python_code
stringlengths
0
1.02M
repo_name
stringlengths
9
48
file_path
stringlengths
5
114
import atexit import getpass import os import pwd import shutil import subprocess as sp import tempfile import warnings import genomepy.utils from pybedtools import BedTool import pysam import pandas as pd def check_path(arg, error_missing=True): """Expand all paths. Can check for existence.""" if arg is None: return arg args = [arg] if isinstance(arg, str) else arg paths = [cleanpath(arg) for arg in args] if error_missing: for path in paths: if not os.path.exists(path): raise FileNotFoundError( f"'{os.path.basename(path)}' not found in '{os.path.dirname(path)}'." ) return paths[0] if isinstance(arg, str) else paths def cleanpath(path): """Expand any path input to a literal path output""" return os.path.abspath( # expand relative paths (inc './' and '../') os.path.expanduser( # expand '~' os.path.expandvars(path) # expand '$VARIABLES' ) ) def shhh_bedtool(func): """ Decorator that silences pybedtools RuntimeWarnings such as `line buffering (buffering=1) isn't supported in binary mode` """ def wrapper(*args, **kwargs): with warnings.catch_warnings(): warnings.filterwarnings("ignore", category=RuntimeWarning) func(*args, **kwargs) return wrapper @shhh_bedtool def bed_sort(bed): """ Sort a bed file. """ tmpdir = tempfile.mkdtemp(prefix="ANANSE_") try: tmpfile = os.path.join(tmpdir, os.path.basename(bed)) BedTool(bed).sort(output=tmpfile) shutil.copy2(tmpfile, bed) finally: shutil.rmtree(tmpdir, ignore_errors=True) @shhh_bedtool def bed_merge(list_of_beds, merged_bed): """ merge any number of bed files (merges overlapping regions) """ bed = BedTool(list_of_beds[0]) if list_of_beds[1:]: bed = bed.cat(*list_of_beds[1:]) bed.saveas(merged_bed) @shhh_bedtool def count_reads(bams, peakfile, bed_output): """ Count bam reads in putative enhancer regions """ # replace with gimmemotifs.preprocessing.coverage_table() bed = BedTool(peakfile) bam_list = bams if isinstance(bams, list) else [bams] bed.multi_bam_coverage(bams=bam_list, output=bed_output) def samc(ncore): """set decent samtools range for samtools functions (1-5 total threads)""" return max(0, min(ncore - 1, 4)) def bam_index(bam, force=True, ncore=1): if force or not os.path.exists(f"{bam}.bai"): index_parameters = [f"-@ {samc(ncore)}", bam] pysam.index(*index_parameters) # noqa def bam_sort(bam, ncore=1): tmpdir = tempfile.mkdtemp(prefix="ANANSE_") try: sorted_bam = os.path.join(tmpdir, os.path.basename(bam)) sort_parameters = [f"-@ {samc(ncore)}", "-o", sorted_bam, bam] pysam.sort(*sort_parameters) # noqa: pysam bug shutil.copy2(sorted_bam, bam) bam_index(bam, force=True, ncore=ncore) finally: shutil.rmtree(tmpdir, ignore_errors=True) def bam_merge(list_of_bams, merged_bam, ncore=1): """ merge any number of (sorted) bam files """ [bam_index(bam, force=False, ncore=ncore) for bam in list_of_bams] if len(list_of_bams) > 1: merge_parameters = ["-f", f"-@ {samc(ncore)}", merged_bam] + list_of_bams pysam.merge(*merge_parameters) # noqa: pysam bug bam_index(merged_bam) else: # os.symlink() doesn't work with multi_bam_coverage() bam = list_of_bams[0] shutil.copy2(bam, merged_bam) shutil.copy2(f"{bam}.bai", f"{merged_bam}.bai") def mosdepth(bed, bam, bed_output, ncore=1): """ Count (median per base overlap of) bam reads in putative enhancer regions """ ncore = min(4, ncore) tmpdir = tempfile.mkdtemp(prefix="ANANSE_") try: prefix = os.path.join(tmpdir, "bam_coverage") cmd = f"mosdepth -nxm -t {ncore} -b {bed} {prefix} {bam}" sp.check_call(cmd, shell=True) tmp_bed_output = f"{prefix}.regions.bed" cmd = f"gunzip -f {tmp_bed_output}.gz" sp.check_call(cmd, shell=True) shutil.copy2(tmp_bed_output, bed_output) finally: shutil.rmtree(tmpdir, ignore_errors=True) # def bed_sum_coverages(multi_bam_coverage, sum_bam_coverage): # """ # MultiBamCov returns a BED3+n with one column per bam. # This function sums up all bam counts and returns a BED3+1. # """ # bed = pd.read_csv(multi_bam_coverage, header=None, sep="\t") # columns = bed.shape[1] # if columns != 4: # bed3 = bed.iloc[:, :3] # scores = bed.iloc[:, 3:].sum(axis=1) # bed = pd.concat([bed3, scores], axis=1) # bed.to_csv(sum_bam_coverage, sep="\t", header=False, index=False) # def non_empty_files(files, error_msg, size_threshold=10, verbose=True): # """Check list of files for content # # Args: # files: list of filepaths # error_msg: message for all empty files # size_threshold: minimum size to be considered non-empty # verbose: return warnings? # # Returns: # list of non-empty files # """ # ret_files = [] # for file in files: # if os.path.getsize(file) > size_threshold: # ret_files.append(file) # elif verbose: # logger.warning(f"Empty file: '{os.path.basename(file)}'") # # if not ret_files: # logger.exception(error_msg) # exit(1) # return ret_files def mytmpdir(): """ returns a temp directory that is removed when the process is completed the directory is not removed if the process is killed by the user """ if not hasattr(mytmpdir, "dir") or not mytmpdir.dir: # can also be removed with clean_tmp() mytmpdir.dir = tempfile.mkdtemp(prefix=f"ANANSE_{os.getpid()}.") atexit.register(shutil.rmtree, mytmpdir.dir, ignore_errors=True) return mytmpdir.dir def clean_tmp(): """ remove leftover temp dirs temp dirs are left if ANANSE was killed by the user """ user = getpass.getuser() tempdir = tempfile.gettempdir() # all tmp files/directories starting with "ANANSE_" & owner by the user tmp_files = os.listdir(tempdir) ananse_files = [ os.path.join(tempdir, f) for f in tmp_files if f.startswith("ANANSE_") ] user_files = [ f for f in ananse_files if os.path.exists(f) and pwd.getpwuid(os.stat(f).st_uid).pw_name == user ] # delete _ = [genomepy.utils.rm_rf(f) for f in user_files] def get_motif_factors(motif, indirect=True): """Return all TFs that are associated with a motif.""" motif_factors = [] for factor_type, factors in motif.factors.items(): if factor_type == "direct" or indirect: motif_factors += factors return motif_factors def check_input_factors(factors): """Check factors. Factors can either be a list of transcription factors, or a filename of a file that contains TFs. Returns a list of factors. Returns ------- list List of TF names. """ # Load factors if factors is None: return # if factors is a string, assume it's a filename if isinstance(factors, str): fname = factors # if factors is a list of 1, and it exists, assume it's