arcadianlee/monomer · Datasets at Hugging Face

instruction stringclasses 1 value	input stringlengths 4 139	output stringlengths 165 168
Based on the given SMILES string, predict the monomer's relevant properties.	CC(O)c1cc(Br)ccc1Br	The compound has a boiling point of 260.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 215.0 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	C=Cc1cc(Br)cc(Br)c1O	The compound has a boiling point of 280.0 °C, flammability rating of 1, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 243.91 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	Oc1c(S)cc(Br)cc1Br	The compound has a boiling point of 320.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 272.9 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	NNc1cc(Br)cc(Br)c1O	The compound has a boiling point of 310.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 259.91 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	C#CCCc1c(Br)cncc1Br	The compound has a boiling point of 280.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 215.91 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	NNc1c(Br)cncc1Br	The compound has a boiling point of 310.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 232.93 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	Brc1cc(Br)c(C2CO2)s1	The compound has a boiling point of 230.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 243.9 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	SCc1sc(Br)cc1Br	The compound has a boiling point of 280.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 256.98 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	Sc1sc(Br)cc1Br	The compound has a boiling point of 260.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 246.8 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	N=C(N)c1sc(Br)cc1Br	The compound has a boiling point of 310.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 0, solubility rating of 1, and a molar mass of 259.9 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	Brc1ccc(Br)c(C2CO2)c1	The compound has a boiling point of 215.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 215.87 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	Brc1cncc(Br)c1C1CO1	The compound has a boiling point of 230.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 215.9 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	N#CCCc1c(Br)cncc1Br	The compound has a boiling point of 280.5 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 220.91 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	CC(C#N)c1c(Br)cncc1Br	The compound has a boiling point of 320.5 °C, flammability rating of 0, toxicity level of 1, odor rating of 0, solubility rating of 0, and a molar mass of 246.91 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	NOCc1c(Br)cncc1Br	The compound has a boiling point of 280.5 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 259.94 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	CC(C)(O)c1cc(Br)c(Br)o1	The compound has a boiling point of 230.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 244.9 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	O=CCc1ccc(Br)cc1Br	The compound has a boiling point of 315.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 251.91 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	C#CCc1c(Br)cncc1Br	The compound has a boiling point of 280.5 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 221.91 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	NOCc1ccc(Br)cc1Br	The compound has a boiling point of 310.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 259.91 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	O=C=Nc1c(Br)cncc1Br	The compound has a boiling point of 280.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 0, solubility rating of 1, and a molar mass of 244.87 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	C#CC(C)c1c(Br)cncc1Br	The compound has a boiling point of 280.0 °C, flammability rating of 1, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 234.95 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	Brc1cc(C2CO2)oc1Br	The compound has a boiling point of 230.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 215.86 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	OCCc1sc(Br)cc1Br	The compound has a boiling point of 280.5 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 246.98 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	CC1(c2cc(Br)c(Br)o2)CO1	The compound has a boiling point of 220.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 229.9 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	CC(O)c1cc(Br)c(Br)o1	The compound has a boiling point of 230.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 215.9 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	C=Cc1sc(Br)cc1Br	The compound has a boiling point of 310.0 °C, flammability rating of 1, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 246.0 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	Oc1cc(Br)c(Br)o1	The compound has a boiling point of 260.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 215.81 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	Oc1sc(Br)cc1Br	The compound has a boiling point of 260.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 229.87 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	OCc1sc(Br)cc1Br	The compound has a boiling point of 260.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 246.94 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	ONCc1ccc(Br)cc1Br	The compound has a boiling point of 280.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 251.91 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	CC(C#N)c1ccc(Br)cc1Br	The compound has a boiling point of 320.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 251.94 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	C=Cc1cc(Br)ccc1Br	The compound has a boiling point of 315.0 °C, flammability rating of 1, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 215.9 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	Brc1ccc(C2CO2)c(Br)c1	The compound has a boiling point of 280.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 215.87 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	C#CCc1ccc(Br)cc1Br	The compound has a boiling point of 320.