QualifierValue::nom)), |(_, v)| v); map( tuple((parse_name, opt(parse_value))), |(name, value)| Qualifier{ name, value } )(input) } } #[derive(Debug, PartialEq, Eq)] pub enum QualifierValue { QuotedText(String), VocabularyTerm(FtString), ReferenceNumber(u32), } impl <'a, E : ParseError<&'a str>> Nommed<&'a str, E> for QualifierValue{ fn nom(input: &'a str) -> IResult<&'a str, QualifierValue, E> { let parse_quoted_text = map( tuple((tag("\""), take_while(|c| c!= '"'), tag("\""))), |(_, v, _): (&str, &str, &str)| QualifierValue::QuotedText(v.to_string())); let parse_vocabulary_term = map( FtString::nom, QualifierValue::VocabularyTerm); let parse_reference_number = map( tuple((tag("["), u32::nom, tag("]"))), |(_, d, _)| QualifierValue::ReferenceNumber(d)); alt(( parse_quoted_text, parse_vocabulary_term, parse_reference_number ))(input) } } // // // Location data model starts here // // Should really be in a sub-module I guess // // /// A point within a sequence, representing a specific nucleotide. Counts from 1. #[derive(Debug, PartialEq, Eq)] pub struct Point(u32); impl <'a, E : ParseError<&'a str>> Nommed<&'a str, E> for Point { fn nom(input: &'a str) -> IResult<&'a str, Point, E> { map(u32::nom, Point)(input) } } /// A position between two bases in a sequence. /// pub /// For example, 122^123. The locations must be consecutive. /// /// For example, 100^1 for a circular sequence of length 100. #[derive(Debug, PartialEq, Eq)] pub struct Between(u32, u32); impl <'a, E : ParseError<&'a str>> Nommed<&'a str, E> for Between { fn nom(input: &'a str) -> IResult<&'a str, Between, E> { map( tuple(( u32::nom, tag("^"), u32::nom )), |(from, _, to)| Between(from, to) )(input) } } #[derive(Debug, PartialEq, Eq)] pub enum Position { Point(Point), Between(Between) } impl <'a, E : ParseError<&'a str>> Nommed<&'a str, E> for Position { fn nom(input: &'a str) -> IResult<&'a str, Position, E> { alt(( map(Between::nom, Position::Between), map(Point::nom, Position::Point) ))(input) } } #[derive(Debug, PartialEq, Eq)] pub enum Local { Point(Point), Between(Between), Within { from: Point, to: Point }, Span { from: Position, to: Position, before_from: bool, after_to: bool }, } impl Local { pub fn span(from: u32, to: u32) -> Local { Local::Span { from: Position::Point(Point(from)), to: Position::Point(Point(to)), before_from: false, after_to: false } } } impl <'a, E : ParseError<&'a str>> Nommed<&'a str, E> for Local { fn nom(input: &'a str) -> IResult<&'a str, Local, E> { let parse_within = map( tuple((Point::nom, tag("."), Point::nom)), |(from, _, to)| Local::Within { from, to }); let parse_span = map( tuple(( opt(tag("<")), Position::nom, tag(".."), opt(tag(">")), Position::nom)), |(before_from, from, _, after_to, to)| Local::Span { from, to, before_from: before_from.is_some(), after_to: after_to.is_some() } ); alt(( map(Between::nom, Local::Between), parse_within, parse_span, map(Point::nom, Local::Point), // must do this last as it's a prefix of the others ))(input) } } #[derive(Debug, PartialEq, Eq)] pub enum Loc { Remote { within: String, at: Local }, Local(Local) } impl <'a, E : ParseError<&'a str>> Nommed<&'a str, E> for Loc { fn nom(input: &'a str) -> IResult<&'a str, Loc, E> { let parse_accession = take_while1(|c| { let b = c as u8; is_alphanumeric(b) || b == b'.' }); alt(( map( tuple((parse_accession, tag(":"), Local::nom)), |(within, _, at)| Loc::Remote { within: within.to_string(), at } ), map(Local::nom, Loc::Local) ))(input) } } #[derive(Debug, PartialEq, Eq)] pub enum LocOp { Loc(Loc), Complement(Box<LocOp>), Join(Vec<LocOp>), Order(Vec<LocOp>) } impl <'a, E : ParseError<&'a str>> Nommed<&'a str, E> for LocOp { fn nom(input: &'a str) -> IResult<&'a str, LocOp, E> { let parse_complement = map( tuple(( tag("complement("), cut(LocOp::nom), tag(")") )), |(_, loc, _)| loc ); let parse_join = map( tuple(( tag("join("), cut(separated_list(tag(","), LocOp::nom)), tag(")") )), |(_, locs, _)| locs ); let parse_order = map( tuple(( tag("order("), cut(separated_list(tag(","), LocOp::nom)), tag(")") )), |(_, locs, _)| locs ); alt(( map(Loc::nom, LocOp::Loc), map(parse_complement, |loc| LocOp::Complement(Box::new(loc))), map(parse_join, LocOp::Join), map(parse_order, LocOp::Order) ))(input) } } #[cfg(test)] mod tests { use super::*; use nom::error::{ convert_error, VerboseError, }; fn assert_nom_to_expected<'a, T>() -> impl Fn(&'a str, T) -> () where T: Nommed<&'a str, VerboseError<&'a str>> + std::fmt::Debug + PartialEq { move |input: &str, expected: T| { match T::nom(input) { Ok((rem, ref res)) if!rem.is_empty() => panic!("Non-empty remaining input {}, parsed out {:?}", rem, res), Ok((_, res)) => assert_eq!(res, expected, "Got result {:?} but expected {:?}", res, expected), Err(nom::Err::Error(e)) | Err(nom::Err::Failure(e)) => panic!("Problem: {}", convert_error(input, e)), e => panic!("Unknown error: {:?}", e) } } } // #[test] // fn test_parse_feature_record_from_spec() { // let expect = assert_nom_to_expected::<FeatureRecord>(); // expect( // r#" // source 1..1000 // /culture_collection="ATCC:11775" // /culture_collection="CECT:515" // "#, // FeatureRecord { // key: "source".to_string(), // location: LocOp::Loc(Loc::Local(Local::span(1, 1000))), // qualifiers: vec![] // } // ) // } #[test] fn test_parse_qualifiers_from_spec() { let expect = assert_nom_to_expected::<Qualifier>(); expect( "/pseudo", Qualifier { name: FtString("pseudo".to_string()), value: None }); expect( "/citation=[1]", Qualifier { name: FtString("citation".to_string()), value: Some(QualifierValue::ReferenceNumber(1)) }); expect( "/gene=\"arsC\"", Qualifier { name: FtString("gene".to_string()), value: Some(QualifierValue::QuotedText("arsC".to_string()))}); expect( "/rpt_type=DISPERSED", Qualifier { name: FtString("rpt_type".to_string()), value: Some(QualifierValue::VocabularyTerm(FtString("DISPERSED".to_string())))}); } #[test] fn test_parse_locations_from_spec() { let expect = assert_nom_to_expected::<LocOp>(); expect( "467", LocOp::Loc(Loc::Local(Local::Point(Point(467)))));
expect( "340..565", LocOp::Loc(Loc::Local(Local::Span { from: Position::Point(Point(340)), to: Position::Point(Point(565)), before_from: false, after_to: false }))); expect( "<345..500", LocOp::Loc(Loc::Local(Local::Span { from: Position::Point(Point(345)), to: Position::Point(Point(500)), before_from: true, after_to: false }))); expect( "<1..888", LocOp::Loc(Loc::Local(Local::Span { from: Position::Point(Point(1)), to: Position::Point(Point(888)), before_from: true, after_to: false }))); expect( "1..>888", LocOp::Loc(Loc::Local(Local::Span { from: Position::Point(Point(1)), to: Position::Point(Point(888)), before_from: false, after_to: true }))); expect( "102.110", LocOp::Loc(Loc::Local(Local::Within { from: Point(102), to: Point(110) }))); expect( "123^124", LocOp::Loc(Loc::Local(Local::Between(Between(123, 124))))); expect( "join(12..78)", LocOp::Join(vec![ LocOp::Loc(Loc::Local(Local::span(12, 78)))])); expect( "join(12..78,134..202)", LocOp::Join(vec![ LocOp::Loc(Loc::Local(Local::span(12, 78))), LocOp::Loc(Loc::Local(Local::span(134, 202)))])); expect( "complement(34..126)", LocOp::Complement(Box::new(LocOp::Loc(Loc::Local(Local::span(34, 126)))))); expect( "complement(join(2691..4571,4918..5163))", LocOp::Complement(Box::new(LocOp::Join(vec![ LocOp::Loc(Loc::Local(Local::span(2691, 4571))), LocOp::Loc(Loc::Local(Local::span(4918, 5163))) ])))); expect( "join(complement(4918..5163),complement(2691..4571))", LocOp::Join(vec![ LocOp::Complement(Box::new(LocOp::Loc(Loc::Local(Local::span(4918, 5163))))), LocOp::Complement(Box::new(LocOp::Loc(Loc::Local(Local::span(2691, 4571))))) ])); expect( "J00194.1:100..202", LocOp::Loc(Loc::Remote{ within: String::from("J00194.1"), at: Local::span(100, 202) })); expect( "join(1..100,J00194.1:100..202)", LocOp::Join(vec![ LocOp::Loc(Loc::Local(Local::span(1, 100))), LocOp::Loc(Loc::Remote { within: String::from("J00194.1"), at: Local::span(100, 202)}) ])); } }
random_line_split
feature_table.rs
//! # Feature Table //! //! Data model and parsers for the DDBJ/ENA/GenBank Feature Table. //! //! See: http://www.insdc.org/files/feature_table.html use nom::{ IResult, branch::{ alt, }, bytes::complete::{ tag, take_while_m_n, take_while, take_while1, }, character::{ is_alphanumeric, }, combinator::{ cut, map, opt, verify, }, error::{ ParseError, }, multi::{ // many1, separated_list, }, sequence::{ tuple, }, }; use super::parser::Nommed; #[derive(Debug, PartialEq, Eq)] pub struct FeatureTable { features: Vec<FeatureRecord> } #[derive(Debug, PartialEq, Eq)] pub struct FeatureRecord { key: String, location: LocOp, qualifiers: Vec<Qualifier> } // impl <'a, E : ParseError<&'a str>> Nommed<&'a str, E> for FeatureRecord { // fn nom(input: &'a str) -> IResult<&'a str, FeatureRecord, E> { // } // } /// An ID that's valid within the feature table. /// /// This is: /// * At least one letter /// * Upper case, lower case letters /// * Numbers 0..9 /// * Underscore (_) /// * Hyphen (-) /// * Single quote (') /// * Asterisk (*) /// The maximum length is 20 characters. #[derive(Debug, PartialEq, Eq)] pub struct FtString(String); // litle utility for ranges. // // Note: couldn't use 'a'..='b' because this is an iterator, so doesn't // implement `Copy`. #[derive(Clone, Copy)] struct Interval<T>(T, T); impl <T : PartialOrd> Interval<T> { fn contains(&self, e: &T) -> bool { self.0 <= *e && *e <= self.1 } } impl <'a, E : ParseError<&'a str>> Nommed<&'a str, E> for FtString { fn nom(input: &'a str) -> IResult<&'a str, FtString, E> { let uc = Interval('A', 'Z'); let lc = Interval('a', 'z'); let di = Interval('0', '9'); let misc = "_-'*"; let ft_char = { move |c: char| uc.contains(&c) || lc.contains(&c) || di.contains(&c) || misc.contains(c) }; let alpha = { move |c: char| uc.contains(&c) || lc.contains(&c) }; map( verify( take_while_m_n(1, 20, ft_char), move |s: &str| s.chars().any(alpha) ), |s: &str| FtString(s.to_string()) )(input) } } #[derive(Debug, PartialEq, Eq)] pub struct Qualifier { name: FtString, value: Option<QualifierValue> } impl <'a, E : ParseError<&'a str>> Nommed<&'a str, E> for Qualifier { fn nom(input: &'a str) -> IResult<&'a str, Qualifier, E> { let parse_name = map(tuple((tag("/"), FtString::nom)), |(_, n)| n); let parse_value = map(tuple((tag("="), QualifierValue::nom)), |(_, v)| v); map( tuple((parse_name, opt(parse_value))), |(name, value)| Qualifier{ name, value } )(input) } } #[derive(Debug, PartialEq, Eq)] pub enum QualifierValue { QuotedText(String), VocabularyTerm(FtString), ReferenceNumber(u32), } impl <'a, E : ParseError<&'a str>> Nommed<&'a str, E> for QualifierValue{ fn nom(input: &'a str) -> IResult<&'a str, QualifierValue, E> { let parse_quoted_text = map( tuple((tag("\""), take_while(|c| c!= '"'), tag("\""))), |(_, v, _): (&str, &str, &str)| QualifierValue::QuotedText(v.to_string())); let parse_vocabulary_term = map( FtString::nom, QualifierValue::VocabularyTerm); let parse_reference_number = map( tuple((tag("["), u32::nom, tag("]"))), |(_, d, _)| QualifierValue::ReferenceNumber(d)); alt(( parse_quoted_text, parse_vocabulary_term, parse_reference_number ))(input) } } // // // Location data model starts here // // Should really be in a sub-module I guess // // /// A point within a sequence, representing a specific nucleotide. Counts from 1. #[derive(Debug, PartialEq, Eq)] pub struct Point(u32); impl <'a, E : ParseError<&'a str>> Nommed<&'a str, E> for Point { fn nom(input: &'a str) -> IResult<&'a str, Point, E> { map(u32::nom, Point)(input) } } /// A position between two bases in a sequence. /// pub /// For example, 122^123. The locations must be consecutive. /// /// For example, 100^1 for a circular sequence of length 100. #[derive(Debug, PartialEq, Eq)] pub struct Between(u32, u32); impl <'a, E : ParseError<&'a str>> Nommed<&'a str, E> for Between { fn nom(input: &'a str) -> IResult<&'a str, Between, E> { map( tuple(( u32::nom, tag("^"), u32::nom )), |(from, _, to)| Between(from, to) )(input) } } #[derive(Debug, PartialEq, Eq)] pub enum Position { Point(Point), Between(Between) } impl <'a, E : ParseError<&'a str>> Nommed<&'a str, E> for Position { fn nom(input: &'a str) -> IResult<&'a str, Position, E> { alt(( map(Between::nom, Position::Between), map(Point::nom, Position::Point) ))(input) } } #[derive(Debug, PartialEq, Eq)] pub enum Local { Point(Point), Between(Between), Within { from: Point, to: Point }, Span { from: Position, to: Position, before_from: bool, after_to: bool }, } impl Local { pub fn span(from: u32, to: u32) -> Local { Local::Span { from: Position::Point(Point(from)), to: Position::Point(Point(to)), before_from: false, after_to: false } } } impl <'a, E : ParseError<&'a str>> Nommed<&'a str, E> for Local { fn nom(input: &'a str) -> IResult<&'a str, Local, E>
))(input) } } #[derive(Debug, PartialEq, Eq)] pub enum Loc { Remote { within: String, at: Local }, Local(Local) } impl <'a, E : ParseError<&'a str>> Nommed<&'a str, E> for Loc { fn nom(input: &'a str) -> IResult<&'a str, Loc, E> { let parse_accession = take_while1(|c| { let b = c as u8; is_alphanumeric(b) || b == b'.' }); alt(( map( tuple((parse_accession, tag(":"), Local::nom)), |(within, _, at)| Loc::Remote { within: within.to_string(), at } ), map(Local::nom, Loc::Local) ))(input) } } #[derive(Debug, PartialEq, Eq)] pub enum LocOp { Loc(Loc), Complement(Box<LocOp>), Join(Vec<LocOp>), Order(Vec<LocOp>) } impl <'a, E : ParseError<&'a str>> Nommed<&'a str, E> for LocOp { fn nom(input: &'a str) -> IResult<&'a str, LocOp, E> { let parse_complement = map( tuple(( tag("complement("), cut(LocOp::nom), tag(")") )), |(_, loc, _)| loc ); let parse_join = map( tuple(( tag("join("), cut(separated_list(tag(","), LocOp::nom)), tag(")") )), |(_, locs, _)| locs ); let parse_order = map( tuple(( tag("order("), cut(separated_list(tag(","), LocOp::nom)), tag(")") )), |(_, locs, _)| locs ); alt(( map(Loc::nom, LocOp::Loc), map(parse_complement, |loc| LocOp::Complement(Box::new(loc))), map(parse_join, LocOp::Join), map(parse_order, LocOp::Order) ))(input) } } #[cfg(test)] mod tests { use super::*; use nom::error::{ convert_error, VerboseError, }; fn assert_nom_to_expected<'a, T>() -> impl Fn(&'a str, T) -> () where T: Nommed<&'a str, VerboseError<&'a str>> + std::fmt::Debug + PartialEq { move |input: &str, expected: T| { match T::nom(input) { Ok((rem, ref res)) if!rem.is_empty() => panic!("Non-empty remaining input {}, parsed out {:?}", rem, res), Ok((_, res)) => assert_eq!(res, expected, "Got result {:?} but expected {:?}", res, expected), Err(nom::Err::Error(e)) | Err(nom::Err::Failure(e)) => panic!("Problem: {}", convert_error(input, e)), e => panic!("Unknown error: {:?}", e) } } } // #[test] // fn test_parse_feature_record_from_spec() { // let expect = assert_nom_to_expected::<FeatureRecord>(); // expect( // r#" // source 1..1000 // /culture_collection="ATCC:11775" // /culture_collection="CECT:515" // "#, // FeatureRecord { // key: "source".to_string(), // location: LocOp::Loc(Loc::Local(Local::span(1, 1000))), // qualifiers: vec![] // } // ) // } #[test] fn test_parse_qualifiers_from_spec() { let expect = assert_nom_to_expected::<Qualifier>(); expect( "/pseudo", Qualifier { name: FtString("pseudo".to_string()), value: None }); expect( "/citation=[1]", Qualifier { name: FtString("citation".to_string()), value: Some(QualifierValue::ReferenceNumber(1)) }); expect( "/gene=\"arsC\"", Qualifier { name: FtString("gene".to_string()), value: Some(QualifierValue::QuotedText("arsC".to_string()))}); expect( "/rpt_type=DISPERSED", Qualifier { name: FtString("rpt_type".to_string()), value: Some(QualifierValue::VocabularyTerm(FtString("DISPERSED".to_string())))}); } #[test] fn test_parse_locations_from_spec() { let expect = assert_nom_to_expected::<LocOp>(); expect( "467", LocOp::Loc(Loc::Local(Local::Point(Point(467))))); expect( "340..565", LocOp::Loc(Loc::Local(Local::Span { from: Position::Point(Point(340)), to: Position::Point(Point(565)), before_from: false, after_to: false }))); expect( "<345..500", LocOp::Loc(Loc::Local(Local::Span { from: Position::Point(Point(345)), to: Position::Point(Point(500)), before_from: true, after_to: false }))); expect( "<1..888", LocOp::Loc(Loc::Local(Local::Span { from: Position::Point(Point(1)), to: Position::Point(Point(888)), before_from: true, after_to: false }))); expect( "1..>888", LocOp::Loc(Loc::Local(Local::Span { from: Position::Point(Point(1)), to: Position::Point(Point(888)), before_from: false, after_to: true }))); expect( "102.110", LocOp::Loc(Loc::Local(Local::Within { from: Point(102), to: Point(110) }))); expect( "123^124", LocOp::Loc(Loc::Local(Local::Between(Between(123, 124))))); expect( "join(12..78)", LocOp::Join(vec![ LocOp::Loc(Loc::Local(Local::span(12, 78)))])); expect( "join(12..78,134..202)", LocOp::Join(vec![ LocOp::Loc(Loc::Local(Local::span(12, 78))), LocOp::Loc(Loc::Local(Local::span(134, 202)))])); expect( "complement(34..126)", LocOp::Complement(Box::new(LocOp::Loc(Loc::Local(Local::span(34, 126)))))); expect( "complement(join(2691..4571,4918..5163))", LocOp::Complement(Box::new(LocOp::Join(vec![ LocOp::Loc(Loc::Local(Local::span(2691, 4571))), LocOp::Loc(Loc::Local(Local::span(4918, 5163))) ])))); expect( "join(complement(4918..5163),complement(2691..4571))", LocOp::Join(vec![ LocOp::Complement(Box::new(LocOp::Loc(Loc::Local(Local::span(4918, 5163))))), LocOp::Complement(Box::new(LocOp::Loc(Loc::Local(Local::span(2691, 4571))))) ])); expect( "J00194.1:100..202", LocOp::Loc(Loc::Remote{ within: String::from("J00194.1"), at: Local::span(100, 202) })); expect( "join(1..100,J00194.1:100..202)", LocOp::Join(vec![ LocOp::Loc(Loc::Local(Local::span(1, 100))), LocOp::Loc(Loc::Remote { within: String::from("J00194.1"), at: Local::span(100, 202)}) ])); } }
{ let parse_within = map( tuple((Point::nom, tag("."), Point::nom)), |(from, _, to)| Local::Within { from, to }); let parse_span = map( tuple(( opt(tag("<")), Position::nom, tag(".."), opt(tag(">")), Position::nom)), |(before_from, from, _, after_to, to)| Local::Span { from, to, before_from: before_from.is_some(), after_to: after_to.is_some() } ); alt(( map(Between::nom, Local::Between), parse_within, parse_span, map(Point::nom, Local::Point), // must do this last as it's a prefix of the others
identifier_body
feature_table.rs
//! # Feature Table //! //! Data model and parsers for the DDBJ/ENA/GenBank Feature Table. //! //! See: http://www.insdc.org/files/feature_table.html use nom::{ IResult, branch::{ alt, }, bytes::complete::{ tag, take_while_m_n, take_while, take_while1, }, character::{ is_alphanumeric, }, combinator::{ cut, map, opt, verify, }, error::{ ParseError, }, multi::{ // many1, separated_list, }, sequence::{ tuple, }, }; use super::parser::Nommed; #[derive(Debug, PartialEq, Eq)] pub struct FeatureTable { features: Vec<FeatureRecord> } #[derive(Debug, PartialEq, Eq)] pub struct
{ key: String, location: LocOp, qualifiers: Vec<Qualifier> } // impl <'a, E : ParseError<&'a str>> Nommed<&'a str, E> for FeatureRecord { // fn nom(input: &'a str) -> IResult<&'a str, FeatureRecord, E> { // } // } /// An ID that's valid within the feature table. /// /// This is: /// * At least one letter /// * Upper case, lower case letters /// * Numbers 0..9 /// * Underscore (_) /// * Hyphen (-) /// * Single quote (') /// * Asterisk (*) /// The maximum length is 20 characters. #[derive(Debug, PartialEq, Eq)] pub struct FtString(String); // litle utility for ranges. // // Note: couldn't use 'a'..='b' because this is an iterator, so doesn't // implement `Copy`. #[derive(Clone, Copy)] struct Interval<T>(T, T); impl <T : PartialOrd> Interval<T> { fn contains(&self, e: &T) -> bool { self.0 <= *e && *e <= self.1 } } impl <'a, E : ParseError<&'a str>> Nommed<&'a str, E> for FtString { fn nom(input: &'a str) -> IResult<&'a str, FtString, E> { let uc = Interval('A', 'Z'); let lc = Interval('a', 'z'); let di = Interval('0', '9'); let misc = "_-'*"; let ft_char = { move |c: char| uc.contains(&c) || lc.contains(&c) || di.contains(&c) || misc.contains(c) }; let alpha = { move |c: char| uc.contains(&c) || lc.contains(&c) }; map( verify( take_while_m_n(1, 20, ft_char), move |s: &str| s.chars().any(alpha) ), |s: &str| FtString(s.to_string()) )(input) } } #[derive(Debug, PartialEq, Eq)] pub struct Qualifier { name: FtString, value: Option<QualifierValue> } impl <'a, E : ParseError<&'a str>> Nommed<&'a str, E> for Qualifier { fn nom(input: &'a str) -> IResult<&'a str, Qualifier, E> { let parse_name = map(tuple((tag("/"), FtString::nom)), |(_, n)| n); let parse_value = map(tuple((tag("="), QualifierValue::nom)), |(_, v)| v); map( tuple((parse_name, opt(parse_value))), |(name, value)| Qualifier{ name, value } )(input) } } #[derive(Debug, PartialEq, Eq)] pub enum QualifierValue { QuotedText(String), VocabularyTerm(FtString), ReferenceNumber(u32), } impl <'a, E : ParseError<&'a str>> Nommed<&'a str, E> for QualifierValue{ fn nom(input: &'a str) -> IResult<&'a str, QualifierValue, E> { let parse_quoted_text = map( tuple((tag("\""), take_while(|c| c!= '"'), tag("\""))), |(_, v, _): (&str, &str, &str)| QualifierValue::QuotedText(v.to_string())); let parse_vocabulary_term = map( FtString::nom, QualifierValue::VocabularyTerm); let parse_reference_number = map( tuple((tag("["), u32::nom, tag("]"))), |(_, d, _)| QualifierValue::ReferenceNumber(d)); alt(( parse_quoted_text, parse_vocabulary_term, parse_reference_number ))(input) } } // // // Location data model starts here // // Should really be in a sub-module I guess // // /// A point within a sequence, representing a specific nucleotide. Counts from 1. #[derive(Debug, PartialEq, Eq)] pub struct Point(u32); impl <'a, E : ParseError<&'a str>> Nommed<&'a str, E> for Point { fn nom(input: &'a str) -> IResult<&'a str, Point, E> { map(u32::nom, Point)(input) } } /// A position between two bases in a sequence. /// pub /// For example, 122^123. The locations must be consecutive. /// /// For example, 100^1 for a circular sequence of length 100. #[derive(Debug, PartialEq, Eq)] pub struct Between(u32, u32); impl <'a, E : ParseError<&'a str>> Nommed<&'a str, E> for Between { fn nom(input: &'a str) -> IResult<&'a str, Between, E> { map( tuple(( u32::nom, tag("^"), u32::nom )), |(from, _, to)| Between(from, to) )(input) } } #[derive(Debug, PartialEq, Eq)] pub enum Position { Point(Point), Between(Between) } impl <'a, E : ParseError<&'a str>> Nommed<&'a str, E> for Position { fn nom(input: &'a str) -> IResult<&'a str, Position, E> { alt(( map(Between::nom, Position::Between), map(Point::nom, Position::Point) ))(input) } } #[derive(Debug, PartialEq, Eq)] pub enum Local { Point(Point), Between(Between), Within { from: Point, to: Point }, Span { from: Position, to: Position, before_from: bool, after_to: bool }, } impl Local { pub fn span(from: u32, to: u32) -> Local { Local::Span { from: Position::Point(Point(from)), to: Position::Point(Point(to)), before_from: false, after_to: false } } } impl <'a, E : ParseError<&'a str>> Nommed<&'a str, E> for Local { fn nom(input: &'a str) -> IResult<&'a str, Local, E> { let parse_within = map( tuple((Point::nom, tag("."), Point::nom)), |(from, _, to)| Local::Within { from, to }); let parse_span = map( tuple(( opt(tag("<")), Position::nom, tag(".."), opt(tag(">")), Position::nom)), |(before_from, from, _, after_to, to)| Local::Span { from, to, before_from: before_from.is_some(), after_to: after_to.is_some() } ); alt(( map(Between::nom, Local::Between), parse_within, parse_span, map(Point::nom, Local::Point), // must do this last as it's a prefix of the others ))(input) } } #[derive(Debug, PartialEq, Eq)] pub enum Loc { Remote { within: String, at: Local }, Local(Local) } impl <'a, E : ParseError<&'a str>> Nommed<&'a str, E> for Loc { fn nom(input: &'a str) -> IResult<&'a str, Loc, E> { let parse_accession = take_while1(|c| { let b = c as u8; is_alphanumeric(b) || b == b'.' }); alt(( map( tuple((parse_accession, tag(":"), Local::nom)), |(within, _, at)| Loc::Remote { within: within.to_string(), at } ), map(Local::nom, Loc::Local) ))(input) } } #[derive(Debug, PartialEq, Eq)] pub enum LocOp { Loc(Loc), Complement(Box<LocOp>), Join(Vec<LocOp>), Order(Vec<LocOp>) } impl <'a, E : ParseError<&'a str>> Nommed<&'a str, E> for LocOp { fn nom(input: &'a str) -> IResult<&'a str, LocOp, E> { let parse_complement = map( tuple(( tag("complement("), cut(LocOp::nom), tag(")") )), |(_, loc, _)| loc ); let parse_join = map( tuple(( tag("join("), cut(separated_list(tag(","), LocOp::nom)), tag(")") )), |(_, locs, _)| locs ); let parse_order = map( tuple(( tag("order("), cut(separated_list(tag(","), LocOp::nom)), tag(")") )), |(_, locs, _)| locs ); alt(( map(Loc::nom, LocOp::Loc), map(parse_complement, |loc| LocOp::Complement(Box::new(loc))), map(parse_join, LocOp::Join), map(parse_order, LocOp::Order) ))(input) } } #[cfg(test)] mod tests { use super::*; use nom::error::{ convert_error, VerboseError, }; fn assert_nom_to_expected<'a, T>() -> impl Fn(&'a str, T) -> () where T: Nommed<&'a str, VerboseError<&'a str>> + std::fmt::Debug + PartialEq { move |input: &str, expected: T| { match T::nom(input) { Ok((rem, ref res)) if!rem.is_empty() => panic!("Non-empty remaining input {}, parsed out {:?}", rem, res), Ok((_, res)) => assert_eq!(res, expected, "Got result {:?} but expected {:?}", res, expected), Err(nom::Err::Error(e)) | Err(nom::Err::Failure(e)) => panic!("Problem: {}", convert_error(input, e)), e => panic!("Unknown error: {:?}", e) } } } // #[test] // fn test_parse_feature_record_from_spec() { // let expect = assert_nom_to_expected::<FeatureRecord>(); // expect( // r#" // source 1..1000 // /culture_collection="ATCC:11775" // /culture_collection="CECT:515" // "#, // FeatureRecord { // key: "source".to_string(), // location: LocOp::Loc(Loc::Local(Local::span(1, 1000))), // qualifiers: vec![] // } // ) // } #[test] fn test_parse_qualifiers_from_spec() { let expect = assert_nom_to_expected::<Qualifier>(); expect( "/pseudo", Qualifier { name: FtString("pseudo".to_string()), value: None }); expect( "/citation=[1]", Qualifier { name: FtString("citation".to_string()), value: Some(QualifierValue::ReferenceNumber(1)) }); expect( "/gene=\"arsC\"", Qualifier { name: FtString("gene".to_string()), value: Some(QualifierValue::QuotedText("arsC".to_string()))}); expect( "/rpt_type=DISPERSED", Qualifier { name: FtString("rpt_type".to_string()), value: Some(QualifierValue::VocabularyTerm(FtString("DISPERSED".to_string())))}); } #[test] fn test_parse_locations_from_spec() { let expect = assert_nom_to_expected::<LocOp>(); expect( "467", LocOp::Loc(Loc::Local(Local::Point(Point(467))))); expect( "340..565", LocOp::Loc(Loc::Local(Local::Span { from: Position::Point(Point(340)), to: Position::Point(Point(565)), before_from: false, after_to: false }))); expect( "<345..500", LocOp::Loc(Loc::Local(Local::Span { from: Position::Point(Point(345)), to: Position::Point(Point(500)), before_from: true, after_to: false }))); expect( "<1..888", LocOp::Loc(Loc::Local(Local::Span { from: Position::Point(Point(1)), to: Position::Point(Point(888)), before_from: true, after_to: false }))); expect( "1..>888", LocOp::Loc(Loc::Local(Local::Span { from: Position::Point(Point(1)), to: Position::Point(Point(888)), before_from: false, after_to: true }))); expect( "102.110", LocOp::Loc(Loc::Local(Local::Within { from: Point(102), to: Point(110) }))); expect( "123^124", LocOp::Loc(Loc::Local(Local::Between(Between(123, 124))))); expect( "join(12..78)", LocOp::Join(vec![ LocOp::Loc(Loc::Local(Local::span(12, 78)))])); expect( "join(12..78,134..202)", LocOp::Join(vec![ LocOp::Loc(Loc::Local(Local::span(12, 78))), LocOp::Loc(Loc::Local(Local::span(134, 202)))])); expect( "complement(34..126)", LocOp::Complement(Box::new(LocOp::Loc(Loc::Local(Local::span(34, 126)))))); expect( "complement(join(2691..4571,4918..5163))", LocOp::Complement(Box::new(LocOp::Join(vec![ LocOp::Loc(Loc::Local(Local::span(2691, 4571))), LocOp::Loc(Loc::Local(Local::span(4918, 5163))) ])))); expect( "join(complement(4918..5163),complement(2691..4571))", LocOp::Join(vec![ LocOp::Complement(Box::new(LocOp::Loc(Loc::Local(Local::span(4918, 5163))))), LocOp::Complement(Box::new(LocOp::Loc(Loc::Local(Local::span(2691, 4571))))) ])); expect( "J00194.1:100..202", LocOp::Loc(Loc::Remote{ within: String::from("J00194.1"), at: Local::span(100, 202) })); expect( "join(1..100,J00194.1:100..202)", LocOp::Join(vec![ LocOp::Loc(Loc::Local(Local::span(1, 100))), LocOp::Loc(Loc::Remote { within: String::from("J00194.1"), at: Local::span(100, 202)}) ])); } }
FeatureRecord
identifier_name
condition_strategy_generators.rs
use crate::ai_utils::playout_result; use crate::competing_optimizers::StrategyOptimizer; use crate::condition_strategy::{ Condition, ConditionKind, ConditionStrategy, EvaluatedPriorities, EvaluationData, Rule, }; use crate::representative_sampling::NewFractalRepresentativeSeedSearch; use crate::seed_system::{Seed, SingleSeed, SingleSeedGenerator}; use crate::seeds_concrete::CombatChoiceLineagesKind; use crate::simulation::{Runner, StandardRunner}; use crate::simulation_state::CombatState; use rand::seq::SliceRandom; use rand::{Rng, SeedableRng}; use rand_chacha::ChaCha8Rng; use rand_distr::StandardNormal; use serde::{Deserialize, Serialize}; use smallvec::alloc::fmt::Formatter; use std::fmt; use std::fmt::Display; use std::ops::Deref; use std::sync::Arc; use std::time::{Duration, Instant}; pub type SeedSearch = NewFractalRepresentativeSeedSearch< ConditionStrategy, SingleSeed<CombatChoiceLineagesKind>, SingleSeedGenerator, >; pub struct StrategyGeneratorsWithSharedRepresenativeSeeds { pub seed_search: SeedSearch, pub generators: Vec<SharingGenerator>, } pub struct SharingGenerator { pub time_used: Duration, pub generator: GeneratorKind, } #[derive(Clone, Serialize, Deserialize, Debug)] pub enum GeneratorKind { HillClimb { steps: usize, num_verification_seeds: usize, start: HillClimbStart, kind: HillClimbKind, }, } #[derive(Copy, Clone, Serialize, Deserialize, Debug)] pub enum HillClimbStart { NewRandom, FromSeedSearch, } #[derive(Copy, Clone, Serialize, Deserialize, Debug)] pub enum HillClimbKind { BunchOfRandomChanges, BunchOfRandomChangesInspired, OneRelevantRule, } impl StrategyGeneratorsWithSharedRepresenativeSeeds { pub fn new( starting_state: CombatState, rng: &mut impl Rng, ) -> StrategyGeneratorsWithSharedRepresenativeSeeds { let mut generators = Vec::new(); for steps in (0..=8).map(|i| 1 << i) { for num_verification_seeds in (0..=5).map(|i| 1 << i) { for &start in &[HillClimbStart::NewRandom, HillClimbStart::FromSeedSearch] { for &kind in &[ HillClimbKind::BunchOfRandomChanges, HillClimbKind::BunchOfRandomChangesInspired, HillClimbKind::OneRelevantRule, ] { generators.push(SharingGenerator { time_used: Duration::from_secs(0), generator: GeneratorKind::HillClimb { steps, num_verification_seeds, start, kind, }, }); } } } } StrategyGeneratorsWithSharedRepresenativeSeeds { seed_search: NewFractalRepresentativeSeedSearch::new( starting_state, SingleSeedGenerator::new(ChaCha8Rng::from_rng(rng).unwrap()), Default::default(), ), generators, } } pub fn step(&mut self, rng: &mut impl Rng) { let generator = self .generators .iter_mut() .min_by_key(|g| g.time_used) .unwrap(); let start = Instant::now(); let strategy = generator.generator.gen_strategy(&self.seed_search, rng); let duration = start.elapsed(); generator.time_used += duration; self.seed_search.consider_strategy( Arc::new(strategy), generator.generator.min_playouts_before_culling(), rng, ); } } pub struct HillClimbSeedInfo<'a> { pub seed: &'a SingleSeed<CombatChoiceLineagesKind>, pub current_score: f64, } impl GeneratorKind { pub fn min_playouts_before_culling(&self) -> usize { match self { &GeneratorKind::HillClimb { steps,.. } => steps.min(32), } } pub fn gen_strategy(&self, seed_search: &SeedSearch, rng: &mut impl Rng) -> ConditionStrategy { match self { &GeneratorKind::HillClimb { steps, num_verification_seeds, start, kind, } => { let mut current = match start { HillClimbStart::NewRandom => { ConditionStrategy::fresh_distinctive_candidate(&seed_search.starting_state, rng) } HillClimbStart::FromSeedSearch => seed_search .strategies .choose(rng) .unwrap() .strategy .deref() .clone(), }; let mut verification_seeds: Vec<_> = seed_search .seeds .iter() .take(num_verification_seeds) .collect(); // hack - the seed search may not have generated this many (or any) seeds yet let extra_seeds; if verification_seeds.len() < num_verification_seeds
let mut verification_seeds: Vec<_> = verification_seeds .into_iter() .map(|s| HillClimbSeedInfo { seed: s, current_score: playout_result(&seed_search.starting_state, s.view(), &current).score, }) .collect(); let mut improvements = 0; let mut improvements_on_first = 0; for _ in 0..steps { verification_seeds.shuffle(rng); let (first, rest) = verification_seeds.split_first().unwrap(); let new = kind.hill_climb_candidate(seed_search, &current, &verification_seeds, rng); let first_score = playout_result(&seed_search.starting_state, first.seed.view(), &new).score; if first_score <= verification_seeds[0].current_score { continue; } improvements_on_first += 1; let new_scores: Vec<_> = std::iter::once(first_score) .chain( rest .iter() .map(|s| playout_result(&seed_search.starting_state, s.seed.view(), &new).score), ) .collect(); if new_scores.iter().sum::<f64>() > verification_seeds .iter() .map(|s| s.current_score) .sum::<f64>() { current = new; for (info, new_score) in verification_seeds.iter_mut().zip(new_scores) { info.current_score = new_score; } improvements += 1; } } current.annotation = format!( "{} + {}/{}/{}", current.annotation, improvements, improvements_on_first, self ); current } } } } impl HillClimbKind { fn hill_climb_candidate( &self, seed_search: &SeedSearch, current: &ConditionStrategy, verification_seeds: &[HillClimbSeedInfo], rng: &mut impl Rng, ) -> ConditionStrategy { let (first, _rest) = verification_seeds.split_first().unwrap(); match self { HillClimbKind::BunchOfRandomChanges => { current.bunch_of_random_changes(&seed_search.starting_state, rng, &[]) } HillClimbKind::BunchOfRandomChangesInspired => current.bunch_of_random_changes( &seed_search.starting_state, rng, &seed_search .strategies .iter() .map(|s| &*s.strategy) .collect::<Vec<_>>(), ), HillClimbKind::OneRelevantRule => { let mut state = seed_search.starting_state.clone(); let mut runner = StandardRunner::new(&mut state, first.seed.view()); let mut candidate_rules = Vec::new(); while!runner.state().combat_over() { let state = runner.state(); let data = EvaluationData::new(state); let priorities = EvaluatedPriorities::evaluated(&current.rules, state, &data); let best_index = priorities.best_index(); for _ in 0..50 { let condition = Condition::random_generally_relevant_choice_distinguisher(state, rng); let mut rule = Rule { conditions: vec![condition], flat_reward: rng.sample(StandardNormal), ..Default::default() }; if priorities.best_index_with_extra_rule(&rule, state, &data)!= best_index { for _ in 0..rng.gen_range(0..=2) { for _ in 0..50 { let condition = Condition::random_generally_relevant_state_distinguisher(state, rng); if condition.evaluate(state, &data.contexts().next().unwrap()) { rule.conditions.push(condition); break; } } } candidate_rules.push(rule); break; } } let choice = &data.choices[best_index].choice; runner.apply_choice(&choice); } let mut new = current.clone(); if let Some(new_rule) = candidate_rules.choose(rng) { new.rules.push(new_rule.clone()) } new } } } } impl Display for GeneratorKind { fn fmt(&self, f: &mut Formatter<'_>) -> fmt::Result { match self { GeneratorKind::HillClimb { steps, num_verification_seeds, start: _, kind, } => { write!(f, "{}x{:?}@{}", steps, kind, num_verification_seeds) } } } } impl StrategyOptimizer for StrategyGeneratorsWithSharedRepresenativeSeeds { type Strategy = ConditionStrategy; fn step(&mut self, _state: &CombatState, rng: &mut ChaCha8Rng) { self.step(rng); } fn report(&self) -> Arc<Self::Strategy> { let result = self.seed_search.best_strategy(); self.seed_search.report(); println!("StrategyGeneratorsWithSharedRepresenativeSeeds top strategies:"); for strategy in &self.seed_search.strategies { println!("{}", strategy.strategy.annotation); } result } } impl ConditionStrategy { pub fn bunch_of_random_changes( &self, state: &CombatState, rng: &mut impl Rng, promising_strategies: &[&ConditionStrategy], ) -> ConditionStrategy { fn tweak_rules( rules: &mut Vec<Rule>, state: &CombatState, rng: &mut impl Rng, promising_conditions: &[Condition], ) { let remove_chance = 0.05f64.min(2.0 / rules.len() as f64); rules.retain(|_| rng.gen::<f64>() > remove_chance); for rule in rules.iter_mut() { if rng.gen() { if rule.flat_reward!= 0.0 { rule.flat_reward += rng.sample::<f64, _>(StandardNormal) * 0.2; } if rule.block_per_energy_reward!= 0.0 { rule.block_per_energy_reward += rng.sample::<f64, _>(StandardNormal) * 0.02; } for value in &mut rule.unblocked_damage_per_energy_rewards { if *value!= 0.0 { *value += rng.sample::<f64, _>(StandardNormal) * 0.01; } } } } for _ in 0..rng.gen_range(10..30) { let condition; if rng.gen() || promising_conditions.is_empty() { condition = Condition::random_generally_relevant_state_distinguisher(state, rng); } else { condition = promising_conditions.choose(rng).unwrap().clone(); } if rng.gen() || rules.is_empty() { rules.push(Rule { conditions: vec![ Condition::random_generally_relevant_choice_distinguisher(state, rng), condition, ], flat_reward: rng.sample(StandardNormal), ..Default::default() }) } else { rules.choose_mut(rng).unwrap().conditions.push(condition); } } } let promising_conditions: Vec<_> = promising_strategies .iter() .flat_map(|s| { s.rules .iter() .flat_map(|rule| &rule.conditions) .filter(|c| { !matches!( c.kind, ConditionKind::PlayCardId(_) | ConditionKind::UsePotionId(_) ) }) .cloned() }) .collect(); let mut result = self.clone(); tweak_rules(&mut result.rules, state, rng, &promising_conditions); result } }
{ extra_seeds = (verification_seeds.len()..num_verification_seeds) .map(|_| SingleSeed::new(rng)) .collect::<Vec<_>>(); verification_seeds.extend(extra_seeds.iter()); }
conditional_block
condition_strategy_generators.rs
use crate::ai_utils::playout_result; use crate::competing_optimizers::StrategyOptimizer; use crate::condition_strategy::{ Condition, ConditionKind, ConditionStrategy, EvaluatedPriorities, EvaluationData, Rule, }; use crate::representative_sampling::NewFractalRepresentativeSeedSearch; use crate::seed_system::{Seed, SingleSeed, SingleSeedGenerator}; use crate::seeds_concrete::CombatChoiceLineagesKind; use crate::simulation::{Runner, StandardRunner}; use crate::simulation_state::CombatState; use rand::seq::SliceRandom; use rand::{Rng, SeedableRng}; use rand_chacha::ChaCha8Rng; use rand_distr::StandardNormal; use serde::{Deserialize, Serialize}; use smallvec::alloc::fmt::Formatter; use std::fmt; use std::fmt::Display; use std::ops::Deref; use std::sync::Arc; use std::time::{Duration, Instant}; pub type SeedSearch = NewFractalRepresentativeSeedSearch< ConditionStrategy, SingleSeed<CombatChoiceLineagesKind>, SingleSeedGenerator, >; pub struct StrategyGeneratorsWithSharedRepresenativeSeeds { pub seed_search: SeedSearch, pub generators: Vec<SharingGenerator>, } pub struct SharingGenerator { pub time_used: Duration, pub generator: GeneratorKind, } #[derive(Clone, Serialize, Deserialize, Debug)] pub enum GeneratorKind { HillClimb { steps: usize, num_verification_seeds: usize, start: HillClimbStart, kind: HillClimbKind, }, } #[derive(Copy, Clone, Serialize, Deserialize, Debug)] pub enum HillClimbStart { NewRandom, FromSeedSearch, } #[derive(Copy, Clone, Serialize, Deserialize, Debug)] pub enum HillClimbKind { BunchOfRandomChanges, BunchOfRandomChangesInspired, OneRelevantRule, } impl StrategyGeneratorsWithSharedRepresenativeSeeds { pub fn new( starting_state: CombatState, rng: &mut impl Rng, ) -> StrategyGeneratorsWithSharedRepresenativeSeeds { let mut generators = Vec::new(); for steps in (0..=8).map(|i| 1 << i) { for num_verification_seeds in (0..=5).map(|i| 1 << i) { for &start in &[HillClimbStart::NewRandom, HillClimbStart::FromSeedSearch] { for &kind in &[ HillClimbKind::BunchOfRandomChanges, HillClimbKind::BunchOfRandomChangesInspired, HillClimbKind::OneRelevantRule, ] { generators.push(SharingGenerator { time_used: Duration::from_secs(0), generator: GeneratorKind::HillClimb { steps, num_verification_seeds, start, kind, }, }); } } } } StrategyGeneratorsWithSharedRepresenativeSeeds { seed_search: NewFractalRepresentativeSeedSearch::new( starting_state, SingleSeedGenerator::new(ChaCha8Rng::from_rng(rng).unwrap()), Default::default(), ), generators, } } pub fn step(&mut self, rng: &mut impl Rng) { let generator = self .generators .iter_mut() .min_by_key(|g| g.time_used) .unwrap(); let start = Instant::now(); let strategy = generator.generator.gen_strategy(&self.seed_search, rng); let duration = start.elapsed(); generator.time_used += duration; self.seed_search.consider_strategy( Arc::new(strategy), generator.generator.min_playouts_before_culling(), rng, ); } } pub struct HillClimbSeedInfo<'a> { pub seed: &'a SingleSeed<CombatChoiceLineagesKind>, pub current_score: f64, } impl GeneratorKind { pub fn min_playouts_before_culling(&self) -> usize { match self { &GeneratorKind::HillClimb { steps,.. } => steps.min(32), } } pub fn gen_strategy(&self, seed_search: &SeedSearch, rng: &mut impl Rng) -> ConditionStrategy { match self { &GeneratorKind::HillClimb { steps, num_verification_seeds, start, kind, } => { let mut current = match start { HillClimbStart::NewRandom => { ConditionStrategy::fresh_distinctive_candidate(&seed_search.starting_state, rng) } HillClimbStart::FromSeedSearch => seed_search .strategies .choose(rng) .unwrap() .strategy .deref() .clone(), }; let mut verification_seeds: Vec<_> = seed_search .seeds .iter() .take(num_verification_seeds) .collect(); // hack - the seed search may not have generated this many (or any) seeds yet let extra_seeds; if verification_seeds.len() < num_verification_seeds { extra_seeds = (verification_seeds.len()..num_verification_seeds) .map(|_| SingleSeed::new(rng)) .collect::<Vec<_>>(); verification_seeds.extend(extra_seeds.iter()); } let mut verification_seeds: Vec<_> = verification_seeds .into_iter() .map(|s| HillClimbSeedInfo { seed: s, current_score: playout_result(&seed_search.starting_state, s.view(), &current).score, }) .collect(); let mut improvements = 0; let mut improvements_on_first = 0; for _ in 0..steps { verification_seeds.shuffle(rng); let (first, rest) = verification_seeds.split_first().unwrap(); let new = kind.hill_climb_candidate(seed_search, &current, &verification_seeds, rng); let first_score = playout_result(&seed_search.starting_state, first.seed.view(), &new).score; if first_score <= verification_seeds[0].current_score { continue; } improvements_on_first += 1; let new_scores: Vec<_> = std::iter::once(first_score) .chain( rest .iter() .map(|s| playout_result(&seed_search.starting_state, s.seed.view(), &new).score), ) .collect(); if new_scores.iter().sum::<f64>() > verification_seeds .iter() .map(|s| s.current_score) .sum::<f64>() { current = new; for (info, new_score) in verification_seeds.iter_mut().zip(new_scores) { info.current_score = new_score; } improvements += 1; } } current.annotation = format!( "{} + {}/{}/{}", current.annotation, improvements, improvements_on_first, self ); current } } } } impl HillClimbKind { fn hill_climb_candidate( &self, seed_search: &SeedSearch, current: &ConditionStrategy, verification_seeds: &[HillClimbSeedInfo], rng: &mut impl Rng, ) -> ConditionStrategy { let (first, _rest) = verification_seeds.split_first().unwrap(); match self { HillClimbKind::BunchOfRandomChanges => { current.bunch_of_random_changes(&seed_search.starting_state, rng, &[]) } HillClimbKind::BunchOfRandomChangesInspired => current.bunch_of_random_changes( &seed_search.starting_state, rng, &seed_search .strategies .iter() .map(|s| &*s.strategy) .collect::<Vec<_>>(), ), HillClimbKind::OneRelevantRule => { let mut state = seed_search.starting_state.clone(); let mut runner = StandardRunner::new(&mut state, first.seed.view()); let mut candidate_rules = Vec::new(); while!runner.state().combat_over() { let state = runner.state(); let data = EvaluationData::new(state); let priorities = EvaluatedPriorities::evaluated(&current.rules, state, &data); let best_index = priorities.best_index(); for _ in 0..50 { let condition = Condition::random_generally_relevant_choice_distinguisher(state, rng); let mut rule = Rule { conditions: vec![condition], flat_reward: rng.sample(StandardNormal), ..Default::default() }; if priorities.best_index_with_extra_rule(&rule, state, &data)!= best_index { for _ in 0..rng.gen_range(0..=2) { for _ in 0..50 { let condition = Condition::random_generally_relevant_state_distinguisher(state, rng); if condition.evaluate(state, &data.contexts().next().unwrap()) { rule.conditions.push(condition); break; } } } candidate_rules.push(rule); break; } } let choice = &data.choices[best_index].choice; runner.apply_choice(&choice); } let mut new = current.clone(); if let Some(new_rule) = candidate_rules.choose(rng) { new.rules.push(new_rule.clone()) } new } } } } impl Display for GeneratorKind { fn fmt(&self, f: &mut Formatter<'_>) -> fmt::Result { match self { GeneratorKind::HillClimb { steps, num_verification_seeds, start: _, kind, } => { write!(f, "{}x{:?}@{}", steps, kind, num_verification_seeds) } } } } impl StrategyOptimizer for StrategyGeneratorsWithSharedRepresenativeSeeds { type Strategy = ConditionStrategy; fn step(&mut self, _state: &CombatState, rng: &mut ChaCha8Rng) { self.step(rng); } fn report(&self) -> Arc<Self::Strategy> { let result = self.seed_search.best_strategy(); self.seed_search.report(); println!("StrategyGeneratorsWithSharedRepresenativeSeeds top strategies:"); for strategy in &self.seed_search.strategies { println!("{}", strategy.strategy.annotation); } result } } impl ConditionStrategy { pub fn bunch_of_random_changes( &self, state: &CombatState, rng: &mut impl Rng, promising_strategies: &[&ConditionStrategy], ) -> ConditionStrategy { fn tweak_rules( rules: &mut Vec<Rule>, state: &CombatState, rng: &mut impl Rng, promising_conditions: &[Condition], ) { let remove_chance = 0.05f64.min(2.0 / rules.len() as f64); rules.retain(|_| rng.gen::<f64>() > remove_chance); for rule in rules.iter_mut() { if rng.gen() { if rule.flat_reward!= 0.0 { rule.flat_reward += rng.sample::<f64, _>(StandardNormal) * 0.2; } if rule.block_per_energy_reward!= 0.0 { rule.block_per_energy_reward += rng.sample::<f64, _>(StandardNormal) * 0.02; } for value in &mut rule.unblocked_damage_per_energy_rewards { if *value!= 0.0 { *value += rng.sample::<f64, _>(StandardNormal) * 0.01; } } } } for _ in 0..rng.gen_range(10..30) { let condition; if rng.gen() || promising_conditions.is_empty() { condition = Condition::random_generally_relevant_state_distinguisher(state, rng); } else { condition = promising_conditions.choose(rng).unwrap().clone(); } if rng.gen() || rules.is_empty() { rules.push(Rule { conditions: vec![ Condition::random_generally_relevant_choice_distinguisher(state, rng), condition, ], flat_reward: rng.sample(StandardNormal), ..Default::default() }) } else { rules.choose_mut(rng).unwrap().conditions.push(condition); } } } let promising_conditions: Vec<_> = promising_strategies .iter() .flat_map(|s| { s.rules .iter() .flat_map(|rule| &rule.conditions) .filter(|c| { !matches!( c.kind, ConditionKind::PlayCardId(_) | ConditionKind::UsePotionId(_) ) }) .cloned() })
tweak_rules(&mut result.rules, state, rng, &promising_conditions); result } }
.collect(); let mut result = self.clone();
random_line_split
condition_strategy_generators.rs
use crate::ai_utils::playout_result; use crate::competing_optimizers::StrategyOptimizer; use crate::condition_strategy::{ Condition, ConditionKind, ConditionStrategy, EvaluatedPriorities, EvaluationData, Rule, }; use crate::representative_sampling::NewFractalRepresentativeSeedSearch; use crate::seed_system::{Seed, SingleSeed, SingleSeedGenerator}; use crate::seeds_concrete::CombatChoiceLineagesKind; use crate::simulation::{Runner, StandardRunner}; use crate::simulation_state::CombatState; use rand::seq::SliceRandom; use rand::{Rng, SeedableRng}; use rand_chacha::ChaCha8Rng; use rand_distr::StandardNormal; use serde::{Deserialize, Serialize}; use smallvec::alloc::fmt::Formatter; use std::fmt; use std::fmt::Display; use std::ops::Deref; use std::sync::Arc; use std::time::{Duration, Instant}; pub type SeedSearch = NewFractalRepresentativeSeedSearch< ConditionStrategy, SingleSeed<CombatChoiceLineagesKind>, SingleSeedGenerator, >; pub struct StrategyGeneratorsWithSharedRepresenativeSeeds { pub seed_search: SeedSearch, pub generators: Vec<SharingGenerator>, } pub struct SharingGenerator { pub time_used: Duration, pub generator: GeneratorKind, } #[derive(Clone, Serialize, Deserialize, Debug)] pub enum GeneratorKind { HillClimb { steps: usize, num_verification_seeds: usize, start: HillClimbStart, kind: HillClimbKind, }, } #[derive(Copy, Clone, Serialize, Deserialize, Debug)] pub enum HillClimbStart { NewRandom, FromSeedSearch, } #[derive(Copy, Clone, Serialize, Deserialize, Debug)] pub enum HillClimbKind { BunchOfRandomChanges, BunchOfRandomChangesInspired, OneRelevantRule, } impl StrategyGeneratorsWithSharedRepresenativeSeeds { pub fn new( starting_state: CombatState, rng: &mut impl Rng, ) -> StrategyGeneratorsWithSharedRepresenativeSeeds
} } } StrategyGeneratorsWithSharedRepresenativeSeeds { seed_search: NewFractalRepresentativeSeedSearch::new( starting_state, SingleSeedGenerator::new(ChaCha8Rng::from_rng(rng).unwrap()), Default::default(), ), generators, } } pub fn step(&mut self, rng: &mut impl Rng) { let generator = self .generators .iter_mut() .min_by_key(|g| g.time_used) .unwrap(); let start = Instant::now(); let strategy = generator.generator.gen_strategy(&self.seed_search, rng); let duration = start.elapsed(); generator.time_used += duration; self.seed_search.consider_strategy( Arc::new(strategy), generator.generator.min_playouts_before_culling(), rng, ); } } pub struct HillClimbSeedInfo<'a> { pub seed: &'a SingleSeed<CombatChoiceLineagesKind>, pub current_score: f64, } impl GeneratorKind { pub fn min_playouts_before_culling(&self) -> usize { match self { &GeneratorKind::HillClimb { steps,.. } => steps.min(32), } } pub fn gen_strategy(&self, seed_search: &SeedSearch, rng: &mut impl Rng) -> ConditionStrategy { match self { &GeneratorKind::HillClimb { steps, num_verification_seeds, start, kind, } => { let mut current = match start { HillClimbStart::NewRandom => { ConditionStrategy::fresh_distinctive_candidate(&seed_search.starting_state, rng) } HillClimbStart::FromSeedSearch => seed_search .strategies .choose(rng) .unwrap() .strategy .deref() .clone(), }; let mut verification_seeds: Vec<_> = seed_search .seeds .iter() .take(num_verification_seeds) .collect(); // hack - the seed search may not have generated this many (or any) seeds yet let extra_seeds; if verification_seeds.len() < num_verification_seeds { extra_seeds = (verification_seeds.len()..num_verification_seeds) .map(|_| SingleSeed::new(rng)) .collect::<Vec<_>>(); verification_seeds.extend(extra_seeds.iter()); } let mut verification_seeds: Vec<_> = verification_seeds .into_iter() .map(|s| HillClimbSeedInfo { seed: s, current_score: playout_result(&seed_search.starting_state, s.view(), &current).score, }) .collect(); let mut improvements = 0; let mut improvements_on_first = 0; for _ in 0..steps { verification_seeds.shuffle(rng); let (first, rest) = verification_seeds.split_first().unwrap(); let new = kind.hill_climb_candidate(seed_search, &current, &verification_seeds, rng); let first_score = playout_result(&seed_search.starting_state, first.seed.view(), &new).score; if first_score <= verification_seeds[0].current_score { continue; } improvements_on_first += 1; let new_scores: Vec<_> = std::iter::once(first_score) .chain( rest .iter() .map(|s| playout_result(&seed_search.starting_state, s.seed.view(), &new).score), ) .collect(); if new_scores.iter().sum::<f64>() > verification_seeds .iter() .map(|s| s.current_score) .sum::<f64>() { current = new; for (info, new_score) in verification_seeds.iter_mut().zip(new_scores) { info.current_score = new_score; } improvements += 1; } } current.annotation = format!( "{} + {}/{}/{}", current.annotation, improvements, improvements_on_first, self ); current } } } } impl HillClimbKind { fn hill_climb_candidate( &self, seed_search: &SeedSearch, current: &ConditionStrategy, verification_seeds: &[HillClimbSeedInfo], rng: &mut impl Rng, ) -> ConditionStrategy { let (first, _rest) = verification_seeds.split_first().unwrap(); match self { HillClimbKind::BunchOfRandomChanges => { current.bunch_of_random_changes(&seed_search.starting_state, rng, &[]) } HillClimbKind::BunchOfRandomChangesInspired => current.bunch_of_random_changes( &seed_search.starting_state, rng, &seed_search .strategies .iter() .map(|s| &*s.strategy) .collect::<Vec<_>>(), ), HillClimbKind::OneRelevantRule => { let mut state = seed_search.starting_state.clone(); let mut runner = StandardRunner::new(&mut state, first.seed.view()); let mut candidate_rules = Vec::new(); while!runner.state().combat_over() { let state = runner.state(); let data = EvaluationData::new(state); let priorities = EvaluatedPriorities::evaluated(&current.rules, state, &data); let best_index = priorities.best_index(); for _ in 0..50 { let condition = Condition::random_generally_relevant_choice_distinguisher(state, rng); let mut rule = Rule { conditions: vec![condition], flat_reward: rng.sample(StandardNormal), ..Default::default() }; if priorities.best_index_with_extra_rule(&rule, state, &data)!= best_index { for _ in 0..rng.gen_range(0..=2) { for _ in 0..50 { let condition = Condition::random_generally_relevant_state_distinguisher(state, rng); if condition.evaluate(state, &data.contexts().next().unwrap()) { rule.conditions.push(condition); break; } } } candidate_rules.push(rule); break; } } let choice = &data.choices[best_index].choice; runner.apply_choice(&choice); } let mut new = current.clone(); if let Some(new_rule) = candidate_rules.choose(rng) { new.rules.push(new_rule.clone()) } new } } } } impl Display for GeneratorKind { fn fmt(&self, f: &mut Formatter<'_>) -> fmt::Result { match self { GeneratorKind::HillClimb { steps, num_verification_seeds, start: _, kind, } => { write!(f, "{}x{:?}@{}", steps, kind, num_verification_seeds) } } } } impl StrategyOptimizer for StrategyGeneratorsWithSharedRepresenativeSeeds { type Strategy = ConditionStrategy; fn step(&mut self, _state: &CombatState, rng: &mut ChaCha8Rng) { self.step(rng); } fn report(&self) -> Arc<Self::Strategy> { let result = self.seed_search.best_strategy(); self.seed_search.report(); println!("StrategyGeneratorsWithSharedRepresenativeSeeds top strategies:"); for strategy in &self.seed_search.strategies { println!("{}", strategy.strategy.annotation); } result } } impl ConditionStrategy { pub fn bunch_of_random_changes( &self, state: &CombatState, rng: &mut impl Rng, promising_strategies: &[&ConditionStrategy], ) -> ConditionStrategy { fn tweak_rules( rules: &mut Vec<Rule>, state: &CombatState, rng: &mut impl Rng, promising_conditions: &[Condition], ) { let remove_chance = 0.05f64.min(2.0 / rules.len() as f64); rules.retain(|_| rng.gen::<f64>() > remove_chance); for rule in rules.iter_mut() { if rng.gen() { if rule.flat_reward!= 0.0 { rule.flat_reward += rng.sample::<f64, _>(StandardNormal) * 0.2; } if rule.block_per_energy_reward!= 0.0 { rule.block_per_energy_reward += rng.sample::<f64, _>(StandardNormal) * 0.02; } for value in &mut rule.unblocked_damage_per_energy_rewards { if *value!= 0.0 { *value += rng.sample::<f64, _>(StandardNormal) * 0.01; } } } } for _ in 0..rng.gen_range(10..30) { let condition; if rng.gen() || promising_conditions.is_empty() { condition = Condition::random_generally_relevant_state_distinguisher(state, rng); } else { condition = promising_conditions.choose(rng).unwrap().clone(); } if rng.gen() || rules.is_empty() { rules.push(Rule { conditions: vec![ Condition::random_generally_relevant_choice_distinguisher(state, rng), condition, ], flat_reward: rng.sample(StandardNormal), ..Default::default() }) } else { rules.choose_mut(rng).unwrap().conditions.push(condition); } } } let promising_conditions: Vec<_> = promising_strategies .iter() .flat_map(|s| { s.rules .iter() .flat_map(|rule| &rule.conditions) .filter(|c| { !matches!( c.kind, ConditionKind::PlayCardId(_) | ConditionKind::UsePotionId(_) ) }) .cloned() }) .collect(); let mut result = self.clone(); tweak_rules(&mut result.rules, state, rng, &promising_conditions); result } }
{ let mut generators = Vec::new(); for steps in (0..=8).map(|i| 1 << i) { for num_verification_seeds in (0..=5).map(|i| 1 << i) { for &start in &[HillClimbStart::NewRandom, HillClimbStart::FromSeedSearch] { for &kind in &[ HillClimbKind::BunchOfRandomChanges, HillClimbKind::BunchOfRandomChangesInspired, HillClimbKind::OneRelevantRule, ] { generators.push(SharingGenerator { time_used: Duration::from_secs(0), generator: GeneratorKind::HillClimb { steps, num_verification_seeds, start, kind, }, }); }
identifier_body
condition_strategy_generators.rs
use crate::ai_utils::playout_result; use crate::competing_optimizers::StrategyOptimizer; use crate::condition_strategy::{ Condition, ConditionKind, ConditionStrategy, EvaluatedPriorities, EvaluationData, Rule, }; use crate::representative_sampling::NewFractalRepresentativeSeedSearch; use crate::seed_system::{Seed, SingleSeed, SingleSeedGenerator}; use crate::seeds_concrete::CombatChoiceLineagesKind; use crate::simulation::{Runner, StandardRunner}; use crate::simulation_state::CombatState; use rand::seq::SliceRandom; use rand::{Rng, SeedableRng}; use rand_chacha::ChaCha8Rng; use rand_distr::StandardNormal; use serde::{Deserialize, Serialize}; use smallvec::alloc::fmt::Formatter; use std::fmt; use std::fmt::Display; use std::ops::Deref; use std::sync::Arc; use std::time::{Duration, Instant}; pub type SeedSearch = NewFractalRepresentativeSeedSearch< ConditionStrategy, SingleSeed<CombatChoiceLineagesKind>, SingleSeedGenerator, >; pub struct StrategyGeneratorsWithSharedRepresenativeSeeds { pub seed_search: SeedSearch, pub generators: Vec<SharingGenerator>, } pub struct SharingGenerator { pub time_used: Duration, pub generator: GeneratorKind, } #[derive(Clone, Serialize, Deserialize, Debug)] pub enum GeneratorKind { HillClimb { steps: usize, num_verification_seeds: usize, start: HillClimbStart, kind: HillClimbKind, }, } #[derive(Copy, Clone, Serialize, Deserialize, Debug)] pub enum HillClimbStart { NewRandom, FromSeedSearch, } #[derive(Copy, Clone, Serialize, Deserialize, Debug)] pub enum HillClimbKind { BunchOfRandomChanges, BunchOfRandomChangesInspired, OneRelevantRule, } impl StrategyGeneratorsWithSharedRepresenativeSeeds { pub fn new( starting_state: CombatState, rng: &mut impl Rng, ) -> StrategyGeneratorsWithSharedRepresenativeSeeds { let mut generators = Vec::new(); for steps in (0..=8).map(|i| 1 << i) { for num_verification_seeds in (0..=5).map(|i| 1 << i) { for &start in &[HillClimbStart::NewRandom, HillClimbStart::FromSeedSearch] { for &kind in &[ HillClimbKind::BunchOfRandomChanges, HillClimbKind::BunchOfRandomChangesInspired, HillClimbKind::OneRelevantRule, ] { generators.push(SharingGenerator { time_used: Duration::from_secs(0), generator: GeneratorKind::HillClimb { steps, num_verification_seeds, start, kind, }, }); } } } } StrategyGeneratorsWithSharedRepresenativeSeeds { seed_search: NewFractalRepresentativeSeedSearch::new( starting_state, SingleSeedGenerator::new(ChaCha8Rng::from_rng(rng).unwrap()), Default::default(), ), generators, } } pub fn step(&mut self, rng: &mut impl Rng) { let generator = self .generators .iter_mut() .min_by_key(|g| g.time_used) .unwrap(); let start = Instant::now(); let strategy = generator.generator.gen_strategy(&self.seed_search, rng); let duration = start.elapsed(); generator.time_used += duration; self.seed_search.consider_strategy( Arc::new(strategy), generator.generator.min_playouts_before_culling(), rng, ); } } pub struct
<'a> { pub seed: &'a SingleSeed<CombatChoiceLineagesKind>, pub current_score: f64, } impl GeneratorKind { pub fn min_playouts_before_culling(&self) -> usize { match self { &GeneratorKind::HillClimb { steps,.. } => steps.min(32), } } pub fn gen_strategy(&self, seed_search: &SeedSearch, rng: &mut impl Rng) -> ConditionStrategy { match self { &GeneratorKind::HillClimb { steps, num_verification_seeds, start, kind, } => { let mut current = match start { HillClimbStart::NewRandom => { ConditionStrategy::fresh_distinctive_candidate(&seed_search.starting_state, rng) } HillClimbStart::FromSeedSearch => seed_search .strategies .choose(rng) .unwrap() .strategy .deref() .clone(), }; let mut verification_seeds: Vec<_> = seed_search .seeds .iter() .take(num_verification_seeds) .collect(); // hack - the seed search may not have generated this many (or any) seeds yet let extra_seeds; if verification_seeds.len() < num_verification_seeds { extra_seeds = (verification_seeds.len()..num_verification_seeds) .map(|_| SingleSeed::new(rng)) .collect::<Vec<_>>(); verification_seeds.extend(extra_seeds.iter()); } let mut verification_seeds: Vec<_> = verification_seeds .into_iter() .map(|s| HillClimbSeedInfo { seed: s, current_score: playout_result(&seed_search.starting_state, s.view(), &current).score, }) .collect(); let mut improvements = 0; let mut improvements_on_first = 0; for _ in 0..steps { verification_seeds.shuffle(rng); let (first, rest) = verification_seeds.split_first().unwrap(); let new = kind.hill_climb_candidate(seed_search, &current, &verification_seeds, rng); let first_score = playout_result(&seed_search.starting_state, first.seed.view(), &new).score; if first_score <= verification_seeds[0].current_score { continue; } improvements_on_first += 1; let new_scores: Vec<_> = std::iter::once(first_score) .chain( rest .iter() .map(|s| playout_result(&seed_search.starting_state, s.seed.view(), &new).score), ) .collect(); if new_scores.iter().sum::<f64>() > verification_seeds .iter() .map(|s| s.current_score) .sum::<f64>() { current = new; for (info, new_score) in verification_seeds.iter_mut().zip(new_scores) { info.current_score = new_score; } improvements += 1; } } current.annotation = format!( "{} + {}/{}/{}", current.annotation, improvements, improvements_on_first, self ); current } } } } impl HillClimbKind { fn hill_climb_candidate( &self, seed_search: &SeedSearch, current: &ConditionStrategy, verification_seeds: &[HillClimbSeedInfo], rng: &mut impl Rng, ) -> ConditionStrategy { let (first, _rest) = verification_seeds.split_first().unwrap(); match self { HillClimbKind::BunchOfRandomChanges => { current.bunch_of_random_changes(&seed_search.starting_state, rng, &[]) } HillClimbKind::BunchOfRandomChangesInspired => current.bunch_of_random_changes( &seed_search.starting_state, rng, &seed_search .strategies .iter() .map(|s| &*s.strategy) .collect::<Vec<_>>(), ), HillClimbKind::OneRelevantRule => { let mut state = seed_search.starting_state.clone(); let mut runner = StandardRunner::new(&mut state, first.seed.view()); let mut candidate_rules = Vec::new(); while!runner.state().combat_over() { let state = runner.state(); let data = EvaluationData::new(state); let priorities = EvaluatedPriorities::evaluated(&current.rules, state, &data); let best_index = priorities.best_index(); for _ in 0..50 { let condition = Condition::random_generally_relevant_choice_distinguisher(state, rng); let mut rule = Rule { conditions: vec![condition], flat_reward: rng.sample(StandardNormal), ..Default::default() }; if priorities.best_index_with_extra_rule(&rule, state, &data)!= best_index { for _ in 0..rng.gen_range(0..=2) { for _ in 0..50 { let condition = Condition::random_generally_relevant_state_distinguisher(state, rng); if condition.evaluate(state, &data.contexts().next().unwrap()) { rule.conditions.push(condition); break; } } } candidate_rules.push(rule); break; } } let choice = &data.choices[best_index].choice; runner.apply_choice(&choice); } let mut new = current.clone(); if let Some(new_rule) = candidate_rules.choose(rng) { new.rules.push(new_rule.clone()) } new } } } } impl Display for GeneratorKind { fn fmt(&self, f: &mut Formatter<'_>) -> fmt::Result { match self { GeneratorKind::HillClimb { steps, num_verification_seeds, start: _, kind, } => { write!(f, "{}x{:?}@{}", steps, kind, num_verification_seeds) } } } } impl StrategyOptimizer for StrategyGeneratorsWithSharedRepresenativeSeeds { type Strategy = ConditionStrategy; fn step(&mut self, _state: &CombatState, rng: &mut ChaCha8Rng) { self.step(rng); } fn report(&self) -> Arc<Self::Strategy> { let result = self.seed_search.best_strategy(); self.seed_search.report(); println!("StrategyGeneratorsWithSharedRepresenativeSeeds top strategies:"); for strategy in &self.seed_search.strategies { println!("{}", strategy.strategy.annotation); } result } } impl ConditionStrategy { pub fn bunch_of_random_changes( &self, state: &CombatState, rng: &mut impl Rng, promising_strategies: &[&ConditionStrategy], ) -> ConditionStrategy { fn tweak_rules( rules: &mut Vec<Rule>, state: &CombatState, rng: &mut impl Rng, promising_conditions: &[Condition], ) { let remove_chance = 0.05f64.min(2.0 / rules.len() as f64); rules.retain(|_| rng.gen::<f64>() > remove_chance); for rule in rules.iter_mut() { if rng.gen() { if rule.flat_reward!= 0.0 { rule.flat_reward += rng.sample::<f64, _>(StandardNormal) * 0.2; } if rule.block_per_energy_reward!= 0.0 { rule.block_per_energy_reward += rng.sample::<f64, _>(StandardNormal) * 0.02; } for value in &mut rule.unblocked_damage_per_energy_rewards { if *value!= 0.0 { *value += rng.sample::<f64, _>(StandardNormal) * 0.01; } } } } for _ in 0..rng.gen_range(10..30) { let condition; if rng.gen() || promising_conditions.is_empty() { condition = Condition::random_generally_relevant_state_distinguisher(state, rng); } else { condition = promising_conditions.choose(rng).unwrap().clone(); } if rng.gen() || rules.is_empty() { rules.push(Rule { conditions: vec![ Condition::random_generally_relevant_choice_distinguisher(state, rng), condition, ], flat_reward: rng.sample(StandardNormal), ..Default::default() }) } else { rules.choose_mut(rng).unwrap().conditions.push(condition); } } } let promising_conditions: Vec<_> = promising_strategies .iter() .flat_map(|s| { s.rules .iter() .flat_map(|rule| &rule.conditions) .filter(|c| { !matches!( c.kind, ConditionKind::PlayCardId(_) | ConditionKind::UsePotionId(_) ) }) .cloned() }) .collect(); let mut result = self.clone(); tweak_rules(&mut result.rules, state, rng, &promising_conditions); result } }
HillClimbSeedInfo
identifier_name
runner.rs
use core::fmt::{Display, Formatter, Result as FmtResult}; use std::error::Error as StdError; use std::sync::mpsc::{sync_channel, SyncSender, TryRecvError, TrySendError}; use std::thread::{sleep, spawn}; use std::time::{Duration, Instant}; use std::{cell::RefCell, sync::mpsc::Receiver}; use skulpin_renderer::{ash, LogicalSize, RendererBuilder}; use ash::vk::Result as VkResult; use crate::skia::{Color, Matrix, Picture, PictureRecorder, Point, Rect, Size}; use super::input::{EventHandleResult, InputState}; use super::time::TimeState; use super::Game; use super::{default_font_set::DefaultFontSet, FontSet}; use sdl2::event::Event as Sdl2Event; use skulpin_renderer_sdl2::{sdl2, Sdl2Window}; enum Event { Sdl2Event(Sdl2Event), Crash(Error), } enum FeedbackEvent { Exit, } #[derive(Debug)] pub enum Error { RendererError(VkResult), } impl Display for Error { fn fmt(&self, f: &mut Formatter) -> FmtResult { match self { Error::RendererError(e) => e.fmt(f), } } } impl StdError for Error { fn source(&self) -> Option<&(dyn StdError +'static)> { match self { Error::RendererError(e) => Some(e), } } } impl From<VkResult> for Error { fn from(result: VkResult) -> Self { Error::RendererError(result) } } #[derive(Debug, PartialEq, Clone, Copy)] pub struct ID(u64); impl ID { pub fn next() -> Self { Self(State::with_mut(|x| { let id = x.id_keeper; x.id_keeper += 1; id })) } } pub struct State { pub input_state: InputState, pub time_state: TimeState, pub time_state_draw: TimeState, pub font_set: Box<dyn FontSet>, id_keeper: u64, } impl State { const PANIC_MESSAGE: &'static str = "Attempt to get game state while game is uninitialised"; thread_local!(pub static STATE: RefCell<Option<State>> = RefCell::new(None)); #[inline] pub fn with<F, R>(f: F) -> R where
#[inline] pub fn with_mut<F, R>(f: F) -> R where F: FnOnce(&mut State) -> R, { Self::STATE.with(|x| f(x.borrow_mut().as_mut().expect(Self::PANIC_MESSAGE))) } pub fn last_update_time() -> Duration { Self::STATE.with(|x| { x.borrow() .as_ref() .expect(Self::PANIC_MESSAGE) .time_state .last_update_time() }) } pub fn elapsed() -> Duration { Self::STATE.with(|x| { x.borrow() .as_ref() .expect(Self::PANIC_MESSAGE) .time_state .elapsed() }) } pub fn last_update_time_draw() -> Duration { Self::STATE.with(|x| { x.borrow() .as_ref() .expect(Self::PANIC_MESSAGE) .time_state_draw .last_update_time() }) } pub fn mouse_position() -> Point { Self::STATE.with(|x| { x.borrow() .as_ref() .expect(Self::PANIC_MESSAGE) .input_state .mouse_position }) } } pub struct Runner; impl Runner { pub const PIC_QUEUE_LENGTH: usize = 1; pub const EVENT_QUEUE_SIZE: usize = 8; pub const FEEDBACK_QUEUE_SIZE: usize = 1; pub const BACKGROUND: Color = Color::from_argb(255, 10, 10, 10); pub fn run<F, T>( game: F, inner_size: LogicalSize, window_title: &str, renderer_builder: RendererBuilder, ) where F:'static + Send + FnOnce() -> T, T: Game, { let sdl_context = sdl2::init().expect("Failed to initialize SDL2"); let video_subsystem = sdl_context .video() .expect("Failed to create SDL2 video subsystem"); let sdl_window = video_subsystem .window(window_title, inner_size.width, inner_size.height) .resizable() .build() .expect("Failed to create game window"); let window = Sdl2Window::new(&sdl_window); sdl_context.mouse().show_cursor(false); let (pic_tx, pic_rx) = sync_channel(Self::PIC_QUEUE_LENGTH); let (event_tx, event_rx) = sync_channel(Self::EVENT_QUEUE_SIZE); let (feedback_tx, feedback_rx) = sync_channel(Self::FEEDBACK_QUEUE_SIZE); spawn(move || { gstreamer::init().expect("Failed to initialize GStreamer"); let input_state = InputState::new(inner_size); let time_state = TimeState::new(); let time_state_draw = TimeState::new(); State::STATE.with(|x| { *x.borrow_mut() = Some(State { input_state, time_state, time_state_draw, font_set: Box::new(DefaultFontSet::new()), id_keeper: 0, }); }); let mut game = game(); game.set_size( State::STATE.with(|x| x.borrow().as_ref().unwrap().input_state.window_size), ); Self::game_thread(game, event_rx, pic_tx, feedback_tx); }); let mut renderer = renderer_builder .build(&window) .expect("Failed to create renderer"); let mut event_pump = sdl_context .event_pump() .expect("Failed to create SDL2 event pump"); 'events: loop { match feedback_rx.try_recv() { Ok(event) => match event { FeedbackEvent::Exit => { break 'events; } }, Err(e) => match e { TryRecvError::Empty => { for event in event_pump.poll_iter() { if event_tx.send(Event::Sdl2Event(event)).is_err() { break 'events; } } match pic_rx.try_recv() { Ok(pic) => { if let Err(e) = renderer.draw(&window, |canvas, _| { canvas.clear(Self::BACKGROUND); canvas.draw_picture(pic, Some(&Matrix::default()), None); }) { let _ = event_tx.send(Event::Crash(e.into())); break 'events; } } Err(e) => match e { TryRecvError::Empty => sleep(Duration::MILLISECOND), TryRecvError::Disconnected => break 'events, }, } } TryRecvError::Disconnected => break 'events, }, } } } fn game_thread( mut game: impl Game, event_rx: Receiver<Event>, pic_tx: SyncSender<Picture>, feedback_tx: SyncSender<FeedbackEvent>, ) { let target_update_time = Duration::MILLISECOND; // 1000 fps let target_frame_time = Duration::MILLISECOND * 8; // 120 fps let mut last_frame = Instant::now(); loop { game.update(); let mut is_redraw = false; // TODO: is this loop the cause of bad VSync? loop { match event_rx.try_recv() { Ok(event) => { if Self::handle_event(&mut game, event, &feedback_tx) { return; } } Err(e) => match e { TryRecvError::Empty => break, TryRecvError::Disconnected => return, }, } } let frame_time = last_frame.elapsed(); if frame_time > target_frame_time { last_frame = Instant::now() - (frame_time - target_frame_time); is_redraw = true; let mut rec = PictureRecorder::new(); let bounds = Rect::from_size(State::with(|x| { let w = x.input_state.window_size; (w.width, w.height) })); let canvas = rec.begin_recording(bounds, None); game.draw(canvas); if let Err(why) = pic_tx.try_send( rec.finish_recording_as_picture(None) .expect("Failed to finish recording picture while rendering"), ) { match why { // Skip any unsent frames, just in case the renderer // fails to catch up, and to prevent lockups. TrySendError::Full(_) => {} TrySendError::Disconnected(_) => { panic!("Failed to send canvas to draw thread (disconnected channel)") } } } State::with_mut(|x| x.time_state_draw.update()); } State::with_mut(|state| { if!is_redraw { let update_time = state.time_state.last_update().elapsed(); if target_update_time > update_time { sleep(target_update_time - update_time); } } state.time_state.update(); }); } } fn handle_event( game: &mut impl Game, event: Event, feedback_tx: &SyncSender<FeedbackEvent>, ) -> bool { match event { Event::Sdl2Event(event) => { if let Some(r) = State::with_mut(|x| x.input_state.handle_event(&event)) { match r { EventHandleResult::Input(event) => game.input(event), EventHandleResult::Resized(size) => { game.set_size(Size::new(size.width, size.height)) } EventHandleResult::Exit => { game.close(); feedback_tx .send(FeedbackEvent::Exit) .expect("Failed to send feedback event to draw thread"); return true; } } } } Event::Crash(e) => { game.crash(e); feedback_tx .send(FeedbackEvent::Exit) .expect("Failed to send feedback event to draw thread"); return true; } } false } }
F: FnOnce(&State) -> R, { Self::STATE.with(|x| f(x.borrow().as_ref().expect(Self::PANIC_MESSAGE))) }
random_line_split
runner.rs
use core::fmt::{Display, Formatter, Result as FmtResult}; use std::error::Error as StdError; use std::sync::mpsc::{sync_channel, SyncSender, TryRecvError, TrySendError}; use std::thread::{sleep, spawn}; use std::time::{Duration, Instant}; use std::{cell::RefCell, sync::mpsc::Receiver}; use skulpin_renderer::{ash, LogicalSize, RendererBuilder}; use ash::vk::Result as VkResult; use crate::skia::{Color, Matrix, Picture, PictureRecorder, Point, Rect, Size}; use super::input::{EventHandleResult, InputState}; use super::time::TimeState; use super::Game; use super::{default_font_set::DefaultFontSet, FontSet}; use sdl2::event::Event as Sdl2Event; use skulpin_renderer_sdl2::{sdl2, Sdl2Window}; enum Event { Sdl2Event(Sdl2Event), Crash(Error), } enum FeedbackEvent { Exit, } #[derive(Debug)] pub enum Error { RendererError(VkResult), } impl Display for Error { fn fmt(&self, f: &mut Formatter) -> FmtResult { match self { Error::RendererError(e) => e.fmt(f), } } } impl StdError for Error { fn source(&self) -> Option<&(dyn StdError +'static)>
} impl From<VkResult> for Error { fn from(result: VkResult) -> Self { Error::RendererError(result) } } #[derive(Debug, PartialEq, Clone, Copy)] pub struct ID(u64); impl ID { pub fn next() -> Self { Self(State::with_mut(|x| { let id = x.id_keeper; x.id_keeper += 1; id })) } } pub struct State { pub input_state: InputState, pub time_state: TimeState, pub time_state_draw: TimeState, pub font_set: Box<dyn FontSet>, id_keeper: u64, } impl State { const PANIC_MESSAGE: &'static str = "Attempt to get game state while game is uninitialised"; thread_local!(pub static STATE: RefCell<Option<State>> = RefCell::new(None)); #[inline] pub fn with<F, R>(f: F) -> R where F: FnOnce(&State) -> R, { Self::STATE.with(|x| f(x.borrow().as_ref().expect(Self::PANIC_MESSAGE))) } #[inline] pub fn with_mut<F, R>(f: F) -> R where F: FnOnce(&mut State) -> R, { Self::STATE.with(|x| f(x.borrow_mut().as_mut().expect(Self::PANIC_MESSAGE))) } pub fn last_update_time() -> Duration { Self::STATE.with(|x| { x.borrow() .as_ref() .expect(Self::PANIC_MESSAGE) .time_state .last_update_time() }) } pub fn elapsed() -> Duration { Self::STATE.with(|x| { x.borrow() .as_ref() .expect(Self::PANIC_MESSAGE) .time_state .elapsed() }) } pub fn last_update_time_draw() -> Duration { Self::STATE.with(|x| { x.borrow() .as_ref() .expect(Self::PANIC_MESSAGE) .time_state_draw .last_update_time() }) } pub fn mouse_position() -> Point { Self::STATE.with(|x| { x.borrow() .as_ref() .expect(Self::PANIC_MESSAGE) .input_state .mouse_position }) } } pub struct Runner; impl Runner { pub const PIC_QUEUE_LENGTH: usize = 1; pub const EVENT_QUEUE_SIZE: usize = 8; pub const FEEDBACK_QUEUE_SIZE: usize = 1; pub const BACKGROUND: Color = Color::from_argb(255, 10, 10, 10); pub fn run<F, T>( game: F, inner_size: LogicalSize, window_title: &str, renderer_builder: RendererBuilder, ) where F:'static + Send + FnOnce() -> T, T: Game, { let sdl_context = sdl2::init().expect("Failed to initialize SDL2"); let video_subsystem = sdl_context .video() .expect("Failed to create SDL2 video subsystem"); let sdl_window = video_subsystem .window(window_title, inner_size.width, inner_size.height) .resizable() .build() .expect("Failed to create game window"); let window = Sdl2Window::new(&sdl_window); sdl_context.mouse().show_cursor(false); let (pic_tx, pic_rx) = sync_channel(Self::PIC_QUEUE_LENGTH); let (event_tx, event_rx) = sync_channel(Self::EVENT_QUEUE_SIZE); let (feedback_tx, feedback_rx) = sync_channel(Self::FEEDBACK_QUEUE_SIZE); spawn(move || { gstreamer::init().expect("Failed to initialize GStreamer"); let input_state = InputState::new(inner_size); let time_state = TimeState::new(); let time_state_draw = TimeState::new(); State::STATE.with(|x| { *x.borrow_mut() = Some(State { input_state, time_state, time_state_draw, font_set: Box::new(DefaultFontSet::new()), id_keeper: 0, }); }); let mut game = game(); game.set_size( State::STATE.with(|x| x.borrow().as_ref().unwrap().input_state.window_size), ); Self::game_thread(game, event_rx, pic_tx, feedback_tx); }); let mut renderer = renderer_builder .build(&window) .expect("Failed to create renderer"); let mut event_pump = sdl_context .event_pump() .expect("Failed to create SDL2 event pump"); 'events: loop { match feedback_rx.try_recv() { Ok(event) => match event { FeedbackEvent::Exit => { break 'events; } }, Err(e) => match e { TryRecvError::Empty => { for event in event_pump.poll_iter() { if event_tx.send(Event::Sdl2Event(event)).is_err() { break 'events; } } match pic_rx.try_recv() { Ok(pic) => { if let Err(e) = renderer.draw(&window, |canvas, _| { canvas.clear(Self::BACKGROUND); canvas.draw_picture(pic, Some(&Matrix::default()), None); }) { let _ = event_tx.send(Event::Crash(e.into())); break 'events; } } Err(e) => match e { TryRecvError::Empty => sleep(Duration::MILLISECOND), TryRecvError::Disconnected => break 'events, }, } } TryRecvError::Disconnected => break 'events, }, } } } fn game_thread( mut game: impl Game, event_rx: Receiver<Event>, pic_tx: SyncSender<Picture>, feedback_tx: SyncSender<FeedbackEvent>, ) { let target_update_time = Duration::MILLISECOND; // 1000 fps let target_frame_time = Duration::MILLISECOND * 8; // 120 fps let mut last_frame = Instant::now(); loop { game.update(); let mut is_redraw = false; // TODO: is this loop the cause of bad VSync? loop { match event_rx.try_recv() { Ok(event) => { if Self::handle_event(&mut game, event, &feedback_tx) { return; } } Err(e) => match e { TryRecvError::Empty => break, TryRecvError::Disconnected => return, }, } } let frame_time = last_frame.elapsed(); if frame_time > target_frame_time { last_frame = Instant::now() - (frame_time - target_frame_time); is_redraw = true; let mut rec = PictureRecorder::new(); let bounds = Rect::from_size(State::with(|x| { let w = x.input_state.window_size; (w.width, w.height) })); let canvas = rec.begin_recording(bounds, None); game.draw(canvas); if let Err(why) = pic_tx.try_send( rec.finish_recording_as_picture(None) .expect("Failed to finish recording picture while rendering"), ) { match why { // Skip any unsent frames, just in case the renderer // fails to catch up, and to prevent lockups. TrySendError::Full(_) => {} TrySendError::Disconnected(_) => { panic!("Failed to send canvas to draw thread (disconnected channel)") } } } State::with_mut(|x| x.time_state_draw.update()); } State::with_mut(|state| { if!is_redraw { let update_time = state.time_state.last_update().elapsed(); if target_update_time > update_time { sleep(target_update_time - update_time); } } state.time_state.update(); }); } } fn handle_event( game: &mut impl Game, event: Event, feedback_tx: &SyncSender<FeedbackEvent>, ) -> bool { match event { Event::Sdl2Event(event) => { if let Some(r) = State::with_mut(|x| x.input_state.handle_event(&event)) { match r { EventHandleResult::Input(event) => game.input(event), EventHandleResult::Resized(size) => { game.set_size(Size::new(size.width, size.height)) } EventHandleResult::Exit => { game.close(); feedback_tx .send(FeedbackEvent::Exit) .expect("Failed to send feedback event to draw thread"); return true; } } } } Event::Crash(e) => { game.crash(e); feedback_tx .send(FeedbackEvent::Exit) .expect("Failed to send feedback event to draw thread"); return true; } } false } }