a filename elif isinstance(factors, list) and len(factors) == 1: fname = factors[0] # It's a list with more than one value, assuming it's a list of TF names. else: return factors if not os.path.exists(fname): raise ValueError(f"Factors file '{factors}' does not exist") factors = [line.strip() for line in open(fname)] return factors def view_h5(fname, tfs=None, fmt="wide"): """Extract information from an ANANSE binding.h5 file. Parameters ---------- fname : str File name (binding.h5). tfs : list, optional List of transcription factor names to extract. All TFs are used by default. fmt : str, optional Return output in 'wide' or in 'long' format. Default is 'wide'. Returns ------- pandas.Dataframe """ if fmt not in ["wide", "long"]: raise ValueError("fmt should be either 'wide' or 'long'") with pd.HDFStore(fname) as hdf: if tfs is None: tfs = [x for x in dir(hdf.root) if not x.startswith("_")] idx = hdf.get("_index") df = pd.DataFrame(index=idx.index) for tf in tfs: df[tf] = hdf.get(tf).values if fmt == "long": df.index.rename("loc", inplace=True) df = df.reset_index().melt( id_vars=["loc"], value_name="prob", var_name="factor" ) return df
ANANSE-master
ananse/utils.py
#!/usr/bin/env python # Copyright (c) 2009-2019 Quan Xu <qxuchn@gmail.com> # # This module is free software. You can redistribute it and/or modify it under # the terms of the MIT License, see the file COPYING included with this # distribution. """Build gene regulatory network""" # Python imports import os import math import re import shutil import sys import warnings import numpy as np import pandas as pd from scipy.stats import rankdata from sklearn.preprocessing import minmax_scale import dask.dataframe as dd from tempfile import NamedTemporaryFile, mkdtemp from dask.distributed import progress from loguru import logger from pandas import HDFStore from tqdm.auto import tqdm import pyranges as pr warnings.filterwarnings("ignore") PACKAGE_DIR = os.path.dirname(__file__) class Network(object): def __init__( self, ncore=1, genome="hg38", gene_bed=None, include_promoter=False, include_enhancer=True, ): """ infer cell type-specific gene regulatory network Parameters ---------- ncore : int Specifies the number of threads to use during analysis. (default: 1) genome : str The genome that is used for the gene annotation and the enhancer location. (default: "hg38") gene_bed : str, optional Gene annotation for the genome specified with -g as a 12 column BED file. (default: None) include_promoter : bool Include or exclude promoter peaks (<= TSS +/- 2kb) in network inference. (default: False) include_enhancer : bool Include or exclude enhancer peaks (> TSS +/- 2kb) in network inference. (default: True) """ self.ncore = ncore self.genome = genome self._tmp_files = [] # # Motif information file # if pfmfile is None: # self.pfmfile = "../data/gimme.vertebrate.v5.1.pfm" # else: # self.pfmfile = pfmfile # self.motifs2factors = self.pfmfile.replace(".pfm", ".motif2factors.txt") # self.factortable = self.pfmfile.replace(".pfm", ".factortable.txt") # Gene information file self.gene_bed = gene_bed if gene_bed is None: if self.genome in ["hg38", "hg19"]: self.gene_bed = os.path.join( PACKAGE_DIR, "db", f"{self.genome}.genes.bed" ) else: raise TypeError("Please provide a gene bed file with -a argument.") if not os.path.exists(self.gene_bed): raise FileNotFoundError( f"Could not find the gene bed file {self.gene_bed}." ) # self.promoter = promoter self.include_promoter = include_promoter self.include_enhancer = include_enhancer @staticmethod def unique_enhancers(fname): """Extract a list of unique enhancers. Parameters ---------- fname : str File name of a tab-separated file that contains an 'enhancer' column. Returns ------- PyRanges object with enhancers """ logger.info("reading enhancers") # Read enhancers from binding file header = pd.read_table(fname, nrows=0) idx = header.columns.get_loc("enhancer") skiprows = 1 chunksize = 2_000_000 enhancers = np.array([]) while True: try: tmp = pd.read_table( fname, usecols=[idx], header=None, nrows=chunksize, skiprows=skiprows, ) except pd.errors.EmptyDataError: break if tmp.shape[0] == 0 or tmp.iloc[0, 0] in enhancers: break skiprows += chunksize enhancers = np.hstack((enhancers, tmp.iloc[:, 0].unique())) enhancers = np.unique(enhancers) # Split into columns and create PyRanges object p = re.compile("[:-]") enhancers = pr.PyRanges( pd.DataFrame( [re.split(p, e) for e in enhancers], columns=["Chromosome", "Start", "End"], ) ) return enhancers @staticmethod def distance_weight( include_promoter=False, include_enhancer=True, alpha=1e4, maximum_distance=100_000, full_weight_region=5000, promoter_region=2000, ): """Build weight distribution based on distance to TSS. The basic idea is similar to Wang et al. [1], with some modifications. The resulting weight ranges from 0 (far from the TSS) to 1 (near the TSS) and is based on several different variables. If `include_promoter` is `True`, then distances smaller than `promoter_region` are included, otherwise they are excluded, the weight is set to 0. The `full_weight_region` parameters determines the region where the weight will be 1, regardless of distance. The `maximum_distance` parameter sets the maximum distance to consider. The weight decays with an increasing distance, starting from 1 at `full_weight_region` to 0 at `maximum_distance`. The `alpha` parameters controls the decay. Parameters ---------- include_promoter : bool, optional Include promoter regions. Default is False. include_enhancer : bool, optional Include enhancer regions, ie. regions that are distal to the promoter. alpha : float, optional Controls weight decay, default is 1e4. maximum_distance : int, optional Maximum distance from TSS to consider. Default is 100kb. full_weight_region : int, optional Distance where regions will receive the full weight. Default is 5kb. promoter_region : int, optional Promoter region, default is 2kb. Returns ------- DataFrame with two columns: distance and weight. References ---------- ..