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 215.9 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	C#CCc1cc(Br)ccc1Br	The compound has a boiling point of 320.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 215.9 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	SCc1cc(Br)cnc1Br	The compound has a boiling point of 280.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 246.04 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	C#CC(C)c1cc(Br)ccc1Br	The compound has a boiling point of 320.0 °C, flammability rating of 1, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 234.0 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	N=C(N)c1ccc(Br)cc1Br	The compound has a boiling point of 305.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 251.85 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	NOCc1cc(Br)ccc1Br	The compound has a boiling point of 310.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 251.9 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	C=Cc1ccc(Br)cc1Br	The compound has a boiling point of 326.5 °C, flammability rating of 1, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 215.89 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	NNc1cc(Br)c(O)c(Br)c1	The compound has a boiling point of 310.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 259.91 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	O=CC=Cc1ccc(Br)cc1Br	The compound has a boiling point of 315.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 251.9 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	C#Cc1ccc(Br)cc1Br	The compound has a boiling point of 326.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 215.86 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	CC(O)c1c(Br)cncc1Br	The compound has a boiling point of 260.5 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 229.0 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	CC(O)c1ccc(Br)c(Br)c1	The compound has a boiling point of 260.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 215.9 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	C=CC(=O)c1ccc(Br)c(Br)c1	The compound has a boiling point of 305.0 °C, flammability rating of 1, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 246.91 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	C#CCc1cc(Br)c(O)c(Br)c1	The compound has a boiling point of 310.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 243.9 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	C#Cc1cc(Br)c(OC)c(Br)c1	The compound has a boiling point of 280.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 244.91 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	C=Cc1cc(Br)c(O)c(Br)c1	The compound has a boiling point of 280.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 243.9 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	O=C=Nc1ccc(Br)c(Br)c1	The compound has a boiling point of 280.5 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 244.91 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	C#Cc1cc(Br)cnc1Br	The compound has a boiling point of 280.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 207.9 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	CC(C#N)c1ncc(Br)cc1Br	The compound has a boiling point of 280.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 0, solubility rating of 0, and a molar mass of 243.94 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	CC(O)c1cc(Br)cnc1Br	The compound has a boiling point of 280.5 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 229.0 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	Brc1cnc(C2CO2)c(Br)c1	The compound has a boiling point of 230.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 215.87 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	C=Cc1cc(Br)cnc1Br	The compound has a boiling point of 280.0 °C, flammability rating of 1, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 221.9 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	Brc1cccc(Br)c1C1CO1	The compound has a boiling point of 260.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 215.9 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	Brc1ccc(C2CO2)cc1Br	The compound has a boiling point of 310.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 215.87 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	O=CC=Cc1c(Br)cccc1Br	The compound has a boiling point of 320.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 251.9 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	C#CCCc1c(Br)cccc1Br	The compound has a boiling point of 320.0 °C, flammability rating of 1, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 215.9 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	CC(O)c1c(Br)cccc1Br	The compound has a boiling point of 260.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 215.0 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	N=C(N)c1c(Br)cccc1Br	The compound has a boiling point of 320.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 246.91 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	C#CCc1c(Br)cccc1Br	The compound has a boiling point of 320.0 °C, flammability rating of 1, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 215.9 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	C#CC(C)c1c(Br)cccc1Br	The compound has a boiling point of 320.0 °C, flammability rating of 1, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 243.0 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	C=Cc1c(Br)cccc1Br	The compound has a boiling point of 285.0 °C, flammability rating of 1, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 215.9 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	ONCc1c(Br)cccc1Br	The compound has a boiling point of 280.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 246.92 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	C#Cc1c(Br)cccc1Br	The compound has a boiling point of 326.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 215.91 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	NNc1cc(Br)cnc1Br	The compound has a boiling point of 280.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 229.93 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	O=CCc1cc(Br)cnc1Br	The compound has a boiling point of 310.