{ match self { Error::RendererError(e) => Some(e), } }
identifier_body
runner.rs
use core::fmt::{Display, Formatter, Result as FmtResult}; use std::error::Error as StdError; use std::sync::mpsc::{sync_channel, SyncSender, TryRecvError, TrySendError}; use std::thread::{sleep, spawn}; use std::time::{Duration, Instant}; use std::{cell::RefCell, sync::mpsc::Receiver}; use skulpin_renderer::{ash, LogicalSize, RendererBuilder}; use ash::vk::Result as VkResult; use crate::skia::{Color, Matrix, Picture, PictureRecorder, Point, Rect, Size}; use super::input::{EventHandleResult, InputState}; use super::time::TimeState; use super::Game; use super::{default_font_set::DefaultFontSet, FontSet}; use sdl2::event::Event as Sdl2Event; use skulpin_renderer_sdl2::{sdl2, Sdl2Window}; enum Event { Sdl2Event(Sdl2Event), Crash(Error), } enum FeedbackEvent { Exit, } #[derive(Debug)] pub enum Error { RendererError(VkResult), } impl Display for Error { fn fmt(&self, f: &mut Formatter) -> FmtResult { match self { Error::RendererError(e) => e.fmt(f), } } } impl StdError for Error { fn source(&self) -> Option<&(dyn StdError +'static)> { match self { Error::RendererError(e) => Some(e), } } } impl From<VkResult> for Error { fn from(result: VkResult) -> Self { Error::RendererError(result) } } #[derive(Debug, PartialEq, Clone, Copy)] pub struct ID(u64); impl ID { pub fn next() -> Self { Self(State::with_mut(|x| { let id = x.id_keeper; x.id_keeper += 1; id })) } } pub struct State { pub input_state: InputState, pub time_state: TimeState, pub time_state_draw: TimeState, pub font_set: Box<dyn FontSet>, id_keeper: u64, } impl State { const PANIC_MESSAGE: &'static str = "Attempt to get game state while game is uninitialised"; thread_local!(pub static STATE: RefCell<Option<State>> = RefCell::new(None)); #[inline] pub fn with<F, R>(f: F) -> R where F: FnOnce(&State) -> R, { Self::STATE.with(|x| f(x.borrow().as_ref().expect(Self::PANIC_MESSAGE))) } #[inline] pub fn with_mut<F, R>(f: F) -> R where F: FnOnce(&mut State) -> R, { Self::STATE.with(|x| f(x.borrow_mut().as_mut().expect(Self::PANIC_MESSAGE))) } pub fn last_update_time() -> Duration { Self::STATE.with(|x| { x.borrow() .as_ref() .expect(Self::PANIC_MESSAGE) .time_state .last_update_time() }) } pub fn
() -> Duration { Self::STATE.with(|x| { x.borrow() .as_ref() .expect(Self::PANIC_MESSAGE) .time_state .elapsed() }) } pub fn last_update_time_draw() -> Duration { Self::STATE.with(|x| { x.borrow() .as_ref() .expect(Self::PANIC_MESSAGE) .time_state_draw .last_update_time() }) } pub fn mouse_position() -> Point { Self::STATE.with(|x| { x.borrow() .as_ref() .expect(Self::PANIC_MESSAGE) .input_state .mouse_position }) } } pub struct Runner; impl Runner { pub const PIC_QUEUE_LENGTH: usize = 1; pub const EVENT_QUEUE_SIZE: usize = 8; pub const FEEDBACK_QUEUE_SIZE: usize = 1; pub const BACKGROUND: Color = Color::from_argb(255, 10, 10, 10); pub fn run<F, T>( game: F, inner_size: LogicalSize, window_title: &str, renderer_builder: RendererBuilder, ) where F:'static + Send + FnOnce() -> T, T: Game, { let sdl_context = sdl2::init().expect("Failed to initialize SDL2"); let video_subsystem = sdl_context .video() .expect("Failed to create SDL2 video subsystem"); let sdl_window = video_subsystem .window(window_title, inner_size.width, inner_size.height) .resizable() .build() .expect("Failed to create game window"); let window = Sdl2Window::new(&sdl_window); sdl_context.mouse().show_cursor(false); let (pic_tx, pic_rx) = sync_channel(Self::PIC_QUEUE_LENGTH); let (event_tx, event_rx) = sync_channel(Self::EVENT_QUEUE_SIZE); let (feedback_tx, feedback_rx) = sync_channel(Self::FEEDBACK_QUEUE_SIZE); spawn(move || { gstreamer::init().expect("Failed to initialize GStreamer"); let input_state = InputState::new(inner_size); let time_state = TimeState::new(); let time_state_draw = TimeState::new(); State::STATE.with(|x| { *x.borrow_mut() = Some(State { input_state, time_state, time_state_draw, font_set: Box::new(DefaultFontSet::new()), id_keeper: 0, }); }); let mut game = game(); game.set_size( State::STATE.with(|x| x.borrow().as_ref().unwrap().input_state.window_size), ); Self::game_thread(game, event_rx, pic_tx, feedback_tx); }); let mut renderer = renderer_builder .build(&window) .expect("Failed to create renderer"); let mut event_pump = sdl_context .event_pump() .expect("Failed to create SDL2 event pump"); 'events: loop { match feedback_rx.try_recv() { Ok(event) => match event { FeedbackEvent::Exit => { break 'events; } }, Err(e) => match e { TryRecvError::Empty => { for event in event_pump.poll_iter() { if event_tx.send(Event::Sdl2Event(event)).is_err() { break 'events; } } match pic_rx.try_recv() { Ok(pic) => { if let Err(e) = renderer.draw(&window, |canvas, _| { canvas.clear(Self::BACKGROUND); canvas.draw_picture(pic, Some(&Matrix::default()), None); }) { let _ = event_tx.send(Event::Crash(e.into())); break 'events; } } Err(e) => match e { TryRecvError::Empty => sleep(Duration::MILLISECOND), TryRecvError::Disconnected => break 'events, }, } } TryRecvError::Disconnected => break 'events, }, } } } fn game_thread( mut game: impl Game, event_rx: Receiver<Event>, pic_tx: SyncSender<Picture>, feedback_tx: SyncSender<FeedbackEvent>, ) { let target_update_time = Duration::MILLISECOND; // 1000 fps let target_frame_time = Duration::MILLISECOND * 8; // 120 fps let mut last_frame = Instant::now(); loop { game.update(); let mut is_redraw = false; // TODO: is this loop the cause of bad VSync? loop { match event_rx.try_recv() { Ok(event) => { if Self::handle_event(&mut game, event, &feedback_tx) { return; } } Err(e) => match e { TryRecvError::Empty => break, TryRecvError::Disconnected => return, }, } } let frame_time = last_frame.elapsed(); if frame_time > target_frame_time { last_frame = Instant::now() - (frame_time - target_frame_time); is_redraw = true; let mut rec = PictureRecorder::new(); let bounds = Rect::from_size(State::with(|x| { let w = x.input_state.window_size; (w.width, w.height) })); let canvas = rec.begin_recording(bounds, None); game.draw(canvas); if let Err(why) = pic_tx.try_send( rec.finish_recording_as_picture(None) .expect("Failed to finish recording picture while rendering"), ) { match why { // Skip any unsent frames, just in case the renderer // fails to catch up, and to prevent lockups. TrySendError::Full(_) => {} TrySendError::Disconnected(_) => { panic!("Failed to send canvas to draw thread (disconnected channel)") } } } State::with_mut(|x| x.time_state_draw.update()); } State::with_mut(|state| { if!is_redraw { let update_time = state.time_state.last_update().elapsed(); if target_update_time > update_time { sleep(target_update_time - update_time); } } state.time_state.update(); }); } } fn handle_event( game: &mut impl Game, event: Event, feedback_tx: &SyncSender<FeedbackEvent>, ) -> bool { match event { Event::Sdl2Event(event) => { if let Some(r) = State::with_mut(|x| x.input_state.handle_event(&event)) { match r { EventHandleResult::Input(event) => game.input(event), EventHandleResult::Resized(size) => { game.set_size(Size::new(size.width, size.height)) } EventHandleResult::Exit => { game.close(); feedback_tx .send(FeedbackEvent::Exit) .expect("Failed to send feedback event to draw thread"); return true; } } } } Event::Crash(e) => { game.crash(e); feedback_tx .send(FeedbackEvent::Exit) .expect("Failed to send feedback event to draw thread"); return true; } } false } }
elapsed
identifier_name
humantoken.rs
$name ,)* ]; }; } define_prefixes! { quetta Q 30 1000000000000000000000000000000, ronna R 27 1000000000000000000000000000, yotta Y 24 1000000000000000000000000, zetta Z 21 1000000000000000000000, exa E 18 1000000000000000000, peta P 15 1000000000000000, tera T 12 1000000000000, giga G 9 1000000000, mega M 6 1000000, kilo k 3 1000, // Leave this out because // - it simplifies our printing logic // - these are not commonly used // - it's more consistent with lotus // // hecto h 2 100, // deca da 1 10, // deci d -1 0.1, // centi c -2 0.01, milli m -3 0.001, micro μ or u -6 0.000001, nano n -9 0.000000001, pico p -12 0.000000000001, femto f -15 0.000000000000001, atto a -18 0.000000000000000001, zepto z -21 0.000000000000000000001, yocto y -24 0.000000000000000000000001, ronto r -27 0.000000000000000000000000001, quecto q -30 0.000000000000000000000000000001, } #[test] fn sorted() { let is_sorted_biggest_first = SUPPORTED_PREFIXES .windows(2) .all(|pair| pair[0].multiplier() > pair[1].multiplier()); assert!(is_sorted_biggest_first) } } mod parse { // ENHANCE(aatifsyed): could accept pairs like "1 nano 1 atto" use crate::shim::econ::TokenAmount; use anyhow::{anyhow, bail}; use bigdecimal::{BigDecimal, ParseBigDecimalError}; use nom::{ bytes::complete::tag, character::complete::multispace0, combinator::{map_res, opt}, error::{FromExternalError, ParseError}, number::complete::recognize_float, sequence::terminated, IResult, }; use super::si; /// Parse token amounts as floats with SI prefixed-units. /// ``` /// # use forest_filecoin::doctest_private::{TokenAmount, parse}; /// fn assert_attos(input: &str, attos: u64) { /// let expected = TokenAmount::from_atto(attos); /// let actual = parse(input).unwrap(); /// assert_eq!(expected, actual); /// } /// assert_attos("1a", 1); /// assert_attos("1aFIL", 1); /// assert_attos("1 femtoFIL", 1000); /// assert_attos("1.1 f", 1100); /// assert_attos("1.0e3 attofil", 1000); /// ``` /// /// # Known bugs /// - `1efil` will not parse as an exa (`10^18`), because we'll try and /// parse it as a exponent in the float. Instead use `1 efil`. pub fn parse(input: &str) -> anyhow::Result<TokenAmount> { let (mut big_decimal, scale) = parse_big_decimal_and_scale(input)?; if let Some(scale) = scale { big_decimal *= scale.multiplier(); } let fil = big_decimal; let attos = fil * si::atto.multiplier().inverse(); if!attos.is_integer() { bail!("sub-atto amounts are not allowed"); } let (attos, scale) = attos.with_scale(0).into_bigint_and_exponent(); assert_eq!(scale, 0, "we've just set the scale!"); Ok(TokenAmount::from_atto(attos)) } fn nom2anyhow(e: nom::Err<nom::error::VerboseError<&str>>) -> anyhow::Error { anyhow!("parse error: {e}") } fn parse_big_decimal_and_scale( input: &str, ) -> anyhow::Result<(BigDecimal, Option<si::Prefix>)> { // Strip `fil` or `FIL` at most once from the end let input = match (input.strip_suffix("FIL"), input.strip_suffix("fil")) { // remove whitespace before the units if there was any (Some(stripped), _) => stripped.trim_end(), (_, Some(stripped)) => stripped.trim_end(), _ => input, }; let (input, big_decimal) = permit_trailing_ws(bigdecimal)(input).map_err(nom2anyhow)?; let (input, scale) = opt(permit_trailing_ws(si_scale))(input).map_err(nom2anyhow)?; if!input.is_empty() { bail!("Unexpected trailing input: {input}") } Ok((big_decimal, scale)) } fn permit_trailing_ws<'a, F, O, E: ParseError<&'a str>>( inner: F, ) -> impl FnMut(&'a str) -> IResult<&'a str, O, E> where F: FnMut(&'a str) -> IResult<&'a str, O, E>, { terminated(inner, multispace0) } /// Take an [si::Prefix] from the front of `input` fn si_scale<'a, E: ParseError<&'a str>>(input: &'a str) -> IResult<&str, si::Prefix, E> { // Try the longest matches first, so we don't e.g match `a` instead of `atto`, // leaving `tto`. let mut scales = si::SUPPORTED_PREFIXES .iter() .flat_map(|scale| { std::iter::once(&scale.name) .chain(scale.units) .map(move |prefix| (*prefix, scale)) }) .collect::<Vec<_>>(); scales.sort_by_key(|(prefix, _)| std::cmp::Reverse(*prefix)); for (prefix, scale) in scales { if let Ok((rem, _prefix)) = tag::<_, _, E>(prefix)(input) { return Ok((rem, *scale)); } } Err(nom::Err::Error(E::from_error_kind( input, nom::error::ErrorKind::Alt, ))) } /// Take a float from the front of `input` fn bigdecimal<'a, E: ParseError<&'a str>>(input: &'a str) -> IResult<&str, BigDecimal, E> where E: FromExternalError<&'a str, ParseBigDecimalError>, { map_res(recognize_float, str::parse)(input) } #[cfg(test)] mod tests { use std::str::FromStr as _; use num::{BigInt, One as _}; use super::*; #[test] fn cover_scales() { for scale in si::SUPPORTED_PREFIXES { let _did_not_panic = scale.multiplier(); } } #[test] fn parse_bigdecimal() { fn do_test(input: &str, expected: &str) { let expected = BigDecimal::from_str(expected).unwrap(); let (rem, actual) = bigdecimal::<nom::error::VerboseError<_>>(input).unwrap(); assert_eq!(expected, actual); assert!(rem.is_empty()); } do_test("1", "1"); do_test("0.1", "0.1"); do_test(".1", ".1"); do_test("1e1", "10"); do_test("1.", "1"); } fn test_dec_scale( input: &str, expected_amount: &str, expected_scale: impl Into<Option<si::Prefix>>, ) { let expected_amount = BigDecimal::from_str(expected_amount).unwrap(); let expected_scale = expected_scale.into(); let (actual_amount, actual_scale) = parse_big_decimal_and_scale(input).unwrap(); assert_eq!(expected_amount, actual_amount, "{input}"); assert_eq!(expected_scale, actual_scale, "{input}"); } #[test] fn basic_bigdecimal_and_scale() { // plain test_dec_scale("1", "1", None); // include unit test_dec_scale("1 FIL", "1", None); test_dec_scale("1FIL", "1", None); test_dec_scale("1 fil", "1", None); test_dec_scale("1fil", "1", None); let possible_units = ["", "fil", "FIL", " fil", " FIL"]; let possible_prefixes = ["atto", "a", " atto", " a"]; for unit in possible_units { for prefix in possible_prefixes { let input = format!("1{prefix}{unit}"); test_dec_scale(&input, "1", si::atto) } } } #[test] fn parse_exa_and_exponent() { test_dec_scale("1 E", "1", si::exa); test_dec_scale("1e0E", "1", si::exa); // ENHANCE(aatifsyed): this should be parsed as 1 exa, but that // would probably require an entirely custom float parser with // lookahead - users will have to include a space for now // do_test("1E", "1", exa); } #[test] fn more_than_96_bits() { use std::iter::{once, repeat}; // The previous rust_decimal implementation had at most 96 bits of precision // we should be able to exceed that let test_str = once('1') .chain(repeat('0').take(98)) .chain(['1']) .collect::<String>(); test_dec_scale(&test_str, &test_str, None); } #[test] fn disallow_too_small() { parse("1 atto").unwrap(); assert_eq!( parse("0.1 atto").unwrap_err().to_string(), "sub-atto amounts are not allowed" ) } #[test] fn some_values() { let one_atto = TokenAmount::from_atto(BigInt::one()); let one_nano = TokenAmount::from_nano(BigInt::one()); assert_eq!(one_atto, parse("1 atto").unwrap()); assert_eq!(one_atto, parse("1000 zepto").unwrap()); assert_eq!(one_nano, parse("1 nano").unwrap()); } #[test] fn all_possible_prefixes() { for scale in si::SUPPORTED_PREFIXES { for prefix in scale.units.iter().chain([&scale.name]) { // Need a space here because of the exa ambiguity test_dec_scale(&format!("1 {prefix}"), "1", *scale); } } } } } mod print { use std::fmt; use crate::shim::econ::TokenAmount; use bigdecimal::BigDecimal; use num::{BigInt, Zero as _}; use super::si; fn scale(n: BigDecimal) -> (BigDecimal, Option<si::Prefix>) { for prefix in si::SUPPORTED_PREFIXES .iter() .filter(|prefix| prefix.exponent > 0) { let scaled = n.clone() / prefix.multiplier(); if scaled.is_integer() { return (scaled, Some(*prefix)); } } if n.is_integer() { return (n, None); } for prefix in si::SUPPORTED_PREFIXES .iter() .filter(|prefix| prefix.exponent < 0) { let scaled = n.clone() / prefix.multiplier(); if scaled.is_integer() { return (scaled, Some(*prefix)); } } let smallest_prefix = si::SUPPORTED_PREFIXES.last().unwrap(); (n / smallest_prefix.multiplier(), Some(*smallest_prefix)) } pub struct Pr
attos: BigInt, } impl From<&TokenAmount> for Pretty { fn from(value: &TokenAmount) -> Self { Self { attos: value.atto().clone(), } } } pub trait TokenAmountPretty { fn pretty(&self) -> Pretty; } impl TokenAmountPretty for TokenAmount { /// Note the following format specifiers: /// - `{:#}`: print number of FIL, not e.g `milliFIL` /// - `{:.4}`: round to 4 significant figures /// - `{:.#4}`: both /// /// ``` /// # use forest_filecoin::doctest_private::{TokenAmountPretty as _, TokenAmount}; /// /// let amount = TokenAmount::from_nano(1500); /// /// // Defaults to precise, with SI prefix /// assert_eq!("1500 nanoFIL", format!("{}", amount.pretty())); /// /// // Rounded to 1 s.f /// assert_eq!("~2 microFIL", format!("{:.1}", amount.pretty())); /// /// // Show absolute FIL /// assert_eq!("0.0000015 FIL", format!("{:#}", amount.pretty())); /// /// // Rounded absolute FIL /// assert_eq!("~0.000002 FIL", format!("{:#.1}", amount.pretty())); /// /// // We only indicate lost precision when relevant /// assert_eq!("1500 nanoFIL", format!("{:.2}", amount.pretty())); /// ``` /// /// # Formatting /// - We select the most diminutive SI prefix (or not!) that allows us /// to display an integer amount. // RUST(aatifsyed): this should be -> impl fmt::Display // // Users shouldn't be able to name `Pretty` anyway fn pretty(&self) -> Pretty { Pretty::from(self) } } impl fmt::Display for Pretty { fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result { let actual_fil = &self.attos * si::atto.multiplier(); // rounding let fil_for_printing = match f.precision() { None => actual_fil.normalized(), Some(prec) => actual_fil .with_prec(u64::try_from(prec).expect("requested precision is absurd")) .normalized(), }; let precision_was_lost = fil_for_printing!= actual_fil; if precision_was_lost { f.write_str("~")?; } // units or whole let (print_me, prefix) = match f.alternate() { true => (fil_for_printing, None), false => scale(fil_for_printing), }; // write the string match print_me.is_zero() { true => f.write_str("0 FIL"), false => match prefix { Some(prefix) => f.write_fmt(format_args!("{print_me} {}FIL", prefix.name)), None => f.write_fmt(format_args!("{print_me} FIL")), }, } } } #[cfg(test)] mod tests { use std::str::FromStr as _; use num::One as _; use pretty_assertions::assert_eq; use super::*; #[test] fn prefixes_represent_themselves() { for prefix in si::SUPPORTED_PREFIXES { let input = BigDecimal::from_str(prefix.multiplier).unwrap(); assert_eq!((BigDecimal::one(), Some(*prefix)), scale(input)); } } #[test] fn very_large() { let mut one_thousand_quettas = String::from(si::quetta.multiplier); one_thousand_quettas.push_str("000"); test_scale(&one_thousand_quettas, "1000", si::quetta); } #[test] fn very_small() { let mut one_thousanth_of_a_quecto = String::from(si::quecto.multiplier); one_thousanth_of_a_quecto.pop(); one_thousanth_of_a_quecto.push_str("0001"); test_scale(&one_thousanth_of_a_quecto, "0.001", si::quecto); } fn test_scale( input: &str, expected_value: &str, expected_prefix: impl Into<Option<si::Prefix>>, ) { let input = BigDecimal::from_str(input).unwrap(); let expected_value = BigDecimal::from_str(expected_value).unwrap(); let expected_prefix = expected_prefix.into(); assert_eq!((expected_value, expected_prefix), scale(input)) } #[test] fn simple() { test_scale("1000000", "1", si::mega); test_scale("100000", "100", si::kilo); test_scale("10000", "10", si::kilo); test_scale("1000", "1", si::kilo); test_scale("100", "100", None); test_scale("10", "10", None); test_scale("1", "1", None); test_scale("0.1", "100", si::milli); test_scale("0.01", "10", si::milli); test_scale("0.001", "1", si::milli); test_scale("0.0001", "100", si::micro); } #[test] fn trailing_one() { test_scale("10001000", "10001", si::kilo); test_scale("10001", "10001", None); test_scale("1000.1", "1000100", si::milli); } fn attos(input: &str) -> TokenAmount { TokenAmount::from_atto(BigInt::from_str(input).unwrap()) } fn fils(input: &str) -> TokenAmount { TokenAmount::from_whole(BigInt::from_str(input).unwrap()) }
etty {
identifier_name
humantoken.rs
).map_err(nom2anyhow)?; let (input, scale) = opt(permit_trailing_ws(si_scale))(input).map_err(nom2anyhow)?; if!input.is_empty() { bail!("Unexpected trailing input: {input}") } Ok((big_decimal, scale)) } fn permit_trailing_ws<'a, F, O, E: ParseError<&'a str>>( inner: F, ) -> impl FnMut(&'a str) -> IResult<&'a str, O, E> where F: FnMut(&'a str) -> IResult<&'a str, O, E>, { terminated(inner, multispace0) } /// Take an [si::Prefix] from the front of `input` fn si_scale<'a, E: ParseError<&'a str>>(input: &'a str) -> IResult<&str, si::Prefix, E> { // Try the longest matches first, so we don't e.g match `a` instead of `atto`, // leaving `tto`. let mut scales = si::SUPPORTED_PREFIXES .iter() .flat_map(|scale| { std::iter::once(&scale.name) .chain(scale.units) .map(move |prefix| (*prefix, scale)) }) .collect::<Vec<_>>(); scales.sort_by_key(|(prefix, _)| std::cmp::Reverse(*prefix)); for (prefix, scale) in scales { if let Ok((rem, _prefix)) = tag::<_, _, E>(prefix)(input) { return Ok((rem, *scale)); } } Err(nom::Err::Error(E::from_error_kind( input, nom::error::ErrorKind::Alt, ))) } /// Take a float from the front of `input` fn bigdecimal<'a, E: ParseError<&'a str>>(input: &'a str) -> IResult<&str, BigDecimal, E> where E: FromExternalError<&'a str, ParseBigDecimalError>, { map_res(recognize_float, str::parse)(input) } #[cfg(test)] mod tests { use std::str::FromStr as _; use num::{BigInt, One as _}; use super::*; #[test] fn cover_scales() { for scale in si::SUPPORTED_PREFIXES { let _did_not_panic = scale.multiplier(); } } #[test] fn parse_bigdecimal() { fn do_test(input: &str, expected: &str) { let expected = BigDecimal::from_str(expected).unwrap(); let (rem, actual) = bigdecimal::<nom::error::VerboseError<_>>(input).unwrap(); assert_eq!(expected, actual); assert!(rem.is_empty()); } do_test("1", "1"); do_test("0.1", "0.1"); do_test(".1", ".1"); do_test("1e1", "10"); do_test("1.", "1"); } fn test_dec_scale( input: &str, expected_amount: &str, expected_scale: impl Into<Option<si::Prefix>>, ) { let expected_amount = BigDecimal::from_str(expected_amount).unwrap(); let expected_scale = expected_scale.into(); let (actual_amount, actual_scale) = parse_big_decimal_and_scale(input).unwrap(); assert_eq!(expected_amount, actual_amount, "{input}"); assert_eq!(expected_scale, actual_scale, "{input}"); } #[test] fn basic_bigdecimal_and_scale() { // plain test_dec_scale("1", "1", None); // include unit test_dec_scale("1 FIL", "1", None); test_dec_scale("1FIL", "1", None); test_dec_scale("1 fil", "1", None); test_dec_scale("1fil", "1", None); let possible_units = ["", "fil", "FIL", " fil", " FIL"]; let possible_prefixes = ["atto", "a", " atto", " a"]; for unit in possible_units { for prefix in possible_prefixes { let input = format!("1{prefix}{unit}"); test_dec_scale(&input, "1", si::atto) } } } #[test] fn parse_exa_and_exponent() { test_dec_scale("1 E", "1", si::exa); test_dec_scale("1e0E", "1", si::exa); // ENHANCE(aatifsyed): this should be parsed as 1 exa, but that // would probably require an entirely custom float parser with // lookahead - users will have to include a space for now // do_test("1E", "1", exa); } #[test] fn more_than_96_bits() { use std::iter::{once, repeat}; // The previous rust_decimal implementation had at most 96 bits of precision // we should be able to exceed that let test_str = once('1') .chain(repeat('0').take(98)) .chain(['1']) .collect::<String>(); test_dec_scale(&test_str, &test_str, None); } #[test] fn disallow_too_small() { parse("1 atto").unwrap(); assert_eq!( parse("0.1 atto").unwrap_err().to_string(), "sub-atto amounts are not allowed" ) } #[test] fn some_values() { let one_atto = TokenAmount::from_atto(BigInt::one()); let one_nano = TokenAmount::from_nano(BigInt::one()); assert_eq!(one_atto, parse("1 atto").unwrap()); assert_eq!(one_atto, parse("1000 zepto").unwrap()); assert_eq!(one_nano, parse("1 nano").unwrap()); } #[test] fn all_possible_prefixes() { for scale in si::SUPPORTED_PREFIXES { for prefix in scale.units.iter().chain([&scale.name]) { // Need a space here because of the exa ambiguity test_dec_scale(&format!("1 {prefix}"), "1", *scale); } } } } } mod print { use std::fmt; use crate::shim::econ::TokenAmount; use bigdecimal::BigDecimal; use num::{BigInt, Zero as _}; use super::si; fn scale(n: BigDecimal) -> (BigDecimal, Option<si::Prefix>) { for prefix in si::SUPPORTED_PREFIXES .iter() .filter(|prefix| prefix.exponent > 0) { let scaled = n.clone() / prefix.multiplier(); if scaled.is_integer() { return (scaled, Some(*prefix)); } } if n.is_integer() { return (n, None); } for prefix in si::SUPPORTED_PREFIXES .iter() .filter(|prefix| prefix.exponent < 0) { let scaled = n.clone() / prefix.multiplier(); if scaled.is_integer() { return (scaled, Some(*prefix)); } } let smallest_prefix = si::SUPPORTED_PREFIXES.last().unwrap(); (n / smallest_prefix.multiplier(), Some(*smallest_prefix)) } pub struct Pretty { attos: BigInt, } impl From<&TokenAmount> for Pretty { fn from(value: &TokenAmount) -> Self { Self { attos: value.atto().clone(), } } } pub trait TokenAmountPretty { fn pretty(&self) -> Pretty; } impl TokenAmountPretty for TokenAmount { /// Note the following format specifiers: /// - `{:#}`: print number of FIL, not e.g `milliFIL` /// - `{:.4}`: round to 4 significant figures /// - `{:.#4}`: both /// /// ``` /// # use forest_filecoin::doctest_private::{TokenAmountPretty as _, TokenAmount}; /// /// let amount = TokenAmount::from_nano(1500); /// /// // Defaults to precise, with SI prefix /// assert_eq!("1500 nanoFIL", format!("{}", amount.pretty())); /// /// // Rounded to 1 s.f /// assert_eq!("~2 microFIL", format!("{:.1}", amount.pretty())); /// /// // Show absolute FIL /// assert_eq!("0.0000015 FIL", format!("{:#}", amount.pretty())); /// /// // Rounded absolute FIL /// assert_eq!("~0.000002 FIL", format!("{:#.1}", amount.pretty())); /// /// // We only indicate lost precision when relevant /// assert_eq!("1500 nanoFIL", format!("{:.2}", amount.pretty())); /// ``` /// /// # Formatting /// - We select the most diminutive SI prefix (or not!) that allows us /// to display an integer amount. // RUST(aatifsyed): this should be -> impl fmt::Display // // Users shouldn't be able to name `Pretty` anyway fn pretty(&self) -> Pretty { Pretty::from(self) } } impl fmt::Display for Pretty { fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result { let actual_fil = &self.attos * si::atto.multiplier(); // rounding let fil_for_printing = match f.precision() { None => actual_fil.normalized(), Some(prec) => actual_fil .with_prec(u64::try_from(prec).expect("requested precision is absurd")) .normalized(), }; let precision_was_lost = fil_for_printing!= actual_fil; if precision_was_lost { f.write_str("~")?; } // units or whole let (print_me, prefix) = match f.alternate() { true => (fil_for_printing, None), false => scale(fil_for_printing), }; // write the string match print_me.is_zero() { true => f.write_str("0 FIL"), false => match prefix { Some(prefix) => f.write_fmt(format_args!("{print_me} {}FIL", prefix.name)), None => f.write_fmt(format_args!("{print_me} FIL")), }, } } } #[cfg(test)] mod tests { use std::str::FromStr as _; use num::One as _; use pretty_assertions::assert_eq; use super::*; #[test] fn prefixes_represent_themselves() { for prefix in si::SUPPORTED_PREFIXES { let input = BigDecimal::from_str(prefix.multiplier).unwrap(); assert_eq!((BigDecimal::one(), Some(*prefix)), scale(input)); } } #[test] fn very_large() { let mut one_thousand_quettas = String::from(si::quetta.multiplier); one_thousand_quettas.push_str("000"); test_scale(&one_thousand_quettas, "1000", si::quetta); } #[test] fn very_small() { let mut one_thousanth_of_a_quecto = String::from(si::quecto.multiplier); one_thousanth_of_a_quecto.pop(); one_thousanth_of_a_quecto.push_str("0001"); test_scale(&one_thousanth_of_a_quecto, "0.001", si::quecto); } fn test_scale( input: &str, expected_value: &str, expected_prefix: impl Into<Option<si::Prefix>>, ) { let input = BigDecimal::from_str(input).unwrap(); let expected_value = BigDecimal::from_str(expected_value).unwrap(); let expected_prefix = expected_prefix.into(); assert_eq!((expected_value, expected_prefix), scale(input)) } #[test] fn simple() { test_scale("1000000", "1", si::mega); test_scale("100000", "100", si::kilo); test_scale("10000", "10", si::kilo); test_scale("1000", "1", si::kilo); test_scale("100", "100", None); test_scale("10", "10", None); test_scale("1", "1", None); test_scale("0.1", "100", si::milli); test_scale("0.01", "10", si::milli); test_scale("0.001", "1", si::milli); test_scale("0.0001", "100", si::micro); } #[test] fn trailing_one() { test_scale("10001000", "10001", si::kilo); test_scale("10001", "10001", None); test_scale("1000.1", "1000100", si::milli); } fn attos(input: &str) -> TokenAmount { TokenAmount::from_atto(BigInt::from_str(input).unwrap()) } fn fils(input: &str) -> TokenAmount { TokenAmount::from_whole(BigInt::from_str(input).unwrap()) } #[test] fn test_display() { assert_eq!("0 FIL", format!("{}", attos("0").pretty())); // Absolute works assert_eq!("1 attoFIL", format!("{}", attos("1").pretty())); assert_eq!( "0.000000000000000001 FIL", format!("{:#}", attos("1").pretty()) ); // We select the right suffix assert_eq!("1 femtoFIL", format!("{}", attos("1000").pretty())); assert_eq!("1001 attoFIL", format!("{}", attos("1001").pretty())); // If you ask for 0 precision, you get it assert_eq!("~0 FIL", format!("{:.0}", attos("1001").pretty())); // Rounding without a prefix assert_eq!("~10 FIL", format!("{:.1}", fils("11").pretty())); // Rounding with absolute assert_eq!( "~0.000000000000002 FIL", format!("{:#.1}", attos("1940").pretty()) ); assert_eq!( "~0.0000000000000019 FIL", format!("{:#.2}", attos("1940").pretty()) ); assert_eq!( "0.00000000000000194 FIL", format!("{:#.3}", attos("1940").pretty()) ); // Small numbers with a gap then a trailing one are rounded down assert_eq!("~1 femtoFIL", format!("{:.1}", attos("1001").pretty())); assert_eq!("~1 femtoFIL", format!("{:.2}", attos("1001").pretty())); assert_eq!("~1 femtoFIL", format!("{:.3}", attos("1001").pretty())); assert_eq!("1001 attoFIL", format!("{:.4}", attos("1001").pretty())); assert_eq!("1001 attoFIL", format!("{:.5}", attos("1001").pretty())); // Small numbers with trailing numbers are rounded down assert_eq!("~1 femtoFIL", format!("{:.1}", attos("1234").pretty())); assert_eq!("~1200 attoFIL", format!("{:.2}", attos("1234").pretty())); assert_eq!("~1230 attoFIL", format!("{:.3}", attos("1234").pretty())); assert_eq!("1234 attoFIL", format!("{:.4}", attos("1234").pretty())); assert_eq!("1234 attoFIL", format!("{:.5}", attos("1234").pretty())); // Small numbers are rounded appropriately assert_eq!("~2 femtoFIL", format!("{:.1}", attos("1900").pretty())); assert_eq!("~2 femtoFIL", format!("{:.1}", attos("1500").pretty())); assert_eq!("~1 femtoFIL", format!("{:.1}", attos("1400").pretty())); // Big numbers with a gap then a trailing one are rounded down assert_eq!("~1 kiloFIL", format!("{:.1}", fils("1001").pretty())); assert_eq!("~1 kiloFIL", format!("{:.2}", fils("1001").pretty())); assert_eq!("~1 kiloFIL", format!("{:.3}", fils("1001").pretty())); assert_eq!("1001 FIL", format!("{:.4}", fils("1001").pretty())); assert_eq!("1001 FIL", format!("{:.5}", fils("1001").pretty())); // Big numbers with trailing numbers are rounded down assert_eq!("~1 kiloFIL", format!("{:.1}", fils("1234").pretty())); assert_eq!("~1200 FIL", format!("{:.2}", fils("1234").pretty())); assert_eq!("~1230 FIL", format!("{:.3}", fils("1234").pretty())); assert_eq!("1234 FIL", format!("{:.4}", fils("1234").pretty())); assert_eq!("1234 FIL", format!("{:.5}", fils("1234").pretty())); // Big numbers are rounded appropriately assert_eq!("~2 kiloFIL", format!("{:.1}", fils("1900").pretty())); assert_eq!("~2 kiloFIL", format!("{:.1}", fils("1500").pretty())); assert_eq!("~1 kiloFIL", format!("{:.1}", fils("1400").pretty())); } } } #[cfg(test)] mod fuzz { use quickcheck::quickcheck; use super::*; quickcheck! { fn roundtrip(expected: crate::shim::econ::TokenAmount) -> () { // Default formatting let actual = parse(&format!("{}", expected.pretty())).unwrap(); assert_eq!(expected, actual); // Absolute formatting let actual = parse(&format!("{:#}", expected.pretty())).unwrap(); assert_eq!(expected, actual); // Don't test rounded formatting... } }
quickcheck! { fn parser_no_panic(s: String) -> () { let _ = parse(&s); } }
random_line_split
humantoken.rs
$name ,)* ]; }; } define_prefixes! { quetta Q 30 1000000000000000000000000000000, ronna R 27 1000000000000000000000000000, yotta Y 24 1000000000000000000000000, zetta Z 21 1000000000000000000000, exa E 18 1000000000000000000, peta P 15 1000000000000000, tera T 12 1000000000000, giga G 9 1000000000, mega M 6 1000000, kilo k 3 1000, // Leave this out because // - it simplifies our printing logic // - these are not commonly used // - it's more consistent with lotus // // hecto h 2 100, // deca da 1 10, // deci d -1 0.1, // centi c -2 0.01, milli m -3 0.001, micro μ or u -6 0.000001, nano n -9 0.000000001, pico p -12 0.000000000001, femto f -15 0.000000000000001, atto a -18 0.000000000000000001, zepto z -21 0.000000000000000000001, yocto y -24 0.000000000000000000000001, ronto r -27 0.000000000000000000000000001, quecto q -30 0.000000000000000000000000000001, } #[test] fn sorted() { let is_sorted_biggest_first = SUPPORTED_PREFIXES .windows(2) .all(|pair| pair[0].multiplier() > pair[1].multiplier()); assert!(is_sorted_biggest_first) } } mod parse { // ENHANCE(aatifsyed): could accept pairs like "1 nano 1 atto" use crate::shim::econ::TokenAmount; use anyhow::{anyhow, bail}; use bigdecimal::{BigDecimal, ParseBigDecimalError}; use nom::{ bytes::complete::tag, character::complete::multispace0, combinator::{map_res, opt}, error::{FromExternalError, ParseError}, number::complete::recognize_float, sequence::terminated, IResult, }; use super::si; /// Parse token amounts as floats with SI prefixed-units. /// ``` /// # use forest_filecoin::doctest_private::{TokenAmount, parse}; /// fn assert_attos(input: &str, attos: u64) { /// let expected = TokenAmount::from_atto(attos); /// let actual = parse(input).unwrap(); /// assert_eq!(expected, actual); /// } /// assert_attos("1a", 1); /// assert_attos("1aFIL", 1); /// assert_attos("1 femtoFIL", 1000); /// assert_attos("1.1 f", 1100); /// assert_attos("1.0e3 attofil", 1000); /// ``` /// /// # Known bugs /// - `1efil` will not parse as an exa (`10^18`), because we'll try and /// parse it as a exponent in the float. Instead use `1 efil`. pub fn parse(input: &str) -> anyhow::Result<TokenAmount> { let (mut big_decimal, scale) = parse_big_decimal_and_scale(input)?; if let Some(scale) = scale { big_decimal *= scale.multiplier(); } let fil = big_decimal; let attos = fil * si::atto.multiplier().inverse(); if!attos.is_integer() { bail!("sub-atto amounts are not allowed"); } let (attos, scale) = attos.with_scale(0).into_bigint_and_exponent(); assert_eq!(scale, 0, "we've just set the scale!"); Ok(TokenAmount::from_atto(attos)) } fn nom2anyhow(e: nom::Err<nom::error::VerboseError<&str>>) -> anyhow::Error { anyhow!("parse error: {e}") } fn parse_big_decimal_and_scale( input: &str, ) -> anyhow::Result<(BigDecimal, Option<si::Prefix>)> { // Strip `fil` or `FIL` at most once from the end let input = match (input.strip_suffix("FIL"), input.strip_suffix("fil")) { // remove whitespace before the units if there was any (Some(stripped), _) => stripped.trim_end(), (_, Some(stripped)) => stripped.trim_end(), _ => input, }; let (input, big_decimal) = permit_trailing_ws(bigdecimal)(input).map_err(nom2anyhow)?; let (input, scale) = opt(permit_trailing_ws(si_scale))(input).map_err(nom2anyhow)?; if!input.is_empty() { bail!("Unexpected trailing input: {input}") } Ok((big_decimal, scale)) } fn permit_trailing_ws<'a, F, O, E: ParseError<&'a str>>( inner: F, ) -> impl FnMut(&'a str) -> IResult<&'a str, O, E> where F: FnMut(&'a str) -> IResult<&'a str, O, E>, { terminated(inner, multispace0) } /// Take an [si::Prefix] from the front of `input` fn si_scale<'a, E: ParseError<&'a str>>(input: &'a str) -> IResult<&str, si::Prefix, E> {
input, nom::error::ErrorKind::Alt, ))) } /// Take a float from the front of `input` fn bigdecimal<'a, E: ParseError<&'a str>>(input: &'a str) -> IResult<&str, BigDecimal, E> where E: FromExternalError<&'a str, ParseBigDecimalError>, { map_res(recognize_float, str::parse)(input) } #[cfg(test)] mod tests { use std::str::FromStr as _; use num::{BigInt, One as _}; use super::*; #[test] fn cover_scales() { for scale in si::SUPPORTED_PREFIXES { let _did_not_panic = scale.multiplier(); } } #[test] fn parse_bigdecimal() { fn do_test(input: &str, expected: &str) { let expected = BigDecimal::from_str(expected).unwrap(); let (rem, actual) = bigdecimal::<nom::error::VerboseError<_>>(input).unwrap(); assert_eq!(expected, actual); assert!(rem.is_empty()); } do_test("1", "1"); do_test("0.1", "0.1"); do_test(".1", ".1"); do_test("1e1", "10"); do_test("1.", "1"); } fn test_dec_scale( input: &str, expected_amount: &str, expected_scale: impl Into<Option<si::Prefix>>, ) { let expected_amount = BigDecimal::from_str(expected_amount).unwrap(); let expected_scale = expected_scale.into(); let (actual_amount, actual_scale) = parse_big_decimal_and_scale(input).unwrap(); assert_eq!(expected_amount, actual_amount, "{input}"); assert_eq!(expected_scale, actual_scale, "{input}"); } #[test] fn basic_bigdecimal_and_scale() { // plain test_dec_scale("1", "1", None); // include unit test_dec_scale("1 FIL", "1", None); test_dec_scale("1FIL", "1", None); test_dec_scale("1 fil", "1", None); test_dec_scale("1fil", "1", None); let possible_units = ["", "fil", "FIL", " fil", " FIL"]; let possible_prefixes = ["atto", "a", " atto", " a"]; for unit in possible_units { for prefix in possible_prefixes { let input = format!("1{prefix}{unit}"); test_dec_scale(&input, "1", si::atto) } } } #[test] fn parse_exa_and_exponent() { test_dec_scale("1 E", "1", si::exa); test_dec_scale("1e0E", "1", si::exa); // ENHANCE(aatifsyed): this should be parsed as 1 exa, but that // would probably require an entirely custom float parser with // lookahead - users will have to include a space for now // do_test("1E", "1", exa); } #[test] fn more_than_96_bits() { use std::iter::{once, repeat}; // The previous rust_decimal implementation had at most 96 bits of precision // we should be able to exceed that let test_str = once('1') .chain(repeat('0').take(98)) .chain(['1']) .collect::<String>(); test_dec_scale(&test_str, &test_str, None); } #[test] fn disallow_too_small() { parse("1 atto").unwrap(); assert_eq!( parse("0.1 atto").unwrap_err().to_string(), "sub-atto amounts are not allowed" ) } #[test] fn some_values() { let one_atto = TokenAmount::from_atto(BigInt::one()); let one_nano = TokenAmount::from_nano(BigInt::one()); assert_eq!(one_atto, parse("1 atto").unwrap()); assert_eq!(one_atto, parse("1000 zepto").unwrap()); assert_eq!(one_nano, parse("1 nano").unwrap()); } #[test] fn all_possible_prefixes() { for scale in si::SUPPORTED_PREFIXES { for prefix in scale.units.iter().chain([&scale.name]) { // Need a space here because of the exa ambiguity test_dec_scale(&format!("1 {prefix}"), "1", *scale); } } } } } mod print { use std::fmt; use crate::shim::econ::TokenAmount; use bigdecimal::BigDecimal; use num::{BigInt, Zero as _}; use super::si; fn scale(n: BigDecimal) -> (BigDecimal, Option<si::Prefix>) { for prefix in si::SUPPORTED_PREFIXES .iter() .filter(|prefix| prefix.exponent > 0) { let scaled = n.clone() / prefix.multiplier(); if scaled.is_integer() { return (scaled, Some(*prefix)); } } if n.is_integer() { return (n, None); } for prefix in si::SUPPORTED_PREFIXES .iter() .filter(|prefix| prefix.exponent < 0) { let scaled = n.clone() / prefix.multiplier(); if scaled.is_integer() { return (scaled, Some(*prefix)); } } let smallest_prefix = si::SUPPORTED_PREFIXES.last().unwrap(); (n / smallest_prefix.multiplier(), Some(*smallest_prefix)) } pub struct Pretty { attos: BigInt, } impl From<&TokenAmount> for Pretty { fn from(value: &TokenAmount) -> Self { Self { attos: value.atto().clone(), } } } pub trait TokenAmountPretty { fn pretty(&self) -> Pretty; } impl TokenAmountPretty for TokenAmount { /// Note the following format specifiers: /// - `{:#}`: print number of FIL, not e.g `milliFIL` /// - `{:.4}`: round to 4 significant figures /// - `{:.#4}`: both /// /// ``` /// # use forest_filecoin::doctest_private::{TokenAmountPretty as _, TokenAmount}; /// /// let amount = TokenAmount::from_nano(1500); /// /// // Defaults to precise, with SI prefix /// assert_eq!("1500 nanoFIL", format!("{}", amount.pretty())); /// /// // Rounded to 1 s.f /// assert_eq!("~2 microFIL", format!("{:.1}", amount.pretty())); /// /// // Show absolute FIL /// assert_eq!("0.0000015 FIL", format!("{:#}", amount.pretty())); /// /// // Rounded absolute FIL /// assert_eq!("~0.000002 FIL", format!("{:#.1}", amount.pretty())); /// /// // We only indicate lost precision when relevant /// assert_eq!("1500 nanoFIL", format!("{:.2}", amount.pretty())); /// ``` /// /// # Formatting /// - We select the most diminutive SI prefix (or not!) that allows us /// to display an integer amount. // RUST(aatifsyed): this should be -> impl fmt::Display // // Users shouldn't be able to name `Pretty` anyway fn pretty(&self) -> Pretty { Pretty::from(self) } } impl fmt::Display for Pretty { fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result { let actual_fil = &self.attos * si::atto.multiplier(); // rounding let fil_for_printing = match f.precision() { None => actual_fil.normalized(), Some(prec) => actual_fil .with_prec(u64::try_from(prec).expect("requested precision is absurd")) .normalized(), }; let precision_was_lost = fil_for_printing!= actual_fil; if precision_was_lost { f.write_str("~")?; } // units or whole let (print_me, prefix) = match f.alternate() { true => (fil_for_printing, None), false => scale(fil_for_printing), }; // write the string match print_me.is_zero() { true => f.write_str("0 FIL"), false => match prefix { Some(prefix) => f.write_fmt(format_args!("{print_me} {}FIL", prefix.name)), None => f.write_fmt(format_args!("{print_me} FIL")), }, } } } #[cfg(test)] mod tests { use std::str::FromStr as _; use num::One as _; use pretty_assertions::assert_eq; use super::*; #[test] fn prefixes_represent_themselves() { for prefix in si::SUPPORTED_PREFIXES { let input = BigDecimal::from_str(prefix.multiplier).unwrap(); assert_eq!((BigDecimal::one(), Some(*prefix)), scale(input)); } } #[test] fn very_large() { let mut one_thousand_quettas = String::from(si::quetta.multiplier); one_thousand_quettas.push_str("000"); test_scale(&one_thousand_quettas, "1000", si::quetta); } #[test] fn very_small() { let mut one_thousanth_of_a_quecto = String::from(si::quecto.multiplier); one_thousanth_of_a_quecto.pop(); one_thousanth_of_a_quecto.push_str("0001"); test_scale(&one_thousanth_of_a_quecto, "0.001", si::quecto); } fn test_scale( input: &str, expected_value: &str, expected_prefix: impl Into<Option<si::Prefix>>, ) { let input = BigDecimal::from_str(input).unwrap(); let expected_value = BigDecimal::from_str(expected_value).unwrap(); let expected_prefix = expected_prefix.into(); assert_eq!((expected_value, expected_prefix), scale(input)) } #[test] fn simple() { test_scale("1000000", "1", si::mega); test_scale("100000", "100", si::kilo); test_scale("10000", "10", si::kilo); test_scale("1000", "1", si::kilo); test_scale("100", "100", None); test_scale("10", "10", None); test_scale("1", "1", None); test_scale("0.1", "100", si::milli); test_scale("0.01", "10", si::milli); test_scale("0.001", "1", si::milli); test_scale("0.0001", "100", si::micro); } #[test] fn trailing_one() { test_scale("10001000", "10001", si::kilo); test_scale("10001", "10001", None); test_scale("1000.1", "1000100", si::milli); } fn attos(input: &str) -> TokenAmount { TokenAmount::from_atto(BigInt::from_str(input).unwrap()) } fn fils(input: &str) -> TokenAmount { TokenAmount::from_whole(BigInt::from_str(input).unwrap()) }
// Try the longest matches first, so we don't e.g match `a` instead of `atto`, // leaving `tto`. let mut scales = si::SUPPORTED_PREFIXES .iter() .flat_map(|scale| { std::iter::once(&scale.name) .chain(scale.units) .map(move |prefix| (*prefix, scale)) }) .collect::<Vec<_>>(); scales.sort_by_key(|(prefix, _)| std::cmp::Reverse(*prefix)); for (prefix, scale) in scales { if let Ok((rem, _prefix)) = tag::<_, _, E>(prefix)(input) { return Ok((rem, *scale)); } } Err(nom::Err::Error(E::from_error_kind(
identifier_body
lib.rs
// LNP/BP lLibraries implementing LNPBP specifications & standards // Written in 2021-2022 by // Dr. Maxim Orlovsky <orlovsky@pandoraprime.ch> // // To the extent possible under law, the author(s) have dedicated all // copyright and related and neighboring rights to this software to // the public domain worldwide. This software is distributed without // any warranty. // // You should have received a copy of the MIT License // along with this software. // If not, see <https://opensource.org/licenses/MIT>. // Coding conventions #![recursion_limit = "256"] #![deny(dead_code, missing_docs, warnings)] //! Library implementing LNPBP-14 standard: Bech32 encoding for //! client-side-validated data. //! //! Types that need to have `data1...` and `z1...` bech 32 implementation //! according to LNPBP-14 must implement [`ToBech32Payload`] and //! [`FromBech32Payload`] traits. //! //! Bech32 `id1...` representation is provided automatically only for hash types //! implementing [`bitcoin_hashes::Hash`] trait #[macro_use] extern crate amplify; #[macro_use] extern crate strict_encoding; #[cfg(feature = "serde")] #[macro_use] extern crate serde_crate as serde; use std::convert::{Infallible, TryFrom}; use std::fmt::{self, Debug, Formatter}; use std::str::FromStr; use amplify::hex::ToHex; use bech32::{FromBase32, ToBase32, Variant}; use bitcoin_hashes::{sha256t, Hash}; #[cfg(feature = "zip")] use deflate::{write::DeflateEncoder, Compression}; #[cfg(feature = "serde")] use serde::{ de::{Error as SerdeError, Unexpected, Visitor}, Deserializer, Serializer, }; #[cfg(feature = "serde")] use serde_with::{hex::Hex, As}; /// Bech32 HRP used in generic identifiers pub const HRP_ID: &str = "id"; /// Bech32 HRP used for representation of arbitrary data blobs in their raw /// (uncompressed) form pub const HRP_DATA: &str = "data"; #[cfg(feature = "zip")] /// Bech32 HRP used for representation of zip-compressed blobs pub const HRP_ZIP: &str = "z"; /// Constant specifying default compression algorithm ("deflate") #[cfg(feature = "zip")] pub const RAW_DATA_ENCODING_DEFLATE: u8 = 1u8; /// Errors generated by Bech32 conversion functions (both parsing and /// type-specific conversion errors) #[derive(Clone, PartialEq, Eq, Display, Debug, From, Error)] #[display(doc_comments)] pub enum Error { /// bech32 string parse error - {0} #[from] Bech32Error(::bech32::Error), /// payload data are not strictly encoded - {0} #[from] NotStrictEncoded(strict_encoding::Error), /// payload data are not a bitcoin hash - {0} #[from] NotBitcoinHash(bitcoin_hashes::Error), /// Requested object type does not match used Bech32 HRP WrongPrefix, /// bech32m encoding must be used instead of legacy bech32 WrongVariant, /// payload must start with encoding prefix NoEncodingPrefix, /// provided raw data use unknown encoding version {0} UnknownRawDataEncoding(u8), /// can not encode raw data with DEFLATE algorithm DeflateEncoding, /// error inflating compressed data from payload: {0} InflateError(String), } impl From<Infallible> for Error { fn from(_: Infallible) -> Self { unreachable!("infalliable error in lnpbp_bech32 blob") }
/// Type for wrapping Vec<u8> data in cases you need to do a convenient /// enum variant display derives with `#[display(inner)]` #[cfg_attr( feature = "serde", derive(Serialize, Deserialize), serde(crate = "serde_crate", transparent) )] #[derive( Wrapper, Clone, Ord, PartialOrd, Eq, PartialEq, Hash, Default, Display, From )] #[derive(StrictEncode, StrictDecode)] #[wrap( Index, IndexMut, IndexRange, IndexFull, IndexFrom, IndexTo, IndexInclusive )] #[display(Vec::bech32_data_string)] // We get `(To)Bech32DataString` and `FromBech32DataString` for free b/c // the wrapper creates `From<Vec<u8>>` impl for us, which with rust stdlib // implies `TryFrom<Vec<u8>>`, for which we have auto trait derivation // `FromBech32Payload`, for which the traits above are automatically derived pub struct Blob( #[cfg_attr(feature = "serde", serde(with = "As::<Hex>"))] Vec<u8>, ); impl AsRef<[u8]> for Blob { fn as_ref(&self) -> &[u8] { &self.0 } } impl Debug for Blob { fn fmt(&self, f: &mut Formatter<'_>) -> fmt::Result { write!(f, "Blob({})", self.0.to_hex()) } } impl FromStr for Blob { type Err = Error; fn from_str(s: &str) -> Result<Self, Self::Err> { Blob::from_bech32_data_str(s) } } /// Convertor trait for extracting data from a given type which will be part of /// Bech32 payload pub trait ToBech32Payload { /// Must return a vector with Bech32 payload data fn to_bech32_payload(&self) -> Vec<u8>; } /// Extracts data representation from a given type which will be part of Bech32 /// payload pub trait AsBech32Payload { /// Must return a reference to a slice representing Bech32 payload data fn as_bech32_payload(&self) -> &[u8]; } impl<T> AsBech32Payload for T where T: AsRef<[u8]>, { fn as_bech32_payload(&self) -> &[u8] { self.as_ref() } } /// Convertor which constructs a given type from Bech32 payload data pub trait FromBech32Payload where Self: Sized, { /// Construct type from Bech32 payload data fn from_bech32_payload(payload: Vec<u8>) -> Result<Self, Error>; } impl<T> FromBech32Payload for T where T: TryFrom<Vec<u8>>, Error: From<T::Error>, { fn from_bech32_payload(payload: Vec<u8>) -> Result<T, Error> { Ok(T::try_from(payload)?) } } // -- Common (non-LNPBP-39) traits /// Creates Bech32 string with appropriate type data representation. /// Depending on the specific type, this may be `id`-string, `data`-string, /// `z`-string or other type of HRP. pub trait ToBech32String { /// Creates Bech32 string with appropriate type data representation fn to_bech32_string(&self) -> String; } /// Constructs type from the provided Bech32 string, or fails with /// [`enum@Error`] pub trait FromBech32Str { /// Specifies which HRP is used by Bech32 string representing this data type const HRP: &'static str; /// Constructs type from the provided Bech32 string, or fails with /// [`enum@Error`] fn from_bech32_str(s: &str) -> Result<Self, Error> where Self: Sized; } /// Strategies for automatic implementation of the Bech32 traits pub mod strategies { use amplify::{Holder, Wrapper}; use strict_encoding::{StrictDecode, StrictEncode}; use super::*; /// Strategy for Bech32 representation as uncompressed data (starting from /// `data1...` HRP). The data are takken by using [`StrictEncode`] /// implementation defined for the type. pub struct UsingStrictEncoding; /// Strategy for Bech32 representation of the newtypes wrapping other types. /// The strategy simply inherits Bech32 representation from the inner type. pub struct Wrapped; #[cfg(feature = "zip")] /// Strategy for Bech32 representation as compressed data (starting from /// `z1...` HRP). The data are takken by using [`StrictEncode`] /// implementation defined for the type. pub struct CompressedStrictEncoding; /// Helper trait for implementing specific strategy for Bech32 construction pub trait Strategy { /// Bech32 HRP prefix used by a type const HRP: &'static str; /// Specific strategy used for automatic implementation of all /// Bech32-related traits. type Strategy; } impl<T> ToBech32String for T where T: Strategy + Clone, Holder<T, <T as Strategy>::Strategy>: ToBech32String, { #[inline] fn to_bech32_string(&self) -> String { Holder::new(self.clone()).to_bech32_string() } } impl<T> FromBech32Str for T where T: Strategy, Holder<T, <T as Strategy>::Strategy>: FromBech32Str, { const HRP: &'static str = T::HRP; #[inline] fn from_bech32_str(s: &str) -> Result<Self, Error> { Ok(Holder::from_bech32_str(s)?.into_inner()) } } impl<T> ToBech32String for Holder<T, Wrapped> where T: Wrapper, T::Inner: ToBech32String, { #[inline] fn to_bech32_string(&self) -> String { self.as_inner().as_inner().to_bech32_string() } } impl<T> FromBech32Str for Holder<T, Wrapped> where T: Wrapper + Strategy, T::Inner: FromBech32Str, { const HRP: &'static str = T::HRP; #[inline] fn from_bech32_str(s: &str) -> Result<Self, Error> { Ok(Self::new(T::from_inner(T::Inner::from_bech32_str(s)?))) } } impl<T> ToBech32String for Holder<T, UsingStrictEncoding> where T: StrictEncode + Strategy, { #[inline] fn to_bech32_string(&self) -> String { let data = self .as_inner() .strict_serialize() .expect("in-memory strict encoding failure"); ::bech32::encode(T::HRP, data.to_base32(), Variant::Bech32m) .unwrap_or_else(|_| s!("Error: wrong bech32 prefix")) } } impl<T> FromBech32Str for Holder<T, UsingStrictEncoding> where T: StrictDecode + Strategy, { const HRP: &'static str = T::HRP; #[inline] fn from_bech32_str(s: &str) -> Result<Self, Error> { let (hrp, data, variant) = ::bech32::decode(s)?; if hrp.as_str()!= Self::HRP { return Err(Error::WrongPrefix); } if variant!= Variant::Bech32m { return Err(Error::WrongVariant); } Ok(Self::new(T::strict_deserialize(Vec::<u8>::from_base32( &data, )?)?)) } } } pub use strategies::Strategy; // -- Sealed traits & their implementation /// Special trait for preventing implementation of [`FromBech32DataStr`] and /// others from outside of this crate. For details see /// <https://rust-lang.github.io/api-guidelines/future-proofing.html#sealed-traits-protect-against-downstream-implementations-c-sealed> mod sealed { use amplify::Wrapper; use super::*; pub trait HashType<Tag>: Wrapper<Inner = sha256t::Hash<Tag>> where Tag: sha256t::Tag, { } pub trait ToPayload: ToBech32Payload {} pub trait AsPayload: AsBech32Payload {} pub trait FromPayload: FromBech32Payload {} impl<T, Tag> HashType<Tag> for T where T: Wrapper<Inner = sha256t::Hash<Tag>>, Tag: sha256t::Tag, { } impl<T> ToPayload for T where T: ToBech32Payload {} impl<T> AsPayload for T where T: AsBech32Payload {} impl<T> FromPayload for T where T: FromBech32Payload {} } /// Trait for creating `data1...` Bech32 representation of a given type pub trait ToBech32DataString: sealed::ToPayload { /// Returns `data1...` Bech32 representation of a given type fn to_bech32_data_string(&self) -> String { ::bech32::encode( HRP_DATA, self.to_bech32_payload().to_base32(), Variant::Bech32m, ) .expect("HRP is hardcoded and can't fail") } } impl<T> ToBech32DataString for T where T: sealed::ToPayload {} /// Trait for creating `data1...` Bech32 representation of a given type pub trait Bech32DataString: sealed::AsPayload { /// Returns `data1...` Bech32 representation of a given type fn bech32_data_string(&self) -> String { ::bech32::encode( HRP_DATA, self.as_bech32_payload().to_base32(), Variant::Bech32m, ) .expect("HRP is hardcoded and can't fail") } } impl<T> Bech32DataString for T where T: sealed::AsPayload {} /// Trait for reconstruction type data from `data1...` Bech32 string pub trait FromBech32DataStr where Self: Sized + sealed::FromPayload, { /// Reconstructs type data from `data1...` Bech32 string fn from_bech32_data_str(s: &str) -> Result<Self, Error> { let (hrp, data, variant) = bech32::decode(s)?; if hrp!= HRP_DATA { return Err(Error::WrongPrefix); } if variant!= Variant::Bech32m { return Err(Error::WrongVariant); } Self::from_bech32_payload(Vec::<u8>::from_base32(&data)?) } } impl<T> FromBech32DataStr for T where T: sealed::FromPayload {} #[doc(hidden)] #[cfg(feature = "zip")] pub mod zip { use amplify::Holder; use strict_encoding::{StrictDecode, StrictEncode}; use super::*; fn payload_to_bech32_zip_string(hrp: &str, payload: &[u8]) -> String { use std::io::Write; // We initialize writer with a version byte, indicating deflation // algorithm used let writer = vec![RAW_DATA_ENCODING_DEFLATE]; let mut encoder = DeflateEncoder::new(writer, Compression::Best); encoder .write_all(payload) .expect("in-memory strict encoder failure"); let data = encoder.finish().expect("zip algorithm failure"); ::bech32::encode(hrp, data.to_base32(), Variant::Bech32m) .expect("HRP is hardcoded and can't fail") } fn bech32_zip_str_to_payload(hrp: &str, s: &str) -> Result<Vec<u8>, Error> { let (prefix, data, version) = bech32::decode(s)?; if prefix!= hrp { return Err(Error::WrongPrefix); } if version!= Variant::Bech32m { return Err(Error::WrongVariant); } let data = Vec::<u8>::from_base32(&data)?; match *data[..].first().ok_or(Error::NoEncodingPrefix)? { RAW_DATA_ENCODING_DEFLATE => { let decoded = inflate::inflate_bytes(&data[1..]) .map_err(Error::InflateError)?; Ok(decoded) } unknown_ver => Err(Error::UnknownRawDataEncoding(unknown_ver)), } } /// Trait for creating `z1...` (compressed binary data blob) Bech32 /// representation of a given type pub trait ToBech32ZipString: sealed::ToPayload { /// Returns `z1...` (compressed binary data blob) Bech32 representation /// of a given type fn to_bech32_zip_string(&self) -> String { payload_to_bech32_zip_string(HRP_ZIP, &self.to_bech32_payload()) } } impl<T> ToBech32ZipString for T where T: sealed::ToPayload {} /// Trait for creating `z1...` (compressed binary data blob) Bech32 /// representation of a given type pub trait Bech32ZipString: sealed::AsPayload { /// Returns `z1...` (compressed binary data blob) Bech32 representation /// of a given type fn bech32_zip_string(&self) -> String { payload_to_bech32_zip_string(HRP_ZIP, self.as_bech32_payload()) } } impl<T> Bech32ZipString for T where T: sealed::AsPayload {} /// Trait for reconstruction type data from `z1...` (compressed binary data /// blob) Bech32 string pub trait FromBech32ZipStr: sealed::FromPayload { /// Reconstructs type data from `z1...` (compressed binary data blob) /// Bech32 string fn from_bech32_zip_str(s: &str) -> Result<Self, Error> { Self::from_bech32_payload(bech32_zip_str_to_payload(HRP_ZIP, s)?) } } impl<T> FromBech32ZipStr for T where T: sealed::FromPayload {} impl<T> ToBech32String for Holder<T, strategies::CompressedStrictEncoding> where T: StrictEncode + Strategy, { #[inline] fn to_bech32_string(&self) -> String { let data = self .as_inner() .strict_serialize() .expect("in-memory strict encoding failure"); payload_to_bech32_zip_string(T::HRP, &data) } } impl<T> FromBech32Str for Holder<T, strategies::CompressedStrictEncoding> where T: StrictDecode + Strategy, { const HRP: &'static str = T::HRP; #[inline] fn from_bech32_str(s: &str) -> Result<Self, Error> { Ok(Self::new(T::strict_deserialize( bech32_zip_str_to_payload(Self::HRP, s)?, )?)) } } } #[cfg(feature = "zip")] pub use zip::*; /// Trait representing given bitcoin hash type as a Bech32 `id1...` value pub trait ToBech32IdString<Tag> where Self: sealed::HashType<Tag>, Tag: sha256t::Tag, { /// Returns Bech32-encoded string in form of `id1...` representing the type fn to_bech32_id_string(&self) -> String; } /// Trait that can generate the type from a given Bech32 `id1...` value pub trait FromBech32IdStr<Tag> where Self: sealed::HashType<Tag> + Sized, Tag: sha256t::Tag, { /// Reconstructs the identifier type from the provided Bech32 `id1...` /// string fn from_bech32_id_str(s: &str) -> Result<Self, Error>; } impl<T, Tag> ToBech32IdString<Tag> for T where Self: sealed::HashType<Tag>, Tag: sha256t::Tag, { fn to_bech32_id_string(&self) -> String { ::bech32::encode(HRP_ID, self.to_inner().to_base32(), Variant::Bech32m) .expect("HRP is hardcoded and can't fail") } } impl<T, Tag> FromBech32IdStr<Tag> for T where Self: sealed::HashType<Tag>, Tag: sha256t::Tag, { fn from_bech32_id_str(s: &str) -> Result<T, Error> { let (hrp, id, variant) = ::bech32::decode(s)?; if hrp!= HRP_ID { return Err(Error::WrongPrefix); } if variant!= Variant::Bech32m { return Err(Error::WrongVariant); } let vec = Vec::<u8>::from_base32(&id)?; Ok(Self::from_inner(Self::Inner::from_slice(&vec)?)) } } /// Helper method for serde serialization of types supporting Bech32 /// representation #[cfg(feature = "serde")] pub fn serialize<T, S>(data: &T, serializer: S) -> Result<S::Ok, S::Error> where S: Serializer, T: ToBech32String, { serializer.serialize_str(&data.to_bech32_string()) } /// Helper method for serde deserialization of types supporting Bech32 /// representation #[cfg(feature = "serde")] pub fn deserialize<'de, T, D>(deserializer: D) -> Result<T, D::Error> where D: Deserializer<'de>, T: FromBech32Str, { deserializer.deserialize_str(Bech32Visitor::<T>(std::marker::PhantomData)) } #[cfg(feature = "serde")] struct Bech32Visitor<Value>(std::marker::PhantomData<Value>); #[cfg(feature = "serde")] impl<'de, ValueT> Visitor<'de> for Bech32Visitor<ValueT> where ValueT: FromBech32Str, { type Value = ValueT; fn expecting( &self, formatter: &mut std::fmt::Formatter, ) -> std::fmt::Result { formatter.write_str("a bech32m-encoded string") } fn visit_str<E>(self, v: &str) -> Result<Self::Value, E> where E: SerdeError, { Self::Value::from_bech32_str(v).map_err(|_| { E::invalid_value(Unexpected::Str(v), &"valid bech32 string") }) } }
}
random_line_split
lib.rs
// LNP/BP lLibraries implementing LNPBP specifications & standards // Written in 2021-2022 by // Dr. Maxim Orlovsky <orlovsky@pandoraprime.ch> // // To the extent possible under law, the author(s) have dedicated all // copyright and related and neighboring rights to this software to // the public domain worldwide. This software is distributed without // any warranty. // // You should have received a copy of the MIT License // along with this software. // If not, see <https://opensource.org/licenses/MIT>. // Coding conventions #![recursion_limit = "256"] #![deny(dead_code, missing_docs, warnings)] //! Library implementing LNPBP-14 standard: Bech32 encoding for //! client-side-validated data. //! //! Types that need to have `data1...` and `z1...` bech 32 implementation //! according to LNPBP-14 must implement [`ToBech32Payload`] and //! [`FromBech32Payload`] traits. //! //! Bech32 `id1...` representation is provided automatically only for hash types //! implementing [`bitcoin_hashes::Hash`] trait #[macro_use] extern crate amplify; #[macro_use] extern crate strict_encoding; #[cfg(feature = "serde")] #[macro_use] extern crate serde_crate as serde; use std::convert::{Infallible, TryFrom}; use std::fmt::{self, Debug, Formatter}; use std::str::FromStr; use amplify::hex::ToHex; use bech32::{FromBase32, ToBase32, Variant}; use bitcoin_hashes::{sha256t, Hash}; #[cfg(feature = "zip")] use deflate::{write::DeflateEncoder, Compression}; #[cfg(feature = "serde")] use serde::{ de::{Error as SerdeError, Unexpected, Visitor}, Deserializer, Serializer, }; #[cfg(feature = "serde")] use serde_with::{hex::Hex, As}; /// Bech32 HRP used in generic identifiers pub const HRP_ID: &str = "id"; /// Bech32 HRP used for representation of arbitrary data blobs in their raw /// (uncompressed) form pub const HRP_DATA: &str = "data"; #[cfg(feature = "zip")] /// Bech32 HRP used for representation of zip-compressed blobs pub const HRP_ZIP: &str = "z"; /// Constant specifying default compression algorithm ("deflate") #[cfg(feature = "zip")] pub const RAW_DATA_ENCODING_DEFLATE: u8 = 1u8; /// Errors generated by Bech32 conversion functions (both parsing and /// type-specific conversion errors) #[derive(Clone, PartialEq, Eq, Display, Debug, From, Error)] #[display(doc_comments)] pub enum Error { /// bech32 string parse error - {0} #[from] Bech32Error(::bech32::Error), /// payload data are not strictly encoded - {0} #[from] NotStrictEncoded(strict_encoding::Error), /// payload data are not a bitcoin hash - {0} #[from] NotBitcoinHash(bitcoin_hashes::Error), /// Requested object type does not match used Bech32 HRP WrongPrefix, /// bech32m encoding must be used instead of legacy bech32 WrongVariant, /// payload must start with encoding prefix NoEncodingPrefix, /// provided raw data use unknown encoding version {0} UnknownRawDataEncoding(u8), /// can not encode raw data with DEFLATE algorithm DeflateEncoding, /// error inflating compressed data from payload: {0} InflateError(String), } impl From<Infallible> for Error { fn from(_: Infallible) -> Self { unreachable!("infalliable error in lnpbp_bech32 blob") } } /// Type for wrapping Vec<u8> data in cases you need to do a convenient /// enum variant display derives with `#[display(inner)]` #[cfg_attr( feature = "serde", derive(Serialize, Deserialize), serde(crate = "serde_crate", transparent) )] #[derive( Wrapper, Clone, Ord, PartialOrd, Eq, PartialEq, Hash, Default, Display, From )] #[derive(StrictEncode, StrictDecode)] #[wrap( Index, IndexMut, IndexRange, IndexFull, IndexFrom, IndexTo, IndexInclusive )] #[display(Vec::bech32_data_string)] // We get `(To)Bech32DataString` and `FromBech32DataString` for free b/c // the wrapper creates `From<Vec<u8>>` impl for us, which with rust stdlib // implies `TryFrom<Vec<u8>>`, for which we have auto trait derivation // `FromBech32Payload`, for which the traits above are automatically derived pub struct Blob( #[cfg_attr(feature = "serde", serde(with = "As::<Hex>"))] Vec<u8>, ); impl AsRef<[u8]> for Blob { fn as_ref(&self) -> &[u8] { &self.0 } } impl Debug for Blob { fn fmt(&self, f: &mut Formatter<'_>) -> fmt::Result { write!(f, "Blob({})", self.0.to_hex()) } } impl FromStr for Blob { type Err = Error; fn from_str(s: &str) -> Result<Self, Self::Err> { Blob::from_bech32_data_str(s) } } /// Convertor trait for extracting data from a given type which will be part of /// Bech32 payload pub trait ToBech32Payload { /// Must return a vector with Bech32 payload data fn to_bech32_payload(&self) -> Vec<u8>; } /// Extracts data representation from a given type which will be part of Bech32 /// payload pub trait AsBech32Payload { /// Must return a reference to a slice representing Bech32 payload data fn as_bech32_payload(&self) -> &[u8]; } impl<T> AsBech32Payload for T where T: AsRef<[u8]>, { fn as_bech32_payload(&self) -> &[u8] { self.as_ref() } } /// Convertor which constructs a given type from Bech32 payload data pub trait FromBech32Payload where Self: Sized, { /// Construct type from Bech32 payload data fn from_bech32_payload(payload: Vec<u8>) -> Result<Self, Error>; } impl<T> FromBech32Payload for T where T: TryFrom<Vec<u8>>, Error: From<T::Error>, { fn from_bech32_payload(payload: Vec<u8>) -> Result<T, Error> { Ok(T::try_from(payload)?) } } // -- Common (non-LNPBP-39) traits /// Creates Bech32 string with appropriate type data representation. /// Depending on the specific type, this may be `id`-string, `data`-string, /// `z`-string or other type of HRP. pub trait ToBech32String { /// Creates Bech32 string with appropriate type data representation fn to_bech32_string(&self) -> String; } /// Constructs type from the provided Bech32 string, or fails with /// [`enum@Error`] pub trait FromBech32Str { /// Specifies which HRP is used by Bech32 string representing this data type const HRP: &'static str; /// Constructs type from the provided Bech32 string, or fails with /// [`enum@Error`] fn from_bech32_str(s: &str) -> Result<Self, Error> where Self: Sized; } /// Strategies for automatic implementation of the Bech32 traits pub mod strategies { use amplify::{Holder, Wrapper}; use strict_encoding::{StrictDecode, StrictEncode}; use super::*; /// Strategy for Bech32 representation as uncompressed data (starting from /// `data1...` HRP). The data are takken by using [`StrictEncode`] /// implementation defined for the type. pub struct UsingStrictEncoding; /// Strategy for Bech32 representation of the newtypes wrapping other types. /// The strategy simply inherits Bech32 representation from the inner type. pub struct Wrapped; #[cfg(feature = "zip")] /// Strategy for Bech32 representation as compressed data (starting from /// `z1...` HRP). The data are takken by using [`StrictEncode`] /// implementation defined for the type. pub struct CompressedStrictEncoding; /// Helper trait for implementing specific strategy for Bech32 construction pub trait Strategy { /// Bech32 HRP prefix used by a type const HRP: &'static str; /// Specific strategy used for automatic implementation of all /// Bech32-related traits. type Strategy; } impl<T> ToBech32String for T where T: Strategy + Clone, Holder<T, <T as Strategy>::Strategy>: ToBech32String, { #[inline] fn to_bech32_string(&self) -> String { Holder::new(self.clone()).to_bech32_string() } } impl<T> FromBech32Str for T where T: Strategy, Holder<T, <T as Strategy>::Strategy>: FromBech32Str, { const HRP: &'static str = T::HRP; #[inline] fn from_bech32_str(s: &str) -> Result<Self, Error> { Ok(Holder::from_bech32_str(s)?.into_inner()) } } impl<T> ToBech32String for Holder<T, Wrapped> where T: Wrapper, T::Inner: ToBech32String, { #[inline] fn to_bech32_string(&self) -> String { self.as_inner().as_inner().to_bech32_string() } } impl<T> FromBech32Str for Holder<T, Wrapped> where T: Wrapper + Strategy, T::Inner: FromBech32Str, { const HRP: &'static str = T::HRP; #[inline] fn from_bech32_str(s: &str) -> Result<Self, Error> { Ok(Self::new(T::from_inner(T::Inner::from_bech32_str(s)?))) } } impl<T> ToBech32String for Holder<T, UsingStrictEncoding> where T: StrictEncode + Strategy, { #[inline] fn to_bech32_string(&self) -> String { let data = self .as_inner() .strict_serialize() .expect("in-memory strict encoding failure"); ::bech32::encode(T::HRP, data.to_base32(), Variant::Bech32m) .unwrap_or_else(|_| s!("Error: wrong bech32 prefix")) } } impl<T> FromBech32Str for Holder<T, UsingStrictEncoding> where T: StrictDecode + Strategy, { const HRP: &'static str = T::HRP; #[inline] fn from_bech32_str(s: &str) -> Result<Self, Error> { let (hrp, data, variant) = ::bech32::decode(s)?; if hrp.as_str()!= Self::HRP { return Err(Error::WrongPrefix); } if variant!= Variant::Bech32m { return Err(Error::WrongVariant); } Ok(Self::new(T::strict_deserialize(Vec::<u8>::from_base32( &data, )?)?)) } } } pub use strategies::Strategy; // -- Sealed traits & their implementation /// Special trait for preventing implementation of [`FromBech32DataStr`] and /// others from outside of this crate. For details see /// <https://rust-lang.github.io/api-guidelines/future-proofing.html#sealed-traits-protect-against-downstream-implementations-c-sealed> mod sealed { use amplify::Wrapper; use super::*; pub trait HashType<Tag>: Wrapper<Inner = sha256t::Hash<Tag>> where Tag: sha256t::Tag, { } pub trait ToPayload: ToBech32Payload {} pub trait AsPayload: AsBech32Payload {} pub trait FromPayload: FromBech32Payload {} impl<T, Tag> HashType<Tag> for T where T: Wrapper<Inner = sha256t::Hash<Tag>>, Tag: sha256t::Tag, { } impl<T> ToPayload for T where T: ToBech32Payload {} impl<T> AsPayload for T where T: AsBech32Payload {} impl<T> FromPayload for T where T: FromBech32Payload {} } /// Trait for creating `data1...` Bech32 representation of a given type pub trait ToBech32DataString: sealed::ToPayload { /// Returns `data1...` Bech32 representation of a given type fn to_bech32_data_string(&self) -> String { ::bech32::encode( HRP_DATA, self.to_bech32_payload().to_base32(), Variant::Bech32m, ) .expect("HRP is hardcoded and can't fail") } } impl<T> ToBech32DataString for T where T: sealed::ToPayload {} /// Trait for creating `data1...` Bech32 representation of a given type pub trait Bech32DataString: sealed::AsPayload { /// Returns `data1...` Bech32 representation of a given type fn bech32_data_string(&self) -> String { ::bech32::encode( HRP_DATA, self.as_bech32_payload().to_base32(), Variant::Bech32m, ) .expect("HRP is hardcoded and can't fail") } } impl<T> Bech32DataString for T where T: sealed::AsPayload {} /// Trait for reconstruction type data from `data1...` Bech32 string pub trait FromBech32DataStr where Self: Sized + sealed::FromPayload, { /// Reconstructs type data from `data1...` Bech32 string fn from_bech32_data_str(s: &str) -> Result<Self, Error> { let (hrp, data, variant) = bech32::decode(s)?; if hrp!= HRP_DATA { return Err(Error::WrongPrefix); } if variant!= Variant::Bech32m { return Err(Error::WrongVariant); } Self::from_bech32_payload(Vec::<u8>::from_base32(&data)?) } } impl<T> FromBech32DataStr for T where T: sealed::FromPayload {} #[doc(hidden)] #[cfg(feature = "zip")] pub mod zip { use amplify::Holder; use strict_encoding::{StrictDecode, StrictEncode}; use super::*; fn payload_to_bech32_zip_string(hrp: &str, payload: &[u8]) -> String { use std::io::Write; // We initialize writer with a version byte, indicating deflation // algorithm used let writer = vec![RAW_DATA_ENCODING_DEFLATE]; let mut encoder = DeflateEncoder::new(writer, Compression::Best); encoder .write_all(payload) .expect("in-memory strict encoder failure"); let data = encoder.finish().expect("zip algorithm failure"); ::bech32::encode(hrp, data.to_base32(), Variant::Bech32m) .expect("HRP is hardcoded and can't fail") } fn bech32_zip_str_to_payload(hrp: &str, s: &str) -> Result<Vec<u8>, Error> { let (prefix, data, version) = bech32::decode(s)?; if prefix!= hrp { return Err(Error::WrongPrefix); } if version!= Variant::Bech32m { return Err(Error::WrongVariant); } let data = Vec::<u8>::from_base32(&data)?; match *data[..].first().ok_or(Error::NoEncodingPrefix)? { RAW_DATA_ENCODING_DEFLATE => { let decoded = inflate::inflate_bytes(&data[1..]) .map_err(Error::InflateError)?; Ok(decoded) } unknown_ver => Err(Error::UnknownRawDataEncoding(unknown_ver)), } } /// Trait for creating `z1...` (compressed binary data blob) Bech32 /// representation of a given type pub trait ToBech32ZipString: sealed::ToPayload { /// Returns `z1...` (compressed binary data blob) Bech32 representation /// of a given type fn to_bech32_zip_string(&self) -> String { payload_to_bech32_zip_string(HRP_ZIP, &self.to_bech32_payload()) } } impl<T> ToBech32ZipString for T where T: sealed::ToPayload {} /// Trait for creating `z1...` (compressed binary data blob) Bech32 /// representation of a given type pub trait Bech32ZipString: sealed::AsPayload { /// Returns `z1...` (compressed binary data blob) Bech32 representation /// of a given type fn bech32_zip_string(&self) -> String { payload_to_bech32_zip_string(HRP_ZIP, self.as_bech32_payload()) } } impl<T> Bech32ZipString for T where T: sealed::AsPayload {} /// Trait for reconstruction type data from `z1...` (compressed binary data /// blob) Bech32 string pub trait FromBech32ZipStr: sealed::FromPayload { /// Reconstructs type data from `z1...` (compressed binary data blob) /// Bech32 string fn from_bech32_zip_str(s: &str) -> Result<Self, Error> { Self::from_bech32_payload(bech32_zip_str_to_payload(HRP_ZIP, s)?) } } impl<T> FromBech32ZipStr for T where T: sealed::FromPayload {} impl<T> ToBech32String for Holder<T, strategies::CompressedStrictEncoding> where T: StrictEncode + Strategy, { #[inline] fn to_bech32_string(&self) -> String { let data = self .as_inner() .strict_serialize() .expect("in-memory strict encoding failure"); payload_to_bech32_zip_string(T::HRP, &data) } } impl<T> FromBech32Str for Holder<T, strategies::CompressedStrictEncoding> where T: StrictDecode + Strategy, { const HRP: &'static str = T::HRP; #[inline] fn from_bech32_str(s: &str) -> Result<Self, Error> { Ok(Self::new(T::strict_deserialize( bech32_zip_str_to_payload(Self::HRP, s)?, )?)) } } } #[cfg(feature = "zip")] pub use zip::*; /// Trait representing given bitcoin hash type as a Bech32 `id1...` value pub trait ToBech32IdString<Tag> where Self: sealed::HashType<Tag>, Tag: sha256t::Tag, { /// Returns Bech32-encoded string in form of `id1...` representing the type fn to_bech32_id_string(&self) -> String; } /// Trait that can generate the type from a given Bech32 `id1...` value pub trait FromBech32IdStr<Tag> where Self: sealed::HashType<Tag> + Sized, Tag: sha256t::Tag, { /// Reconstructs the identifier type from the provided Bech32 `id1...` /// string fn from_bech32_id_str(s: &str) -> Result<Self, Error>; } impl<T, Tag> ToBech32IdString<Tag> for T where Self: sealed::HashType<Tag>, Tag: sha256t::Tag, { fn to_bech32_id_string(&self) -> String { ::bech32::encode(HRP_ID, self.to_inner().to_base32(), Variant::Bech32m) .expect("HRP is hardcoded and can't fail") } } impl<T, Tag> FromBech32IdStr<Tag> for T where Self: sealed::HashType<Tag>, Tag: sha256t::Tag, { fn from_bech32_id_str(s: &str) -> Result<T, Error> { let (hrp, id, variant) = ::bech32::decode(s)?; if hrp!= HRP_ID { return Err(Error::WrongPrefix); } if variant!= Variant::Bech32m { return Err(Error::WrongVariant); } let vec = Vec::<u8>::from_base32(&id)?; Ok(Self::from_inner(Self::Inner::from_slice(&vec)?)) } } /// Helper method for serde serialization of types supporting Bech32 /// representation #[cfg(feature = "serde")] pub fn serialize<T, S>(data: &T, serializer: S) -> Result<S::Ok, S::Error> where S: Serializer, T: ToBech32String, { serializer.serialize_str(&data.to_bech32_string()) } /// Helper method for serde deserialization of types supporting Bech32 /// representation #[cfg(feature = "serde")] pub fn deserialize<'de, T, D>(deserializer: D) -> Result<T, D::Error> where D: Deserializer<'de>, T: FromBech32Str, { deserializer.deserialize_str(Bech32Visitor::<T>(std::marker::PhantomData)) } #[cfg(feature = "serde")] struct
<Value>(std::marker::PhantomData<Value>); #[cfg(feature = "serde")] impl<'de, ValueT> Visitor<'de> for Bech32Visitor<ValueT> where ValueT: FromBech32Str, { type Value = ValueT; fn expecting( &self, formatter: &mut std::fmt::Formatter, ) -> std::fmt::Result { formatter.write_str("a bech32m-encoded string") } fn visit_str<E>(self, v: &str) -> Result<Self::Value, E> where E: SerdeError, { Self::Value::from_bech32_str(v).map_err(|_| { E::invalid_value(Unexpected::Str(v), &"valid bech32 string") }) } }
Bech32Visitor
identifier_name
lib.rs