[1] Wang S, Zang C, Xiao T, Fan J, Mei S, Qin Q, Wu Q, Li X, Xu K, He HH, Brown M, Meyer CA, Liu XS. "Modeling cis-regulation with a compendium of genome-wide histone H3K27ac profiles." Genome Res. 2016 Oct;26(10):1417-1429. doi: 10.1101/gr.201574.115. PMID: 27466232 """ u = -math.log(1.0 / 3.0) * 1e5 / alpha promoter_weight = int(include_promoter) enhancer_weight = int(include_enhancer) weight1 = pd.DataFrame( { "weight": [promoter_weight for _ in range(0, promoter_region + 1)], "dist": range(0, promoter_region + 1), } ) weight2 = pd.DataFrame( { "weight": [ enhancer_weight for _ in range(promoter_region + 1, full_weight_region + 1) ], "dist": range(promoter_region + 1, full_weight_region + 1), } ) weight3 = pd.DataFrame( { "weight": [ enhancer_weight * 2.0 * math.exp(-u * math.fabs(z) / 1e5) / (1.0 + math.exp(-u * math.fabs(z) / 1e5)) for z in range(1, maximum_distance - full_weight_region + 1) ], "dist": range(full_weight_region + 1, maximum_distance + 1), } ) weight = pd.concat([weight1, weight2, weight3]) return weight def enhancer2gene( self, peak_pr, up=100_000, down=100_000, alpha=1e4, promoter=2000, full_weight_region=5000, ): """Couple enhancers to genes. Parameters ---------- peak_pr : PyRanges object PyRanges object with enhancer regions. up : int, optional Upstream maximum distance, by default 100kb. down : int, optional Upstream maximum distabce, by default 100kb. alpha : float, optional Parameter to control weight decay, by default 1e4. promoter : int, optional Promoter region, by default 2000. full_weight_region : int, optional Region that will receive full weight, by default 5000. Returns ------- pandas.DataFrame DataFrame with enhancer regions, gene names, distance and weight. """ genes = region_gene_overlap(peak_pr, self.gene_bed) # Get the distance from center of enhancer to TSS # Correct for extension genes["dist"] = ( (genes["Start_b"] + genes["End_b"]) / 2 - genes["Start"] ).astype(int) genes.loc[genes["Strand"] == "+", "dist"] -= up genes.loc[genes["Strand"] == "-", "dist"] -= down genes["dist"] = np.abs(genes["dist"]) # Create region in chr:start:end format genes["loc"] = ( genes["Chromosome"].astype(str) + ":" + genes["Start_b"].astype(str) + "-" + genes["End_b"].astype(str) ) # Keep the gene-enhancer combination with the smallest distance genes = genes.sort_values("dist").drop_duplicates( subset=["loc", "Name"], keep="first" ) # Return the right stuff genes = genes.set_index("loc")[["Name", "dist"]].rename( columns={"Name": "gene"} ) # Get distance-based wight weight = self.distance_weight( include_promoter=self.include_promoter, include_enhancer=self.include_enhancer, alpha=alpha, promoter_region=promoter, full_weight_region=full_weight_region, ).set_index("dist") genes = genes.join(weight, on="dist") return genes def aggregate_binding( self, binding_fname, tfs=None, up=1e5, down=1e5, alpha=None, promoter=2000, full_weight_region=5000, combine_function="sum", ): """Summarize all binding signal per gene per TF. Return a dask delayed computation object. Parameters ---------- binding_fname : str Filename of binding network. tfs : list, optional List of transcription factor names, by default None, which means that all TFs will be used. up : int, optional Maximum upstream region to include, by default 1e5 down : [type], optional Maximum downstream region to include, by default 1e5 alpha : float, optional Distance at which the weight will be half, by default None promoter : int, optional Promoter region, by default 2000 full_weight_region : int, optional Region that will receive full weight, regardless of distance, by default 5000. combine_function : str, optional How to combine signal of weighted enhancers, by default "sum". Valid options are "sum", "mean" or "max". Returns ------- dask.DataFrame DataFrame with delayed computations. """ if not os.path.exists(binding_fname): raise ValueError(f"File {binding_fname} does not exist!") if combine_function not in ["mean", "max", "sum"]: raise NotImplementedError( "Unknown combine function, valid options are: mean, max, sum" ) maximum_distance = max(up, down) if alpha is None: alpha = maximum_distance / 10 if promoter > maximum_distance: raise ValueError( "promoter region is larger than the maximum distance to use" ) hdf = HDFStore(binding_fname, "r") # TODO: This is hacky (depending on "_"), however the hdf.keys() method is # much slower. Currently all TF names do *not* start with "_" all_tfs = [x for x in dir(hdf.root) if not x.startswith("_")] logger.info(f"Binding file contains {len(all_tfs)} TFs.") if tfs is None: tfs = all_tfs else: not_valid = set(all_tfs) - set(tfs) if len(not_valid) > 1: logger.warning( f"The following TFs are found in {binding_fname}, but do not seem to be TFs:" ) logger.warning(", ".join(not_valid)) tfs = set(tfs) & set(all_tfs) logger.info(f"Using {len(tfs)} TFs.") # Read enhancer index from hdf5 file enhancers = hdf.get(key="_index") chroms = enhancers.index.to_series().str.replace(":.*", "").unique() tmpdir = mkdtemp() self._tmp_files.append(tmpdir) # mark for deletion later # Summarize enhancers per gene, per chromosome. In principle this could # also be done at once, however, the memory usage of dask is very finicky. # This is a pragmatic solution, that seems to work well, does not use a # lot of memory and is not too slow (~50 seconds per chromosome). for chrom in chroms: logger.info(f"Aggregating binding for genes on {chrom}") # Get the index of all enhancers for this specific chromosome idx = enhancers.index.str.contains(f"^{chrom}:") idx_i = np.arange(enhancers.shape[0])[idx] # Create a pyranges object enhancer_pr = pr.PyRanges( enhancers[idx] .index.to_series() .str.split(r"[:-]", expand=True) .rename(columns={0: "Chromosome", 1: "Start", 2: "End"}) ) # Link enhancers to genes on basis of distance to annotated TSS gene_df = self.enhancer2gene( enhancer_pr, up=up, down=down, alpha=alpha, promoter=promoter, full_weight_region=full_weight_region, ) gene_df = gene_df.dropna() bp = pd.DataFrame(index=enhancers[idx].index) for tf in tqdm( tfs, total=len(tfs), desc="Aggregating", unit_scale=1, unit=" TFs" ): # Load TF binding data for this chromosome. # hdf.get() is *much* faster here than pd.read_hdf() bp[tf] = hdf.get(key=tf)[idx_i].values # Skipping everything with weight 0, as it won't be counted anyway. gene_df = gene_df[gene_df["weight"] > 0] # Make sure binding score and enhancers match up (i.e. same enhancer # is used for multiple genes) gene_df = gene_df.join(bp).dropna() bp = gene_df[tfs] gene_df = gene_df[["gene", "weight"]] # Multiply binding score by weight bp = bp.mul(gene_df["weight"], axis=0) # Summarize weighted score per gene bp["gene"] = gene_df["gene"] tmp = bp.groupby("gene") if combine_function == "mean": tmp = tmp.mean() elif combine_function == "max": tmp = tmp.max() elif combine_function == "sum": tmp = tmp.sum() # Go from wide to long format, to be able to merge with other # information later tmp = tmp.reset_index().melt( id_vars=tmp.index.name, var_name="tf", value_name="weighted_binding" ) # Create dataframe with two columns: tf_gene and weighted_binding score tmp["tf_target"] = tmp["tf"] + "_" + tmp["gene"] tmp[["tf_target", "weighted_binding"]].to_csv( os.path.join(tmpdir, f"{chrom}.csv"), index=False ) hdf.close() ddf = dd.read_csv(os.path.join(tmpdir, "*.csv")).set_index("tf_target") return ddf def _save_temp_expression(self, df, name): tmp = df.rename(columns={"tpm": f"{name}_expression"}) tmp[f"{name}_expression"] = minmax_scale(tmp[f"{name}_expression"].rank()) tmp.index.rename(name, inplace=True) tmp["key"] = 0 fname = NamedTemporaryFile( prefix="ananse.", suffix=f".