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 0, solubility rating of 1, and a molar mass of 246.0 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	NOCc1c(Br)cccc1Br	The compound has a boiling point of 280.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 259.91 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	C=CC(=O)c1c(Br)cccc1Br	The compound has a boiling point of 320.5 °C, flammability rating of 1, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 251.91 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	SCc1c(Br)cccc1Br	The compound has a boiling point of 310.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 246.0 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	COCOc1c(Br)cc(F)cc1Br	The compound has a boiling point of 280.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 282.9 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	CCCCNC(=O)c1cc(Br)ccc1Br	The compound has a boiling point of 320.5 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 287.05 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	O=C(Nc1ccncc1)c1cc(Br)ccc1Br	The compound has a boiling point of 350.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 319.0 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	CCCCCCNC(=O)c1cc(Br)ccc1Br	The compound has a boiling point of 350.0 °C, flammability rating of 1, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 327.07 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	O=C(O)c1cnn(Cc2ccccc2Br)c1Br	The compound has a boiling point of 350.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 344.1 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	COC(CNC(=O)c1cc(Br)ccc1Br)OC	The compound has a boiling point of 320.5 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 335.05 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	COC(=O)C(C)NC(=O)c1cc(Br)ccc1Br	The compound has a boiling point of 320.5 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 312.04 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	O=C(Cc1ccc(Br)cc1)Nc1ncccc1Br	The compound has a boiling point of 350.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 312.1 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	O=C(Nc1ccc(Cl)cc1)c1cc(Br)ccc1Br	The compound has a boiling point of 350.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 327.0 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	O=C(Nc1ccccc1Cl)c1cc(Br)ccc1Br	The compound has a boiling point of 350.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 344.04 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	Cc1ccccc1NC(=O)c1cc(Br)ccc1Br	The compound has a boiling point of 350.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 327.1 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	C=C(C)COc1c(Br)cc(C=O)cc1Br	The compound has a boiling point of 280.5 °C, flammability rating of 1, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 282.0 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	Cc1cc(Br)c(S(=O)(=O)NC(C)(C)C)cc1Br	The compound has a boiling point of 350.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 355.1 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	O=C(c1ccc(Br)nc1)c1ccc(Br)nc1	The compound has a boiling point of 350.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 344.04 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	Nc1ccccc1NC(=O)c1cc(Br)ccc1Br	The compound has a boiling point of 360.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 317.0 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	O=S(=O)(Cl)Cc1cccc(Br)c1Br	The compound has a boiling point of 280.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 306.94 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	Cc1c(Br)csc1Br	The compound has a boiling point of 279.5 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 215.94 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	O=C(O)Cc1cc(Br)sc1Br	The compound has a boiling point of 320.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 282.9 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	CC(=O)SCc1cccc(Br)c1Br	The compound has a boiling point of 310.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 272.05 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	O=C(Nc1ncccc1Br)c1ccccc1Br	The compound has a boiling point of 350.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 311.1 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	O=C(Nc1ncccc1Br)c1ccc(Br)cc1	The compound has a boiling point of 350.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 320.1 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	Cc1ccc(Br)c(NC(=O)c2cccc(Br)c2)c1	The compound has a boiling point of 350.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 344.1 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	O=C(Nc1cccc(Cl)c1)c1cc(Br)ccc1Br	The compound has a boiling point of 350.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 344.44 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	CCOC(=O)CNC(=O)c1cc(Br)ccc1Br	The compound has a boiling point of 320.5 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 322.05 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	O=C(Nc1ccccc1F)c1cc(Br)ccc1Br	The compound has a boiling point of 350.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 344.0 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	CC(=O)NCCNC(=O)c1cc(Br)ccc1Br	The compound has a boiling point of 320.5 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 312.05 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	CCCCCNC(=O)c1cc(Br)ccc1Br	The compound has a boiling point of 320.5 °C, flammability rating of 1, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 313.06 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	CCOC(=O)C(N)Cc1cc(Br)cc(Br)c1	The compound has a boiling point of 320.5 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 313.04 g/mol.
Based on the given SMILES string, predict the monomer's relevant properties.	CC(C)=CCOc1c(Br)cc(Br)cc1C=O	The compound has a boiling point of 280.5 °C, flammability rating of 1, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 282.0 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