//! JSON-RPC client implementation. #![deny(missing_docs)] use failure::{format_err, Fail}; use futures::sync::{mpsc, oneshot}; use futures::{future, prelude::*}; use jsonrpc_core::{Error, Params}; use serde::de::DeserializeOwned; use serde::Serialize; use serde_json::Value; use std::marker::PhantomData; pub mod transports; #[cfg(test)] mod logger; /// The errors returned by the client. #[derive(Debug, Fail)] pub enum RpcError { /// An error returned by the server. #[fail(display = "Server returned rpc error {}", _0)] JsonRpcError(Error), /// Failure to parse server response. #[fail(display = "Failed to parse server response as {}: {}", _0, _1)] ParseError(String, failure::Error), /// Request timed out. #[fail(display = "Request timed out")] Timeout, /// Not rpc specific errors. #[fail(display = "{}", _0)] Other(failure::Error), } impl From<Error> for RpcError { fn from(error: Error) -> Self { RpcError::JsonRpcError(error) } } /// An RPC call message. struct CallMessage { /// The RPC method name. method: String, /// The RPC method parameters. params: Params, /// The oneshot channel to send the result of the rpc /// call to. sender: oneshot::Sender<Result<Value, RpcError>>, } /// An RPC notification. struct NotifyMessage { /// The RPC method name. method: String, /// The RPC method paramters. params: Params, } /// An RPC subscription. struct Subscription { /// The subscribe method name. subscribe: String, /// The subscribe method parameters. subscribe_params: Params, /// The name of the notification. notification: String, /// The unsubscribe method name. unsubscribe: String, } /// An RPC subscribe message. struct SubscribeMessage { /// The subscription to subscribe to. subscription: Subscription, /// The channel to send notifications to. sender: mpsc::Sender<Result<Value, RpcError>>, } /// A message sent to the `RpcClient`. enum RpcMessage { /// Make an RPC call. Call(CallMessage), /// Send a notification. Notify(NotifyMessage), /// Subscribe to a notification. Subscribe(SubscribeMessage), } impl From<CallMessage> for RpcMessage { fn from(msg: CallMessage) -> Self { RpcMessage::Call(msg) } } impl From<NotifyMessage> for RpcMessage { fn from(msg: NotifyMessage) -> Self { RpcMessage::Notify(msg) } } impl From<SubscribeMessage> for RpcMessage { fn from(msg: SubscribeMessage) -> Self { RpcMessage::Subscribe(msg) } } /// A channel to a `RpcClient`. #[derive(Clone)] pub struct RpcChannel(mpsc::Sender<RpcMessage>); impl RpcChannel { fn send( &self, msg: RpcMessage, ) -> impl Future<Item = mpsc::Sender<RpcMessage>, Error = mpsc::SendError<RpcMessage>> { self.0.to_owned().send(msg) } } impl From<mpsc::Sender<RpcMessage>> for RpcChannel { fn from(sender: mpsc::Sender<RpcMessage>) -> Self { RpcChannel(sender) } } /// The future returned by the rpc call. pub struct RpcFuture { recv: oneshot::Receiver<Result<Value, RpcError>>, } impl RpcFuture { /// Creates a new `RpcFuture`. pub fn new(recv: oneshot::Receiver<Result<Value, RpcError>>) -> Self { RpcFuture { recv } } } impl Future for RpcFuture { type Item = Value; type Error = RpcError; fn poll(&mut self) -> Result<Async<Self::Item>, Self::Error> { // TODO should timeout (#410) match self.recv.poll() { Ok(Async::Ready(Ok(value))) => Ok(Async::Ready(value)), Ok(Async::Ready(Err(error))) => Err(error), Ok(Async::NotReady) => Ok(Async::NotReady), Err(error) => Err(RpcError::Other(error.into())), } } } /// The stream returned by a subscribe. pub struct SubscriptionStream { recv: mpsc::Receiver<Result<Value, RpcError>>, } impl SubscriptionStream { /// Crates a new `SubscriptionStream`. pub fn new(recv: mpsc::Receiver<Result<Value, RpcError>>) -> Self { SubscriptionStream { recv } } } impl Stream for SubscriptionStream { type Item = Value; type Error = RpcError; fn poll(&mut self) -> Result<Async<Option<Self::Item>>, Self::Error> { match self.recv.poll() { Ok(Async::Ready(Some(Ok(value)))) => Ok(Async::Ready(Some(value))), Ok(Async::Ready(Some(Err(error)))) => Err(error), Ok(Async::Ready(None)) => Ok(Async::Ready(None)), Ok(Async::NotReady) => Ok(Async::NotReady), Err(()) => Err(RpcError::Other(format_err!("mpsc channel returned an error."))), } } } /// A typed subscription stream. pub struct TypedSubscriptionStream<T> { _marker: PhantomData<T>, returns: &'static str, stream: SubscriptionStream, } impl<T> TypedSubscriptionStream<T> { /// Creates a new `TypedSubscriptionStream`. pub fn new(stream: SubscriptionStream, returns: &'static str) -> Self { TypedSubscriptionStream { _marker: PhantomData, returns, stream, } } } impl<T: DeserializeOwned +'static> Stream for TypedSubscriptionStream<T> { type Item = T; type Error = RpcError; fn poll(&mut self) -> Result<Async<Option<Self::Item>>, Self::Error> { let result = match self.stream.poll()? { Async::Ready(Some(value)) => serde_json::from_value::<T>(value) .map(|result| Async::Ready(Some(result))) .map_err(|error| RpcError::ParseError(self.returns.into(), error.into()))?, Async::Ready(None) => Async::Ready(None), Async::NotReady => Async::NotReady, }; Ok(result) } } /// Client for raw JSON RPC requests #[derive(Clone)] pub struct RawClient(RpcChannel); impl From<RpcChannel> for RawClient { fn from(channel: RpcChannel) -> Self { RawClient(channel) } } impl RawClient { /// Call RPC method with raw JSON. pub fn call_method(&self, method: &str, params: Params) -> impl Future<Item = Value, Error = RpcError> { let (sender, receiver) = oneshot::channel(); let msg = CallMessage { method: method.into(), params, sender, }; self.0 .send(msg.into()) .map_err(|error| RpcError::Other(error.into())) .and_then(|_| RpcFuture::new(receiver)) } /// Send RPC notification with raw JSON. pub fn notify(&self, method: &str, params: Params) -> impl Future<Item = (), Error = RpcError> { let msg = NotifyMessage { method: method.into(), params, }; self.0 .send(msg.into()) .map(|_| ()) .map_err(|error| RpcError::Other(error.into())) } /// Subscribe to topic with raw JSON. pub fn subscribe( &self, subscribe: &str, subscribe_params: Params, notification: &str, unsubscribe: &str, ) -> impl Future<Item = SubscriptionStream, Error = RpcError> { let (sender, receiver) = mpsc::channel(0); let msg = SubscribeMessage { subscription: Subscription { subscribe: subscribe.into(), subscribe_params, notification: notification.into(), unsubscribe: unsubscribe.into(), }, sender, }; self.0 .send(msg.into()) .map_err(|error| RpcError::Other(error.into())) .map(|_| SubscriptionStream::new(receiver)) } } /// Client for typed JSON RPC requests #[derive(Clone)] pub struct TypedClient(RawClient); impl From<RpcChannel> for TypedClient { fn from(channel: RpcChannel) -> Self { TypedClient(channel.into()) } } impl TypedClient { /// Create a new `TypedClient`. pub fn new(raw_cli: RawClient) -> Self { TypedClient(raw_cli) } /// Call RPC with serialization of request and deserialization of response. pub fn call_method<T: Serialize, R: DeserializeOwned +'static>( &self, method: &str, returns: &'static str, args: T, ) -> impl Future<Item = R, Error = RpcError> { let args = serde_json::to_value(args).expect("Only types with infallible serialisation can be used for JSON-RPC"); let params = match args { Value::Array(vec) => Params::Array(vec), Value::Null => Params::None, Value::Object(map) => Params::Map(map), _ => { return future::Either::A(future::err(RpcError::Other(format_err!( "RPC params should serialize to a JSON array, JSON object or null" )))) } }; future::Either::B(self.0.call_method(method, params).and_then(move |value: Value| { log::debug!("response: {:?}", value); let result = serde_json::from_value::<R>(value).map_err(|error| RpcError::ParseError(returns.into(), error.into())); future::done(result) })) } /// Call RPC with serialization of request only. pub fn notify<T: Serialize>(&self, method: &str, args: T) -> impl Future<Item = (), Error = RpcError> { let args = serde_json::to_value(args).expect("Only types with infallible serialisation can be used for JSON-RPC"); let params = match args { Value::Array(vec) => Params::Array(vec), Value::Null => Params::None, _ => { return future::Either::A(future::err(RpcError::Other(format_err!( "RPC params should serialize to a JSON array, or null" )))) } }; future::Either::B(self.0.notify(method, params)) } /// Subscribe with serialization of request and deserialization of response. pub fn subscribe<T: Serialize, R: DeserializeOwned +'static>( &self, subscribe: &str, subscribe_params: T, topic: &str, unsubscribe: &str, returns: &'static str, ) -> impl Future<Item = TypedSubscriptionStream<R>, Error = RpcError> { let args = serde_json::to_value(subscribe_params) .expect("Only types with infallible serialisation can be used for JSON-RPC"); let params = match args { Value::Array(vec) => Params::Array(vec), Value::Null => Params::None, _ => { return future::Either::A(future::err(RpcError::Other(format_err!( "RPC params should serialize to a JSON array, or null" )))) } }; let typed_stream = self .0 .subscribe(subscribe, params, topic, unsubscribe) .map(move |stream| TypedSubscriptionStream::new(stream, returns)); future::Either::B(typed_stream) } } #[cfg(test)] mod tests { use super::*; use crate::transports::local;
#[derive(Clone)] struct AddClient(TypedClient); impl From<RpcChannel> for AddClient { fn from(channel: RpcChannel) -> Self { AddClient(channel.into()) } } impl AddClient { fn add(&self, a: u64, b: u64) -> impl Future<Item = u64, Error = RpcError> { self.0.call_method("add", "u64", (a, b)) } fn completed(&self, success: bool) -> impl Future<Item = (), Error = RpcError> { self.0.notify("completed", (success,)) } } #[test] fn test_client_terminates() { crate::logger::init_log(); let mut handler = IoHandler::new(); handler.add_method("add", |params: Params| { let (a, b) = params.parse::<(u64, u64)>()?; let res = a + b; Ok(jsonrpc_core::to_value(res).unwrap()) }); let (client, rpc_client) = local::connect::<AddClient, _, _>(handler); let fut = client .clone() .add(3, 4) .and_then(move |res| client.add(res, 5)) .join(rpc_client) .map(|(res, ())| { assert_eq!(res, 12); }) .map_err(|err| { eprintln!("{:?}", err); assert!(false); }); tokio::run(fut); } #[test] fn should_send_notification() { crate::logger::init_log(); let mut handler = IoHandler::new(); handler.add_notification("completed", |params: Params| { let (success,) = params.parse::<(bool,)>().expect("expected to receive one boolean"); assert_eq!(success, true); }); let (client, rpc_client) = local::connect::<AddClient, _, _>(handler); let fut = client .clone() .completed(true) .map(move |()| drop(client)) .join(rpc_client) .map(|_| ()) .map_err(|err| { eprintln!("{:?}", err); assert!(false); }); tokio::run(fut); } #[test] fn should_handle_subscription() { crate::logger::init_log(); // given let mut handler = PubSubHandler::<local::LocalMeta, _>::default(); let called = Arc::new(AtomicBool::new(false)); let called2 = called.clone(); handler.add_subscription( "hello", ("subscribe_hello", |params, _meta, subscriber: Subscriber| { assert_eq!(params, core::Params::None); let sink = subscriber .assign_id(SubscriptionId::Number(5)) .expect("assigned subscription id"); std::thread::spawn(move || { for i in 0..3 { std::thread::sleep(std::time::Duration::from_millis(100)); let value = serde_json::json!({ "subscription": 5, "result": vec![i], }); sink.notify(serde_json::from_value(value).unwrap()) .wait() .expect("sent notification"); } }); }), ("unsubscribe_hello", move |id, _meta| { // Should be called because session is dropped. called2.store(true, Ordering::SeqCst); assert_eq!(id, SubscriptionId::Number(5)); future::ok(core::Value::Bool(true)) }), ); // when let (client, rpc_client) = local::connect_with_pubsub::<TypedClient, _>(handler); let received = Arc::new(std::sync::Mutex::new(vec![])); let r2 = received.clone(); let fut = client .subscribe::<_, (u32,)>("subscribe_hello", (), "hello", "unsubscribe_hello", "u32") .and_then(|stream| { stream .into_future() .map(move |(result, _)| { drop(client); r2.lock().unwrap().push(result.unwrap()); }) .map_err(|_| { panic!("Expected message not received."); }) }) .join(rpc_client) .map(|(res, _)| { log::info!("ok {:?}", res); }) .map_err(|err| { log::error!("err {:?}", err); }); tokio::run(fut); assert_eq!(called.load(Ordering::SeqCst), true); assert!( !received.lock().unwrap().is_empty(), "Expected at least one received item." ); } }
use crate::{RpcChannel, RpcError, TypedClient}; use jsonrpc_core::{self as core, IoHandler}; use jsonrpc_pubsub::{PubSubHandler, Subscriber, SubscriptionId}; use std::sync::atomic::{AtomicBool, Ordering}; use std::sync::Arc;
random_line_split
lib.rs
//! JSON-RPC client implementation. #![deny(missing_docs)] use failure::{format_err, Fail}; use futures::sync::{mpsc, oneshot}; use futures::{future, prelude::*}; use jsonrpc_core::{Error, Params}; use serde::de::DeserializeOwned; use serde::Serialize; use serde_json::Value; use std::marker::PhantomData; pub mod transports; #[cfg(test)] mod logger; /// The errors returned by the client. #[derive(Debug, Fail)] pub enum RpcError { /// An error returned by the server. #[fail(display = "Server returned rpc error {}", _0)] JsonRpcError(Error), /// Failure to parse server response. #[fail(display = "Failed to parse server response as {}: {}", _0, _1)] ParseError(String, failure::Error), /// Request timed out. #[fail(display = "Request timed out")] Timeout, /// Not rpc specific errors. #[fail(display = "{}", _0)] Other(failure::Error), } impl From<Error> for RpcError { fn from(error: Error) -> Self { RpcError::JsonRpcError(error) } } /// An RPC call message. struct CallMessage { /// The RPC method name. method: String, /// The RPC method parameters. params: Params, /// The oneshot channel to send the result of the rpc /// call to. sender: oneshot::Sender<Result<Value, RpcError>>, } /// An RPC notification. struct NotifyMessage { /// The RPC method name. method: String, /// The RPC method paramters. params: Params, } /// An RPC subscription. struct Subscription { /// The subscribe method name. subscribe: String, /// The subscribe method parameters. subscribe_params: Params, /// The name of the notification. notification: String, /// The unsubscribe method name. unsubscribe: String, } /// An RPC subscribe message. struct SubscribeMessage { /// The subscription to subscribe to. subscription: Subscription, /// The channel to send notifications to. sender: mpsc::Sender<Result<Value, RpcError>>, } /// A message sent to the `RpcClient`. enum RpcMessage { /// Make an RPC call. Call(CallMessage), /// Send a notification. Notify(NotifyMessage), /// Subscribe to a notification. Subscribe(SubscribeMessage), } impl From<CallMessage> for RpcMessage { fn from(msg: CallMessage) -> Self { RpcMessage::Call(msg) } } impl From<NotifyMessage> for RpcMessage { fn from(msg: NotifyMessage) -> Self { RpcMessage::Notify(msg) } } impl From<SubscribeMessage> for RpcMessage { fn from(msg: SubscribeMessage) -> Self { RpcMessage::Subscribe(msg) } } /// A channel to a `RpcClient`. #[derive(Clone)] pub struct RpcChannel(mpsc::Sender<RpcMessage>); impl RpcChannel { fn send( &self, msg: RpcMessage, ) -> impl Future<Item = mpsc::Sender<RpcMessage>, Error = mpsc::SendError<RpcMessage>> { self.0.to_owned().send(msg) } } impl From<mpsc::Sender<RpcMessage>> for RpcChannel { fn from(sender: mpsc::Sender<RpcMessage>) -> Self { RpcChannel(sender) } } /// The future returned by the rpc call. pub struct RpcFuture { recv: oneshot::Receiver<Result<Value, RpcError>>, } impl RpcFuture { /// Creates a new `RpcFuture`. pub fn new(recv: oneshot::Receiver<Result<Value, RpcError>>) -> Self { RpcFuture { recv } } } impl Future for RpcFuture { type Item = Value; type Error = RpcError; fn poll(&mut self) -> Result<Async<Self::Item>, Self::Error> { // TODO should timeout (#410) match self.recv.poll() { Ok(Async::Ready(Ok(value))) => Ok(Async::Ready(value)), Ok(Async::Ready(Err(error))) => Err(error), Ok(Async::NotReady) => Ok(Async::NotReady), Err(error) => Err(RpcError::Other(error.into())), } } } /// The stream returned by a subscribe. pub struct SubscriptionStream { recv: mpsc::Receiver<Result<Value, RpcError>>, } impl SubscriptionStream { /// Crates a new `SubscriptionStream`. pub fn new(recv: mpsc::Receiver<Result<Value, RpcError>>) -> Self { SubscriptionStream { recv } } } impl Stream for SubscriptionStream { type Item = Value; type Error = RpcError; fn poll(&mut self) -> Result<Async<Option<Self::Item>>, Self::Error> { match self.recv.poll() { Ok(Async::Ready(Some(Ok(value)))) => Ok(Async::Ready(Some(value))), Ok(Async::Ready(Some(Err(error)))) => Err(error), Ok(Async::Ready(None)) => Ok(Async::Ready(None)), Ok(Async::NotReady) => Ok(Async::NotReady), Err(()) => Err(RpcError::Other(format_err!("mpsc channel returned an error."))), } } } /// A typed subscription stream. pub struct TypedSubscriptionStream<T> { _marker: PhantomData<T>, returns: &'static str, stream: SubscriptionStream, } impl<T> TypedSubscriptionStream<T> { /// Creates a new `TypedSubscriptionStream`. pub fn new(stream: SubscriptionStream, returns: &'static str) -> Self { TypedSubscriptionStream { _marker: PhantomData, returns, stream, } } } impl<T: DeserializeOwned +'static> Stream for TypedSubscriptionStream<T> { type Item = T; type Error = RpcError; fn poll(&mut self) -> Result<Async<Option<Self::Item>>, Self::Error> { let result = match self.stream.poll()? { Async::Ready(Some(value)) => serde_json::from_value::<T>(value) .map(|result| Async::Ready(Some(result))) .map_err(|error| RpcError::ParseError(self.returns.into(), error.into()))?, Async::Ready(None) => Async::Ready(None), Async::NotReady => Async::NotReady, }; Ok(result) } } /// Client for raw JSON RPC requests #[derive(Clone)] pub struct RawClient(RpcChannel); impl From<RpcChannel> for RawClient { fn from(channel: RpcChannel) -> Self { RawClient(channel) } } impl RawClient { /// Call RPC method with raw JSON. pub fn call_method(&self, method: &str, params: Params) -> impl Future<Item = Value, Error = RpcError> { let (sender, receiver) = oneshot::channel(); let msg = CallMessage { method: method.into(), params, sender, }; self.0 .send(msg.into()) .map_err(|error| RpcError::Other(error.into())) .and_then(|_| RpcFuture::new(receiver)) } /// Send RPC notification with raw JSON. pub fn notify(&self, method: &str, params: Params) -> impl Future<Item = (), Error = RpcError> { let msg = NotifyMessage { method: method.into(), params, }; self.0 .send(msg.into()) .map(|_| ()) .map_err(|error| RpcError::Other(error.into())) } /// Subscribe to topic with raw JSON. pub fn subscribe( &self, subscribe: &str, subscribe_params: Params, notification: &str, unsubscribe: &str, ) -> impl Future<Item = SubscriptionStream, Error = RpcError> { let (sender, receiver) = mpsc::channel(0); let msg = SubscribeMessage { subscription: Subscription { subscribe: subscribe.into(), subscribe_params, notification: notification.into(), unsubscribe: unsubscribe.into(), }, sender, }; self.0 .send(msg.into()) .map_err(|error| RpcError::Other(error.into())) .map(|_| SubscriptionStream::new(receiver)) } } /// Client for typed JSON RPC requests #[derive(Clone)] pub struct TypedClient(RawClient); impl From<RpcChannel> for TypedClient { fn from(channel: RpcChannel) -> Self { TypedClient(channel.into()) } } impl TypedClient { /// Create a new `TypedClient`. pub fn new(raw_cli: RawClient) -> Self { TypedClient(raw_cli) } /// Call RPC with serialization of request and deserialization of response. pub fn call_method<T: Serialize, R: DeserializeOwned +'static>( &self, method: &str, returns: &'static str, args: T, ) -> impl Future<Item = R, Error = RpcError> { let args = serde_json::to_value(args).expect("Only types with infallible serialisation can be used for JSON-RPC"); let params = match args { Value::Array(vec) => Params::Array(vec), Value::Null => Params::None, Value::Object(map) => Params::Map(map), _ => { return future::Either::A(future::err(RpcError::Other(format_err!( "RPC params should serialize to a JSON array, JSON object or null" )))) } }; future::Either::B(self.0.call_method(method, params).and_then(move |value: Value| { log::debug!("response: {:?}", value); let result = serde_json::from_value::<R>(value).map_err(|error| RpcError::ParseError(returns.into(), error.into())); future::done(result) })) } /// Call RPC with serialization of request only. pub fn notify<T: Serialize>(&self, method: &str, args: T) -> impl Future<Item = (), Error = RpcError> { let args = serde_json::to_value(args).expect("Only types with infallible serialisation can be used for JSON-RPC"); let params = match args { Value::Array(vec) => Params::Array(vec), Value::Null => Params::None, _ => { return future::Either::A(future::err(RpcError::Other(format_err!( "RPC params should serialize to a JSON array, or null" )))) } }; future::Either::B(self.0.notify(method, params)) } /// Subscribe with serialization of request and deserialization of response. pub fn subscribe<T: Serialize, R: DeserializeOwned +'static>( &self, subscribe: &str, subscribe_params: T, topic: &str, unsubscribe: &str, returns: &'static str, ) -> impl Future<Item = TypedSubscriptionStream<R>, Error = RpcError>
} #[cfg(test)] mod tests { use super::*; use crate::transports::local; use crate::{RpcChannel, RpcError, TypedClient}; use jsonrpc_core::{self as core, IoHandler}; use jsonrpc_pubsub::{PubSubHandler, Subscriber, SubscriptionId}; use std::sync::atomic::{AtomicBool, Ordering}; use std::sync::Arc; #[derive(Clone)] struct AddClient(TypedClient); impl From<RpcChannel> for AddClient { fn from(channel: RpcChannel) -> Self { AddClient(channel.into()) } } impl AddClient { fn add(&self, a: u64, b: u64) -> impl Future<Item = u64, Error = RpcError> { self.0.call_method("add", "u64", (a, b)) } fn completed(&self, success: bool) -> impl Future<Item = (), Error = RpcError> { self.0.notify("completed", (success,)) } } #[test] fn test_client_terminates() { crate::logger::init_log(); let mut handler = IoHandler::new(); handler.add_method("add", |params: Params| { let (a, b) = params.parse::<(u64, u64)>()?; let res = a + b; Ok(jsonrpc_core::to_value(res).unwrap()) }); let (client, rpc_client) = local::connect::<AddClient, _, _>(handler); let fut = client .clone() .add(3, 4) .and_then(move |res| client.add(res, 5)) .join(rpc_client) .map(|(res, ())| { assert_eq!(res, 12); }) .map_err(|err| { eprintln!("{:?}", err); assert!(false); }); tokio::run(fut); } #[test] fn should_send_notification() { crate::logger::init_log(); let mut handler = IoHandler::new(); handler.add_notification("completed", |params: Params| { let (success,) = params.parse::<(bool,)>().expect("expected to receive one boolean"); assert_eq!(success, true); }); let (client, rpc_client) = local::connect::<AddClient, _, _>(handler); let fut = client .clone() .completed(true) .map(move |()| drop(client)) .join(rpc_client) .map(|_| ()) .map_err(|err| { eprintln!("{:?}", err); assert!(false); }); tokio::run(fut); } #[test] fn should_handle_subscription() { crate::logger::init_log(); // given let mut handler = PubSubHandler::<local::LocalMeta, _>::default(); let called = Arc::new(AtomicBool::new(false)); let called2 = called.clone(); handler.add_subscription( "hello", ("subscribe_hello", |params, _meta, subscriber: Subscriber| { assert_eq!(params, core::Params::None); let sink = subscriber .assign_id(SubscriptionId::Number(5)) .expect("assigned subscription id"); std::thread::spawn(move || { for i in 0..3 { std::thread::sleep(std::time::Duration::from_millis(100)); let value = serde_json::json!({ "subscription": 5, "result": vec![i], }); sink.notify(serde_json::from_value(value).unwrap()) .wait() .expect("sent notification"); } }); }), ("unsubscribe_hello", move |id, _meta| { // Should be called because session is dropped. called2.store(true, Ordering::SeqCst); assert_eq!(id, SubscriptionId::Number(5)); future::ok(core::Value::Bool(true)) }), ); // when let (client, rpc_client) = local::connect_with_pubsub::<TypedClient, _>(handler); let received = Arc::new(std::sync::Mutex::new(vec![])); let r2 = received.clone(); let fut = client .subscribe::<_, (u32,)>("subscribe_hello", (), "hello", "unsubscribe_hello", "u32") .and_then(|stream| { stream .into_future() .map(move |(result, _)| { drop(client); r2.lock().unwrap().push(result.unwrap()); }) .map_err(|_| { panic!("Expected message not received."); }) }) .join(rpc_client) .map(|(res, _)| { log::info!("ok {:?}", res); }) .map_err(|err| { log::error!("err {:?}", err); }); tokio::run(fut); assert_eq!(called.load(Ordering::SeqCst), true); assert!( !received.lock().unwrap().is_empty(), "Expected at least one received item." ); } }
{ let args = serde_json::to_value(subscribe_params) .expect("Only types with infallible serialisation can be used for JSON-RPC"); let params = match args { Value::Array(vec) => Params::Array(vec), Value::Null => Params::None, _ => { return future::Either::A(future::err(RpcError::Other(format_err!( "RPC params should serialize to a JSON array, or null" )))) } }; let typed_stream = self .0 .subscribe(subscribe, params, topic, unsubscribe) .map(move |stream| TypedSubscriptionStream::new(stream, returns)); future::Either::B(typed_stream) }
identifier_body
lib.rs
//! JSON-RPC client implementation. #![deny(missing_docs)] use failure::{format_err, Fail}; use futures::sync::{mpsc, oneshot}; use futures::{future, prelude::*}; use jsonrpc_core::{Error, Params}; use serde::de::DeserializeOwned; use serde::Serialize; use serde_json::Value; use std::marker::PhantomData; pub mod transports; #[cfg(test)] mod logger; /// The errors returned by the client. #[derive(Debug, Fail)] pub enum RpcError { /// An error returned by the server. #[fail(display = "Server returned rpc error {}", _0)] JsonRpcError(Error), /// Failure to parse server response. #[fail(display = "Failed to parse server response as {}: {}", _0, _1)] ParseError(String, failure::Error), /// Request timed out. #[fail(display = "Request timed out")] Timeout, /// Not rpc specific errors. #[fail(display = "{}", _0)] Other(failure::Error), } impl From<Error> for RpcError { fn from(error: Error) -> Self { RpcError::JsonRpcError(error) } } /// An RPC call message. struct CallMessage { /// The RPC method name. method: String, /// The RPC method parameters. params: Params, /// The oneshot channel to send the result of the rpc /// call to. sender: oneshot::Sender<Result<Value, RpcError>>, } /// An RPC notification. struct NotifyMessage { /// The RPC method name. method: String, /// The RPC method paramters. params: Params, } /// An RPC subscription. struct Subscription { /// The subscribe method name. subscribe: String, /// The subscribe method parameters. subscribe_params: Params, /// The name of the notification. notification: String, /// The unsubscribe method name. unsubscribe: String, } /// An RPC subscribe message. struct SubscribeMessage { /// The subscription to subscribe to. subscription: Subscription, /// The channel to send notifications to. sender: mpsc::Sender<Result<Value, RpcError>>, } /// A message sent to the `RpcClient`. enum RpcMessage { /// Make an RPC call. Call(CallMessage), /// Send a notification. Notify(NotifyMessage), /// Subscribe to a notification. Subscribe(SubscribeMessage), } impl From<CallMessage> for RpcMessage { fn from(msg: CallMessage) -> Self { RpcMessage::Call(msg) } } impl From<NotifyMessage> for RpcMessage { fn from(msg: NotifyMessage) -> Self { RpcMessage::Notify(msg) } } impl From<SubscribeMessage> for RpcMessage { fn from(msg: SubscribeMessage) -> Self { RpcMessage::Subscribe(msg) } } /// A channel to a `RpcClient`. #[derive(Clone)] pub struct RpcChannel(mpsc::Sender<RpcMessage>); impl RpcChannel { fn send( &self, msg: RpcMessage, ) -> impl Future<Item = mpsc::Sender<RpcMessage>, Error = mpsc::SendError<RpcMessage>> { self.0.to_owned().send(msg) } } impl From<mpsc::Sender<RpcMessage>> for RpcChannel { fn from(sender: mpsc::Sender<RpcMessage>) -> Self { RpcChannel(sender) } } /// The future returned by the rpc call. pub struct RpcFuture { recv: oneshot::Receiver<Result<Value, RpcError>>, } impl RpcFuture { /// Creates a new `RpcFuture`. pub fn new(recv: oneshot::Receiver<Result<Value, RpcError>>) -> Self { RpcFuture { recv } } } impl Future for RpcFuture { type Item = Value; type Error = RpcError; fn poll(&mut self) -> Result<Async<Self::Item>, Self::Error> { // TODO should timeout (#410) match self.recv.poll() { Ok(Async::Ready(Ok(value))) => Ok(Async::Ready(value)), Ok(Async::Ready(Err(error))) => Err(error), Ok(Async::NotReady) => Ok(Async::NotReady), Err(error) => Err(RpcError::Other(error.into())), } } } /// The stream returned by a subscribe. pub struct SubscriptionStream { recv: mpsc::Receiver<Result<Value, RpcError>>, } impl SubscriptionStream { /// Crates a new `SubscriptionStream`. pub fn new(recv: mpsc::Receiver<Result<Value, RpcError>>) -> Self { SubscriptionStream { recv } } } impl Stream for SubscriptionStream { type Item = Value; type Error = RpcError; fn poll(&mut self) -> Result<Async<Option<Self::Item>>, Self::Error> { match self.recv.poll() { Ok(Async::Ready(Some(Ok(value)))) => Ok(Async::Ready(Some(value))), Ok(Async::Ready(Some(Err(error)))) => Err(error), Ok(Async::Ready(None)) => Ok(Async::Ready(None)), Ok(Async::NotReady) => Ok(Async::NotReady), Err(()) => Err(RpcError::Other(format_err!("mpsc channel returned an error."))), } } } /// A typed subscription stream. pub struct TypedSubscriptionStream<T> { _marker: PhantomData<T>, returns: &'static str, stream: SubscriptionStream, } impl<T> TypedSubscriptionStream<T> { /// Creates a new `TypedSubscriptionStream`. pub fn new(stream: SubscriptionStream, returns: &'static str) -> Self { TypedSubscriptionStream { _marker: PhantomData, returns, stream, } } } impl<T: DeserializeOwned +'static> Stream for TypedSubscriptionStream<T> { type Item = T; type Error = RpcError; fn poll(&mut self) -> Result<Async<Option<Self::Item>>, Self::Error> { let result = match self.stream.poll()? { Async::Ready(Some(value)) => serde_json::from_value::<T>(value) .map(|result| Async::Ready(Some(result))) .map_err(|error| RpcError::ParseError(self.returns.into(), error.into()))?, Async::Ready(None) => Async::Ready(None), Async::NotReady => Async::NotReady, }; Ok(result) } } /// Client for raw JSON RPC requests #[derive(Clone)] pub struct RawClient(RpcChannel); impl From<RpcChannel> for RawClient { fn from(channel: RpcChannel) -> Self { RawClient(channel) } } impl RawClient { /// Call RPC method with raw JSON. pub fn call_method(&self, method: &str, params: Params) -> impl Future<Item = Value, Error = RpcError> { let (sender, receiver) = oneshot::channel(); let msg = CallMessage { method: method.into(), params, sender, }; self.0 .send(msg.into()) .map_err(|error| RpcError::Other(error.into())) .and_then(|_| RpcFuture::new(receiver)) } /// Send RPC notification with raw JSON. pub fn notify(&self, method: &str, params: Params) -> impl Future<Item = (), Error = RpcError> { let msg = NotifyMessage { method: method.into(), params, }; self.0 .send(msg.into()) .map(|_| ()) .map_err(|error| RpcError::Other(error.into())) } /// Subscribe to topic with raw JSON. pub fn subscribe( &self, subscribe: &str, subscribe_params: Params, notification: &str, unsubscribe: &str, ) -> impl Future<Item = SubscriptionStream, Error = RpcError> { let (sender, receiver) = mpsc::channel(0); let msg = SubscribeMessage { subscription: Subscription { subscribe: subscribe.into(), subscribe_params, notification: notification.into(), unsubscribe: unsubscribe.into(), }, sender, }; self.0 .send(msg.into()) .map_err(|error| RpcError::Other(error.into())) .map(|_| SubscriptionStream::new(receiver)) } } /// Client for typed JSON RPC requests #[derive(Clone)] pub struct TypedClient(RawClient); impl From<RpcChannel> for TypedClient { fn from(channel: RpcChannel) -> Self { TypedClient(channel.into()) } } impl TypedClient { /// Create a new `TypedClient`. pub fn new(raw_cli: RawClient) -> Self { TypedClient(raw_cli) } /// Call RPC with serialization of request and deserialization of response. pub fn call_method<T: Serialize, R: DeserializeOwned +'static>( &self, method: &str, returns: &'static str, args: T, ) -> impl Future<Item = R, Error = RpcError> { let args = serde_json::to_value(args).expect("Only types with infallible serialisation can be used for JSON-RPC"); let params = match args { Value::Array(vec) => Params::Array(vec), Value::Null => Params::None, Value::Object(map) => Params::Map(map), _ => { return future::Either::A(future::err(RpcError::Other(format_err!( "RPC params should serialize to a JSON array, JSON object or null" )))) } }; future::Either::B(self.0.call_method(method, params).and_then(move |value: Value| { log::debug!("response: {:?}", value); let result = serde_json::from_value::<R>(value).map_err(|error| RpcError::ParseError(returns.into(), error.into())); future::done(result) })) } /// Call RPC with serialization of request only. pub fn notify<T: Serialize>(&self, method: &str, args: T) -> impl Future<Item = (), Error = RpcError> { let args = serde_json::to_value(args).expect("Only types with infallible serialisation can be used for JSON-RPC"); let params = match args { Value::Array(vec) => Params::Array(vec), Value::Null => Params::None, _ => { return future::Either::A(future::err(RpcError::Other(format_err!( "RPC params should serialize to a JSON array, or null" )))) } }; future::Either::B(self.0.notify(method, params)) } /// Subscribe with serialization of request and deserialization of response. pub fn
<T: Serialize, R: DeserializeOwned +'static>( &self, subscribe: &str, subscribe_params: T, topic: &str, unsubscribe: &str, returns: &'static str, ) -> impl Future<Item = TypedSubscriptionStream<R>, Error = RpcError> { let args = serde_json::to_value(subscribe_params) .expect("Only types with infallible serialisation can be used for JSON-RPC"); let params = match args { Value::Array(vec) => Params::Array(vec), Value::Null => Params::None, _ => { return future::Either::A(future::err(RpcError::Other(format_err!( "RPC params should serialize to a JSON array, or null" )))) } }; let typed_stream = self .0 .subscribe(subscribe, params, topic, unsubscribe) .map(move |stream| TypedSubscriptionStream::new(stream, returns)); future::Either::B(typed_stream) } } #[cfg(test)] mod tests { use super::*; use crate::transports::local; use crate::{RpcChannel, RpcError, TypedClient}; use jsonrpc_core::{self as core, IoHandler}; use jsonrpc_pubsub::{PubSubHandler, Subscriber, SubscriptionId}; use std::sync::atomic::{AtomicBool, Ordering}; use std::sync::Arc; #[derive(Clone)] struct AddClient(TypedClient); impl From<RpcChannel> for AddClient { fn from(channel: RpcChannel) -> Self { AddClient(channel.into()) } } impl AddClient { fn add(&self, a: u64, b: u64) -> impl Future<Item = u64, Error = RpcError> { self.0.call_method("add", "u64", (a, b)) } fn completed(&self, success: bool) -> impl Future<Item = (), Error = RpcError> { self.0.notify("completed", (success,)) } } #[test] fn test_client_terminates() { crate::logger::init_log(); let mut handler = IoHandler::new(); handler.add_method("add", |params: Params| { let (a, b) = params.parse::<(u64, u64)>()?; let res = a + b; Ok(jsonrpc_core::to_value(res).unwrap()) }); let (client, rpc_client) = local::connect::<AddClient, _, _>(handler); let fut = client .clone() .add(3, 4) .and_then(move |res| client.add(res, 5)) .join(rpc_client) .map(|(res, ())| { assert_eq!(res, 12); }) .map_err(|err| { eprintln!("{:?}", err); assert!(false); }); tokio::run(fut); } #[test] fn should_send_notification() { crate::logger::init_log(); let mut handler = IoHandler::new(); handler.add_notification("completed", |params: Params| { let (success,) = params.parse::<(bool,)>().expect("expected to receive one boolean"); assert_eq!(success, true); }); let (client, rpc_client) = local::connect::<AddClient, _, _>(handler); let fut = client .clone() .completed(true) .map(move |()| drop(client)) .join(rpc_client) .map(|_| ()) .map_err(|err| { eprintln!("{:?}", err); assert!(false); }); tokio::run(fut); } #[test] fn should_handle_subscription() { crate::logger::init_log(); // given let mut handler = PubSubHandler::<local::LocalMeta, _>::default(); let called = Arc::new(AtomicBool::new(false)); let called2 = called.clone(); handler.add_subscription( "hello", ("subscribe_hello", |params, _meta, subscriber: Subscriber| { assert_eq!(params, core::Params::None); let sink = subscriber .assign_id(SubscriptionId::Number(5)) .expect("assigned subscription id"); std::thread::spawn(move || { for i in 0..3 { std::thread::sleep(std::time::Duration::from_millis(100)); let value = serde_json::json!({ "subscription": 5, "result": vec![i], }); sink.notify(serde_json::from_value(value).unwrap()) .wait() .expect("sent notification"); } }); }), ("unsubscribe_hello", move |id, _meta| { // Should be called because session is dropped. called2.store(true, Ordering::SeqCst); assert_eq!(id, SubscriptionId::Number(5)); future::ok(core::Value::Bool(true)) }), ); // when let (client, rpc_client) = local::connect_with_pubsub::<TypedClient, _>(handler); let received = Arc::new(std::sync::Mutex::new(vec![])); let r2 = received.clone(); let fut = client .subscribe::<_, (u32,)>("subscribe_hello", (), "hello", "unsubscribe_hello", "u32") .and_then(|stream| { stream .into_future() .map(move |(result, _)| { drop(client); r2.lock().unwrap().push(result.unwrap()); }) .map_err(|_| { panic!("Expected message not received."); }) }) .join(rpc_client) .map(|(res, _)| { log::info!("ok {:?}", res); }) .map_err(|err| { log::error!("err {:?}", err); }); tokio::run(fut); assert_eq!(called.load(Ordering::SeqCst), true); assert!( !received.lock().unwrap().is_empty(), "Expected at least one received item." ); } }
subscribe
identifier_name
mod.rs
}, } } } impl GLContextTrait for GLContext { fn get_attributes(&self) -> GLContextAttributes { todo!() } // This does not correctly handle unsetting a window. fn set_window( &mut self, window: Option<&impl raw_window_handle::HasRawWindowHandle>, ) -> Result<(), SetWindowError> { use raw_window_handle::*; unsafe { let window_handle = window .map(|w| match w.raw_window_handle() { RawWindowHandle::Windows(handle) => handle.hwnd as HWND, _ => unreachable!(), }) .unwrap(); let window_device_context = if let Some(_window) = window { if let Some(current_device_context) = self.device_context { ReleaseDC(window_handle, current_device_context); } let device_context = GetDC(window_handle); self.device_context = Some(device_context); device_context } else { std::ptr::null_mut() as HDC }; let pixel_format_descriptor: PIXELFORMATDESCRIPTOR = std::mem::zeroed(); // This will error if the window was previously set with an incompatible // pixel format. if SetPixelFormat( window_device_context, self.pixel_format_id, &pixel_format_descriptor, ) == 0 { return Err(SetWindowError::MismatchedPixelFormat); } error_if_false(wglMakeCurrent(window_device_context, self.context_ptr)).unwrap(); // self.set_vsync(self.vsync).unwrap(); // Everytime a device context is requested, vsync must be updated. self.current_window = if let Some(_window) = window { Some(window_handle) } else { None }; self.set_vsync(self.vsync).unwrap(); } Ok(()) } // Is this behavior correct? Does it really work if called from another thread? fn make_current(&mut self) -> Result<(), std::io::Error>
fn swap_buffers(&mut self) { if let Some(device_context) = self.device_context { unsafe { SwapBuffers(device_context); } } } fn resize(&mut self) {} // wglSwapIntervalEXT sets VSync for the window bound to the current context. // However here we treat Vsync as a setting on the GLContext, // so whenever a window is bound we update the GL Context. fn set_vsync(&mut self, vsync: VSync) -> Result<(), Error> { if self.current_window.is_some() { // This call to swap_buffers seems to prevent an issue on Macbooks // where the setting wouldn't take effect. // I suspect wglSwapIntervalEXT doesn't get set if a lock of some // sort is held on back/front buffers, so rendering here ensures that's unlikely // to happen. self.swap_buffers(); if match vsync { VSync::Off => wglSwapIntervalEXT(0), VSync::On => wglSwapIntervalEXT(1), VSync::Adaptive => wglSwapIntervalEXT(-1), VSync::Other(i) => wglSwapIntervalEXT(i), } == false { Err(Error::last_os_error()) } else { self.vsync = vsync; Ok(()) } } else { Ok(()) // Nothing happens, should an error be returned? } } fn get_vsync(&self) -> VSync { match wglGetSwapIntervalEXT() { 0 => VSync::Off, 1 => VSync::On, -1 => VSync::Adaptive, i => VSync::Other(i), } } fn get_proc_address(&self, address: &str) -> *const core::ffi::c_void { get_proc_address_inner(self.opengl_module, address) } } fn get_proc_address_inner(opengl_module: HMODULE, address: &str) -> *const core::ffi::c_void { unsafe { let name = std::ffi::CString::new(address).unwrap(); let mut result = wglGetProcAddress(name.as_ptr() as *const i8) as *const std::ffi::c_void; if result.is_null() { // Functions that were part of OpenGL1 need to be loaded differently. result = GetProcAddress(opengl_module, name.as_ptr() as *const i8) as *const std::ffi::c_void; } /* if result.is_null() { println!("FAILED TO LOAD: {}", address); } else { println!("Loaded: {} {:?}", address, result); } */ result } } impl Drop for GLContext { fn drop(&mut self) { unsafe { if wglDeleteContext(self.context_ptr) == 0 { panic!("Failed to delete OpenGL Context"); } if let Some(hdc) = self.device_context { if ReleaseDC(self.current_window.unwrap(), hdc) == 0 { panic!("Failed to release device context"); } } } } } impl GLContextBuilder { pub fn build(&self) -> Result<GLContext, ()> { Ok(new_opengl_context( self.gl_attributes.color_bits, self.gl_attributes.alpha_bits, self.gl_attributes.depth_bits, self.gl_attributes.stencil_bits, self.gl_attributes.msaa_samples, self.gl_attributes.major_version, self.gl_attributes.minor_version, self.gl_attributes.srgb, ) .unwrap()) } } /// Creates an OpenGL context. /// h_instance is the parent module's h_instance /// class_name is the parent class's name /// panic_if_fail will crash the program with a useful callstack if something goes wrong /// color bits and alpha bits should add up to 32 pub fn new_opengl_context( color_bits: u8, alpha_bits: u8, depth_bits: u8, stencil_bits: u8, msaa_samples: u8, major_version: u8, minor_version: u8, srgb: bool, ) -> Result<GLContext, Error> { // This function performs the following steps: // * First register the window class. // * Then create a dummy_window with that class... // * Which is used to setup a dummy OpenGL context... // * Which is used to load OpenGL extensions... // * Which are used to set more specific pixel formats and specify an OpenGL version... // * Which is used to create another dummy window... // * Which is used to create the final OpenGL context! unsafe { // Register the window class. let window_class_name = win32_string("kapp_gl_window"); let h_instance = GetModuleHandleW(null_mut()); let window_class = WNDCLASSW { style: 0, lpfnWndProc: Some(kapp_gl_window_callback), cbClsExtra: 0, cbWndExtra: 0, hInstance: h_instance, hIcon: null_mut(), hCursor: null_mut(), // This may not be what is desired. Potentially this makes it annoying to change the cursor later. hbrBackground: null_mut(), lpszMenuName: null_mut(), lpszClassName: window_class_name.as_ptr(), }; RegisterClassW(&window_class); // Then create a dummy window let h_instance = GetModuleHandleW(null_mut()); let dummy_window = create_dummy_window(h_instance, &window_class_name); error_if_null(dummy_window)?; // DC stands for 'device context' // Definition of a device context: // https://docs.microsoft.com/en-us/windows/win32/gdi/device-contexts let dummy_window_dc = GetDC(dummy_window); error_if_null(dummy_window_dc)?; // Create a dummy PIXELFORMATDESCRIPTOR (PFD). // This PFD is based on the recommendations from here: // https://www.khronos.org/opengl/wiki/Creating_an_OpenGL_Context_(WGL)#Create_a_False_Context let mut dummy_pfd: PIXELFORMATDESCRIPTOR = std::mem::zeroed(); dummy_pfd.nSize = size_of::<PIXELFORMATDESCRIPTOR>() as u16; dummy_pfd.nVersion = 1; dummy_pfd.dwFlags = PFD_DRAW_TO_WINDOW | PFD_SUPPORT_OPENGL | PFD_DOUBLEBUFFER; dummy_pfd.iPixelType = PFD_TYPE_RGBA as u8; dummy_pfd.cColorBits = 32; dummy_pfd.cAlphaBits = 8; dummy_pfd.cDepthBits = 24; let dummy_pixel_format_id = ChoosePixelFormat(dummy_window_dc, &dummy_pfd); error_if_false(dummy_pixel_format_id)?; error_if_false(SetPixelFormat( dummy_window_dc, dummy_pixel_format_id, &dummy_pfd, ))?; // Create the dummy OpenGL context. let dummy_opengl_context = wglCreateContext(dummy_window_dc); error_if_null(dummy_opengl_context)?; error_if_false(wglMakeCurrent(dummy_window_dc, dummy_opengl_context))?; // Load the function to choose a pixel format. wglChoosePixelFormatARB_ptr = wgl_get_proc_address("wglChoosePixelFormatARB")?; // Load the function to create an OpenGL context with extra attributes. wglCreateContextAttribsARB_ptr = wgl_get_proc_address("wglCreateContextAttribsARB")?; // Create the second dummy window. let dummy_window2 = create_dummy_window(h_instance, &window_class_name); error_if_null(dummy_window2)?; // DC is 'device context' let dummy_window_dc2 = GetDC(dummy_window2); error_if_null(dummy_window_dc2)?; // Setup the actual pixel format we'll use. // Later this is where we'll specify pixel format parameters. // Documentation about these flags here: // https://www.khronos.org/registry/OpenGL/extensions/ARB/WGL_ARB_pixel_format.txt let pixel_attributes = vec![ WGL_DRAW_TO_WINDOW_ARB, TRUE as i32, WGL_SUPPORT_OPENGL_ARB, TRUE as i32, WGL_DOUBLE_BUFFER_ARB, TRUE as i32, WGL_PIXEL_TYPE_ARB, WGL_TYPE_RGBA_ARB, WGL_ACCELERATION_ARB, WGL_FULL_ACCELERATION_ARB, WGL_COLOR_BITS_ARB, color_bits as i32, WGL_ALPHA_BITS_ARB, alpha_bits as i32, WGL_DEPTH_BITS_ARB, depth_bits as i32, WGL_STENCIL_BITS_ARB, stencil_bits as i32, WGL_SAMPLE_BUFFERS_ARB, 1, WGL_SAMPLES_ARB, msaa_samples as i32, WGL_FRAMEBUFFER_SRGB_CAPABLE_ARB, if srgb { TRUE as i32 } else { FALSE as i32 }, 0, ]; let mut pixel_format_id = 0; let mut number_of_formats = 0; error_if_false(wglChoosePixelFormatARB( dummy_window_dc2, pixel_attributes.as_ptr(), null_mut(), 1, &mut pixel_format_id, &mut number_of_formats, ))?; error_if_false(number_of_formats as i32)?; // error_if_false just errors if the argument is 0, which is what we need here // PFD stands for 'pixel format descriptor' // It's unclear why this call to DescribePixelFormat is needed? // DescribePixelFormat fills the pfd with a description of the pixel format. // But why does this window need the same pixel format as the previous one? // Just it just need a valid pixel format? let mut pfd: PIXELFORMATDESCRIPTOR = std::mem::zeroed(); DescribePixelFormat( dummy_window_dc2, pixel_format_id, size_of::<PIXELFORMATDESCRIPTOR>() as u32, &mut pfd, ); SetPixelFormat(dummy_window_dc2, pixel_format_id, &pfd); // Finally we can create the OpenGL context! // Need to allow for choosing major and minor version. let major_version_minimum = major_version as i32; let minor_version_minimum = minor_version as i32; let context_attributes = [ WGL_CONTEXT_MAJOR_VERSION_ARB, major_version_minimum, WGL_CONTEXT_MINOR_VERSION_ARB, minor_version_minimum, WGL_CONTEXT_PROFILE_MASK_ARB, WGL_CONTEXT_CORE_PROFILE_BIT_ARB, 0, ]; let opengl_context = wglCreateContextAttribsARB( dummy_window_dc2, 0 as HGLRC, // An existing OpenGL context to share resources with. 0 means none. context_attributes.as_ptr(), ); error_if_null(opengl_context)?; // Clean up all of our resources // It's bad that these calls only occur if all the prior steps were succesful. // If a program were to recover from a failure to setup an OpenGL context these resources would be leaked. wglMakeCurrent(dummy_window_dc, null_mut()); wglDeleteContext(dummy_opengl_context); ReleaseDC(dummy_window, dummy_window_dc); DestroyWindow(dummy_window); error_if_false(wglMakeCurrent(dummy_window_dc2, opengl_context))?; let opengl_module = LoadLibraryA("opengl32.dll\0".as_ptr() as *const i8); // Load swap interval for Vsync let function_pointer = wglGetProcAddress("wglSwapIntervalEXT\0".as_ptr() as *const i8); if function_pointer.is_null() { println!("Could not find wglSwapIntervalEXT"); return Err(Error::last_os_error()); } else { wglSwapIntervalEXT_ptr = function_pointer as *const std::ffi::c_void; } let function_pointer = wglGetProcAddress("wglGetSwapIntervalEXT\0".as_ptr() as *const i8); if function_pointer.is_null() { println!("Could not find wglGetSwapIntervalEXT"); return Err(Error::last_os_error()); } else { wglGetSwapIntervalEXT_ptr = function_pointer as *const std::ffi::c_void; } // Default to Vsync enabled if!wglSwapIntervalEXT(1) { return Err(Error::last_os_error()); } // Will the dummy window be rendererd to if no other window is made current? ReleaseDC(dummy_window2, dummy_window_dc2); DestroyWindow(dummy_window2); // Disconnects from current window // Uncommenting this line can cause intermittment crashes // It's unclear why, as this should just disconnect the dummy window context // However leaving this commented should be harmless. // Actually, it just improves the situation, but doesn't prevent it. //wglMakeCurrent(dummy_window_dc2, null_mut()); Ok(GLContext { context_ptr: opengl_context, pixel_format_id, _pixel_format_descriptor: pfd, opengl_module, current_window: None, vsync: VSync::On, device_context: None, }) } } fn create_dummy_window(h_instance: HINSTANCE, class_name: &Vec<u16>) -> HWND { let title = win32_string("kapp Placeholder"); unsafe { // https://docs.microsoft.com/en-us/windows/win32/api/winuser/nf-winuser-createwindowexw CreateWindowExW( 0, // extended style Is this ok? class_name.as_ptr(), // A class created by RegisterClass title.as_ptr(), // window title WS_CLIPSIBLINGS | WS_CLIPCHILDREN, // style 0, // x position 0, // y position 1, // width 1, // height null_mut(), // parent window null_mut(), // menu h_instance, // Module handle null_mut(), // Data sent to window ) } } pub unsafe extern "system" fn kapp_gl_window_callback( hwnd: HWND, u_msg: UINT, w_param: WPARAM, l_param: LPARAM, ) -> LRESULT { // DefWindowProcW is the default Window event handler. DefWindowProcW(hwnd, u_msg, w_param, l_param) } fn wgl_get_proc_address(name: &str) -> Result<*const c_void, Error> { let name = std::ffi::CString::new(name).unwrap(); let result = unsafe { wglGetProcAddress(name.as_ptr() as *const i8) as *const c_void }; error_if_null(result)?; Ok(result) } // These definitions are based on the wglext.h header available here: // https://www.khronos.org/registry/OpenGL/api/GL/wglext.h #[allow(non_snake_case, non_upper_case_globals)] static mut wglChoosePixelFormatARB_ptr: *const c_void = std::ptr::null(); #[allow(non_snake_case, non_upper_case_globals)] fn wglChoosePixelFormatARB( hdc: HDC, piAttribIList: *const c_int, pfAttribFList: *const c_float, nMaxFormats: c_uint, piFormats: *mut c_int, nNumFormats: *mut c_uint, ) -> c_int { unsafe { std::mem::transmute::< _, extern "system" fn( HDC, *const c_int, *const c_float, c_uint, *mut c_int, *mut c_uint, ) -> c_int, >(wglChoosePixelFormatARB_ptr)( hdc, piAttribIList, pfAttribFList, nMaxFormats, piFormats, nNumFormats, ) } } #[allow(non_snake_case, non_upper_case_globals)] static mut wglCreateContextAttribsARB_ptr: *
{ unsafe { let window_device_context = self.device_context.unwrap_or(std::ptr::null_mut()); error_if_false(wglMakeCurrent(window_device_context, self.context_ptr)) } }
identifier_body
mod.rs
}, } } } impl GLContextTrait for GLContext { fn get_attributes(&self) -> GLContextAttributes { todo!() } // This does not correctly handle unsetting a window. fn set_window( &mut self, window: Option<&impl raw_window_handle::HasRawWindowHandle>, ) -> Result<(), SetWindowError> { use raw_window_handle::*; unsafe { let window_handle = window .map(|w| match w.raw_window_handle() { RawWindowHandle::Windows(handle) => handle.hwnd as HWND, _ => unreachable!(), }) .unwrap(); let window_device_context = if let Some(_window) = window { if let Some(current_device_context) = self.device_context { ReleaseDC(window_handle, current_device_context); } let device_context = GetDC(window_handle); self.device_context = Some(device_context); device_context } else { std::ptr::null_mut() as HDC }; let pixel_format_descriptor: PIXELFORMATDESCRIPTOR = std::mem::zeroed(); // This will error if the window was previously set with an incompatible // pixel format. if SetPixelFormat( window_device_context, self.pixel_format_id, &pixel_format_descriptor, ) == 0 { return Err(SetWindowError::MismatchedPixelFormat); } error_if_false(wglMakeCurrent(window_device_context, self.context_ptr)).unwrap(); // self.set_vsync(self.vsync).unwrap(); // Everytime a device context is requested, vsync must be updated. self.current_window = if let Some(_window) = window { Some(window_handle) } else { None }; self.set_vsync(self.vsync).unwrap(); } Ok(()) } // Is this behavior correct? Does it really work if called from another thread? fn make_current(&mut self) -> Result<(), std::io::Error> { unsafe { let window_device_context = self.device_context.unwrap_or(std::ptr::null_mut()); error_if_false(wglMakeCurrent(window_device_context, self.context_ptr)) } } fn swap_buffers(&mut self) { if let Some(device_context) = self.device_context { unsafe { SwapBuffers(device_context); } } } fn resize(&mut self) {} // wglSwapIntervalEXT sets VSync for the window bound to the current context. // However here we treat Vsync as a setting on the GLContext, // so whenever a window is bound we update the GL Context. fn set_vsync(&mut self, vsync: VSync) -> Result<(), Error> { if self.current_window.is_some() { // This call to swap_buffers seems to prevent an issue on Macbooks // where the setting wouldn't take effect. // I suspect wglSwapIntervalEXT doesn't get set if a lock of some // sort is held on back/front buffers, so rendering here ensures that's unlikely // to happen. self.swap_buffers(); if match vsync { VSync::Off => wglSwapIntervalEXT(0), VSync::On => wglSwapIntervalEXT(1), VSync::Adaptive => wglSwapIntervalEXT(-1), VSync::Other(i) => wglSwapIntervalEXT(i), } == false { Err(Error::last_os_error()) } else { self.vsync = vsync; Ok(()) } } else { Ok(()) // Nothing happens, should an error be returned? } } fn get_vsync(&self) -> VSync { match wglGetSwapIntervalEXT() { 0 => VSync::Off, 1 => VSync::On, -1 => VSync::Adaptive, i => VSync::Other(i), } } fn get_proc_address(&self, address: &str) -> *const core::ffi::c_void { get_proc_address_inner(self.opengl_module, address) } } fn get_proc_address_inner(opengl_module: HMODULE, address: &str) -> *const core::ffi::c_void { unsafe { let name = std::ffi::CString::new(address).unwrap(); let mut result = wglGetProcAddress(name.as_ptr() as *const i8) as *const std::ffi::c_void; if result.is_null() { // Functions that were part of OpenGL1 need to be loaded differently. result = GetProcAddress(opengl_module, name.as_ptr() as *const i8) as *const std::ffi::c_void; } /* if result.is_null() { println!("FAILED TO LOAD: {}", address); } else { println!("Loaded: {} {:?}", address, result); } */ result } } impl Drop for GLContext { fn drop(&mut self) { unsafe { if wglDeleteContext(self.context_ptr) == 0 { panic!("Failed to delete OpenGL Context"); } if let Some(hdc) = self.device_context { if ReleaseDC(self.current_window.unwrap(), hdc) == 0
} } } } impl GLContextBuilder { pub fn build(&self) -> Result<GLContext, ()> { Ok(new_opengl_context( self.gl_attributes.color_bits, self.gl_attributes.alpha_bits, self.gl_attributes.depth_bits, self.gl_attributes.stencil_bits, self.gl_attributes.msaa_samples, self.gl_attributes.major_version, self.gl_attributes.minor_version, self.gl_attributes.srgb, ) .unwrap()) } } /// Creates an OpenGL context. /// h_instance is the parent module's h_instance /// class_name is the parent class's name /// panic_if_fail will crash the program with a useful callstack if something goes wrong /// color bits and alpha bits should add up to 32 pub fn new_opengl_context( color_bits: u8, alpha_bits: u8, depth_bits: u8, stencil_bits: u8, msaa_samples: u8, major_version: u8, minor_version: u8, srgb: bool, ) -> Result<GLContext, Error> { // This function performs the following steps: // * First register the window class. // * Then create a dummy_window with that class... // * Which is used to setup a dummy OpenGL context... // * Which is used to load OpenGL extensions... // * Which are used to set more specific pixel formats and specify an OpenGL version... // * Which is used to create another dummy window... // * Which is used to create the final OpenGL context! unsafe { // Register the window class. let window_class_name = win32_string("kapp_gl_window"); let h_instance = GetModuleHandleW(null_mut()); let window_class = WNDCLASSW { style: 0, lpfnWndProc: Some(kapp_gl_window_callback), cbClsExtra: 0, cbWndExtra: 0, hInstance: h_instance, hIcon: null_mut(), hCursor: null_mut(), // This may not be what is desired. Potentially this makes it annoying to change the cursor later. hbrBackground: null_mut(), lpszMenuName: null_mut(), lpszClassName: window_class_name.as_ptr(), }; RegisterClassW(&window_class); // Then create a dummy window let h_instance = GetModuleHandleW(null_mut()); let dummy_window = create_dummy_window(h_instance, &window_class_name); error_if_null(dummy_window)?; // DC stands for 'device context' // Definition of a device context: // https://docs.microsoft.com/en-us/windows/win32/gdi/device-contexts let dummy_window_dc = GetDC(dummy_window); error_if_null(dummy_window_dc)?; // Create a dummy PIXELFORMATDESCRIPTOR (PFD). // This PFD is based on the recommendations from here: // https://www.khronos.org/opengl/wiki/Creating_an_OpenGL_Context_(WGL)#Create_a_False_Context let mut dummy_pfd: PIXELFORMATDESCRIPTOR = std::mem::zeroed(); dummy_pfd.nSize = size_of::<PIXELFORMATDESCRIPTOR>() as u16; dummy_pfd.nVersion = 1; dummy_pfd.dwFlags = PFD_DRAW_TO_WINDOW | PFD_SUPPORT_OPENGL | PFD_DOUBLEBUFFER; dummy_pfd.iPixelType = PFD_TYPE_RGBA as u8; dummy_pfd.cColorBits = 32; dummy_pfd.cAlphaBits = 8; dummy_pfd.cDepthBits = 24; let dummy_pixel_format_id = ChoosePixelFormat(dummy_window_dc, &dummy_pfd); error_if_false(dummy_pixel_format_id)?; error_if_false(SetPixelFormat( dummy_window_dc, dummy_pixel_format_id, &dummy_pfd, ))?; // Create the dummy OpenGL context. let dummy_opengl_context = wglCreateContext(dummy_window_dc); error_if_null(dummy_opengl_context)?; error_if_false(wglMakeCurrent(dummy_window_dc, dummy_opengl_context))?; // Load the function to choose a pixel format. wglChoosePixelFormatARB_ptr = wgl_get_proc_address("wglChoosePixelFormatARB")?; // Load the function to create an OpenGL context with extra attributes. wglCreateContextAttribsARB_ptr = wgl_get_proc_address("wglCreateContextAttribsARB")?; // Create the second dummy window. let dummy_window2 = create_dummy_window(h_instance, &window_class_name); error_if_null(dummy_window2)?; // DC is 'device context' let dummy_window_dc2 = GetDC(dummy_window2); error_if_null(dummy_window_dc2)?; // Setup the actual pixel format we'll use. // Later this is where we'll specify pixel format parameters. // Documentation about these flags here: // https://www.khronos.org/registry/OpenGL/extensions/ARB/WGL_ARB_pixel_format.txt let pixel_attributes = vec![ WGL_DRAW_TO_WINDOW_ARB, TRUE as i32, WGL_SUPPORT_OPENGL_ARB, TRUE as i32, WGL_DOUBLE_BUFFER_ARB, TRUE as i32, WGL_PIXEL_TYPE_ARB, WGL_TYPE_RGBA_ARB, WGL_ACCELERATION_ARB, WGL_FULL_ACCELERATION_ARB, WGL_COLOR_BITS_ARB, color_bits as i32, WGL_ALPHA_BITS_ARB, alpha_bits as i32, WGL_DEPTH_BITS_ARB, depth_bits as i32, WGL_STENCIL_BITS_ARB, stencil_bits as i32, WGL_SAMPLE_BUFFERS_ARB, 1, WGL_SAMPLES_ARB, msaa_samples as i32, WGL_FRAMEBUFFER_SRGB_CAPABLE_ARB, if srgb { TRUE as i32 } else { FALSE as i32 }, 0, ]; let mut pixel_format_id = 0; let mut number_of_formats = 0; error_if_false(wglChoosePixelFormatARB( dummy_window_dc2, pixel_attributes.as_ptr(), null_mut(), 1, &mut pixel_format_id, &mut number_of_formats, ))?; error_if_false(number_of_formats as i32)?; // error_if_false just errors if the argument is 0, which is what we need here // PFD stands for 'pixel format descriptor' // It's unclear why this call to DescribePixelFormat is needed? // DescribePixelFormat fills the pfd with a description of the pixel format. // But why does this window need the same pixel format as the previous one? // Just it just need a valid pixel format? let mut pfd: PIXELFORMATDESCRIPTOR = std::mem::zeroed(); DescribePixelFormat( dummy_window_dc2, pixel_format_id, size_of::<PIXELFORMATDESCRIPTOR>() as u32, &mut pfd, ); SetPixelFormat(dummy_window_dc2, pixel_format_id, &pfd); // Finally we can create the OpenGL context! // Need to allow for choosing major and minor version. let major_version_minimum = major_version as i32; let minor_version_minimum = minor_version as i32; let context_attributes = [ WGL_CONTEXT_MAJOR_VERSION_ARB, major_version_minimum, WGL_CONTEXT_MINOR_VERSION_ARB, minor_version_minimum, WGL_CONTEXT_PROFILE_MASK_ARB, WGL_CONTEXT_CORE_PROFILE_BIT_ARB, 0, ]; let opengl_context = wglCreateContextAttribsARB( dummy_window_dc2, 0 as HGLRC, // An existing OpenGL context to share resources with. 0 means none. context_attributes.as_ptr(), ); error_if_null(opengl_context)?; // Clean up all of our resources // It's bad that these calls only occur if all the prior steps were succesful. // If a program were to recover from a failure to setup an OpenGL context these resources would be leaked. wglMakeCurrent(dummy_window_dc, null_mut()); wglDeleteContext(dummy_opengl_context); ReleaseDC(dummy_window, dummy_window_dc); DestroyWindow(dummy_window); error_if_false(wglMakeCurrent(dummy_window_dc2, opengl_context))?; let opengl_module = LoadLibraryA("opengl32.dll\0".as_ptr() as *const i8); // Load swap interval for Vsync let function_pointer = wglGetProcAddress("wglSwapIntervalEXT\0".as_ptr() as *const i8); if function_pointer.is_null() { println!("Could not find wglSwapIntervalEXT"); return Err(Error::last_os_error()); } else { wglSwapIntervalEXT_ptr = function_pointer as *const std::ffi::c_void; } let function_pointer = wglGetProcAddress("wglGetSwapIntervalEXT\0".as_ptr() as *const i8); if function_pointer.is_null() { println!("Could not find wglGetSwapIntervalEXT"); return Err(Error::last_os_error()); } else { wglGetSwapIntervalEXT_ptr = function_pointer as *const std::ffi::c_void; } // Default to Vsync enabled if!wglSwapIntervalEXT(1) { return Err(Error::last_os_error()); } // Will the dummy window be rendererd to if no other window is made current? ReleaseDC(dummy_window2, dummy_window_dc2); DestroyWindow(dummy_window2); // Disconnects from current window // Uncommenting this line can cause intermittment crashes // It's unclear why, as this should just disconnect the dummy window context // However leaving this commented should be harmless. // Actually, it just improves the situation, but doesn't prevent it. //wglMakeCurrent(dummy_window_dc2, null_mut()); Ok(GLContext { context_ptr: opengl_context, pixel_format_id, _pixel_format_descriptor: pfd, opengl_module, current_window: None, vsync: VSync::On, device_context: None, }) } } fn create_dummy_window(h_instance: HINSTANCE, class_name: &Vec<u16>) -> HWND { let title = win32_string("kapp Placeholder"); unsafe { // https://docs.microsoft.com/en-us/windows/win32/api/winuser/nf-winuser-createwindowexw CreateWindowExW( 0, // extended style Is this ok? class_name.as_ptr(), // A class created by RegisterClass title.as_ptr(), // window title WS_CLIPSIBLINGS | WS_CLIPCHILDREN, // style 0, // x position 0, // y position 1, // width 1, // height null_mut(), // parent window null_mut(), // menu h_instance, // Module handle null_mut(), // Data sent to window ) } } pub unsafe extern "system" fn kapp_gl_window_callback( hwnd: HWND, u_msg: UINT, w_param: WPARAM, l_param: LPARAM, ) -> LRESULT { // DefWindowProcW is the default Window event handler. DefWindowProcW(hwnd, u_msg, w_param, l_param) } fn wgl_get_proc_address(name: &str) -> Result<*const c_void, Error> { let name = std::ffi::CString::new(name).unwrap(); let result = unsafe { wglGetProcAddress(name.as_ptr() as *const i8) as *const c_void }; error_if_null(result)?; Ok(result) } // These definitions are based on the wglext.h header available here: // https://www.khronos.org/registry/OpenGL/api/GL/wglext.h #[allow(non_snake_case, non_upper_case_globals)] static mut wglChoosePixelFormatARB_ptr: *const c_void = std::ptr::null(); #[allow(non_snake_case, non_upper_case_globals)] fn wglChoosePixelFormatARB( hdc: HDC, piAttribIList: *const c_int, pfAttribFList: *const c_float, nMaxFormats: c_uint, piFormats: *mut c_int, nNumFormats: *mut c_uint, ) -> c_int { unsafe { std::mem::transmute::< _, extern "system" fn( HDC, *const c_int, *const c_float, c_uint, *mut c_int, *mut c_uint, ) -> c_int, >(wglChoosePixelFormatARB_ptr)( hdc, piAttribIList, pfAttribFList, nMaxFormats, piFormats, nNumFormats, ) } } #[allow(non_snake_case, non_upper_case_globals)] static mut wglCreateContextAttribsARB_ptr: *
{ panic!("Failed to release device context"); }
conditional_block
mod.rs
}, } } } impl GLContextTrait for GLContext { fn get_attributes(&self) -> GLContextAttributes { todo!() } // This does not correctly handle unsetting a window. fn set_window( &mut self, window: Option<&impl raw_window_handle::HasRawWindowHandle>, ) -> Result<(), SetWindowError> { use raw_window_handle::*; unsafe { let window_handle = window .map(|w| match w.raw_window_handle() { RawWindowHandle::Windows(handle) => handle.hwnd as HWND, _ => unreachable!(), }) .unwrap(); let window_device_context = if let Some(_window) = window { if let Some(current_device_context) = self.device_context { ReleaseDC(window_handle, current_device_context); } let device_context = GetDC(window_handle); self.device_context = Some(device_context); device_context } else { std::ptr::null_mut() as HDC }; let pixel_format_descriptor: PIXELFORMATDESCRIPTOR = std::mem::zeroed(); // This will error if the window was previously set with an incompatible // pixel format. if SetPixelFormat( window_device_context, self.pixel_format_id, &pixel_format_descriptor, ) == 0 { return Err(SetWindowError::MismatchedPixelFormat); } error_if_false(wglMakeCurrent(window_device_context, self.context_ptr)).unwrap(); // self.set_vsync(self.vsync).unwrap(); // Everytime a device context is requested, vsync must be updated. self.current_window = if let Some(_window) = window { Some(window_handle) } else { None }; self.set_vsync(self.vsync).unwrap(); } Ok(()) } // Is this behavior correct? Does it really work if called from another thread? fn make_current(&mut self) -> Result<(), std::io::Error> { unsafe { let window_device_context = self.device_context.unwrap_or(std::ptr::null_mut()); error_if_false(wglMakeCurrent(window_device_context, self.context_ptr)) } } fn swap_buffers(&mut self) { if let Some(device_context) = self.device_context { unsafe { SwapBuffers(device_context); } } } fn resize(&mut self) {} // wglSwapIntervalEXT sets VSync for the window bound to the current context. // However here we treat Vsync as a setting on the GLContext, // so whenever a window is bound we update the GL Context. fn set_vsync(&mut self, vsync: VSync) -> Result<(), Error> { if self.current_window.is_some() { // This call to swap_buffers seems to prevent an issue on Macbooks // where the setting wouldn't take effect. // I suspect wglSwapIntervalEXT doesn't get set if a lock of some // sort is held on back/front buffers, so rendering here ensures that's unlikely // to happen. self.swap_buffers(); if match vsync { VSync::Off => wglSwapIntervalEXT(0), VSync::On => wglSwapIntervalEXT(1), VSync::Adaptive => wglSwapIntervalEXT(-1), VSync::Other(i) => wglSwapIntervalEXT(i), } == false { Err(Error::last_os_error()) } else { self.vsync = vsync; Ok(()) } } else { Ok(()) // Nothing happens, should an error be returned? } } fn get_vsync(&self) -> VSync { match wglGetSwapIntervalEXT() { 0 => VSync::Off, 1 => VSync::On, -1 => VSync::Adaptive, i => VSync::Other(i), } } fn
(&self, address: &str) -> *const core::ffi::c_void { get_proc_address_inner(self.opengl_module, address) } } fn get_proc_address_inner(opengl_module: HMODULE, address: &str) -> *const core::ffi::c_void { unsafe { let name = std::ffi::CString::new(address).unwrap(); let mut result = wglGetProcAddress(name.as_ptr() as *const i8) as *const std::ffi::c_void; if result.is_null() { // Functions that were part of OpenGL1 need to be loaded differently. result = GetProcAddress(opengl_module, name.as_ptr() as *const i8) as *const std::ffi::c_void; } /* if result.is_null() { println!("FAILED TO LOAD: {}", address); } else { println!("Loaded: {} {:?}", address, result); } */ result } } impl Drop for GLContext { fn drop(&mut self) { unsafe { if wglDeleteContext(self.context_ptr) == 0 { panic!("Failed to delete OpenGL Context"); } if let Some(hdc) = self.device_context { if ReleaseDC(self.current_window.unwrap(), hdc) == 0 { panic!("Failed to release device context"); } } } } } impl GLContextBuilder { pub fn build(&self) -> Result<GLContext, ()> { Ok(new_opengl_context( self.gl_attributes.color_bits, self.gl_attributes.alpha_bits, self.gl_attributes.depth_bits, self.gl_attributes.stencil_bits, self.gl_attributes.msaa_samples, self.gl_attributes.major_version, self.gl_attributes.minor_version, self.gl_attributes.srgb, ) .unwrap()) } } /// Creates an OpenGL context. /// h_instance is the parent module's h_instance /// class_name is the parent class's name /// panic_if_fail will crash the program with a useful callstack if something goes wrong /// color bits and alpha bits should add up to 32 pub fn new_opengl_context( color_bits: u8, alpha_bits: u8, depth_bits: u8, stencil_bits: u8, msaa_samples: u8, major_version: u8, minor_version: u8, srgb: bool, ) -> Result<GLContext, Error> { // This function performs the following steps: // * First register the window class. // * Then create a dummy_window with that class... // * Which is used to setup a dummy OpenGL context... // * Which is used to load OpenGL extensions... // * Which are used to set more specific pixel formats and specify an OpenGL version... // * Which is used to create another dummy window... // * Which is used to create the final OpenGL context! unsafe { // Register the window class. let window_class_name = win32_string("kapp_gl_window"); let h_instance = GetModuleHandleW(null_mut()); let window_class = WNDCLASSW { style: 0, lpfnWndProc: Some(kapp_gl_window_callback), cbClsExtra: 0, cbWndExtra: 0, hInstance: h_instance, hIcon: null_mut(), hCursor: null_mut(), // This may not be what is desired. Potentially this makes it annoying to change the cursor later. hbrBackground: null_mut(), lpszMenuName: null_mut(), lpszClassName: window_class_name.as_ptr(), }; RegisterClassW(&window_class); // Then create a dummy window let h_instance = GetModuleHandleW(null_mut()); let dummy_window = create_dummy_window(h_instance, &window_class_name); error_if_null(dummy_window)?; // DC stands for 'device context' // Definition of a device context: // https://docs.microsoft.com/en-us/windows/win32/gdi/device-contexts let dummy_window_dc = GetDC(dummy_window); error_if_null(dummy_window_dc)?; // Create a dummy PIXELFORMATDESCRIPTOR (PFD). // This PFD is based on the recommendations from here: // https://www.khronos.org/opengl/wiki/Creating_an_OpenGL_Context_(WGL)#Create_a_False_Context let mut dummy_pfd: PIXELFORMATDESCRIPTOR = std::mem::zeroed(); dummy_pfd.nSize = size_of::<PIXELFORMATDESCRIPTOR>() as u16; dummy_pfd.nVersion = 1; dummy_pfd.dwFlags = PFD_DRAW_TO_WINDOW | PFD_SUPPORT_OPENGL | PFD_DOUBLEBUFFER; dummy_pfd.iPixelType = PFD_TYPE_RGBA as u8; dummy_pfd.cColorBits = 32; dummy_pfd.cAlphaBits = 8; dummy_pfd.cDepthBits = 24; let dummy_pixel_format_id = ChoosePixelFormat(dummy_window_dc, &dummy_pfd); error_if_false(dummy_pixel_format_id)?; error_if_false(SetPixelFormat( dummy_window_dc, dummy_pixel_format_id, &dummy_pfd, ))?; // Create the dummy OpenGL context. let dummy_opengl_context = wglCreateContext(dummy_window_dc); error_if_null(dummy_opengl_context)?; error_if_false(wglMakeCurrent(dummy_window_dc, dummy_opengl_context))?; // Load the function to choose a pixel format. wglChoosePixelFormatARB_ptr = wgl_get_proc_address("wglChoosePixelFormatARB")?; // Load the function to create an OpenGL context with extra attributes. wglCreateContextAttribsARB_ptr = wgl_get_proc_address("wglCreateContextAttribsARB")?; // Create the second dummy window. let dummy_window2 = create_dummy_window(h_instance, &window_class_name); error_if_null(dummy_window2)?; // DC is 'device context' let dummy_window_dc2 = GetDC(dummy_window2); error_if_null(dummy_window_dc2)?; // Setup the actual pixel format we'll use. // Later this is where we'll specify pixel format parameters. // Documentation about these flags here: // https://www.khronos.org/registry/OpenGL/extensions/ARB/WGL_ARB_pixel_format.txt let pixel_attributes = vec![ WGL_DRAW_TO_WINDOW_ARB, TRUE as i32, WGL_SUPPORT_OPENGL_ARB, TRUE as i32, WGL_DOUBLE_BUFFER_ARB, TRUE as i32, WGL_PIXEL_TYPE_ARB, WGL_TYPE_RGBA_ARB, WGL_ACCELERATION_ARB, WGL_FULL_ACCELERATION_ARB, WGL_COLOR_BITS_ARB, color_bits as i32, WGL_ALPHA_BITS_ARB, alpha_bits as i32, WGL_DEPTH_BITS_ARB, depth_bits as i32, WGL_STENCIL_BITS_ARB, stencil_bits as i32, WGL_SAMPLE_BUFFERS_ARB, 1, WGL_SAMPLES_ARB, msaa_samples as i32, WGL_FRAMEBUFFER_SRGB_CAPABLE_ARB, if srgb { TRUE as i32 } else { FALSE as i32 }, 0, ]; let mut pixel_format_id = 0; let mut number_of_formats = 0; error_if_false(wglChoosePixelFormatARB( dummy_window_dc2, pixel_attributes.as_ptr(), null_mut(), 1, &mut pixel_format_id, &mut number_of_formats, ))?; error_if_false(number_of_formats as i32)?; // error_if_false just errors if the argument is 0, which is what we need here // PFD stands for 'pixel format descriptor' // It's unclear why this call to DescribePixelFormat is needed? // DescribePixelFormat fills the pfd with a description of the pixel format. // But why does this window need the same pixel format as the previous one? // Just it just need a valid pixel format? let mut pfd: PIXELFORMATDESCRIPTOR = std::mem::zeroed(); DescribePixelFormat( dummy_window_dc2, pixel_format_id, size_of::<PIXELFORMATDESCRIPTOR>() as u32, &mut pfd, ); SetPixelFormat(dummy_window_dc2, pixel_format_id, &pfd); // Finally we can create the OpenGL context! // Need to allow for choosing major and minor version. let major_version_minimum = major_version as i32; let minor_version_minimum = minor_version as i32; let context_attributes = [ WGL_CONTEXT_MAJOR_VERSION_ARB, major_version_minimum, WGL_CONTEXT_MINOR_VERSION_ARB, minor_version_minimum, WGL_CONTEXT_PROFILE_MASK_ARB, WGL_CONTEXT_CORE_PROFILE_BIT_ARB, 0, ]; let opengl_context = wglCreateContextAttribsARB( dummy_window_dc2, 0 as HGLRC, // An existing OpenGL context to share resources with. 0 means none. context_attributes.as_ptr(), ); error_if_null(opengl_context)?; // Clean up all of our resources // It's bad that these calls only occur if all the prior steps were succesful. // If a program were to recover from a failure to setup an OpenGL context these resources would be leaked. wglMakeCurrent(dummy_window_dc, null_mut()); wglDeleteContext(dummy_opengl_context); ReleaseDC(dummy_window, dummy_window_dc); DestroyWindow(dummy_window); error_if_false(wglMakeCurrent(dummy_window_dc2, opengl_context))?; let opengl_module = LoadLibraryA("opengl32.dll\0".as_ptr() as *const i8); // Load swap interval for Vsync let function_pointer = wglGetProcAddress("wglSwapIntervalEXT\0".as_ptr() as *const i8); if function_pointer.is_null() { println!("Could not find wglSwapIntervalEXT"); return Err(Error::last_os_error()); } else { wglSwapIntervalEXT_ptr = function_pointer as *const std::ffi::c_void; } let function_pointer = wglGetProcAddress("wglGetSwapIntervalEXT\0".as_ptr() as *const i8); if function_pointer.is_null() { println!("Could not find wglGetSwapIntervalEXT"); return Err(Error::last_os_error()); } else { wglGetSwapIntervalEXT_ptr = function_pointer as *const std::ffi::c_void; } // Default to Vsync enabled if!wglSwapIntervalEXT(1) { return Err(Error::last_os_error()); } // Will the dummy window be rendererd to if no other window is made current? ReleaseDC(dummy_window2, dummy_window_dc2); DestroyWindow(dummy_window2); // Disconnects from current window // Uncommenting this line can cause intermittment crashes // It's unclear why, as this should just disconnect the dummy window context // However leaving this commented should be harmless. // Actually, it just improves the situation, but doesn't prevent it. //wglMakeCurrent(dummy_window_dc2, null_mut()); Ok(GLContext { context_ptr: opengl_context, pixel_format_id, _pixel_format_descriptor: pfd, opengl_module, current_window: None, vsync: VSync::On, device_context: None, }) } } fn create_dummy_window(h_instance: HINSTANCE, class_name: &Vec<u16>) -> HWND { let title = win32_string("kapp Placeholder"); unsafe { // https://docs.microsoft.com/en-us/windows/win32/api/winuser/nf-winuser-createwindowexw CreateWindowExW( 0, // extended style Is this ok? class_name.as_ptr(), // A class created by RegisterClass title.as_ptr(), // window title WS_CLIPSIBLINGS | WS_CLIPCHILDREN, // style 0, // x position 0, // y position 1, // width 1, // height null_mut(), // parent window null_mut(), // menu h_instance, // Module handle null_mut(), // Data sent to window ) } } pub unsafe extern "system" fn kapp_gl_window_callback( hwnd: HWND, u_msg: UINT, w_param: WPARAM, l_param: LPARAM, ) -> LRESULT { // DefWindowProcW is the default Window event handler. DefWindowProcW(hwnd, u_msg, w_param, l_param) } fn wgl_get_proc_address(name: &str) -> Result<*const c_void, Error> { let name = std::ffi::CString::new(name).unwrap(); let result = unsafe { wglGetProcAddress(name.as_ptr() as *const i8) as *const c_void }; error_if_null(result)?; Ok(result) } // These definitions are based on the wglext.h header available here: // https://www.khronos.org/registry/OpenGL/api/GL/wglext.h #[allow(non_snake_case, non_upper_case_globals)] static mut wglChoosePixelFormatARB_ptr: *const c_void = std::ptr::null(); #[allow(non_snake_case, non_upper_case_globals)] fn wglChoosePixelFormatARB( hdc: HDC, piAttribIList: *const c_int, pfAttribFList: *const c_float, nMaxFormats: c_uint, piFormats: *mut c_int, nNumFormats: *mut c_uint, ) -> c_int { unsafe { std::mem::transmute::< _, extern "system" fn( HDC, *const c_int, *const c_float, c_uint, *mut c_int, *mut c_uint, ) -> c_int, >(wglChoosePixelFormatARB_ptr)( hdc, piAttribIList, pfAttribFList, nMaxFormats, piFormats, nNumFormats, ) } } #[allow(non_snake_case, non_upper_case_globals)] static mut wglCreateContextAttribsARB_ptr: *
get_proc_address
identifier_name
mod.rs
}, } } } impl GLContextTrait for GLContext { fn get_attributes(&self) -> GLContextAttributes { todo!() } // This does not correctly handle unsetting a window. fn set_window( &mut self, window: Option<&impl raw_window_handle::HasRawWindowHandle>, ) -> Result<(), SetWindowError> { use raw_window_handle::*; unsafe { let window_handle = window .map(|w| match w.raw_window_handle() {