{name}.parquet", delete=False ).name self._tmp_files.append(fname) tmp.reset_index().to_parquet(fname, index=False) return fname def create_expression_network( self, fin_expression, column="tpm", tfs=None, bindingfile=None ): """Create a gene expression based network. Based on a file with gene expression levels (a TPM column), a dask DataFrame is generated with the combined expression levels of the tf and the target gene. By default, the expresison levels are ranked and subsequently scaled between 0 and 1. Parameters ---------- fin_expression : str or list One of more files that contains gene expression data. First column should contain the gene names in HGNC symbols. column : str, optional Column name that contains gene expression, 'tpm' by default (case insensitive). tfs : list, optional List of TF gene names. All TFs will be used by default. bindingfile : str, optional Output file from ANANSE binding. Returns ------- Dask DataFrame with gene expression based values. """ # Convert to a list of filename(s) if isinstance(fin_expression, str): fin_expression = [fin_expression] # Read all expression input files and take the mean expression per gene re_column = re.compile(fr"^{column}$", re.IGNORECASE) expression = pd.DataFrame( pd.concat( [ pd.read_table(f, index_col=0).filter(regex=re_column) for f in fin_expression ], axis=1, ).mean(1), columns=[column], ) expression[column] = np.log2(expression[column] + 1e-5) genes = pd.read_table( self.gene_bed, usecols=[3], comment="#", names=["name"], index_col=0 ) overlap = len(genes.index.intersection(expression.index)) if overlap / expression.shape[0] < 0.1: logger.error( "gene annotation identifiers do not seem to match between annotation and expression files!" ) sample_exp = ", ".join(expression.sample(5).index.values) sample_gene = ", ".join(genes.sample(5).index.values) logger.error(f"expression sample: {sample_exp}") logger.error(f"annotation sample: {sample_gene}") sys.exit(1) # Create the TF list, based on valid transcription factors if tfs is None: try: act = pd.read_hdf(bindingfile, key="_factor_activity") if "factor" in act.columns: act = act.set_index("factor") tfs = list(set(act.index.tolist())) except KeyError: tffile = os.path.join(PACKAGE_DIR, "db", "tfs.txt") tfs = pd.read_csv(tffile, header=None)[0].tolist() # Save TFs and targets as temporary files idx = expression.index[expression.index.isin(tfs)] tmp = expression.loc[idx] if tmp.shape[0] == 0: logger.error( "None of the transcription factors are found in your expression file." ) logger.error( "If you have human data, please make sure you use HGNC symbols (gene names)." ) logger.error( "If you have non-human data, you have to create a custom motif to gene mapping." ) logger.error("See this link for one possibility to create this file: ") logger.error( "https://gimmemotifs.readthedocs.io/en/stable/reference.html#command-gimme-motif2factors" ) logger.error( "If you use a custom motif mapping, you will also have (re)run `gimme binding` with this file." ) sys.exit(1) tf_fname = self._save_temp_expression(tmp, "tf") target_fname = self._save_temp_expression(expression, "target") # Read files (delayed) and merge on 'key' to create a Cartesian product # combining all TFs with all target genes. a = dd.read_parquet(tf_fname) b = dd.read_parquet(target_fname) network = a.merge(b, how="outer") # Use one-column index that contains TF and target genes. # This is necessary for dask, as dask cannot merge on a MultiIndex. # Otherwise this would be an inefficient and unnecessary step. network["tf_target"] = network["tf"] + "_" + network["target"] network = network[ ["tf", "target", "tf_target", "tf_expression", "target_expression"] ] return network def run_network( self, binding, fin_expression=None, tfs=None, outfile=None, up=1e5, down=1e5, alpha=None, promoter=2000, full_weight_region=5000, ): """Create network. Parameters ---------- binding : str Filename with binding information. Should contain at least three columns: "factor", "enhancer" and "binding". fin_expression : str or list, optional Filename of list of filenames with expression information. tfs : list, optional List of transcription factors to use, by default None, which means all TFs will be used. outfile : str, optional Output file. If None, returns a dataframe. up : int, optional Upstream maximum distance, by default 100kb. down : int, optional Upstream maximum distabce, by default 100kb. alpha : float, optional Parameter to control weight decay, by default 1e4. promoter : int, optional Promoter region, by default 2000. full_weight_region : int, optional Region that will receive full weight, by default 5000.""" # Expression base network logger.info("Loading expression") df_expression = self.create_expression_network( fin_expression, tfs=tfs, bindingfile=binding ) # Use a version of the binding network, either promoter-based, enhancer-based # or both. if self.include_promoter or self.include_enhancer: df_binding = self.aggregate_binding( binding, tfs=tfs, up=up, down=down, alpha=alpha, promoter=promoter, full_weight_region=full_weight_region, combine_function="sum", ) try: act = pd.read_hdf(binding, key="_factor_activity") if "factor" in act.columns: act = act.set_index("factor") logger.info("Reading factor activity") act.index.name = "tf" act["activity"] = minmax_scale(rankdata(act["activity"], method="min")) df_expression = df_expression.merge( act, right_index=True, left_on="tf", how="left" ).fillna(0.5) except KeyError: pass df_expression = df_expression.drop(columns=["tf"]) # This is where the