CC(O)c1cc(Br)ccc1Br

The compound has a boiling point of 260.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 215.0 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

C=Cc1cc(Br)cc(Br)c1O

The compound has a boiling point of 280.0 °C, flammability rating of 1, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 243.91 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

Oc1c(S)cc(Br)cc1Br

The compound has a boiling point of 320.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 272.9 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

NNc1cc(Br)cc(Br)c1O

The compound has a boiling point of 310.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 259.91 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

C#CCCc1c(Br)cncc1Br

The compound has a boiling point of 280.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 215.91 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

NNc1c(Br)cncc1Br

The compound has a boiling point of 310.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 232.93 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

Brc1cc(Br)c(C2CO2)s1

The compound has a boiling point of 230.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 243.9 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

SCc1sc(Br)cc1Br

The compound has a boiling point of 280.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 256.98 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

Sc1sc(Br)cc1Br

The compound has a boiling point of 260.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 246.8 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

N=C(N)c1sc(Br)cc1Br

The compound has a boiling point of 310.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 0, solubility rating of 1, and a molar mass of 259.9 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

Brc1ccc(Br)c(C2CO2)c1

The compound has a boiling point of 215.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 215.87 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

Brc1cncc(Br)c1C1CO1

The compound has a boiling point of 230.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 215.9 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

N#CCCc1c(Br)cncc1Br

The compound has a boiling point of 280.5 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 220.91 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

CC(C#N)c1c(Br)cncc1Br

The compound has a boiling point of 320.5 °C, flammability rating of 0, toxicity level of 1, odor rating of 0, solubility rating of 0, and a molar mass of 246.91 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

NOCc1c(Br)cncc1Br

The compound has a boiling point of 280.5 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 259.94 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

CC(C)(O)c1cc(Br)c(Br)o1

The compound has a boiling point of 230.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 244.9 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

O=CCc1ccc(Br)cc1Br

The compound has a boiling point of 315.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 251.91 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

C#CCc1c(Br)cncc1Br

The compound has a boiling point of 280.5 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 221.91 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

NOCc1ccc(Br)cc1Br

The compound has a boiling point of 310.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 259.91 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

O=C=Nc1c(Br)cncc1Br

The compound has a boiling point of 280.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 0, solubility rating of 1, and a molar mass of 244.87 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

C#CC(C)c1c(Br)cncc1Br

The compound has a boiling point of 280.0 °C, flammability rating of 1, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 234.95 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

Brc1cc(C2CO2)oc1Br

The compound has a boiling point of 230.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 215.86 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

OCCc1sc(Br)cc1Br

The compound has a boiling point of 280.5 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 246.98 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

CC1(c2cc(Br)c(Br)o2)CO1

The compound has a boiling point of 220.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 229.9 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

CC(O)c1cc(Br)c(Br)o1

The compound has a boiling point of 230.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 215.9 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

C=Cc1sc(Br)cc1Br

The compound has a boiling point of 310.0 °C, flammability rating of 1, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 246.0 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

Oc1cc(Br)c(Br)o1

The compound has a boiling point of 260.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 215.81 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

Oc1sc(Br)cc1Br

The compound has a boiling point of 260.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 229.87 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

OCc1sc(Br)cc1Br

The compound has a boiling point of 260.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 246.94 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

ONCc1ccc(Br)cc1Br

The compound has a boiling point of 280.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 251.91 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

CC(C#N)c1ccc(Br)cc1Br

The compound has a boiling point of 320.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 251.94 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

C=Cc1cc(Br)ccc1Br

The compound has a boiling point of 315.0 °C, flammability rating of 1, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 215.9 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

Brc1ccc(C2CO2)c(Br)c1

The compound has a boiling point of 280.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 215.87 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

C#CCc1ccc(Br)cc1Br

The compound has a boiling point of 320.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 215.9 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

C#CCc1cc(Br)ccc1Br

The compound has a boiling point of 320.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 215.9 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