_ => unreachable!(), }) .unwrap(); let window_device_context = if let Some(_window) = window { if let Some(current_device_context) = self.device_context { ReleaseDC(window_handle, current_device_context); } let device_context = GetDC(window_handle); self.device_context = Some(device_context); device_context } else { std::ptr::null_mut() as HDC }; let pixel_format_descriptor: PIXELFORMATDESCRIPTOR = std::mem::zeroed(); // This will error if the window was previously set with an incompatible // pixel format. if SetPixelFormat( window_device_context, self.pixel_format_id, &pixel_format_descriptor, ) == 0 { return Err(SetWindowError::MismatchedPixelFormat); } error_if_false(wglMakeCurrent(window_device_context, self.context_ptr)).unwrap(); // self.set_vsync(self.vsync).unwrap(); // Everytime a device context is requested, vsync must be updated. self.current_window = if let Some(_window) = window { Some(window_handle) } else { None }; self.set_vsync(self.vsync).unwrap(); } Ok(()) } // Is this behavior correct? Does it really work if called from another thread? fn make_current(&mut self) -> Result<(), std::io::Error> { unsafe { let window_device_context = self.device_context.unwrap_or(std::ptr::null_mut()); error_if_false(wglMakeCurrent(window_device_context, self.context_ptr)) } } fn swap_buffers(&mut self) { if let Some(device_context) = self.device_context { unsafe { SwapBuffers(device_context); } } } fn resize(&mut self) {} // wglSwapIntervalEXT sets VSync for the window bound to the current context. // However here we treat Vsync as a setting on the GLContext, // so whenever a window is bound we update the GL Context. fn set_vsync(&mut self, vsync: VSync) -> Result<(), Error> { if self.current_window.is_some() { // This call to swap_buffers seems to prevent an issue on Macbooks // where the setting wouldn't take effect. // I suspect wglSwapIntervalEXT doesn't get set if a lock of some // sort is held on back/front buffers, so rendering here ensures that's unlikely // to happen. self.swap_buffers(); if match vsync { VSync::Off => wglSwapIntervalEXT(0), VSync::On => wglSwapIntervalEXT(1), VSync::Adaptive => wglSwapIntervalEXT(-1), VSync::Other(i) => wglSwapIntervalEXT(i), } == false { Err(Error::last_os_error()) } else { self.vsync = vsync; Ok(()) } } else { Ok(()) // Nothing happens, should an error be returned? } } fn get_vsync(&self) -> VSync { match wglGetSwapIntervalEXT() { 0 => VSync::Off, 1 => VSync::On, -1 => VSync::Adaptive, i => VSync::Other(i), } } fn get_proc_address(&self, address: &str) -> *const core::ffi::c_void { get_proc_address_inner(self.opengl_module, address) } } fn get_proc_address_inner(opengl_module: HMODULE, address: &str) -> *const core::ffi::c_void { unsafe { let name = std::ffi::CString::new(address).unwrap(); let mut result = wglGetProcAddress(name.as_ptr() as *const i8) as *const std::ffi::c_void; if result.is_null() { // Functions that were part of OpenGL1 need to be loaded differently. result = GetProcAddress(opengl_module, name.as_ptr() as *const i8) as *const std::ffi::c_void; } /* if result.is_null() { println!("FAILED TO LOAD: {}", address); } else { println!("Loaded: {} {:?}", address, result); } */ result } } impl Drop for GLContext { fn drop(&mut self) { unsafe { if wglDeleteContext(self.context_ptr) == 0 { panic!("Failed to delete OpenGL Context"); } if let Some(hdc) = self.device_context { if ReleaseDC(self.current_window.unwrap(), hdc) == 0 { panic!("Failed to release device context"); } } } } } impl GLContextBuilder { pub fn build(&self) -> Result<GLContext, ()> { Ok(new_opengl_context( self.gl_attributes.color_bits, self.gl_attributes.alpha_bits, self.gl_attributes.depth_bits, self.gl_attributes.stencil_bits, self.gl_attributes.msaa_samples, self.gl_attributes.major_version, self.gl_attributes.minor_version, self.gl_attributes.srgb, ) .unwrap()) } } /// Creates an OpenGL context. /// h_instance is the parent module's h_instance /// class_name is the parent class's name /// panic_if_fail will crash the program with a useful callstack if something goes wrong /// color bits and alpha bits should add up to 32 pub fn new_opengl_context( color_bits: u8, alpha_bits: u8, depth_bits: u8, stencil_bits: u8, msaa_samples: u8, major_version: u8, minor_version: u8, srgb: bool, ) -> Result<GLContext, Error> { // This function performs the following steps: // * First register the window class. // * Then create a dummy_window with that class... // * Which is used to setup a dummy OpenGL context... // * Which is used to load OpenGL extensions... // * Which are used to set more specific pixel formats and specify an OpenGL version... // * Which is used to create another dummy window... // * Which is used to create the final OpenGL context! unsafe { // Register the window class. let window_class_name = win32_string("kapp_gl_window"); let h_instance = GetModuleHandleW(null_mut()); let window_class = WNDCLASSW { style: 0, lpfnWndProc: Some(kapp_gl_window_callback), cbClsExtra: 0, cbWndExtra: 0, hInstance: h_instance, hIcon: null_mut(), hCursor: null_mut(), // This may not be what is desired. Potentially this makes it annoying to change the cursor later. hbrBackground: null_mut(), lpszMenuName: null_mut(), lpszClassName: window_class_name.as_ptr(), }; RegisterClassW(&window_class); // Then create a dummy window let h_instance = GetModuleHandleW(null_mut()); let dummy_window = create_dummy_window(h_instance, &window_class_name); error_if_null(dummy_window)?; // DC stands for 'device context' // Definition of a device context: // https://docs.microsoft.com/en-us/windows/win32/gdi/device-contexts let dummy_window_dc = GetDC(dummy_window); error_if_null(dummy_window_dc)?; // Create a dummy PIXELFORMATDESCRIPTOR (PFD). // This PFD is based on the recommendations from here: // https://www.khronos.org/opengl/wiki/Creating_an_OpenGL_Context_(WGL)#Create_a_False_Context let mut dummy_pfd: PIXELFORMATDESCRIPTOR = std::mem::zeroed(); dummy_pfd.nSize = size_of::<PIXELFORMATDESCRIPTOR>() as u16; dummy_pfd.nVersion = 1; dummy_pfd.dwFlags = PFD_DRAW_TO_WINDOW | PFD_SUPPORT_OPENGL | PFD_DOUBLEBUFFER; dummy_pfd.iPixelType = PFD_TYPE_RGBA as u8; dummy_pfd.cColorBits = 32; dummy_pfd.cAlphaBits = 8; dummy_pfd.cDepthBits = 24; let dummy_pixel_format_id = ChoosePixelFormat(dummy_window_dc, &dummy_pfd); error_if_false(dummy_pixel_format_id)?; error_if_false(SetPixelFormat( dummy_window_dc, dummy_pixel_format_id, &dummy_pfd, ))?; // Create the dummy OpenGL context. let dummy_opengl_context = wglCreateContext(dummy_window_dc); error_if_null(dummy_opengl_context)?; error_if_false(wglMakeCurrent(dummy_window_dc, dummy_opengl_context))?; // Load the function to choose a pixel format. wglChoosePixelFormatARB_ptr = wgl_get_proc_address("wglChoosePixelFormatARB")?; // Load the function to create an OpenGL context with extra attributes. wglCreateContextAttribsARB_ptr = wgl_get_proc_address("wglCreateContextAttribsARB")?; // Create the second dummy window. let dummy_window2 = create_dummy_window(h_instance, &window_class_name); error_if_null(dummy_window2)?; // DC is 'device context' let dummy_window_dc2 = GetDC(dummy_window2); error_if_null(dummy_window_dc2)?; // Setup the actual pixel format we'll use. // Later this is where we'll specify pixel format parameters. // Documentation about these flags here: // https://www.khronos.org/registry/OpenGL/extensions/ARB/WGL_ARB_pixel_format.txt let pixel_attributes = vec![ WGL_DRAW_TO_WINDOW_ARB, TRUE as i32, WGL_SUPPORT_OPENGL_ARB, TRUE as i32, WGL_DOUBLE_BUFFER_ARB, TRUE as i32, WGL_PIXEL_TYPE_ARB, WGL_TYPE_RGBA_ARB, WGL_ACCELERATION_ARB, WGL_FULL_ACCELERATION_ARB, WGL_COLOR_BITS_ARB, color_bits as i32, WGL_ALPHA_BITS_ARB, alpha_bits as i32, WGL_DEPTH_BITS_ARB, depth_bits as i32, WGL_STENCIL_BITS_ARB, stencil_bits as i32, WGL_SAMPLE_BUFFERS_ARB, 1, WGL_SAMPLES_ARB, msaa_samples as i32, WGL_FRAMEBUFFER_SRGB_CAPABLE_ARB, if srgb { TRUE as i32 } else { FALSE as i32 }, 0, ]; let mut pixel_format_id = 0; let mut number_of_formats = 0; error_if_false(wglChoosePixelFormatARB( dummy_window_dc2, pixel_attributes.as_ptr(), null_mut(), 1, &mut pixel_format_id, &mut number_of_formats, ))?; error_if_false(number_of_formats as i32)?; // error_if_false just errors if the argument is 0, which is what we need here // PFD stands for 'pixel format descriptor' // It's unclear why this call to DescribePixelFormat is needed? // DescribePixelFormat fills the pfd with a description of the pixel format. // But why does this window need the same pixel format as the previous one? // Just it just need a valid pixel format? let mut pfd: PIXELFORMATDESCRIPTOR = std::mem::zeroed(); DescribePixelFormat( dummy_window_dc2, pixel_format_id, size_of::<PIXELFORMATDESCRIPTOR>() as u32, &mut pfd, ); SetPixelFormat(dummy_window_dc2, pixel_format_id, &pfd); // Finally we can create the OpenGL context! // Need to allow for choosing major and minor version. let major_version_minimum = major_version as i32; let minor_version_minimum = minor_version as i32; let context_attributes = [ WGL_CONTEXT_MAJOR_VERSION_ARB, major_version_minimum, WGL_CONTEXT_MINOR_VERSION_ARB, minor_version_minimum, WGL_CONTEXT_PROFILE_MASK_ARB, WGL_CONTEXT_CORE_PROFILE_BIT_ARB, 0, ]; let opengl_context = wglCreateContextAttribsARB( dummy_window_dc2, 0 as HGLRC, // An existing OpenGL context to share resources with. 0 means none. context_attributes.as_ptr(), ); error_if_null(opengl_context)?; // Clean up all of our resources // It's bad that these calls only occur if all the prior steps were succesful. // If a program were to recover from a failure to setup an OpenGL context these resources would be leaked. wglMakeCurrent(dummy_window_dc, null_mut()); wglDeleteContext(dummy_opengl_context); ReleaseDC(dummy_window, dummy_window_dc); DestroyWindow(dummy_window); error_if_false(wglMakeCurrent(dummy_window_dc2, opengl_context))?; let opengl_module = LoadLibraryA("opengl32.dll\0".as_ptr() as *const i8); // Load swap interval for Vsync let function_pointer = wglGetProcAddress("wglSwapIntervalEXT\0".as_ptr() as *const i8); if function_pointer.is_null() { println!("Could not find wglSwapIntervalEXT"); return Err(Error::last_os_error()); } else { wglSwapIntervalEXT_ptr = function_pointer as *const std::ffi::c_void; } let function_pointer = wglGetProcAddress("wglGetSwapIntervalEXT\0".as_ptr() as *const i8); if function_pointer.is_null() { println!("Could not find wglGetSwapIntervalEXT"); return Err(Error::last_os_error()); } else { wglGetSwapIntervalEXT_ptr = function_pointer as *const std::ffi::c_void; } // Default to Vsync enabled if!wglSwapIntervalEXT(1) { return Err(Error::last_os_error()); } // Will the dummy window be rendererd to if no other window is made current? ReleaseDC(dummy_window2, dummy_window_dc2); DestroyWindow(dummy_window2); // Disconnects from current window // Uncommenting this line can cause intermittment crashes // It's unclear why, as this should just disconnect the dummy window context // However leaving this commented should be harmless. // Actually, it just improves the situation, but doesn't prevent it. //wglMakeCurrent(dummy_window_dc2, null_mut()); Ok(GLContext { context_ptr: opengl_context, pixel_format_id, _pixel_format_descriptor: pfd, opengl_module, current_window: None, vsync: VSync::On, device_context: None, }) } } fn create_dummy_window(h_instance: HINSTANCE, class_name: &Vec<u16>) -> HWND { let title = win32_string("kapp Placeholder"); unsafe { // https://docs.microsoft.com/en-us/windows/win32/api/winuser/nf-winuser-createwindowexw CreateWindowExW( 0, // extended style Is this ok? class_name.as_ptr(), // A class created by RegisterClass title.as_ptr(), // window title WS_CLIPSIBLINGS | WS_CLIPCHILDREN, // style 0, // x position 0, // y position 1, // width 1, // height null_mut(), // parent window null_mut(), // menu h_instance, // Module handle null_mut(), // Data sent to window ) } } pub unsafe extern "system" fn kapp_gl_window_callback( hwnd: HWND, u_msg: UINT, w_param: WPARAM, l_param: LPARAM, ) -> LRESULT { // DefWindowProcW is the default Window event handler. DefWindowProcW(hwnd, u_msg, w_param, l_param) } fn wgl_get_proc_address(name: &str) -> Result<*const c_void, Error> { let name = std::ffi::CString::new(name).unwrap(); let result = unsafe { wglGetProcAddress(name.as_ptr() as *const i8) as *const c_void }; error_if_null(result)?; Ok(result) } // These definitions are based on the wglext.h header available here: // https://www.khronos.org/registry/OpenGL/api/GL/wglext.h #[allow(non_snake_case, non_upper_case_globals)] static mut wglChoosePixelFormatARB_ptr: *const c_void = std::ptr::null(); #[allow(non_snake_case, non_upper_case_globals)] fn wglChoosePixelFormatARB( hdc: HDC, piAttribIList: *const c_int, pfAttribFList: *const c_float, nMaxFormats: c_uint, piFormats: *mut c_int, nNumFormats: *mut c_uint, ) -> c_int { unsafe { std::mem::transmute::< _, extern "system" fn( HDC, *const c_int, *const c_float, c_uint, *mut c_int, *mut c_uint, ) -> c_int, >(wglChoosePixelFormatARB_ptr)( hdc, piAttribIList, pfAttribFList, nMaxFormats, piFormats, nNumFormats, ) } } #[allow(non_snake_case, non_upper_case_globals)] static mut wglCreateContextAttribsARB_ptr: *const c
RawWindowHandle::Windows(handle) => handle.hwnd as HWND,
random_line_split
facade.rs
// Copyright 2020 The Fuchsia Authors. All rights reserved. // Use of this source code is governed by a BSD-style license that can be // found in the LICENSE file. use crate::common_utils::common::get_proxy_or_connect; use crate::repository_manager::types::RepositoryOutput; use anyhow::{format_err, Error}; use fidl_fuchsia_pkg::{RepositoryManagerMarker, RepositoryManagerProxy}; use fidl_fuchsia_pkg_ext::RepositoryConfig; use fuchsia_syslog::macros::fx_log_info; use fuchsia_zircon as zx; use parking_lot::RwLock; use serde_json::{from_value, to_value, Value}; use std::convert::TryFrom; /// Facade providing access to RepositoryManager interfaces. #[derive(Debug)] pub struct RepositoryManagerFacade { proxy: RwLock<Option<RepositoryManagerProxy>>, } impl RepositoryManagerFacade { pub fn new() -> Self { Self { proxy: RwLock::new(None) } } #[cfg(test)] fn new_with_proxy(proxy: RepositoryManagerProxy) -> Self { Self { proxy: RwLock::new(Some(proxy)) } } fn proxy(&self) -> Result<RepositoryManagerProxy, Error> { get_proxy_or_connect::<RepositoryManagerMarker>(&self.proxy) } /// Lists repositories using the repository_manager fidl service. /// /// Returns a list containing repository info in the format of /// RepositoryConfig. pub async fn list_repo(&self) -> Result<Value, Error> { match self.fetch_repos().await { Ok(repos) =>
Err(err) => { return Err(format_err!("Listing Repositories failed with error {:?}", err)) } }; } /// Add a new source to an existing repository. /// /// params format uses RepositoryConfig, example: /// { /// "repo_url": "fuchsia-pkg://example.com", /// "root_keys":[ /// { /// "type":"ed25519", /// "value":"00" /// }], /// "mirrors": [ /// { /// "mirror_url": "http://example.org/", /// "subscribe": true /// }], /// "update_package_url": "fuchsia-pkg://update.example.com/update", /// "root_version": 1, /// "root_threshold": 1, /// } pub async fn add(&self, args: Value) -> Result<Value, Error> { let add_request: RepositoryConfig = from_value(args)?; fx_log_info!("Add Repo request received {:?}", add_request); let res = self.proxy()?.add(add_request.into()).await?; match res.map_err(zx::Status::from_raw) { Ok(()) => Ok(to_value(RepositoryOutput::Success)?), _ => Err(format_err!("Add repo errored with code {:?}", res)), } } /// Fetches repositories using repository_manager.list FIDL service. async fn fetch_repos(&self) -> Result<Vec<RepositoryConfig>, anyhow::Error> { let (iter, server_end) = fidl::endpoints::create_proxy()?; self.proxy()?.list(server_end)?; let mut repos = vec![]; loop { let chunk = iter.next().await?; if chunk.is_empty() { break; } repos.extend(chunk); } repos .into_iter() .map(|repo| RepositoryConfig::try_from(repo).map_err(|e| anyhow::Error::from(e))) .collect() } } #[cfg(test)] mod tests { use super::*; use crate::common_utils::test::assert_value_round_trips_as; use fidl_fuchsia_pkg::{RepositoryIteratorRequest, RepositoryManagerRequest}; use fidl_fuchsia_pkg_ext::{ MirrorConfigBuilder, RepositoryConfig, RepositoryConfigBuilder, RepositoryKey, }; use fuchsia_syslog::macros::{fx_log_err, fx_log_info}; use fuchsia_url::pkg_url::{PkgUrl, RepoUrl}; use futures::{future::Future, join, StreamExt, TryFutureExt, TryStreamExt}; use http::Uri; use matches::assert_matches; use parking_lot::Mutex; use serde_json::json; use std::iter::FusedIterator; fn make_test_repo_config() -> RepositoryConfig { RepositoryConfigBuilder::new(RepoUrl::new("example.com".to_string()).expect("valid url")) .add_root_key(RepositoryKey::Ed25519(vec![0u8])) .add_mirror( MirrorConfigBuilder::new("http://example.org".parse::<Uri>().unwrap()) .unwrap() .subscribe(true) .build(), ) .update_package_url( PkgUrl::parse("fuchsia-pkg://update.example.com/update").expect("valid PkgUrl"), ) .build() } struct MockRepositoryManagerBuilder { expected: Vec<Box<dyn FnOnce(RepositoryManagerRequest) + Send +'static>>, repos: Mutex<Vec<RepositoryConfig>>, } impl MockRepositoryManagerBuilder { fn new() -> Self { Self { expected: vec![], repos: Mutex::new(vec![]) } } fn push(mut self, request: impl FnOnce(RepositoryManagerRequest) + Send +'static) -> Self { self.expected.push(Box::new(request)); self } fn add_repository(self, repo_config: RepositoryConfig) -> Self { self.repos.lock().push(repo_config); self } fn expect_list_repository(self) -> Self { let mut repos = self.repos.lock().clone().into_iter().map(|r| r.into()); self.push(move |req| match req { RepositoryManagerRequest::List { iterator,.. } => { let mut stream = iterator.into_stream().expect("list iterator into_stream"); // repos must be fused b/c the Next() fidl method should return an empty vector // forever after iteration is complete let _: &dyn FusedIterator<Item = _> = &repos; fuchsia_async::Task::spawn( async move { while let Some(RepositoryIteratorRequest::Next { responder }) = stream.try_next().await? { responder.send(&mut repos.by_ref().take(5)).expect("next send") } Ok(()) } .unwrap_or_else(|e: anyhow::Error| { fx_log_err!("error running list protocol: {:#}", e) }), ) .detach(); } req => panic!("unexpected request: {:?}", req), }) } fn expect_add_repository(self, repo_add: RepositoryConfig) -> Self { self.push(move |req| match req { RepositoryManagerRequest::Add { repo, responder } => { let new_repo = RepositoryConfig::try_from(repo).expect("valid repo config"); assert_eq!(new_repo, repo_add); responder.send(&mut Ok(())).expect("send ok"); } req => panic!("unexpected request: {:?}", req), }) } fn build(self) -> (RepositoryManagerFacade, impl Future<Output = ()>) { let (proxy, mut stream) = fidl::endpoints::create_proxy_and_stream::<RepositoryManagerMarker>().unwrap(); let fut = async move { for expected in self.expected { expected(stream.next().await.unwrap().unwrap()); } assert_matches!(stream.next().await, None); }; (RepositoryManagerFacade::new_with_proxy(proxy), fut) } } #[test] fn serde_repo_configuration() { let repo_config = make_test_repo_config(); assert_value_round_trips_as( repo_config, json!( { "repo_url": "fuchsia-pkg://example.com", "root_keys":[ { "type":"ed25519", "value":"00" }], "mirrors": [ { "mirror_url": "http://example.org/", "subscribe": true }], "update_package_url": "fuchsia-pkg://update.example.com/update", "root_version": 1, "root_threshold": 1, }), ); } #[fuchsia_async::run_singlethreaded(test)] async fn list_repository_ok() { let (facade, repository_manager) = MockRepositoryManagerBuilder::new() .add_repository(make_test_repo_config()) .expect_list_repository() .build(); let test = async move { let config = facade.list_repo().await.unwrap(); fx_log_info!("Repo listed: {:?}", config); let mut repo_config: Vec<RepositoryConfig> = from_value(config).unwrap(); assert_eq!(repo_config.len(), 1); let received_repo = repo_config.pop().unwrap(); let expected_pkg_url = PkgUrl::parse("fuchsia-pkg://update.example.com/update").unwrap(); match received_repo.update_package_url() { Some(u) => assert_eq!(u.to_string(), expected_pkg_url.to_string()), None => fx_log_err!("update_package_url is empty."), } }; join!(repository_manager, test); } #[fuchsia_async::run_singlethreaded(test)] async fn add_repository_ok() { let repo_test = make_test_repo_config(); let (facade, repository_manager) = MockRepositoryManagerBuilder::new().expect_add_repository(repo_test.clone()).build(); let test = async move { let status = facade.add(to_value(repo_test.clone()).unwrap()).await.unwrap(); assert_matches!(from_value(status).unwrap(), RepositoryOutput::Success) }; join!(repository_manager, test); } }
{ let return_value = to_value(&repos)?; return Ok(return_value); }
conditional_block
facade.rs
// Copyright 2020 The Fuchsia Authors. All rights reserved. // Use of this source code is governed by a BSD-style license that can be // found in the LICENSE file. use crate::common_utils::common::get_proxy_or_connect; use crate::repository_manager::types::RepositoryOutput; use anyhow::{format_err, Error}; use fidl_fuchsia_pkg::{RepositoryManagerMarker, RepositoryManagerProxy}; use fidl_fuchsia_pkg_ext::RepositoryConfig; use fuchsia_syslog::macros::fx_log_info; use fuchsia_zircon as zx; use parking_lot::RwLock; use serde_json::{from_value, to_value, Value}; use std::convert::TryFrom; /// Facade providing access to RepositoryManager interfaces. #[derive(Debug)] pub struct RepositoryManagerFacade { proxy: RwLock<Option<RepositoryManagerProxy>>, } impl RepositoryManagerFacade { pub fn new() -> Self { Self { proxy: RwLock::new(None) } }
} fn proxy(&self) -> Result<RepositoryManagerProxy, Error> { get_proxy_or_connect::<RepositoryManagerMarker>(&self.proxy) } /// Lists repositories using the repository_manager fidl service. /// /// Returns a list containing repository info in the format of /// RepositoryConfig. pub async fn list_repo(&self) -> Result<Value, Error> { match self.fetch_repos().await { Ok(repos) => { let return_value = to_value(&repos)?; return Ok(return_value); } Err(err) => { return Err(format_err!("Listing Repositories failed with error {:?}", err)) } }; } /// Add a new source to an existing repository. /// /// params format uses RepositoryConfig, example: /// { /// "repo_url": "fuchsia-pkg://example.com", /// "root_keys":[ /// { /// "type":"ed25519", /// "value":"00" /// }], /// "mirrors": [ /// { /// "mirror_url": "http://example.org/", /// "subscribe": true /// }], /// "update_package_url": "fuchsia-pkg://update.example.com/update", /// "root_version": 1, /// "root_threshold": 1, /// } pub async fn add(&self, args: Value) -> Result<Value, Error> { let add_request: RepositoryConfig = from_value(args)?; fx_log_info!("Add Repo request received {:?}", add_request); let res = self.proxy()?.add(add_request.into()).await?; match res.map_err(zx::Status::from_raw) { Ok(()) => Ok(to_value(RepositoryOutput::Success)?), _ => Err(format_err!("Add repo errored with code {:?}", res)), } } /// Fetches repositories using repository_manager.list FIDL service. async fn fetch_repos(&self) -> Result<Vec<RepositoryConfig>, anyhow::Error> { let (iter, server_end) = fidl::endpoints::create_proxy()?; self.proxy()?.list(server_end)?; let mut repos = vec![]; loop { let chunk = iter.next().await?; if chunk.is_empty() { break; } repos.extend(chunk); } repos .into_iter() .map(|repo| RepositoryConfig::try_from(repo).map_err(|e| anyhow::Error::from(e))) .collect() } } #[cfg(test)] mod tests { use super::*; use crate::common_utils::test::assert_value_round_trips_as; use fidl_fuchsia_pkg::{RepositoryIteratorRequest, RepositoryManagerRequest}; use fidl_fuchsia_pkg_ext::{ MirrorConfigBuilder, RepositoryConfig, RepositoryConfigBuilder, RepositoryKey, }; use fuchsia_syslog::macros::{fx_log_err, fx_log_info}; use fuchsia_url::pkg_url::{PkgUrl, RepoUrl}; use futures::{future::Future, join, StreamExt, TryFutureExt, TryStreamExt}; use http::Uri; use matches::assert_matches; use parking_lot::Mutex; use serde_json::json; use std::iter::FusedIterator; fn make_test_repo_config() -> RepositoryConfig { RepositoryConfigBuilder::new(RepoUrl::new("example.com".to_string()).expect("valid url")) .add_root_key(RepositoryKey::Ed25519(vec![0u8])) .add_mirror( MirrorConfigBuilder::new("http://example.org".parse::<Uri>().unwrap()) .unwrap() .subscribe(true) .build(), ) .update_package_url( PkgUrl::parse("fuchsia-pkg://update.example.com/update").expect("valid PkgUrl"), ) .build() } struct MockRepositoryManagerBuilder { expected: Vec<Box<dyn FnOnce(RepositoryManagerRequest) + Send +'static>>, repos: Mutex<Vec<RepositoryConfig>>, } impl MockRepositoryManagerBuilder { fn new() -> Self { Self { expected: vec![], repos: Mutex::new(vec![]) } } fn push(mut self, request: impl FnOnce(RepositoryManagerRequest) + Send +'static) -> Self { self.expected.push(Box::new(request)); self } fn add_repository(self, repo_config: RepositoryConfig) -> Self { self.repos.lock().push(repo_config); self } fn expect_list_repository(self) -> Self { let mut repos = self.repos.lock().clone().into_iter().map(|r| r.into()); self.push(move |req| match req { RepositoryManagerRequest::List { iterator,.. } => { let mut stream = iterator.into_stream().expect("list iterator into_stream"); // repos must be fused b/c the Next() fidl method should return an empty vector // forever after iteration is complete let _: &dyn FusedIterator<Item = _> = &repos; fuchsia_async::Task::spawn( async move { while let Some(RepositoryIteratorRequest::Next { responder }) = stream.try_next().await? { responder.send(&mut repos.by_ref().take(5)).expect("next send") } Ok(()) } .unwrap_or_else(|e: anyhow::Error| { fx_log_err!("error running list protocol: {:#}", e) }), ) .detach(); } req => panic!("unexpected request: {:?}", req), }) } fn expect_add_repository(self, repo_add: RepositoryConfig) -> Self { self.push(move |req| match req { RepositoryManagerRequest::Add { repo, responder } => { let new_repo = RepositoryConfig::try_from(repo).expect("valid repo config"); assert_eq!(new_repo, repo_add); responder.send(&mut Ok(())).expect("send ok"); } req => panic!("unexpected request: {:?}", req), }) } fn build(self) -> (RepositoryManagerFacade, impl Future<Output = ()>) { let (proxy, mut stream) = fidl::endpoints::create_proxy_and_stream::<RepositoryManagerMarker>().unwrap(); let fut = async move { for expected in self.expected { expected(stream.next().await.unwrap().unwrap()); } assert_matches!(stream.next().await, None); }; (RepositoryManagerFacade::new_with_proxy(proxy), fut) } } #[test] fn serde_repo_configuration() { let repo_config = make_test_repo_config(); assert_value_round_trips_as( repo_config, json!( { "repo_url": "fuchsia-pkg://example.com", "root_keys":[ { "type":"ed25519", "value":"00" }], "mirrors": [ { "mirror_url": "http://example.org/", "subscribe": true }], "update_package_url": "fuchsia-pkg://update.example.com/update", "root_version": 1, "root_threshold": 1, }), ); } #[fuchsia_async::run_singlethreaded(test)] async fn list_repository_ok() { let (facade, repository_manager) = MockRepositoryManagerBuilder::new() .add_repository(make_test_repo_config()) .expect_list_repository() .build(); let test = async move { let config = facade.list_repo().await.unwrap(); fx_log_info!("Repo listed: {:?}", config); let mut repo_config: Vec<RepositoryConfig> = from_value(config).unwrap(); assert_eq!(repo_config.len(), 1); let received_repo = repo_config.pop().unwrap(); let expected_pkg_url = PkgUrl::parse("fuchsia-pkg://update.example.com/update").unwrap(); match received_repo.update_package_url() { Some(u) => assert_eq!(u.to_string(), expected_pkg_url.to_string()), None => fx_log_err!("update_package_url is empty."), } }; join!(repository_manager, test); } #[fuchsia_async::run_singlethreaded(test)] async fn add_repository_ok() { let repo_test = make_test_repo_config(); let (facade, repository_manager) = MockRepositoryManagerBuilder::new().expect_add_repository(repo_test.clone()).build(); let test = async move { let status = facade.add(to_value(repo_test.clone()).unwrap()).await.unwrap(); assert_matches!(from_value(status).unwrap(), RepositoryOutput::Success) }; join!(repository_manager, test); } }
#[cfg(test)] fn new_with_proxy(proxy: RepositoryManagerProxy) -> Self { Self { proxy: RwLock::new(Some(proxy)) }
random_line_split
facade.rs
// Copyright 2020 The Fuchsia Authors. All rights reserved. // Use of this source code is governed by a BSD-style license that can be // found in the LICENSE file. use crate::common_utils::common::get_proxy_or_connect; use crate::repository_manager::types::RepositoryOutput; use anyhow::{format_err, Error}; use fidl_fuchsia_pkg::{RepositoryManagerMarker, RepositoryManagerProxy}; use fidl_fuchsia_pkg_ext::RepositoryConfig; use fuchsia_syslog::macros::fx_log_info; use fuchsia_zircon as zx; use parking_lot::RwLock; use serde_json::{from_value, to_value, Value}; use std::convert::TryFrom; /// Facade providing access to RepositoryManager interfaces. #[derive(Debug)] pub struct RepositoryManagerFacade { proxy: RwLock<Option<RepositoryManagerProxy>>, } impl RepositoryManagerFacade { pub fn new() -> Self { Self { proxy: RwLock::new(None) } } #[cfg(test)] fn new_with_proxy(proxy: RepositoryManagerProxy) -> Self { Self { proxy: RwLock::new(Some(proxy)) } } fn proxy(&self) -> Result<RepositoryManagerProxy, Error> { get_proxy_or_connect::<RepositoryManagerMarker>(&self.proxy) } /// Lists repositories using the repository_manager fidl service. /// /// Returns a list containing repository info in the format of /// RepositoryConfig. pub async fn list_repo(&self) -> Result<Value, Error> { match self.fetch_repos().await { Ok(repos) => { let return_value = to_value(&repos)?; return Ok(return_value); } Err(err) => { return Err(format_err!("Listing Repositories failed with error {:?}", err)) } }; } /// Add a new source to an existing repository. /// /// params format uses RepositoryConfig, example: /// { /// "repo_url": "fuchsia-pkg://example.com", /// "root_keys":[ /// { /// "type":"ed25519", /// "value":"00" /// }], /// "mirrors": [ /// { /// "mirror_url": "http://example.org/", /// "subscribe": true /// }], /// "update_package_url": "fuchsia-pkg://update.example.com/update", /// "root_version": 1, /// "root_threshold": 1, /// } pub async fn add(&self, args: Value) -> Result<Value, Error> { let add_request: RepositoryConfig = from_value(args)?; fx_log_info!("Add Repo request received {:?}", add_request); let res = self.proxy()?.add(add_request.into()).await?; match res.map_err(zx::Status::from_raw) { Ok(()) => Ok(to_value(RepositoryOutput::Success)?), _ => Err(format_err!("Add repo errored with code {:?}", res)), } } /// Fetches repositories using repository_manager.list FIDL service. async fn fetch_repos(&self) -> Result<Vec<RepositoryConfig>, anyhow::Error> { let (iter, server_end) = fidl::endpoints::create_proxy()?; self.proxy()?.list(server_end)?; let mut repos = vec![]; loop { let chunk = iter.next().await?; if chunk.is_empty() { break; } repos.extend(chunk); } repos .into_iter() .map(|repo| RepositoryConfig::try_from(repo).map_err(|e| anyhow::Error::from(e))) .collect() } } #[cfg(test)] mod tests { use super::*; use crate::common_utils::test::assert_value_round_trips_as; use fidl_fuchsia_pkg::{RepositoryIteratorRequest, RepositoryManagerRequest}; use fidl_fuchsia_pkg_ext::{ MirrorConfigBuilder, RepositoryConfig, RepositoryConfigBuilder, RepositoryKey, }; use fuchsia_syslog::macros::{fx_log_err, fx_log_info}; use fuchsia_url::pkg_url::{PkgUrl, RepoUrl}; use futures::{future::Future, join, StreamExt, TryFutureExt, TryStreamExt}; use http::Uri; use matches::assert_matches; use parking_lot::Mutex; use serde_json::json; use std::iter::FusedIterator; fn make_test_repo_config() -> RepositoryConfig { RepositoryConfigBuilder::new(RepoUrl::new("example.com".to_string()).expect("valid url")) .add_root_key(RepositoryKey::Ed25519(vec![0u8])) .add_mirror( MirrorConfigBuilder::new("http://example.org".parse::<Uri>().unwrap()) .unwrap() .subscribe(true) .build(), ) .update_package_url( PkgUrl::parse("fuchsia-pkg://update.example.com/update").expect("valid PkgUrl"), ) .build() } struct MockRepositoryManagerBuilder { expected: Vec<Box<dyn FnOnce(RepositoryManagerRequest) + Send +'static>>, repos: Mutex<Vec<RepositoryConfig>>, } impl MockRepositoryManagerBuilder { fn new() -> Self { Self { expected: vec![], repos: Mutex::new(vec![]) } } fn push(mut self, request: impl FnOnce(RepositoryManagerRequest) + Send +'static) -> Self { self.expected.push(Box::new(request)); self } fn add_repository(self, repo_config: RepositoryConfig) -> Self { self.repos.lock().push(repo_config); self } fn expect_list_repository(self) -> Self { let mut repos = self.repos.lock().clone().into_iter().map(|r| r.into()); self.push(move |req| match req { RepositoryManagerRequest::List { iterator,.. } => { let mut stream = iterator.into_stream().expect("list iterator into_stream"); // repos must be fused b/c the Next() fidl method should return an empty vector // forever after iteration is complete let _: &dyn FusedIterator<Item = _> = &repos; fuchsia_async::Task::spawn( async move { while let Some(RepositoryIteratorRequest::Next { responder }) = stream.try_next().await? { responder.send(&mut repos.by_ref().take(5)).expect("next send") } Ok(()) } .unwrap_or_else(|e: anyhow::Error| { fx_log_err!("error running list protocol: {:#}", e) }), ) .detach(); } req => panic!("unexpected request: {:?}", req), }) } fn expect_add_repository(self, repo_add: RepositoryConfig) -> Self { self.push(move |req| match req { RepositoryManagerRequest::Add { repo, responder } => { let new_repo = RepositoryConfig::try_from(repo).expect("valid repo config"); assert_eq!(new_repo, repo_add); responder.send(&mut Ok(())).expect("send ok"); } req => panic!("unexpected request: {:?}", req), }) } fn build(self) -> (RepositoryManagerFacade, impl Future<Output = ()>) { let (proxy, mut stream) = fidl::endpoints::create_proxy_and_stream::<RepositoryManagerMarker>().unwrap(); let fut = async move { for expected in self.expected { expected(stream.next().await.unwrap().unwrap()); } assert_matches!(stream.next().await, None); }; (RepositoryManagerFacade::new_with_proxy(proxy), fut) } } #[test] fn
() { let repo_config = make_test_repo_config(); assert_value_round_trips_as( repo_config, json!( { "repo_url": "fuchsia-pkg://example.com", "root_keys":[ { "type":"ed25519", "value":"00" }], "mirrors": [ { "mirror_url": "http://example.org/", "subscribe": true }], "update_package_url": "fuchsia-pkg://update.example.com/update", "root_version": 1, "root_threshold": 1, }), ); } #[fuchsia_async::run_singlethreaded(test)] async fn list_repository_ok() { let (facade, repository_manager) = MockRepositoryManagerBuilder::new() .add_repository(make_test_repo_config()) .expect_list_repository() .build(); let test = async move { let config = facade.list_repo().await.unwrap(); fx_log_info!("Repo listed: {:?}", config); let mut repo_config: Vec<RepositoryConfig> = from_value(config).unwrap(); assert_eq!(repo_config.len(), 1); let received_repo = repo_config.pop().unwrap(); let expected_pkg_url = PkgUrl::parse("fuchsia-pkg://update.example.com/update").unwrap(); match received_repo.update_package_url() { Some(u) => assert_eq!(u.to_string(), expected_pkg_url.to_string()), None => fx_log_err!("update_package_url is empty."), } }; join!(repository_manager, test); } #[fuchsia_async::run_singlethreaded(test)] async fn add_repository_ok() { let repo_test = make_test_repo_config(); let (facade, repository_manager) = MockRepositoryManagerBuilder::new().expect_add_repository(repo_test.clone()).build(); let test = async move { let status = facade.add(to_value(repo_test.clone()).unwrap()).await.unwrap(); assert_matches!(from_value(status).unwrap(), RepositoryOutput::Success) }; join!(repository_manager, test); } }
serde_repo_configuration
identifier_name
facade.rs
// Copyright 2020 The Fuchsia Authors. All rights reserved. // Use of this source code is governed by a BSD-style license that can be // found in the LICENSE file. use crate::common_utils::common::get_proxy_or_connect; use crate::repository_manager::types::RepositoryOutput; use anyhow::{format_err, Error}; use fidl_fuchsia_pkg::{RepositoryManagerMarker, RepositoryManagerProxy}; use fidl_fuchsia_pkg_ext::RepositoryConfig; use fuchsia_syslog::macros::fx_log_info; use fuchsia_zircon as zx; use parking_lot::RwLock; use serde_json::{from_value, to_value, Value}; use std::convert::TryFrom; /// Facade providing access to RepositoryManager interfaces. #[derive(Debug)] pub struct RepositoryManagerFacade { proxy: RwLock<Option<RepositoryManagerProxy>>, } impl RepositoryManagerFacade { pub fn new() -> Self { Self { proxy: RwLock::new(None) } } #[cfg(test)] fn new_with_proxy(proxy: RepositoryManagerProxy) -> Self { Self { proxy: RwLock::new(Some(proxy)) } } fn proxy(&self) -> Result<RepositoryManagerProxy, Error> { get_proxy_or_connect::<RepositoryManagerMarker>(&self.proxy) } /// Lists repositories using the repository_manager fidl service. /// /// Returns a list containing repository info in the format of /// RepositoryConfig. pub async fn list_repo(&self) -> Result<Value, Error> { match self.fetch_repos().await { Ok(repos) => { let return_value = to_value(&repos)?; return Ok(return_value); } Err(err) => { return Err(format_err!("Listing Repositories failed with error {:?}", err)) } }; } /// Add a new source to an existing repository. /// /// params format uses RepositoryConfig, example: /// { /// "repo_url": "fuchsia-pkg://example.com", /// "root_keys":[ /// { /// "type":"ed25519", /// "value":"00" /// }], /// "mirrors": [ /// { /// "mirror_url": "http://example.org/", /// "subscribe": true /// }], /// "update_package_url": "fuchsia-pkg://update.example.com/update", /// "root_version": 1, /// "root_threshold": 1, /// } pub async fn add(&self, args: Value) -> Result<Value, Error>
/// Fetches repositories using repository_manager.list FIDL service. async fn fetch_repos(&self) -> Result<Vec<RepositoryConfig>, anyhow::Error> { let (iter, server_end) = fidl::endpoints::create_proxy()?; self.proxy()?.list(server_end)?; let mut repos = vec![]; loop { let chunk = iter.next().await?; if chunk.is_empty() { break; } repos.extend(chunk); } repos .into_iter() .map(|repo| RepositoryConfig::try_from(repo).map_err(|e| anyhow::Error::from(e))) .collect() } } #[cfg(test)] mod tests { use super::*; use crate::common_utils::test::assert_value_round_trips_as; use fidl_fuchsia_pkg::{RepositoryIteratorRequest, RepositoryManagerRequest}; use fidl_fuchsia_pkg_ext::{ MirrorConfigBuilder, RepositoryConfig, RepositoryConfigBuilder, RepositoryKey, }; use fuchsia_syslog::macros::{fx_log_err, fx_log_info}; use fuchsia_url::pkg_url::{PkgUrl, RepoUrl}; use futures::{future::Future, join, StreamExt, TryFutureExt, TryStreamExt}; use http::Uri; use matches::assert_matches; use parking_lot::Mutex; use serde_json::json; use std::iter::FusedIterator; fn make_test_repo_config() -> RepositoryConfig { RepositoryConfigBuilder::new(RepoUrl::new("example.com".to_string()).expect("valid url")) .add_root_key(RepositoryKey::Ed25519(vec![0u8])) .add_mirror( MirrorConfigBuilder::new("http://example.org".parse::<Uri>().unwrap()) .unwrap() .subscribe(true) .build(), ) .update_package_url( PkgUrl::parse("fuchsia-pkg://update.example.com/update").expect("valid PkgUrl"), ) .build() } struct MockRepositoryManagerBuilder { expected: Vec<Box<dyn FnOnce(RepositoryManagerRequest) + Send +'static>>, repos: Mutex<Vec<RepositoryConfig>>, } impl MockRepositoryManagerBuilder { fn new() -> Self { Self { expected: vec![], repos: Mutex::new(vec![]) } } fn push(mut self, request: impl FnOnce(RepositoryManagerRequest) + Send +'static) -> Self { self.expected.push(Box::new(request)); self } fn add_repository(self, repo_config: RepositoryConfig) -> Self { self.repos.lock().push(repo_config); self } fn expect_list_repository(self) -> Self { let mut repos = self.repos.lock().clone().into_iter().map(|r| r.into()); self.push(move |req| match req { RepositoryManagerRequest::List { iterator,.. } => { let mut stream = iterator.into_stream().expect("list iterator into_stream"); // repos must be fused b/c the Next() fidl method should return an empty vector // forever after iteration is complete let _: &dyn FusedIterator<Item = _> = &repos; fuchsia_async::Task::spawn( async move { while let Some(RepositoryIteratorRequest::Next { responder }) = stream.try_next().await? { responder.send(&mut repos.by_ref().take(5)).expect("next send") } Ok(()) } .unwrap_or_else(|e: anyhow::Error| { fx_log_err!("error running list protocol: {:#}", e) }), ) .detach(); } req => panic!("unexpected request: {:?}", req), }) } fn expect_add_repository(self, repo_add: RepositoryConfig) -> Self { self.push(move |req| match req { RepositoryManagerRequest::Add { repo, responder } => { let new_repo = RepositoryConfig::try_from(repo).expect("valid repo config"); assert_eq!(new_repo, repo_add); responder.send(&mut Ok(())).expect("send ok"); } req => panic!("unexpected request: {:?}", req), }) } fn build(self) -> (RepositoryManagerFacade, impl Future<Output = ()>) { let (proxy, mut stream) = fidl::endpoints::create_proxy_and_stream::<RepositoryManagerMarker>().unwrap(); let fut = async move { for expected in self.expected { expected(stream.next().await.unwrap().unwrap()); } assert_matches!(stream.next().await, None); }; (RepositoryManagerFacade::new_with_proxy(proxy), fut) } } #[test] fn serde_repo_configuration() { let repo_config = make_test_repo_config(); assert_value_round_trips_as( repo_config, json!( { "repo_url": "fuchsia-pkg://example.com", "root_keys":[ { "type":"ed25519", "value":"00" }], "mirrors": [ { "mirror_url": "http://example.org/", "subscribe": true }], "update_package_url": "fuchsia-pkg://update.example.com/update", "root_version": 1, "root_threshold": 1, }), ); } #[fuchsia_async::run_singlethreaded(test)] async fn list_repository_ok() { let (facade, repository_manager) = MockRepositoryManagerBuilder::new() .add_repository(make_test_repo_config()) .expect_list_repository() .build(); let test = async move { let config = facade.list_repo().await.unwrap(); fx_log_info!("Repo listed: {:?}", config); let mut repo_config: Vec<RepositoryConfig> = from_value(config).unwrap(); assert_eq!(repo_config.len(), 1); let received_repo = repo_config.pop().unwrap(); let expected_pkg_url = PkgUrl::parse("fuchsia-pkg://update.example.com/update").unwrap(); match received_repo.update_package_url() { Some(u) => assert_eq!(u.to_string(), expected_pkg_url.to_string()), None => fx_log_err!("update_package_url is empty."), } }; join!(repository_manager, test); } #[fuchsia_async::run_singlethreaded(test)] async fn add_repository_ok() { let repo_test = make_test_repo_config(); let (facade, repository_manager) = MockRepositoryManagerBuilder::new().expect_add_repository(repo_test.clone()).build(); let test = async move { let status = facade.add(to_value(repo_test.clone()).unwrap()).await.unwrap(); assert_matches!(from_value(status).unwrap(), RepositoryOutput::Success) }; join!(repository_manager, test); } }
{ let add_request: RepositoryConfig = from_value(args)?; fx_log_info!("Add Repo request received {:?}", add_request); let res = self.proxy()?.add(add_request.into()).await?; match res.map_err(zx::Status::from_raw) { Ok(()) => Ok(to_value(RepositoryOutput::Success)?), _ => Err(format_err!("Add repo errored with code {:?}", res)), } }
identifier_body
transaction.rs
//! The `transaction` module provides functionality for creating log transactions. use bincode::serialize; use hash::{Hash, Hasher}; use serde::Serialize; use sha2::Sha512; use signature::{Keypair, KeypairUtil, Signature}; use solana_sdk::pubkey::Pubkey; use std::mem::size_of; pub const SIGNED_DATA_OFFSET: usize = size_of::<Signature>(); pub const SIG_OFFSET: usize = 0; pub const PUB_KEY_OFFSET: usize = size_of::<Signature>() + size_of::<u64>(); /// An instruction to execute a program under the `program_id` of `program_ids_index` with the /// specified accounts and userdata #[derive(Serialize, Deserialize, Debug, PartialEq, Eq, Clone)] pub struct Instruction { /// The program code that executes this transaction is identified by the program_id. /// this is an offset into the Transaction::program_ids field pub program_ids_index: u8, /// Indices into the keys array of which accounts to load pub accounts: Vec<u8>, /// Userdata to be stored in the account pub userdata: Vec<u8>, } impl Instruction { pub fn new<T: Serialize>(program_ids_index: u8, userdata: &T, accounts: Vec<u8>) -> Self { let userdata = serialize(userdata).unwrap(); Instruction { program_ids_index, userdata, accounts, } } } /// An atomic transaction #[derive(Serialize, Deserialize, Debug, PartialEq, Eq, Clone)] pub struct Transaction { /// A digital signature of `account_keys`, `program_ids`, `last_id`, `fee` and `instructions`, signed by `Pubkey`. pub signature: Signature, /// The `Pubkeys` that are executing this transaction userdata. The meaning of each key is /// program-specific. /// * account_keys[0] - Typically this is the `caller` public key. `signature` is verified with account_keys[0]. /// In the future which key pays the fee and which keys have signatures would be configurable. /// * account_keys[1] - Typically this is the program context or the recipient of the tokens pub account_keys: Vec<Pubkey>, /// The ID of a recent ledger entry. pub last_id: Hash, /// The number of tokens paid for processing and storage of this transaction. pub fee: u64, /// Keys identifying programs in the instructions vector. pub program_ids: Vec<Pubkey>, /// Programs that will be executed in sequence and commited in one atomic transaction if all /// succeed. pub instructions: Vec<Instruction>, } impl Transaction { pub fn
<T: Serialize>( from_keypair: &Keypair, transaction_keys: &[Pubkey], program_id: Pubkey, userdata: &T, last_id: Hash, fee: u64, ) -> Self { let program_ids = vec![program_id]; let accounts = (0..=transaction_keys.len() as u8).collect(); let instructions = vec![Instruction::new(0, userdata, accounts)]; Self::new_with_instructions( from_keypair, transaction_keys, last_id, fee, program_ids, instructions, ) } /// Create a signed transaction /// * `from_keypair` - The key used to sign the transaction. This key is stored as keys[0] /// * `account_keys` - The keys for the transaction. These are the program state /// instances or token recipient keys. /// * `last_id` - The PoH hash. /// * `fee` - The transaction fee. /// * `program_ids` - The keys that identify programs used in the `instruction` vector. /// * `instructions` - The programs and their arguments that the transaction will execute atomically pub fn new_with_instructions( from_keypair: &Keypair, keys: &[Pubkey], last_id: Hash, fee: u64, program_ids: Vec<Pubkey>, instructions: Vec<Instruction>, ) -> Self { let from = from_keypair.pubkey(); let mut account_keys = vec![from]; account_keys.extend_from_slice(keys); let mut tx = Transaction { signature: Signature::default(), account_keys, last_id: Hash::default(), fee, program_ids, instructions, }; tx.sign(from_keypair, last_id); tx } pub fn userdata(&self, instruction_index: usize) -> &[u8] { &self.instructions[instruction_index].userdata } fn key_index(&self, instruction_index: usize, accounts_index: usize) -> Option<usize> { self.instructions .get(instruction_index) .and_then(|instruction| instruction.accounts.get(accounts_index)) .map(|&account_keys_index| account_keys_index as usize) } pub fn key(&self, instruction_index: usize, accounts_index: usize) -> Option<&Pubkey> { self.key_index(instruction_index, accounts_index) .and_then(|account_keys_index| self.account_keys.get(account_keys_index)) } pub fn signed_key(&self, instruction_index: usize, accounts_index: usize) -> Option<&Pubkey> { match self.key_index(instruction_index, accounts_index) { None => None, Some(0) => self.account_keys.get(0), Some(_) => None, } } pub fn program_id(&self, instruction_index: usize) -> &Pubkey { let program_ids_index = self.instructions[instruction_index].program_ids_index; &self.program_ids[program_ids_index as usize] } /// Get the transaction data to sign. pub fn get_sign_data(&self) -> Vec<u8> { let mut data = serialize(&self.account_keys).expect("serialize account_keys"); let last_id_data = serialize(&self.last_id).expect("serialize last_id"); data.extend_from_slice(&last_id_data); let fee_data = serialize(&self.fee).expect("serialize fee"); data.extend_from_slice(&fee_data); let program_ids = serialize(&self.program_ids).expect("serialize program_ids"); data.extend_from_slice(&program_ids); let instructions = serialize(&self.instructions).expect("serialize instructions"); data.extend_from_slice(&instructions); data } /// Sign this transaction. pub fn sign(&mut self, keypair: &Keypair, last_id: Hash) { self.last_id = last_id; let sign_data = self.get_sign_data(); self.signature = Signature::new(&keypair.sign::<Sha512>(&sign_data).to_bytes()); } /// Verify only the transaction signature. pub fn verify_signature(&self) -> bool { warn!("transaction signature verification called"); self.signature .verify(&self.from().as_ref(), &self.get_sign_data()) } /// Verify that references in the instructions are valid pub fn verify_refs(&self) -> bool { for instruction in &self.instructions { if (instruction.program_ids_index as usize) >= self.program_ids.len() { return false; } for account_index in &instruction.accounts { if (*account_index as usize) >= self.account_keys.len() { return false; } } } true } pub fn from(&self) -> &Pubkey { &self.account_keys[0] } // a hash of a slice of transactions only needs to hash the signatures pub fn hash(transactions: &[Transaction]) -> Hash { let mut hasher = Hasher::default(); transactions .iter() .for_each(|tx| hasher.hash(&tx.signature.as_ref())); hasher.result() } } #[cfg(test)] mod tests { use super::*; use bincode::serialize; use signature::GenKeys; #[test] fn test_refs() { let key = Keypair::new(); let key1 = Keypair::new().pubkey(); let key2 = Keypair::new().pubkey(); let prog1 = Keypair::new().pubkey(); let prog2 = Keypair::new().pubkey(); let instructions = vec![ Instruction::new(0, &(), vec![0, 1]), Instruction::new(1, &(), vec![0, 2]), ]; let tx = Transaction::new_with_instructions( &key, &[key1, key2], Default::default(), 0, vec![prog1, prog2], instructions, ); assert!(tx.verify_refs()); assert_eq!(tx.key(0, 0), Some(&key.pubkey())); assert_eq!(tx.signed_key(0, 0), Some(&key.pubkey())); assert_eq!(tx.key(1, 0), Some(&key.pubkey())); assert_eq!(tx.signed_key(1, 0), Some(&key.pubkey())); assert_eq!(tx.key(0, 1), Some(&key1)); assert_eq!(tx.signed_key(0, 1), None); assert_eq!(tx.key(1, 1), Some(&key2)); assert_eq!(tx.signed_key(1, 1), None); assert_eq!(tx.key(2, 0), None); assert_eq!(tx.signed_key(2, 0), None); assert_eq!(tx.key(0, 2), None); assert_eq!(tx.signed_key(0, 2), None); assert_eq!(*tx.program_id(0), prog1); assert_eq!(*tx.program_id(1), prog2); } #[test] fn test_refs_invalid_program_id() { let key = Keypair::new(); let instructions = vec![Instruction::new(1, &(), vec![])]; let tx = Transaction::new_with_instructions( &key, &[], Default::default(), 0, vec![], instructions, ); assert!(!tx.verify_refs()); } #[test] fn test_refs_invalid_account() { let key = Keypair::new(); let instructions = vec![Instruction::new(0, &(), vec![1])]; let tx = Transaction::new_with_instructions( &key, &[], Default::default(), 0, vec![Default::default()], instructions, ); assert_eq!(*tx.program_id(0), Default::default()); assert!(!tx.verify_refs()); } /// Detect binary changes in the serialized contract userdata, which could have a downstream /// affect on SDKs and DApps #[test] fn test_sdk_serialize() { let keypair = &GenKeys::new([0u8; 32]).gen_n_keypairs(1)[0]; let to = Pubkey::new(&[ 1, 1, 1, 4, 5, 6, 7, 8, 9, 9, 9, 9, 9, 9, 9, 9, 9, 9, 9, 9, 9, 9, 9, 9, 8, 7, 6, 5, 4, 1, 1, 1, ]); let program_id = Pubkey::new(&[ 2, 2, 2, 4, 5, 6, 7, 8, 9, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 9, 8, 7, 6, 5, 4, 2, 2, 2, ]); let tx = Transaction::new( keypair, &[keypair.pubkey(), to], program_id, &(1u8, 2u8, 3u8), Hash::default(), 99, ); assert_eq!( serialize(&tx).unwrap(), vec![ 238, 228, 120, 18, 14, 44, 44, 74, 186, 124, 104, 174, 137, 227, 237, 157, 147, 37, 230, 74, 20, 48, 234, 36, 170, 60, 68, 184, 171, 240, 203, 18, 255, 110, 164, 67, 212, 206, 115, 182, 13, 90, 38, 215, 191, 51, 79, 183, 57, 102, 248, 221, 114, 72, 120, 66, 113, 146, 251, 102, 69, 187, 25, 8, 3, 0, 0, 0, 0, 0, 0, 0, 218, 65, 89, 124, 81, 87, 72, 141, 119, 36, 224, 63, 184, 216, 74, 55, 106, 67, 184, 244, 21, 24, 161, 28, 195, 135, 182, 105, 178, 238, 101, 134, 218, 65, 89, 124, 81, 87, 72, 141, 119, 36, 224, 63, 184, 216, 74, 55, 106, 67, 184, 244, 21, 24, 161, 28, 195, 135, 182, 105, 178, 238, 101, 134, 1, 1, 1, 4, 5, 6, 7, 8, 9, 9, 9, 9, 9, 9, 9, 9, 9, 9, 9, 9, 9, 9, 9, 9, 8, 7, 6, 5, 4, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 99, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 2, 2, 2, 4, 5, 6, 7, 8, 9, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 9, 8, 7, 6, 5, 4, 2, 2, 2, 1, 0, 0, 0, 0, 0, 0, 0, 0, 3, 0, 0, 0, 0, 0, 0, 0, 0, 1, 2, 3, 0, 0, 0, 0, 0, 0, 0, 1, 2, 3 ], ); } }
new
identifier_name
transaction.rs
//! The `transaction` module provides functionality for creating log transactions. use bincode::serialize; use hash::{Hash, Hasher}; use serde::Serialize; use sha2::Sha512; use signature::{Keypair, KeypairUtil, Signature}; use solana_sdk::pubkey::Pubkey; use std::mem::size_of; pub const SIGNED_DATA_OFFSET: usize = size_of::<Signature>(); pub const SIG_OFFSET: usize = 0; pub const PUB_KEY_OFFSET: usize = size_of::<Signature>() + size_of::<u64>(); /// An instruction to execute a program under the `program_id` of `program_ids_index` with the /// specified accounts and userdata #[derive(Serialize, Deserialize, Debug, PartialEq, Eq, Clone)] pub struct Instruction { /// The program code that executes this transaction is identified by the program_id. /// this is an offset into the Transaction::program_ids field pub program_ids_index: u8, /// Indices into the keys array of which accounts to load pub accounts: Vec<u8>, /// Userdata to be stored in the account pub userdata: Vec<u8>, } impl Instruction { pub fn new<T: Serialize>(program_ids_index: u8, userdata: &T, accounts: Vec<u8>) -> Self { let userdata = serialize(userdata).unwrap(); Instruction { program_ids_index, userdata, accounts, } } } /// An atomic transaction #[derive(Serialize, Deserialize, Debug, PartialEq, Eq, Clone)] pub struct Transaction { /// A digital signature of `account_keys`, `program_ids`, `last_id`, `fee` and `instructions`, signed by `Pubkey`. pub signature: Signature, /// The `Pubkeys` that are executing this transaction userdata. The meaning of each key is /// program-specific. /// * account_keys[0] - Typically this is the `caller` public key. `signature` is verified with account_keys[0]. /// In the future which key pays the fee and which keys have signatures would be configurable. /// * account_keys[1] - Typically this is the program context or the recipient of the tokens pub account_keys: Vec<Pubkey>, /// The ID of a recent ledger entry. pub last_id: Hash, /// The number of tokens paid for processing and storage of this transaction. pub fee: u64, /// Keys identifying programs in the instructions vector. pub program_ids: Vec<Pubkey>, /// Programs that will be executed in sequence and commited in one atomic transaction if all /// succeed. pub instructions: Vec<Instruction>, } impl Transaction { pub fn new<T: Serialize>( from_keypair: &Keypair, transaction_keys: &[Pubkey], program_id: Pubkey, userdata: &T, last_id: Hash, fee: u64, ) -> Self { let program_ids = vec![program_id]; let accounts = (0..=transaction_keys.len() as u8).collect(); let instructions = vec![Instruction::new(0, userdata, accounts)]; Self::new_with_instructions( from_keypair, transaction_keys, last_id, fee, program_ids, instructions, ) } /// Create a signed transaction /// * `from_keypair` - The key used to sign the transaction. This key is stored as keys[0] /// * `account_keys` - The keys for the transaction. These are the program state /// instances or token recipient keys. /// * `last_id` - The PoH hash. /// * `fee` - The transaction fee. /// * `program_ids` - The keys that identify programs used in the `instruction` vector. /// * `instructions` - The programs and their arguments that the transaction will execute atomically pub fn new_with_instructions( from_keypair: &Keypair, keys: &[Pubkey], last_id: Hash, fee: u64, program_ids: Vec<Pubkey>, instructions: Vec<Instruction>, ) -> Self { let from = from_keypair.pubkey(); let mut account_keys = vec![from]; account_keys.extend_from_slice(keys); let mut tx = Transaction { signature: Signature::default(), account_keys, last_id: Hash::default(), fee, program_ids, instructions, }; tx.sign(from_keypair, last_id); tx } pub fn userdata(&self, instruction_index: usize) -> &[u8] { &self.instructions[instruction_index].userdata } fn key_index(&self, instruction_index: usize, accounts_index: usize) -> Option<usize> { self.instructions .get(instruction_index) .and_then(|instruction| instruction.accounts.get(accounts_index)) .map(|&account_keys_index| account_keys_index as usize) } pub fn key(&self, instruction_index: usize, accounts_index: usize) -> Option<&Pubkey> { self.key_index(instruction_index, accounts_index) .and_then(|account_keys_index| self.account_keys.get(account_keys_index)) } pub fn signed_key(&self, instruction_index: usize, accounts_index: usize) -> Option<&Pubkey> { match self.key_index(instruction_index, accounts_index) { None => None, Some(0) => self.account_keys.get(0), Some(_) => None, } } pub fn program_id(&self, instruction_index: usize) -> &Pubkey { let program_ids_index = self.instructions[instruction_index].program_ids_index; &self.program_ids[program_ids_index as usize] } /// Get the transaction data to sign. pub fn get_sign_data(&self) -> Vec<u8> { let mut data = serialize(&self.account_keys).expect("serialize account_keys"); let last_id_data = serialize(&self.last_id).expect("serialize last_id");
data.extend_from_slice(&fee_data); let program_ids = serialize(&self.program_ids).expect("serialize program_ids"); data.extend_from_slice(&program_ids); let instructions = serialize(&self.instructions).expect("serialize instructions"); data.extend_from_slice(&instructions); data } /// Sign this transaction. pub fn sign(&mut self, keypair: &Keypair, last_id: Hash) { self.last_id = last_id; let sign_data = self.get_sign_data(); self.signature = Signature::new(&keypair.sign::<Sha512>(&sign_data).to_bytes()); } /// Verify only the transaction signature. pub fn verify_signature(&self) -> bool { warn!("transaction signature verification called"); self.signature .verify(&self.from().as_ref(), &self.get_sign_data()) } /// Verify that references in the instructions are valid pub fn verify_refs(&self) -> bool { for instruction in &self.instructions { if (instruction.program_ids_index as usize) >= self.program_ids.len() { return false; } for account_index in &instruction.accounts { if (*account_index as usize) >= self.account_keys.len() { return false; } } } true } pub fn from(&self) -> &Pubkey { &self.account_keys[0] } // a hash of a slice of transactions only needs to hash the signatures pub fn hash(transactions: &[Transaction]) -> Hash { let mut hasher = Hasher::default(); transactions .iter() .for_each(|tx| hasher.hash(&tx.signature.as_ref())); hasher.result() } } #[cfg(test)] mod tests { use super::*; use bincode::serialize; use signature::GenKeys; #[test] fn test_refs() { let key = Keypair::new(); let key1 = Keypair::new().pubkey(); let key2 = Keypair::new().pubkey(); let prog1 = Keypair::new().pubkey(); let prog2 = Keypair::new().pubkey(); let instructions = vec![ Instruction::new(0, &(), vec![0, 1]), Instruction::new(1, &(), vec![0, 2]), ]; let tx = Transaction::new_with_instructions( &key, &[key1, key2], Default::default(), 0, vec![prog1, prog2], instructions, ); assert!(tx.verify_refs()); assert_eq!(tx.key(0, 0), Some(&key.pubkey())); assert_eq!(tx.signed_key(0, 0), Some(&key.pubkey())); assert_eq!(tx.key(1, 0), Some(&key.pubkey())); assert_eq!(tx.signed_key(1, 0), Some(&key.pubkey())); assert_eq!(tx.key(0, 1), Some(&key1)); assert_eq!(tx.signed_key(0, 1), None); assert_eq!(tx.key(1, 1), Some(&key2)); assert_eq!(tx.signed_key(1, 1), None); assert_eq!(tx.key(2, 0), None); assert_eq!(tx.signed_key(2, 0), None); assert_eq!(tx.key(0, 2), None); assert_eq!(tx.signed_key(0, 2), None); assert_eq!(*tx.program_id(0), prog1); assert_eq!(*tx.program_id(1), prog2); } #[test] fn test_refs_invalid_program_id() { let key = Keypair::new(); let instructions = vec![Instruction::new(1, &(), vec![])]; let tx = Transaction::new_with_instructions( &key, &[], Default::default(), 0, vec![], instructions, ); assert!(!tx.verify_refs()); } #[test] fn test_refs_invalid_account() { let key = Keypair::new(); let instructions = vec![Instruction::new(0, &(), vec![1])]; let tx = Transaction::new_with_instructions( &key, &[], Default::default(), 0, vec![Default::default()], instructions, ); assert_eq!(*tx.program_id(0), Default::default()); assert!(!tx.verify_refs()); } /// Detect binary changes in the serialized contract userdata, which could have a downstream /// affect on SDKs and DApps #[test] fn test_sdk_serialize() { let keypair = &GenKeys::new([0u8; 32]).gen_n_keypairs(1)[0]; let to = Pubkey::new(&[ 1, 1, 1, 4, 5, 6, 7, 8, 9, 9, 9, 9, 9, 9, 9, 9, 9, 9, 9, 9, 9, 9, 9, 9, 8, 7, 6, 5, 4, 1, 1, 1, ]); let program_id = Pubkey::new(&[ 2, 2, 2, 4, 5, 6, 7, 8, 9, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 9, 8, 7, 6, 5, 4, 2, 2, 2, ]); let tx = Transaction::new( keypair, &[keypair.pubkey(), to], program_id, &(1u8, 2u8, 3u8), Hash::default(), 99, ); assert_eq!( serialize(&tx).unwrap(), vec![ 238, 228, 120, 18, 14, 44, 44, 74, 186, 124, 104, 174, 137, 227, 237, 157, 147, 37, 230, 74, 20, 48, 234, 36, 170, 60, 68, 184, 171, 240, 203, 18, 255, 110, 164, 67, 212, 206, 115, 182, 13, 90, 38, 215, 191, 51, 79, 183, 57, 102, 248, 221, 114, 72, 120, 66, 113, 146, 251, 102, 69, 187, 25, 8, 3, 0, 0, 0, 0, 0, 0, 0, 218, 65, 89, 124, 81, 87, 72, 141, 119, 36, 224, 63, 184, 216, 74, 55, 106, 67, 184, 244, 21, 24, 161, 28, 195, 135, 182, 105, 178, 238, 101, 134, 218, 65, 89, 124, 81, 87, 72, 141, 119, 36, 224, 63, 184, 216, 74, 55, 106, 67, 184, 244, 21, 24, 161, 28, 195, 135, 182, 105, 178, 238, 101, 134, 1, 1, 1, 4, 5, 6, 7, 8, 9, 9, 9, 9, 9, 9, 9, 9, 9, 9, 9, 9, 9, 9, 9, 9, 8, 7, 6, 5, 4, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 99, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 2, 2, 2, 4, 5, 6, 7, 8, 9, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 9, 8, 7, 6, 5, 4, 2, 2, 2, 1, 0, 0, 0, 0, 0, 0, 0, 0, 3, 0, 0, 0, 0, 0, 0, 0, 0, 1, 2, 3, 0, 0, 0, 0, 0, 0, 0, 1, 2, 3 ], ); } }
data.extend_from_slice(&last_id_data); let fee_data = serialize(&self.fee).expect("serialize fee");
random_line_split
transaction.rs
//! The `transaction` module provides functionality for creating log transactions. use bincode::serialize; use hash::{Hash, Hasher}; use serde::Serialize; use sha2::Sha512; use signature::{Keypair, KeypairUtil, Signature}; use solana_sdk::pubkey::Pubkey; use std::mem::size_of; pub const SIGNED_DATA_OFFSET: usize = size_of::<Signature>(); pub const SIG_OFFSET: usize = 0; pub const PUB_KEY_OFFSET: usize = size_of::<Signature>() + size_of::<u64>(); /// An instruction to execute a program under the `program_id` of `program_ids_index` with the /// specified accounts and userdata #[derive(Serialize, Deserialize, Debug, PartialEq, Eq, Clone)] pub struct Instruction { /// The program code that executes this transaction is identified by the program_id. /// this is an offset into the Transaction::program_ids field pub program_ids_index: u8, /// Indices into the keys array of which accounts to load pub accounts: Vec<u8>, /// Userdata to be stored in the account pub userdata: Vec<u8>, } impl Instruction { pub fn new<T: Serialize>(program_ids_index: u8, userdata: &T, accounts: Vec<u8>) -> Self
} /// An atomic transaction #[derive(Serialize, Deserialize, Debug, PartialEq, Eq, Clone)] pub struct Transaction { /// A digital signature of `account_keys`, `program_ids`, `last_id`, `fee` and `instructions`, signed by `Pubkey`. pub signature: Signature, /// The `Pubkeys` that are executing this transaction userdata. The meaning of each key is /// program-specific. /// * account_keys[0] - Typically this is the `caller` public key. `signature` is verified with account_keys[0]. /// In the future which key pays the fee and which keys have signatures would be configurable. /// * account_keys[1] - Typically this is the program context or the recipient of the tokens pub account_keys: Vec<Pubkey>, /// The ID of a recent ledger entry. pub last_id: Hash, /// The number of tokens paid for processing and storage of this transaction. pub fee: u64, /// Keys identifying programs in the instructions vector. pub program_ids: Vec<Pubkey>, /// Programs that will be executed in sequence and commited in one atomic transaction if all /// succeed. pub instructions: Vec<Instruction>, } impl Transaction { pub fn new<T: Serialize>( from_keypair: &Keypair, transaction_keys: &[Pubkey], program_id: Pubkey, userdata: &T, last_id: Hash, fee: u64, ) -> Self { let program_ids = vec![program_id]; let accounts = (0..=transaction_keys.len() as u8).collect(); let instructions = vec![Instruction::new(0, userdata, accounts)]; Self::new_with_instructions( from_keypair, transaction_keys, last_id, fee, program_ids, instructions, ) } /// Create a signed transaction /// * `from_keypair` - The key used to sign the transaction. This key is stored as keys[0] /// * `account_keys` - The keys for the transaction. These are the program state /// instances or token recipient keys. /// * `last_id` - The PoH hash. /// * `fee` - The transaction fee. /// * `program_ids` - The keys that identify programs used in the `instruction` vector. /// * `instructions` - The programs and their arguments that the transaction will execute atomically pub fn new_with_instructions( from_keypair: &Keypair, keys: &[Pubkey], last_id: Hash, fee: u64, program_ids: Vec<Pubkey>, instructions: Vec<Instruction>, ) -> Self { let from = from_keypair.pubkey(); let mut account_keys = vec![from]; account_keys.extend_from_slice(keys); let mut tx = Transaction { signature: Signature::default(), account_keys, last_id: Hash::default(), fee, program_ids, instructions, }; tx.sign(from_keypair, last_id); tx } pub fn userdata(&self, instruction_index: usize) -> &[u8] { &self.instructions[instruction_index].userdata } fn key_index(&self, instruction_index: usize, accounts_index: usize) -> Option<usize> { self.instructions .get(instruction_index) .and_then(|instruction| instruction.accounts.get(accounts_index)) .map(|&account_keys_index| account_keys_index as usize) } pub fn key(&self, instruction_index: usize, accounts_index: usize) -> Option<&Pubkey> { self.key_index(instruction_index, accounts_index) .and_then(|account_keys_index| self.account_keys.get(account_keys_index)) } pub fn signed_key(&self, instruction_index: usize, accounts_index: usize) -> Option<&Pubkey> { match self.key_index(instruction_index, accounts_index) { None => None, Some(0) => self.account_keys.get(0), Some(_) => None, } } pub fn program_id(&self, instruction_index: usize) -> &Pubkey { let program_ids_index = self.instructions[instruction_index].program_ids_index; &self.program_ids[program_ids_index as usize] } /// Get the transaction data to sign. pub fn get_sign_data(&self) -> Vec<u8> { let mut data = serialize(&self.account_keys).expect("serialize account_keys"); let last_id_data = serialize(&self.last_id).expect("serialize last_id"); data.extend_from_slice(&last_id_data); let fee_data = serialize(&self.fee).expect("serialize fee"); data.extend_from_slice(&fee_data); let program_ids = serialize(&self.program_ids).expect("serialize program_ids"); data.extend_from_slice(&program_ids); let instructions = serialize(&self.instructions).expect("serialize instructions"); data.extend_from_slice(&instructions); data } /// Sign this transaction. pub fn sign(&mut self, keypair: &Keypair, last_id: Hash) { self.last_id = last_id; let sign_data = self.get_sign_data(); self.signature = Signature::new(&keypair.sign::<Sha512>(&sign_data).to_bytes()); } /// Verify only the transaction signature. pub fn verify_signature(&self) -> bool { warn!("transaction signature verification called"); self.signature .verify(&self.from().as_ref(), &self.get_sign_data()) } /// Verify that references in the instructions are valid pub fn verify_refs(&self) -> bool { for instruction in &self.instructions { if (instruction.program_ids_index as usize) >= self.program_ids.len() { return false; } for account_index in &instruction.accounts { if (*account_index as usize) >= self.account_keys.len() { return false; } } } true } pub fn from(&self) -> &Pubkey { &self.account_keys[0] } // a hash of a slice of transactions only needs to hash the signatures pub fn hash(transactions: &[Transaction]) -> Hash { let mut hasher = Hasher::default(); transactions .iter() .for_each(|tx| hasher.hash(&tx.signature.as_ref())); hasher.result() } } #[cfg(test)] mod tests { use super::*; use bincode::serialize; use signature::GenKeys; #[test] fn test_refs() { let key = Keypair::new(); let key1 = Keypair::new().pubkey(); let key2 = Keypair::new().pubkey(); let prog1 = Keypair::new().pubkey(); let prog2 = Keypair::new().pubkey(); let instructions = vec![ Instruction::new(0, &(), vec![0, 1]), Instruction::new(1, &(), vec![0, 2]), ]; let tx = Transaction::new_with_instructions( &key, &[key1, key2], Default::default(), 0, vec![prog1, prog2], instructions, ); assert!(tx.verify_refs()); assert_eq!(tx.key(0, 0), Some(&key.pubkey())); assert_eq!(tx.signed_key(0, 0), Some(&key.pubkey())); assert_eq!(tx.key(1, 0), Some(&key.pubkey())); assert_eq!(tx.signed_key(1, 0), Some(&key.pubkey())); assert_eq!(tx.key(0, 1), Some(&key1)); assert_eq!(tx.signed_key(0, 1), None); assert_eq!(tx.key(1, 1), Some(&key2)); assert_eq!(tx.signed_key(1, 1), None); assert_eq!(tx.key(2, 0), None); assert_eq!(tx.signed_key(2, 0), None); assert_eq!(tx.key(0, 2), None); assert_eq!(tx.signed_key(0, 2), None); assert_eq!(*tx.program_id(0), prog1); assert_eq!(*tx.program_id(1), prog2); } #[test] fn test_refs_invalid_program_id() { let key = Keypair::new(); let instructions = vec![Instruction::new(1, &(), vec![])]; let tx = Transaction::new_with_instructions( &key, &[], Default::default(), 0, vec![], instructions, ); assert!(!tx.verify_refs()); } #[test] fn test_refs_invalid_account() { let key = Keypair::new(); let instructions = vec![Instruction::new(0, &(), vec![1])]; let tx = Transaction::new_with_instructions( &key, &[], Default::default(), 0, vec![Default::default()], instructions, ); assert_eq!(*tx.program_id(0), Default::default()); assert!(!tx.verify_refs()); } /// Detect binary changes in the serialized contract userdata, which could have a downstream /// affect on SDKs and DApps #[test] fn test_sdk_serialize() { let keypair = &GenKeys::new([0u8; 32]).gen_n_keypairs(1)[0]; let to = Pubkey::new(&[ 1, 1, 1, 4, 5, 6, 7, 8, 9, 9, 9, 9, 9, 9, 9, 9, 9, 9, 9, 9, 9, 9, 9, 9, 8, 7, 6, 5, 4, 1, 1, 1, ]); let program_id = Pubkey::new(&[ 2, 2, 2, 4, 5, 6, 7, 8, 9, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 9, 8, 7, 6, 5, 4, 2, 2, 2, ]); let tx = Transaction::new( keypair, &[keypair.pubkey(), to], program_id, &(1u8, 2u8, 3u8), Hash::default(), 99, ); assert_eq!( serialize(&tx).unwrap(), vec![ 238, 228, 120, 18, 14, 44, 44, 74, 186, 124, 104, 174, 137, 227, 237, 157, 147, 37, 230, 74, 20, 48, 234, 36, 170, 60, 68, 184, 171, 240, 203, 18, 255, 110, 164, 67, 212, 206, 115, 182, 13, 90, 38, 215, 191, 51, 79, 183, 57, 102, 248, 221, 114, 72, 120, 66, 113, 146, 251, 102, 69, 187, 25, 8, 3, 0, 0, 0, 0, 0, 0, 0, 218, 65, 89, 124, 81, 87, 72, 141, 119, 36, 224, 63, 184, 216, 74, 55, 106, 67, 184, 244, 21, 24, 161, 28, 195, 135, 182, 105, 178, 238, 101, 134, 218, 65, 89, 124, 81, 87, 72, 141, 119, 36, 224, 63, 184, 216, 74, 55, 106, 67, 184, 244, 21, 24, 161, 28, 195, 135, 182, 105, 178, 238, 101, 134, 1, 1, 1, 4, 5, 6, 7, 8, 9, 9, 9, 9, 9, 9, 9, 9, 9, 9, 9, 9, 9, 9, 9, 9, 8, 7, 6, 5, 4, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 99, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 2, 2, 2, 4, 5, 6, 7, 8, 9, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 9, 8, 7, 6, 5, 4, 2, 2, 2, 1, 0, 0, 0, 0, 0, 0, 0, 0, 3, 0, 0, 0, 0, 0, 0, 0, 0, 1, 2, 3, 0, 0, 0, 0, 0, 0, 0, 1, 2, 3 ], ); } }
{ let userdata = serialize(userdata).unwrap(); Instruction { program_ids_index, userdata, accounts, } }
identifier_body
main.rs
extern crate getopts; extern crate hyper; extern crate futures; extern crate tokio_core; extern crate hyper_tls; extern crate pretty_env_logger; extern crate ftp; use std::io::Read; use getopts::Options; use std::str; use std::error::Error; use std::fs::File; use std::path::Path; use std::io::stdin; use std::env; use std::io::{self, Write}; use futures::Future; use futures::stream::Stream; use hyper::Client; use ftp::FtpStream; fn main() { const VERSION: Option<&'static str> = option_env!("CARGO_PKG_VERSION"); pretty_env_logger::init().unwrap(); // Using args() instead of args_os(), cause they never panic let commandline_args: Vec<_> = env::args().collect(); let program = commandline_args[0].clone(); // Use the getopts package Options structure let mut opts = Options::new(); // Create the file argument opts.optopt("d", "", "Specify destination file", "NAME"); // Create help flag (-h or --help) opts.optflag("h", "help", "Print this help menu"); // Create version l opts.optflag("v", "version", "Check the version you're running"); // Use the innate parse() method // https://doc.rust-lang.org/1.2.0/book/match.html // https://doc.rust-lang.org/std/macro.panic.html let matches = match opts.parse(&commandline_args[1..]){ Ok(m) => { m } Err(f) => {panic!(f.to_string())} }; // Handle help flags if matches.opt_present("h"){ let brief = format!("Usage: {} FILE [options]", program); print!("{}", opts.usage(&brief)); return; } else if matches.opt_present("v"){ println!("Version: v{}", VERSION.unwrap_or("unknown")); return; } // Check if the input file has been specified let input = if!matches.free.is_empty(){ matches.free[0].clone() } else { let brief = format!("Usage: {} FILE [options]", program); print!("{}", opts.usage(&brief)); return; }; // Check if the destination is empty - if so, we extract the name from given source path let dest = match matches.opt_str("d") { Some(x) => x, None => extract_file_name_if_empty_string(input.clone()), }; // Get URL to see what type of protocol we're dealing with let url = input.clone(); let url = url.parse::<hyper::Uri>().unwrap(); // Depending on the protocol - call appropriate functions match url.scheme(){ Some("http") => http_download_single_file(url, &dest[..]), Some("https") => https_download_single_file(url, &dest[..]), Some("ftp") => ftp_download_single_file(input, &dest[..]), // Some("ftps") => ftps_download_single_file(input, &dest[..]), Some(&_) => panic!("Sorry, unknown protocol!"), None => panic!("Sorry, no protocol given!"), } } // Download a single file form FTP server // fn ftps_download_single_file(input: std::string::String, destination: &str){ // } // Download a single file form FTP server fn ftp_download_single_file(input: std::string::String, destination: &str){ let (host, directory, file) = parse_data_from_ftp_fullpath(input.clone()); // Create a connection to an FTP server and authenticate to it. let mut ftp_stream = FtpStream::connect(host).unwrap_or_else(|err| panic!("{}", err) ); // Set transfer_type to binary so we can properly transport images let _ = ftp_stream.transfer_type(ftp::types::FileType::Binary); let (user, password) = parse_userdata_from_ftp_fullpath(input); let _ = ftp_stream.login(&user[..], &password[..]).unwrap(); // Change into a new directory, relative to the one we are currently in. let _ = ftp_stream.cwd(&directory[..]).unwrap(); let path = Path::new(destination); let display = path.display(); let reader = ftp_stream.get(&file).unwrap(); let iterator = reader.bytes(); //Open a file in write-only mode, returns `io::Result<File>` let mut local_file = match File::create(&path) { Err(why) => panic!("couldn't create {}: {}", display, why.description()), Ok(file) => file, }; for byte in iterator { // println!("{}", byte.unwrap()); match local_file.write(&[byte.unwrap()]) { Err(why) => { panic!("couldn't write to {}: {}", display, why.description()) }, Ok(_) => (), }; } let _ = local_file.flush(); // -- BufReader, iteracja po byte'ach -- // let mut reader = ftp_stream.get(file).unwrap(); // //Open a file in write-only mode, returns `io::Result<File>` // let mut local_file = match File::create(&path) { // Err(why) => panic!("couldn't create {}: {}", // display, // why.description()), // Ok(file) => file, // }; // loop{ // let chunk = read_n(&mut reader, 5); // match chunk { // Ok(v) => match io::stdout().write_all(&v) { // Err(why) => { // panic!("couldn't write to {}: {}", display, // why.description()) // }, // Ok(_) => (), // }, // Err(0) => return, // Err(_) => panic!("OMG!"), // }; // } // -- simple_retr -- // let remote_file = ftp_stream.simple_retr("file").unwrap(); // println!("Read file with contents\n{}\n", str::from_utf8(&remote_file.into_inner()).unwrap()); // Terminate the connection to the server. let _ = ftp_stream.quit(); } #[allow(dead_code)] fn read_n<R>(reader: R, bytes_to_read: u64) -> Result<Vec<u8>, i32> where R: Read, { let mut buf = vec![]; let mut chunk = reader.take(bytes_to_read); let status = chunk.read_to_end(&mut buf); // Do appropriate error handling match status { Ok(0) => Err(0), Ok(_) => Ok(buf), _ => panic!("Didn't read enough"), } } // Function that uses futures #[allow(dead_code)] #[allow(unused_variables, unused_mut)] fn http_download_single_file_work(url: hyper::Uri, destination: &str){ let mut core = tokio_core::reactor::Core::new().unwrap(); let handle = core.handle(); let client = Client::new(&handle); let work = client.get(url).and_then(|res| { println!("Response: {}", res.status()); println!("Headers: \n{}", res.headers()); res.body().for_each(|chunk| { io::stdout().write_all(&chunk).map_err(From::from) }) }).map(|_| { println!("\n\nDone."); }); core.run(work).unwrap(); } // Function that downloads a single file // It doesnt user futures - blocking and not very effective fn http_download_single_file(url: hyper::Uri, destination: &str){ let mut core = tokio_core::reactor::Core::new().unwrap(); let handle = core.handle(); let client = Client::new(&handle); let work = client.get(url); let reponse = core.run(work).unwrap(); let buf2 = reponse.body().collect(); let finally = match core.run(buf2){ Ok(res) => res, Err(_) => panic!("OMG"), }; let path = Path::new(destination); let display = path.display(); // Open a file in write-only mode, returns `io::Result<File>` let mut file = match File::create(&path) { Err(why) => panic!("couldn't create {}: {}", display, why.description()), Ok(file) => file, }; for x in &finally { match file.write_all(&x) { Err(why) => { panic!("couldn't write to {}: {}", display, why.description()) }, Ok(_) => (), } } println!("successfully wrote to {}", display); } // Function that downloads a single file // It doesnt user futures - blocking and not very effective fn https_download_single_file(url: hyper::Uri, destination: &str){ let mut core = tokio_core::reactor::Core::new().unwrap(); let client = Client::configure().connector(::hyper_tls::HttpsConnector::new(4, &core.handle()).unwrap()).build(&core.handle()); let work = client.get(url); let reponse = core.run(work).unwrap(); let buf2 = reponse.body().collect(); let finally = match core.run(buf2){ Ok(res) => res, Err(_) => panic!("OMG"), }; let path = Path::new(destination); let display = path.display(); // Open a file in write-only mode, returns `io::Result<File>` let mut file = match File::create(&path) { Err(why) => panic!("couldn't create {}: {}", display, why.description()), Ok(file) => file, };
match file.write_all(&x) { Err(why) => { panic!("couldn't write to {}: {}", display, why.description()) }, Ok(_) => (), } } println!("successfully wrote to {}", display); } fn extract_file_name_if_empty_string(fullpath: std::string::String) -> std::string::String { let split: Vec<&str> = fullpath.split("/").collect(); std::string::String::from(*split.last().unwrap()) } fn parse_data_from_ftp_fullpath(input: std::string::String) -> (std::string::String, std::string::String, std::string::String){ let replace = input.replace("ftp://", ""); let split: Vec<&str> = replace.split("/").collect(); let split2 = split.clone(); let split3: Vec<&str> = split2.first().unwrap().split("@").collect(); let host = split3.last().unwrap(); let proper_host = format!("{}:21", host); let file = split.last().unwrap(); let directory = split[1..split.len()-1].join("/"); (proper_host, directory, std::string::String::from(*file)) } fn parse_userdata_from_ftp_fullpath(input: std::string::String) -> (std::string::String, std::string::String){ let replace = input.replace("ftp://", ""); let mut username = std::string::String::new(); let mut password = std::string::String::new(); if replace.contains("@") { let split: Vec<&str> = replace.split("@").collect(); let split2: Vec<&str> = split.first().unwrap().split(":").collect(); username = std::string::String::from(*split2.first().unwrap()).clone(); password = std::string::String::from(*split2.last().unwrap()).clone(); } else { println!("User: "); stdin().read_line(&mut username).expect("Did not enter a correct string"); if let Some('\n')=username.chars().next_back() { username.pop(); } if let Some('\r')=username.chars().next_back() { username.pop(); } println!("Password: "); stdin().read_line(&mut password).expect("Did not enter a correct string"); if let Some('\n')=password.chars().next_back() { password.pop(); } if let Some('\r')=password.chars().next_back() { password.pop(); } } (username, password) }
for x in &finally {
random_line_split
main.rs
extern crate getopts; extern crate hyper; extern crate futures; extern crate tokio_core; extern crate hyper_tls; extern crate pretty_env_logger; extern crate ftp; use std::io::Read; use getopts::Options; use std::str; use std::error::Error; use std::fs::File; use std::path::Path; use std::io::stdin; use std::env; use std::io::{self, Write}; use futures::Future; use futures::stream::Stream; use hyper::Client; use ftp::FtpStream; fn main()