heavy lifting of all delayed computations gets done # logger.info("Computing network") if fin_expression is not None: result = df_expression.merge( df_binding, right_index=True, left_on="tf_target", how="left" ) result = result.persist() result = result.fillna(0) logger.info("Computing network") progress(result) result = result.compute() else: result = df_binding result["weighted_binding"] = minmax_scale( rankdata(result["weighted_binding"], method="min") ) columns = [ "tf_expression", "target_expression", "weighted_binding", "activity", ] columns = [col for col in columns if col in result] logger.info(f"Using {', '.join(columns)}") # Combine the individual scores result["prob"] = result[columns].mean(1) else: result = df_expression result["prob"] = result[["tf_expression", "target_expression"]].mean(1) result = result.compute() if outfile: logger.info("Writing network") out_dir = os.path.abspath(os.path.dirname(outfile)) os.makedirs(out_dir, exist_ok=True) result[["tf_target", "prob"]].to_csv(outfile, sep="\t", index=False) else: return result[["tf_target", "prob"]] def __del__(self): if not hasattr(self, "_tmp_files"): return for fname in self._tmp_files: if os.path.exists(fname): shutil.rmtree(fname, ignore_errors=True) def region_gene_overlap( region_pr, gene_bed, up=100_000, down=100_000, ): """ Couple enhancers to genes. Parameters ---------- region_pr : PyRanges object PyRanges object with enhancer regions. gene_bed : str gene_bed up : int, optional Upstream maximum distance, by default 100kb. down : int, optional Upstream maximum distance, by default 100kb. Returns ------- pandas.DataFrame DataFrame with enhancer regions, gene names, distance and weight. """ genes = pr.read_bed(gene_bed) # Convert to DataFrame & we don't need intron/exon information genes = genes.as_df().iloc[:, :6] # Get the TSS only genes.loc[genes["Strand"] == "+", "End"] = genes.loc[ genes["Strand"] == "+", "Start" ] genes.loc[genes["Strand"] == "-", "Start"] = genes.loc[ genes["Strand"] == "-", "End" ] # Extend up and down genes.loc[genes["Strand"] == "+", "Start"] -= up genes.loc[genes["Strand"] == "+", "End"] += down genes.loc[genes["Strand"] == "-", "Start"] -= down genes.loc[genes["Strand"] == "-", "End"] += up # Perform the overlap genes = pr.PyRanges(genes) genes = genes.join(region_pr).as_df() return genes
ANANSE-master
ananse/network.py
import multiprocessing as mp import os import tempfile import shutil import dask.dataframe as dd import dask.diagnostics import genomepy from gimmemotifs.scanner import scan_regionfile_to_table from gimmemotifs.utils import pfmfile_location from loguru import logger import numpy as np import pandas as pd import pickle import pysam import qnorm from scipy import stats from sklearn.preprocessing import minmax_scale from ananse.utils import ( bed_sort, bed_merge, bam_index, bam_sort, mosdepth, ) from ananse.distributions import Distributions class CombineBedFiles: def __init__(self, genome, peakfiles, verbose=True): self.genome = genome self.list_of_peakfiles = ( peakfiles if isinstance(peakfiles, list) else [peakfiles] ) self.verbose = verbose @staticmethod def is_narrowpeak(bed, check_values=True): """ Check BED type by column count. Check if peak values are not all zeroes unless check_values is False. Accepts a BED file (including narrowPeak, broadPeak, etc.) Returns bool """ with open(bed) as b: for line in b: if line.startswith("#"): continue line = line.split("\t") cols = len(line) break # narrowPeak has 10 columns # and the peak column is >= 0 if cols != 10 or int(line[9]) < 0: return False if not check_values: return True # check if the peak values aren't all zeroes summit_values = 0 sample_size = 20 # check an arbitrary number of lines with open(bed) as b: for n, line in enumerate(b): if line.startswith("#"): continue line = line.split("\t") peak_val = int(line[9]) # value must be >=0 if peak_val < 0: return False summit_values += peak_val if n >= sample_size: break if summit_values > 0: return True return False @staticmethod def bed_resize( genome, bed_in, bed_out, width=200, narrowpeak=False, fix_outliers=False, output_bed3=True, verbose=True, ): """ Set bed region width. If the input bed is a narrowPeak file (narrowpeak=True), center region on the summit (start+peak). Otherwise center on the middle of the region. If fix_outliers is set to True, shift regions to fit their chromosomes. Otherwise drop these regions. If output_bed3 is set to False, output the whole bed file. """ half_seqlen = width // 2 chrom_sizes = genomepy.Genome(genome).sizes missing_chrm = [] if narrowpeak: def get_summit(_start, _, summit_offset): return _start + int(summit_offset) summit_col = 9 else: def get_summit(_start, _end, _): return (_start + _end) // 2 summit_col = 0 # unused with open(bed_in) as old, open(bed_out, "w") as new: for line in old: if line.startswith("#"): continue line = line.split("\t") chrm = str(line[0]) if chrm not in chrom_sizes.keys(): missing_chrm.append(chrm) continue start = int(line[1]) end = int(line[2]) rest = line[3:] if not output_bed3 else [] chrm_len = chrom_sizes[chrm] if width == end - start: nstart = str(start) nend = str(end) elif chrm_len <= width: if not fix_outliers: continue nstart = str(0) nend = str(chrm_len) else: summit = get_summit(start, end, line[summit_col]) if not fix_outliers: nstart = str(summit - half_seqlen) nend = str(summit + half_seqlen) if int(nstart) < 0 or int(nend) > chrm_len: continue else: # adjust the summit for the chromosome boundaries summit = max(summit, 0 + half_seqlen) summit = min(summit, chrm_len - half_seqlen) nstart = str(summit - half_seqlen) nend = str(summit + half_seqlen) new.write("\t".join([chrm, nstart, nend] + rest) + "\n") if missing_chrm and verbose: logger.warning( "The following contigs were present in " + f"'{os.path.basename(bed_in)}', " + "but were missing in the genome file: " + f"{', '.join(list(set(missing_chrm)))}\n" ) return bed_out def run(self, outfile, width=200, force=False): if force or not os.path.exists(outfile): if self.verbose: logger.info("Combining bed files") tmpdir = tempfile.mkdtemp(prefix="ANANSE_") try: list_of_beds = [] for peakfile in self.list_of_peakfiles: # use narrowPeak Peak location for region centering if possible is_np = self.is_narrowpeak(peakfile) resized_peakfile = os.path.join(tmpdir, os.path.basename(peakfile)) # resize each BED region to 200 BP