SCc1cc(Br)cnc1Br

The compound has a boiling point of 280.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 246.04 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

C#CC(C)c1cc(Br)ccc1Br

The compound has a boiling point of 320.0 °C, flammability rating of 1, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 234.0 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

N=C(N)c1ccc(Br)cc1Br

The compound has a boiling point of 305.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 251.85 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

NOCc1cc(Br)ccc1Br

The compound has a boiling point of 310.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 251.9 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

C=Cc1ccc(Br)cc1Br

The compound has a boiling point of 326.5 °C, flammability rating of 1, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 215.89 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

NNc1cc(Br)c(O)c(Br)c1

The compound has a boiling point of 310.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 259.91 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

O=CC=Cc1ccc(Br)cc1Br

The compound has a boiling point of 315.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 251.9 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

C#Cc1ccc(Br)cc1Br

The compound has a boiling point of 326.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 215.86 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

CC(O)c1c(Br)cncc1Br

The compound has a boiling point of 260.5 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 229.0 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

CC(O)c1ccc(Br)c(Br)c1

The compound has a boiling point of 260.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 215.9 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

C=CC(=O)c1ccc(Br)c(Br)c1

The compound has a boiling point of 305.0 °C, flammability rating of 1, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 246.91 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

C#CCc1cc(Br)c(O)c(Br)c1

The compound has a boiling point of 310.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 243.9 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

C#Cc1cc(Br)c(OC)c(Br)c1

The compound has a boiling point of 280.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 244.91 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

C=Cc1cc(Br)c(O)c(Br)c1

The compound has a boiling point of 280.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 243.9 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

O=C=Nc1ccc(Br)c(Br)c1

The compound has a boiling point of 280.5 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 244.91 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

C#Cc1cc(Br)cnc1Br

The compound has a boiling point of 280.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 207.9 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

CC(C#N)c1ncc(Br)cc1Br

The compound has a boiling point of 280.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 0, solubility rating of 0, and a molar mass of 243.94 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

CC(O)c1cc(Br)cnc1Br

The compound has a boiling point of 280.5 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 229.0 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

Brc1cnc(C2CO2)c(Br)c1

The compound has a boiling point of 230.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 215.87 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

C=Cc1cc(Br)cnc1Br

The compound has a boiling point of 280.0 °C, flammability rating of 1, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 221.9 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

Brc1cccc(Br)c1C1CO1

The compound has a boiling point of 260.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 215.9 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

Brc1ccc(C2CO2)cc1Br

The compound has a boiling point of 310.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 215.87 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

O=CC=Cc1c(Br)cccc1Br

The compound has a boiling point of 320.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 251.9 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

C#CCCc1c(Br)cccc1Br

The compound has a boiling point of 320.0 °C, flammability rating of 1, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 215.9 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

CC(O)c1c(Br)cccc1Br

The compound has a boiling point of 260.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 215.0 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

N=C(N)c1c(Br)cccc1Br

The compound has a boiling point of 320.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 246.91 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

C#CCc1c(Br)cccc1Br

The compound has a boiling point of 320.0 °C, flammability rating of 1, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 215.9 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

C#CC(C)c1c(Br)cccc1Br

The compound has a boiling point of 320.0 °C, flammability rating of 1, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 243.0 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

C=Cc1c(Br)cccc1Br

The compound has a boiling point of 285.0 °C, flammability rating of 1, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 215.9 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

ONCc1c(Br)cccc1Br

The compound has a boiling point of 280.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 246.92 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

C#Cc1c(Br)cccc1Br

The compound has a boiling point of 326.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 215.91 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

NNc1cc(Br)cnc1Br

The compound has a boiling point of 280.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 229.93 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

O=CCc1cc(Br)cnc1Br

The compound has a boiling point of 310.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 0, solubility rating of 1, and a molar mass of 246.0 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

NOCc1c(Br)cccc1Br

The compound has a boiling point of 280.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 259.91 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

C=CC(=O)c1c(Br)cccc1Br

The compound has a boiling point of 320.5 °C, flammability rating of 1, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 251.91 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