// https://doc.rust-lang.org/std/macro.panic.html let matches = match opts.parse(&commandline_args[1..]){ Ok(m) => { m } Err(f) => {panic!(f.to_string())} }; // Handle help flags if matches.opt_present("h"){ let brief = format!("Usage: {} FILE [options]", program); print!("{}", opts.usage(&brief)); return; } else if matches.opt_present("v"){ println!("Version: v{}", VERSION.unwrap_or("unknown")); return; } // Check if the input file has been specified let input = if!matches.free.is_empty(){ matches.free[0].clone() } else { let brief = format!("Usage: {} FILE [options]", program); print!("{}", opts.usage(&brief)); return; }; // Check if the destination is empty - if so, we extract the name from given source path let dest = match matches.opt_str("d") { Some(x) => x, None => extract_file_name_if_empty_string(input.clone()), }; // Get URL to see what type of protocol we're dealing with let url = input.clone(); let url = url.parse::<hyper::Uri>().unwrap(); // Depending on the protocol - call appropriate functions match url.scheme(){ Some("http") => http_download_single_file(url, &dest[..]), Some("https") => https_download_single_file(url, &dest[..]), Some("ftp") => ftp_download_single_file(input, &dest[..]), // Some("ftps") => ftps_download_single_file(input, &dest[..]), Some(&_) => panic!("Sorry, unknown protocol!"), None => panic!("Sorry, no protocol given!"), } } // Download a single file form FTP server // fn ftps_download_single_file(input: std::string::String, destination: &str){ // } // Download a single file form FTP server fn ftp_download_single_file(input: std::string::String, destination: &str){ let (host, directory, file) = parse_data_from_ftp_fullpath(input.clone()); // Create a connection to an FTP server and authenticate to it. let mut ftp_stream = FtpStream::connect(host).unwrap_or_else(|err| panic!("{}", err) ); // Set transfer_type to binary so we can properly transport images let _ = ftp_stream.transfer_type(ftp::types::FileType::Binary); let (user, password) = parse_userdata_from_ftp_fullpath(input); let _ = ftp_stream.login(&user[..], &password[..]).unwrap(); // Change into a new directory, relative to the one we are currently in. let _ = ftp_stream.cwd(&directory[..]).unwrap(); let path = Path::new(destination); let display = path.display(); let reader = ftp_stream.get(&file).unwrap(); let iterator = reader.bytes(); //Open a file in write-only mode, returns `io::Result<File>` let mut local_file = match File::create(&path) { Err(why) => panic!("couldn't create {}: {}", display, why.description()), Ok(file) => file, }; for byte in iterator { // println!("{}", byte.unwrap()); match local_file.write(&[byte.unwrap()]) { Err(why) => { panic!("couldn't write to {}: {}", display, why.description()) }, Ok(_) => (), }; } let _ = local_file.flush(); // -- BufReader, iteracja po byte'ach -- // let mut reader = ftp_stream.get(file).unwrap(); // //Open a file in write-only mode, returns `io::Result<File>` // let mut local_file = match File::create(&path) { // Err(why) => panic!("couldn't create {}: {}", // display, // why.description()), // Ok(file) => file, // }; // loop{ // let chunk = read_n(&mut reader, 5); // match chunk { // Ok(v) => match io::stdout().write_all(&v) { // Err(why) => { // panic!("couldn't write to {}: {}", display, // why.description()) // }, // Ok(_) => (), // }, // Err(0) => return, // Err(_) => panic!("OMG!"), // }; // } // -- simple_retr -- // let remote_file = ftp_stream.simple_retr("file").unwrap(); // println!("Read file with contents\n{}\n", str::from_utf8(&remote_file.into_inner()).unwrap()); // Terminate the connection to the server. let _ = ftp_stream.quit(); } #[allow(dead_code)] fn read_n<R>(reader: R, bytes_to_read: u64) -> Result<Vec<u8>, i32> where R: Read, { let mut buf = vec![]; let mut chunk = reader.take(bytes_to_read); let status = chunk.read_to_end(&mut buf); // Do appropriate error handling match status { Ok(0) => Err(0), Ok(_) => Ok(buf), _ => panic!("Didn't read enough"), } } // Function that uses futures #[allow(dead_code)] #[allow(unused_variables, unused_mut)] fn http_download_single_file_work(url: hyper::Uri, destination: &str){ let mut core = tokio_core::reactor::Core::new().unwrap(); let handle = core.handle(); let client = Client::new(&handle); let work = client.get(url).and_then(|res| { println!("Response: {}", res.status()); println!("Headers: \n{}", res.headers()); res.body().for_each(|chunk| { io::stdout().write_all(&chunk).map_err(From::from) }) }).map(|_| { println!("\n\nDone."); }); core.run(work).unwrap(); } // Function that downloads a single file // It doesnt user futures - blocking and not very effective fn http_download_single_file(url: hyper::Uri, destination: &str){ let mut core = tokio_core::reactor::Core::new().unwrap(); let handle = core.handle(); let client = Client::new(&handle); let work = client.get(url); let reponse = core.run(work).unwrap(); let buf2 = reponse.body().collect(); let finally = match core.run(buf2){ Ok(res) => res, Err(_) => panic!("OMG"), }; let path = Path::new(destination); let display = path.display(); // Open a file in write-only mode, returns `io::Result<File>` let mut file = match File::create(&path) { Err(why) => panic!("couldn't create {}: {}", display, why.description()), Ok(file) => file, }; for x in &finally { match file.write_all(&x) { Err(why) => { panic!("couldn't write to {}: {}", display, why.description()) }, Ok(_) => (), } } println!("successfully wrote to {}", display); } // Function that downloads a single file // It doesnt user futures - blocking and not very effective fn https_download_single_file(url: hyper::Uri, destination: &str){ let mut core = tokio_core::reactor::Core::new().unwrap(); let client = Client::configure().connector(::hyper_tls::HttpsConnector::new(4, &core.handle()).unwrap()).build(&core.handle()); let work = client.get(url); let reponse = core.run(work).unwrap(); let buf2 = reponse.body().collect(); let finally = match core.run(buf2){ Ok(res) => res, Err(_) => panic!("OMG"), }; let path = Path::new(destination); let display = path.display(); // Open a file in write-only mode, returns `io::Result<File>` let mut file = match File::create(&path) { Err(why) => panic!("couldn't create {}: {}", display, why.description()), Ok(file) => file, }; for x in &finally { match file.write_all(&x) { Err(why) => { panic!("couldn't write to {}: {}", display, why.description()) }, Ok(_) => (), } } println!("successfully wrote to {}", display); } fn extract_file_name_if_empty_string(fullpath: std::string::String) -> std::string::String { let split: Vec<&str> = fullpath.split("/").collect(); std::string::String::from(*split.last().unwrap()) } fn parse_data_from_ftp_fullpath(input: std::string::String) -> (std::string::String, std::string::String, std::string::String){ let replace = input.replace("ftp://", ""); let split: Vec<&str> = replace.split("/").collect(); let split2 = split.clone(); let split3: Vec<&str> = split2.first().unwrap().split("@").collect(); let host = split3.last().unwrap(); let proper_host = format!("{}:21", host); let file = split.last().unwrap(); let directory = split[1..split.len()-1].join("/"); (proper_host, directory, std::string::String::from(*file)) } fn parse_userdata_from_ftp_fullpath(input: std::string::String) -> (std::string::String, std::string::String){ let replace = input.replace("ftp://", ""); let mut username = std::string::String::new(); let mut password = std::string::String::new(); if replace.contains("@") { let split: Vec<&str> = replace.split("@").collect(); let split2: Vec<&str> = split.first().unwrap().split(":").collect(); username = std::string::String::from(*split2.first().unwrap()).clone(); password = std::string::String::from(*split2.last().unwrap()).clone(); } else { println!("User: "); stdin().read_line(&mut username).expect("Did not enter a correct string"); if let Some('\n')=username.chars().next_back() { username.pop(); } if let Some('\r')=username.chars().next_back() { username.pop(); } println!("Password: "); stdin().read_line(&mut password).expect("Did not enter a correct string"); if let Some('\n')=password.chars().next_back() { password.pop(); } if let Some('\r')=password.chars().next_back() { password.pop(); } } (username, password) }
{ const VERSION: Option<&'static str> = option_env!("CARGO_PKG_VERSION"); pretty_env_logger::init().unwrap(); // Using args() instead of args_os(), cause they never panic let commandline_args: Vec<_> = env::args().collect(); let program = commandline_args[0].clone(); // Use the getopts package Options structure let mut opts = Options::new(); // Create the file argument opts.optopt("d", "", "Specify destination file", "NAME"); // Create help flag (-h or --help) opts.optflag("h", "help", "Print this help menu"); // Create version l opts.optflag("v", "version", "Check the version you're running"); // Use the innate parse() method // https://doc.rust-lang.org/1.2.0/book/match.html
identifier_body
main.rs
extern crate getopts; extern crate hyper; extern crate futures; extern crate tokio_core; extern crate hyper_tls; extern crate pretty_env_logger; extern crate ftp; use std::io::Read; use getopts::Options; use std::str; use std::error::Error; use std::fs::File; use std::path::Path; use std::io::stdin; use std::env; use std::io::{self, Write}; use futures::Future; use futures::stream::Stream; use hyper::Client; use ftp::FtpStream; fn main() { const VERSION: Option<&'static str> = option_env!("CARGO_PKG_VERSION"); pretty_env_logger::init().unwrap(); // Using args() instead of args_os(), cause they never panic let commandline_args: Vec<_> = env::args().collect(); let program = commandline_args[0].clone(); // Use the getopts package Options structure let mut opts = Options::new(); // Create the file argument opts.optopt("d", "", "Specify destination file", "NAME"); // Create help flag (-h or --help) opts.optflag("h", "help", "Print this help menu"); // Create version l opts.optflag("v", "version", "Check the version you're running"); // Use the innate parse() method // https://doc.rust-lang.org/1.2.0/book/match.html // https://doc.rust-lang.org/std/macro.panic.html let matches = match opts.parse(&commandline_args[1..]){ Ok(m) => { m } Err(f) => {panic!(f.to_string())} }; // Handle help flags if matches.opt_present("h"){ let brief = format!("Usage: {} FILE [options]", program); print!("{}", opts.usage(&brief)); return; } else if matches.opt_present("v"){ println!("Version: v{}", VERSION.unwrap_or("unknown")); return; } // Check if the input file has been specified let input = if!matches.free.is_empty(){ matches.free[0].clone() } else { let brief = format!("Usage: {} FILE [options]", program); print!("{}", opts.usage(&brief)); return; }; // Check if the destination is empty - if so, we extract the name from given source path let dest = match matches.opt_str("d") { Some(x) => x, None => extract_file_name_if_empty_string(input.clone()), }; // Get URL to see what type of protocol we're dealing with let url = input.clone(); let url = url.parse::<hyper::Uri>().unwrap(); // Depending on the protocol - call appropriate functions match url.scheme(){ Some("http") => http_download_single_file(url, &dest[..]), Some("https") => https_download_single_file(url, &dest[..]), Some("ftp") => ftp_download_single_file(input, &dest[..]), // Some("ftps") => ftps_download_single_file(input, &dest[..]), Some(&_) => panic!("Sorry, unknown protocol!"), None => panic!("Sorry, no protocol given!"), } } // Download a single file form FTP server // fn ftps_download_single_file(input: std::string::String, destination: &str){ // } // Download a single file form FTP server fn ftp_download_single_file(input: std::string::String, destination: &str){ let (host, directory, file) = parse_data_from_ftp_fullpath(input.clone()); // Create a connection to an FTP server and authenticate to it. let mut ftp_stream = FtpStream::connect(host).unwrap_or_else(|err| panic!("{}", err) ); // Set transfer_type to binary so we can properly transport images let _ = ftp_stream.transfer_type(ftp::types::FileType::Binary); let (user, password) = parse_userdata_from_ftp_fullpath(input); let _ = ftp_stream.login(&user[..], &password[..]).unwrap(); // Change into a new directory, relative to the one we are currently in. let _ = ftp_stream.cwd(&directory[..]).unwrap(); let path = Path::new(destination); let display = path.display(); let reader = ftp_stream.get(&file).unwrap(); let iterator = reader.bytes(); //Open a file in write-only mode, returns `io::Result<File>` let mut local_file = match File::create(&path) { Err(why) => panic!("couldn't create {}: {}", display, why.description()), Ok(file) => file, }; for byte in iterator { // println!("{}", byte.unwrap()); match local_file.write(&[byte.unwrap()]) { Err(why) => { panic!("couldn't write to {}: {}", display, why.description()) }, Ok(_) => (), }; } let _ = local_file.flush(); // -- BufReader, iteracja po byte'ach -- // let mut reader = ftp_stream.get(file).unwrap(); // //Open a file in write-only mode, returns `io::Result<File>` // let mut local_file = match File::create(&path) { // Err(why) => panic!("couldn't create {}: {}", // display, // why.description()), // Ok(file) => file, // }; // loop{ // let chunk = read_n(&mut reader, 5); // match chunk { // Ok(v) => match io::stdout().write_all(&v) { // Err(why) => { // panic!("couldn't write to {}: {}", display, // why.description()) // }, // Ok(_) => (), // }, // Err(0) => return, // Err(_) => panic!("OMG!"), // }; // } // -- simple_retr -- // let remote_file = ftp_stream.simple_retr("file").unwrap(); // println!("Read file with contents\n{}\n", str::from_utf8(&remote_file.into_inner()).unwrap()); // Terminate the connection to the server. let _ = ftp_stream.quit(); } #[allow(dead_code)] fn read_n<R>(reader: R, bytes_to_read: u64) -> Result<Vec<u8>, i32> where R: Read, { let mut buf = vec![]; let mut chunk = reader.take(bytes_to_read); let status = chunk.read_to_end(&mut buf); // Do appropriate error handling match status { Ok(0) => Err(0), Ok(_) => Ok(buf), _ => panic!("Didn't read enough"), } } // Function that uses futures #[allow(dead_code)] #[allow(unused_variables, unused_mut)] fn http_download_single_file_work(url: hyper::Uri, destination: &str){ let mut core = tokio_core::reactor::Core::new().unwrap(); let handle = core.handle(); let client = Client::new(&handle); let work = client.get(url).and_then(|res| { println!("Response: {}", res.status()); println!("Headers: \n{}", res.headers()); res.body().for_each(|chunk| { io::stdout().write_all(&chunk).map_err(From::from) }) }).map(|_| { println!("\n\nDone."); }); core.run(work).unwrap(); } // Function that downloads a single file // It doesnt user futures - blocking and not very effective fn http_download_single_file(url: hyper::Uri, destination: &str){ let mut core = tokio_core::reactor::Core::new().unwrap(); let handle = core.handle(); let client = Client::new(&handle); let work = client.get(url); let reponse = core.run(work).unwrap(); let buf2 = reponse.body().collect(); let finally = match core.run(buf2){ Ok(res) => res, Err(_) => panic!("OMG"), }; let path = Path::new(destination); let display = path.display(); // Open a file in write-only mode, returns `io::Result<File>` let mut file = match File::create(&path) { Err(why) => panic!("couldn't create {}: {}", display, why.description()), Ok(file) => file, }; for x in &finally { match file.write_all(&x) { Err(why) => { panic!("couldn't write to {}: {}", display, why.description()) }, Ok(_) => (), } } println!("successfully wrote to {}", display); } // Function that downloads a single file // It doesnt user futures - blocking and not very effective fn
(url: hyper::Uri, destination: &str){ let mut core = tokio_core::reactor::Core::new().unwrap(); let client = Client::configure().connector(::hyper_tls::HttpsConnector::new(4, &core.handle()).unwrap()).build(&core.handle()); let work = client.get(url); let reponse = core.run(work).unwrap(); let buf2 = reponse.body().collect(); let finally = match core.run(buf2){ Ok(res) => res, Err(_) => panic!("OMG"), }; let path = Path::new(destination); let display = path.display(); // Open a file in write-only mode, returns `io::Result<File>` let mut file = match File::create(&path) { Err(why) => panic!("couldn't create {}: {}", display, why.description()), Ok(file) => file, }; for x in &finally { match file.write_all(&x) { Err(why) => { panic!("couldn't write to {}: {}", display, why.description()) }, Ok(_) => (), } } println!("successfully wrote to {}", display); } fn extract_file_name_if_empty_string(fullpath: std::string::String) -> std::string::String { let split: Vec<&str> = fullpath.split("/").collect(); std::string::String::from(*split.last().unwrap()) } fn parse_data_from_ftp_fullpath(input: std::string::String) -> (std::string::String, std::string::String, std::string::String){ let replace = input.replace("ftp://", ""); let split: Vec<&str> = replace.split("/").collect(); let split2 = split.clone(); let split3: Vec<&str> = split2.first().unwrap().split("@").collect(); let host = split3.last().unwrap(); let proper_host = format!("{}:21", host); let file = split.last().unwrap(); let directory = split[1..split.len()-1].join("/"); (proper_host, directory, std::string::String::from(*file)) } fn parse_userdata_from_ftp_fullpath(input: std::string::String) -> (std::string::String, std::string::String){ let replace = input.replace("ftp://", ""); let mut username = std::string::String::new(); let mut password = std::string::String::new(); if replace.contains("@") { let split: Vec<&str> = replace.split("@").collect(); let split2: Vec<&str> = split.first().unwrap().split(":").collect(); username = std::string::String::from(*split2.first().unwrap()).clone(); password = std::string::String::from(*split2.last().unwrap()).clone(); } else { println!("User: "); stdin().read_line(&mut username).expect("Did not enter a correct string"); if let Some('\n')=username.chars().next_back() { username.pop(); } if let Some('\r')=username.chars().next_back() { username.pop(); } println!("Password: "); stdin().read_line(&mut password).expect("Did not enter a correct string"); if let Some('\n')=password.chars().next_back() { password.pop(); } if let Some('\r')=password.chars().next_back() { password.pop(); } } (username, password) }
https_download_single_file
identifier_name
update_webhook_message.rs
//! Update a message created by a webhook via execution. use crate::{ client::Client, error::Error as HttpError, request::{ self, validate_inner::{self, ComponentValidationError, ComponentValidationErrorType}, AuditLogReason, AuditLogReasonError, Form, NullableField, Request, }, response::{marker::EmptyBody, ResponseFuture}, routing::Route, }; use serde::Serialize; use std::{ error::Error, fmt::{Display, Formatter, Result as FmtResult}, }; use twilight_model::{ application::component::Component, channel::{embed::Embed, message::AllowedMentions, Attachment}, id::{MessageId, WebhookId}, }; /// A webhook's message can not be updated as configured. #[derive(Debug)] pub struct UpdateWebhookMessageError { kind: UpdateWebhookMessageErrorType, source: Option<Box<dyn Error + Send + Sync>>, } impl UpdateWebhookMessageError { /// Immutable reference to the type of error that occurred. #[must_use = "retrieving the type has no effect if left unused"] pub const fn kind(&self) -> &UpdateWebhookMessageErrorType { &self.kind } /// Consume the error, returning the source error if there is any. #[must_use = "consuming the error and retrieving the source has no effect if left unused"] pub fn into_source(self) -> Option<Box<dyn Error + Send + Sync>> { self.source } /// Consume the error, returning the owned error type and the source error. #[must_use = "consuming the error into its parts has no effect if left unused"] pub fn
( self, ) -> ( UpdateWebhookMessageErrorType, Option<Box<dyn Error + Send + Sync>>, ) { (self.kind, self.source) } } impl Display for UpdateWebhookMessageError { fn fmt(&self, f: &mut Formatter<'_>) -> FmtResult { match &self.kind { UpdateWebhookMessageErrorType::ComponentCount { count } => { Display::fmt(count, f)?; f.write_str(" components were provided, but only ")?; Display::fmt(&ComponentValidationError::COMPONENT_COUNT, f)?; f.write_str(" root components are allowed") } UpdateWebhookMessageErrorType::ComponentInvalid {.. } => { f.write_str("a provided component is invalid") } UpdateWebhookMessageErrorType::ContentInvalid => { f.write_str("message content is invalid") } UpdateWebhookMessageErrorType::EmbedTooLarge {.. } => { f.write_str("length of one of the embeds is too large") } UpdateWebhookMessageErrorType::TooManyEmbeds => { f.write_str("only 10 embeds may be provided") } } } } impl Error for UpdateWebhookMessageError { fn source(&self) -> Option<&(dyn Error +'static)> { self.source .as_ref() .map(|source| &**source as &(dyn Error +'static)) } } /// Type of [`UpdateWebhookMessageError`] that occurred. #[derive(Debug)] #[non_exhaustive] pub enum UpdateWebhookMessageErrorType { /// Content is over 2000 UTF-16 characters. ContentInvalid, /// Length of one of the embeds is over 6000 characters. EmbedTooLarge { /// Index of the embed that was too large. /// /// This can be used to index into the provided embeds to retrieve the /// invalid embed. index: usize, }, /// An invalid message component was provided. ComponentInvalid { /// Additional details about the validation failure type. kind: ComponentValidationErrorType, }, /// Too many message components were provided. ComponentCount { /// Number of components that were provided. count: usize, }, /// Too many embeds were provided. /// /// A webhook can have up to 10 embeds. TooManyEmbeds, } #[derive(Serialize)] struct UpdateWebhookMessageFields<'a> { #[serde(skip_serializing_if = "Option::is_none")] allowed_mentions: Option<AllowedMentions>, #[serde(skip_serializing_if = "request::slice_is_empty")] attachments: &'a [Attachment], #[serde(skip_serializing_if = "Option::is_none")] components: Option<NullableField<&'a [Component]>>, #[serde(skip_serializing_if = "Option::is_none")] content: Option<NullableField<&'a str>>, #[serde(skip_serializing_if = "Option::is_none")] embeds: Option<NullableField<&'a [Embed]>>, #[serde(skip_serializing_if = "Option::is_none")] payload_json: Option<&'a [u8]>, } /// Update a message created by a webhook. /// /// A webhook's message must always have at least one embed or some amount of /// content. If you wish to delete a webhook's message refer to /// [`DeleteWebhookMessage`]. /// /// # Examples /// /// Update a webhook's message by setting the content to `test <@3>` - /// attempting to mention user ID 3 - and specifying that only that the user may /// not be mentioned. /// /// ```no_run /// # use twilight_http::Client; /// use twilight_model::{ /// channel::message::AllowedMentions, /// id::{MessageId, WebhookId} /// }; /// /// # #[tokio::main] /// # async fn main() -> Result<(), Box<dyn std::error::Error>> { /// # let client = Client::new("token".to_owned()); /// client.update_webhook_message(WebhookId(1), "token here", MessageId(2)) /// // By creating a default set of allowed mentions, no entity can be /// // mentioned. /// .allowed_mentions(AllowedMentions::default()) /// .content(Some("test <@3>"))? /// .exec() /// .await?; /// # Ok(()) } /// ``` /// /// [`DeleteWebhookMessage`]: super::DeleteWebhookMessage #[must_use = "requests must be configured and executed"] pub struct UpdateWebhookMessage<'a> { fields: UpdateWebhookMessageFields<'a>, files: &'a [(&'a str, &'a [u8])], http: &'a Client, message_id: MessageId, reason: Option<&'a str>, token: &'a str, webhook_id: WebhookId, } impl<'a> UpdateWebhookMessage<'a> { /// Maximum number of embeds that a webhook's message may have. pub const EMBED_COUNT_LIMIT: usize = 10; pub(crate) const fn new( http: &'a Client, webhook_id: WebhookId, token: &'a str, message_id: MessageId, ) -> Self { Self { fields: UpdateWebhookMessageFields { allowed_mentions: None, attachments: &[], components: None, content: None, embeds: None, payload_json: None, }, files: &[], http, message_id, reason: None, token, webhook_id, } } /// Set the allowed mentions in the message. pub fn allowed_mentions(mut self, allowed: AllowedMentions) -> Self { self.fields.allowed_mentions.replace(allowed); self } /// Specify multiple attachments already present in the target message to keep. /// /// If called, all unspecified attachments will be removed from the message. /// If not called, all attachments will be kept. pub const fn attachments(mut self, attachments: &'a [Attachment]) -> Self { self.fields.attachments = attachments; self } /// Add multiple [`Component`]s to a message. /// /// Calling this method multiple times will clear previous calls. /// /// Pass `None` to clear existing components. /// /// # Errors /// /// Returns an [`UpdateWebhookMessageErrorType::ComponentCount`] error /// type if too many components are provided. /// /// Returns an [`UpdateWebhookMessageErrorType::ComponentInvalid`] error /// type if one of the provided components is invalid. pub fn components( mut self, components: Option<&'a [Component]>, ) -> Result<Self, UpdateWebhookMessageError> { if let Some(components) = components.as_ref() { validate_inner::components(components).map_err(|source| { let (kind, inner_source) = source.into_parts(); match kind { ComponentValidationErrorType::ComponentCount { count } => { UpdateWebhookMessageError { kind: UpdateWebhookMessageErrorType::ComponentCount { count }, source: inner_source, } } other => UpdateWebhookMessageError { kind: UpdateWebhookMessageErrorType::ComponentInvalid { kind: other }, source: inner_source, }, } })?; } self.fields.components = Some(NullableField(components)); Ok(self) } /// Set the content of the message. /// /// Pass `None` if you want to remove the message content. /// /// Note that if there is are no embeds then you will not be able to remove /// the content of the message. /// /// The maximum length is 2000 UTF-16 characters. /// /// # Errors /// /// Returns an [`UpdateWebhookMessageErrorType::ContentInvalid`] error type if /// the content length is too long. pub fn content(mut self, content: Option<&'a str>) -> Result<Self, UpdateWebhookMessageError> { if let Some(content_ref) = content { if!validate_inner::content_limit(content_ref) { return Err(UpdateWebhookMessageError { kind: UpdateWebhookMessageErrorType::ContentInvalid, source: None, }); } } self.fields.content = Some(NullableField(content)); Ok(self) } /// Set the list of embeds of the webhook's message. /// /// Pass `None` to remove all of the embeds. /// /// The maximum number of allowed embeds is defined by /// [`EMBED_COUNT_LIMIT`]. /// /// The total character length of each embed must not exceed 6000 /// characters. Additionally, the internal fields also have character /// limits. Refer to [the discord docs] for more information. /// /// # Examples /// /// Create an embed and update the message with the new embed. The content /// of the original message is unaffected and only the embed(s) are /// modified. /// /// ```no_run /// # use twilight_http::Client; /// use twilight_embed_builder::EmbedBuilder; /// use twilight_model::id::{MessageId, WebhookId}; /// /// # #[tokio::main] async fn main() -> Result<(), Box<dyn std::error::Error>> { /// # let client = Client::new("token".to_owned()); /// let embed = EmbedBuilder::new() /// .description("Powerful, flexible, and scalable ecosystem of Rust libraries for the Discord API.") /// .title("Twilight") /// .url("https://twilight.rs") /// .build()?; /// /// client.update_webhook_message(WebhookId(1), "token", MessageId(2)) /// .embeds(Some(&[embed]))? /// .exec() /// .await?; /// # Ok(()) } /// ``` /// /// # Errors /// /// Returns an [`UpdateWebhookMessageErrorType::EmbedTooLarge`] error type /// if one of the embeds are too large. /// /// Returns an [`UpdateWebhookMessageErrorType::TooManyEmbeds`] error type /// if more than 10 embeds are provided. /// /// [the discord docs]: https://discord.com/developers/docs/resources/channel#embed-limits /// [`EMBED_COUNT_LIMIT`]: Self::EMBED_COUNT_LIMIT pub fn embeds( mut self, embeds: Option<&'a [Embed]>, ) -> Result<Self, UpdateWebhookMessageError> { if let Some(embeds_present) = embeds.as_deref() { if embeds_present.len() > Self::EMBED_COUNT_LIMIT { return Err(UpdateWebhookMessageError { kind: UpdateWebhookMessageErrorType::TooManyEmbeds, source: None, }); } for (idx, embed) in embeds_present.iter().enumerate() { if let Err(source) = validate_inner::embed(embed) { return Err(UpdateWebhookMessageError { kind: UpdateWebhookMessageErrorType::EmbedTooLarge { index: idx }, source: Some(Box::new(source)), }); } } } self.fields.embeds = Some(NullableField(embeds)); Ok(self) } /// Attach multiple files to the webhook. /// /// Calling this method will clear any previous calls. pub const fn files(mut self, files: &'a [(&'a str, &'a [u8])]) -> Self { self.files = files; self } /// JSON encoded body of any additional request fields. /// /// If this method is called, all other fields are ignored, except for /// [`files`]. See [Discord Docs/Create Message] and /// [`ExecuteWebhook::payload_json`]. /// /// [`files`]: Self::files /// [`ExecuteWebhook::payload_json`]: super::ExecuteWebhook::payload_json /// [Discord Docs/Create Message]: https://discord.com/developers/docs/resources/channel#create-message-params pub const fn payload_json(mut self, payload_json: &'a [u8]) -> Self { self.fields.payload_json = Some(payload_json); self } // `self` needs to be consumed and the client returned due to parameters // being consumed in request construction. fn request(&mut self) -> Result<Request, HttpError> { let mut request = Request::builder(&Route::UpdateWebhookMessage { message_id: self.message_id.0, token: self.token, webhook_id: self.webhook_id.0, }) .use_authorization_token(false); if!self.files.is_empty() || self.fields.payload_json.is_some() { let mut form = Form::new(); for (index, (name, file)) in self.files.iter().enumerate() { form.file(format!("{}", index).as_bytes(), name.as_bytes(), file); } if let Some(payload_json) = &self.fields.payload_json { form.payload_json(payload_json); } else { if self.fields.allowed_mentions.is_none() { self.fields.allowed_mentions = self.http.default_allowed_mentions(); } let body = crate::json::to_vec(&self.fields).map_err(HttpError::json)?; form.payload_json(&body); } request = request.form(form); } else { if self.fields.allowed_mentions.is_none() { self.fields.allowed_mentions = self.http.default_allowed_mentions(); } request = request.json(&self.fields)?; } if let Some(reason) = self.reason.as_ref() { request = request.headers(request::audit_header(reason)?); } Ok(request.build()) } /// Execute the request, returning a future resolving to a [`Response`]. /// /// [`Response`]: crate::response::Response pub fn exec(mut self) -> ResponseFuture<EmptyBody> { match self.request() { Ok(request) => self.http.request(request), Err(source) => ResponseFuture::error(source), } } } impl<'a> AuditLogReason<'a> for UpdateWebhookMessage<'a> { fn reason(mut self, reason: &'a str) -> Result<Self, AuditLogReasonError> { self.reason.replace(AuditLogReasonError::validate(reason)?); Ok(self) } } #[cfg(test)] mod tests { use super::{UpdateWebhookMessage, UpdateWebhookMessageFields}; use crate::{ client::Client, request::{AuditLogReason, NullableField, Request}, routing::Route, }; use twilight_model::id::{MessageId, WebhookId}; #[test] fn test_request() { let client = Client::new("token".to_owned()); let mut builder = UpdateWebhookMessage::new(&client, WebhookId(1), "token", MessageId(2)) .content(Some("test")) .expect("'test' content couldn't be set") .reason("reason") .expect("'reason' is not a valid reason"); let actual = builder.request().expect("failed to create request"); let body = UpdateWebhookMessageFields { allowed_mentions: None, attachments: &[], components: None, content: Some(NullableField(Some("test"))), embeds: None, payload_json: None, }; let route = Route::UpdateWebhookMessage { message_id: 2, token: "token", webhook_id: 1, }; let expected = Request::builder(&route) .json(&body) .expect("failed to serialize body") .build(); assert_eq!(expected.body, actual.body); assert_eq!(expected.path, actual.path); } }
into_parts
identifier_name
update_webhook_message.rs
//! Update a message created by a webhook via execution. use crate::{ client::Client, error::Error as HttpError, request::{ self, validate_inner::{self, ComponentValidationError, ComponentValidationErrorType}, AuditLogReason, AuditLogReasonError, Form, NullableField, Request, }, response::{marker::EmptyBody, ResponseFuture}, routing::Route, }; use serde::Serialize; use std::{ error::Error, fmt::{Display, Formatter, Result as FmtResult}, }; use twilight_model::{ application::component::Component, channel::{embed::Embed, message::AllowedMentions, Attachment}, id::{MessageId, WebhookId}, }; /// A webhook's message can not be updated as configured. #[derive(Debug)] pub struct UpdateWebhookMessageError { kind: UpdateWebhookMessageErrorType, source: Option<Box<dyn Error + Send + Sync>>, } impl UpdateWebhookMessageError { /// Immutable reference to the type of error that occurred. #[must_use = "retrieving the type has no effect if left unused"] pub const fn kind(&self) -> &UpdateWebhookMessageErrorType { &self.kind } /// Consume the error, returning the source error if there is any. #[must_use = "consuming the error and retrieving the source has no effect if left unused"] pub fn into_source(self) -> Option<Box<dyn Error + Send + Sync>> { self.source } /// Consume the error, returning the owned error type and the source error. #[must_use = "consuming the error into its parts has no effect if left unused"] pub fn into_parts( self, ) -> ( UpdateWebhookMessageErrorType, Option<Box<dyn Error + Send + Sync>>, ) { (self.kind, self.source) } } impl Display for UpdateWebhookMessageError { fn fmt(&self, f: &mut Formatter<'_>) -> FmtResult { match &self.kind { UpdateWebhookMessageErrorType::ComponentCount { count } => { Display::fmt(count, f)?; f.write_str(" components were provided, but only ")?; Display::fmt(&ComponentValidationError::COMPONENT_COUNT, f)?; f.write_str(" root components are allowed") } UpdateWebhookMessageErrorType::ComponentInvalid {.. } => { f.write_str("a provided component is invalid") } UpdateWebhookMessageErrorType::ContentInvalid => { f.write_str("message content is invalid") } UpdateWebhookMessageErrorType::EmbedTooLarge {.. } => { f.write_str("length of one of the embeds is too large") } UpdateWebhookMessageErrorType::TooManyEmbeds => { f.write_str("only 10 embeds may be provided") } } } } impl Error for UpdateWebhookMessageError { fn source(&self) -> Option<&(dyn Error +'static)> { self.source .as_ref() .map(|source| &**source as &(dyn Error +'static)) } } /// Type of [`UpdateWebhookMessageError`] that occurred. #[derive(Debug)] #[non_exhaustive] pub enum UpdateWebhookMessageErrorType { /// Content is over 2000 UTF-16 characters. ContentInvalid, /// Length of one of the embeds is over 6000 characters. EmbedTooLarge { /// Index of the embed that was too large. /// /// This can be used to index into the provided embeds to retrieve the /// invalid embed. index: usize, }, /// An invalid message component was provided. ComponentInvalid { /// Additional details about the validation failure type. kind: ComponentValidationErrorType, }, /// Too many message components were provided. ComponentCount { /// Number of components that were provided. count: usize, }, /// Too many embeds were provided. /// /// A webhook can have up to 10 embeds. TooManyEmbeds, } #[derive(Serialize)] struct UpdateWebhookMessageFields<'a> { #[serde(skip_serializing_if = "Option::is_none")] allowed_mentions: Option<AllowedMentions>, #[serde(skip_serializing_if = "request::slice_is_empty")] attachments: &'a [Attachment], #[serde(skip_serializing_if = "Option::is_none")] components: Option<NullableField<&'a [Component]>>, #[serde(skip_serializing_if = "Option::is_none")] content: Option<NullableField<&'a str>>, #[serde(skip_serializing_if = "Option::is_none")] embeds: Option<NullableField<&'a [Embed]>>, #[serde(skip_serializing_if = "Option::is_none")] payload_json: Option<&'a [u8]>, } /// Update a message created by a webhook. /// /// A webhook's message must always have at least one embed or some amount of /// content. If you wish to delete a webhook's message refer to /// [`DeleteWebhookMessage`]. /// /// # Examples /// /// Update a webhook's message by setting the content to `test <@3>` - /// attempting to mention user ID 3 - and specifying that only that the user may /// not be mentioned. /// /// ```no_run /// # use twilight_http::Client; /// use twilight_model::{ /// channel::message::AllowedMentions, /// id::{MessageId, WebhookId} /// }; /// /// # #[tokio::main] /// # async fn main() -> Result<(), Box<dyn std::error::Error>> { /// # let client = Client::new("token".to_owned()); /// client.update_webhook_message(WebhookId(1), "token here", MessageId(2)) /// // By creating a default set of allowed mentions, no entity can be /// // mentioned. /// .allowed_mentions(AllowedMentions::default()) /// .content(Some("test <@3>"))? /// .exec() /// .await?; /// # Ok(()) } /// ``` /// /// [`DeleteWebhookMessage`]: super::DeleteWebhookMessage #[must_use = "requests must be configured and executed"] pub struct UpdateWebhookMessage<'a> { fields: UpdateWebhookMessageFields<'a>, files: &'a [(&'a str, &'a [u8])], http: &'a Client, message_id: MessageId, reason: Option<&'a str>, token: &'a str, webhook_id: WebhookId, } impl<'a> UpdateWebhookMessage<'a> { /// Maximum number of embeds that a webhook's message may have. pub const EMBED_COUNT_LIMIT: usize = 10; pub(crate) const fn new( http: &'a Client, webhook_id: WebhookId, token: &'a str, message_id: MessageId, ) -> Self { Self { fields: UpdateWebhookMessageFields { allowed_mentions: None, attachments: &[], components: None, content: None, embeds: None, payload_json: None, }, files: &[], http, message_id, reason: None, token, webhook_id, } } /// Set the allowed mentions in the message. pub fn allowed_mentions(mut self, allowed: AllowedMentions) -> Self { self.fields.allowed_mentions.replace(allowed); self } /// Specify multiple attachments already present in the target message to keep. /// /// If called, all unspecified attachments will be removed from the message. /// If not called, all attachments will be kept. pub const fn attachments(mut self, attachments: &'a [Attachment]) -> Self { self.fields.attachments = attachments; self } /// Add multiple [`Component`]s to a message. /// /// Calling this method multiple times will clear previous calls. /// /// Pass `None` to clear existing components. /// /// # Errors /// /// Returns an [`UpdateWebhookMessageErrorType::ComponentCount`] error /// type if too many components are provided. /// /// Returns an [`UpdateWebhookMessageErrorType::ComponentInvalid`] error /// type if one of the provided components is invalid. pub fn components( mut self, components: Option<&'a [Component]>, ) -> Result<Self, UpdateWebhookMessageError> { if let Some(components) = components.as_ref() { validate_inner::components(components).map_err(|source| { let (kind, inner_source) = source.into_parts(); match kind { ComponentValidationErrorType::ComponentCount { count } => { UpdateWebhookMessageError { kind: UpdateWebhookMessageErrorType::ComponentCount { count }, source: inner_source, } } other => UpdateWebhookMessageError { kind: UpdateWebhookMessageErrorType::ComponentInvalid { kind: other }, source: inner_source, }, } })?; } self.fields.components = Some(NullableField(components)); Ok(self) } /// Set the content of the message. /// /// Pass `None` if you want to remove the message content. /// /// Note that if there is are no embeds then you will not be able to remove /// the content of the message. /// /// The maximum length is 2000 UTF-16 characters. /// /// # Errors /// /// Returns an [`UpdateWebhookMessageErrorType::ContentInvalid`] error type if /// the content length is too long. pub fn content(mut self, content: Option<&'a str>) -> Result<Self, UpdateWebhookMessageError> { if let Some(content_ref) = content { if!validate_inner::content_limit(content_ref) { return Err(UpdateWebhookMessageError { kind: UpdateWebhookMessageErrorType::ContentInvalid, source: None, }); } } self.fields.content = Some(NullableField(content)); Ok(self) } /// Set the list of embeds of the webhook's message. /// /// Pass `None` to remove all of the embeds. /// /// The maximum number of allowed embeds is defined by /// [`EMBED_COUNT_LIMIT`]. /// /// The total character length of each embed must not exceed 6000 /// characters. Additionally, the internal fields also have character /// limits. Refer to [the discord docs] for more information. /// /// # Examples /// /// Create an embed and update the message with the new embed. The content /// of the original message is unaffected and only the embed(s) are /// modified. /// /// ```no_run /// # use twilight_http::Client; /// use twilight_embed_builder::EmbedBuilder; /// use twilight_model::id::{MessageId, WebhookId}; /// /// # #[tokio::main] async fn main() -> Result<(), Box<dyn std::error::Error>> { /// # let client = Client::new("token".to_owned()); /// let embed = EmbedBuilder::new() /// .description("Powerful, flexible, and scalable ecosystem of Rust libraries for the Discord API.") /// .title("Twilight") /// .url("https://twilight.rs") /// .build()?; /// /// client.update_webhook_message(WebhookId(1), "token", MessageId(2)) /// .embeds(Some(&[embed]))? /// .exec() /// .await?; /// # Ok(()) } /// ``` /// /// # Errors /// /// Returns an [`UpdateWebhookMessageErrorType::EmbedTooLarge`] error type /// if one of the embeds are too large. /// /// Returns an [`UpdateWebhookMessageErrorType::TooManyEmbeds`] error type /// if more than 10 embeds are provided. /// /// [the discord docs]: https://discord.com/developers/docs/resources/channel#embed-limits /// [`EMBED_COUNT_LIMIT`]: Self::EMBED_COUNT_LIMIT pub fn embeds( mut self, embeds: Option<&'a [Embed]>, ) -> Result<Self, UpdateWebhookMessageError> { if let Some(embeds_present) = embeds.as_deref() { if embeds_present.len() > Self::EMBED_COUNT_LIMIT { return Err(UpdateWebhookMessageError { kind: UpdateWebhookMessageErrorType::TooManyEmbeds, source: None, }); } for (idx, embed) in embeds_present.iter().enumerate() { if let Err(source) = validate_inner::embed(embed) { return Err(UpdateWebhookMessageError { kind: UpdateWebhookMessageErrorType::EmbedTooLarge { index: idx }, source: Some(Box::new(source)), }); } } } self.fields.embeds = Some(NullableField(embeds)); Ok(self) } /// Attach multiple files to the webhook. /// /// Calling this method will clear any previous calls. pub const fn files(mut self, files: &'a [(&'a str, &'a [u8])]) -> Self { self.files = files; self } /// JSON encoded body of any additional request fields. /// /// If this method is called, all other fields are ignored, except for /// [`files`]. See [Discord Docs/Create Message] and /// [`ExecuteWebhook::payload_json`]. /// /// [`files`]: Self::files /// [`ExecuteWebhook::payload_json`]: super::ExecuteWebhook::payload_json /// [Discord Docs/Create Message]: https://discord.com/developers/docs/resources/channel#create-message-params pub const fn payload_json(mut self, payload_json: &'a [u8]) -> Self
// `self` needs to be consumed and the client returned due to parameters // being consumed in request construction. fn request(&mut self) -> Result<Request, HttpError> { let mut request = Request::builder(&Route::UpdateWebhookMessage { message_id: self.message_id.0, token: self.token, webhook_id: self.webhook_id.0, }) .use_authorization_token(false); if!self.files.is_empty() || self.fields.payload_json.is_some() { let mut form = Form::new(); for (index, (name, file)) in self.files.iter().enumerate() { form.file(format!("{}", index).as_bytes(), name.as_bytes(), file); } if let Some(payload_json) = &self.fields.payload_json { form.payload_json(payload_json); } else { if self.fields.allowed_mentions.is_none() { self.fields.allowed_mentions = self.http.default_allowed_mentions(); } let body = crate::json::to_vec(&self.fields).map_err(HttpError::json)?; form.payload_json(&body); } request = request.form(form); } else { if self.fields.allowed_mentions.is_none() { self.fields.allowed_mentions = self.http.default_allowed_mentions(); } request = request.json(&self.fields)?; } if let Some(reason) = self.reason.as_ref() { request = request.headers(request::audit_header(reason)?); } Ok(request.build()) } /// Execute the request, returning a future resolving to a [`Response`]. /// /// [`Response`]: crate::response::Response pub fn exec(mut self) -> ResponseFuture<EmptyBody> { match self.request() { Ok(request) => self.http.request(request), Err(source) => ResponseFuture::error(source), } } } impl<'a> AuditLogReason<'a> for UpdateWebhookMessage<'a> { fn reason(mut self, reason: &'a str) -> Result<Self, AuditLogReasonError> { self.reason.replace(AuditLogReasonError::validate(reason)?); Ok(self) } } #[cfg(test)] mod tests { use super::{UpdateWebhookMessage, UpdateWebhookMessageFields}; use crate::{ client::Client, request::{AuditLogReason, NullableField, Request}, routing::Route, }; use twilight_model::id::{MessageId, WebhookId}; #[test] fn test_request() { let client = Client::new("token".to_owned()); let mut builder = UpdateWebhookMessage::new(&client, WebhookId(1), "token", MessageId(2)) .content(Some("test")) .expect("'test' content couldn't be set") .reason("reason") .expect("'reason' is not a valid reason"); let actual = builder.request().expect("failed to create request"); let body = UpdateWebhookMessageFields { allowed_mentions: None, attachments: &[], components: None, content: Some(NullableField(Some("test"))), embeds: None, payload_json: None, }; let route = Route::UpdateWebhookMessage { message_id: 2, token: "token", webhook_id: 1, }; let expected = Request::builder(&route) .json(&body) .expect("failed to serialize body") .build(); assert_eq!(expected.body, actual.body); assert_eq!(expected.path, actual.path); } }
{ self.fields.payload_json = Some(payload_json); self }
identifier_body
update_webhook_message.rs
//! Update a message created by a webhook via execution. use crate::{ client::Client, error::Error as HttpError, request::{ self, validate_inner::{self, ComponentValidationError, ComponentValidationErrorType}, AuditLogReason, AuditLogReasonError, Form, NullableField, Request, }, response::{marker::EmptyBody, ResponseFuture}, routing::Route, }; use serde::Serialize; use std::{ error::Error, fmt::{Display, Formatter, Result as FmtResult}, }; use twilight_model::{ application::component::Component, channel::{embed::Embed, message::AllowedMentions, Attachment}, id::{MessageId, WebhookId}, }; /// A webhook's message can not be updated as configured. #[derive(Debug)] pub struct UpdateWebhookMessageError { kind: UpdateWebhookMessageErrorType, source: Option<Box<dyn Error + Send + Sync>>, } impl UpdateWebhookMessageError { /// Immutable reference to the type of error that occurred. #[must_use = "retrieving the type has no effect if left unused"] pub const fn kind(&self) -> &UpdateWebhookMessageErrorType { &self.kind } /// Consume the error, returning the source error if there is any. #[must_use = "consuming the error and retrieving the source has no effect if left unused"] pub fn into_source(self) -> Option<Box<dyn Error + Send + Sync>> { self.source } /// Consume the error, returning the owned error type and the source error. #[must_use = "consuming the error into its parts has no effect if left unused"] pub fn into_parts( self, ) -> ( UpdateWebhookMessageErrorType, Option<Box<dyn Error + Send + Sync>>, ) { (self.kind, self.source) } } impl Display for UpdateWebhookMessageError { fn fmt(&self, f: &mut Formatter<'_>) -> FmtResult { match &self.kind { UpdateWebhookMessageErrorType::ComponentCount { count } => { Display::fmt(count, f)?; f.write_str(" components were provided, but only ")?; Display::fmt(&ComponentValidationError::COMPONENT_COUNT, f)?; f.write_str(" root components are allowed") } UpdateWebhookMessageErrorType::ComponentInvalid {.. } => { f.write_str("a provided component is invalid") } UpdateWebhookMessageErrorType::ContentInvalid => { f.write_str("message content is invalid") } UpdateWebhookMessageErrorType::EmbedTooLarge {.. } => { f.write_str("length of one of the embeds is too large") } UpdateWebhookMessageErrorType::TooManyEmbeds => { f.write_str("only 10 embeds may be provided") } } } } impl Error for UpdateWebhookMessageError { fn source(&self) -> Option<&(dyn Error +'static)> { self.source .as_ref() .map(|source| &**source as &(dyn Error +'static)) } } /// Type of [`UpdateWebhookMessageError`] that occurred. #[derive(Debug)] #[non_exhaustive] pub enum UpdateWebhookMessageErrorType { /// Content is over 2000 UTF-16 characters. ContentInvalid, /// Length of one of the embeds is over 6000 characters. EmbedTooLarge { /// Index of the embed that was too large. /// /// This can be used to index into the provided embeds to retrieve the /// invalid embed. index: usize, }, /// An invalid message component was provided. ComponentInvalid { /// Additional details about the validation failure type. kind: ComponentValidationErrorType, }, /// Too many message components were provided. ComponentCount { /// Number of components that were provided. count: usize, }, /// Too many embeds were provided. /// /// A webhook can have up to 10 embeds. TooManyEmbeds, } #[derive(Serialize)] struct UpdateWebhookMessageFields<'a> { #[serde(skip_serializing_if = "Option::is_none")] allowed_mentions: Option<AllowedMentions>, #[serde(skip_serializing_if = "request::slice_is_empty")] attachments: &'a [Attachment], #[serde(skip_serializing_if = "Option::is_none")] components: Option<NullableField<&'a [Component]>>, #[serde(skip_serializing_if = "Option::is_none")] content: Option<NullableField<&'a str>>, #[serde(skip_serializing_if = "Option::is_none")] embeds: Option<NullableField<&'a [Embed]>>, #[serde(skip_serializing_if = "Option::is_none")] payload_json: Option<&'a [u8]>, } /// Update a message created by a webhook. /// /// A webhook's message must always have at least one embed or some amount of /// content. If you wish to delete a webhook's message refer to /// [`DeleteWebhookMessage`]. /// /// # Examples /// /// Update a webhook's message by setting the content to `test <@3>` - /// attempting to mention user ID 3 - and specifying that only that the user may /// not be mentioned. /// /// ```no_run /// # use twilight_http::Client; /// use twilight_model::{ /// channel::message::AllowedMentions, /// id::{MessageId, WebhookId} /// }; /// /// # #[tokio::main] /// # async fn main() -> Result<(), Box<dyn std::error::Error>> { /// # let client = Client::new("token".to_owned()); /// client.update_webhook_message(WebhookId(1), "token here", MessageId(2)) /// // By creating a default set of allowed mentions, no entity can be /// // mentioned. /// .allowed_mentions(AllowedMentions::default()) /// .content(Some("test <@3>"))? /// .exec() /// .await?; /// # Ok(()) } /// ``` /// /// [`DeleteWebhookMessage`]: super::DeleteWebhookMessage #[must_use = "requests must be configured and executed"] pub struct UpdateWebhookMessage<'a> { fields: UpdateWebhookMessageFields<'a>, files: &'a [(&'a str, &'a [u8])], http: &'a Client, message_id: MessageId, reason: Option<&'a str>, token: &'a str, webhook_id: WebhookId, } impl<'a> UpdateWebhookMessage<'a> { /// Maximum number of embeds that a webhook's message may have. pub const EMBED_COUNT_LIMIT: usize = 10; pub(crate) const fn new( http: &'a Client, webhook_id: WebhookId, token: &'a str, message_id: MessageId, ) -> Self { Self { fields: UpdateWebhookMessageFields { allowed_mentions: None, attachments: &[], components: None, content: None, embeds: None, payload_json: None, }, files: &[], http, message_id, reason: None, token, webhook_id, } } /// Set the allowed mentions in the message. pub fn allowed_mentions(mut self, allowed: AllowedMentions) -> Self { self.fields.allowed_mentions.replace(allowed); self } /// Specify multiple attachments already present in the target message to keep. /// /// If called, all unspecified attachments will be removed from the message. /// If not called, all attachments will be kept. pub const fn attachments(mut self, attachments: &'a [Attachment]) -> Self { self.fields.attachments = attachments; self } /// Add multiple [`Component`]s to a message. /// /// Calling this method multiple times will clear previous calls. /// /// Pass `None` to clear existing components. /// /// # Errors /// /// Returns an [`UpdateWebhookMessageErrorType::ComponentCount`] error /// type if too many components are provided. /// /// Returns an [`UpdateWebhookMessageErrorType::ComponentInvalid`] error /// type if one of the provided components is invalid. pub fn components( mut self, components: Option<&'a [Component]>, ) -> Result<Self, UpdateWebhookMessageError> { if let Some(components) = components.as_ref() { validate_inner::components(components).map_err(|source| { let (kind, inner_source) = source.into_parts(); match kind { ComponentValidationErrorType::ComponentCount { count } => { UpdateWebhookMessageError { kind: UpdateWebhookMessageErrorType::ComponentCount { count }, source: inner_source, } } other => UpdateWebhookMessageError { kind: UpdateWebhookMessageErrorType::ComponentInvalid { kind: other }, source: inner_source, }, } })?; } self.fields.components = Some(NullableField(components)); Ok(self) } /// Set the content of the message. /// /// Pass `None` if you want to remove the message content. /// /// Note that if there is are no embeds then you will not be able to remove /// the content of the message. /// /// The maximum length is 2000 UTF-16 characters. /// /// # Errors /// /// Returns an [`UpdateWebhookMessageErrorType::ContentInvalid`] error type if /// the content length is too long. pub fn content(mut self, content: Option<&'a str>) -> Result<Self, UpdateWebhookMessageError> { if let Some(content_ref) = content { if!validate_inner::content_limit(content_ref) { return Err(UpdateWebhookMessageError { kind: UpdateWebhookMessageErrorType::ContentInvalid, source: None, }); } } self.fields.content = Some(NullableField(content)); Ok(self) } /// Set the list of embeds of the webhook's message. /// /// Pass `None` to remove all of the embeds. /// /// The maximum number of allowed embeds is defined by /// [`EMBED_COUNT_LIMIT`]. /// /// The total character length of each embed must not exceed 6000 /// characters. Additionally, the internal fields also have character /// limits. Refer to [the discord docs] for more information. /// /// # Examples ///
/// of the original message is unaffected and only the embed(s) are /// modified. /// /// ```no_run /// # use twilight_http::Client; /// use twilight_embed_builder::EmbedBuilder; /// use twilight_model::id::{MessageId, WebhookId}; /// /// # #[tokio::main] async fn main() -> Result<(), Box<dyn std::error::Error>> { /// # let client = Client::new("token".to_owned()); /// let embed = EmbedBuilder::new() /// .description("Powerful, flexible, and scalable ecosystem of Rust libraries for the Discord API.") /// .title("Twilight") /// .url("https://twilight.rs") /// .build()?; /// /// client.update_webhook_message(WebhookId(1), "token", MessageId(2)) /// .embeds(Some(&[embed]))? /// .exec() /// .await?; /// # Ok(()) } /// ``` /// /// # Errors /// /// Returns an [`UpdateWebhookMessageErrorType::EmbedTooLarge`] error type /// if one of the embeds are too large. /// /// Returns an [`UpdateWebhookMessageErrorType::TooManyEmbeds`] error type /// if more than 10 embeds are provided. /// /// [the discord docs]: https://discord.com/developers/docs/resources/channel#embed-limits /// [`EMBED_COUNT_LIMIT`]: Self::EMBED_COUNT_LIMIT pub fn embeds( mut self, embeds: Option<&'a [Embed]>, ) -> Result<Self, UpdateWebhookMessageError> { if let Some(embeds_present) = embeds.as_deref() { if embeds_present.len() > Self::EMBED_COUNT_LIMIT { return Err(UpdateWebhookMessageError { kind: UpdateWebhookMessageErrorType::TooManyEmbeds, source: None, }); } for (idx, embed) in embeds_present.iter().enumerate() { if let Err(source) = validate_inner::embed(embed) { return Err(UpdateWebhookMessageError { kind: UpdateWebhookMessageErrorType::EmbedTooLarge { index: idx }, source: Some(Box::new(source)), }); } } } self.fields.embeds = Some(NullableField(embeds)); Ok(self) } /// Attach multiple files to the webhook. /// /// Calling this method will clear any previous calls. pub const fn files(mut self, files: &'a [(&'a str, &'a [u8])]) -> Self { self.files = files; self } /// JSON encoded body of any additional request fields. /// /// If this method is called, all other fields are ignored, except for /// [`files`]. See [Discord Docs/Create Message] and /// [`ExecuteWebhook::payload_json`]. /// /// [`files`]: Self::files /// [`ExecuteWebhook::payload_json`]: super::ExecuteWebhook::payload_json /// [Discord Docs/Create Message]: https://discord.com/developers/docs/resources/channel#create-message-params pub const fn payload_json(mut self, payload_json: &'a [u8]) -> Self { self.fields.payload_json = Some(payload_json); self } // `self` needs to be consumed and the client returned due to parameters // being consumed in request construction. fn request(&mut self) -> Result<Request, HttpError> { let mut request = Request::builder(&Route::UpdateWebhookMessage { message_id: self.message_id.0, token: self.token, webhook_id: self.webhook_id.0, }) .use_authorization_token(false); if!self.files.is_empty() || self.fields.payload_json.is_some() { let mut form = Form::new(); for (index, (name, file)) in self.files.iter().enumerate() { form.file(format!("{}", index).as_bytes(), name.as_bytes(), file); } if let Some(payload_json) = &self.fields.payload_json { form.payload_json(payload_json); } else { if self.fields.allowed_mentions.is_none() { self.fields.allowed_mentions = self.http.default_allowed_mentions(); } let body = crate::json::to_vec(&self.fields).map_err(HttpError::json)?; form.payload_json(&body); } request = request.form(form); } else { if self.fields.allowed_mentions.is_none() { self.fields.allowed_mentions = self.http.default_allowed_mentions(); } request = request.json(&self.fields)?; } if let Some(reason) = self.reason.as_ref() { request = request.headers(request::audit_header(reason)?); } Ok(request.build()) } /// Execute the request, returning a future resolving to a [`Response`]. /// /// [`Response`]: crate::response::Response pub fn exec(mut self) -> ResponseFuture<EmptyBody> { match self.request() { Ok(request) => self.http.request(request), Err(source) => ResponseFuture::error(source), } } } impl<'a> AuditLogReason<'a> for UpdateWebhookMessage<'a> { fn reason(mut self, reason: &'a str) -> Result<Self, AuditLogReasonError> { self.reason.replace(AuditLogReasonError::validate(reason)?); Ok(self) } } #[cfg(test)] mod tests { use super::{UpdateWebhookMessage, UpdateWebhookMessageFields}; use crate::{ client::Client, request::{AuditLogReason, NullableField, Request}, routing::Route, }; use twilight_model::id::{MessageId, WebhookId}; #[test] fn test_request() { let client = Client::new("token".to_owned()); let mut builder = UpdateWebhookMessage::new(&client, WebhookId(1), "token", MessageId(2)) .content(Some("test")) .expect("'test' content couldn't be set") .reason("reason") .expect("'reason' is not a valid reason"); let actual = builder.request().expect("failed to create request"); let body = UpdateWebhookMessageFields { allowed_mentions: None, attachments: &[], components: None, content: Some(NullableField(Some("test"))), embeds: None, payload_json: None, }; let route = Route::UpdateWebhookMessage { message_id: 2, token: "token", webhook_id: 1, }; let expected = Request::builder(&route) .json(&body) .expect("failed to serialize body") .build(); assert_eq!(expected.body, actual.body); assert_eq!(expected.path, actual.path); } }
/// Create an embed and update the message with the new embed. The content
random_line_split
update_webhook_message.rs
//! Update a message created by a webhook via execution. use crate::{ client::Client, error::Error as HttpError, request::{ self, validate_inner::{self, ComponentValidationError, ComponentValidationErrorType}, AuditLogReason, AuditLogReasonError, Form, NullableField, Request, }, response::{marker::EmptyBody, ResponseFuture}, routing::Route, }; use serde::Serialize; use std::{ error::Error, fmt::{Display, Formatter, Result as FmtResult}, }; use twilight_model::{ application::component::Component, channel::{embed::Embed, message::AllowedMentions, Attachment}, id::{MessageId, WebhookId}, }; /// A webhook's message can not be updated as configured. #[derive(Debug)] pub struct UpdateWebhookMessageError { kind: UpdateWebhookMessageErrorType, source: Option<Box<dyn Error + Send + Sync>>, } impl UpdateWebhookMessageError { /// Immutable reference to the type of error that occurred. #[must_use = "retrieving the type has no effect if left unused"] pub const fn kind(&self) -> &UpdateWebhookMessageErrorType { &self.kind } /// Consume the error, returning the source error if there is any. #[must_use = "consuming the error and retrieving the source has no effect if left unused"] pub fn into_source(self) -> Option<Box<dyn Error + Send + Sync>> { self.source } /// Consume the error, returning the owned error type and the source error. #[must_use = "consuming the error into its parts has no effect if left unused"] pub fn into_parts( self, ) -> ( UpdateWebhookMessageErrorType, Option<Box<dyn Error + Send + Sync>>, ) { (self.kind, self.source) } } impl Display for UpdateWebhookMessageError { fn fmt(&self, f: &mut Formatter<'_>) -> FmtResult { match &self.kind { UpdateWebhookMessageErrorType::ComponentCount { count } => { Display::fmt(count, f)?; f.write_str(" components were provided, but only ")?; Display::fmt(&ComponentValidationError::COMPONENT_COUNT, f)?; f.write_str(" root components are allowed") } UpdateWebhookMessageErrorType::ComponentInvalid {.. } => { f.write_str("a provided component is invalid") } UpdateWebhookMessageErrorType::ContentInvalid => { f.write_str("message content is invalid") } UpdateWebhookMessageErrorType::EmbedTooLarge {.. } => { f.write_str("length of one of the embeds is too large") } UpdateWebhookMessageErrorType::TooManyEmbeds => { f.write_str("only 10 embeds may be provided") } } } } impl Error for UpdateWebhookMessageError { fn source(&self) -> Option<&(dyn Error +'static)> { self.source .as_ref() .map(|source| &**source as &(dyn Error +'static)) } } /// Type of [`UpdateWebhookMessageError`] that occurred. #[derive(Debug)] #[non_exhaustive] pub enum UpdateWebhookMessageErrorType { /// Content is over 2000 UTF-16 characters. ContentInvalid, /// Length of one of the embeds is over 6000 characters. EmbedTooLarge { /// Index of the embed that was too large. /// /// This can be used to index into the provided embeds to retrieve the /// invalid embed. index: usize, }, /// An invalid message component was provided. ComponentInvalid { /// Additional details about the validation failure type. kind: ComponentValidationErrorType, }, /// Too many message components were provided. ComponentCount { /// Number of components that were provided. count: usize, }, /// Too many embeds were provided. /// /// A webhook can have up to 10 embeds. TooManyEmbeds, } #[derive(Serialize)] struct UpdateWebhookMessageFields<'a> { #[serde(skip_serializing_if = "Option::is_none")] allowed_mentions: Option<AllowedMentions>, #[serde(skip_serializing_if = "request::slice_is_empty")] attachments: &'a [Attachment], #[serde(skip_serializing_if = "Option::is_none")] components: Option<NullableField<&'a [Component]>>, #[serde(skip_serializing_if = "Option::is_none")] content: Option<NullableField<&'a str>>, #[serde(skip_serializing_if = "Option::is_none")] embeds: Option<NullableField<&'a [Embed]>>, #[serde(skip_serializing_if = "Option::is_none")] payload_json: Option<&'a [u8]>, } /// Update a message created by a webhook. /// /// A webhook's message must always have at least one embed or some amount of /// content. If you wish to delete a webhook's message refer to /// [`DeleteWebhookMessage`]. /// /// # Examples /// /// Update a webhook's message by setting the content to `test <@3>` - /// attempting to mention user ID 3 - and specifying that only that the user may /// not be mentioned. /// /// ```no_run /// # use twilight_http::Client; /// use twilight_model::{ /// channel::message::AllowedMentions, /// id::{MessageId, WebhookId} /// }; /// /// # #[tokio::main] /// # async fn main() -> Result<(), Box<dyn std::error::Error>> { /// # let client = Client::new("token".to_owned()); /// client.update_webhook_message(WebhookId(1), "token here", MessageId(2)) /// // By creating a default set of allowed mentions, no entity can be /// // mentioned. /// .allowed_mentions(AllowedMentions::default()) /// .content(Some("test <@3>"))? /// .exec() /// .await?; /// # Ok(()) } /// ``` /// /// [`DeleteWebhookMessage`]: super::DeleteWebhookMessage #[must_use = "requests must be configured and executed"] pub struct UpdateWebhookMessage<'a> { fields: UpdateWebhookMessageFields<'a>, files: &'a [(&'a str, &'a [u8])], http: &'a Client, message_id: MessageId, reason: Option<&'a str>, token: &'a str, webhook_id: WebhookId, } impl<'a> UpdateWebhookMessage<'a> { /// Maximum number of embeds that a webhook's message may have. pub const EMBED_COUNT_LIMIT: usize = 10; pub(crate) const fn new( http: &'a Client, webhook_id: WebhookId, token: &'a str, message_id: MessageId, ) -> Self { Self { fields: UpdateWebhookMessageFields { allowed_mentions: None, attachments: &[], components: None, content: None, embeds: None, payload_json: None, }, files: &[], http, message_id, reason: None, token, webhook_id, } } /// Set the allowed mentions in the message. pub fn allowed_mentions(mut self, allowed: AllowedMentions) -> Self { self.fields.allowed_mentions.replace(allowed); self } /// Specify multiple attachments already present in the target message to keep. /// /// If called, all unspecified attachments will be removed from the message. /// If not called, all attachments will be kept. pub const fn attachments(mut self, attachments: &'a [Attachment]) -> Self { self.fields.attachments = attachments; self } /// Add multiple [`Component`]s to a message. /// /// Calling this method multiple times will clear previous calls. /// /// Pass `None` to clear existing components. /// /// # Errors /// /// Returns an [`UpdateWebhookMessageErrorType::ComponentCount`] error /// type if too many components are provided. /// /// Returns an [`UpdateWebhookMessageErrorType::ComponentInvalid`] error /// type if one of the provided components is invalid. pub fn components( mut self, components: Option<&'a [Component]>, ) -> Result<Self, UpdateWebhookMessageError> { if let Some(components) = components.as_ref()
self.fields.components = Some(NullableField(components)); Ok(self) } /// Set the content of the message. /// /// Pass `None` if you want to remove the message content. /// /// Note that if there is are no embeds then you will not be able to remove /// the content of the message. /// /// The maximum length is 2000 UTF-16 characters. /// /// # Errors /// /// Returns an [`UpdateWebhookMessageErrorType::ContentInvalid`] error type if /// the content length is too long. pub fn content(mut self, content: Option<&'a str>) -> Result<Self, UpdateWebhookMessageError> { if let Some(content_ref) = content { if!validate_inner::content_limit(content_ref) { return Err(UpdateWebhookMessageError { kind: UpdateWebhookMessageErrorType::ContentInvalid, source: None, }); } } self.fields.content = Some(NullableField(content)); Ok(self) } /// Set the list of embeds of the webhook's message. /// /// Pass `None` to remove all of the embeds. /// /// The maximum number of allowed embeds is defined by /// [`EMBED_COUNT_LIMIT`]. /// /// The total character length of each embed must not exceed 6000 /// characters. Additionally, the internal fields also have character /// limits. Refer to [the discord docs] for more information. /// /// # Examples /// /// Create an embed and update the message with the new embed. The content /// of the original message is unaffected and only the embed(s) are /// modified. /// /// ```no_run /// # use twilight_http::Client; /// use twilight_embed_builder::EmbedBuilder; /// use twilight_model::id::{MessageId, WebhookId}; /// /// # #[tokio::main] async fn main() -> Result<(), Box<dyn std::error::Error>> { /// # let client = Client::new("token".to_owned()); /// let embed = EmbedBuilder::new() /// .description("Powerful, flexible, and scalable ecosystem of Rust libraries for the Discord API.") /// .title("Twilight") /// .url("https://twilight.rs") /// .build()?; /// /// client.update_webhook_message(WebhookId(1), "token", MessageId(2)) /// .embeds(Some(&[embed]))? /// .exec() /// .await?; /// # Ok(()) } /// ``` /// /// # Errors /// /// Returns an [`UpdateWebhookMessageErrorType::EmbedTooLarge`] error type /// if one of the embeds are too large. /// /// Returns an [`UpdateWebhookMessageErrorType::TooManyEmbeds`] error type /// if more than 10 embeds are provided. /// /// [the discord docs]: https://discord.com/developers/docs/resources/channel#embed-limits /// [`EMBED_COUNT_LIMIT`]: Self::EMBED_COUNT_LIMIT pub fn embeds( mut self, embeds: Option<&'a [Embed]>, ) -> Result<Self, UpdateWebhookMessageError> { if let Some(embeds_present) = embeds.as_deref() { if embeds_present.len() > Self::EMBED_COUNT_LIMIT { return Err(UpdateWebhookMessageError { kind: UpdateWebhookMessageErrorType::TooManyEmbeds, source: None, }); } for (idx, embed) in embeds_present.iter().enumerate() { if let Err(source) = validate_inner::embed(embed) { return Err(UpdateWebhookMessageError { kind: UpdateWebhookMessageErrorType::EmbedTooLarge { index: idx }, source: Some(Box::new(source)), }); } } } self.fields.embeds = Some(NullableField(embeds)); Ok(self) } /// Attach multiple files to the webhook. /// /// Calling this method will clear any previous calls. pub const fn files(mut self, files: &'a [(&'a str, &'a [u8])]) -> Self { self.files = files; self } /// JSON encoded body of any additional request fields. /// /// If this method is called, all other fields are ignored, except for /// [`files`]. See [Discord Docs/Create Message] and /// [`ExecuteWebhook::payload_json`]. /// /// [`files`]: Self::files /// [`ExecuteWebhook::payload_json`]: super::ExecuteWebhook::payload_json /// [Discord Docs/Create Message]: https://discord.com/developers/docs/resources/channel#create-message-params pub const fn payload_json(mut self, payload_json: &'a [u8]) -> Self { self.fields.payload_json = Some(payload_json); self } // `self` needs to be consumed and the client returned due to parameters // being consumed in request construction. fn request(&mut self) -> Result<Request, HttpError> { let mut request = Request::builder(&Route::UpdateWebhookMessage { message_id: self.message_id.0, token: self.token, webhook_id: self.webhook_id.0, }) .use_authorization_token(false); if!self.files.is_empty() || self.fields.payload_json.is_some() { let mut form = Form::new(); for (index, (name, file)) in self.files.iter().enumerate() { form.file(format!("{}", index).as_bytes(), name.as_bytes(), file); } if let Some(payload_json) = &self.fields.payload_json { form.payload_json(payload_json); } else { if self.fields.allowed_mentions.is_none() { self.fields.allowed_mentions = self.http.default_allowed_mentions(); } let body = crate::json::to_vec(&self.fields).map_err(HttpError::json)?; form.payload_json(&body); } request = request.form(form); } else { if self.fields.allowed_mentions.is_none() { self.fields.allowed_mentions = self.http.default_allowed_mentions(); } request = request.json(&self.fields)?; } if let Some(reason) = self.reason.as_ref() { request = request.headers(request::audit_header(reason)?); } Ok(request.build()) } /// Execute the request, returning a future resolving to a [`Response`]. /// /// [`Response`]: crate::response::Response pub fn exec(mut self) -> ResponseFuture<EmptyBody> { match self.request() { Ok(request) => self.http.request(request), Err(source) => ResponseFuture::error(source), } } } impl<'a> AuditLogReason<'a> for UpdateWebhookMessage<'a> { fn reason(mut self, reason: &'a str) -> Result<Self, AuditLogReasonError> { self.reason.replace(AuditLogReasonError::validate(reason)?); Ok(self) } } #[cfg(test)] mod tests { use super::{UpdateWebhookMessage, UpdateWebhookMessageFields}; use crate::{ client::Client, request::{AuditLogReason, NullableField, Request}, routing::Route, }; use twilight_model::id::{MessageId, WebhookId}; #[test] fn test_request() { let client = Client::new("token".to_owned()); let mut builder = UpdateWebhookMessage::new(&client, WebhookId(1), "token", MessageId(2)) .content(Some("test")) .expect("'test' content couldn't be set") .reason("reason") .expect("'reason' is not a valid reason"); let actual = builder.request().expect("failed to create request"); let body = UpdateWebhookMessageFields { allowed_mentions: None, attachments: &[], components: None, content: Some(NullableField(Some("test"))), embeds: None, payload_json: None, }; let route = Route::UpdateWebhookMessage { message_id: 2, token: "token", webhook_id: 1, }; let expected = Request::builder(&route) .json(&body) .expect("failed to serialize body") .build(); assert_eq!(expected.body, actual.body); assert_eq!(expected.path, actual.path); } }
{ validate_inner::components(components).map_err(|source| { let (kind, inner_source) = source.into_parts(); match kind { ComponentValidationErrorType::ComponentCount { count } => { UpdateWebhookMessageError { kind: UpdateWebhookMessageErrorType::ComponentCount { count }, source: inner_source, } } other => UpdateWebhookMessageError { kind: UpdateWebhookMessageErrorType::ComponentInvalid { kind: other }, source: inner_source, }, } })?; }
conditional_block
mode.rs
use std::{io,process,str,thread,time}; use std::io::Error; use std::result::Result; use regex::Regex; use serde::{Serialize,Deserialize}; use crate::{fileio,util}; #[derive(Debug)] pub struct InputMode { width:String, height:String, rate:String, name:String, display:String, } impl InputMode { pub fn new(width:&str,height:&str,rate:&str,display:&str,name:&str) -> InputMode { InputMode { width:width.to_string(), height:height.to_string(), rate:rate.to_string(), display:display.to_string(), name:name.to_string() } } } #[derive(Clone,Debug,Serialize,Deserialize)] pub struct CvtMode { name: String, clock: String, h_disp: String, h_sync_start: String, h_sync_end: String, h_total: String, v_disp: String, v_sync_start: String, v_sync_end: String, v_total: String, flags: String, } impl CvtMode { pub fn get_name(&self) -> &str { &self.name } /* pub fn new_empty() -> CvtMode { CvtMode { name: String::new(), clock: String::new(), h_disp: String::new(), h_sync_start: String::new(), h_sync_end: String::new(), h_total: String::new(), v_disp: String::new(), v_sync_start: String::new(), v_sync_end: String::new(), v_total: String::new(), flags: String::new(), } } */ } // Some(d) would be a vec of the displays for which to delete the mode; if d is None, the mode will be removed from all connected displays // xrandr doesn't seem to think the program has access to user-created modes for deletion; // could run as root but would rather not. // TODO: address deletion permission issue /* fn delete_mode_xrandr(n: &str, d: Option<Vec<String>>, verbose: bool) -> Result<(),Error> { for display in d.unwrap() { delete_mode(&n,&display); } let currents_handle = thread::spawn(move || get_current_modes(verbose)); let defaults_handle = thread::spawn(move || get_default_modes(verbose)); let currents = currents_handle.join().unwrap()?; let defaults = defaults_handle.join().unwrap()?; let displays = match d { Some(disps) => disps, None => { let mut tmp: Vec<String> = Vec::with_capacity(currents.len()); for mode in &currents { tmp.push(mode.display.clone()); } tmp } }; println!("{:?}",&currents); // these loops are because xrandr doesn't let you update modes or delete them while in use for disp in displays { for default in &defaults { if default.display == disp { if verbose { println!("Switching to default mode to allow updating of the current mode"); } switch_mode(&default.name, &disp, verbose)?; // switch the display to its default mode to enable deletion of in-use mode } } if verbose { println!("Removing mode {} from display {}",&n,&disp); } let mut cmd = process::Command::new("xrandr"); cmd.arg("--delmode").arg(disp.clone()).arg(n.clone()); println!("{:?}",cmd.output().unwrap()); } Ok(()) } */ pub fn add_mode(w: Option<&str>, h: Option<&str>, r: Option<&str>, d: Option<&str>, n: Option<&str>, t: Option<&str>, f: Option<&str>, test: bool, save: bool, verbose: bool) -> Result<(),Error> { let current_modes = get_current_modes(verbose)?; // Use first current display mode for parameters not supplied // and as the fallback if test option is used let width = w.unwrap_or(&current_modes[0].width).to_string(); let height = h.unwrap_or(&current_modes[0].height).to_string(); let rate = r.unwrap_or(&current_modes[0].rate).to_string(); let display = d.unwrap_or(&current_modes[0].display).to_string(); let tmp = format!("{}x{}_{}",width,height,rate); // default test timeout is 10 seconds. let name = match n { Some(nm) => String::from(nm), None => { tmp } }; let i_mode = InputMode { width, height, rate, display: String::from(&display), name: name.clone() }; let mut d_vec: Vec<String> = Vec::with_capacity(1); d_vec.push(display.clone()); // compute CVT timings and delete xrandr mode concurrently; wait for deletion before adding to xrandr //let del_handle = thread::spawn(move || delete_mode_xrandr(&name, Some(d_vec), verbose)); let cvt_handle = thread::spawn(move || gen_cvt_mode(&i_mode, verbose)); let fallback_cvt_handle = thread::spawn(move || gen_cvt_mode(&current_modes[0], verbose)); //let _ = del_handle.join().unwrap(); let cvt = cvt_handle.join().unwrap(); let fallback_cvt = fallback_cvt_handle.join().unwrap(); new_mode(&cvt, &display, verbose)?; if test { test_mode(&cvt, &fallback_cvt, &display, t, verbose)?; } if save { fileio::save_mode(&cvt,f,verbose)? } Ok(()) } pub fn apply_mode(n: &str, d: &str, t: Option<&str>, test: bool, persist: bool, verbose: bool) -> Result<(), io::Error> { println!("Applying mode {} to display {}.",n,d); let mode = fileio::get_mode(n, None, verbose).unwrap(); if test { let default_modes = get_default_modes(verbose)?; let default_mode = gen_cvt_mode(&default_modes[0],verbose); test_mode(&mode, &default_mode, d, t, verbose)?; println!("Keep the mode you just tested? y/n"); let mut input = String::new(); while!(input.contains("y") || input.contains("n")) { let _ = io::stdin().read_line(&mut input); if input.contains("n") { return Ok(()); } } } switch_mode(n, d, verbose)?; if persist { fileio::save_mode_persistent(&mode, verbose)?; } Ok(()) } fn test_mode(mode: &CvtMode, default_mode: &CvtMode, display: &str, t: Option<&str>, verbose: bool) -> Result<(), io::Error> { let name = &mode.get_name(); let default_name = &default_mode.get_name(); let timeout: u64 = match t { Some(time) => { let tmp = match time.parse() { Ok(kk) => kk, Err(_) => { eprintln!("Error: timeout must be an integer greater than zero. Using default timeout of 10 seconds."); 10 // just default to 10 secs if invalid timeout provided rather than returning an error } }; if tmp > 0 { tmp } else { 10 // default to 10 secs if none given } } None => 10 }; let delay = time::Duration::from_secs(timeout); if verbose { println!("Testing mode {} on display {} for {} secs.", name, display, timeout); thread::sleep(time::Duration::from_secs(1)); } if verbose { let _ = thread::spawn(move || util::print_countdown(timeout)); // this should maybe print regardless of verbose option, idk } let handle = thread::spawn(move || thread::sleep(delay)); switch_mode(name, display, verbose)?; handle.join().expect("Timer thread had an error."); if verbose { println!("Reverting to mode {} on display {}.", default_name, display); } switch_mode(default_name, display, verbose)?; Ok(()) } fn gen_cvt_mode(input: &InputMode, verbose: bool) -> CvtMode { if verbose { println!("Generating coordinated video timings for mode {}",input.name); } let mut cmd = process::Command::new("cvt"); cmd.arg(&input.width).arg(&input.height).arg(&input.rate); let output = cmd.output().unwrap(); let out = str::from_utf8(&output.stdout).unwrap(); let lines: Vec<_> = out.split('"').collect(); let mut t: Vec<_> = lines[2][2..lines[2].len()-1].split(" ").collect(); let mut i=0; while i < t.len() { if t[i] == "" || t[i] == "\t" { t.remove(i); } else { i += 1; } } let tmp = CvtMode { name: input.name.to_owned(), clock: String::from(t[0]), h_disp: String::from(t[1]), h_sync_start: String::from(t[2]), h_sync_end: String::from(t[3]), h_total: String::from(t[4]), v_disp: String::from(t[5]), v_sync_start: String::from(t[6]), v_sync_end: String::from(t[7]), v_total: String::from(t[8]), flags: format!("{} {}",t[9],t[10]), }; if verbose { println!("{:?}",tmp); } tmp } // Retrieves modes which are currently in use fn get_current_modes(verbose: bool) -> Result<Vec<InputMode>, Error> { if verbose { println!("Retrieving current display configuration."); } let re = Regex::new(r"(\S+)\s+connected.*\n[[a-zA-Z0-9\.]*\n]*\s*([0-9]+)x([0-9]+)\s*([0-9]+\.[0-9]+)\*").unwrap(); util::get_modes_helper(&re, verbose) } // Retrieves the default modes for each display fn get_default_modes(verbose: bool) -> Result<Vec<InputMode>, Error> { if verbose { println!("Retrieving current display configuration."); } let re = Regex::new(r"(\S+)\s+connected.*\n[[a-zA-Z0-9\.]*\n]*\s*([0-9]+)x([0-9]+)\s*([0-9]+\.[0-9]+)[\*]?\+").unwrap(); util::get_modes_helper(&re, verbose) } fn switch_mode(name: &str, display: &str, verbose: bool) -> Result<(), io::Error> { let mut cmd = process::Command::new("xrandr"); cmd.arg("--output").arg(&display).arg("--mode").arg(name); if verbose { println!("Applying mode {} to display {}",name,&display); } cmd.output()?; if verbose { println!("Successfully applied mode {} to display {}",name, &display); } Ok(()) } // Adds the newly created mode to xrandr fn new_mode(mode: &CvtMode, display: &str, verbose: bool) -> Result<(), io::Error> { let mut cmd = process::Command::new("xrandr");