self.bed_resize( genome=self.genome, bed_in=peakfile, bed_out=resized_peakfile, width=width, narrowpeak=is_np, verbose=self.verbose, ) bed_sort(resized_peakfile) list_of_beds.append(resized_peakfile) # merge resized beds into one merged_bed = os.path.join(tmpdir, "merged") bed_merge(list_of_beds=list_of_beds, merged_bed=merged_bed) shutil.copy2(merged_bed, outfile) finally: shutil.rmtree(tmpdir, ignore_errors=True) class ScorePeaks: def __init__(self, bams, bed, ncore=1, verbose=True): self.list_of_bams = bams if isinstance(bams, list) else [bams] self.bed = bed # one bed file with all putative enhancer binding regions self.verbose = verbose self.ncore = ncore def compatibility_check(self): """ Check if any chromosome in each bams file are found in the bed file. This filters out datasets mapped to different genomes. """ error = False bed_chromosomes = set( pd.read_csv(self.bed, sep="\t", header=None)[0].astype(str) ) for bam in self.list_of_bams: bam_header = pysam.view(bam, "-H").split("\n") # noqa: pysam bug for line in bam_header: if not line.startswith("@SQ"): continue # extract chrom (ex: '@SQ\tSN:chr11\tLN:100316') chrom = line.split("\tSN:")[1].split("\tLN:")[0] # if any chrom matches: next bam if chrom in bed_chromosomes: break else: logger.exception( f"Chromosomes in the peak file(s) do not match any in bam file '{os.path.basename(bam)}'!\n" f"Does {self.bed} contain any regions, and " "are both bam- and peak file(s) mapped to the same genome assembly?\n" ) error = True if error: exit(1) def peaks_count(self, outdir): """ count bam reads in the bed regions returns one bed file for each bam in outdir """ # linear script: # coverage_files = [] # for bam in self.list_of_bams: # bed_output = os.path.join(outdir, os.path.basename(bam).replace(".bam", ".regions.bed")) # coverage_files.append(bed_output) # mosdepth(self.bed, bam, bed_output, self.ncore) # return coverage_files # parallel script: nbams = len(self.list_of_bams) npool = min(self.ncore, nbams) ncore = min(4, self.ncore // npool) # 1-4 cores/bam # list with tuples. each tuple = one run mosdepth_params = [] coverage_files = [] for bam in self.list_of_bams: bed_output = os.path.join( outdir, os.path.basename(bam).replace(".bam", ".regions.bed") ) mosdepth_params.append((self.bed, bam, bed_output, ncore)) coverage_files.append(bed_output) pool = mp.Pool(npool) try: pool.starmap_async(mosdepth, mosdepth_params) finally: # To make sure processes are closed in the end, even if errors happen pool.close() pool.join() return coverage_files @staticmethod def peaks_merge(coverage_files, bed_output, ncore=1): """ averages all peaks_count outputs uses quantile normalization to normalize for read depth returns one BED 3+1 file """ ncore = min(4, ncore) bed = pd.read_csv(coverage_files[0], header=None, sep="\t") if len(coverage_files) > 1: for file in coverage_files[1:]: scores = pd.read_csv(file, header=None, sep="\t")[3] bed = pd.concat([bed, scores], axis=1) scores = bed.iloc[:, 3:] scores = qnorm.quantile_normalize(scores, axis=1, ncpus=ncore) scores = scores.mean(axis=1) bed = pd.concat([bed.iloc[:, :3], scores], axis=1) bed.to_csv(bed_output, sep="\t", header=False, index=False) @staticmethod def peaks_fit(bam_coverage, bed_output, dist_func="lognorm_dist", **kwargs): """ fit the peak scores to a distribution """ bed = pd.read_csv(bam_coverage, header=None, sep="\t") region = ( bed[0].astype(str) + ":" + bed[1].astype(str) + "-" + bed[2].astype(str) ) score = bed[3] # obtain a distribution dist_func = Distributions().set(dist_func) # with np.errstate(divide="ignore", invalid="ignore"): # dist = dist_func(score, **kwargs) dist = dist_func(score, **kwargs) # replace scores with distribution values ascending_dist = np.sort(dist) ascending_scores_index = np.searchsorted(np.sort(score), score) norm_score = np.array([ascending_dist[i] for i in ascending_scores_index]) logn_score = np.log(norm_score + 1) scaled_score = minmax_scale(logn_score) log10_score = np.log10(norm_score + 1) data = { "region": region, # ex: "chr1:0-200" "score": score, "norm_score": norm_score, "logn_score": logn_score, "scaled_score": scaled_score, "log10_score": log10_score, # used by the original function } bed = pd.DataFrame(data=data) bed.to_csv(bed_output, sep="\t", index=False) def run(self, outfile, dist_func="peak_rank_file_dist", force=False, **kwargs): # save the results as it takes ages to run raw_peak_scores = os.path.join(os.path.dirname(outfile), "raw_scoredpeaks.bed") if force or not os.path.exists(raw_peak_scores): self.compatibility_check() tmpdir = tempfile.mkdtemp(prefix="ANANSE_") try: if self.verbose: logger.info("Scoring peaks (slow)") try: # assumes sorted for bam in self.list_of_bams: bam_index(bam, force=False, ncore=self.ncore) coverage_files = self.peaks_count(tmpdir) except Exception: # sort, index & try again for bam in self.list_of_bams: bam_sort(bam, self.ncore) coverage_files = self.peaks_count(tmpdir) tmp_peak_scores = os.path.join(tmpdir, "raw_scoredpeaks.bed") self.peaks_merge(coverage_files, tmp_peak_scores, self.ncore) shutil.copy2(tmp_peak_scores, raw_peak_scores) finally: shutil.rmtree(tmpdir, ignore_errors=True) # fit bam read counts to specified distribution if force or not os.path.exists(outfile): self.peaks_fit(raw_peak_scores, outfile, dist_func=dist_func, **kwargs) class ScoreMotifs: def __init__(self, genome, bed, pfmfile=None, ncore=1, verbose=True): self.genome = genome self.bed = bed # putative enhancer regions in format chr:start-end (in column 0 with header) self.pfm_file = pfmfile_location(pfmfile) self.ncore = ncore self.verbose = verbose def motifs_get_scores(self, pfmscorefile, debug=False): """ Scan for TF binding motifs in potential enhancer regions. """ if not debug: df = scan_regionfile_to_table( input_table=self.bed, genome=self.genome, scoring="score", pfmfile=self.pfm_file, ncpus=self.ncore, zscore=True, gc=True, ) else: # test output df = pd.DataFrame( { "region": ["chr1:400-600", "chr1:2400-2600", "chr1:10003-10203"], "GM.5.0.Sox.0001": [-0.544, -2.496, -0.544], "GM.5.0.Homeodomain.0001": [-0.750, -0.377, -7.544], } ).set_index("region") df["motif"] = df.idxmax(axis=1) df["zscore"] = df.max(axis=1) df.reset_index(inplace=True) df.to_csv( pfmscorefile, sep="\t", header=True, index=False, columns=["motif", "region", "zscore"], # filter + order columns ) @staticmethod def motifs_normalize(bed_input, bed_output): """ Add