SCc1c(Br)cccc1Br

The compound has a boiling point of 310.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 246.0 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

COCOc1c(Br)cc(F)cc1Br

The compound has a boiling point of 280.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 282.9 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

CCCCNC(=O)c1cc(Br)ccc1Br

The compound has a boiling point of 320.5 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 287.05 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

O=C(Nc1ccncc1)c1cc(Br)ccc1Br

The compound has a boiling point of 350.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 319.0 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

CCCCCCNC(=O)c1cc(Br)ccc1Br

The compound has a boiling point of 350.0 °C, flammability rating of 1, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 327.07 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

O=C(O)c1cnn(Cc2ccccc2Br)c1Br

The compound has a boiling point of 350.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 344.1 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

COC(CNC(=O)c1cc(Br)ccc1Br)OC

The compound has a boiling point of 320.5 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 335.05 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

COC(=O)C(C)NC(=O)c1cc(Br)ccc1Br

The compound has a boiling point of 320.5 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 312.04 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

O=C(Cc1ccc(Br)cc1)Nc1ncccc1Br

The compound has a boiling point of 350.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 312.1 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

O=C(Nc1ccc(Cl)cc1)c1cc(Br)ccc1Br

The compound has a boiling point of 350.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 327.0 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

O=C(Nc1ccccc1Cl)c1cc(Br)ccc1Br

The compound has a boiling point of 350.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 344.04 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

Cc1ccccc1NC(=O)c1cc(Br)ccc1Br

The compound has a boiling point of 350.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 327.1 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

C=C(C)COc1c(Br)cc(C=O)cc1Br

The compound has a boiling point of 280.5 °C, flammability rating of 1, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 282.0 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

Cc1cc(Br)c(S(=O)(=O)NC(C)(C)C)cc1Br

The compound has a boiling point of 350.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 355.1 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

O=C(c1ccc(Br)nc1)c1ccc(Br)nc1

The compound has a boiling point of 350.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 344.04 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

Nc1ccccc1NC(=O)c1cc(Br)ccc1Br

The compound has a boiling point of 360.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 317.0 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

O=S(=O)(Cl)Cc1cccc(Br)c1Br

The compound has a boiling point of 280.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 306.94 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

Cc1c(Br)csc1Br

The compound has a boiling point of 279.5 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 215.94 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

O=C(O)Cc1cc(Br)sc1Br

The compound has a boiling point of 320.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 282.9 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

CC(=O)SCc1cccc(Br)c1Br

The compound has a boiling point of 310.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 272.05 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

O=C(Nc1ncccc1Br)c1ccccc1Br

The compound has a boiling point of 350.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 311.1 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

O=C(Nc1ncccc1Br)c1ccc(Br)cc1

The compound has a boiling point of 350.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 320.1 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

Cc1ccc(Br)c(NC(=O)c2cccc(Br)c2)c1

The compound has a boiling point of 350.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 344.1 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

O=C(Nc1cccc(Cl)c1)c1cc(Br)ccc1Br

The compound has a boiling point of 350.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 344.44 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

CCOC(=O)CNC(=O)c1cc(Br)ccc1Br

The compound has a boiling point of 320.5 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 322.05 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

O=C(Nc1ccccc1F)c1cc(Br)ccc1Br

The compound has a boiling point of 350.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 344.0 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

CC(=O)NCCNC(=O)c1cc(Br)ccc1Br

The compound has a boiling point of 320.5 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 312.05 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

CCCCCNC(=O)c1cc(Br)ccc1Br

The compound has a boiling point of 320.5 °C, flammability rating of 1, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 313.06 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

CCOC(=O)C(N)Cc1cc(Br)cc(Br)c1

The compound has a boiling point of 320.5 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 313.04 g/mol.

Based on the given SMILES string, predict the monomer's relevant properties.

CC(C)=CCOc1c(Br)cc(Br)cc1C=O

The compound has a boiling point of 280.5 °C, flammability rating of 1, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 282.0 g/mol.