.arg(&mode.name) .arg(&mode.clock) .arg(&mode.h_disp) .arg(&mode.h_sync_start) .arg(&mode.h_sync_end) .arg(&mode.h_total) .arg(&mode.v_disp) .arg(&mode.v_sync_start) .arg(&mode.v_sync_end) .arg(&mode.v_total) .arg(&mode.flags); if verbose { println!("Creating xrandr mode {}",&mode.name); } cmd.output()?; if verbose { println!("Adding mode {} for display {}.",&mode.name,display); } cmd = process::Command::new("xrandr"); cmd.arg("--addmode").arg(display).arg(&mode.name); cmd.output()?; Ok(()) }
cmd.arg("--newmode")
random_line_split
mode.rs
use std::{io,process,str,thread,time}; use std::io::Error; use std::result::Result; use regex::Regex; use serde::{Serialize,Deserialize}; use crate::{fileio,util}; #[derive(Debug)] pub struct InputMode { width:String, height:String, rate:String, name:String, display:String, } impl InputMode { pub fn new(width:&str,height:&str,rate:&str,display:&str,name:&str) -> InputMode { InputMode { width:width.to_string(), height:height.to_string(), rate:rate.to_string(), display:display.to_string(), name:name.to_string() } } } #[derive(Clone,Debug,Serialize,Deserialize)] pub struct CvtMode { name: String, clock: String, h_disp: String, h_sync_start: String, h_sync_end: String, h_total: String, v_disp: String, v_sync_start: String, v_sync_end: String, v_total: String, flags: String, } impl CvtMode { pub fn get_name(&self) -> &str { &self.name } /* pub fn new_empty() -> CvtMode { CvtMode { name: String::new(), clock: String::new(), h_disp: String::new(), h_sync_start: String::new(), h_sync_end: String::new(), h_total: String::new(), v_disp: String::new(), v_sync_start: String::new(), v_sync_end: String::new(), v_total: String::new(), flags: String::new(), } } */ } // Some(d) would be a vec of the displays for which to delete the mode; if d is None, the mode will be removed from all connected displays // xrandr doesn't seem to think the program has access to user-created modes for deletion; // could run as root but would rather not. // TODO: address deletion permission issue /* fn delete_mode_xrandr(n: &str, d: Option<Vec<String>>, verbose: bool) -> Result<(),Error> { for display in d.unwrap() { delete_mode(&n,&display); } let currents_handle = thread::spawn(move || get_current_modes(verbose)); let defaults_handle = thread::spawn(move || get_default_modes(verbose)); let currents = currents_handle.join().unwrap()?; let defaults = defaults_handle.join().unwrap()?; let displays = match d { Some(disps) => disps, None => { let mut tmp: Vec<String> = Vec::with_capacity(currents.len()); for mode in &currents { tmp.push(mode.display.clone()); } tmp } }; println!("{:?}",&currents); // these loops are because xrandr doesn't let you update modes or delete them while in use for disp in displays { for default in &defaults { if default.display == disp { if verbose { println!("Switching to default mode to allow updating of the current mode"); } switch_mode(&default.name, &disp, verbose)?; // switch the display to its default mode to enable deletion of in-use mode } } if verbose { println!("Removing mode {} from display {}",&n,&disp); } let mut cmd = process::Command::new("xrandr"); cmd.arg("--delmode").arg(disp.clone()).arg(n.clone()); println!("{:?}",cmd.output().unwrap()); } Ok(()) } */ pub fn add_mode(w: Option<&str>, h: Option<&str>, r: Option<&str>, d: Option<&str>, n: Option<&str>, t: Option<&str>, f: Option<&str>, test: bool, save: bool, verbose: bool) -> Result<(),Error> { let current_modes = get_current_modes(verbose)?; // Use first current display mode for parameters not supplied // and as the fallback if test option is used let width = w.unwrap_or(&current_modes[0].width).to_string(); let height = h.unwrap_or(&current_modes[0].height).to_string(); let rate = r.unwrap_or(&current_modes[0].rate).to_string(); let display = d.unwrap_or(&current_modes[0].display).to_string(); let tmp = format!("{}x{}_{}",width,height,rate); // default test timeout is 10 seconds. let name = match n { Some(nm) => String::from(nm), None => { tmp } }; let i_mode = InputMode { width, height, rate, display: String::from(&display), name: name.clone() }; let mut d_vec: Vec<String> = Vec::with_capacity(1); d_vec.push(display.clone()); // compute CVT timings and delete xrandr mode concurrently; wait for deletion before adding to xrandr //let del_handle = thread::spawn(move || delete_mode_xrandr(&name, Some(d_vec), verbose)); let cvt_handle = thread::spawn(move || gen_cvt_mode(&i_mode, verbose)); let fallback_cvt_handle = thread::spawn(move || gen_cvt_mode(&current_modes[0], verbose)); //let _ = del_handle.join().unwrap(); let cvt = cvt_handle.join().unwrap(); let fallback_cvt = fallback_cvt_handle.join().unwrap(); new_mode(&cvt, &display, verbose)?; if test { test_mode(&cvt, &fallback_cvt, &display, t, verbose)?; } if save { fileio::save_mode(&cvt,f,verbose)? } Ok(()) } pub fn apply_mode(n: &str, d: &str, t: Option<&str>, test: bool, persist: bool, verbose: bool) -> Result<(), io::Error> { println!("Applying mode {} to display {}.",n,d); let mode = fileio::get_mode(n, None, verbose).unwrap(); if test { let default_modes = get_default_modes(verbose)?; let default_mode = gen_cvt_mode(&default_modes[0],verbose); test_mode(&mode, &default_mode, d, t, verbose)?; println!("Keep the mode you just tested? y/n"); let mut input = String::new(); while!(input.contains("y") || input.contains("n")) { let _ = io::stdin().read_line(&mut input); if input.contains("n") { return Ok(()); } } } switch_mode(n, d, verbose)?; if persist { fileio::save_mode_persistent(&mode, verbose)?; } Ok(()) } fn test_mode(mode: &CvtMode, default_mode: &CvtMode, display: &str, t: Option<&str>, verbose: bool) -> Result<(), io::Error> { let name = &mode.get_name(); let default_name = &default_mode.get_name(); let timeout: u64 = match t { Some(time) => { let tmp = match time.parse() { Ok(kk) => kk, Err(_) => { eprintln!("Error: timeout must be an integer greater than zero. Using default timeout of 10 seconds."); 10 // just default to 10 secs if invalid timeout provided rather than returning an error } }; if tmp > 0 { tmp } else { 10 // default to 10 secs if none given } } None => 10 }; let delay = time::Duration::from_secs(timeout); if verbose { println!("Testing mode {} on display {} for {} secs.", name, display, timeout); thread::sleep(time::Duration::from_secs(1)); } if verbose { let _ = thread::spawn(move || util::print_countdown(timeout)); // this should maybe print regardless of verbose option, idk } let handle = thread::spawn(move || thread::sleep(delay)); switch_mode(name, display, verbose)?; handle.join().expect("Timer thread had an error."); if verbose { println!("Reverting to mode {} on display {}.", default_name, display); } switch_mode(default_name, display, verbose)?; Ok(()) } fn gen_cvt_mode(input: &InputMode, verbose: bool) -> CvtMode { if verbose { println!("Generating coordinated video timings for mode {}",input.name); } let mut cmd = process::Command::new("cvt"); cmd.arg(&input.width).arg(&input.height).arg(&input.rate); let output = cmd.output().unwrap(); let out = str::from_utf8(&output.stdout).unwrap(); let lines: Vec<_> = out.split('"').collect(); let mut t: Vec<_> = lines[2][2..lines[2].len()-1].split(" ").collect(); let mut i=0; while i < t.len() { if t[i] == "" || t[i] == "\t" { t.remove(i); } else { i += 1; } } let tmp = CvtMode { name: input.name.to_owned(), clock: String::from(t[0]), h_disp: String::from(t[1]), h_sync_start: String::from(t[2]), h_sync_end: String::from(t[3]), h_total: String::from(t[4]), v_disp: String::from(t[5]), v_sync_start: String::from(t[6]), v_sync_end: String::from(t[7]), v_total: String::from(t[8]), flags: format!("{} {}",t[9],t[10]), }; if verbose { println!("{:?}",tmp); } tmp } // Retrieves modes which are currently in use fn get_current_modes(verbose: bool) -> Result<Vec<InputMode>, Error> { if verbose { println!("Retrieving current display configuration."); } let re = Regex::new(r"(\S+)\s+connected.*\n[[a-zA-Z0-9\.]*\n]*\s*([0-9]+)x([0-9]+)\s*([0-9]+\.[0-9]+)\*").unwrap(); util::get_modes_helper(&re, verbose) } // Retrieves the default modes for each display fn get_default_modes(verbose: bool) -> Result<Vec<InputMode>, Error> { if verbose { println!("Retrieving current display configuration."); } let re = Regex::new(r"(\S+)\s+connected.*\n[[a-zA-Z0-9\.]*\n]*\s*([0-9]+)x([0-9]+)\s*([0-9]+\.[0-9]+)[\*]?\+").unwrap(); util::get_modes_helper(&re, verbose) } fn switch_mode(name: &str, display: &str, verbose: bool) -> Result<(), io::Error> { let mut cmd = process::Command::new("xrandr"); cmd.arg("--output").arg(&display).arg("--mode").arg(name); if verbose { println!("Applying mode {} to display {}",name,&display); } cmd.output()?; if verbose { println!("Successfully applied mode {} to display {}",name, &display); } Ok(()) } // Adds the newly created mode to xrandr fn new_mode(mode: &CvtMode, display: &str, verbose: bool) -> Result<(), io::Error>
} cmd = process::Command::new("xrandr"); cmd.arg("--addmode").arg(display).arg(&mode.name); cmd.output()?; Ok(()) }
{ let mut cmd = process::Command::new("xrandr"); cmd.arg("--newmode") .arg(&mode.name) .arg(&mode.clock) .arg(&mode.h_disp) .arg(&mode.h_sync_start) .arg(&mode.h_sync_end) .arg(&mode.h_total) .arg(&mode.v_disp) .arg(&mode.v_sync_start) .arg(&mode.v_sync_end) .arg(&mode.v_total) .arg(&mode.flags); if verbose { println!("Creating xrandr mode {}",&mode.name); } cmd.output()?; if verbose { println!("Adding mode {} for display {}.",&mode.name,display);
identifier_body
mode.rs
use std::{io,process,str,thread,time}; use std::io::Error; use std::result::Result; use regex::Regex; use serde::{Serialize,Deserialize}; use crate::{fileio,util}; #[derive(Debug)] pub struct InputMode { width:String, height:String, rate:String, name:String, display:String, } impl InputMode { pub fn new(width:&str,height:&str,rate:&str,display:&str,name:&str) -> InputMode { InputMode { width:width.to_string(), height:height.to_string(), rate:rate.to_string(), display:display.to_string(), name:name.to_string() } } } #[derive(Clone,Debug,Serialize,Deserialize)] pub struct CvtMode { name: String, clock: String, h_disp: String, h_sync_start: String, h_sync_end: String, h_total: String, v_disp: String, v_sync_start: String, v_sync_end: String, v_total: String, flags: String, } impl CvtMode { pub fn get_name(&self) -> &str { &self.name } /* pub fn new_empty() -> CvtMode { CvtMode { name: String::new(), clock: String::new(), h_disp: String::new(), h_sync_start: String::new(), h_sync_end: String::new(), h_total: String::new(), v_disp: String::new(), v_sync_start: String::new(), v_sync_end: String::new(), v_total: String::new(), flags: String::new(), } } */ } // Some(d) would be a vec of the displays for which to delete the mode; if d is None, the mode will be removed from all connected displays // xrandr doesn't seem to think the program has access to user-created modes for deletion; // could run as root but would rather not. // TODO: address deletion permission issue /* fn delete_mode_xrandr(n: &str, d: Option<Vec<String>>, verbose: bool) -> Result<(),Error> { for display in d.unwrap() { delete_mode(&n,&display); } let currents_handle = thread::spawn(move || get_current_modes(verbose)); let defaults_handle = thread::spawn(move || get_default_modes(verbose)); let currents = currents_handle.join().unwrap()?; let defaults = defaults_handle.join().unwrap()?; let displays = match d { Some(disps) => disps, None => { let mut tmp: Vec<String> = Vec::with_capacity(currents.len()); for mode in &currents { tmp.push(mode.display.clone()); } tmp } }; println!("{:?}",&currents); // these loops are because xrandr doesn't let you update modes or delete them while in use for disp in displays { for default in &defaults { if default.display == disp { if verbose { println!("Switching to default mode to allow updating of the current mode"); } switch_mode(&default.name, &disp, verbose)?; // switch the display to its default mode to enable deletion of in-use mode } } if verbose { println!("Removing mode {} from display {}",&n,&disp); } let mut cmd = process::Command::new("xrandr"); cmd.arg("--delmode").arg(disp.clone()).arg(n.clone()); println!("{:?}",cmd.output().unwrap()); } Ok(()) } */ pub fn
(w: Option<&str>, h: Option<&str>, r: Option<&str>, d: Option<&str>, n: Option<&str>, t: Option<&str>, f: Option<&str>, test: bool, save: bool, verbose: bool) -> Result<(),Error> { let current_modes = get_current_modes(verbose)?; // Use first current display mode for parameters not supplied // and as the fallback if test option is used let width = w.unwrap_or(&current_modes[0].width).to_string(); let height = h.unwrap_or(&current_modes[0].height).to_string(); let rate = r.unwrap_or(&current_modes[0].rate).to_string(); let display = d.unwrap_or(&current_modes[0].display).to_string(); let tmp = format!("{}x{}_{}",width,height,rate); // default test timeout is 10 seconds. let name = match n { Some(nm) => String::from(nm), None => { tmp } }; let i_mode = InputMode { width, height, rate, display: String::from(&display), name: name.clone() }; let mut d_vec: Vec<String> = Vec::with_capacity(1); d_vec.push(display.clone()); // compute CVT timings and delete xrandr mode concurrently; wait for deletion before adding to xrandr //let del_handle = thread::spawn(move || delete_mode_xrandr(&name, Some(d_vec), verbose)); let cvt_handle = thread::spawn(move || gen_cvt_mode(&i_mode, verbose)); let fallback_cvt_handle = thread::spawn(move || gen_cvt_mode(&current_modes[0], verbose)); //let _ = del_handle.join().unwrap(); let cvt = cvt_handle.join().unwrap(); let fallback_cvt = fallback_cvt_handle.join().unwrap(); new_mode(&cvt, &display, verbose)?; if test { test_mode(&cvt, &fallback_cvt, &display, t, verbose)?; } if save { fileio::save_mode(&cvt,f,verbose)? } Ok(()) } pub fn apply_mode(n: &str, d: &str, t: Option<&str>, test: bool, persist: bool, verbose: bool) -> Result<(), io::Error> { println!("Applying mode {} to display {}.",n,d); let mode = fileio::get_mode(n, None, verbose).unwrap(); if test { let default_modes = get_default_modes(verbose)?; let default_mode = gen_cvt_mode(&default_modes[0],verbose); test_mode(&mode, &default_mode, d, t, verbose)?; println!("Keep the mode you just tested? y/n"); let mut input = String::new(); while!(input.contains("y") || input.contains("n")) { let _ = io::stdin().read_line(&mut input); if input.contains("n") { return Ok(()); } } } switch_mode(n, d, verbose)?; if persist { fileio::save_mode_persistent(&mode, verbose)?; } Ok(()) } fn test_mode(mode: &CvtMode, default_mode: &CvtMode, display: &str, t: Option<&str>, verbose: bool) -> Result<(), io::Error> { let name = &mode.get_name(); let default_name = &default_mode.get_name(); let timeout: u64 = match t { Some(time) => { let tmp = match time.parse() { Ok(kk) => kk, Err(_) => { eprintln!("Error: timeout must be an integer greater than zero. Using default timeout of 10 seconds."); 10 // just default to 10 secs if invalid timeout provided rather than returning an error } }; if tmp > 0 { tmp } else { 10 // default to 10 secs if none given } } None => 10 }; let delay = time::Duration::from_secs(timeout); if verbose { println!("Testing mode {} on display {} for {} secs.", name, display, timeout); thread::sleep(time::Duration::from_secs(1)); } if verbose { let _ = thread::spawn(move || util::print_countdown(timeout)); // this should maybe print regardless of verbose option, idk } let handle = thread::spawn(move || thread::sleep(delay)); switch_mode(name, display, verbose)?; handle.join().expect("Timer thread had an error."); if verbose { println!("Reverting to mode {} on display {}.", default_name, display); } switch_mode(default_name, display, verbose)?; Ok(()) } fn gen_cvt_mode(input: &InputMode, verbose: bool) -> CvtMode { if verbose { println!("Generating coordinated video timings for mode {}",input.name); } let mut cmd = process::Command::new("cvt"); cmd.arg(&input.width).arg(&input.height).arg(&input.rate); let output = cmd.output().unwrap(); let out = str::from_utf8(&output.stdout).unwrap(); let lines: Vec<_> = out.split('"').collect(); let mut t: Vec<_> = lines[2][2..lines[2].len()-1].split(" ").collect(); let mut i=0; while i < t.len() { if t[i] == "" || t[i] == "\t" { t.remove(i); } else { i += 1; } } let tmp = CvtMode { name: input.name.to_owned(), clock: String::from(t[0]), h_disp: String::from(t[1]), h_sync_start: String::from(t[2]), h_sync_end: String::from(t[3]), h_total: String::from(t[4]), v_disp: String::from(t[5]), v_sync_start: String::from(t[6]), v_sync_end: String::from(t[7]), v_total: String::from(t[8]), flags: format!("{} {}",t[9],t[10]), }; if verbose { println!("{:?}",tmp); } tmp } // Retrieves modes which are currently in use fn get_current_modes(verbose: bool) -> Result<Vec<InputMode>, Error> { if verbose { println!("Retrieving current display configuration."); } let re = Regex::new(r"(\S+)\s+connected.*\n[[a-zA-Z0-9\.]*\n]*\s*([0-9]+)x([0-9]+)\s*([0-9]+\.[0-9]+)\*").unwrap(); util::get_modes_helper(&re, verbose) } // Retrieves the default modes for each display fn get_default_modes(verbose: bool) -> Result<Vec<InputMode>, Error> { if verbose { println!("Retrieving current display configuration."); } let re = Regex::new(r"(\S+)\s+connected.*\n[[a-zA-Z0-9\.]*\n]*\s*([0-9]+)x([0-9]+)\s*([0-9]+\.[0-9]+)[\*]?\+").unwrap(); util::get_modes_helper(&re, verbose) } fn switch_mode(name: &str, display: &str, verbose: bool) -> Result<(), io::Error> { let mut cmd = process::Command::new("xrandr"); cmd.arg("--output").arg(&display).arg("--mode").arg(name); if verbose { println!("Applying mode {} to display {}",name,&display); } cmd.output()?; if verbose { println!("Successfully applied mode {} to display {}",name, &display); } Ok(()) } // Adds the newly created mode to xrandr fn new_mode(mode: &CvtMode, display: &str, verbose: bool) -> Result<(), io::Error> { let mut cmd = process::Command::new("xrandr"); cmd.arg("--newmode") .arg(&mode.name) .arg(&mode.clock) .arg(&mode.h_disp) .arg(&mode.h_sync_start) .arg(&mode.h_sync_end) .arg(&mode.h_total) .arg(&mode.v_disp) .arg(&mode.v_sync_start) .arg(&mode.v_sync_end) .arg(&mode.v_total) .arg(&mode.flags); if verbose { println!("Creating xrandr mode {}",&mode.name); } cmd.output()?; if verbose { println!("Adding mode {} for display {}.",&mode.name,display); } cmd = process::Command::new("xrandr"); cmd.arg("--addmode").arg(display).arg(&mode.name); cmd.output()?; Ok(()) }
add_mode
identifier_name
ic4164.rs
the column address is put onto the address pins and the active-low /// column address strobe pin CAS is set low. /// /// The chip has three basic modes of operation, controlled by the active-low write-enable /// (WE) pin with some help from CAS. If WE is high, then the chip is in read mode after the /// address is set. If WE is low, the mode depends on whether WE went low before the address /// was set by putting CAS low; if CAS went low first, (meaning the chip was initially in /// read mode), setting WE low will start read-modify-write mode, where the value at that /// address is still available on the data-out pin (Q) even as the new value is set from the /// data-in pin (D). If WE goes low before CAS, then read mode is never entered and write /// mode is enabled instead. The value of D is still written to memory, but Q is /// disconnected and no data is available there. /// /// The Commodore 64 does not use read-modify-write mode. The WE pin is always set to its /// proper level before the CAS pin goes low. /// /// While WE and CAS control what is read from and/or written to the chip's memory, RAS is /// not needed for anything other than setting the row address. Hence RAS can remain low /// through multiple memory accesses, as long as its address is valid for all of them, /// allowing reads and writes to happen within a single 256-address page of memory without /// incurring the cost of resetting the row address. This doesn't happen in the C64; the /// 6567 VIC cycles the RAS line once every clock cycle. /// /// Unlike most other non-logic chips in the system, there is no dedicated chip-select pin. /// The combination of RAS and CAS can be regarded as such a pin, and it is used that way in /// the Commodore 64. /// /// The chip comes in a 16-pin dual in-line package with the following pin assignments. /// ```text /// +---+--+---+ /// NC |1 +--+ 16| Vss /// D |2 15| CAS /// WE |3 14| Q /// RAS |4 13| A6 /// A0 |5 4164 12| A3 /// A2 |6 11| A4 /// A1 |7 10| A5 /// Vcc |8 9| A7 /// +----------+ /// ``` /// These pin assignments are explained below. /// /// | Pin | Name | Description | /// | --- | ----- | ---------------------------------------------------------------------- | /// | 1 | NC | No connection. Not emulated. | /// | --- | ----- | ---------------------------------------------------------------------- | /// | 2 | D | Data input. This pin's value is written to memory when write mode is | /// | | | entered. | /// | --- | ----- | ---------------------------------------------------------------------- | /// | 3 | WE | Active-low write enable. If this is low, memory is being written to. | /// | | | If it is high, memory is being read. | /// | --- | ----- | ---------------------------------------------------------------------- | /// | 4 | RAS | Active-low row address strobe. When this goes low, the value of the | /// | | | address pins is stored as the row address for the internal 256x256 | /// | | | memory array. | /// | --- | ----- | ---------------------------------------------------------------------- | /// | 5 | A0 | Address pins. These 8 pins in conjunction with RAS and CAS allow the | /// | 6 | A2 | the addressing of 65,536 memory locations. | /// | 7 | A1 | | /// | 9 | A7 | | /// | 10 | A5 | | /// | 11 | A4 | | /// | 12 | A3 | | /// | 13 | A6 | | /// | --- | ----- | ---------------------------------------------------------------------- | /// | 8 | Vcc | +5V power supply. Not emulated. | /// | --- | ----- | ---------------------------------------------------------------------- | /// | 14 | Q | Data output. The value of the memory at the latched location appears | /// | | | on this pin when the CAS pin goes low in read mode. | /// | --- | ----- | ---------------------------------------------------------------------- | /// | 15 | CAS | Active-low column address strobe. When this goes low, the value of the | /// | | | address pins is stored as the column address for the internal 256x256 | /// | | | memory array, and the location is either read from or written to, | /// | | | depending on the value of WE. | /// | --- | ----- | ---------------------------------------------------------------------- | /// | 16 | Vss | 0V power supply (ground). Not emulated. | /// /// In the Commodore 64, U9, U10, U11, U12, U21, U22, U23, and U24 are 4164s, one for each /// of the 8 bits on the data bus. pub struct Ic4164 { /// The pins of the 4164, along with a dummy pin (at index 0) to ensure that the vector /// index of the others matches the 1-based pin assignments. pins: RefVec<Pin>, /// Separate references to the A0-A7 pins in the `pins` vector. addr_pins: RefVec<Pin>, /// The place where the data is actually stored. The 4164 is 1-bit memory that is stored /// in a 256x256 matrix internally, but we don't have either u1 or u256 types (bools /// don't count; they actually take up much more than 1 bit of memory space). Instead we /// pack the bits into an array of 2048 u32s, which we then address through a function /// that resolves the row and column into an array index and an index to the bit inside /// the u32 value at that array index. memory: [u32; 2048], /// The latched row value taken from the pins when RAS transitions low. If no row has /// been latched (RAS hasn't yet gone low), this will be `None`. row: Option<u8>, /// The latched column value taken from the pins when CAS transitions low. If no column /// has been latched (CAS hasn't yet gone low), this will be `None`. col: Option<u8>, /// The latched data bit taken from the D pin. This is latched just before a write takes /// place and is done so that its value can replace the Q pin's value in RMW mode /// easily. If no data has been latched (either WE or CAS is not low), this will be /// `None`. data: Option<u8>, } impl Ic4164 { /// Creates a new 4164 64k x 1 dynamic RAM emulation and returns a shared, internally /// mutable reference to it. pub fn new() -> DeviceRef { // Address pins 0-7. let a0 = pin!(A0, "A0", Input); let a1 = pin!(A1, "A1", Input); let a2 = pin!(A2, "A2", Input); let a3 = pin!(A3, "A3", Input); let a4 = pin!(A4, "A4", Input); let a5 = pin!(A5, "A5", Input); let a6 = pin!(A6, "A6", Input); let a7 = pin!(A7, "A7", Input); // The data input pin. When the chip is in write or read-modify-write mode, the // value of this pin will be written to the appropriate bit in the memory array. let d = pin!(D, "D", Input); // The data output pin. This is active in read and read-modify-write mode, set to // the value of the bit at the address latched by RAS and CAS. In write mode, it is // hi-Z. let q = pin!(Q, "Q", Output); // The row address strobe. Setting this low latches the values of A0-A7, saving them // to be part of the address used to access the memory array. let ras = pin!(RAS, "RAS", Input); // The column address strobe. Setting this low latches A0-A7 into the second part of // the memory address. It also initiates read or write mode, depending on the value // of WE. let cas = pin!(CAS, "CAS", Input); // The write-enable pin. If this is high, the chip is in read mode; if it and CAS // are low, the chip is in either write or read-modify-write mode, depending on // which pin went low first. let we = pin!(WE, "WE", Input); // Power supply and no-contact pins. These are not emulated. let nc = pin!(NC, "NC", Unconnected); let vcc = pin!(VCC, "VCC", Unconnected); let vss = pin!(VSS, "VSS", Unconnected); let pins = pins![a0, a1, a2, a3, a4, a5, a6, a7, d, q, ras, cas, we, nc, vcc, vss]; let addr_pins = RefVec::with_vec( IntoIterator::into_iter(PA_ADDRESS) .map(|pa| clone_ref!(pins[pa])) .collect::<Vec<PinRef>>(), ); let device: DeviceRef = new_ref!(Ic4164 { pins, addr_pins, memory: [0; 2048], row: None, col: None, data: None, }); float!(q); attach_to!(device, ras, cas, we); device } /// Reads the row and col and calculates the specific bit in the memory array to which /// this row/col combination refers. The first element of the return value is the index /// of the 32-bit number in the memory array where that bit resides; the second element /// is the index of the bit within that 32-bit number. fn resolve(&self) -> (usize, usize) { // Unless there's a bug in this program, this method should never be called while // either `self.row` or `self.col` are `None`. So we actually *want* it to panic if // `unwrap()` fails. let row = self.row.unwrap() as usize; let col = self.col.unwrap() as usize; let row_index = row << 3; let col_index = (col & 0b1110_0000) >> 5; let bit_index = col & 0b0001_1111; (row_index | col_index, bit_index) } /// Retrieves a single bit from the memory array and sets the level of the Q pin to the /// value of that bit. fn read(&self) { let (index, bit) = self.resolve(); let value = (self.memory[index] & (1 << bit)) >> bit; set_level!(self.pins[Q], Some(value as f64)) } /// Writes the value of the D pin to a single bit in the memory array. If the Q pin is /// also connected, the value is also sent to it; this happens only in RMW mode and /// keeps the input and output data pins synched. (This guaranteed sync means that the /// C64 can connect these two pins with a PC board trace, but the C64 doesn't use RMW /// mode.) fn write(&mut self) { let (index, bit) = self.resolve(); if self.data.unwrap() == 1 { self.memory[index] |= 1 << bit; } else { self.memory[index] &=!(1 << bit); } if!floating!(self.pins[Q]) { set_level!(self.pins[Q], Some(self.data.unwrap() as f64)); } } } impl Device for Ic4164 { fn pins(&self) -> RefVec<Pin> { self.pins.clone() } fn registers(&self) -> Vec<u8> { vec![] } fn update(&mut self, event: &LevelChange) { match event { LevelChange(pin) if number!(pin) == RAS => { // Invoked when the RAS pin changes level. When it goes low, the current // states of the A0-A7 pins are latched. The address is released when the // RAS pin goes high. // // Since this is the only thing that RAS is used for, it can be left low for // multiple memory accesses if its bits of the address remain the same for // those accesses. This can speed up reads and writes within the same page // by reducing the amount of setup needed for those reads and writes. (This // does not happen in the C64.) if high!(pin) { self.row = None; } else { self.row = Some(pins_to_value(&self.addr_pins) as u8); } } LevelChange(pin) if number!(pin) == CAS => { // Invoked when the CAS pin changes level. // // When CAS goes low, the current states of the A0-A7 pins are latched in a // smiliar way to when RAS goes low. What else happens depends on whether // the WE pin is low. If it is, the chip goes into write mode and the value // on the D pin is saved to a memory location referred to by the latched row // and column values. If WE is not low, read mode is entered, and the value // in that memory location is put onto the Q pin. (Setting the WE pin low // after CAS goes low sets read-modify-write mode; the read that CAS // initiated is still valid.) // // When CAS goes high, the Q pin is disconnected and the latched column and // data (if there is one) values are cleared. if high!(pin)
else { self.col = Some(pins_to_value(&self.addr_pins) as u8); if high!(self.pins[WE]) { self.read(); } else { self.data = Some(if high!(self.pins[D]) { 1 } else { 0 }); self.write(); } } } LevelChange(pin) if number!(pin) == WE => { // Invoked when the WE pin changes level. // // When WE is high, read mode is enabled (though the actual read will not be // available until both RAS and CAS are set low, indicating that the address // of the read is valid). The internal latched input data value is cleared. // // When WE goes low, the write mode that is enabled depends on whether CAS // is already low. If it is, the chip must have been in read mode and now // moves into read-modify-write mode. The data value on the Q pin remains // valid, and the valus on the D pin is latched and stored at the // appropriate memory location. // // If CAS is still high when WE goes low, the Q pin is disconnected. Nothing // further happens until CAS goes low; at that point, the chip goes into // write mode (data is written to memory but nothing is available to be // read). if high!(pin) { self.data = None; } else { if high!(self.pins[CAS]) { float!(self.pins[Q]); } else { self.data = Some(if high!(self.pins[D]) { 1 } else { 0 }); self.write(); } } } _ => {} } } fn debug_fmt(&self, f: &mut std::fmt::Formatter) -> std::fmt::Result { write!(f, "{:?}, {:?}, {:?}", self.row, self.col, self.data) } } #[cfg(test)] mod test { use crate::{ components::trace::{Trace, TraceRef}, test_utils::{make_traces, value_to_traces}, }; use super::*; fn before_each() -> (DeviceRef, RefVec<Trace>, RefVec<Trace>) { let device = Ic4164::new(); let tr = make_traces(&device); set!(tr[WE]); set!(tr[RAS]); set!(tr[CAS]); let addr_tr = RefVec::with_vec( IntoIterator::into_iter(PA_ADDRESS) .map(|p| clone_ref!(tr[p])) .collect::<Vec<TraceRef>>(), ); (device, tr, addr_tr) } #[test] fn read_mode_enable_q() { let (_, tr, _) = before_each(); clear!(tr[RAS]); clear!(tr[CAS]); // data at 0x0000, which will be 0 initially assert!(low!(tr[Q]), "Q should have data during read"); set!(tr[CAS]); set!(tr[RAS]); assert!(floating!(tr[Q]), "Q should be disabled after read"); } #[test] fn write_mode_disable_q() { let (_, tr, _) = before_each(); clear!(tr[RAS]); clear!(tr[WE]); clear!(tr[CAS]); assert!(floating!(tr[Q]), "Q should be disabled during write"); set!(tr[CAS]); set!(tr[WE]); set!(tr[RAS]); assert!(floating!(tr[Q]), "Q should be disabled after write"); } #[test] fn rmw_mode_enable_q() { let (_, tr, _) = before_each(); clear!(tr[D]); clear!(tr[RAS]); clear!(tr[CAS]); clear!(tr[WE]); assert!(low!(tr[Q]), "Q should be enabled during RMW"); set!(tr[WE]); set!(tr[CAS]); set!(tr[RAS]); assert!(floating!(tr[Q]), "Q should be disabled after RMW"); } #[test] fn read_write_one_bit() { let (_, tr, _) = before_each(); // Write is happening at 0x0000, so we don't need to set addresses at all set!(tr[D]); clear!(tr[WE]); clear!(tr[RAS]); clear!(tr[CAS]); // 1 is written to address 0x0000 at this point set!(tr[CAS]); set!(tr[RAS]); set!(tr[WE]); clear!(tr[RAS]); clear!(tr[CAS]); let value = high!(tr[Q]); set!(tr[CAS]); set!(tr[RAS]); assert!(value, "Value 1 not written to address 0x0000"); } #[test] fn rmw_one_bit() { let (_, tr, _) = before_each(); // Write is happening at 0x0000, so we don't need to set addresses at all set!(tr[D]); clear!(tr[RAS]); clear!(tr[CAS]); // in read mode, Q should be 0 because no data has been written to 0x0000 yet assert!( low!(tr[Q]), "Value 0 not read from address 0x0000 in RMW mode" ); // Lower WE to go into RMW clear!(tr[WE]); // 1 is written to address 0x0000 at this point set!(tr[CAS]); set!(tr[RAS]); set!(tr[WE]); clear!(tr[RAS]); clear!(tr[CAS]); let value = high!(tr[Q]); set!(tr[CAS]); set!(tr[RAS]);
{ float!(self.pins[Q]); self.col = None; self.data = None; }
conditional_block
ic4164.rs
then the column address is put onto the address pins and the active-low /// column address strobe pin CAS is set low. /// /// The chip has three basic modes of operation, controlled by the active-low write-enable /// (WE) pin with some help from CAS. If WE is high, then the chip is in read mode after the /// address is set. If WE is low, the mode depends on whether WE went low before the address /// was set by putting CAS low; if CAS went low first, (meaning the chip was initially in /// read mode), setting WE low will start read-modify-write mode, where the value at that /// address is still available on the data-out pin (Q) even as the new value is set from the /// data-in pin (D). If WE goes low before CAS, then read mode is never entered and write /// mode is enabled instead. The value of D is still written to memory, but Q is /// disconnected and no data is available there. /// /// The Commodore 64 does not use read-modify-write mode. The WE pin is always set to its /// proper level before the CAS pin goes low. /// /// While WE and CAS control what is read from and/or written to the chip's memory, RAS is /// not needed for anything other than setting the row address. Hence RAS can remain low /// through multiple memory accesses, as long as its address is valid for all of them, /// allowing reads and writes to happen within a single 256-address page of memory without /// incurring the cost of resetting the row address. This doesn't happen in the C64; the /// 6567 VIC cycles the RAS line once every clock cycle. /// /// Unlike most other non-logic chips in the system, there is no dedicated chip-select pin. /// The combination of RAS and CAS can be regarded as such a pin, and it is used that way in /// the Commodore 64. /// /// The chip comes in a 16-pin dual in-line package with the following pin assignments. /// ```text /// +---+--+---+ /// NC |1 +--+ 16| Vss /// D |2 15| CAS /// WE |3 14| Q /// RAS |4 13| A6 /// A0 |5 4164 12| A3 /// A2 |6 11| A4 /// A1 |7 10| A5 /// Vcc |8 9| A7 /// +----------+ /// ``` /// These pin assignments are explained below. /// /// | Pin | Name | Description | /// | --- | ----- | ---------------------------------------------------------------------- | /// | 1 | NC | No connection. Not emulated. | /// | --- | ----- | ---------------------------------------------------------------------- | /// | 2 | D | Data input. This pin's value is written to memory when write mode is | /// | | | entered. | /// | --- | ----- | ---------------------------------------------------------------------- | /// | 3 | WE | Active-low write enable. If this is low, memory is being written to. | /// | | | If it is high, memory is being read. | /// | --- | ----- | ---------------------------------------------------------------------- | /// | 4 | RAS | Active-low row address strobe. When this goes low, the value of the | /// | | | address pins is stored as the row address for the internal 256x256 | /// | | | memory array. | /// | --- | ----- | ---------------------------------------------------------------------- | /// | 5 | A0 | Address pins. These 8 pins in conjunction with RAS and CAS allow the | /// | 6 | A2 | the addressing of 65,536 memory locations. | /// | 7 | A1 | | /// | 9 | A7 | | /// | 10 | A5 | | /// | 11 | A4 | | /// | 12 | A3 | | /// | 13 | A6 | | /// | --- | ----- | ---------------------------------------------------------------------- | /// | 8 | Vcc | +5V power supply. Not emulated. | /// | --- | ----- | ---------------------------------------------------------------------- | /// | 14 | Q | Data output. The value of the memory at the latched location appears | /// | | | on this pin when the CAS pin goes low in read mode. | /// | --- | ----- | ---------------------------------------------------------------------- | /// | 15 | CAS | Active-low column address strobe. When this goes low, the value of the | /// | | | address pins is stored as the column address for the internal 256x256 | /// | | | memory array, and the location is either read from or written to, | /// | | | depending on the value of WE. | /// | --- | ----- | ---------------------------------------------------------------------- | /// | 16 | Vss | 0V power supply (ground). Not emulated. | /// /// In the Commodore 64, U9, U10, U11, U12, U21, U22, U23, and U24 are 4164s, one for each /// of the 8 bits on the data bus. pub struct Ic4164 { /// The pins of the 4164, along with a dummy pin (at index 0) to ensure that the vector /// index of the others matches the 1-based pin assignments. pins: RefVec<Pin>, /// Separate references to the A0-A7 pins in the `pins` vector. addr_pins: RefVec<Pin>, /// The place where the data is actually stored. The 4164 is 1-bit memory that is stored /// in a 256x256 matrix internally, but we don't have either u1 or u256 types (bools /// don't count; they actually take up much more than 1 bit of memory space). Instead we /// pack the bits into an array of 2048 u32s, which we then address through a function /// that resolves the row and column into an array index and an index to the bit inside /// the u32 value at that array index. memory: [u32; 2048], /// The latched row value taken from the pins when RAS transitions low. If no row has /// been latched (RAS hasn't yet gone low), this will be `None`. row: Option<u8>, /// The latched column value taken from the pins when CAS transitions low. If no column /// has been latched (CAS hasn't yet gone low), this will be `None`. col: Option<u8>, /// The latched data bit taken from the D pin. This is latched just before a write takes /// place and is done so that its value can replace the Q pin's value in RMW mode /// easily. If no data has been latched (either WE or CAS is not low), this will be /// `None`. data: Option<u8>, } impl Ic4164 { /// Creates a new 4164 64k x 1 dynamic RAM emulation and returns a shared, internally /// mutable reference to it. pub fn new() -> DeviceRef { // Address pins 0-7. let a0 = pin!(A0, "A0", Input); let a1 = pin!(A1, "A1", Input); let a2 = pin!(A2, "A2", Input); let a3 = pin!(A3, "A3", Input); let a4 = pin!(A4, "A4", Input); let a5 = pin!(A5, "A5", Input); let a6 = pin!(A6, "A6", Input); let a7 = pin!(A7, "A7", Input); // The data input pin. When the chip is in write or read-modify-write mode, the // value of this pin will be written to the appropriate bit in the memory array. let d = pin!(D, "D", Input); // The data output pin. This is active in read and read-modify-write mode, set to // the value of the bit at the address latched by RAS and CAS. In write mode, it is // hi-Z. let q = pin!(Q, "Q", Output); // The row address strobe. Setting this low latches the values of A0-A7, saving them // to be part of the address used to access the memory array. let ras = pin!(RAS, "RAS", Input); // The column address strobe. Setting this low latches A0-A7 into the second part of // the memory address. It also initiates read or write mode, depending on the value // of WE. let cas = pin!(CAS, "CAS", Input); // The write-enable pin. If this is high, the chip is in read mode; if it and CAS // are low, the chip is in either write or read-modify-write mode, depending on // which pin went low first. let we = pin!(WE, "WE", Input); // Power supply and no-contact pins. These are not emulated. let nc = pin!(NC, "NC", Unconnected); let vcc = pin!(VCC, "VCC", Unconnected); let vss = pin!(VSS, "VSS", Unconnected); let pins = pins![a0, a1, a2, a3, a4, a5, a6, a7, d, q, ras, cas, we, nc, vcc, vss]; let addr_pins = RefVec::with_vec( IntoIterator::into_iter(PA_ADDRESS) .map(|pa| clone_ref!(pins[pa])) .collect::<Vec<PinRef>>(), ); let device: DeviceRef = new_ref!(Ic4164 { pins, addr_pins, memory: [0; 2048], row: None, col: None, data: None, }); float!(q); attach_to!(device, ras, cas, we); device } /// Reads the row and col and calculates the specific bit in the memory array to which /// this row/col combination refers. The first element of the return value is the index /// of the 32-bit number in the memory array where that bit resides; the second element /// is the index of the bit within that 32-bit number. fn resolve(&self) -> (usize, usize) { // Unless there's a bug in this program, this method should never be called while // either `self.row` or `self.col` are `None`. So we actually *want* it to panic if // `unwrap()` fails. let row = self.row.unwrap() as usize; let col = self.col.unwrap() as usize; let row_index = row << 3; let col_index = (col & 0b1110_0000) >> 5; let bit_index = col & 0b0001_1111; (row_index | col_index, bit_index) } /// Retrieves a single bit from the memory array and sets the level of the Q pin to the /// value of that bit. fn read(&self) { let (index, bit) = self.resolve(); let value = (self.memory[index] & (1 << bit)) >> bit; set_level!(self.pins[Q], Some(value as f64)) } /// Writes the value of the D pin to a single bit in the memory array. If the Q pin is /// also connected, the value is also sent to it; this happens only in RMW mode and /// keeps the input and output data pins synched. (This guaranteed sync means that the /// C64 can connect these two pins with a PC board trace, but the C64 doesn't use RMW /// mode.) fn write(&mut self) { let (index, bit) = self.resolve(); if self.data.unwrap() == 1 { self.memory[index] |= 1 << bit; } else { self.memory[index] &=!(1 << bit); } if!floating!(self.pins[Q]) { set_level!(self.pins[Q], Some(self.data.unwrap() as f64)); } } } impl Device for Ic4164 { fn pins(&self) -> RefVec<Pin> { self.pins.clone() } fn registers(&self) -> Vec<u8> { vec![] } fn update(&mut self, event: &LevelChange) { match event { LevelChange(pin) if number!(pin) == RAS => { // Invoked when the RAS pin changes level. When it goes low, the current // states of the A0-A7 pins are latched. The address is released when the // RAS pin goes high. // // Since this is the only thing that RAS is used for, it can be left low for // multiple memory accesses if its bits of the address remain the same for // those accesses. This can speed up reads and writes within the same page // by reducing the amount of setup needed for those reads and writes. (This // does not happen in the C64.) if high!(pin) { self.row = None; } else { self.row = Some(pins_to_value(&self.addr_pins) as u8); } } LevelChange(pin) if number!(pin) == CAS => { // Invoked when the CAS pin changes level. // // When CAS goes low, the current states of the A0-A7 pins are latched in a // smiliar way to when RAS goes low. What else happens depends on whether // the WE pin is low. If it is, the chip goes into write mode and the value // on the D pin is saved to a memory location referred to by the latched row // and column values. If WE is not low, read mode is entered, and the value // in that memory location is put onto the Q pin. (Setting the WE pin low // after CAS goes low sets read-modify-write mode; the read that CAS // initiated is still valid.) // // When CAS goes high, the Q pin is disconnected and the latched column and // data (if there is one) values are cleared. if high!(pin) { float!(self.pins[Q]); self.col = None; self.data = None; } else { self.col = Some(pins_to_value(&self.addr_pins) as u8); if high!(self.pins[WE]) { self.read(); } else { self.data = Some(if high!(self.pins[D]) { 1 } else { 0 }); self.write(); } } } LevelChange(pin) if number!(pin) == WE => { // Invoked when the WE pin changes level. // // When WE is high, read mode is enabled (though the actual read will not be // available until both RAS and CAS are set low, indicating that the address // of the read is valid). The internal latched input data value is cleared. // // When WE goes low, the write mode that is enabled depends on whether CAS // is already low. If it is, the chip must have been in read mode and now // moves into read-modify-write mode. The data value on the Q pin remains // valid, and the valus on the D pin is latched and stored at the // appropriate memory location. // // If CAS is still high when WE goes low, the Q pin is disconnected. Nothing // further happens until CAS goes low; at that point, the chip goes into // write mode (data is written to memory but nothing is available to be // read). if high!(pin) { self.data = None; } else { if high!(self.pins[CAS]) { float!(self.pins[Q]); } else { self.data = Some(if high!(self.pins[D]) { 1 } else { 0 }); self.write(); } } } _ => {} } } fn debug_fmt(&self, f: &mut std::fmt::Formatter) -> std::fmt::Result { write!(f, "{:?}, {:?}, {:?}", self.row, self.col, self.data) } } #[cfg(test)] mod test { use crate::{ components::trace::{Trace, TraceRef}, test_utils::{make_traces, value_to_traces}, }; use super::*; fn before_each() -> (DeviceRef, RefVec<Trace>, RefVec<Trace>) { let device = Ic4164::new(); let tr = make_traces(&device); set!(tr[WE]); set!(tr[RAS]); set!(tr[CAS]); let addr_tr = RefVec::with_vec( IntoIterator::into_iter(PA_ADDRESS) .map(|p| clone_ref!(tr[p])) .collect::<Vec<TraceRef>>(), ); (device, tr, addr_tr) } #[test] fn read_mode_enable_q() { let (_, tr, _) = before_each(); clear!(tr[RAS]); clear!(tr[CAS]); // data at 0x0000, which will be 0 initially assert!(low!(tr[Q]), "Q should have data during read"); set!(tr[CAS]); set!(tr[RAS]); assert!(floating!(tr[Q]), "Q should be disabled after read"); } #[test] fn write_mode_disable_q() { let (_, tr, _) = before_each(); clear!(tr[RAS]); clear!(tr[WE]); clear!(tr[CAS]); assert!(floating!(tr[Q]), "Q should be disabled during write"); set!(tr[CAS]); set!(tr[WE]); set!(tr[RAS]); assert!(floating!(tr[Q]), "Q should be disabled after write"); } #[test] fn rmw_mode_enable_q() { let (_, tr, _) = before_each(); clear!(tr[D]); clear!(tr[RAS]); clear!(tr[CAS]); clear!(tr[WE]); assert!(low!(tr[Q]), "Q should be enabled during RMW"); set!(tr[WE]); set!(tr[CAS]); set!(tr[RAS]); assert!(floating!(tr[Q]), "Q should be disabled after RMW"); } #[test] fn read_write_one_bit() { let (_, tr, _) = before_each(); // Write is happening at 0x0000, so we don't need to set addresses at all set!(tr[D]); clear!(tr[WE]); clear!(tr[RAS]); clear!(tr[CAS]); // 1 is written to address 0x0000 at this point set!(tr[CAS]); set!(tr[RAS]); set!(tr[WE]); clear!(tr[RAS]); clear!(tr[CAS]); let value = high!(tr[Q]); set!(tr[CAS]); set!(tr[RAS]); assert!(value, "Value 1 not written to address 0x0000"); } #[test] fn rmw_one_bit() { let (_, tr, _) = before_each(); // Write is happening at 0x0000, so we don't need to set addresses at all set!(tr[D]); clear!(tr[RAS]); clear!(tr[CAS]); // in read mode, Q should be 0 because no data has been written to 0x0000 yet assert!( low!(tr[Q]), "Value 0 not read from address 0x0000 in RMW mode" ); // Lower WE to go into RMW
// 1 is written to address 0x0000 at this point set!(tr[CAS]); set!(tr[RAS]); set!(tr[WE]); clear!(tr[RAS]); clear!(tr[CAS]); let value = high!(tr[Q]); set!(tr[CAS]); set!(tr[RAS]);
clear!(tr[WE]);
random_line_split
ic4164.rs
the column address is put onto the address pins and the active-low /// column address strobe pin CAS is set low. /// /// The chip has three basic modes of operation, controlled by the active-low write-enable /// (WE) pin with some help from CAS. If WE is high, then the chip is in read mode after the /// address is set. If WE is low, the mode depends on whether WE went low before the address /// was set by putting CAS low; if CAS went low first, (meaning the chip was initially in /// read mode), setting WE low will start read-modify-write mode, where the value at that /// address is still available on the data-out pin (Q) even as the new value is set from the /// data-in pin (D). If WE goes low before CAS, then read mode is never entered and write /// mode is enabled instead. The value of D is still written to memory, but Q is /// disconnected and no data is available there. /// /// The Commodore 64 does not use read-modify-write mode. The WE pin is always set to its /// proper level before the CAS pin goes low. /// /// While WE and CAS control what is read from and/or written to the chip's memory, RAS is /// not needed for anything other than setting the row address. Hence RAS can remain low /// through multiple memory accesses, as long as its address is valid for all of them, /// allowing reads and writes to happen within a single 256-address page of memory without /// incurring the cost of resetting the row address. This doesn't happen in the C64; the /// 6567 VIC cycles the RAS line once every clock cycle. /// /// Unlike most other non-logic chips in the system, there is no dedicated chip-select pin. /// The combination of RAS and CAS can be regarded as such a pin, and it is used that way in /// the Commodore 64. /// /// The chip comes in a 16-pin dual in-line package with the following pin assignments. /// ```text /// +---+--+---+ /// NC |1 +--+ 16| Vss /// D |2 15| CAS /// WE |3 14| Q /// RAS |4 13| A6 /// A0 |5 4164 12| A3 /// A2 |6 11| A4 /// A1 |7 10| A5 /// Vcc |8 9| A7 /// +----------+ /// ``` /// These pin assignments are explained below. /// /// | Pin | Name | Description | /// | --- | ----- | ---------------------------------------------------------------------- | /// | 1 | NC | No connection. Not emulated. | /// | --- | ----- | ---------------------------------------------------------------------- | /// | 2 | D | Data input. This pin's value is written to memory when write mode is | /// | | | entered. | /// | --- | ----- | ---------------------------------------------------------------------- | /// | 3 | WE | Active-low write enable. If this is low, memory is being written to. | /// | | | If it is high, memory is being read. | /// | --- | ----- | ---------------------------------------------------------------------- | /// | 4 | RAS | Active-low row address strobe. When this goes low, the value of the | /// | | | address pins is stored as the row address for the internal 256x256 | /// | | | memory array. | /// | --- | ----- | ---------------------------------------------------------------------- | /// | 5 | A0 | Address pins. These 8 pins in conjunction with RAS and CAS allow the | /// | 6 | A2 | the addressing of 65,536 memory locations. | /// | 7 | A1 | | /// | 9 | A7 | | /// | 10 | A5 | | /// | 11 | A4 | | /// | 12 | A3 | | /// | 13 | A6 | | /// | --- | ----- | ---------------------------------------------------------------------- | /// | 8 | Vcc | +5V power supply. Not emulated. | /// | --- | ----- | ---------------------------------------------------------------------- | /// | 14 | Q | Data output. The value of the memory at the latched location appears | /// | | | on this pin when the CAS pin goes low in read mode. | /// | --- | ----- | ---------------------------------------------------------------------- | /// | 15 | CAS | Active-low column address strobe. When this goes low, the value of the | /// | | | address pins is stored as the column address for the internal 256x256 | /// | | | memory array, and the location is either read from or written to, | /// | | | depending on the value of WE. | /// | --- | ----- | ---------------------------------------------------------------------- | /// | 16 | Vss | 0V power supply (ground). Not emulated. | /// /// In the Commodore 64, U9, U10, U11, U12, U21, U22, U23, and U24 are 4164s, one for each /// of the 8 bits on the data bus. pub struct Ic4164 { /// The pins of the 4164, along with a dummy pin (at index 0) to ensure that the vector /// index of the others matches the 1-based pin assignments. pins: RefVec<Pin>, /// Separate references to the A0-A7 pins in the `pins` vector. addr_pins: RefVec<Pin>, /// The place where the data is actually stored. The 4164 is 1-bit memory that is stored /// in a 256x256 matrix internally, but we don't have either u1 or u256 types (bools /// don't count; they actually take up much more than 1 bit of memory space). Instead we /// pack the bits into an array of 2048 u32s, which we then address through a function /// that resolves the row and column into an array index and an index to the bit inside /// the u32 value at that array index. memory: [u32; 2048], /// The latched row value taken from the pins when RAS transitions low. If no row has /// been latched (RAS hasn't yet gone low), this will be `None`. row: Option<u8>, /// The latched column value taken from the pins when CAS transitions low. If no column /// has been latched (CAS hasn't yet gone low), this will be `None`. col: Option<u8>, /// The latched data bit taken from the D pin. This is latched just before a write takes /// place and is done so that its value can replace the Q pin's value in RMW mode /// easily. If no data has been latched (either WE or CAS is not low), this will be /// `None`. data: Option<u8>, } impl Ic4164 { /// Creates a new 4164 64k x 1 dynamic RAM emulation and returns a shared, internally /// mutable reference to it. pub fn new() -> DeviceRef { // Address pins 0-7. let a0 = pin!(A0, "A0", Input); let a1 = pin!(A1, "A1", Input); let a2 = pin!(A2, "A2", Input); let a3 = pin!(A3, "A3", Input); let a4 = pin!(A4, "A4", Input); let a5 = pin!(A5, "A5", Input); let a6 = pin!(A6, "A6", Input); let a7 = pin!(A7, "A7", Input); // The data input pin. When the chip is in write or read-modify-write mode, the // value of this pin will be written to the appropriate bit in the memory array. let d = pin!(D, "D", Input); // The data output pin. This is active in read and read-modify-write mode, set to // the value of the bit at the address latched by RAS and CAS. In write mode, it is // hi-Z. let q = pin!(Q, "Q", Output); // The row address strobe. Setting this low latches the values of A0-A7, saving them // to be part of the address used to access the memory array. let ras = pin!(RAS, "RAS", Input); // The column address strobe. Setting this low latches A0-A7 into the second part of // the memory address. It also initiates read or write mode, depending on the value // of WE. let cas = pin!(CAS, "CAS", Input); // The write-enable pin. If this is high, the chip is in read mode; if it and CAS // are low, the chip is in either write or read-modify-write mode, depending on // which pin went low first. let we = pin!(WE, "WE", Input); // Power supply and no-contact pins. These are not emulated. let nc = pin!(NC, "NC", Unconnected); let vcc = pin!(VCC, "VCC", Unconnected); let vss = pin!(VSS, "VSS", Unconnected); let pins = pins![a0, a1, a2, a3, a4, a5, a6, a7, d, q, ras, cas, we, nc, vcc, vss]; let addr_pins = RefVec::with_vec( IntoIterator::into_iter(PA_ADDRESS) .map(|pa| clone_ref!(pins[pa])) .collect::<Vec<PinRef>>(), ); let device: DeviceRef = new_ref!(Ic4164 { pins, addr_pins, memory: [0; 2048], row: None, col: None, data: None, }); float!(q); attach_to!(device, ras, cas, we); device } /// Reads the row and col and calculates the specific bit in the memory array to which /// this row/col combination refers. The first element of the return value is the index /// of the 32-bit number in the memory array where that bit resides; the second element /// is the index of the bit within that 32-bit number. fn resolve(&self) -> (usize, usize) { // Unless there's a bug in this program, this method should never be called while // either `self.row` or `self.col` are `None`. So we actually *want* it to panic if // `unwrap()` fails. let row = self.row.unwrap() as usize; let col = self.col.unwrap() as usize; let row_index = row << 3; let col_index = (col & 0b1110_0000) >> 5; let bit_index = col & 0b0001_1111; (row_index | col_index, bit_index) } /// Retrieves a single bit from the memory array and sets the level of the Q pin to the /// value of that bit. fn read(&self) { let (index, bit) = self.resolve(); let value = (self.memory[index] & (1 << bit)) >> bit; set_level!(self.pins[Q], Some(value as f64)) } /// Writes the value of the D pin to a single bit in the memory array. If the Q pin is /// also connected, the value is also sent to it; this happens only in RMW mode and /// keeps the input and output data pins synched. (This guaranteed sync means that the /// C64 can connect these two pins with a PC board trace, but the C64 doesn't use RMW /// mode.) fn write(&mut self) { let (index, bit) = self.resolve(); if self.data.unwrap() == 1 { self.memory[index] |= 1 << bit; } else { self.memory[index] &=!(1 << bit); } if!floating!(self.pins[Q]) { set_level!(self.pins[Q], Some(self.data.unwrap() as f64)); } } } impl Device for Ic4164 { fn pins(&self) -> RefVec<Pin> { self.pins.clone() } fn registers(&self) -> Vec<u8> { vec![] } fn update(&mut self, event: &LevelChange) { match event { LevelChange(pin) if number!(pin) == RAS => { // Invoked when the RAS pin changes level. When it goes low, the current // states of the A0-A7 pins are latched. The address is released when the // RAS pin goes high. // // Since this is the only thing that RAS is used for, it can be left low for // multiple memory accesses if its bits of the address remain the same for // those accesses. This can speed up reads and writes within the same page // by reducing the amount of setup needed for those reads and writes. (This // does not happen in the C64.) if high!(pin) { self.row = None; } else { self.row = Some(pins_to_value(&self.addr_pins) as u8); } } LevelChange(pin) if number!(pin) == CAS => { // Invoked when the CAS pin changes level. // // When CAS goes low, the current states of the A0-A7 pins are latched in a // smiliar way to when RAS goes low. What else happens depends on whether // the WE pin is low. If it is, the chip goes into write mode and the value // on the D pin is saved to a memory location referred to by the latched row // and column values. If WE is not low, read mode is entered, and the value // in that memory location is put onto the Q pin. (Setting the WE pin low // after CAS goes low sets read-modify-write mode; the read that CAS // initiated is still valid.) // // When CAS goes high, the Q pin is disconnected and the latched column and // data (if there is one) values are cleared. if high!(pin) { float!(self.pins[Q]); self.col = None; self.data = None; } else { self.col = Some(pins_to_value(&self.addr_pins) as u8); if high!(self.pins[WE]) { self.read(); } else { self.data = Some(if high!(self.pins[D]) { 1 } else { 0 }); self.write(); } } } LevelChange(pin) if number!(pin) == WE => { // Invoked when the WE pin changes level. // // When WE is high, read mode is enabled (though the actual read will not be // available until both RAS and CAS are set low, indicating that the address // of the read is valid). The internal latched input data value is cleared. // // When WE goes low, the write mode that is enabled depends on whether CAS // is already low. If it is, the chip must have been in read mode and now // moves into read-modify-write mode. The data value on the Q pin remains // valid, and the valus on the D pin is latched and stored at the // appropriate memory location. // // If CAS is still high when WE goes low, the Q pin is disconnected. Nothing // further happens until CAS goes low; at that point, the chip goes into // write mode (data is written to memory but nothing is available to be // read). if high!(pin) { self.data = None; } else { if high!(self.pins[CAS]) { float!(self.pins[Q]); } else { self.data = Some(if high!(self.pins[D]) { 1 } else { 0 }); self.write(); } } } _ => {} } } fn debug_fmt(&self, f: &mut std::fmt::Formatter) -> std::fmt::Result { write!(f, "{:?}, {:?}, {:?}", self.row, self.col, self.data) } } #[cfg(test)] mod test { use crate::{ components::trace::{Trace, TraceRef}, test_utils::{make_traces, value_to_traces}, }; use super::*; fn before_each() -> (DeviceRef, RefVec<Trace>, RefVec<Trace>) { let device = Ic4164::new(); let tr = make_traces(&device); set!(tr[WE]); set!(tr[RAS]); set!(tr[CAS]); let addr_tr = RefVec::with_vec( IntoIterator::into_iter(PA_ADDRESS) .map(|p| clone_ref!(tr[p])) .collect::<Vec<TraceRef>>(), ); (device, tr, addr_tr) } #[test] fn read_mode_enable_q() { let (_, tr, _) = before_each(); clear!(tr[RAS]); clear!(tr[CAS]); // data at 0x0000, which will be 0 initially assert!(low!(tr[Q]), "Q should have data during read"); set!(tr[CAS]); set!(tr[RAS]); assert!(floating!(tr[Q]), "Q should be disabled after read"); } #[test] fn write_mode_disable_q() { let (_, tr, _) = before_each(); clear!(tr[RAS]); clear!(tr[WE]); clear!(tr[CAS]); assert!(floating!(tr[Q]), "Q should be disabled during write"); set!(tr[CAS]); set!(tr[WE]); set!(tr[RAS]); assert!(floating!(tr[Q]), "Q should be disabled after write"); } #[test] fn rmw_mode_enable_q() { let (_, tr, _) = before_each(); clear!(tr[D]); clear!(tr[RAS]); clear!(tr[CAS]); clear!(tr[WE]); assert!(low!(tr[Q]), "Q should be enabled during RMW"); set!(tr[WE]); set!(tr[CAS]); set!(tr[RAS]); assert!(floating!(tr[Q]), "Q should be disabled after RMW"); } #[test] fn
() { let (_, tr, _) = before_each(); // Write is happening at 0x0000, so we don't need to set addresses at all set!(tr[D]); clear!(tr[WE]); clear!(tr[RAS]); clear!(tr[CAS]); // 1 is written to address 0x0000 at this point set!(tr[CAS]); set!(tr[RAS]); set!(tr[WE]); clear!(tr[RAS]); clear!(tr[CAS]); let value = high!(tr[Q]); set!(tr[CAS]); set!(tr[RAS]); assert!(value, "Value 1 not written to address 0x0000"); } #[test] fn rmw_one_bit() { let (_, tr, _) = before_each(); // Write is happening at 0x0000, so we don't need to set addresses at all set!(tr[D]); clear!(tr[RAS]); clear!(tr[CAS]); // in read mode, Q should be 0 because no data has been written to 0x0000 yet assert!( low!(tr[Q]), "Value 0 not read from address 0x0000 in RMW mode" ); // Lower WE to go into RMW clear!(tr[WE]); // 1 is written to address 0x0000 at this point set!(tr[CAS]); set!(tr[RAS]); set!(tr[WE]); clear!(tr[RAS]); clear!(tr[CAS]); let value = high!(tr[Q]); set!(tr[CAS]); set!(tr[RAS]);
read_write_one_bit
identifier_name
ic4164.rs
the column address is put onto the address pins and the active-low /// column address strobe pin CAS is set low. /// /// The chip has three basic modes of operation, controlled by the active-low write-enable /// (WE) pin with some help from CAS. If WE is high, then the chip is in read mode after the /// address is set. If WE is low, the mode depends on whether WE went low before the address /// was set by putting CAS low; if CAS went low first, (meaning the chip was initially in /// read mode), setting WE low will start read-modify-write mode, where the value at that /// address is still available on the data-out pin (Q) even as the new value is set from the /// data-in pin (D). If WE goes low before CAS, then read mode is never entered and write /// mode is enabled instead. The value of D is still written to memory, but Q is /// disconnected and no data is available there. /// /// The Commodore 64 does not use read-modify-write mode. The WE pin is always set to its /// proper level before the CAS pin goes low. /// /// While WE and CAS control what is read from and/or written to the chip's memory, RAS is /// not needed for anything other than setting the row address. Hence RAS can remain low /// through multiple memory accesses, as long as its address is valid for all of them, /// allowing reads and writes to happen within a single 256-address page of memory without /// incurring the cost of resetting the row address. This doesn't happen in the C64; the /// 6567 VIC cycles the RAS line once every clock cycle. /// /// Unlike most other non-logic chips in the system, there is no dedicated chip-select pin. /// The combination of RAS and CAS can be regarded as such a pin, and it is used that way in /// the Commodore 64. /// /// The chip comes in a 16-pin dual in-line package with the following pin assignments. /// ```text /// +---+--+---+ /// NC |1 +--+ 16| Vss /// D |2 15| CAS /// WE |3 14| Q /// RAS |4 13| A6 /// A0 |5 4164 12| A3 /// A2 |6 11| A4 /// A1 |7 10| A5 /// Vcc |8 9| A7 /// +----------+ /// ``` /// These pin assignments are explained below. /// /// | Pin | Name | Description | /// | --- | ----- | ---------------------------------------------------------------------- | /// | 1 | NC | No connection. Not emulated. | /// | --- | ----- | ---------------------------------------------------------------------- | /// | 2 | D | Data input. This pin's value is written to memory when write mode is | /// | | | entered. | /// | --- | ----- | ---------------------------------------------------------------------- | /// | 3 | WE | Active-low write enable. If this is low, memory is being written to. | /// | | | If it is high, memory is being read. | /// | --- | ----- | ---------------------------------------------------------------------- | /// | 4 | RAS | Active-low row address strobe. When this goes low, the value of the | /// | | | address pins is stored as the row address for the internal 256x256 | /// | | | memory array. | /// | --- | ----- | ---------------------------------------------------------------------- | /// | 5 | A0 | Address pins. These 8 pins in conjunction with RAS and CAS allow the | /// | 6 | A2 | the addressing of 65,536 memory locations. | /// | 7 | A1 | | /// | 9 | A7 | | /// | 10 | A5 | | /// | 11 | A4 | | /// | 12 | A3 | | /// | 13 | A6 | | /// | --- | ----- | ---------------------------------------------------------------------- | /// | 8 | Vcc | +5V power supply. Not emulated. | /// | --- | ----- | ---------------------------------------------------------------------- | /// | 14 | Q | Data output. The value of the memory at the latched location appears | /// | | | on this pin when the CAS pin goes low in read mode. | /// | --- | ----- | ---------------------------------------------------------------------- | /// | 15 | CAS | Active-low column address strobe. When this goes low, the value of the | /// | | | address pins is stored as the column address for the internal 256x256 | /// | | | memory array, and the location is either read from or written to, | /// | | | depending on the value of WE. | /// | --- | ----- | ---------------------------------------------------------------------- | /// | 16 | Vss | 0V power supply (ground). Not emulated. | /// /// In the Commodore 64, U9, U10, U11, U12, U21, U22, U23, and U24 are 4164s, one for each /// of the 8 bits on the data bus. pub struct Ic4164 { /// The pins of the 4164, along with a dummy pin (at index 0) to ensure that the vector /// index of the others matches the 1-based pin assignments. pins: RefVec<Pin>, /// Separate references to the A0-A7 pins in the `pins` vector. addr_pins: RefVec<Pin>, /// The place where the data is actually stored. The 4164 is 1-bit memory that is stored /// in a 256x256 matrix internally, but we don't have either u1 or u256 types (bools /// don't count; they actually take up much more than 1 bit of memory space). Instead we /// pack the bits into an array of 2048 u32s, which we then address through a function /// that resolves the row and column into an array index and an index to the bit inside /// the u32 value at that array index. memory: [u32; 2048], /// The latched row value taken from the pins when RAS transitions low. If no row has /// been latched (RAS hasn't yet gone low), this will be `None`. row: Option<u8>, /// The latched column value taken from the pins when CAS transitions low. If no column /// has been latched (CAS hasn't yet gone low), this will be `None`. col: Option<u8>, /// The latched data bit taken from the D pin. This is latched just before a write takes /// place and is done so that its value can replace the Q pin's value in RMW mode /// easily. If no data has been latched (either WE or CAS is not low), this will be /// `None`. data: Option<u8>, } impl Ic4164 { /// Creates a new 4164 64k x 1 dynamic RAM emulation and returns a shared, internally /// mutable reference to it. pub fn new() -> DeviceRef { // Address pins 0-7. let a0 = pin!(A0, "A0", Input); let a1 = pin!(A1, "A1", Input); let a2 = pin!(A2, "A2", Input); let a3 = pin!(A3, "A3", Input); let a4 = pin!(A4, "A4", Input); let a5 = pin!(A5, "A5", Input); let a6 = pin!(A6, "A6", Input); let a7 = pin!(A7, "A7", Input); // The data input pin. When the chip is in write or read-modify-write mode, the // value of this pin will be written to the appropriate bit in the memory array. let d = pin!(D, "D", Input); // The data output pin. This is active in read and read-modify-write mode, set to // the value of the bit at the address latched by RAS and CAS. In write mode, it is // hi-Z. let q = pin!(Q, "Q", Output); // The row address strobe. Setting this low latches the values of A0-A7, saving them // to be part of the address used to access the memory array. let ras = pin!(RAS, "RAS", Input); // The column address strobe. Setting this low latches A0-A7 into the second part of // the memory address. It also initiates read or write mode, depending on the value // of WE. let cas = pin!(CAS, "CAS", Input); // The write-enable pin. If this is high, the chip is in read mode; if it and CAS // are low, the chip is in either write or read-modify-write mode, depending on // which pin went low first. let we = pin!(WE, "WE", Input); // Power supply and no-contact pins. These are not emulated. let nc = pin!(NC, "NC", Unconnected); let vcc = pin!(VCC, "VCC", Unconnected); let vss = pin!(VSS, "VSS", Unconnected); let pins = pins![a0, a1, a2, a3, a4, a5, a6, a7, d, q, ras, cas, we, nc, vcc, vss]; let addr_pins = RefVec::with_vec( IntoIterator::into_iter(PA_ADDRESS) .map(|pa| clone_ref!(pins[pa])) .collect::<Vec<PinRef>>(), ); let device: DeviceRef = new_ref!(Ic4164 { pins, addr_pins, memory: [0; 2048], row: None, col: None, data: None, }); float!(q); attach_to!(device, ras, cas, we); device } /// Reads the row and col and calculates the specific bit in the memory array to which /// this row/col combination refers. The first element of the return value is the index /// of the 32-bit number in the memory array where that bit resides; the second element /// is the index of the bit within that 32-bit number. fn resolve(&self) -> (usize, usize) { // Unless there's a bug in this program, this method should never be called while // either `self.row` or `self.col` are `None`. So we actually *want* it to panic if // `unwrap()` fails. let row = self.row.unwrap() as usize; let col = self.col.unwrap() as usize; let row_index = row << 3; let col_index = (col & 0b1110_0000) >> 5; let bit_index = col & 0b0001_1111; (row_index | col_index, bit_index) } /// Retrieves a single bit from the memory array and sets the level of the Q pin to the /// value of that bit. fn read(&self) { let (index, bit) = self.resolve(); let value = (self.memory[index] & (1 << bit)) >> bit; set_level!(self.pins[Q], Some(value as f64)) } /// Writes the value of the D pin to a single bit in the memory array. If the Q pin is /// also connected, the value is also sent to it; this happens only in RMW mode and /// keeps the input and output data pins synched. (This guaranteed sync means that the /// C64 can connect these two pins with a PC board trace, but the C64 doesn't use RMW /// mode.) fn write(&mut self) { let (index, bit) = self.resolve(); if self.data.unwrap() == 1 { self.memory[index] |= 1 << bit; } else { self.memory[index] &=!(1 << bit); } if!floating!(self.pins[Q]) { set_level!(self.pins[Q], Some(self.data.unwrap() as f64)); } } } impl Device for Ic4164 { fn pins(&self) -> RefVec<Pin> { self.pins.clone() } fn registers(&self) -> Vec<u8> { vec![] } fn update(&mut self, event: &LevelChange) { match event { LevelChange(pin) if number!(pin) == RAS => { // Invoked when the RAS pin changes level. When it goes low, the current // states of the A0-A7 pins are latched. The address is released when the // RAS pin goes high. // // Since this is the only thing that RAS is used for, it can be left low for // multiple memory accesses if its bits of the address remain the same for // those accesses. This can speed up reads and writes within the same page // by reducing the amount of setup needed for those reads and writes. (This // does not happen in the C64.) if high!(pin) { self.row = None; } else { self.row = Some(pins_to_value(&self.addr_pins) as u8); } } LevelChange(pin) if number!(pin) == CAS => { // Invoked when the CAS pin changes level. // // When CAS goes low, the current states of the A0-A7 pins are latched in a // smiliar way to when RAS goes low. What else happens depends on whether // the WE pin is low. If it is, the chip goes into write mode and the value // on the D pin is saved to a memory location referred to by the latched row // and column values. If WE is not low, read mode is entered, and the value // in that memory location is put onto the Q pin. (Setting the WE pin low // after CAS goes low sets read-modify-write mode; the read that CAS // initiated is still valid.) // // When CAS goes high, the Q pin is disconnected and the latched column and // data (if there is one) values are cleared. if high!(pin) { float!(self.pins[Q]); self.col = None; self.data = None; } else { self.col = Some(pins_to_value(&self.addr_pins) as u8); if high!(self.pins[WE]) { self.read(); } else { self.data = Some(if high!(self.pins[D]) { 1 } else { 0 }); self.write(); } } } LevelChange(pin) if number!(pin) == WE => { // Invoked when the WE pin changes level. // // When WE is high, read mode is enabled (though the actual read will not be // available until both RAS and CAS are set low, indicating that the address // of the read is valid). The internal latched input data value is cleared. // // When WE goes low, the write mode that is enabled depends on whether CAS // is already low. If it is, the chip must have been in read mode and now // moves into read-modify-write mode. The data value on the Q pin remains // valid, and the valus on the D pin is latched and stored at the // appropriate memory location. // // If CAS is still high when WE goes low, the Q pin is disconnected. Nothing // further happens until CAS goes low; at that point, the chip goes into // write mode (data is written to memory but nothing is available to be // read). if high!(pin) { self.data = None; } else { if high!(self.pins[CAS]) { float!(self.pins[Q]); } else { self.data = Some(if high!(self.pins[D]) { 1 } else { 0 }); self.write(); } } } _ => {} } } fn debug_fmt(&self, f: &mut std::fmt::Formatter) -> std::fmt::Result { write!(f, "{:?}, {:?}, {:?}", self.row, self.col, self.data) } } #[cfg(test)] mod test { use crate::{ components::trace::{Trace, TraceRef}, test_utils::{make_traces, value_to_traces}, }; use super::*; fn before_each() -> (DeviceRef, RefVec<Trace>, RefVec<Trace>) { let device = Ic4164::new(); let tr = make_traces(&device); set!(tr[WE]); set!(tr[RAS]); set!(tr[CAS]); let addr_tr = RefVec::with_vec( IntoIterator::into_iter(PA_ADDRESS) .map(|p| clone_ref!(tr[p])) .collect::<Vec<TraceRef>>(), ); (device, tr, addr_tr) } #[test] fn read_mode_enable_q() { let (_, tr, _) = before_each(); clear!(tr[RAS]); clear!(tr[CAS]); // data at 0x0000, which will be 0 initially assert!(low!(tr[Q]), "Q should have data during read"); set!(tr[CAS]); set!(tr[RAS]); assert!(floating!(tr[Q]), "Q should be disabled after read"); } #[test] fn write_mode_disable_q() { let (_, tr, _) = before_each(); clear!(tr[RAS]); clear!(tr[WE]); clear!(tr[CAS]); assert!(floating!(tr[Q]), "Q should be disabled during write"); set!(tr[CAS]); set!(tr[WE]); set!(tr[RAS]); assert!(floating!(tr[Q]), "Q should be disabled after write"); } #[test] fn rmw_mode_enable_q() { let (_, tr, _) = before_each(); clear!(tr[D]); clear!(tr[RAS]); clear!(tr[CAS]); clear!(tr[WE]); assert!(low!(tr[Q]), "Q should be enabled during RMW"); set!(tr[WE]); set!(tr[CAS]); set!(tr[RAS]); assert!(floating!(tr[Q]), "Q should be disabled after RMW"); } #[test] fn read_write_one_bit() { let (_, tr, _) = before_each(); // Write is happening at 0x0000, so we don't need to set addresses at all set!(tr[D]); clear!(tr[WE]); clear!(tr[RAS]); clear!(tr[CAS]); // 1 is written to address 0x0000 at this point set!(tr[CAS]); set!(tr[RAS]); set!(tr[WE]); clear!(tr[RAS]); clear!(tr[CAS]); let value = high!(tr[Q]); set!(tr[CAS]); set!(tr[RAS]); assert!(value, "Value 1 not written to address 0x0000"); } #[test] fn rmw_one_bit()
clear!(tr[CAS]); let value = high!(tr[Q]); set!(tr[CAS]); set!(tr[RAS]);
{ let (_, tr, _) = before_each(); // Write is happening at 0x0000, so we don't need to set addresses at all set!(tr[D]); clear!(tr[RAS]); clear!(tr[CAS]); // in read mode, Q should be 0 because no data has been written to 0x0000 yet assert!( low!(tr[Q]), "Value 0 not read from address 0x0000 in RMW mode" ); // Lower WE to go into RMW clear!(tr[WE]); // 1 is written to address 0x0000 at this point set!(tr[CAS]); set!(tr[RAS]); set!(tr[WE]); clear!(tr[RAS]);
identifier_body
corebuilder.rs