normalized scores to the scored motifs """ bed = pd.read_csv(bed_input, sep="\t") bed["rank_zscore"] = minmax_scale(stats.rankdata(bed["zscore"])) bed.to_csv(bed_output, sep="\t", index=False) def run(self, outfile, force=False): # save the results as it takes ages to run raw_motif_scores = os.path.join( os.path.dirname(outfile), "raw_scoredmotifs.bed" ) if force or not os.path.exists(raw_motif_scores): if self.verbose: logger.info("Scoring motifs (really slow)") self.motifs_get_scores(raw_motif_scores) if force or not os.path.exists(outfile): self.motifs_normalize(raw_motif_scores, outfile) class Binding: def __init__( self, peak_weights, motif_weights, pfmfile=None, model=None, curation_filter=None, tf_list=None, whitelist=True, ncore=1, verbose=True, ): self.peak_weights = peak_weights # output from ScorePeaks self.motif_weights = motif_weights # output from ScoreMotifs self.motifs2factors_file = pfmfile_location(pfmfile).replace( ".pfm", ".motif2factors.txt" ) self.motifs2factors = self.filter_transcription_factors( curation_filter, tf_list, whitelist ) self.model = model if self.model is None: # dream_model.txt is a 2D logistic regression model. package_dir = os.path.dirname(__file__) self.model = os.path.join(package_dir, "db", "dream_model_p300.pickle") self.ncore = ncore self.verbose = verbose def filter_transcription_factors( self, curation_filter=None, tf_list=None, whitelist=True ): """ filter transcription factors from the motif database curation_filter: If None (default), keep all factors. If True, keep only curated factors. If False, keep only non-curated factors. Note: "Curated" TFs have direct evidence for binding or are manually selected for likely binding. tf_list: an optional, single-column file with (case-insensitive) transcription factor names. whitelist: if True (default), tf_list is used as a whitelist. If False, as a blacklist. """ m2f = pd.read_csv(self.motifs2factors_file, sep="\t") # rename stuff m2f.rename( columns={"Motif": "motif", "Factor": "factor", "Curated": "curated"}, inplace=True, ) m2f["factor"] = m2f.factor.str.upper() # make case-insensitive m2f.replace("T", "TBXT", inplace=True) # rename T to TBXT # filter by curation if curation_filter is True: m2f = m2f.loc[m2f.curated == "Y"] elif curation_filter is False: m2f = m2f.loc[m2f.curated == "N"] # shrink table m2f = m2f[["motif", "factor"]] # subset m2f.drop_duplicates( inplace=True ) # case-insensitivity adds loads of duplicates (ex: Sox9 and SOX9) # filter by white/blacklist if tf_list: tfs = ( pd.read_csv(tf_list, header=None)[0].str.upper().tolist() ) # make case-insensitive m2f = ( m2f.loc[m2f.factor.isin(tfs)] if whitelist else m2f.loc[~m2f.factor.isin(tfs)] ) return m2f def get_binding_score(self, motif_weights, peak_weights, outfile): """ Infer TF binding score from motif z-score and peak intensity. """ # merge the scoring tables m = dd.read_csv(motif_weights, sep="\t") m = m.merge(dd.read_csv(peak_weights, sep="\t", blocksize=200e6), on="region")[ ["motif", "region", "zscore", "log10_score"] ] # filter scoring tables for motifs found in motifs2factors m = m.merge(self.motifs2factors, on="motif") # also adds "factor" column # combine scores m = m.groupby(["factor", "region"])[["zscore", "log10_score"]].mean() m = m.dropna().reset_index() with dask.diagnostics.ProgressBar(): m = m.compute(num_workers=self.ncore) # Load model with open(self.model, "rb") as f: clf = pickle.load(f) m["binding"] = clf.predict_proba(m[["zscore", "log10_score"]])[:, 1] # "region" renames to "enhancer" for consistency with ANANSE network m.rename(columns={"region": "enhancer"}, inplace=True) m.to_csv( outfile, sep="\t", index=False, columns=["factor", "enhancer", "binding"] ) def run(self, outfile, force=False): if force or not os.path.exists(outfile): if self.verbose: logger.info("Predict TF binding") self.get_binding_score(self.peak_weights, self.motif_weights, outfile)
ANANSE-master
ananse/enhancer_binding.py
ANANSE-master
ananse/db/__init__.py
from ananse.commands.binding import binding # noqa from ananse.commands.influence import influence # noqa from ananse.commands.network import network # noqa from ananse.commands.view import view # noqa
ANANSE-master
ananse/commands/__init__.py
#!/usr/bin/env python # Copyright (c) 2009-2019 Quan Xu <qxuchn@gmail.com> # # This module is free software. You can redistribute it and/or modify it under # the terms of the MIT License, see the file COPYING included with this # distribution. from __future__ import print_function import ananse.influence from ananse.utils import check_path def influence(args): a = ananse.influence.Influence( ncore=args.ncore, # --ncore (optional) Gbf=check_path(args.Gbf), # --source (Gbf = GRN before) Gaf=check_path(args.Gaf), # --target (Gaf = GRN after) outfile=check_path(args.outfile, error_missing=False), # --output degenes=check_path(args.expression), # --degenes (HGNC gene names, padj and log2foldchanges) edges=args.edges, # --edges (optional) ) a.run_influence(args.plot) # -p
ANANSE-master
ananse/commands/influence.py
#!/usr/bin/env python # Copyright (c) 2021 Simon van Heeringen # # This module is free software. You can redistribute it and/or modify it under # the terms of the MIT License, see the file COPYING included with this # distribution. from ananse.utils import view_h5 import sys def view(args): df = view_h5(args.infile, tfs=args.factors, fmt=args.format) index = True if args.format == "long": index = False if args.outfile is None: args.outfile = sys.stdout df.to_csv(args.outfile, sep="\t", index=index)
ANANSE-master
ananse/commands/view.py
#!/usr/bin/env python # Copyright (c) 2009-2019 Quan Xu <qxuchn@gmail.com> # # This module is free software. You can redistribute it and/or modify it under # the terms of the MIT License, see the file COPYING included with this # distribution. from __future__ import print_function import os import ananse.network from ananse.utils import check_path from dask.distributed import Client, LocalCluster def network(args): ncore = args.ncore if ncore is None: ncore = min(os.cpu_count(), 4) ncore = int(ncore) memory_limit = "12GB" # With one core more memory is needed if ncore == 1: memory_limit = "20GB" b = ananse.network.Network( genome=args.genome, # checked in CLI gene_bed=check_path(args.annotation), include_promoter=args.include_promoter, include_enhancer=args.include_enhancer # pfmfile=args.pfmfile, # promoter=args.promoter ) cluster = LocalCluster( local_directory=os.environ.get("TMP", None), scheduler_port=0, dashboard_address=None, # noqa n_workers=ncore, threads_per_worker=2, memory_limit=memory_limit, ) client = Client(cluster) b.run_network( binding=check_path(args.binding), fin_expression=check_path(args.fin_expression), outfile=check_path(args.outfile, error_missing=False), ) client.close()