use crate::{ error::CoreError, logger::Logger, warrior::{Instruction, Warrior}, }; use rand::Rng; use super::{Core, CoreInstruction}; use std::collections::VecDeque; #[derive(Debug)] pub struct CoreBuilder { pub(super) core_size: usize, pub(super) cycles_before_tie: usize, pub(super) initial_instruction: InitialInstruction, pub(super) instruction_limit: usize, pub(super) maximum_number_of_tasks: usize, pub(super) minimum_separation: usize, pub(super) read_distance: usize, pub(super) write_distance: usize, pub(super) separation: Separation, pub(super) warriors: Vec<Warrior>, pub(super) logger: Option<Box<dyn Logger>>, } impl Default for CoreBuilder { fn default() -> Self { Self { core_size: 8000, cycles_before_tie: 80_000, initial_instruction: InitialInstruction::Fixed(Instruction::default()), instruction_limit: 100, maximum_number_of_tasks: 8000, minimum_separation: 100, read_distance: 8000, write_distance: 8000, separation: Separation::Random(100), warriors: Vec::new(), logger: None, } } } impl CoreBuilder { /// Creates a new instance of CoreBuilder with default parameters and no warriors. pub fn new() -> Self { CoreBuilder::default() } /// Sets the core's size. Core size is the number of instructions which make up the core /// during the battle. pub fn core_size(&mut self, core_size: usize) -> &mut Self { self.core_size = core_size; self } /// Sets the number of cycles that the match can last for before it is declared a tie. pub fn cycles_before_tie(&mut self, cycles_before_tie: usize) -> &mut Self { self.cycles_before_tie = cycles_before_tie; self } /// Sets the core's initial intruction. The initial instruction is that instruction which is preloaded /// into core prior to loading warriors. In addition to loading /// an instruction such as "DAT #0, #0" into all of core, the /// initial instruction could be set to `Random`, meaning core /// instructions are filled with randomly generated instructions. pub fn initial_instruction(&mut self, initial_instruction: InitialInstruction) -> &mut Self { self.initial_instruction = initial_instruction; self } /// The maximum number of instructions allowed per warrior. pub fn instruction_limit(&mut self, instruction_limit: usize) -> &mut Self { self.instruction_limit = instruction_limit; self } /// Each warrior can spawn multiple additional tasks. This variable sets the maximum /// number of tasks allowed per warrior. In other words, this is the size of each warrior's task queue. pub fn maximum_number_of_tasks(&mut self, maximum_number_of_tasks: usize) -> &mut Self { self.maximum_number_of_tasks = maximum_number_of_tasks; self } /// The minimum number of instructions from the first instruction /// of one warrior to the first instruction of the next warrior. pub fn minimum_separation(&mut self, minimum_separation: usize) -> &mut Self { self.minimum_separation = minimum_separation; // Need to put some limit on this related to number of warriors. self } /// This is the range available for warriors to read information /// from core. Attempts to read outside the limits of this range /// result in reading within the local readable range. The range /// is centered on the current instruction. Thus, a range of /// 500 limits reading to offsets of (-249 -> +250) from the /// currently executing instruction. The read limit can therefore /// be considered a mini-core within core. An attempt to read /// location PC+251 reads location PC-249 instead. An attempt to /// read location PC+500 reads location PC instead. /// /// Read distance must be a factor of core size, otherwise the /// above defined behaviour is not guaranteed. pub fn read_distance(&mut self, read_distance: usize) -> &mut Self { self.read_distance = read_distance; self } /// The number of instructions from the first instruction of one
self.separation = separation; self } /// This is the range available for warriors to write information /// to core. Attempts to write outside the limits of this range /// result in writing within the local writable range. The range /// is centered on the current instruction. Thus, a range of 500 /// limits writing to offsets of (-249 -> +250) from the /// currently executing instruction. The write limit can /// therefore be considered a mini-core within core. An attempt /// to write location PC+251 writes to location PC-249 instead. /// An attempt to write to location PC+500 writes to location PC /// instead. /// /// Write distance must be a factor of core size, otherwise the /// above defined behaviour is not guaranteed. pub fn write_distance(&mut self, write_distance: usize) -> &mut Self { self.write_distance = write_distance; self } pub fn load_warriors(&mut self, warriors: &[Warrior]) -> Result<&mut Self, CoreError> { for warrior in warriors { if warrior.len() > self.instruction_limit { return Err(CoreError::WarriorTooLong( warrior.len(), self.instruction_limit, warrior.metadata.name().unwrap_or("Unnamed").to_owned(), )); } if warrior.is_empty() { return Err(CoreError::EmptyWarrior( warrior.metadata.name().unwrap_or("Unnamed").to_owned(), )); }; } self.warriors = warriors.to_vec(); Ok(self) } /// Use a `Logger` to log the battle's output. pub fn log_with(&mut self, logger: Box<dyn Logger>) -> &mut Self { self.logger = Some(logger); self } /// Build the core, consuming the `CoreBuilder` and returning a [`Core`](../struct.Core.html) struct. pub fn build(&self) -> Result<Core, CoreError> { let CoreBuilder { initial_instruction, separation, warriors, maximum_number_of_tasks, core_size, instruction_limit, .. } = self; let mut core_instructions = vec![ CoreInstruction::from_instruction( initial_instruction.clone().extract(), *core_size ); *core_size ]; let separation = separation.clone(); let mut warrior_offsets: Vec<usize> = warriors.iter().map(|w| w.starts_at_line).collect(); match separation { Separation::Random(min_separation) => { let offsets = random_offsets(&warriors, min_separation, *instruction_limit, *core_size); for (i, (offset, warrior)) in offsets.iter().enumerate() { let mut ptr = *offset; warrior_offsets[i] = Core::fold(warrior_offsets[i] + ptr, *core_size, *core_size); for instruction in &warrior.instructions { core_instructions[ptr] = CoreInstruction::from_instruction(instruction.clone(), *core_size); ptr = Core::fold(ptr + 1, *core_size, *core_size); } } } Separation::Fixed(separation) => { let mut ptr = 0_usize; for (i, warrior) in warriors.iter().enumerate() { warrior_offsets[i] = Core::fold(warrior_offsets[i] + ptr, *core_size, *core_size); for instruction in &warrior.instructions { core_instructions[ptr] = CoreInstruction::from_instruction(instruction.clone(), *core_size); ptr = Core::fold(ptr + 1, *core_size, *core_size); } ptr = Core::fold(ptr + separation, *core_size, *core_size); } } }; let task_queues = warrior_offsets .iter() .zip(warriors) .map(|(&offset, warrior)| { let mut v = VecDeque::with_capacity(*maximum_number_of_tasks); let offset = Core::fold(offset, *core_size, *core_size); v.push_back(offset); (warrior, v) }) .collect(); Ok(Core { core: self, instructions: core_instructions, task_queues, current_queue: 0, cycle_count: 0, }) } } /// The separation between warriors at the start of a match. /// /// The number of instructions from the first instruction of one warrior to the first instruction of the next warrior. /// If a core's separation is `Random`, separations will be chosen randomly from the set of numbers larger than the core's minimum separation. #[derive(Debug, Clone)] pub enum Separation { Random(usize), Fixed(usize), } /// The value to which the core's memory addresses are initialised /// at the beginning of the match. /// /// The initial instruction is that instruction which is preloaded /// into core prior to loading warriors. If set to `Random`, core /// instructions are filled with randomly generated instructions. #[derive(Debug, Clone)] pub enum InitialInstruction { Random, Fixed(Instruction), } impl InitialInstruction { /// Extract the initial instruction if it's `Fixed`, or get a random `Instruction` if it's `Random`. pub fn extract(self) -> Instruction { match self { Self::Random => todo!(), Self::Fixed(instr) => instr, } } } fn random_offsets( warriors: &[Warrior], minimum_separation: usize, instruction_limit: usize, core_size: usize, ) -> Vec<(usize, &Warrior)> { let mut offsets: Vec<(usize, &Warrior)> = Vec::new(); for warrior in warriors { let offset_addresses: Vec<usize> = offsets.iter().map(|x| x.0).collect(); let offset = get_valid_address( &offset_addresses, minimum_separation, instruction_limit, core_size, ); offsets.push((offset, warrior)); } offsets } fn get_valid_address( offsets: &[usize], minimum_separation: usize, instruction_limit: usize, core_size: usize, ) -> usize { let diff = |x, y| { if x > y { x - y } else { ((core_size - 1) + y) - x } }; let ptr: usize; let mut rng = rand::thread_rng(); // This will run forever if we can't fit a warrior... 'outer: loop { let address: usize = rng.gen_range(0, core_size); for offset in offsets { let lb = diff(address + instruction_limit, *offset); let ub = diff(offset + instruction_limit, address); if (lb <= minimum_separation) || (ub <= minimum_separation) { continue 'outer; } } ptr = address; break; } ptr } #[cfg(test)] mod test { use super::*; use std::convert::TryFrom; #[test] fn random_addresses() { let imp = Warrior::parse(include_str!("../../warriors/imp.red"), 0).unwrap(); let stone = Warrior::parse(include_str!("../../warriors/stone.red"), 0).unwrap(); let imp2 = imp.clone(); let stone2 = stone.clone(); let imp3 = imp.clone(); let stone3 = stone.clone(); let warriors = vec![imp, stone, imp2, stone2, imp3, stone3]; for _ in 0..5000 { let offsets = random_offsets(&warriors, 100, 100, 8000); assert_eq!(offsets.len(), 6); for offset in &offsets { let mut ok = true; for other in &offsets { if offset.1!= other.1 { let o1 = i64::try_from(offset.0).unwrap(); let o2 = i64::try_from(other.0).unwrap(); if i64::abs(o1 - o2) < 100 { ok = false; break; } } } assert!(ok); } } } }
/// warrior to the first instruction of the next warrior. /// Separation can be set to `Random`, meaning separations will be /// chosen randomly from those larger than the minimum separation. pub fn separation(&mut self, separation: Separation) -> &mut Self {
random_line_split
corebuilder.rs
use crate::{ error::CoreError, logger::Logger, warrior::{Instruction, Warrior}, }; use rand::Rng; use super::{Core, CoreInstruction}; use std::collections::VecDeque; #[derive(Debug)] pub struct CoreBuilder { pub(super) core_size: usize, pub(super) cycles_before_tie: usize, pub(super) initial_instruction: InitialInstruction, pub(super) instruction_limit: usize, pub(super) maximum_number_of_tasks: usize, pub(super) minimum_separation: usize, pub(super) read_distance: usize, pub(super) write_distance: usize, pub(super) separation: Separation, pub(super) warriors: Vec<Warrior>, pub(super) logger: Option<Box<dyn Logger>>, } impl Default for CoreBuilder { fn default() -> Self { Self { core_size: 8000, cycles_before_tie: 80_000, initial_instruction: InitialInstruction::Fixed(Instruction::default()), instruction_limit: 100, maximum_number_of_tasks: 8000, minimum_separation: 100, read_distance: 8000, write_distance: 8000, separation: Separation::Random(100), warriors: Vec::new(), logger: None, } } } impl CoreBuilder { /// Creates a new instance of CoreBuilder with default parameters and no warriors. pub fn new() -> Self { CoreBuilder::default() } /// Sets the core's size. Core size is the number of instructions which make up the core /// during the battle. pub fn core_size(&mut self, core_size: usize) -> &mut Self { self.core_size = core_size; self } /// Sets the number of cycles that the match can last for before it is declared a tie. pub fn cycles_before_tie(&mut self, cycles_before_tie: usize) -> &mut Self { self.cycles_before_tie = cycles_before_tie; self } /// Sets the core's initial intruction. The initial instruction is that instruction which is preloaded /// into core prior to loading warriors. In addition to loading /// an instruction such as "DAT #0, #0" into all of core, the /// initial instruction could be set to `Random`, meaning core /// instructions are filled with randomly generated instructions. pub fn initial_instruction(&mut self, initial_instruction: InitialInstruction) -> &mut Self { self.initial_instruction = initial_instruction; self } /// The maximum number of instructions allowed per warrior. pub fn instruction_limit(&mut self, instruction_limit: usize) -> &mut Self { self.instruction_limit = instruction_limit; self } /// Each warrior can spawn multiple additional tasks. This variable sets the maximum /// number of tasks allowed per warrior. In other words, this is the size of each warrior's task queue. pub fn maximum_number_of_tasks(&mut self, maximum_number_of_tasks: usize) -> &mut Self { self.maximum_number_of_tasks = maximum_number_of_tasks; self } /// The minimum number of instructions from the first instruction /// of one warrior to the first instruction of the next warrior. pub fn minimum_separation(&mut self, minimum_separation: usize) -> &mut Self { self.minimum_separation = minimum_separation; // Need to put some limit on this related to number of warriors. self } /// This is the range available for warriors to read information /// from core. Attempts to read outside the limits of this range /// result in reading within the local readable range. The range /// is centered on the current instruction. Thus, a range of /// 500 limits reading to offsets of (-249 -> +250) from the /// currently executing instruction. The read limit can therefore /// be considered a mini-core within core. An attempt to read /// location PC+251 reads location PC-249 instead. An attempt to /// read location PC+500 reads location PC instead. /// /// Read distance must be a factor of core size, otherwise the /// above defined behaviour is not guaranteed. pub fn read_distance(&mut self, read_distance: usize) -> &mut Self { self.read_distance = read_distance; self } /// The number of instructions from the first instruction of one /// warrior to the first instruction of the next warrior. /// Separation can be set to `Random`, meaning separations will be /// chosen randomly from those larger than the minimum separation. pub fn separation(&mut self, separation: Separation) -> &mut Self { self.separation = separation; self } /// This is the range available for warriors to write information /// to core. Attempts to write outside the limits of this range /// result in writing within the local writable range. The range /// is centered on the current instruction. Thus, a range of 500 /// limits writing to offsets of (-249 -> +250) from the /// currently executing instruction. The write limit can /// therefore be considered a mini-core within core. An attempt /// to write location PC+251 writes to location PC-249 instead. /// An attempt to write to location PC+500 writes to location PC /// instead. /// /// Write distance must be a factor of core size, otherwise the /// above defined behaviour is not guaranteed. pub fn write_distance(&mut self, write_distance: usize) -> &mut Self { self.write_distance = write_distance; self } pub fn
(&mut self, warriors: &[Warrior]) -> Result<&mut Self, CoreError> { for warrior in warriors { if warrior.len() > self.instruction_limit { return Err(CoreError::WarriorTooLong( warrior.len(), self.instruction_limit, warrior.metadata.name().unwrap_or("Unnamed").to_owned(), )); } if warrior.is_empty() { return Err(CoreError::EmptyWarrior( warrior.metadata.name().unwrap_or("Unnamed").to_owned(), )); }; } self.warriors = warriors.to_vec(); Ok(self) } /// Use a `Logger` to log the battle's output. pub fn log_with(&mut self, logger: Box<dyn Logger>) -> &mut Self { self.logger = Some(logger); self } /// Build the core, consuming the `CoreBuilder` and returning a [`Core`](../struct.Core.html) struct. pub fn build(&self) -> Result<Core, CoreError> { let CoreBuilder { initial_instruction, separation, warriors, maximum_number_of_tasks, core_size, instruction_limit, .. } = self; let mut core_instructions = vec![ CoreInstruction::from_instruction( initial_instruction.clone().extract(), *core_size ); *core_size ]; let separation = separation.clone(); let mut warrior_offsets: Vec<usize> = warriors.iter().map(|w| w.starts_at_line).collect(); match separation { Separation::Random(min_separation) => { let offsets = random_offsets(&warriors, min_separation, *instruction_limit, *core_size); for (i, (offset, warrior)) in offsets.iter().enumerate() { let mut ptr = *offset; warrior_offsets[i] = Core::fold(warrior_offsets[i] + ptr, *core_size, *core_size); for instruction in &warrior.instructions { core_instructions[ptr] = CoreInstruction::from_instruction(instruction.clone(), *core_size); ptr = Core::fold(ptr + 1, *core_size, *core_size); } } } Separation::Fixed(separation) => { let mut ptr = 0_usize; for (i, warrior) in warriors.iter().enumerate() { warrior_offsets[i] = Core::fold(warrior_offsets[i] + ptr, *core_size, *core_size); for instruction in &warrior.instructions { core_instructions[ptr] = CoreInstruction::from_instruction(instruction.clone(), *core_size); ptr = Core::fold(ptr + 1, *core_size, *core_size); } ptr = Core::fold(ptr + separation, *core_size, *core_size); } } }; let task_queues = warrior_offsets .iter() .zip(warriors) .map(|(&offset, warrior)| { let mut v = VecDeque::with_capacity(*maximum_number_of_tasks); let offset = Core::fold(offset, *core_size, *core_size); v.push_back(offset); (warrior, v) }) .collect(); Ok(Core { core: self, instructions: core_instructions, task_queues, current_queue: 0, cycle_count: 0, }) } } /// The separation between warriors at the start of a match. /// /// The number of instructions from the first instruction of one warrior to the first instruction of the next warrior. /// If a core's separation is `Random`, separations will be chosen randomly from the set of numbers larger than the core's minimum separation. #[derive(Debug, Clone)] pub enum Separation { Random(usize), Fixed(usize), } /// The value to which the core's memory addresses are initialised /// at the beginning of the match. /// /// The initial instruction is that instruction which is preloaded /// into core prior to loading warriors. If set to `Random`, core /// instructions are filled with randomly generated instructions. #[derive(Debug, Clone)] pub enum InitialInstruction { Random, Fixed(Instruction), } impl InitialInstruction { /// Extract the initial instruction if it's `Fixed`, or get a random `Instruction` if it's `Random`. pub fn extract(self) -> Instruction { match self { Self::Random => todo!(), Self::Fixed(instr) => instr, } } } fn random_offsets( warriors: &[Warrior], minimum_separation: usize, instruction_limit: usize, core_size: usize, ) -> Vec<(usize, &Warrior)> { let mut offsets: Vec<(usize, &Warrior)> = Vec::new(); for warrior in warriors { let offset_addresses: Vec<usize> = offsets.iter().map(|x| x.0).collect(); let offset = get_valid_address( &offset_addresses, minimum_separation, instruction_limit, core_size, ); offsets.push((offset, warrior)); } offsets } fn get_valid_address( offsets: &[usize], minimum_separation: usize, instruction_limit: usize, core_size: usize, ) -> usize { let diff = |x, y| { if x > y { x - y } else { ((core_size - 1) + y) - x } }; let ptr: usize; let mut rng = rand::thread_rng(); // This will run forever if we can't fit a warrior... 'outer: loop { let address: usize = rng.gen_range(0, core_size); for offset in offsets { let lb = diff(address + instruction_limit, *offset); let ub = diff(offset + instruction_limit, address); if (lb <= minimum_separation) || (ub <= minimum_separation) { continue 'outer; } } ptr = address; break; } ptr } #[cfg(test)] mod test { use super::*; use std::convert::TryFrom; #[test] fn random_addresses() { let imp = Warrior::parse(include_str!("../../warriors/imp.red"), 0).unwrap(); let stone = Warrior::parse(include_str!("../../warriors/stone.red"), 0).unwrap(); let imp2 = imp.clone(); let stone2 = stone.clone(); let imp3 = imp.clone(); let stone3 = stone.clone(); let warriors = vec![imp, stone, imp2, stone2, imp3, stone3]; for _ in 0..5000 { let offsets = random_offsets(&warriors, 100, 100, 8000); assert_eq!(offsets.len(), 6); for offset in &offsets { let mut ok = true; for other in &offsets { if offset.1!= other.1 { let o1 = i64::try_from(offset.0).unwrap(); let o2 = i64::try_from(other.0).unwrap(); if i64::abs(o1 - o2) < 100 { ok = false; break; } } } assert!(ok); } } } }
load_warriors
identifier_name
corebuilder.rs
use crate::{ error::CoreError, logger::Logger, warrior::{Instruction, Warrior}, }; use rand::Rng; use super::{Core, CoreInstruction}; use std::collections::VecDeque; #[derive(Debug)] pub struct CoreBuilder { pub(super) core_size: usize, pub(super) cycles_before_tie: usize, pub(super) initial_instruction: InitialInstruction, pub(super) instruction_limit: usize, pub(super) maximum_number_of_tasks: usize, pub(super) minimum_separation: usize, pub(super) read_distance: usize, pub(super) write_distance: usize, pub(super) separation: Separation, pub(super) warriors: Vec<Warrior>, pub(super) logger: Option<Box<dyn Logger>>, } impl Default for CoreBuilder { fn default() -> Self { Self { core_size: 8000, cycles_before_tie: 80_000, initial_instruction: InitialInstruction::Fixed(Instruction::default()), instruction_limit: 100, maximum_number_of_tasks: 8000, minimum_separation: 100, read_distance: 8000, write_distance: 8000, separation: Separation::Random(100), warriors: Vec::new(), logger: None, } } } impl CoreBuilder { /// Creates a new instance of CoreBuilder with default parameters and no warriors. pub fn new() -> Self { CoreBuilder::default() } /// Sets the core's size. Core size is the number of instructions which make up the core /// during the battle. pub fn core_size(&mut self, core_size: usize) -> &mut Self { self.core_size = core_size; self } /// Sets the number of cycles that the match can last for before it is declared a tie. pub fn cycles_before_tie(&mut self, cycles_before_tie: usize) -> &mut Self { self.cycles_before_tie = cycles_before_tie; self } /// Sets the core's initial intruction. The initial instruction is that instruction which is preloaded /// into core prior to loading warriors. In addition to loading /// an instruction such as "DAT #0, #0" into all of core, the /// initial instruction could be set to `Random`, meaning core /// instructions are filled with randomly generated instructions. pub fn initial_instruction(&mut self, initial_instruction: InitialInstruction) -> &mut Self { self.initial_instruction = initial_instruction; self } /// The maximum number of instructions allowed per warrior. pub fn instruction_limit(&mut self, instruction_limit: usize) -> &mut Self
/// Each warrior can spawn multiple additional tasks. This variable sets the maximum /// number of tasks allowed per warrior. In other words, this is the size of each warrior's task queue. pub fn maximum_number_of_tasks(&mut self, maximum_number_of_tasks: usize) -> &mut Self { self.maximum_number_of_tasks = maximum_number_of_tasks; self } /// The minimum number of instructions from the first instruction /// of one warrior to the first instruction of the next warrior. pub fn minimum_separation(&mut self, minimum_separation: usize) -> &mut Self { self.minimum_separation = minimum_separation; // Need to put some limit on this related to number of warriors. self } /// This is the range available for warriors to read information /// from core. Attempts to read outside the limits of this range /// result in reading within the local readable range. The range /// is centered on the current instruction. Thus, a range of /// 500 limits reading to offsets of (-249 -> +250) from the /// currently executing instruction. The read limit can therefore /// be considered a mini-core within core. An attempt to read /// location PC+251 reads location PC-249 instead. An attempt to /// read location PC+500 reads location PC instead. /// /// Read distance must be a factor of core size, otherwise the /// above defined behaviour is not guaranteed. pub fn read_distance(&mut self, read_distance: usize) -> &mut Self { self.read_distance = read_distance; self } /// The number of instructions from the first instruction of one /// warrior to the first instruction of the next warrior. /// Separation can be set to `Random`, meaning separations will be /// chosen randomly from those larger than the minimum separation. pub fn separation(&mut self, separation: Separation) -> &mut Self { self.separation = separation; self } /// This is the range available for warriors to write information /// to core. Attempts to write outside the limits of this range /// result in writing within the local writable range. The range /// is centered on the current instruction. Thus, a range of 500 /// limits writing to offsets of (-249 -> +250) from the /// currently executing instruction. The write limit can /// therefore be considered a mini-core within core. An attempt /// to write location PC+251 writes to location PC-249 instead. /// An attempt to write to location PC+500 writes to location PC /// instead. /// /// Write distance must be a factor of core size, otherwise the /// above defined behaviour is not guaranteed. pub fn write_distance(&mut self, write_distance: usize) -> &mut Self { self.write_distance = write_distance; self } pub fn load_warriors(&mut self, warriors: &[Warrior]) -> Result<&mut Self, CoreError> { for warrior in warriors { if warrior.len() > self.instruction_limit { return Err(CoreError::WarriorTooLong( warrior.len(), self.instruction_limit, warrior.metadata.name().unwrap_or("Unnamed").to_owned(), )); } if warrior.is_empty() { return Err(CoreError::EmptyWarrior( warrior.metadata.name().unwrap_or("Unnamed").to_owned(), )); }; } self.warriors = warriors.to_vec(); Ok(self) } /// Use a `Logger` to log the battle's output. pub fn log_with(&mut self, logger: Box<dyn Logger>) -> &mut Self { self.logger = Some(logger); self } /// Build the core, consuming the `CoreBuilder` and returning a [`Core`](../struct.Core.html) struct. pub fn build(&self) -> Result<Core, CoreError> { let CoreBuilder { initial_instruction, separation, warriors, maximum_number_of_tasks, core_size, instruction_limit, .. } = self; let mut core_instructions = vec![ CoreInstruction::from_instruction( initial_instruction.clone().extract(), *core_size ); *core_size ]; let separation = separation.clone(); let mut warrior_offsets: Vec<usize> = warriors.iter().map(|w| w.starts_at_line).collect(); match separation { Separation::Random(min_separation) => { let offsets = random_offsets(&warriors, min_separation, *instruction_limit, *core_size); for (i, (offset, warrior)) in offsets.iter().enumerate() { let mut ptr = *offset; warrior_offsets[i] = Core::fold(warrior_offsets[i] + ptr, *core_size, *core_size); for instruction in &warrior.instructions { core_instructions[ptr] = CoreInstruction::from_instruction(instruction.clone(), *core_size); ptr = Core::fold(ptr + 1, *core_size, *core_size); } } } Separation::Fixed(separation) => { let mut ptr = 0_usize; for (i, warrior) in warriors.iter().enumerate() { warrior_offsets[i] = Core::fold(warrior_offsets[i] + ptr, *core_size, *core_size); for instruction in &warrior.instructions { core_instructions[ptr] = CoreInstruction::from_instruction(instruction.clone(), *core_size); ptr = Core::fold(ptr + 1, *core_size, *core_size); } ptr = Core::fold(ptr + separation, *core_size, *core_size); } } }; let task_queues = warrior_offsets .iter() .zip(warriors) .map(|(&offset, warrior)| { let mut v = VecDeque::with_capacity(*maximum_number_of_tasks); let offset = Core::fold(offset, *core_size, *core_size); v.push_back(offset); (warrior, v) }) .collect(); Ok(Core { core: self, instructions: core_instructions, task_queues, current_queue: 0, cycle_count: 0, }) } } /// The separation between warriors at the start of a match. /// /// The number of instructions from the first instruction of one warrior to the first instruction of the next warrior. /// If a core's separation is `Random`, separations will be chosen randomly from the set of numbers larger than the core's minimum separation. #[derive(Debug, Clone)] pub enum Separation { Random(usize), Fixed(usize), } /// The value to which the core's memory addresses are initialised /// at the beginning of the match. /// /// The initial instruction is that instruction which is preloaded /// into core prior to loading warriors. If set to `Random`, core /// instructions are filled with randomly generated instructions. #[derive(Debug, Clone)] pub enum InitialInstruction { Random, Fixed(Instruction), } impl InitialInstruction { /// Extract the initial instruction if it's `Fixed`, or get a random `Instruction` if it's `Random`. pub fn extract(self) -> Instruction { match self { Self::Random => todo!(), Self::Fixed(instr) => instr, } } } fn random_offsets( warriors: &[Warrior], minimum_separation: usize, instruction_limit: usize, core_size: usize, ) -> Vec<(usize, &Warrior)> { let mut offsets: Vec<(usize, &Warrior)> = Vec::new(); for warrior in warriors { let offset_addresses: Vec<usize> = offsets.iter().map(|x| x.0).collect(); let offset = get_valid_address( &offset_addresses, minimum_separation, instruction_limit, core_size, ); offsets.push((offset, warrior)); } offsets } fn get_valid_address( offsets: &[usize], minimum_separation: usize, instruction_limit: usize, core_size: usize, ) -> usize { let diff = |x, y| { if x > y { x - y } else { ((core_size - 1) + y) - x } }; let ptr: usize; let mut rng = rand::thread_rng(); // This will run forever if we can't fit a warrior... 'outer: loop { let address: usize = rng.gen_range(0, core_size); for offset in offsets { let lb = diff(address + instruction_limit, *offset); let ub = diff(offset + instruction_limit, address); if (lb <= minimum_separation) || (ub <= minimum_separation) { continue 'outer; } } ptr = address; break; } ptr } #[cfg(test)] mod test { use super::*; use std::convert::TryFrom; #[test] fn random_addresses() { let imp = Warrior::parse(include_str!("../../warriors/imp.red"), 0).unwrap(); let stone = Warrior::parse(include_str!("../../warriors/stone.red"), 0).unwrap(); let imp2 = imp.clone(); let stone2 = stone.clone(); let imp3 = imp.clone(); let stone3 = stone.clone(); let warriors = vec![imp, stone, imp2, stone2, imp3, stone3]; for _ in 0..5000 { let offsets = random_offsets(&warriors, 100, 100, 8000); assert_eq!(offsets.len(), 6); for offset in &offsets { let mut ok = true; for other in &offsets { if offset.1!= other.1 { let o1 = i64::try_from(offset.0).unwrap(); let o2 = i64::try_from(other.0).unwrap(); if i64::abs(o1 - o2) < 100 { ok = false; break; } } } assert!(ok); } } } }
{ self.instruction_limit = instruction_limit; self }
identifier_body
corebuilder.rs
use crate::{ error::CoreError, logger::Logger, warrior::{Instruction, Warrior}, }; use rand::Rng; use super::{Core, CoreInstruction}; use std::collections::VecDeque; #[derive(Debug)] pub struct CoreBuilder { pub(super) core_size: usize, pub(super) cycles_before_tie: usize, pub(super) initial_instruction: InitialInstruction, pub(super) instruction_limit: usize, pub(super) maximum_number_of_tasks: usize, pub(super) minimum_separation: usize, pub(super) read_distance: usize, pub(super) write_distance: usize, pub(super) separation: Separation, pub(super) warriors: Vec<Warrior>, pub(super) logger: Option<Box<dyn Logger>>, } impl Default for CoreBuilder { fn default() -> Self { Self { core_size: 8000, cycles_before_tie: 80_000, initial_instruction: InitialInstruction::Fixed(Instruction::default()), instruction_limit: 100, maximum_number_of_tasks: 8000, minimum_separation: 100, read_distance: 8000, write_distance: 8000, separation: Separation::Random(100), warriors: Vec::new(), logger: None, } } } impl CoreBuilder { /// Creates a new instance of CoreBuilder with default parameters and no warriors. pub fn new() -> Self { CoreBuilder::default() } /// Sets the core's size. Core size is the number of instructions which make up the core /// during the battle. pub fn core_size(&mut self, core_size: usize) -> &mut Self { self.core_size = core_size; self } /// Sets the number of cycles that the match can last for before it is declared a tie. pub fn cycles_before_tie(&mut self, cycles_before_tie: usize) -> &mut Self { self.cycles_before_tie = cycles_before_tie; self } /// Sets the core's initial intruction. The initial instruction is that instruction which is preloaded /// into core prior to loading warriors. In addition to loading /// an instruction such as "DAT #0, #0" into all of core, the /// initial instruction could be set to `Random`, meaning core /// instructions are filled with randomly generated instructions. pub fn initial_instruction(&mut self, initial_instruction: InitialInstruction) -> &mut Self { self.initial_instruction = initial_instruction; self } /// The maximum number of instructions allowed per warrior. pub fn instruction_limit(&mut self, instruction_limit: usize) -> &mut Self { self.instruction_limit = instruction_limit; self } /// Each warrior can spawn multiple additional tasks. This variable sets the maximum /// number of tasks allowed per warrior. In other words, this is the size of each warrior's task queue. pub fn maximum_number_of_tasks(&mut self, maximum_number_of_tasks: usize) -> &mut Self { self.maximum_number_of_tasks = maximum_number_of_tasks; self } /// The minimum number of instructions from the first instruction /// of one warrior to the first instruction of the next warrior. pub fn minimum_separation(&mut self, minimum_separation: usize) -> &mut Self { self.minimum_separation = minimum_separation; // Need to put some limit on this related to number of warriors. self } /// This is the range available for warriors to read information /// from core. Attempts to read outside the limits of this range /// result in reading within the local readable range. The range /// is centered on the current instruction. Thus, a range of /// 500 limits reading to offsets of (-249 -> +250) from the /// currently executing instruction. The read limit can therefore /// be considered a mini-core within core. An attempt to read /// location PC+251 reads location PC-249 instead. An attempt to /// read location PC+500 reads location PC instead. /// /// Read distance must be a factor of core size, otherwise the /// above defined behaviour is not guaranteed. pub fn read_distance(&mut self, read_distance: usize) -> &mut Self { self.read_distance = read_distance; self } /// The number of instructions from the first instruction of one /// warrior to the first instruction of the next warrior. /// Separation can be set to `Random`, meaning separations will be /// chosen randomly from those larger than the minimum separation. pub fn separation(&mut self, separation: Separation) -> &mut Self { self.separation = separation; self } /// This is the range available for warriors to write information /// to core. Attempts to write outside the limits of this range /// result in writing within the local writable range. The range /// is centered on the current instruction. Thus, a range of 500 /// limits writing to offsets of (-249 -> +250) from the /// currently executing instruction. The write limit can /// therefore be considered a mini-core within core. An attempt /// to write location PC+251 writes to location PC-249 instead. /// An attempt to write to location PC+500 writes to location PC /// instead. /// /// Write distance must be a factor of core size, otherwise the /// above defined behaviour is not guaranteed. pub fn write_distance(&mut self, write_distance: usize) -> &mut Self { self.write_distance = write_distance; self } pub fn load_warriors(&mut self, warriors: &[Warrior]) -> Result<&mut Self, CoreError> { for warrior in warriors { if warrior.len() > self.instruction_limit
if warrior.is_empty() { return Err(CoreError::EmptyWarrior( warrior.metadata.name().unwrap_or("Unnamed").to_owned(), )); }; } self.warriors = warriors.to_vec(); Ok(self) } /// Use a `Logger` to log the battle's output. pub fn log_with(&mut self, logger: Box<dyn Logger>) -> &mut Self { self.logger = Some(logger); self } /// Build the core, consuming the `CoreBuilder` and returning a [`Core`](../struct.Core.html) struct. pub fn build(&self) -> Result<Core, CoreError> { let CoreBuilder { initial_instruction, separation, warriors, maximum_number_of_tasks, core_size, instruction_limit, .. } = self; let mut core_instructions = vec![ CoreInstruction::from_instruction( initial_instruction.clone().extract(), *core_size ); *core_size ]; let separation = separation.clone(); let mut warrior_offsets: Vec<usize> = warriors.iter().map(|w| w.starts_at_line).collect(); match separation { Separation::Random(min_separation) => { let offsets = random_offsets(&warriors, min_separation, *instruction_limit, *core_size); for (i, (offset, warrior)) in offsets.iter().enumerate() { let mut ptr = *offset; warrior_offsets[i] = Core::fold(warrior_offsets[i] + ptr, *core_size, *core_size); for instruction in &warrior.instructions { core_instructions[ptr] = CoreInstruction::from_instruction(instruction.clone(), *core_size); ptr = Core::fold(ptr + 1, *core_size, *core_size); } } } Separation::Fixed(separation) => { let mut ptr = 0_usize; for (i, warrior) in warriors.iter().enumerate() { warrior_offsets[i] = Core::fold(warrior_offsets[i] + ptr, *core_size, *core_size); for instruction in &warrior.instructions { core_instructions[ptr] = CoreInstruction::from_instruction(instruction.clone(), *core_size); ptr = Core::fold(ptr + 1, *core_size, *core_size); } ptr = Core::fold(ptr + separation, *core_size, *core_size); } } }; let task_queues = warrior_offsets .iter() .zip(warriors) .map(|(&offset, warrior)| { let mut v = VecDeque::with_capacity(*maximum_number_of_tasks); let offset = Core::fold(offset, *core_size, *core_size); v.push_back(offset); (warrior, v) }) .collect(); Ok(Core { core: self, instructions: core_instructions, task_queues, current_queue: 0, cycle_count: 0, }) } } /// The separation between warriors at the start of a match. /// /// The number of instructions from the first instruction of one warrior to the first instruction of the next warrior. /// If a core's separation is `Random`, separations will be chosen randomly from the set of numbers larger than the core's minimum separation. #[derive(Debug, Clone)] pub enum Separation { Random(usize), Fixed(usize), } /// The value to which the core's memory addresses are initialised /// at the beginning of the match. /// /// The initial instruction is that instruction which is preloaded /// into core prior to loading warriors. If set to `Random`, core /// instructions are filled with randomly generated instructions. #[derive(Debug, Clone)] pub enum InitialInstruction { Random, Fixed(Instruction), } impl InitialInstruction { /// Extract the initial instruction if it's `Fixed`, or get a random `Instruction` if it's `Random`. pub fn extract(self) -> Instruction { match self { Self::Random => todo!(), Self::Fixed(instr) => instr, } } } fn random_offsets( warriors: &[Warrior], minimum_separation: usize, instruction_limit: usize, core_size: usize, ) -> Vec<(usize, &Warrior)> { let mut offsets: Vec<(usize, &Warrior)> = Vec::new(); for warrior in warriors { let offset_addresses: Vec<usize> = offsets.iter().map(|x| x.0).collect(); let offset = get_valid_address( &offset_addresses, minimum_separation, instruction_limit, core_size, ); offsets.push((offset, warrior)); } offsets } fn get_valid_address( offsets: &[usize], minimum_separation: usize, instruction_limit: usize, core_size: usize, ) -> usize { let diff = |x, y| { if x > y { x - y } else { ((core_size - 1) + y) - x } }; let ptr: usize; let mut rng = rand::thread_rng(); // This will run forever if we can't fit a warrior... 'outer: loop { let address: usize = rng.gen_range(0, core_size); for offset in offsets { let lb = diff(address + instruction_limit, *offset); let ub = diff(offset + instruction_limit, address); if (lb <= minimum_separation) || (ub <= minimum_separation) { continue 'outer; } } ptr = address; break; } ptr } #[cfg(test)] mod test { use super::*; use std::convert::TryFrom; #[test] fn random_addresses() { let imp = Warrior::parse(include_str!("../../warriors/imp.red"), 0).unwrap(); let stone = Warrior::parse(include_str!("../../warriors/stone.red"), 0).unwrap(); let imp2 = imp.clone(); let stone2 = stone.clone(); let imp3 = imp.clone(); let stone3 = stone.clone(); let warriors = vec![imp, stone, imp2, stone2, imp3, stone3]; for _ in 0..5000 { let offsets = random_offsets(&warriors, 100, 100, 8000); assert_eq!(offsets.len(), 6); for offset in &offsets { let mut ok = true; for other in &offsets { if offset.1!= other.1 { let o1 = i64::try_from(offset.0).unwrap(); let o2 = i64::try_from(other.0).unwrap(); if i64::abs(o1 - o2) < 100 { ok = false; break; } } } assert!(ok); } } } }
{ return Err(CoreError::WarriorTooLong( warrior.len(), self.instruction_limit, warrior.metadata.name().unwrap_or("Unnamed").to_owned(), )); }
conditional_block
nbd.rs
//! Utility functions for working with nbd devices use rpc::mayastor::*; use crate::{ csi::{NodeStageVolumeRequest, NodeStageVolumeResponse}, device, format::probed_format, mount::{match_mount, mount_fs, Fs}, }; use enclose::enclose; use futures::{ future::{err, ok, Either}, Future, }; use glob::glob; use jsonrpc; use rpc::jsonrpc as jsondata; use std::fmt; use sysfs; use tower_grpc::{Code, Response, Status}; use std::{path::PathBuf, sync::Mutex}; lazy_static! { static ref ARRAY: Mutex<Vec<u32>> = Mutex::new(vec![0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 14, 15]); } #[derive(Clone, Copy)] pub struct NbdDevInfo { instance: u32, major: u64, minor: u64, } impl fmt::Display for NbdDevInfo { fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result { write!(f, "/dev/nbd{}", self.instance) } } impl fmt::Debug for NbdDevInfo { fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result { write!(f, "nbd{} ({}:{})", self.instance, self.major, self.minor) } } pub fn nbd_stage_volume( socket: String, msg: &NodeStageVolumeRequest, filesystem: Fs, mnt_opts: Vec<String>, ) -> Box< dyn Future<Item = Response<NodeStageVolumeResponse>, Error = Status> + Send, > { //let msg = request.into_inner(); let uuid = msg.volume_id.clone(); let target_path = msg.staging_target_path.to_string(); let mount_fail = msg.publish_context.contains_key("mount"); let f = get_nbd_instance(&socket.clone(), &uuid) .and_then(move |nbd_disk| { if nbd_disk.is_none() { // if we dont have a nbd device with a corresponding bdev, // its an error ass it should error!("No device instance found for {}, likely a bug", &uuid); return err(Status::new( Code::Internal, "no such bdev exists".to_string(), )); } let nbd_disk = nbd_disk.unwrap(); if let Some(mount) = match_mount( Some(&nbd_disk.nbd_device), Some(&target_path), false, ) { if mount.source == nbd_disk.nbd_device && mount.dest == target_path { // the device is already mounted we should return OK return ok((true, nbd_disk, target_path, uuid)); } else { // something is there already return error return err(Status::new( Code::AlreadyExists, "Some different BDEV on that path already".to_string(), )); } } ok((false, nbd_disk, target_path, uuid)) }) .and_then(move |mounted| { if!mounted.0 { Either::A( probed_format(&mounted.1.nbd_device, &filesystem.name) .then(move |format_result| { let mnt_result = if mount_fail || format_result.is_err() { if!mount_fail { Err(format_result.unwrap_err()) } else { debug!("Simulating mount failure"); Err("simulated".to_owned()) } } else { mount_fs( &mounted.1.nbd_device, &mounted.2, false, &filesystem.name, &mnt_opts, ) }; if let Err(reason) = mnt_result { Box::new(err(Status::new( Code::Internal, reason, ))) } else { info!( "staged {} on {}", &mounted.3, &mounted.2 ); Box::new(ok(Response::new( NodeStageVolumeResponse {}, ))) } }), ) } else { Either::B(Box::new(ok(Response::new( NodeStageVolumeResponse {}, )))) } }); Box::new(f) } pub fn create_blkdev( socket: String, msg: &CreateBlkdevRequest, ) -> Box<dyn Future<Item = Response<CreateBlkdevReply>, Error = Status> + Send> { trace!("{:?}", msg); debug!("Creating NBD device for {}...", msg.uuid); let nbd_dev_info = NbdDevInfo::new(); let uuid = msg.uuid.clone(); // what ever instance we got assigned, it was in use, and is now removed // from the device list if nbd_dev_info.is_none() { return Box::new(err(Status::new( Code::Internal, String::from("EAGAIN"), ))); } let nbd_dev_info = nbd_dev_info.unwrap(); let f = get_nbd_instance(&socket, &uuid) // TODO: Avoid this step in future chain by returning eexist from // start-nbd-disk json-rpc method. .and_then(enclose! { (uuid) move |bdev| { if let Some(bdev) = bdev { return err(Status::new( Code::AlreadyExists, format!( "Bbdev {} already published at {}", uuid, bdev.nbd_device ), )); } ok(()) }}) .map_err(|e| jsonrpc::error::Error::GenericError(e.to_string())) .and_then(enclose! { (uuid) move |_| { jsonrpc::call::<jsondata::StartNbdDiskArgs, String>( &socket, "start_nbd_disk", Some(jsondata::StartNbdDiskArgs { bdev_name: uuid, nbd_device: format!("{}", nbd_dev_info), }), ) }}) .and_then(move |nbd_device| { trace!("NBD device {} created", &nbd_device); device::await_size(&nbd_device).map_err(jsonrpc::error::Error::from) }) .and_then(move |size| { info!("Device {} reported size: {}", nbd_dev_info, size); let reply = CreateBlkdevReply { blk_dev: format!("{}", nbd_dev_info), }; ok(Response::new(reply)) }) .map_err(move |err| { error!( "Putting back nbd device {} due to error: {}", nbd_dev_info, err.to_string() ); nbd_dev_info.put_back(); err.into_status() }); Box::new(f) } pub fn destroy_blkdev( socket: String, msg: &DestroyBlkdevRequest, ) -> Box<dyn Future<Item = Response<Null>, Error = Status> + Send> { trace!("{:?}", msg); let uuid = msg.uuid.clone(); debug!("Deleting NBD device for {}...", uuid); let f = get_nbd_instance(&socket, &uuid) // TODO: Avoid this step by returning enoent from stop-nbd-disk // json-rpc method. .and_then(move |nbd_disk| { if nbd_disk.is_none() { trace!("bdev {} not found", uuid); return err(Status::new( Code::Internal, format!("no such bdev {}", uuid), )); } let nbd_disk = nbd_disk.unwrap(); ok(nbd_disk) }) .and_then(move |nbd_disk| { trace!("Stopping NBD device {}", nbd_disk.nbd_device); jsonrpc::call::<jsondata::StopNbdDiskArgs, bool>( &socket, "stop_nbd_disk", Some(jsondata::StopNbdDiskArgs { nbd_device: nbd_disk.nbd_device.clone(), }), ) .map_err(|err| err.into_status()) .and_then(|done| { if done { info!( "Stopped NBD device {} with bdev {}", nbd_disk.nbd_device, nbd_disk.bdev_name ); NbdDevInfo::from(nbd_disk.nbd_device).put_back(); Box::new(ok(Response::new(Null {}))) } else { let msg = format!( "Failed to stop nbd device {} for {}", nbd_disk.nbd_device, nbd_disk.bdev_name ); error!("{}", msg); Box::new(err(Status::new(Code::Internal, msg))) } }) }); Box::new(f) } pub fn get_nbd_instance( sock: &str, bdev_name: &str, ) -> Box<dyn Future<Item = Option<jsondata::NbdDisk>, Error = Status> + Send> { let bdev_name = bdev_name.to_string(); let socket = sock.to_string(); let f = jsonrpc::call::<jsondata::GetBdevsArgs, Vec<jsondata::Bdev>>( &socket, "get_bdevs", Some(jsondata::GetBdevsArgs { name: bdev_name.clone(), }), ) .map_err(|e| { Status::new(Code::NotFound, format!("Failed to list bdevs: {}", e)) }) .and_then(move |bdev| { jsonrpc::call::<(), Vec<jsondata::NbdDisk>>( &socket, "get_nbd_disks", None, ) .map(move |nbd_disks| { nbd_disks .into_iter() .find(|ent| ent.bdev_name == bdev[0].name) }) .map_err(|err| { Status::new( Code::NotFound, format!("Failed to find nbd disk: {}", err), ) }) }); Box::new(f) } impl NbdDevInfo { /// This will return the next available nbd device pub fn new() -> Option<Self> { let instance = ARRAY.lock().unwrap().pop()?; trace!("Will use nbd slot {}", instance); NbdDevInfo::create(instance) } fn create(instance: u32) -> Option<Self> { let mut path = PathBuf::from(&format!("/sys/class/block/nbd{}", instance)); path.push("pid"); if path.exists() { trace!( "Dropping nbd instance: {} as it appears to be in use", instance ); return None; } path.pop(); let e = path .strip_prefix("/sys/class/block") .unwrap() .to_str() .unwrap() .split_at(3); let instance = e.1.parse().unwrap(); let dev_t: String = sysfs::parse_value(&path, "dev").unwrap(); let nums: Vec<u64> = dev_t.split(':').map(|x| x.parse().unwrap()).collect(); // Documentation/admin-guide/devices.txt if nums[0]!= 43 { warn!("Invalid major number of nbd dev {}", path.display()); } let nbd = NbdDevInfo { instance, major: nums[0], minor: nums[1], }; assert_eq!(nbd.instance, instance); Some(nbd) } pub fn put_back(&self) { ARRAY.lock().unwrap().push(self.instance); trace!("instance {} added back to the free list", self.instance); } pub fn
() -> usize { glob("/sys/class/block/nbd*").unwrap().count() } } impl From<String> for NbdDevInfo { fn from(e: String) -> Self { let instance: u32 = e.replace("/dev/nbd", "").parse().unwrap(); NbdDevInfo::create(instance).unwrap() } }
num_devices
identifier_name
nbd.rs
//! Utility functions for working with nbd devices use rpc::mayastor::*; use crate::{ csi::{NodeStageVolumeRequest, NodeStageVolumeResponse}, device, format::probed_format, mount::{match_mount, mount_fs, Fs}, }; use enclose::enclose; use futures::{ future::{err, ok, Either}, Future, }; use glob::glob; use jsonrpc; use rpc::jsonrpc as jsondata; use std::fmt; use sysfs; use tower_grpc::{Code, Response, Status}; use std::{path::PathBuf, sync::Mutex}; lazy_static! { static ref ARRAY: Mutex<Vec<u32>> = Mutex::new(vec![0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 14, 15]); } #[derive(Clone, Copy)] pub struct NbdDevInfo { instance: u32, major: u64, minor: u64, } impl fmt::Display for NbdDevInfo { fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result { write!(f, "/dev/nbd{}", self.instance) } } impl fmt::Debug for NbdDevInfo { fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result { write!(f, "nbd{} ({}:{})", self.instance, self.major, self.minor) } } pub fn nbd_stage_volume( socket: String, msg: &NodeStageVolumeRequest, filesystem: Fs, mnt_opts: Vec<String>, ) -> Box< dyn Future<Item = Response<NodeStageVolumeResponse>, Error = Status> + Send, > { //let msg = request.into_inner(); let uuid = msg.volume_id.clone(); let target_path = msg.staging_target_path.to_string(); let mount_fail = msg.publish_context.contains_key("mount"); let f = get_nbd_instance(&socket.clone(), &uuid) .and_then(move |nbd_disk| { if nbd_disk.is_none() { // if we dont have a nbd device with a corresponding bdev, // its an error ass it should error!("No device instance found for {}, likely a bug", &uuid); return err(Status::new( Code::Internal, "no such bdev exists".to_string(), )); } let nbd_disk = nbd_disk.unwrap(); if let Some(mount) = match_mount( Some(&nbd_disk.nbd_device), Some(&target_path), false, ) { if mount.source == nbd_disk.nbd_device && mount.dest == target_path { // the device is already mounted we should return OK return ok((true, nbd_disk, target_path, uuid)); } else { // something is there already return error return err(Status::new( Code::AlreadyExists, "Some different BDEV on that path already".to_string(), )); } } ok((false, nbd_disk, target_path, uuid)) }) .and_then(move |mounted| { if!mounted.0 { Either::A( probed_format(&mounted.1.nbd_device, &filesystem.name) .then(move |format_result| { let mnt_result = if mount_fail || format_result.is_err() { if!mount_fail { Err(format_result.unwrap_err()) } else { debug!("Simulating mount failure"); Err("simulated".to_owned()) } } else { mount_fs( &mounted.1.nbd_device, &mounted.2, false, &filesystem.name, &mnt_opts, ) }; if let Err(reason) = mnt_result { Box::new(err(Status::new( Code::Internal, reason, ))) } else { info!( "staged {} on {}", &mounted.3, &mounted.2 ); Box::new(ok(Response::new( NodeStageVolumeResponse {}, ))) } }), ) } else { Either::B(Box::new(ok(Response::new( NodeStageVolumeResponse {}, )))) } }); Box::new(f) } pub fn create_blkdev( socket: String, msg: &CreateBlkdevRequest, ) -> Box<dyn Future<Item = Response<CreateBlkdevReply>, Error = Status> + Send> { trace!("{:?}", msg); debug!("Creating NBD device for {}...", msg.uuid); let nbd_dev_info = NbdDevInfo::new(); let uuid = msg.uuid.clone(); // what ever instance we got assigned, it was in use, and is now removed // from the device list if nbd_dev_info.is_none() { return Box::new(err(Status::new( Code::Internal, String::from("EAGAIN"), ))); } let nbd_dev_info = nbd_dev_info.unwrap(); let f = get_nbd_instance(&socket, &uuid) // TODO: Avoid this step in future chain by returning eexist from // start-nbd-disk json-rpc method. .and_then(enclose! { (uuid) move |bdev| { if let Some(bdev) = bdev { return err(Status::new( Code::AlreadyExists, format!( "Bbdev {} already published at {}", uuid, bdev.nbd_device ), )); } ok(()) }}) .map_err(|e| jsonrpc::error::Error::GenericError(e.to_string())) .and_then(enclose! { (uuid) move |_| { jsonrpc::call::<jsondata::StartNbdDiskArgs, String>( &socket, "start_nbd_disk", Some(jsondata::StartNbdDiskArgs { bdev_name: uuid, nbd_device: format!("{}", nbd_dev_info), }), ) }}) .and_then(move |nbd_device| { trace!("NBD device {} created", &nbd_device); device::await_size(&nbd_device).map_err(jsonrpc::error::Error::from) }) .and_then(move |size| { info!("Device {} reported size: {}", nbd_dev_info, size); let reply = CreateBlkdevReply { blk_dev: format!("{}", nbd_dev_info), }; ok(Response::new(reply)) }) .map_err(move |err| { error!( "Putting back nbd device {} due to error: {}", nbd_dev_info, err.to_string() ); nbd_dev_info.put_back(); err.into_status() }); Box::new(f) } pub fn destroy_blkdev( socket: String, msg: &DestroyBlkdevRequest, ) -> Box<dyn Future<Item = Response<Null>, Error = Status> + Send> { trace!("{:?}", msg); let uuid = msg.uuid.clone(); debug!("Deleting NBD device for {}...", uuid); let f = get_nbd_instance(&socket, &uuid) // TODO: Avoid this step by returning enoent from stop-nbd-disk // json-rpc method. .and_then(move |nbd_disk| { if nbd_disk.is_none() { trace!("bdev {} not found", uuid); return err(Status::new( Code::Internal, format!("no such bdev {}", uuid), )); } let nbd_disk = nbd_disk.unwrap(); ok(nbd_disk) }) .and_then(move |nbd_disk| { trace!("Stopping NBD device {}", nbd_disk.nbd_device); jsonrpc::call::<jsondata::StopNbdDiskArgs, bool>( &socket, "stop_nbd_disk", Some(jsondata::StopNbdDiskArgs { nbd_device: nbd_disk.nbd_device.clone(), }), ) .map_err(|err| err.into_status()) .and_then(|done| { if done
else { let msg = format!( "Failed to stop nbd device {} for {}", nbd_disk.nbd_device, nbd_disk.bdev_name ); error!("{}", msg); Box::new(err(Status::new(Code::Internal, msg))) } }) }); Box::new(f) } pub fn get_nbd_instance( sock: &str, bdev_name: &str, ) -> Box<dyn Future<Item = Option<jsondata::NbdDisk>, Error = Status> + Send> { let bdev_name = bdev_name.to_string(); let socket = sock.to_string(); let f = jsonrpc::call::<jsondata::GetBdevsArgs, Vec<jsondata::Bdev>>( &socket, "get_bdevs", Some(jsondata::GetBdevsArgs { name: bdev_name.clone(), }), ) .map_err(|e| { Status::new(Code::NotFound, format!("Failed to list bdevs: {}", e)) }) .and_then(move |bdev| { jsonrpc::call::<(), Vec<jsondata::NbdDisk>>( &socket, "get_nbd_disks", None, ) .map(move |nbd_disks| { nbd_disks .into_iter() .find(|ent| ent.bdev_name == bdev[0].name) }) .map_err(|err| { Status::new( Code::NotFound, format!("Failed to find nbd disk: {}", err), ) }) }); Box::new(f) } impl NbdDevInfo { /// This will return the next available nbd device pub fn new() -> Option<Self> { let instance = ARRAY.lock().unwrap().pop()?; trace!("Will use nbd slot {}", instance); NbdDevInfo::create(instance) } fn create(instance: u32) -> Option<Self> { let mut path = PathBuf::from(&format!("/sys/class/block/nbd{}", instance)); path.push("pid"); if path.exists() { trace!( "Dropping nbd instance: {} as it appears to be in use", instance ); return None; } path.pop(); let e = path .strip_prefix("/sys/class/block") .unwrap() .to_str() .unwrap() .split_at(3); let instance = e.1.parse().unwrap(); let dev_t: String = sysfs::parse_value(&path, "dev").unwrap(); let nums: Vec<u64> = dev_t.split(':').map(|x| x.parse().unwrap()).collect(); // Documentation/admin-guide/devices.txt if nums[0]!= 43 { warn!("Invalid major number of nbd dev {}", path.display()); } let nbd = NbdDevInfo { instance, major: nums[0], minor: nums[1], }; assert_eq!(nbd.instance, instance); Some(nbd) } pub fn put_back(&self) { ARRAY.lock().unwrap().push(self.instance); trace!("instance {} added back to the free list", self.instance); } pub fn num_devices() -> usize { glob("/sys/class/block/nbd*").unwrap().count() } } impl From<String> for NbdDevInfo { fn from(e: String) -> Self { let instance: u32 = e.replace("/dev/nbd", "").parse().unwrap(); NbdDevInfo::create(instance).unwrap() } }
{ info!( "Stopped NBD device {} with bdev {}", nbd_disk.nbd_device, nbd_disk.bdev_name ); NbdDevInfo::from(nbd_disk.nbd_device).put_back(); Box::new(ok(Response::new(Null {}))) }
conditional_block
nbd.rs
//! Utility functions for working with nbd devices use rpc::mayastor::*; use crate::{ csi::{NodeStageVolumeRequest, NodeStageVolumeResponse}, device, format::probed_format, mount::{match_mount, mount_fs, Fs}, }; use enclose::enclose; use futures::{ future::{err, ok, Either}, Future, }; use glob::glob; use jsonrpc; use rpc::jsonrpc as jsondata; use std::fmt; use sysfs; use tower_grpc::{Code, Response, Status}; use std::{path::PathBuf, sync::Mutex}; lazy_static! { static ref ARRAY: Mutex<Vec<u32>> = Mutex::new(vec![0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 14, 15]); } #[derive(Clone, Copy)] pub struct NbdDevInfo { instance: u32, major: u64, minor: u64, } impl fmt::Display for NbdDevInfo { fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result
} impl fmt::Debug for NbdDevInfo { fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result { write!(f, "nbd{} ({}:{})", self.instance, self.major, self.minor) } } pub fn nbd_stage_volume( socket: String, msg: &NodeStageVolumeRequest, filesystem: Fs, mnt_opts: Vec<String>, ) -> Box< dyn Future<Item = Response<NodeStageVolumeResponse>, Error = Status> + Send, > { //let msg = request.into_inner(); let uuid = msg.volume_id.clone(); let target_path = msg.staging_target_path.to_string(); let mount_fail = msg.publish_context.contains_key("mount"); let f = get_nbd_instance(&socket.clone(), &uuid) .and_then(move |nbd_disk| { if nbd_disk.is_none() { // if we dont have a nbd device with a corresponding bdev, // its an error ass it should error!("No device instance found for {}, likely a bug", &uuid); return err(Status::new( Code::Internal, "no such bdev exists".to_string(), )); } let nbd_disk = nbd_disk.unwrap(); if let Some(mount) = match_mount( Some(&nbd_disk.nbd_device), Some(&target_path), false, ) { if mount.source == nbd_disk.nbd_device && mount.dest == target_path { // the device is already mounted we should return OK return ok((true, nbd_disk, target_path, uuid)); } else { // something is there already return error return err(Status::new( Code::AlreadyExists, "Some different BDEV on that path already".to_string(), )); } } ok((false, nbd_disk, target_path, uuid)) }) .and_then(move |mounted| { if!mounted.0 { Either::A( probed_format(&mounted.1.nbd_device, &filesystem.name) .then(move |format_result| { let mnt_result = if mount_fail || format_result.is_err() { if!mount_fail { Err(format_result.unwrap_err()) } else { debug!("Simulating mount failure"); Err("simulated".to_owned()) } } else { mount_fs( &mounted.1.nbd_device, &mounted.2, false, &filesystem.name, &mnt_opts, ) }; if let Err(reason) = mnt_result { Box::new(err(Status::new( Code::Internal, reason, ))) } else { info!( "staged {} on {}", &mounted.3, &mounted.2 ); Box::new(ok(Response::new( NodeStageVolumeResponse {}, ))) } }), ) } else { Either::B(Box::new(ok(Response::new( NodeStageVolumeResponse {}, )))) } }); Box::new(f) } pub fn create_blkdev( socket: String, msg: &CreateBlkdevRequest, ) -> Box<dyn Future<Item = Response<CreateBlkdevReply>, Error = Status> + Send> { trace!("{:?}", msg); debug!("Creating NBD device for {}...", msg.uuid); let nbd_dev_info = NbdDevInfo::new(); let uuid = msg.uuid.clone(); // what ever instance we got assigned, it was in use, and is now removed // from the device list if nbd_dev_info.is_none() { return Box::new(err(Status::new( Code::Internal, String::from("EAGAIN"), ))); } let nbd_dev_info = nbd_dev_info.unwrap(); let f = get_nbd_instance(&socket, &uuid) // TODO: Avoid this step in future chain by returning eexist from // start-nbd-disk json-rpc method. .and_then(enclose! { (uuid) move |bdev| { if let Some(bdev) = bdev { return err(Status::new( Code::AlreadyExists, format!( "Bbdev {} already published at {}", uuid, bdev.nbd_device ), )); } ok(()) }}) .map_err(|e| jsonrpc::error::Error::GenericError(e.to_string())) .and_then(enclose! { (uuid) move |_| { jsonrpc::call::<jsondata::StartNbdDiskArgs, String>( &socket, "start_nbd_disk", Some(jsondata::StartNbdDiskArgs { bdev_name: uuid, nbd_device: format!("{}", nbd_dev_info), }), ) }}) .and_then(move |nbd_device| { trace!("NBD device {} created", &nbd_device); device::await_size(&nbd_device).map_err(jsonrpc::error::Error::from) }) .and_then(move |size| { info!("Device {} reported size: {}", nbd_dev_info, size); let reply = CreateBlkdevReply { blk_dev: format!("{}", nbd_dev_info), }; ok(Response::new(reply)) }) .map_err(move |err| { error!( "Putting back nbd device {} due to error: {}", nbd_dev_info, err.to_string() ); nbd_dev_info.put_back(); err.into_status() }); Box::new(f) } pub fn destroy_blkdev( socket: String, msg: &DestroyBlkdevRequest, ) -> Box<dyn Future<Item = Response<Null>, Error = Status> + Send> { trace!("{:?}", msg); let uuid = msg.uuid.clone(); debug!("Deleting NBD device for {}...", uuid); let f = get_nbd_instance(&socket, &uuid) // TODO: Avoid this step by returning enoent from stop-nbd-disk // json-rpc method. .and_then(move |nbd_disk| { if nbd_disk.is_none() { trace!("bdev {} not found", uuid); return err(Status::new( Code::Internal, format!("no such bdev {}", uuid), )); } let nbd_disk = nbd_disk.unwrap(); ok(nbd_disk) }) .and_then(move |nbd_disk| { trace!("Stopping NBD device {}", nbd_disk.nbd_device); jsonrpc::call::<jsondata::StopNbdDiskArgs, bool>( &socket, "stop_nbd_disk", Some(jsondata::StopNbdDiskArgs { nbd_device: nbd_disk.nbd_device.clone(), }), ) .map_err(|err| err.into_status()) .and_then(|done| { if done { info!( "Stopped NBD device {} with bdev {}", nbd_disk.nbd_device, nbd_disk.bdev_name ); NbdDevInfo::from(nbd_disk.nbd_device).put_back(); Box::new(ok(Response::new(Null {}))) } else { let msg = format!( "Failed to stop nbd device {} for {}", nbd_disk.nbd_device, nbd_disk.bdev_name ); error!("{}", msg); Box::new(err(Status::new(Code::Internal, msg))) } }) }); Box::new(f) } pub fn get_nbd_instance( sock: &str, bdev_name: &str, ) -> Box<dyn Future<Item = Option<jsondata::NbdDisk>, Error = Status> + Send> { let bdev_name = bdev_name.to_string(); let socket = sock.to_string(); let f = jsonrpc::call::<jsondata::GetBdevsArgs, Vec<jsondata::Bdev>>( &socket, "get_bdevs", Some(jsondata::GetBdevsArgs { name: bdev_name.clone(), }), ) .map_err(|e| { Status::new(Code::NotFound, format!("Failed to list bdevs: {}", e)) }) .and_then(move |bdev| { jsonrpc::call::<(), Vec<jsondata::NbdDisk>>( &socket, "get_nbd_disks", None, ) .map(move |nbd_disks| { nbd_disks .into_iter() .find(|ent| ent.bdev_name == bdev[0].name) }) .map_err(|err| { Status::new( Code::NotFound, format!("Failed to find nbd disk: {}", err), ) }) }); Box::new(f) } impl NbdDevInfo { /// This will return the next available nbd device pub fn new() -> Option<Self> { let instance = ARRAY.lock().unwrap().pop()?; trace!("Will use nbd slot {}", instance); NbdDevInfo::create(instance) } fn create(instance: u32) -> Option<Self> { let mut path = PathBuf::from(&format!("/sys/class/block/nbd{}", instance)); path.push("pid"); if path.exists() { trace!( "Dropping nbd instance: {} as it appears to be in use", instance ); return None; } path.pop(); let e = path .strip_prefix("/sys/class/block") .unwrap() .to_str() .unwrap() .split_at(3); let instance = e.1.parse().unwrap(); let dev_t: String = sysfs::parse_value(&path, "dev").unwrap(); let nums: Vec<u64> = dev_t.split(':').map(|x| x.parse().unwrap()).collect(); // Documentation/admin-guide/devices.txt if nums[0]!= 43 { warn!("Invalid major number of nbd dev {}", path.display()); } let nbd = NbdDevInfo { instance, major: nums[0], minor: nums[1], }; assert_eq!(nbd.instance, instance); Some(nbd) } pub fn put_back(&self) { ARRAY.lock().unwrap().push(self.instance); trace!("instance {} added back to the free list", self.instance); } pub fn num_devices() -> usize { glob("/sys/class/block/nbd*").unwrap().count() } } impl From<String> for NbdDevInfo { fn from(e: String) -> Self { let instance: u32 = e.replace("/dev/nbd", "").parse().unwrap(); NbdDevInfo::create(instance).unwrap() } }
{ write!(f, "/dev/nbd{}", self.instance) }
identifier_body
nbd.rs
//! Utility functions for working with nbd devices use rpc::mayastor::*; use crate::{ csi::{NodeStageVolumeRequest, NodeStageVolumeResponse}, device, format::probed_format, mount::{match_mount, mount_fs, Fs}, }; use enclose::enclose; use futures::{ future::{err, ok, Either}, Future, }; use glob::glob; use jsonrpc; use rpc::jsonrpc as jsondata; use std::fmt; use sysfs; use tower_grpc::{Code, Response, Status}; use std::{path::PathBuf, sync::Mutex}; lazy_static! { static ref ARRAY: Mutex<Vec<u32>> = Mutex::new(vec![0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 14, 15]); } #[derive(Clone, Copy)] pub struct NbdDevInfo { instance: u32, major: u64, minor: u64, } impl fmt::Display for NbdDevInfo { fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result { write!(f, "/dev/nbd{}", self.instance) } } impl fmt::Debug for NbdDevInfo { fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result { write!(f, "nbd{} ({}:{})", self.instance, self.major, self.minor) } } pub fn nbd_stage_volume( socket: String, msg: &NodeStageVolumeRequest, filesystem: Fs, mnt_opts: Vec<String>, ) -> Box< dyn Future<Item = Response<NodeStageVolumeResponse>, Error = Status> + Send, > { //let msg = request.into_inner(); let uuid = msg.volume_id.clone(); let target_path = msg.staging_target_path.to_string(); let mount_fail = msg.publish_context.contains_key("mount"); let f = get_nbd_instance(&socket.clone(), &uuid) .and_then(move |nbd_disk| { if nbd_disk.is_none() { // if we dont have a nbd device with a corresponding bdev, // its an error ass it should error!("No device instance found for {}, likely a bug", &uuid); return err(Status::new( Code::Internal, "no such bdev exists".to_string(), )); } let nbd_disk = nbd_disk.unwrap(); if let Some(mount) = match_mount( Some(&nbd_disk.nbd_device), Some(&target_path), false, ) { if mount.source == nbd_disk.nbd_device && mount.dest == target_path { // the device is already mounted we should return OK return ok((true, nbd_disk, target_path, uuid)); } else { // something is there already return error return err(Status::new( Code::AlreadyExists, "Some different BDEV on that path already".to_string(), )); } } ok((false, nbd_disk, target_path, uuid)) }) .and_then(move |mounted| { if!mounted.0 { Either::A( probed_format(&mounted.1.nbd_device, &filesystem.name) .then(move |format_result| { let mnt_result = if mount_fail || format_result.is_err() { if!mount_fail { Err(format_result.unwrap_err()) } else { debug!("Simulating mount failure"); Err("simulated".to_owned()) } } else { mount_fs( &mounted.1.nbd_device, &mounted.2, false, &filesystem.name, &mnt_opts, ) }; if let Err(reason) = mnt_result { Box::new(err(Status::new( Code::Internal, reason, ))) } else { info!( "staged {} on {}", &mounted.3, &mounted.2 ); Box::new(ok(Response::new( NodeStageVolumeResponse {}, ))) } }), ) } else { Either::B(Box::new(ok(Response::new( NodeStageVolumeResponse {}, )))) } }); Box::new(f) } pub fn create_blkdev( socket: String, msg: &CreateBlkdevRequest, ) -> Box<dyn Future<Item = Response<CreateBlkdevReply>, Error = Status> + Send> { trace!("{:?}", msg); debug!("Creating NBD device for {}...", msg.uuid); let nbd_dev_info = NbdDevInfo::new(); let uuid = msg.uuid.clone(); // what ever instance we got assigned, it was in use, and is now removed // from the device list if nbd_dev_info.is_none() { return Box::new(err(Status::new( Code::Internal, String::from("EAGAIN"), ))); } let nbd_dev_info = nbd_dev_info.unwrap(); let f = get_nbd_instance(&socket, &uuid) // TODO: Avoid this step in future chain by returning eexist from // start-nbd-disk json-rpc method. .and_then(enclose! { (uuid) move |bdev| { if let Some(bdev) = bdev { return err(Status::new( Code::AlreadyExists, format!( "Bbdev {} already published at {}", uuid, bdev.nbd_device ), )); } ok(()) }}) .map_err(|e| jsonrpc::error::Error::GenericError(e.to_string())) .and_then(enclose! { (uuid) move |_| { jsonrpc::call::<jsondata::StartNbdDiskArgs, String>( &socket, "start_nbd_disk", Some(jsondata::StartNbdDiskArgs { bdev_name: uuid, nbd_device: format!("{}", nbd_dev_info), }), ) }}) .and_then(move |nbd_device| { trace!("NBD device {} created", &nbd_device); device::await_size(&nbd_device).map_err(jsonrpc::error::Error::from) }) .and_then(move |size| { info!("Device {} reported size: {}", nbd_dev_info, size); let reply = CreateBlkdevReply { blk_dev: format!("{}", nbd_dev_info), }; ok(Response::new(reply)) }) .map_err(move |err| { error!( "Putting back nbd device {} due to error: {}", nbd_dev_info, err.to_string() ); nbd_dev_info.put_back(); err.into_status() }); Box::new(f) } pub fn destroy_blkdev( socket: String, msg: &DestroyBlkdevRequest, ) -> Box<dyn Future<Item = Response<Null>, Error = Status> + Send> { trace!("{:?}", msg); let uuid = msg.uuid.clone(); debug!("Deleting NBD device for {}...", uuid); let f = get_nbd_instance(&socket, &uuid) // TODO: Avoid this step by returning enoent from stop-nbd-disk // json-rpc method. .and_then(move |nbd_disk| { if nbd_disk.is_none() { trace!("bdev {} not found", uuid); return err(Status::new( Code::Internal, format!("no such bdev {}", uuid), )); } let nbd_disk = nbd_disk.unwrap(); ok(nbd_disk) }) .and_then(move |nbd_disk| { trace!("Stopping NBD device {}", nbd_disk.nbd_device); jsonrpc::call::<jsondata::StopNbdDiskArgs, bool>( &socket, "stop_nbd_disk", Some(jsondata::StopNbdDiskArgs { nbd_device: nbd_disk.nbd_device.clone(), }), ) .map_err(|err| err.into_status()) .and_then(|done| { if done { info!( "Stopped NBD device {} with bdev {}", nbd_disk.nbd_device, nbd_disk.bdev_name ); NbdDevInfo::from(nbd_disk.nbd_device).put_back(); Box::new(ok(Response::new(Null {}))) } else { let msg = format!( "Failed to stop nbd device {} for {}", nbd_disk.nbd_device, nbd_disk.bdev_name ); error!("{}", msg); Box::new(err(Status::new(Code::Internal, msg))) } }) }); Box::new(f) } pub fn get_nbd_instance( sock: &str, bdev_name: &str, ) -> Box<dyn Future<Item = Option<jsondata::NbdDisk>, Error = Status> + Send> { let bdev_name = bdev_name.to_string(); let socket = sock.to_string(); let f = jsonrpc::call::<jsondata::GetBdevsArgs, Vec<jsondata::Bdev>>( &socket, "get_bdevs", Some(jsondata::GetBdevsArgs { name: bdev_name.clone(), }), ) .map_err(|e| { Status::new(Code::NotFound, format!("Failed to list bdevs: {}", e)) }) .and_then(move |bdev| { jsonrpc::call::<(), Vec<jsondata::NbdDisk>>( &socket, "get_nbd_disks", None, ) .map(move |nbd_disks| { nbd_disks .into_iter() .find(|ent| ent.bdev_name == bdev[0].name) }) .map_err(|err| { Status::new( Code::NotFound, format!("Failed to find nbd disk: {}", err), ) }) }); Box::new(f) } impl NbdDevInfo { /// This will return the next available nbd device pub fn new() -> Option<Self> { let instance = ARRAY.lock().unwrap().pop()?; trace!("Will use nbd slot {}", instance); NbdDevInfo::create(instance) } fn create(instance: u32) -> Option<Self> { let mut path = PathBuf::from(&format!("/sys/class/block/nbd{}", instance)); path.push("pid"); if path.exists() { trace!( "Dropping nbd instance: {} as it appears to be in use", instance ); return None; } path.pop(); let e = path .strip_prefix("/sys/class/block") .unwrap() .to_str() .unwrap() .split_at(3); let instance = e.1.parse().unwrap(); let dev_t: String = sysfs::parse_value(&path, "dev").unwrap(); let nums: Vec<u64> = dev_t.split(':').map(|x| x.parse().unwrap()).collect(); // Documentation/admin-guide/devices.txt if nums[0]!= 43 { warn!("Invalid major number of nbd dev {}", path.display()); } let nbd = NbdDevInfo { instance, major: nums[0], minor: nums[1], }; assert_eq!(nbd.instance, instance); Some(nbd) } pub fn put_back(&self) { ARRAY.lock().unwrap().push(self.instance); trace!("instance {} added back to the free list", self.instance); } pub fn num_devices() -> usize { glob("/sys/class/block/nbd*").unwrap().count() }
} impl From<String> for NbdDevInfo { fn from(e: String) -> Self { let instance: u32 = e.replace("/dev/nbd", "").parse().unwrap(); NbdDevInfo::create(instance).unwrap() } }
random_line_split
main.rs
use crate::argon2id13::Salt; use actix_web::{get, post, web, HttpRequest, HttpResponse}; use aes_gcm::aead::{Aead, NewAead}; use aes_gcm::{Aes256Gcm, Key, Nonce}; use futures::StreamExt; use google_authenticator::{ErrorCorrectionLevel, GoogleAuthenticator}; use hmac::{Hmac, Mac, NewMac}; use lazy_static::lazy_static; use rand_core::{OsRng, RngCore}; use serde::{Deserialize, Serialize}; use serde_json; use sha2::Sha256; use sodiumoxide::crypto::pwhash::argon2id13; use std::collections::HashMap; use std::convert::TryInto; use std::env; use std::fs; use std::fs::File; use std::io::prelude::*; use std::str; use uuid::Uuid; static mut USER_TOKEN: Vec<(String, String)> = Vec::new(); static mut USER_CHALLENGE: Vec<(String, u64)> = Vec::new(); #[derive(Debug)] struct User { username: String, salt: Salt, password_kdf: [u8; 32], secret: String, } #[derive(Serialize, Deserialize, Debug)] struct UserChallenge { username: String, challenge: u64, salt: Salt, } #[derive(Serialize, Deserialize, Debug)] struct Metadata { file_name: String, username: Vec<String>, nonce: [u8; 12], key: Vec<u8>, } #[derive(Deserialize, Debug)] struct ComputedChallenge { challenge: [u8; 32], } lazy_static! { static ref USER_DB: HashMap<&'static str, User> = { let mut map = HashMap::new(); // configuration google authenticator let auth = GoogleAuthenticator::new(); // Cette partie se fait normalement sur le client mais elle est volontairement // mise sur le serveur pour simplifié l'architecture let salt = argon2id13::gen_salt(); let mut key = [0u8; 32]; argon2id13::derive_key( &mut key, "P@ssw0rd".as_bytes(), &salt, argon2id13::OPSLIMIT_SENSITIVE, argon2id13::MEMLIMIT_SENSITIVE, ) .unwrap(); map.insert( "jerome", User { username: "jerome".to_string(), salt: salt, password_kdf: key, secret: auth.create_secret(32), }, ); map }; } #[get("/server/{user_id}")] async fn username(web::Path(user_id): web::Path<String>) -> HttpResponse { // regarde si l'utilisateur est dans la DB, si oui on lui envoie un challenge à résoudre match USER_DB.get::<str>(&user_id.to_string()) { Some(username) => { let user_challenge = UserChallenge { username: user_id.to_string(), salt: username.salt, challenge: OsRng.next_u64(), }; unsafe { USER_CHALLENGE.push((user_id, user_challenge.challenge)); } HttpResponse::Ok().body(serde_json::to_string(&user_challenge).unwrap()) } None => HttpResponse::NotFound().finish(), } } #[post("/server/{user_id}")] // <- define path parameters async fn username_post( web::Path(user_id): web::Path<String>, mut body: web::Payload, ) -> HttpResponse { // check dans la DB si l'utilisateur est présent let user = match USER_DB.get::<str>(&user_id.to_string()) { Some(user) => user, None => { return HttpResponse::NotFound().finish(); } }; // lecture du body pour avoir le challenge envoyé let mut bytes = web::BytesMut::new(); while let Some(item) = body.next().await { let item = item.unwrap(); bytes.extend_from_slice(&item); } // on désérialise le challenge envoyé let computed_challenge: ComputedChallenge = serde_json::from_str(str::from_utf8(&bytes).unwrap()).unwrap(); // récupération du challenge envoyé au client let challenge_to_compute: u64; unsafe { let index = USER_CHALLENGE.iter().position(|x| x.0 == user_id).unwrap(); challenge_to_compute = USER_CHALLENGE.get(index).unwrap().1; USER_CHALLENGE.remove(index); } // Fait le mac à partir de la kdf dans la DB type HmacSha256 = Hmac<Sha256>; let mut mac = HmacSha256::new_varkey(&user.password_kdf).expect("HMAC Error"); mac.update(&challenge_to_compute.to_be_bytes()); let challenge: [u8; 32] = mac .finalize() .into_bytes() .as_slice() .try_into() .expect("Wrong length"); // on teste si les valeurs sont identiques if challenge == computed_challenge.challenge { return HttpResponse::Ok().finish(); } HttpResponse::NonAuthoritativeInformation().finish() } #[get("/2fa/{user_id}")] async fn get_code(web::Path(user_id): web::Path<String>) -> HttpResponse { // configuration google authenticator let auth = GoogleAuthenticator::new(); // check dans la DB si l'utilisateur est présent let user = match USER_DB.get::<str>(&user_id.to_string()) { Some(user) => user, None => { return HttpResponse::NotFound().finish(); } }; // création du code QR let url = auth.qr_code_url( &user.secret, "qr_code", "name", 200, 200, ErrorCorrectionLevel::High, ); HttpResponse::Ok().body(url) } #[post("/2fa/{user_id}")] async fn validate_code(web::Path(user_id): web::Path<String>, req: HttpRequest) -> HttpResponse { // configuration google authenticator let auth = GoogleAuthenticator::new(); // check dans la DB si l'utilisateur est présent let user = match USER_DB.get::<str>(&user_id.to_string()) { Some(user) => user, None => { return HttpResponse::NotFound().finish();
// récupère le code dans le header let input_code: &str = req.headers().get("Code").unwrap().to_str().unwrap(); if!auth.verify_code(&user.secret, &input_code, 0, 0) { println!("Mauvais code."); return HttpResponse::Unauthorized().finish(); } // si ok, un token est envoyé à l'utilisateur pour les prochains échanges let user_token: String = Uuid::new_v4().hyphenated().to_string(); unsafe { USER_TOKEN.push((user_id, user_token.clone())); } HttpResponse::Ok().header("Token", user_token).finish() } #[post("/upload")] async fn upload(mut body: web::Payload, req: HttpRequest) -> HttpResponse { // lire et vérifier le Token if!check_token(&req) { return HttpResponse::NonAuthoritativeInformation().finish(); } // lire le body let mut bytes = web::BytesMut::new(); while let Some(item) = body.next().await { let item = item.unwrap(); bytes.extend_from_slice(&item); } let res: Vec<u8> = bytes.to_vec(); // écriture des données dans un fichier let mut file = File::create(req.headers().get("filename").unwrap().to_str().unwrap()).unwrap(); file.write_all(&res).unwrap(); HttpResponse::Ok().finish() } #[get("/download")] async fn download(req: HttpRequest) -> HttpResponse { // lire et vérifier le Token let filename: &str = req.headers().get("FileName").unwrap().to_str().unwrap(); if!check_token(&req) { return HttpResponse::NonAuthoritativeInformation().finish(); } let work_file = env::current_dir().unwrap().join(&filename); // ouvrir et lire le fichier let mut file = match File::open(work_file) { Ok(result) => result, Err(_) => { return HttpResponse::NoContent().finish(); } }; let mut ciphertext: Vec<u8> = Vec::new(); file.read_to_end(&mut ciphertext).unwrap(); HttpResponse::Ok().body(ciphertext) } #[get("/list")] async fn get_list(req: HttpRequest) -> HttpResponse { // lire et vérifier le Token if!check_token(&req) { return HttpResponse::NonAuthoritativeInformation().finish(); } let user_name: &str = req.headers().get("Username").unwrap().to_str().unwrap(); // préparation des clés pour AES-GCM et du nonce let key_aes = Key::from_slice(b"an example very very secret key."); let aead = Aes256Gcm::new(key_aes); let nonce = Nonce::from_slice(b"unique nonce"); let mut file_list = String::new(); // on lit le contenu du répertoire let paths = fs::read_dir("./").unwrap(); for path in paths { let file = path.unwrap().path().into_os_string().into_string().unwrap(); // pour tous les fichiers est de type metadonnée if file.contains(".metadata") { let mut current_file = File::open(&file).expect("Unable to open the file"); let mut contents = String::new(); current_file .read_to_string(&mut contents) .expect("Unable to read the file"); let meta: Metadata = serde_json::from_str(&contents).unwrap(); if meta.username.contains(&user_name.to_string()) { file_list.push_str(&file.split(".metadata").collect::<String>()); file_list.push('\n'); } } } let ciphertext = aead .encrypt(nonce, file_list.as_bytes()) .expect("encryption failure!"); HttpResponse::Ok().body(ciphertext) } #[actix_web::main] async fn main() -> std::io::Result<()> { println!("Le serveur est prêt à recevoir des requêtes"); use actix_web::{App, HttpServer}; HttpServer::new(|| { App::new() .service(username) .service(username_post) .service(get_code) .service(validate_code) .service(upload) .service(download) .service(get_list) }) .bind("127.0.0.1:8080")? .run() .await } // vérification double facteur pub fn verifiy_2fa(user_secret: &str, token: String) -> bool { let auth = GoogleAuthenticator::new(); if!auth.verify_code(user_secret, &token, 0, 0) { println!("Mauvais code."); return false; } true } // vérifie si le token existe et appartient au bon utilisateur fn check_token(req: &HttpRequest) -> bool { let token: &str = req.headers().get("Token").unwrap().to_str().unwrap(); let user: &str = req.headers().get("Username").unwrap().to_str().unwrap(); unsafe { for pair in USER_TOKEN.iter() { if pair.0 == user && pair.1 == token { return true; } } } return false; }
} };
random_line_split
main.rs
use crate::argon2id13::Salt; use actix_web::{get, post, web, HttpRequest, HttpResponse}; use aes_gcm::aead::{Aead, NewAead}; use aes_gcm::{Aes256Gcm, Key, Nonce}; use futures::StreamExt; use google_authenticator::{ErrorCorrectionLevel, GoogleAuthenticator}; use hmac::{Hmac, Mac, NewMac}; use lazy_static::lazy_static; use rand_core::{OsRng, RngCore}; use serde::{Deserialize, Serialize}; use serde_json; use sha2::Sha256; use sodiumoxide::crypto::pwhash::argon2id13; use std::collections::HashMap; use std::convert::TryInto; use std::env; use std::fs; use std::fs::File; use std::io::prelude::*; use std::str; use uuid::Uuid; static mut USER_TOKEN: Vec<(String, String)> = Vec::new(); static mut USER_CHALLENGE: Vec<(String, u64)> = Vec::new(); #[derive(Debug)] struct User { username: String, salt: Salt, password_kdf: [u8; 32], secret: String, } #[derive(Serialize, Deserialize, Debug)] struct UserChallenge { username: String, challenge: u64, salt: Salt, } #[derive(Serialize, Deserialize, Debug)] struct Metadata { file_name: String, username: Vec<String>, nonce: [u8; 12], key: Vec<u8>, } #[derive(Deserialize, Debug)] struct ComputedChallenge { challenge: [u8; 32], } lazy_static! { static ref USER_DB: HashMap<&'static str, User> = { let mut map = HashMap::new(); // configuration google authenticator let auth = GoogleAuthenticator::new(); // Cette partie se fait normalement sur le client mais elle est volontairement // mise sur le serveur pour simplifié l'architecture let salt = argon2id13::gen_salt(); let mut key = [0u8; 32]; argon2id13::derive_key( &mut key, "P@ssw0rd".as_bytes(), &salt, argon2id13::OPSLIMIT_SENSITIVE, argon2id13::MEMLIMIT_SENSITIVE, ) .unwrap(); map.insert( "jerome", User { username: "jerome".to_string(), salt: salt, password_kdf: key, secret: auth.create_secret(32), }, ); map }; } #[get("/server/{user_id}")] async fn username(web::Path(user_id): web::Path<String>) -> HttpResponse { // regarde si l'utilisateur est dans la DB, si oui on lui envoie un challenge à résoudre match USER_DB.get::<str>(&user_id.to_string()) { Some(username) => { let user_challenge = UserChallenge { username: user_id.to_string(), salt: username.salt, challenge: OsRng.next_u64(), }; unsafe { USER_CHALLENGE.push((user_id, user_challenge.challenge)); } HttpResponse::Ok().body(serde_json::to_string(&user_challenge).unwrap()) } None => HttpResponse::NotFound().finish(), } } #[post("/server/{user_id}")] // <- define path parameters async fn username_post( web::Path(user_id): web::Path<String>, mut body: web::Payload, ) -> HttpResponse { // check dans la DB si l'utilisateur est présent let user = match USER_DB.get::<str>(&user_id.to_string()) { Some(user) => user, None => { return HttpResponse::NotFound().finish(); } }; // lecture du body pour avoir le challenge envoyé let mut bytes = web::BytesMut::new(); while let Some(item) = body.next().await { let item = item.unwrap(); bytes.extend_from_slice(&item); } // on désérialise le challenge envoyé let computed_challenge: ComputedChallenge = serde_json::from_str(str::from_utf8(&bytes).unwrap()).unwrap(); // récupération du challenge envoyé au client let challenge_to_compute: u64; unsafe { let index = USER_CHALLENGE.iter().position(|x| x.0 == user_id).unwrap(); challenge_to_compute = USER_CHALLENGE.get(index).unwrap().1; USER_CHALLENGE.remove(index); } // Fait le mac à partir de la kdf dans la DB type HmacSha256 = Hmac<Sha256>; let mut mac = HmacSha256::new_varkey(&user.password_kdf).expect("HMAC Error"); mac.update(&challenge_to_compute.to_be_bytes()); let challenge: [u8; 32] = mac .finalize() .into_bytes() .as_slice() .try_into() .expect("Wrong length"); // on teste si les valeurs sont identiques if challenge == computed_challenge.challenge { return HttpResponse::Ok().finish(); } HttpResponse::NonAuthoritativeInformation().finish() } #[get("/2fa/{user_id}")] async fn get_code(web::Path(user_id): web::Path<String>) -> HttpResponse { // configuration google authenticator let auth = GoogleAuthenticator::new(); // check dans la DB si l'utilisateur est présent let user = match USER_DB.get::<str>(&user_id.to_string()) { Some(user) => user, None => { return HttpResponse::NotFound().finish(); } }; // création du code QR let url = auth.qr_code_url( &user.secret, "qr_code", "name", 200, 200, ErrorCorrectionLevel::High, ); HttpResponse::Ok().body(url) } #[post("/2fa/{user_id}")] async fn validate_code(web::Path(user_id): web::Path<String>, req: HttpRequest) -> HttpResponse { // configuration google authenticator let auth = GoogleAuthenticator::new(); // check dans la DB si l'utilisateur est présent let user = match USER_DB.get::<str>(&user_id.to_string()) { Some(user) => user, None => { return HttpResponse::NotFound().finish(); } }; // récupère le code dans le header let input_code: &str = req.headers().get("Code").unwrap().to_str().unwrap(); if!auth.verify_code(&user.secret, &input_code, 0, 0) { println!("Mauvais code."); return HttpResponse::Unauthorized().finish(); } // si ok, un token est envoyé à l'utilisateur pour les prochains échanges let user_token: String = Uuid::new_v4().hyphenated().to_string(); unsafe { USER_TOKEN.push((user_id, user_token.clone())); } HttpResponse::Ok().header("Token", user_token).finish() } #[post("/upload")] async fn upload(mut body: web
oad, req: HttpRequest) -> HttpResponse { // lire et vérifier le Token if!check_token(&req) { return HttpResponse::NonAuthoritativeInformation().finish(); } // lire le body let mut bytes = web::BytesMut::new(); while let Some(item) = body.next().await { let item = item.unwrap(); bytes.extend_from_slice(&item); } let res: Vec<u8> = bytes.to_vec(); // écriture des données dans un fichier let mut file = File::create(req.headers().get("filename").unwrap().to_str().unwrap()).unwrap(); file.write_all(&res).unwrap(); HttpResponse::Ok().finish() } #[get("/download")] async fn download(req: HttpRequest) -> HttpResponse { // lire et vérifier le Token let filename: &str = req.headers().get("FileName").unwrap().to_str().unwrap(); if!check_token(&req) { return HttpResponse::NonAuthoritativeInformation().finish(); } let work_file = env::current_dir().unwrap().join(&filename); // ouvrir et lire le fichier let mut file = match File::open(work_file) { Ok(result) => result, Err(_) => { return HttpResponse::NoContent().finish(); } }; let mut ciphertext: Vec<u8> = Vec::new(); file.read_to_end(&mut ciphertext).unwrap(); HttpResponse::Ok().body(ciphertext) } #[get("/list")] async fn get_list(req: HttpRequest) -> HttpResponse { // lire et vérifier le Token if!check_token(&req) { return HttpResponse::NonAuthoritativeInformation().finish(); } let user_name: &str = req.headers().get("Username").unwrap().to_str().unwrap(); // préparation des clés pour AES-GCM et du nonce let key_aes = Key::from_slice(b"an example very very secret key."); let aead = Aes256Gcm::new(key_aes); let nonce = Nonce::from_slice(b"unique nonce"); let mut file_list = String::new(); // on lit le contenu du répertoire let paths = fs::read_dir("./").unwrap(); for path in paths { let file = path.unwrap().path().into_os_string().into_string().unwrap(); // pour tous les fichiers est de type metadonnée if file.contains(".metadata") { let mut current_file = File::open(&file).expect("Unable to open the file"); let mut contents = String::new(); current_file .read_to_string(&mut contents) .expect("Unable to read the file"); let meta: Metadata = serde_json::from_str(&contents).unwrap(); if meta.username.contains(&user_name.to_string()) { file_list.push_str(&file.split(".metadata").collect::<String>()); file_list.push('\n'); } } } let ciphertext = aead .encrypt(nonce, file_list.as_bytes()) .expect("encryption failure!"); HttpResponse::Ok().body(ciphertext) } #[actix_web::main] async fn main() -> std::io::Result<()> { println!("Le serveur est prêt à recevoir des requêtes"); use actix_web::{App, HttpServer}; HttpServer::new(|| { App::new() .service(username) .service(username_post) .service(get_code) .service(validate_code) .service(upload) .service(download) .service(get_list) }) .bind("127.0.0.1:8080")? .run() .await } // vérification double facteur pub fn verifiy_2fa(user_secret: &str, token: String) -> bool { let auth = GoogleAuthenticator::new(); if!auth.verify_code(user_secret, &token, 0, 0) { println!("Mauvais code."); return false; } true } // vérifie si le token existe et appartient au bon utilisateur fn check_token(req: &HttpRequest) -> bool { let token: &str = req.headers().get("Token").unwrap().to_str().unwrap(); let user: &str = req.headers().get("Username").unwrap().to_str().unwrap(); unsafe { for pair in USER_TOKEN.iter() { if pair.0 == user && pair.1 == token { return true; } } } return false; }
::Payl
identifier_name
main.rs
use crate::argon2id13::Salt; use actix_web::{get, post, web, HttpRequest, HttpResponse}; use aes_gcm::aead::{Aead, NewAead}; use aes_gcm::{Aes256Gcm, Key, Nonce}; use futures::StreamExt; use google_authenticator::{ErrorCorrectionLevel, GoogleAuthenticator}; use hmac::{Hmac, Mac, NewMac}; use lazy_static::lazy_static; use rand_core::{OsRng, RngCore}; use serde::{Deserialize, Serialize}; use serde_json; use sha2::Sha256; use sodiumoxide::crypto::pwhash::argon2id13; use std::collections::HashMap; use std::convert::TryInto; use std::env; use std::fs; use std::fs::File; use std::io::prelude::*; use std::str; use uuid::Uuid; static mut USER_TOKEN: Vec<(String, String)> = Vec::new(); static mut USER_CHALLENGE: Vec<(String, u64)> = Vec::new(); #[derive(Debug)] struct User { username: String, salt: Salt, password_kdf: [u8; 32], secret: String, } #[derive(Serialize, Deserialize, Debug)] struct UserChallenge { username: String, challenge: u64, salt: Salt, } #[derive(Serialize, Deserialize, Debug)] struct Metadata { file_name: String, username: Vec<String>, nonce: [u8; 12], key: Vec<u8>, } #[derive(Deserialize, Debug)] struct ComputedChallenge { challenge: [u8; 32], } lazy_static! { static ref USER_DB: HashMap<&'static str, User> = { let mut map = HashMap::new(); // configuration google authenticator let auth = GoogleAuthenticator::new(); // Cette partie se fait normalement sur le client mais elle est volontairement // mise sur le serveur pour simplifié l'architecture let salt = argon2id13::gen_salt(); let mut key = [0u8; 32]; argon2id13::derive_key( &mut key, "P@ssw0rd".as_bytes(), &salt, argon2id13::OPSLIMIT_SENSITIVE, argon2id13::MEMLIMIT_SENSITIVE, ) .unwrap(); map.insert( "jerome", User { username: "jerome".to_string(), salt: salt, password_kdf: key, secret: auth.create_secret(32), }, ); map }; } #[get("/server/{user_id}")] async fn username(web::Path(user_id): web::Path<String>) -> HttpResponse { // regarde si l'utilisateur est dans la DB, si oui on lui envoie un challenge à résoudre match USER_DB.get::<str>(&user_id.to_string()) { Some(username) => { let user_challenge = UserChallenge { username: user_id.to_string(), salt: username.salt, challenge: OsRng.next_u64(), }; unsafe { USER_CHALLENGE.push((user_id, user_challenge.challenge)); } HttpResponse::Ok().body(serde_json::to_string(&user_challenge).unwrap()) } None => HttpResponse::NotFound().finish(), } } #[post("/server/{user_id}")] // <- define path parameters async fn username_post( web::Path(user_id): web::Path<String>, mut body: web::Payload, ) -> HttpResponse { // check dans la DB si l'utilisateur est présent let user = match USER_DB.get::<str>(&user_id.to_string()) { Some(user) => user, None => { return HttpResponse::NotFound().finish(); } }; // lecture du body pour avoir le challenge envoyé let mut bytes = web::BytesMut::new(); while let Some(item) = body.next().await { let item = item.unwrap(); bytes.extend_from_slice(&item); } // on désérialise le challenge envoyé let computed_challenge: ComputedChallenge = serde_json::from_str(str::from_utf8(&bytes).unwrap()).unwrap(); // récupération du challenge envoyé au client let challenge_to_compute: u64; unsafe { let index = USER_CHALLENGE.iter().position(|x| x.0 == user_id).unwrap(); challenge_to_compute = USER_CHALLENGE.get(index).unwrap().1; USER_CHALLENGE.remove(index); } // Fait le mac à partir de la kdf dans la DB type HmacSha256 = Hmac<Sha256>; let mut mac = HmacSha256::new_varkey(&user.password_kdf).expect("HMAC Error"); mac.update(&challenge_to_compute.to_be_bytes()); let challenge: [u8; 32] = mac .finalize() .into_bytes() .as_slice() .try_into() .expect("Wrong length"); // on teste si les valeurs sont identiques if challenge == computed_challenge.challenge { return HttpResponse::Ok().finish(); } HttpResponse::NonAuthoritativeInformation().finish() } #[get("/2fa/{user_id}")] async fn get_code(web::Path(user_id): web::Path<String>) -> HttpResponse { // configuration google authenticator let auth = GoogleAuthenticator::new(); // check dans la DB si l'utilisateur est présent let user = match USER_DB.get::<str>(&user_id.to_string()) { Some(user) => user, None => { return HttpResponse::NotFound().finish(); } }; // création du code QR let url = auth.qr_code_url( &user.secret, "qr_code", "name", 200, 200, ErrorCorrectionLevel::High, ); HttpResponse::Ok().body(url) } #[post("/2fa/{user_id}")] async fn validate_code(web::Path(user_id): web::Path<String>, req: HttpRequest) -> HttpResponse { // configuration google authenticator let auth = GoogleAuthenticator::new(); // check dans la DB si l'utilisateur est présent let user = match USER_DB.get::<str>(&user_id.to_string()) { Some(user) => user, None => { return HttpResponse::NotFound().finish(); } }; // récupère le code dans le header let input_code: &str = req.headers().get("Code").unwrap().to_str().unwrap(); if!auth.verify_code(&user.secret, &input_code, 0, 0) { println!("Mauvais code."); return HttpResponse::Unauthorized().finish(); } // si ok, un token est envoyé à l'utilisateur pour les prochains échanges let user_token: String = Uuid::new_v4().hyphenated().to_string(); unsafe { USER_TOKEN.push((user_id, user_token.clone())); } HttpResponse::Ok().header("Token", user_token).finish() } #[post("/upload")] async fn upload(mut body: web::Payload, req: HttpRequest) -> HttpResponse { // lire et vérifier le Token if!check_token(&req) { return HttpResponse::NonAuthoritativeInformation().finish(); } // lire le body let mut bytes = web::BytesMut::new(); while let Some(item) = body.next().await { let item = item.unwrap(); bytes.extend_from_slice(&item); } let res: Vec<u8> = bytes.to_vec(); // écriture des données dans un fichier let mut file = File::create(req.headers().get("filename").unwrap().to_str().unwrap()).unwrap(); file.write_all(&res).unwrap(); HttpResponse::Ok().finish() } #[get("/download")] async fn download(req: HttpRequest) -> HttpResponse { // lire et vérifier le Token let filename: &str = req.headers().get("FileName").unwrap().to_str().unwrap(); if!check_token(&req) { return HttpResponse::NonAuthoritativeInformation().finish(); } let work_file = env::current_dir().unwrap().join(&filename); // ouvrir et lire le fichier let mut file = match File::open(work_file) { Ok(result) => result, Err(_) => { return HttpResponse::NoContent().finish(); } }; let mut ciphertext: Vec<u8> = Vec::new(); file.read_to_end(&mut ciphertext).unwrap(); HttpResponse::Ok().body(ciphertext) } #[get("/list")] async fn get_list(req: HttpRequest) -> HttpResponse { // lire et vérifier le Token if!check_token(&req) { return HttpResponse::NonAuthoritativeInformation().finish(); } let user_name: &str = req.headers().get("Username").unwrap().to_str().unwrap(); // préparation des clés pour AES-GCM et du nonce let key_aes = Key::from_slice(b"an example very very secret key."); let aead = Aes256Gcm::new(key_aes); let nonce = Nonce::from_slice(b"unique nonce"); let mut file_list = String::new(); // on lit le contenu du répertoire let paths = fs::read_dir("./").unwrap(); for path in paths { let file = path.unwrap().path().into_os_string().into_string().unwrap(); // pour tous les fichiers est de type metadonnée if file.contains(".metadata") { let mut current_file = File::open(&file).expect("Unable to open the file"); let mut contents = String::new(); current_file .read_to_string(&mut contents) .expect("Unable to read the file"); let meta: Metadata = serde_json::from_str(&contents).unwrap(); if meta.username.contains(&user_name.to_string()) { file_list.push_str(&file.split(".metadata").collect::<String>()); file_list.push('\n'); } } } let ciphertext = aead .encrypt(nonce, file_list.as_bytes()) .expect("encryption failure!"); HttpResponse::Ok().body(ciphertext) } #[actix_web::main] async fn main() -> std::io::Result<()> { println!("Le serveur est prêt à recevoir des requêtes"); use actix_web::{App, HttpServer}; HttpServer::new(|| { App::new() .service(username) .service(username_post) .service(get_code) .service(validate_code) .service(upload) .service(download) .service(get_list) }) .bind("127.0.0.1:8080")? .run() .await } // vérification double facteur pub fn verifiy_2fa(user_secret: &str, token: String) -> bool { let auth = GoogleAuthenticator::new(); if!auth.verify_code(user_secret, &token, 0, 0) { println!("Mauvais code."); return false; } true } // vérifie si le token existe et appartient au bon utilisateur fn check_token(req: &HttpRequest) -> bool { let token: &str = req.headers().get("Token").unwrap().to_str().unwrap(); let user: &str = req.headers().get("Username").unwrap().to_str().unwrap(); unsafe { for pair in USER_TOKEN.iter() { if pair.0 == user && pair.1 == token { return true;
}
} } } return false;
conditional_block
main.rs
use crate::argon2id13::Salt; use actix_web::{get, post, web, HttpRequest, HttpResponse}; use aes_gcm::aead::{Aead, NewAead}; use aes_gcm::{Aes256Gcm, Key, Nonce}; use futures::StreamExt; use google_authenticator::{ErrorCorrectionLevel, GoogleAuthenticator}; use hmac::{Hmac, Mac, NewMac}; use lazy_static::lazy_static; use rand_core::{OsRng, RngCore}; use serde::{Deserialize, Serialize}; use serde_json; use sha2::Sha256; use sodiumoxide::crypto::pwhash::argon2id13; use std::collections::HashMap; use std::convert::TryInto; use std::env; use std::fs; use std::fs::File; use std::io::prelude::*; use std::str; use uuid::Uuid; static mut USER_TOKEN: Vec<(String, String)> = Vec::new(); static mut USER_CHALLENGE: Vec<(String, u64)> = Vec::new(); #[derive(Debug)] struct User { username: String, salt: Salt, password_kdf: [u8; 32], secret: String, } #[derive(Serialize, Deserialize, Debug)] struct UserChallenge { username: String, challenge: u64, salt: Salt, } #[derive(Serialize, Deserialize, Debug)] struct Metadata { file_name: String, username: Vec<String>, nonce: [u8; 12], key: Vec<u8>, } #[derive(Deserialize, Debug)] struct ComputedChallenge { challenge: [u8; 32], } lazy_static! { static ref USER_DB: HashMap<&'static str, User> = { let mut map = HashMap::new(); // configuration google authenticator let auth = GoogleAuthenticator::new(); // Cette partie se fait normalement sur le client mais elle est volontairement // mise sur le serveur pour simplifié l'architecture let salt = argon2id13::gen_salt(); let mut key = [0u8; 32]; argon2id13::derive_key( &mut key, "P@ssw0rd".as_bytes(), &salt, argon2id13::OPSLIMIT_SENSITIVE, argon2id13::MEMLIMIT_SENSITIVE, ) .unwrap(); map.insert( "jerome", User { username: "jerome".to_string(), salt: salt, password_kdf: key, secret: auth.create_secret(32), }, ); map }; } #[get("/server/{user_id}")] async fn username(web::Path(user_id): web::Path<String>) -> HttpResponse { // regarde si l'utilisateur est dans la DB, si oui on lui envoie un challenge à résoudre match USER_DB.get::<str>(&user_id.to_string()) { Some(username) => { let user_challenge = UserChallenge { username: user_id.to_string(), salt: username.salt, challenge: OsRng.next_u64(), }; unsafe { USER_CHALLENGE.push((user_id, user_challenge.challenge)); } HttpResponse::Ok().body(serde_json::to_string(&user_challenge).unwrap()) } None => HttpResponse::NotFound().finish(), } } #[post("/server/{user_id}")] // <- define path parameters async fn username_post( web::Path(user_id): web::Path<String>, mut body: web::Payload, ) -> HttpResponse { // check dans la DB si l'utilisateur est présent let user = match USER_DB.get::<str>(&user_id.to_string()) { Some(user) => user, None => { return HttpResponse::NotFound().finish(); } }; // lecture du body pour avoir le challenge envoyé let mut bytes = web::BytesMut::new(); while let Some(item) = body.next().await { let item = item.unwrap(); bytes.extend_from_slice(&item); } // on désérialise le challenge envoyé let computed_challenge: ComputedChallenge = serde_json::from_str(str::from_utf8(&bytes).unwrap()).unwrap(); // récupération du challenge envoyé au client let challenge_to_compute: u64; unsafe { let index = USER_CHALLENGE.iter().position(|x| x.0 == user_id).unwrap(); challenge_to_compute = USER_CHALLENGE.get(index).unwrap().1; USER_CHALLENGE.remove(index); } // Fait le mac à partir de la kdf dans la DB type HmacSha256 = Hmac<Sha256>; let mut mac = HmacSha256::new_varkey(&user.password_kdf).expect("HMAC Error"); mac.update(&challenge_to_compute.to_be_bytes()); let challenge: [u8; 32] = mac .finalize() .into_bytes() .as_slice() .try_into() .expect("Wrong length"); // on teste si les valeurs sont identiques if challenge == computed_challenge.challenge { return HttpResponse::Ok().finish(); } HttpResponse::NonAuthoritativeInformation().finish() } #[get("/2fa/{user_id}")] async fn get_code(web::Path(user_id): web::Path<String>) -> HttpResponse { // configuration google authenticator let auth = GoogleAuthenticator::new(); // check dans la DB si l'utilisateur est présent let user = match USER_DB.get::<str>(&user_id.to_string()) { Some(user) => user, None => { return HttpResponse::NotFound().finish(); } }; // création du code QR let url = auth.qr_code_url( &user.secret, "qr_code", "name", 200, 200, ErrorCorrectionLevel::High, ); HttpResponse::Ok().body(url) } #[post("/2fa/{user_id}")] async fn validate_code(web::Path(user_id): web::Path<String>, req: HttpRequest) -> HttpResponse { // configuration google authenticator let auth = GoogleAuthenticator::new(); // check dans la DB si l'utilisateur est présent let user = match USER_DB.get::<str>(&user_id.to_string()) { Some(user) => user, None => { return HttpResponse::NotFound().finish(); } }; // récupère le code dans le header let input_code: &str = req.headers().get("Code").unwrap().to_str().unwrap(); if!auth.verify_code(&user.secret, &input_code, 0, 0) { println!("Mauvais code."); return HttpResponse::Unauthorized().finish(); } // si ok, un token est envoyé à l'utilisateur pour les prochains échanges let user_token: String = Uuid::new_v4().hyphenated().to_string(); unsafe { USER_TOKEN.push((user_id, user_token.clone())); } HttpResponse::Ok().header("Token", user_token).finish() } #[post("/upload")] async fn upload(mut body: web::Payload, req: HttpRequest) -> HttpResponse { // lire et vérifier le Token if!check_token(&req) { return HttpResponse::NonAuthoritativeInformation().finish(); } // lire le body let mut bytes = web::BytesMut::new(); while let Some(item) = body.next().await { let item = item.unwrap(); bytes.extend_from_slice(&item); } let res: Vec<u8> = bytes.to_vec(); // écriture des données dans un fichier let mut file = File::create(req.headers().get("filename").unwrap().to_str().unwrap()).unwrap(); file.write_all(&res).unwrap(); HttpResponse::Ok().finish() } #[get("/download")] async fn download(req: HttpRequest) -> HttpResponse { // lire et vérifier le Token let filename: &str = req.headers().get("FileName").unwrap().to_str().unwrap(); if!check_token(&req) { return HttpResponse::NonAuthoritativeInformation().finish(); } let work_file = env::current_dir().unwrap().join(&filename); // ouvrir et lire le fichier let mut file = match File::open(work_file) { Ok(result) => result, Err(_) => { return HttpResponse::NoContent().finish(); } }; let mut ciphertext: Vec<u8> = Vec::new(); file.read_to_end(&mut ciphertext).unwrap(); HttpResponse::Ok().body(ciphertext) } #[get("/list")] async fn get_list(req: HttpRequest) -> HttpResponse { // lire et vérifie
let mut contents = String::new(); current_file .read_to_string(&mut contents) .expect("Unable to read the file"); let meta: Metadata = serde_json::from_str(&contents).unwrap(); if meta.username.contains(&user_name.to_string()) { file_list.push_str(&file.split(".metadata").collect::<String>()); file_list.push('\n'); } } } let ciphertext = aead .encrypt(nonce, file_list.as_bytes()) .expect("encryption failure!"); HttpResponse::Ok().body(ciphertext) } #[actix_web::main] async fn main() -> std::io::Result<()> { println!("Le serveur est prêt à recevoir des requêtes"); use actix_web::{App, HttpServer}; HttpServer::new(|| { App::new() .service(username) .service(username_post) .service(get_code) .service(validate_code) .service(upload) .service(download) .service(get_list) }) .bind("127.0.0.1:8080")? .run() .await } // vérification double facteur pub fn verifiy_2fa(user_secret: &str, token: String) -> bool { let auth = GoogleAuthenticator::new(); if!auth.verify_code(user_secret, &token, 0, 0) { println!("Mauvais code."); return false; } true } // vérifie si le token existe et appartient au bon utilisateur fn check_token(req: &HttpRequest) -> bool { let token: &str = req.headers().get("Token").unwrap().to_str().unwrap(); let user: &str = req.headers().get("Username").unwrap().to_str().unwrap(); unsafe { for pair in USER_TOKEN.iter() { if pair.0 == user && pair.1 == token { return true; } } } return false; }
r le Token if !check_token(&req) { return HttpResponse::NonAuthoritativeInformation().finish(); } let user_name: &str = req.headers().get("Username").unwrap().to_str().unwrap(); // préparation des clés pour AES-GCM et du nonce let key_aes = Key::from_slice(b"an example very very secret key."); let aead = Aes256Gcm::new(key_aes); let nonce = Nonce::from_slice(b"unique nonce"); let mut file_list = String::new(); // on lit le contenu du répertoire let paths = fs::read_dir("./").unwrap(); for path in paths { let file = path.unwrap().path().into_os_string().into_string().unwrap(); // pour tous les fichiers est de type metadonnée if file.contains(".metadata") { let mut current_file = File::open(&file).expect("Unable to open the file");
identifier_body
lib.register_lints.rs
will be overwritten. store.register_lints(&[ #[cfg(feature = "internal")] utils::internal_lints::CLIPPY_LINTS_INTERNAL, #[cfg(feature = "internal")] utils::internal_lints::COLLAPSIBLE_SPAN_LINT_CALLS, #[cfg(feature = "internal")] utils::internal_lints::COMPILER_LINT_FUNCTIONS, #[cfg(feature = "internal")] utils::internal_lints::DEFAULT_LINT, #[cfg(feature = "internal")] utils::internal_lints::IF_CHAIN_STYLE, #[cfg(feature = "internal")] utils::internal_lints::INTERNING_DEFINED_SYMBOL, #[cfg(feature = "internal")] utils::internal_lints::INVALID_CLIPPY_VERSION_ATTRIBUTE, #[cfg(feature = "internal")] utils::internal_lints::INVALID_PATHS, #[cfg(feature = "internal")] utils::internal_lints::LINT_WITHOUT_LINT_PASS, #[cfg(feature = "internal")] utils::internal_lints::MATCH_TYPE_ON_DIAGNOSTIC_ITEM, #[cfg(feature = "internal")] utils::internal_lints::MISSING_CLIPPY_VERSION_ATTRIBUTE, #[cfg(feature = "internal")] utils::internal_lints::MISSING_MSRV_ATTR_IMPL, #[cfg(feature = "internal")] utils::internal_lints::OUTER_EXPN_EXPN_DATA, #[cfg(feature = "internal")] utils::internal_lints::PRODUCE_ICE, #[cfg(feature = "internal")] utils::internal_lints::UNNECESSARY_SYMBOL_STR, absurd_extreme_comparisons::ABSURD_EXTREME_COMPARISONS, approx_const::APPROX_CONSTANT, arithmetic::FLOAT_ARITHMETIC, arithmetic::INTEGER_ARITHMETIC, as_conversions::AS_CONVERSIONS, asm_syntax::INLINE_ASM_X86_ATT_SYNTAX, asm_syntax::INLINE_ASM_X86_INTEL_SYNTAX, assertions_on_constants::ASSERTIONS_ON_CONSTANTS, assign_ops::ASSIGN_OP_PATTERN, assign_ops::MISREFACTORED_ASSIGN_OP, async_yields_async::ASYNC_YIELDS_ASYNC, attrs::ALLOW_ATTRIBUTES_WITHOUT_REASON, attrs::BLANKET_CLIPPY_RESTRICTION_LINTS, attrs::DEPRECATED_CFG_ATTR, attrs::DEPRECATED_SEMVER, attrs::EMPTY_LINE_AFTER_OUTER_ATTR, attrs::INLINE_ALWAYS, attrs::MISMATCHED_TARGET_OS, attrs::USELESS_ATTRIBUTE, await_holding_invalid::AWAIT_HOLDING_LOCK, await_holding_invalid::AWAIT_HOLDING_REFCELL_REF, bit_mask::BAD_BIT_MASK, bit_mask::INEFFECTIVE_BIT_MASK, bit_mask::VERBOSE_BIT_MASK, blacklisted_name::BLACKLISTED_NAME, blocks_in_if_conditions::BLOCKS_IN_IF_CONDITIONS, bool_assert_comparison::BOOL_ASSERT_COMPARISON, booleans::LOGIC_BUG, booleans::NONMINIMAL_BOOL, borrow_as_ptr::BORROW_AS_PTR, bytecount::NAIVE_BYTECOUNT, cargo::CARGO_COMMON_METADATA, cargo::MULTIPLE_CRATE_VERSIONS, cargo::NEGATIVE_FEATURE_NAMES, cargo::REDUNDANT_FEATURE_NAMES, cargo::WILDCARD_DEPENDENCIES, case_sensitive_file_extension_comparisons::CASE_SENSITIVE_FILE_EXTENSION_COMPARISONS, casts::CAST_ENUM_CONSTRUCTOR, casts::CAST_ENUM_TRUNCATION, casts::CAST_LOSSLESS, casts::CAST_POSSIBLE_TRUNCATION, casts::CAST_POSSIBLE_WRAP, casts::CAST_PRECISION_LOSS, casts::CAST_PTR_ALIGNMENT, casts::CAST_REF_TO_MUT, casts::CAST_SIGN_LOSS, casts::CAST_SLICE_DIFFERENT_SIZES, casts::CHAR_LIT_AS_U8, casts::FN_TO_NUMERIC_CAST, casts::FN_TO_NUMERIC_CAST_ANY, casts::FN_TO_NUMERIC_CAST_WITH_TRUNCATION, casts::PTR_AS_PTR, casts::UNNECESSARY_CAST, checked_conversions::CHECKED_CONVERSIONS, cognitive_complexity::COGNITIVE_COMPLEXITY,
comparison_chain::COMPARISON_CHAIN, copies::BRANCHES_SHARING_CODE, copies::IFS_SAME_COND, copies::IF_SAME_THEN_ELSE, copies::SAME_FUNCTIONS_IN_IF_CONDITION, copy_iterator::COPY_ITERATOR, create_dir::CREATE_DIR, dbg_macro::DBG_MACRO, default::DEFAULT_TRAIT_ACCESS, default::FIELD_REASSIGN_WITH_DEFAULT, default_numeric_fallback::DEFAULT_NUMERIC_FALLBACK, default_union_representation::DEFAULT_UNION_REPRESENTATION, dereference::EXPLICIT_DEREF_METHODS, dereference::NEEDLESS_BORROW, dereference::REF_BINDING_TO_REFERENCE, derivable_impls::DERIVABLE_IMPLS, derive::DERIVE_HASH_XOR_EQ, derive::DERIVE_ORD_XOR_PARTIAL_ORD, derive::EXPL_IMPL_CLONE_ON_COPY, derive::UNSAFE_DERIVE_DESERIALIZE, disallowed_methods::DISALLOWED_METHODS, disallowed_script_idents::DISALLOWED_SCRIPT_IDENTS, disallowed_types::DISALLOWED_TYPES, doc::DOC_MARKDOWN, doc::MISSING_ERRORS_DOC, doc::MISSING_PANICS_DOC, doc::MISSING_SAFETY_DOC, doc::NEEDLESS_DOCTEST_MAIN, double_comparison::DOUBLE_COMPARISONS, double_parens::DOUBLE_PARENS, drop_forget_ref::DROP_COPY, drop_forget_ref::DROP_REF, drop_forget_ref::FORGET_COPY, drop_forget_ref::FORGET_REF, duration_subsec::DURATION_SUBSEC, else_if_without_else::ELSE_IF_WITHOUT_ELSE, empty_enum::EMPTY_ENUM, entry::MAP_ENTRY, enum_clike::ENUM_CLIKE_UNPORTABLE_VARIANT, enum_variants::ENUM_VARIANT_NAMES, enum_variants::MODULE_INCEPTION, enum_variants::MODULE_NAME_REPETITIONS, eq_op::EQ_OP, eq_op::OP_REF, equatable_if_let::EQUATABLE_IF_LET, erasing_op::ERASING_OP, escape::BOXED_LOCAL, eta_reduction::REDUNDANT_CLOSURE, eta_reduction::REDUNDANT_CLOSURE_FOR_METHOD_CALLS, eval_order_dependence::DIVERGING_SUB_EXPRESSION, eval_order_dependence::EVAL_ORDER_DEPENDENCE, excessive_bools::FN_PARAMS_EXCESSIVE_BOOLS, excessive_bools::STRUCT_EXCESSIVE_BOOLS, exhaustive_items::EXHAUSTIVE_ENUMS, exhaustive_items::EXHAUSTIVE_STRUCTS, exit::EXIT, explicit_write::EXPLICIT_WRITE, fallible_impl_from::FALLIBLE_IMPL_FROM, float_equality_without_abs::FLOAT_EQUALITY_WITHOUT_ABS, float_literal::EXCESSIVE_PRECISION, float_literal::LOSSY_FLOAT_LITERAL, floating_point_arithmetic::IMPRECISE_FLOPS, floating_point_arithmetic::SUBOPTIMAL_FLOPS, format::USELESS_FORMAT, format_args::FORMAT_IN_FORMAT_ARGS, format_args::TO_STRING_IN_FORMAT_ARGS, format_impl::PRINT_IN_FORMAT_IMPL, format_impl::RECURSIVE_FORMAT_IMPL, formatting::POSSIBLE_MISSING_COMMA, formatting::SUSPICIOUS_ASSIGNMENT_FORMATTING, formatting::SUSPICIOUS_ELSE_FORMATTING, formatting::SUSPICIOUS_UNARY_OP_FORMATTING, from_over_into::FROM_OVER_INTO, from_str_radix_10::FROM_STR_RADIX_10, functions::DOUBLE_MUST_USE, functions::MUST_USE_CANDIDATE, functions::MUST_USE_UNIT, functions::NOT_UNSAFE_PTR_ARG_DEREF, functions::RESULT_UNIT_ERR, functions::TOO_MANY_ARGUMENTS, functions::TOO_MANY_LINES, future_not_send::FUTURE_NOT_SEND, get_last_with_len::GET_LAST_WITH_LEN, identity_op::IDENTITY_OP, if_let_mutex::IF_LET_MUTEX, if_not_else::IF_NOT_ELSE, if_then_some_else_none::IF_THEN_SOME_ELSE_NONE, implicit_hasher::IMPLICIT_HASHER, implicit_return::IMPLICIT_RETURN, implicit_saturating_sub::IMPLICIT_SATURATING_SUB, inconsistent_struct_constructor::INCONSISTENT_STRUCT_CONSTRUCTOR, index_refutable_slice::INDEX_REFUTABLE_SLICE, indexing_slicing::INDEXING_SLICING, indexing_slicing::OUT_OF_BOUNDS_INDEXING, infinite_iter::INFINITE_ITER, infinite_iter::MAYBE_INFINITE_ITER, inherent_impl::MULTIPLE_INHERENT_IMPL, inherent_to_string::INHERENT_TO_STRING, inherent_to_string::INHERENT_TO_STRING_SHADOW_DISPLAY, init_numbered_fields::INIT_NUMBERED_FIELDS, inline_fn_without_body::INLINE_FN_WITHOUT_BODY, int_plus_one::INT_PLUS_ONE, integer_division::INTEGER_DIVISION, invalid_upcast_comparisons::INVALID_UPCAST_COMPARISONS, items_after_statements::ITEMS_AFTER_STATEMENTS, iter_not_returning_iterator::ITER_NOT_RETURNING_ITERATOR, large_const_arrays::LARGE_CONST_ARRAYS, large_enum_variant::LARGE_ENUM_VARIANT, large_stack_arrays::LARGE_STACK_ARRAYS, len_zero::COMPARISON_TO_EMPTY, len_zero::LEN_WITHOUT_IS_EMPTY, len_zero::LEN_ZERO, let_if_seq::USELESS_LET_IF_SEQ, let_underscore::LET_UNDERSCORE_DROP, let_underscore::LET_UNDERSCORE_LOCK, let_underscore::LET_UNDERSCORE_MUST_USE, lifetimes::EXTRA_UNUSED_LIFETIMES, lifetimes::NEEDLESS_LIFETIMES, literal_representation::DECIMAL_LITERAL_REPRESENTATION, literal_representation::INCONSISTENT_DIGIT_GROUPING, literal_representation::LARGE_DIGIT_GROUPS, literal_representation::MISTYPED_LITERAL_SUFFIXES, literal_representation::UNREADABLE_LITERAL, literal_representation::UNUSUAL_BYTE_GROUPINGS, loops::EMPTY_LOOP, loops::EXPLICIT_COUNTER_LOOP, loops::EXPLICIT_INTO_ITER_LOOP, loops::EXPLICIT_ITER_LOOP, loops::FOR_KV_MAP, loops::FOR_LOOPS_OVER_FALLIBLES, loops::ITER_NEXT_LOOP, loops::MANUAL_FLATTEN, loops::MANUAL_MEMCPY, loops::MISSING_SPIN_LOOP, loops::MUT_RANGE_BOUND, loops::NEEDLESS_COLLECT, loops::NEEDLESS_RANGE_LOOP, loops::NEVER_LOOP, loops::SAME_ITEM_PUSH, loops::SINGLE_ELEMENT_LOOP, loops::WHILE_IMMUTABLE_CONDITION, loops::WHILE_LET_LOOP, loops::WHILE_LET_ON_ITERATOR, macro_use::MACRO_USE_IMPORTS, main_recursion::MAIN_RECURSION, manual_assert::MANUAL_ASSERT, manual_async_fn::MANUAL_ASYNC_FN, manual_bits::MANUAL_BITS, manual_map::MANUAL_MAP, manual_non_exhaustive::MANUAL_NON_EXHAUSTIVE, manual_ok_or::MANUAL_OK_OR, manual_strip::MANUAL_STRIP, manual_unwrap_or::MANUAL_UNWRAP_OR, map_clone::MAP_CLONE, map_err_ignore::MAP_ERR_IGNORE, map_unit_fn::OPTION_MAP_UNIT_FN, map_unit_fn::RESULT_MAP_UNIT_FN, match_on_vec_items::MATCH_ON_VEC_ITEMS, match_result_ok::MATCH_RESULT_OK, match_str_case_mismatch::MATCH_STR_CASE_MISMATCH, matches::INFALLIBLE_DESTRUCTURING_MATCH, matches::MATCH_AS_REF, matches::MATCH_BOOL, matches::MATCH_LIKE_MATCHES_MACRO, matches::MATCH_OVERLAPPING_ARM, matches::MATCH_REF_PATS, matches::MATCH_SAME_ARMS, matches::MATCH_SINGLE_BINDING, matches::MATCH_WILDCARD_FOR_SINGLE_VARIANTS, matches::MATCH_WILD_ERR_ARM, matches::NEEDLESS_MATCH, matches::REDUNDANT_PATTERN_MATCHING, matches::REST_PAT_IN_FULLY_BOUND_STRUCTS, matches::SINGLE_MATCH, matches::SINGLE_MATCH_ELSE, matches::WILDCARD_ENUM_MATCH_ARM, matches::WILDCARD_IN_OR_PATTERNS, mem_forget::MEM_FORGET, mem_replace::MEM_REPLACE_OPTION_WITH_NONE, mem_replace::MEM_REPLACE_WITH_DEFAULT, mem_replace::MEM_REPLACE_WITH_UNINIT, methods::BIND_INSTEAD_OF_MAP, methods::BYTES_NTH, methods::CHARS_LAST_CMP, methods::CHARS_NEXT_CMP, methods::CLONED_INSTEAD_OF_COPIED, methods::CLONE_DOUBLE_REF, methods::CLONE_ON_COPY, methods::CLONE_ON_REF_PTR, methods::EXPECT_FUN_CALL, methods::EXPECT_USED, methods::EXTEND_WITH_DRAIN, methods::FILETYPE_IS_FILE, methods::FILTER_MAP_IDENTITY, methods::FILTER_MAP_NEXT, methods::FILTER_NEXT, methods::FLAT_MAP_IDENTITY, methods::FLAT_MAP_OPTION, methods::FROM_ITER_INSTEAD_OF_COLLECT, methods::GET_UNWRAP, methods::IMPLICIT_CLONE, methods::INEFFICIENT_TO_STRING, methods::INSPECT_FOR_EACH, methods::INTO_ITER_ON_REF, methods::ITERATOR_STEP_BY_ZERO, methods::ITER_CLONED_COLLECT, methods::ITER_COUNT, methods::ITER_NEXT_SLICE, methods::ITER_NTH, methods::ITER_NTH_ZERO, methods::ITER_OVEREAGER_CLONED, methods::ITER_SKIP_NEXT, methods::ITER_WITH_DRAIN, methods::MANUAL_FILTER_MAP, methods::MANUAL_FIND_MAP, methods::MANUAL_SATURATING_ARITHMETIC, methods::MANUAL_SPLIT_ONCE, methods::MANUAL_STR_REPEAT, methods::MAP_COLLECT_RESULT_UNIT, methods::MAP_FLATTEN, methods::MAP_IDENTITY, methods::MAP_UNWRAP_OR, methods::NEEDLESS_SPLITN, methods::NEW_RET_NO_SELF, methods::OK_EXPECT, methods::OPTION_AS_REF_DEREF, methods::OPTION_FILTER_MAP, methods::OPTION_MAP_OR_NONE, methods::OR_FUN_CALL, methods::OR_THEN_UNWRAP, methods::RESULT_MAP_OR_INTO_OPTION, methods::SEARCH_IS_SOME, methods::SHOULD_IMPLEMENT_TRAIT, methods::SINGLE_CHAR_ADD_STR, methods::SINGLE_CHAR_PATTERN, methods::SKIP_WHILE_NEXT, methods::STRING_EXTEND_CHARS, methods::SUSPICIOUS_MAP, methods::SUSPICIOUS_SPLITN, methods::UNINIT_ASSUMED_INIT, methods::UNNECESSARY_FILTER_MAP, methods::UNNECESSARY_FIND_MAP, methods::UNNECESSARY_FOLD, methods::UNNECESSARY_LAZY_EVALUATIONS, methods::UNNECESSARY_TO_OWNED, methods::UNWRAP_OR_ELSE_DEFAULT, methods::UNWRAP_USED, methods::USELESS_ASREF, methods::WRONG_SELF_CONVENTION, methods::ZST_OFFSET, minmax::MIN_MAX, misc::CMP_NAN, misc::CMP_OWNED, misc::FLOAT_CMP, misc::FLOAT_CMP_CONST, misc::MODULO_ONE, misc::SHORT_CIRCUIT_STATEMENT, misc::TOPLEVEL_REF_ARG, misc::USED_UNDERSCORE_BINDING, misc::ZERO_PTR, misc_early::BUILTIN_TYPE_SHADOW, misc_early::DOUBLE_NEG, misc_early::DUPLICATE_UNDERSCORE_ARGUMENT, misc_early::MIXED_CASE_HEX_LITERALS, misc_early::REDUNDANT_PATTERN, misc_early::SEPARATED_LITERAL_SUFFIX, misc_early::UNNEEDED_FIELD_PATTERN, misc_early::UNNEEDED_WILDCARD_PATTERN, misc_early::UNSEPARATED_LITERAL_SUFFIX, misc_early::ZERO_PREFIXED_LITERAL, missing_const_for_fn::MISSING_CONST_FOR_FN, missing_doc::MISSING_DOCS_IN_PRIVATE_ITEMS, missing_enforced_import_rename::MISSING_ENFORCED_IMPORT_RENAMES, missing_inline::MISSING_INLINE_IN_PUBLIC_ITEMS, module_style::MOD_MODULE_FILES, module_style::SELF_NAMED_MODULE_FILES, modulo_arithmetic::MODULO_ARITHMETIC, mut_key::MUTABLE_KEY_TYPE, mut_mut::MUT_MUT, mut_mutex_lock::MUT_MUTEX_LOCK, mut_reference::UNNECESSARY_MUT_PASSED, mutable_debug_assertion::DEBUG_ASSERT_WITH_MUT_CALL, mutex_atomic::MUTEX_ATOMIC, mutex_atomic::MUTEX_INTEGER, needless_arbitrary_self_type::NEEDLESS_ARBITRARY_SELF_TYPE, needless_bitwise_bool::NEEDLESS_BITWISE_BOOL, needless_bool::BOOL_COMPARISON, needless_bool::NEEDLESS_BOOL, needless_borrowed_ref::NEEDLESS_BORROWED_REFERENCE, needless_continue::NEEDLESS_CONTINUE, needless_for_each::NEEDLESS_FOR_EACH, needless_late_init::NEEDLESS_LATE_INIT, needless_option_as_deref::NEEDLESS_OPTION_AS_DEREF, needless_pass_by_value::NEEDLESS_PASS_BY_VALUE, needless_question_mark::NEEDLESS_QUESTION_MARK, needless_update::NEEDLESS_UPDATE, neg_cmp_op_on_partial_ord::NEG_CMP_OP_ON_PARTIAL_ORD, neg_multiply::NEG_MULTIPLY, new_without_default::NEW_WITHOUT_DEFAULT, no_effect::NO_EFFECT, no_effect::NO_EFFECT_UNDERSCORE_BINDING, no_effect::UNNECESSARY_OPERATION, non_copy_const::BORROW_INTERIOR_MUTABLE_CONST, non_copy_const::DECLARE_INTERIOR_MUTABLE_CONST, non_expressive_names::JUST_UNDERSCORES_AND_DIGITS, non_expressive_names::MANY_SINGLE_CHAR_NAMES, non_expressive_names::SIMILAR_NAMES, non_octal_unix_permissions::NON_OCTAL_UNIX_PERMISSIONS, non_send_fields_in_send_ty::NON_SEND_FIELDS_IN_SEND_TY, nonstandard_macro_braces::NONSTANDARD_MACRO_BRACES, octal_escapes::OCTAL_ESCAPES, only_used_in_recursion::ONLY_USED_IN_RECURSION, open_options::NONSENSICAL_OPEN_OPTIONS, option_env_unwrap::OPTION_ENV_UNWRAP, option_if_let_else::OPTION_IF_LET_ELSE, overflow_check_conditional::OVERFLOW_CHECK_CONDITIONAL, panic_in_result_fn::PANIC_IN_RESULT_FN, panic_unimplemented::PANIC, panic_unimplemented::TODO, panic_unimplemented::UNIMPLEMENTED, panic_unimplemented::UNREACHABLE, partialeq_ne_impl::PARTIALEQ_NE_IMPL, pass_by_ref_or_value::LARGE_TYPES_PASSED_BY_VALUE, pass_by_ref_or_value::TRIVIALLY_COPY_PASS_BY_REF, path_buf_push_overwrite::PATH_BUF_PUSH_OVERWRITE, pattern_type_mismatch::PATTERN_TYPE_MISMATCH, precedence::PRECEDENCE, ptr::CMP_NULL, ptr::INVALID_NULL_PTR_USAGE, ptr::MUT_FROM_REF, ptr::PTR_ARG, ptr_eq::PTR_EQ, ptr_offset_with_cast::PTR_OFFSET_WITH_CAST, question_mark::QUESTION_MARK, ranges::MANUAL_RANGE_CONTAINS, ranges::RANGE_MINUS_ONE, ranges::RANGE_PLUS_ONE, ranges::RANGE_ZIP_WITH_LEN, ranges::REVERSED_EMPTY_RANGES, redundant_clone::REDUNDANT_CLONE, redundant_closure_call::REDUNDANT_CLOSURE_CALL, redundant_else::REDUNDANT_ELSE, redundant_field_names::REDUNDANT_FIELD_NAMES, redundant_pub_crate::REDUNDANT_PUB_CRATE, redundant_slicing::DEREF_BY_SLICING, redundant_slicing::REDUNDANT_SLICING, redundant_static_lifetimes::REDUNDANT_STATIC_LIFETIMES, ref_option_ref::REF_OPTION_REF, reference::DEREF_ADDROF, regex::INVALID_REGEX, regex::TRIVIAL_REGEX, repeat_once::REPEAT_ONCE, return_self_not_must_use::RETURN_SELF_NOT_MUST_USE, returns::LET_AND_RETURN, returns::NEEDLESS_RETURN, same_name_method::SAME_NAME_METHOD, self_assignment::SELF_ASSIGNMENT, self_named_constructors::SELF_NAMED_CONSTRUCTORS, semicolon_if_nothing_returned::SEMICOLON_IF_NOTHING_RETURNED, serde_api::SERDE_API_MISUSE, shadow::SHADOW_REUSE, shadow::SHADOW_SAME, shadow::SHADOW_UNRELATED, single_char_lifetime_names::SINGLE_CHAR_LIFETIME_NAMES, single_component_path_imports::SINGLE_COMPONENT_PATH_IMPORTS, size_of_in_element_count::SIZE_OF_IN_ELEMENT_COUNT, slow_vector_initialization::SLOW_VECTOR_INITIALIZATION, stable_sort_primitive::STABLE_SORT_PRIMITIVE, strings::STRING_ADD, strings::STRING_ADD_ASSIGN, strings::STRING_FROM_UTF8_AS_BYTES, strings::STRING_LIT_AS_BYTES, strings::STRING_SLICE, strings::STRING_TO_STRING, strings::STR_TO_STRING, strlen_on_c_strings::STRLEN_ON_C_STRINGS, suspicious_operation_groupings::SUSPICIOUS_OPERATION_GROUPINGS, suspicious_trait_impl::SUSPICIOUS_ARITHMETIC_IMPL, suspicious_trait_impl::SUSPICIOUS_OP_ASSIGN_IMPL, swap::ALMOST_SWAPPED, swap::MANUAL_SWAP, tabs_in_doc_comments::TABS_IN_DOC_COMMENTS, temporary_assignment::TEMPORARY_ASSIGNMENT, to_digit_is_some::TO_DIGIT_IS_SOME, trailing_empty_array::TRAILING_EMPTY_ARRAY, trait_bounds::TRAIT_DUPLICATION_IN_BOUNDS, trait_bounds::TYPE_REPETITION_IN_BOUNDS, transmute::CROSSPOINTER_TRANSMUTE, transmute::TRANSMUTES_EXPRESSIBLE_AS_PTR_CASTS, transmute::TRANSMUTE_BYTES_TO_STR, transmute::TRANSMUTE_FLOAT_TO_INT, transmute::TRANSMUTE_INT_TO_BOOL, transmute::TRANSMUTE_INT_TO_CHAR, transmute::TRANSMUTE_INT_TO_FLOAT, transmute::TRANSMUTE_NUM_TO_BYTES, transmute::TRANSMUTE_PTR_TO_PTR, transmute::TRANSMUTE_PTR_TO_REF, transmute::TRANSMUTE_UNDEFINED_REPR, transmute::UNSOUND_COLLECTION_TRANSMUTE, transmute::USELESS_TRANSMUTE, transmute::WRONG_TRANSMUTE, transmuting_null::TRANSMUTING_NULL, try_err::TRY_ERR, types::BORROWED_BOX, types::BOX_COLLECTION, types::LINKEDLIST, types::OPTION_OPTION, types::RC_BUFFER, types::RC_MUTEX, types::REDUNDANT_ALLOCATION, types::TYPE_COMPLEXITY, types::VEC_BOX, undocumented_unsafe_blocks::UNDOCUMENTED_UNSAFE_BLOCKS, undropped_manually_drops::UNDROPPED_MANUALLY_DROPS, unicode::INVISIBLE_CHARACTERS, unicode::NON_ASCII_LITERAL, unicode::UNICODE_NOT_NFC, uninit_vec::UNINIT_VEC, unit_hash::UNIT_HASH, unit_return_expecting_ord::UNIT_RETURN_EXPECTING_ORD, unit_types::LET_UNIT_VALUE, unit_types::UNIT_ARG, unit_types::UNIT_CMP, unnamed_address::FN_ADDRESS_COMPARISONS, unnamed_address::VTABLE_ADDRESS_COMPARISONS, unnecessary_self_imports::UNNECESSARY_SELF_IMPORTS, unnecessary_sort_by::UNNECESSARY_SORT_BY, unnecessary_wraps::UNNECESSARY_WRAPS, unnested_or_patterns::UNNESTED_OR_PATTERNS, unsafe_removed_from_name::UNSAFE_REMOVED_FROM_NAME, unused_async::UNUSED_ASYNC, unused_io_amount::UNUSED_IO_AMOUNT, unused_self::UNUSED_SELF, unused_unit::UNUSED_UNIT, unwrap::PANICKING_UNWRAP, unwrap::UNNECESSARY_UNWRAP, unwrap_in_result::UNWRAP_IN_RESULT, upper_case_acronyms::UPPER_CASE_ACRONYMS, use_self::USE_SELF, useless_conversion::USELESS_CONVERSION, vec::USELESS_VEC, vec_init_then_push::VEC_INIT_THEN_PUSH, vec_resize_to_zero::VEC_RESIZE_TO_ZERO, verbose_file_reads::VERBOSE_FILE_READS, wildcard_imports::ENUM_GLOB_USE, wildcard_imports::WILDCARD_IMPORTS, write::PRINTLN_EMPTY_STRING, write::PRINT_LITERAL, write::PRINT_STDERR, write::PRINT_STDOUT, write::PRINT_WITH_NEWLINE, write::USE
collapsible_if::COLLAPSIBLE_ELSE_IF, collapsible_if::COLLAPSIBLE_IF, collapsible_match::COLLAPSIBLE_MATCH,
random_line_split
main.rs
#![cfg_attr(not(debug_assertions), windows_subsystem = "windows")] use std::rc::Rc; use std::cell::Cell; use std::fs::{self, OpenOptions}; use std::io::Write; use std::path::PathBuf; use std::u32; extern crate chariot_drs as lib; use lib::DrsFile as Archive; extern crate number_prefix; use number_prefix::{binary_prefix, Prefixed, Standalone}; extern crate gdk; extern crate gtk; use gtk::prelude::Inhibit; use gtk::{Builder, Button, Entry as EntryBox, FileChooserDialog, ListStore, TreeView, TreeViewColumn, Type, Window, WindowType}; use gtk::{BuilderExt, ButtonExt, CellLayoutExt, DialogExt, EntryExt, FileChooserExt, GtkWindowExt, ListStoreExt, ListStoreExtManual, TreeModelExt, TreeSelectionExt, TreeSortableExtManual, TreeViewColumnExt, TreeViewExt, WidgetExt}; #[derive(Debug, PartialEq, Eq)] enum Column { ID, Type, Size, Offset, } impl Into<u32> for Column { fn into(self) -> u32 { match self { Column::ID => 0, Column::Type => 1, Column::Size => 2, Column::Offset => 3, } } } impl Into<i32> for Column { fn into(self) -> i32 { match self { Column::ID => 0, Column::Type => 1, Column::Size => 2, Column::Offset => 3, } } } macro_rules! add_column { ($tree:ident, $title:expr, $id:expr) => {{ let column = TreeViewColumn::new(); let renderer = gtk::CellRendererText::new(); column.set_title($title); column.set_resizable(true); column.pack_start(&renderer, true); column.add_attribute(&renderer, "text", $id); $tree.append_column(&column); }} } macro_rules! add_sort_func { ($tree:ident, $store:ident, $convert:ident, $col:expr) => {{ let store_clone = $store.clone(); $store.set_sort_func(gtk::SortColumn::Index($col.into()), move |_this, a, b| { let string_at_iter = |iter| store_clone.get_value(iter, $col.into()) .get::<String>() .unwrap(); let a = $convert(string_at_iter(a)); let b = $convert(string_at_iter(b)); a.cmp(&b) }); $tree.get_column($col.into()).unwrap().set_sort_column_id($col.into()); }} } fn setup_tree(tree: TreeView, extract_button: Button) { let sel = tree.get_selection(); let model = match tree.get_model() { Some(m) => m, _ => return, }; sel.connect_changed(move |this| { // TODO: Do all of this when an archive is opened, too. let selected_count = this.count_selected_rows(); let store_len = model.iter_n_children(None); let count_str = if selected_count == 0 || selected_count == store_len { "all".into() } else { format!("({})", selected_count) }; extract_button.set_label(&format!("Extract {}", count_str)) }); } fn
( title: &str, window_type: gtk::WindowType, action: gtk::FileChooserAction, ) -> Option<PathBuf> { let dialog = FileChooserDialog::new(Some(title), Some(&Window::new(window_type)), action); dialog.add_button("_Cancel", gtk::ResponseType::Cancel.into()); match action { gtk::FileChooserAction::Open => { dialog.add_button("_Open", gtk::ResponseType::Ok.into()); } gtk::FileChooserAction::SelectFolder => { dialog.add_button("_Select", gtk::ResponseType::Ok.into()); } _ => (), }; let path = if dialog.run() == gtk::ResponseType::Ok.into() { dialog.get_filename() } else { None }; dialog.destroy(); path } fn enable_archive_button( archive: Rc<Cell<Option<Archive>>>, extract_button: Button, archive_button: Button, archive_entrybox: EntryBox, ei_store: ListStore, ) { archive_button.connect_clicked(move |_this| { let archive_path = match select_dir_dialog( "Select a DRS archive", WindowType::Popup, gtk::FileChooserAction::Open, ) { Some(p) => p, _ => return, }; let archive_path = match archive_path.to_str() { Some(p) => p, _ => return, }; let arch = match Archive::read_from_file(archive_path) { Ok(a) => a, _ => return, }; ei_store.clear(); extract_button.set_sensitive(true); archive_entrybox.set_text(archive_path); for table in arch.tables.iter() { for entry in table.entries.iter() { let float_len = entry.file_size as f32; let formatted_size = match binary_prefix(float_len) { Standalone(bytes) => format!("{} B", bytes), Prefixed(prefix, n) => format!("{:.2} {}B", n, prefix), }; ei_store.insert_with_values( None, &[ Column::ID.into(), Column::Type.into(), Column::Size.into(), Column::Offset.into(), ], &[ &entry.file_id.to_string(), &table.header.file_extension(), &formatted_size, &format!("{:#X}", entry.file_offset), ], ); } } archive.replace(Some(arch)); }); } fn enable_extract_button( archive: Rc<Cell<Option<Archive>>>, extract_button: Button, entryinfo_tree: TreeView, ) { extract_button.connect_clicked(move |_this| { if let Some(dest_dir_path) = select_dir_dialog( "Select a directory to extract to", WindowType::Toplevel, gtk::FileChooserAction::SelectFolder, ) { let arch = match archive.take() { Some(a) => a, _ => return, }; let sel = entryinfo_tree.get_selection(); let (mut sel_paths, model) = sel.get_selected_rows(); if sel_paths.len() == 0 { sel.select_all(); let (s, _) = sel.get_selected_rows(); sel_paths = s; sel.unselect_all(); } for sel_path in sel_paths { let iter = match model.get_iter(&sel_path) { Some(i) => i, _ => continue, }; let val = model.get_value(&iter, 0); let name = val.get::<String>().expect(&format!( "Unable to convert gtk::Type::String {:?} to a Rust String", val )); for table in arch.tables.iter() { let data = match table.find_file_contents(name.parse::<u32>().unwrap()) { Some(d) => d, _ => continue, }; let mut output_filepath = dest_dir_path.clone(); output_filepath.push(name.replace("\\", "/")); output_filepath.set_extension(table.header.file_extension()); let parent = output_filepath.parent().expect(&format!( "Unable to determine parent path of {:?}", &output_filepath )); fs::create_dir_all(&parent) .expect("Failed to create necessary parent directories"); let mut f = OpenOptions::new() .create(true) .read(true) .write(true) .truncate(true) .open(&output_filepath) .expect(&format!( "Failed to open file {:?} for writing", output_filepath )); f.write(data).expect("Failed to write data"); } } archive.replace(Some(arch)); } }); } fn enable_sortable_cols(ei_store: &ListStore, entryinfo_tree: &TreeView) { // Values in the table are strings. They should be converted back // to their original type to make the sort function work properly fn convert_name(s: String) -> u32 { s.parse::<u32>().unwrap() } fn convert_type(s: String) -> String { s } fn convert_size(s: String) -> u32 { let v = s.split(' ').collect::<Vec<&str>>(); let exp = match v.get(1) { Some(&"B") => 0, Some(&"KiB") => 1, Some(&"MiB") => 2, Some(&"GiB") => 3, _ => panic!("Unable to convert size: `{}`", s), }; (1024u32.pow(exp) as f32 * v[0].parse::<f32>().unwrap()) as u32 } fn convert_offset(s: String) -> u32 { u32::from_str_radix(&s[2..], 16).unwrap() } add_sort_func!(entryinfo_tree, ei_store, convert_name, Column::ID); add_sort_func!(entryinfo_tree, ei_store, convert_type, Column::Type); add_sort_func!(entryinfo_tree, ei_store, convert_size, Column::Size); add_sort_func!(entryinfo_tree, ei_store, convert_offset, Column::Offset); } fn main() { gtk::init().unwrap(); let builder = Builder::new(); builder .add_from_string(include_str!("../ui.glade")) .unwrap(); let window: Window = builder.get_object("main_window").unwrap(); let archive_entrybox: EntryBox = builder.get_object("archive_file_entry").unwrap(); let archive_button: Button = builder.get_object("archive_file_button").unwrap(); let extract_button: Button = builder.get_object("extract_button").unwrap(); extract_button.set_sensitive(false); let entryinfo_tree = { let t: TreeView = builder.get_object("entryinfo_tree").unwrap(); let sel = t.get_selection(); sel.set_mode(gtk::SelectionMode::Multiple); t }; window.set_title("DRS Studio"); window.set_position(gtk::WindowPosition::Center); window.get_preferred_width(); window.set_default_size(1440, 900); let ei_store = ListStore::new(&[Type::String, Type::String, Type::String, Type::String]); entryinfo_tree.set_model(Some(&ei_store)); entryinfo_tree.set_headers_visible(true); add_column!(entryinfo_tree, "ID", Column::ID.into()); add_column!(entryinfo_tree, "Type", Column::Type.into()); add_column!(entryinfo_tree, "Size", Column::Size.into()); add_column!(entryinfo_tree, "Offset", Column::Offset.into()); setup_tree(entryinfo_tree.clone(), extract_button.clone()); let archive: Rc<Cell<Option<Archive>>> = Rc::new(Cell::new(None)); enable_sortable_cols(&ei_store, &entryinfo_tree); enable_archive_button( archive.clone(), extract_button.clone(), archive_button.clone(), archive_entrybox.clone(), ei_store, ); enable_extract_button(archive.clone(), extract_button.clone(), entryinfo_tree); window.connect_delete_event(|_, _| { gtk::main_quit(); Inhibit(false) }); window.show_all(); gtk::main(); }
select_dir_dialog
identifier_name
main.rs
#![cfg_attr(not(debug_assertions), windows_subsystem = "windows")] use std::rc::Rc; use std::cell::Cell; use std::fs::{self, OpenOptions}; use std::io::Write; use std::path::PathBuf; use std::u32; extern crate chariot_drs as lib; use lib::DrsFile as Archive; extern crate number_prefix; use number_prefix::{binary_prefix, Prefixed, Standalone}; extern crate gdk; extern crate gtk; use gtk::prelude::Inhibit; use gtk::{Builder, Button, Entry as EntryBox, FileChooserDialog, ListStore, TreeView, TreeViewColumn, Type, Window, WindowType}; use gtk::{BuilderExt, ButtonExt, CellLayoutExt, DialogExt, EntryExt, FileChooserExt, GtkWindowExt, ListStoreExt, ListStoreExtManual, TreeModelExt, TreeSelectionExt, TreeSortableExtManual, TreeViewColumnExt, TreeViewExt, WidgetExt}; #[derive(Debug, PartialEq, Eq)] enum Column { ID, Type, Size, Offset, } impl Into<u32> for Column { fn into(self) -> u32 { match self { Column::ID => 0, Column::Type => 1, Column::Size => 2, Column::Offset => 3, } } } impl Into<i32> for Column { fn into(self) -> i32 { match self { Column::ID => 0, Column::Type => 1, Column::Size => 2, Column::Offset => 3, } } } macro_rules! add_column { ($tree:ident, $title:expr, $id:expr) => {{ let column = TreeViewColumn::new(); let renderer = gtk::CellRendererText::new(); column.set_title($title); column.set_resizable(true); column.pack_start(&renderer, true); column.add_attribute(&renderer, "text", $id); $tree.append_column(&column); }} } macro_rules! add_sort_func { ($tree:ident, $store:ident, $convert:ident, $col:expr) => {{ let store_clone = $store.clone(); $store.set_sort_func(gtk::SortColumn::Index($col.into()), move |_this, a, b| { let string_at_iter = |iter| store_clone.get_value(iter, $col.into()) .get::<String>() .unwrap(); let a = $convert(string_at_iter(a)); let b = $convert(string_at_iter(b)); a.cmp(&b) }); $tree.get_column($col.into()).unwrap().set_sort_column_id($col.into()); }} } fn setup_tree(tree: TreeView, extract_button: Button) { let sel = tree.get_selection(); let model = match tree.get_model() { Some(m) => m, _ => return, }; sel.connect_changed(move |this| { // TODO: Do all of this when an archive is opened, too. let selected_count = this.count_selected_rows(); let store_len = model.iter_n_children(None);
let count_str = if selected_count == 0 || selected_count == store_len { "all".into() } else { format!("({})", selected_count) }; extract_button.set_label(&format!("Extract {}", count_str)) }); } fn select_dir_dialog( title: &str, window_type: gtk::WindowType, action: gtk::FileChooserAction, ) -> Option<PathBuf> { let dialog = FileChooserDialog::new(Some(title), Some(&Window::new(window_type)), action); dialog.add_button("_Cancel", gtk::ResponseType::Cancel.into()); match action { gtk::FileChooserAction::Open => { dialog.add_button("_Open", gtk::ResponseType::Ok.into()); } gtk::FileChooserAction::SelectFolder => { dialog.add_button("_Select", gtk::ResponseType::Ok.into()); } _ => (), }; let path = if dialog.run() == gtk::ResponseType::Ok.into() { dialog.get_filename() } else { None }; dialog.destroy(); path } fn enable_archive_button( archive: Rc<Cell<Option<Archive>>>, extract_button: Button, archive_button: Button, archive_entrybox: EntryBox, ei_store: ListStore, ) { archive_button.connect_clicked(move |_this| { let archive_path = match select_dir_dialog( "Select a DRS archive", WindowType::Popup, gtk::FileChooserAction::Open, ) { Some(p) => p, _ => return, }; let archive_path = match archive_path.to_str() { Some(p) => p, _ => return, }; let arch = match Archive::read_from_file(archive_path) { Ok(a) => a, _ => return, }; ei_store.clear(); extract_button.set_sensitive(true); archive_entrybox.set_text(archive_path); for table in arch.tables.iter() { for entry in table.entries.iter() { let float_len = entry.file_size as f32; let formatted_size = match binary_prefix(float_len) { Standalone(bytes) => format!("{} B", bytes), Prefixed(prefix, n) => format!("{:.2} {}B", n, prefix), }; ei_store.insert_with_values( None, &[ Column::ID.into(), Column::Type.into(), Column::Size.into(), Column::Offset.into(), ], &[ &entry.file_id.to_string(), &table.header.file_extension(), &formatted_size, &format!("{:#X}", entry.file_offset), ], ); } } archive.replace(Some(arch)); }); } fn enable_extract_button( archive: Rc<Cell<Option<Archive>>>, extract_button: Button, entryinfo_tree: TreeView, ) { extract_button.connect_clicked(move |_this| { if let Some(dest_dir_path) = select_dir_dialog( "Select a directory to extract to", WindowType::Toplevel, gtk::FileChooserAction::SelectFolder, ) { let arch = match archive.take() { Some(a) => a, _ => return, }; let sel = entryinfo_tree.get_selection(); let (mut sel_paths, model) = sel.get_selected_rows(); if sel_paths.len() == 0 { sel.select_all(); let (s, _) = sel.get_selected_rows(); sel_paths = s; sel.unselect_all(); } for sel_path in sel_paths { let iter = match model.get_iter(&sel_path) { Some(i) => i, _ => continue, }; let val = model.get_value(&iter, 0); let name = val.get::<String>().expect(&format!( "Unable to convert gtk::Type::String {:?} to a Rust String", val )); for table in arch.tables.iter() { let data = match table.find_file_contents(name.parse::<u32>().unwrap()) { Some(d) => d, _ => continue, }; let mut output_filepath = dest_dir_path.clone(); output_filepath.push(name.replace("\\", "/")); output_filepath.set_extension(table.header.file_extension()); let parent = output_filepath.parent().expect(&format!( "Unable to determine parent path of {:?}", &output_filepath )); fs::create_dir_all(&parent) .expect("Failed to create necessary parent directories"); let mut f = OpenOptions::new() .create(true) .read(true) .write(true) .truncate(true) .open(&output_filepath) .expect(&format!( "Failed to open file {:?} for writing", output_filepath )); f.write(data).expect("Failed to write data"); } } archive.replace(Some(arch)); } }); } fn enable_sortable_cols(ei_store: &ListStore, entryinfo_tree: &TreeView) { // Values in the table are strings. They should be converted back // to their original type to make the sort function work properly fn convert_name(s: String) -> u32 { s.parse::<u32>().unwrap() } fn convert_type(s: String) -> String { s } fn convert_size(s: String) -> u32 { let v = s.split(' ').collect::<Vec<&str>>(); let exp = match v.get(1) { Some(&"B") => 0, Some(&"KiB") => 1, Some(&"MiB") => 2, Some(&"GiB") => 3, _ => panic!("Unable to convert size: `{}`", s), }; (1024u32.pow(exp) as f32 * v[0].parse::<f32>().unwrap()) as u32 } fn convert_offset(s: String) -> u32 { u32::from_str_radix(&s[2..], 16).unwrap() } add_sort_func!(entryinfo_tree, ei_store, convert_name, Column::ID); add_sort_func!(entryinfo_tree, ei_store, convert_type, Column::Type); add_sort_func!(entryinfo_tree, ei_store, convert_size, Column::Size); add_sort_func!(entryinfo_tree, ei_store, convert_offset, Column::Offset); } fn main() { gtk::init().unwrap(); let builder = Builder::new(); builder .add_from_string(include_str!("../ui.glade")) .unwrap(); let window: Window = builder.get_object("main_window").unwrap(); let archive_entrybox: EntryBox = builder.get_object("archive_file_entry").unwrap(); let archive_button: Button = builder.get_object("archive_file_button").unwrap(); let extract_button: Button = builder.get_object("extract_button").unwrap(); extract_button.set_sensitive(false); let entryinfo_tree = { let t: TreeView = builder.get_object("entryinfo_tree").unwrap(); let sel = t.get_selection(); sel.set_mode(gtk::SelectionMode::Multiple); t }; window.set_title("DRS Studio"); window.set_position(gtk::WindowPosition::Center); window.get_preferred_width(); window.set_default_size(1440, 900); let ei_store = ListStore::new(&[Type::String, Type::String, Type::String, Type::String]); entryinfo_tree.set_model(Some(&ei_store)); entryinfo_tree.set_headers_visible(true); add_column!(entryinfo_tree, "ID", Column::ID.into()); add_column!(entryinfo_tree, "Type", Column::Type.into()); add_column!(entryinfo_tree, "Size", Column::Size.into()); add_column!(entryinfo_tree, "Offset", Column::Offset.into()); setup_tree(entryinfo_tree.clone(), extract_button.clone()); let archive: Rc<Cell<Option<Archive>>> = Rc::new(Cell::new(None)); enable_sortable_cols(&ei_store, &entryinfo_tree); enable_archive_button( archive.clone(), extract_button.clone(), archive_button.clone(), archive_entrybox.clone(), ei_store, ); enable_extract_button(archive.clone(), extract_button.clone(), entryinfo_tree); window.connect_delete_event(|_, _| { gtk::main_quit(); Inhibit(false) }); window.show_all(); gtk::main(); }
random_line_split
main.rs
#![cfg_attr(not(debug_assertions), windows_subsystem = "windows")] use std::rc::Rc; use std::cell::Cell; use std::fs::{self, OpenOptions}; use std::io::Write; use std::path::PathBuf; use std::u32; extern crate chariot_drs as lib; use lib::DrsFile as Archive; extern crate number_prefix; use number_prefix::{binary_prefix, Prefixed, Standalone}; extern crate gdk; extern crate gtk; use gtk::prelude::Inhibit; use gtk::{Builder, Button, Entry as EntryBox, FileChooserDialog, ListStore, TreeView, TreeViewColumn, Type, Window, WindowType}; use gtk::{BuilderExt, ButtonExt, CellLayoutExt, DialogExt, EntryExt, FileChooserExt, GtkWindowExt, ListStoreExt, ListStoreExtManual, TreeModelExt, TreeSelectionExt, TreeSortableExtManual, TreeViewColumnExt, TreeViewExt, WidgetExt}; #[derive(Debug, PartialEq, Eq)] enum Column { ID, Type, Size, Offset, } impl Into<u32> for Column { fn into(self) -> u32 { match self { Column::ID => 0, Column::Type => 1, Column::Size => 2, Column::Offset => 3, } } } impl Into<i32> for Column { fn into(self) -> i32 { match self { Column::ID => 0, Column::Type => 1, Column::Size => 2, Column::Offset => 3, } } } macro_rules! add_column { ($tree:ident, $title:expr, $id:expr) => {{ let column = TreeViewColumn::new(); let renderer = gtk::CellRendererText::new(); column.set_title($title); column.set_resizable(true); column.pack_start(&renderer, true); column.add_attribute(&renderer, "text", $id); $tree.append_column(&column); }} } macro_rules! add_sort_func { ($tree:ident, $store:ident, $convert:ident, $col:expr) => {{ let store_clone = $store.clone(); $store.set_sort_func(gtk::SortColumn::Index($col.into()), move |_this, a, b| { let string_at_iter = |iter| store_clone.get_value(iter, $col.into()) .get::<String>() .unwrap(); let a = $convert(string_at_iter(a)); let b = $convert(string_at_iter(b)); a.cmp(&b) }); $tree.get_column($col.into()).unwrap().set_sort_column_id($col.into()); }} } fn setup_tree(tree: TreeView, extract_button: Button) { let sel = tree.get_selection(); let model = match tree.get_model() { Some(m) => m, _ => return, }; sel.connect_changed(move |this| { // TODO: Do all of this when an archive is opened, too. let selected_count = this.count_selected_rows(); let store_len = model.iter_n_children(None); let count_str = if selected_count == 0 || selected_count == store_len { "all".into() } else { format!("({})", selected_count) }; extract_button.set_label(&format!("Extract {}", count_str)) }); } fn select_dir_dialog( title: &str, window_type: gtk::WindowType, action: gtk::FileChooserAction, ) -> Option<PathBuf> { let dialog = FileChooserDialog::new(Some(title), Some(&Window::new(window_type)), action); dialog.add_button("_Cancel", gtk::ResponseType::Cancel.into()); match action { gtk::FileChooserAction::Open => { dialog.add_button("_Open", gtk::ResponseType::Ok.into()); } gtk::FileChooserAction::SelectFolder => { dialog.add_button("_Select", gtk::ResponseType::Ok.into()); } _ => (), }; let path = if dialog.run() == gtk::ResponseType::Ok.into() { dialog.get_filename() } else { None }; dialog.destroy(); path } fn enable_archive_button( archive: Rc<Cell<Option<Archive>>>, extract_button: Button, archive_button: Button, archive_entrybox: EntryBox, ei_store: ListStore, ) { archive_button.connect_clicked(move |_this| { let archive_path = match select_dir_dialog( "Select a DRS archive", WindowType::Popup, gtk::FileChooserAction::Open, ) { Some(p) => p, _ => return, }; let archive_path = match archive_path.to_str() { Some(p) => p, _ => return, }; let arch = match Archive::read_from_file(archive_path) { Ok(a) => a, _ => return, }; ei_store.clear(); extract_button.set_sensitive(true); archive_entrybox.set_text(archive_path); for table in arch.tables.iter() { for entry in table.entries.iter() { let float_len = entry.file_size as f32; let formatted_size = match binary_prefix(float_len) { Standalone(bytes) => format!("{} B", bytes), Prefixed(prefix, n) => format!("{:.2} {}B", n, prefix), }; ei_store.insert_with_values( None, &[ Column::ID.into(), Column::Type.into(), Column::Size.into(), Column::Offset.into(), ], &[ &entry.file_id.to_string(), &table.header.file_extension(), &formatted_size, &format!("{:#X}", entry.file_offset), ], ); } } archive.replace(Some(arch)); }); } fn enable_extract_button( archive: Rc<Cell<Option<Archive>>>, extract_button: Button, entryinfo_tree: TreeView, ) { extract_button.connect_clicked(move |_this| { if let Some(dest_dir_path) = select_dir_dialog( "Select a directory to extract to", WindowType::Toplevel, gtk::FileChooserAction::SelectFolder, ) { let arch = match archive.take() { Some(a) => a, _ => return, }; let sel = entryinfo_tree.get_selection(); let (mut sel_paths, model) = sel.get_selected_rows(); if sel_paths.len() == 0 { sel.select_all(); let (s, _) = sel.get_selected_rows(); sel_paths = s; sel.unselect_all(); } for sel_path in sel_paths { let iter = match model.get_iter(&sel_path) { Some(i) => i, _ => continue, }; let val = model.get_value(&iter, 0); let name = val.get::<String>().expect(&format!( "Unable to convert gtk::Type::String {:?} to a Rust String", val )); for table in arch.tables.iter() { let data = match table.find_file_contents(name.parse::<u32>().unwrap()) { Some(d) => d, _ => continue, }; let mut output_filepath = dest_dir_path.clone(); output_filepath.push(name.replace("\\", "/")); output_filepath.set_extension(table.header.file_extension()); let parent = output_filepath.parent().expect(&format!( "Unable to determine parent path of {:?}", &output_filepath )); fs::create_dir_all(&parent) .expect("Failed to create necessary parent directories"); let mut f = OpenOptions::new() .create(true) .read(true) .write(true) .truncate(true) .open(&output_filepath) .expect(&format!( "Failed to open file {:?} for writing", output_filepath )); f.write(data).expect("Failed to write data"); } } archive.replace(Some(arch)); } }); } fn enable_sortable_cols(ei_store: &ListStore, entryinfo_tree: &TreeView) { // Values in the table are strings. They should be converted back // to their original type to make the sort function work properly fn convert_name(s: String) -> u32 { s.parse::<u32>().unwrap() } fn convert_type(s: String) -> String
fn convert_size(s: String) -> u32 { let v = s.split(' ').collect::<Vec<&str>>(); let exp = match v.get(1) { Some(&"B") => 0, Some(&"KiB") => 1, Some(&"MiB") => 2, Some(&"GiB") => 3, _ => panic!("Unable to convert size: `{}`", s), }; (1024u32.pow(exp) as f32 * v[0].parse::<f32>().unwrap()) as u32 } fn convert_offset(s: String) -> u32 { u32::from_str_radix(&s[2..], 16).unwrap() } add_sort_func!(entryinfo_tree, ei_store, convert_name, Column::ID); add_sort_func!(entryinfo_tree, ei_store, convert_type, Column::Type); add_sort_func!(entryinfo_tree, ei_store, convert_size, Column::Size); add_sort_func!(entryinfo_tree, ei_store, convert_offset, Column::Offset); } fn main() { gtk::init().unwrap(); let builder = Builder::new(); builder .add_from_string(include_str!("../ui.glade")) .unwrap(); let window: Window = builder.get_object("main_window").unwrap(); let archive_entrybox: EntryBox = builder.get_object("archive_file_entry").unwrap(); let archive_button: Button = builder.get_object("archive_file_button").unwrap(); let extract_button: Button = builder.get_object("extract_button").unwrap(); extract_button.set_sensitive(false); let entryinfo_tree = { let t: TreeView = builder.get_object("entryinfo_tree").unwrap(); let sel = t.get_selection(); sel.set_mode(gtk::SelectionMode::Multiple); t }; window.set_title("DRS Studio"); window.set_position(gtk::WindowPosition::Center); window.get_preferred_width(); window.set_default_size(1440, 900); let ei_store = ListStore::new(&[Type::String, Type::String, Type::String, Type::String]); entryinfo_tree.set_model(Some(&ei_store)); entryinfo_tree.set_headers_visible(true); add_column!(entryinfo_tree, "ID", Column::ID.into()); add_column!(entryinfo_tree, "Type", Column::Type.into()); add_column!(entryinfo_tree, "Size", Column::Size.into()); add_column!(entryinfo_tree, "Offset", Column::Offset.into()); setup_tree(entryinfo_tree.clone(), extract_button.clone()); let archive: Rc<Cell<Option<Archive>>> = Rc::new(Cell::new(None)); enable_sortable_cols(&ei_store, &entryinfo_tree); enable_archive_button( archive.clone(), extract_button.clone(), archive_button.clone(), archive_entrybox.clone(), ei_store, ); enable_extract_button(archive.clone(), extract_button.clone(), entryinfo_tree); window.connect_delete_event(|_, _| { gtk::main_quit(); Inhibit(false) }); window.show_all(); gtk::main(); }
{ s }
identifier_body
block.rs
//! Implementations of cryptographic attacks against block ciphers. use utils::data::Data; use utils::metrics; use victims::block::{EcbOrCbc, EcbWithSuffix, EcbWithAffixes, EcbUserProfile, CbcCookie}; /// Determine whether a block cipher is using ECB or CBC mode. /// /// Given a black box which encrypts (padded) user data under ECB mode or CBC mode at random, /// detect which mode it is using. pub fn is_ecb_mode(ecb_cbc_box: &mut EcbOrCbc) -> bool { // Find an upper bound on the block size of the cipher by encrypting some empty data. let block_size = ecb_cbc_box.encrypt(&Data::new()).len(); // Provide some input data which will definitely result in repeated blocks under ECB mode. let input = Data::from_bytes(vec![0; 10 * block_size]); let encrypted = ecb_cbc_box.encrypt(&input); metrics::has_repeated_blocks(&encrypted, block_size) } /// Decrypt an unknown suffix encrypted under ECB mode. /// /// Given a black box which adds an unknown suffix to input data before encrypting under ECB mode /// with the given block size, determine the suffix. pub fn find_ecb_suffix(ecb_suffix_box: &EcbWithSuffix) -> Data { // Determine the block size by repeatedly encrypting larger chunks of data until the output // jumps in length. let block_size; let base_len = ecb_suffix_box.encrypt(&Data::new()).len(); let mut cnt = 1; loop { let bytes = vec![0; cnt]; let input = Data::from_bytes(bytes); let new_len = ecb_suffix_box.encrypt(&input).len(); if new_len > base_len { block_size = new_len - base_len; break; } cnt += 1; } // Confirm that ECB is being used. let test_bytes = vec![0; block_size * 10]; let output = ecb_suffix_box.encrypt(&Data::from_bytes(test_bytes)); assert!(metrics::has_repeated_blocks(&output, block_size)); // Keep track of the suffix bytes that we have decrypted so far. let mut suffix = Vec::new(); // Decrypt the suffix one byte at a time. 'outer: loop { // Pad the known suffix with null bytes until it finishes one byte before a block boundary. let num_bytes = block_size - 1 - (suffix.len() % block_size); let padding = vec![0; num_bytes]; let mut padded_known = padding.clone(); padded_known.extend_from_slice(&suffix); // Pass the padding into the box, and grab the encrypted block which corresponds to our // input block whose last byte we are trying to determine. let block_pos = padding.len() + suffix.len() + 1 - block_size; let output = ecb_suffix_box.encrypt(&Data::from_bytes(padding)); if output.len() <= block_pos + block_size { // We've retrieved the whole suffix, so break. break; } let block = &output.bytes()[block_pos..block_pos + block_size]; // Compare the encrypted block against all the possible outputs that the block could // encrypt to, depending on its final byte. let partial_block = &padded_known[block_pos..]; for byte in 0..256 { let mut test_block = partial_block.to_vec(); test_block.push(byte as u8); let output = ecb_suffix_box.encrypt(&Data::from_bytes(test_block)); if &output.bytes()[..block_size] == block { suffix.push(byte as u8); continue 'outer; } } } Data::from_bytes(suffix) } /// Find the length of an unknown prefix which is appended to ECB-encrypted messages. fn find_ecb_prefix_len(ecb_affixes_box: &EcbWithAffixes, block_size: usize) -> usize { // Find the block in which the prefix ends, by finding the first block which is different upon // inserting a null byte. let empty = ecb_affixes_box.encrypt(&Data::new()); let noisy = ecb_affixes_box.encrypt(&Data::from_bytes(vec![0])); let mut prefix_block = 0; for (ix, (byte1, byte2)) in empty.bytes().iter().zip(noisy.bytes().iter()).enumerate() { if byte1!= byte2 { prefix_block = ix / block_size; break; } } // Now find the length of the prefix modulo the block size, by finding the smallest number of // null bytes we need to provide as input in order to produce repeated blocks. let mut prefix_len = block_size * prefix_block; for ix in 0..block_size { let repeats = Data::from_bytes(vec![0; 2 * block_size + ix]); let output = ecb_affixes_box.encrypt(&repeats); if output.bytes()[block_size * (prefix_block + 1)..block_size * (prefix_block + 2)] == output.bytes()[block_size * (prefix_block + 2)..block_size * (prefix_block + 3)] { prefix_len += block_size - ix; break; } } prefix_len } /// Decrypt an unknown suffix encrypted under ECB mode, when a prefix is also added. /// /// Given a black box which adds an unknown prefix and suffix to input data before encrypting under /// ECB mode with the given block size, determine the suffix. pub fn find_ecb_suffix_with_prefix(ecb_affixes_box: &EcbWithAffixes) -> Data { // Determine the block size by repeatedly encrypting larger chunks of data until the output // jumps in length. let block_size; let base_len = ecb_affixes_box.encrypt(&Data::new()).len(); let mut cnt = 1; loop { let bytes = vec![0; cnt]; let input = Data::from_bytes(bytes); let new_len = ecb_affixes_box.encrypt(&input).len(); if new_len > base_len { block_size = new_len - base_len; break; } cnt += 1; } // Confirm that ECB is being used. let test_bytes = vec![0; block_size * 10]; let output = ecb_affixes_box.encrypt(&Data::from_bytes(test_bytes)); assert!(metrics::has_repeated_blocks(&output, block_size)); // First, find the length of the prefix, which is currently unknown. let prefix_len = find_ecb_prefix_len(ecb_affixes_box, block_size); // Keep track of the suffix bytes that we have decrypted so far. let mut suffix = Vec::new(); // Decrypt the suffix one byte at a time. 'outer: loop { // Pad the known suffix with null bytes until it finishes one byte before a block boundary. let num_bytes = 2 * block_size - 1 - ((prefix_len + suffix.len()) % block_size); let padding = vec![0; num_bytes]; let mut padded_known = vec![0; prefix_len]; padded_known.extend_from_slice(&padding); padded_known.extend_from_slice(&suffix); // Pass the padding into the box, and grab the encrypted block which corresponds to our // input block whose last byte we are trying to determine. let block_pos = prefix_len + padding.len() + suffix.len() + 1 - block_size; let output = ecb_affixes_box.encrypt(&Data::from_bytes(padding)); if output.len() <= block_pos + block_size { // We've retrieved the whole suffix, so break. break; } let block = &output.bytes()[block_pos..block_pos + block_size]; // Compare the encrypted block against all the possible outputs that the block could // encrypt to, depending on its final byte. let partial_block = &padded_known[block_pos..]; let extra_padding = block_size - (prefix_len % block_size); let output_start = prefix_len + extra_padding; for byte in 0..256 { let mut test_block = vec![0; block_size - (prefix_len % block_size)]; test_block.extend_from_slice(partial_block); test_block.push(byte as u8); let output = ecb_affixes_box.encrypt(&Data::from_bytes(test_block)); if &output.bytes()[output_start..output_start + block_size] == block { suffix.push(byte as u8); continue 'outer; } } } Data::from_bytes(suffix) } /// Create a token which the `EcbUserProfile` decodes into a user profile with admin privileges. /// /// Given - a black box which, given an email address, creates a user profile encoded in the form /// `email=<user-email>&uid=10&role=user`, then encrypts that under ECB mode and provides the /// output as a token to the user. /// /// This utilises an ECB cut-and-paste attack to create an admin token. pub fn craft_ecb_admin_token(ecb_profile_box: &EcbUserProfile) -> Data { // Paste together non-admin tokens in order to create an admin token. This works by first // asking for the following three tokens: // // 0123456789ABCDEF 0123456789ABCDEF 0123456789ABCDEF // email@foo.com --> email=email@foo. com&uid=10&role= user // noone@fakeadmin --> email=noone@fake admin&uid=10&rol e=user // useless@madeup.com --> email=useless@ma deup.com&uid=10& role=user // // If we then take the first two blocks of the first token, the second block of the second // token and the final block of the third token, and paste them together, we will end up with // the following token: // // email=email@foo.com&uid=10&role=admin&uid=10&rolrole=user let token1 = ecb_profile_box.make_token("email@foo.com"); let token2 = ecb_profile_box.make_token("noone@fakeadmin"); let token3 = ecb_profile_box.make_token("useless@madeup"); let mut new_token_bytes = Vec::with_capacity(4 * 16); new_token_bytes.extend_from_slice(&token1.bytes()[..32]); new_token_bytes.extend_from_slice(&token2.bytes()[16..32]); new_token_bytes.extend_from_slice(&token3.bytes()[32..]); Data::from_bytes(new_token_bytes) } /// Create a token which the `CbcCookie` decodes into a cookie with admin privileges. /// /// Given - a black box which, given an arbitrary string, escapes the metacharacters ';' and '=' /// from the input, then produces a cookie in the form /// `comment1=cooking%20MCs;userdata=<user-data>;comment2=%20like%20a%20pound%20of%20bacon` and /// encrypts the result under CBC mode. /// /// This utilises a CBC bitflipping attack to create an admin token. pub fn
(cbc_cookie_box: &CbcCookie) -> Data { // First, provide the user data "aaaaaaaaaaaaaaaa:admin<true:aa<a" and get the // resulting token as raw bytes. let token = cbc_cookie_box.make_token("aaaaaaaaaaaaaaaa:admin<true:aa<a"); let mut bytes = token.bytes().to_vec(); // Now, by flipping some of the bits in this token, we can obtain an admin token. Specifically, // in CBC mode, flipping a bit in one ciphertext block scrambles the block it occurs in, and // reproduces the exact same edit in the following block after decryption. This means that by // choosing the bits we flip to occur in the block immediately before the one containing // ':admin<true:' we can edit ':' into ';' and '<' into '='. This requires flipping the final // bit of each of bytes 32, 38, 43 and 46. for position in &[32, 38, 43, 46] { bytes[*position] ^= 1; } Data::from_bytes(bytes) }
craft_cbc_admin_token
identifier_name