ANANSE-master
ananse/commands/network.py
#!/usr/bin/env python # Copyright (c) 2009-2019 Quan Xu <qxuchn@gmail.com> # # This module is free software. You can redistribute it and/or modify it under # the terms of the MIT License, see the file COPYING included with this # distribution. from ananse.peakpredictor import predict_peaks from ananse.utils import check_path, check_input_factors def binding(args): predict_peaks( check_path(args.outdir, error_missing=False), atac_bams=check_path(args.atac_bams), histone_bams=check_path(args.histone_bams), regionfiles=check_path(args.regionfiles), reference=check_path(args.reference), factors=check_input_factors(args.factors), genome=args.genome, # checked in CLI pfmfile=check_path(args.pfmfile), pfmscorefile=check_path(args.pfmscorefile), ncpus=args.ncpus, )
ANANSE-master
ananse/commands/binding.py
import os import genomepy.utils from loguru import logger from ananse.enhancer_binding import ( CombineBedFiles, ScorePeaks, ScoreMotifs, Binding, ) from ananse.utils import clean_tmp @logger.catch def run_binding( genome, peakfiles, bams, outdir, peak_width=200, dist_func="peak_rank_file_dist", pfmfile=None, curation_filter=None, tf_list=None, whitelist=True, model=None, ncore=1, force=False, keep_intermediates=True, verbose=True, **kwargs, ): """ Predict transcription factor binding in specified regions Args: genome: path to the genome fasta used to align the bams and peaks to peakfiles: one or more BED format files with putative enhancer regions (e.g. narrowPeak, broadPeak) bams: one or more BAM format files where reads mark enhancer activity (H3K27Ac/p300 ChIP-seq or ATAC-seq) outdir: directory where you wish to store the output peak_width: peakfiles are resized to this width (default 200 bp) dist_func: bam reads are normalized to the selected distribution (default: an empirical distribution) pfmfile: the pfm file of the transcription factors to search for (default gimme.vertebrate.v5.0) curation_filter: True = curated TFs, False = no curated TFs, None = all TFs (default: None) tf_list: optional file with single column TF names whitelist: True = use tf_list as a whitelist. False = use tf_list as a blacklist model: classification model to use (default: dream) ncore: number of cores to use force: overwrite earlier intermediate data? (default: False) keep_intermediates: keep intermediate data after completion? (default: True) verbose: keep you informed of the progress? (default: True) **kwargs: passed to the selected dist_func Returns: binding.tsv: the strongest transcription factor and its binding score for each region in the peakfile(s) """ # clean up previous ANANSE tmp files clean_tmp() # check input file paths files = [] for arg in [genome, peakfiles, bams, pfmfile, tf_list, model]: if arg: if isinstance(arg, list): files.extend(arg) else: files.append(arg) for file in files: if not os.path.exists(file): logger.exception(f"Could not find {file}!") exit(1) outfile = os.path.join(outdir, "binding.tsv") intermediate_dir = os.path.join(outdir, "intermediate_results") if force or not os.path.exists(outfile): genomepy.utils.mkdir_p(intermediate_dir) cbed = CombineBedFiles(genome=genome, peakfiles=peakfiles, verbose=verbose) combined_bed = os.path.join(intermediate_dir, "combined.bed") cbed.run(outfile=combined_bed, width=peak_width, force=force) sp = ScorePeaks(bams=bams, bed=combined_bed, ncore=ncore, verbose=verbose) scored_peaks = os.path.join(intermediate_dir, "scoredpeaks.bed") sp.run(outfile=scored_peaks, dist_func=dist_func, force=force, **kwargs) sm = ScoreMotifs( genome=genome, bed=scored_peaks, pfmfile=pfmfile, ncore=ncore, verbose=verbose, ) scored_motifs = os.path.join(intermediate_dir, "scoredmotifs.bed") sm.run(outfile=scored_motifs, force=force) b = Binding( peak_weights=scored_peaks, motif_weights=scored_motifs, pfmfile=pfmfile, model=model, curation_filter=curation_filter, tf_list=tf_list, whitelist=whitelist, ncore=ncore, verbose=verbose, ) b.run(outfile=outfile, force=force) if not keep_intermediates: genomepy.utils.rm_rf(intermediate_dir) if verbose: logger.info("ANANSE binding finished successfully!")
ANANSE-master
ananse/commands/enhancer_binding.py
ANANSE-master
tests/__init__.py
import numpy as np import pytest import ananse.distributions def test_distributions(): d = ananse.distributions.Distributions() func_list = d.get() assert isinstance(func_list, list) for func in func_list: d.set(func) scores = np.array([0, 1, 2]) def test_scale_dist(): s = ananse.distributions.scale_dist(scores) assert np.array_equal(s, np.array([0, 0.5, 1])) def test_log_scale_dist(): s = ananse.distributions.log_scale_dist(scores) assert np.allclose(s, np.array([0.0, 0.63092975, 1.0])) def test_replace_infs(): score_w_infs = [-np.inf, 0, 1, np.inf] s = ananse.distributions.replace_infs(score_w_infs) assert np.array_equal(s, np.array([0, 0, 1, 1])) def test_scipy_dist(): s = ananse.distributions.scipy_dist(scores, **{"dist": "loglaplace"}) assert np.allclose(s, np.array([4.72219713e-05, 2.05410078e-01, 6.83221921e-01])) s = ananse.distributions.scipy_dist(scores, **{"dist": "lognorm"}) assert np.allclose(s, np.array([0, 8.0793556e12, 2.8352896e-02])) with pytest.raises(ValueError): ananse.distributions.scipy_dist(scores, **{"dist": "wrongname"}) def test_peak_rank_dist(): s = ananse.distributions.peak_rank_dist(scores) assert np.allclose(s, np.array([0, 0.4077607, 0.4077607])) def test_peak_rank_file_dist(): s = ananse.distributions.peak_rank_file_dist(scores, **{"file": "peak_rank.txt"}) assert len(s) == 3 s = ananse.distributions.peak_rank_file_dist( scores, **{"file": "peak_rank_hg38_h3k27ac.txt"} ) assert len(s) == 3 # too many peaks with pytest.raises(ValueError): ananse.distributions.peak_rank_file_dist( range(108_087), **{"file": "peak_rank.txt"} )
ANANSE-master
tests/continuous_integration/test_03_distributions.py
from collections import namedtuple from tempfile import NamedTemporaryFile import numpy as np import pytest import pandas as pd from ananse.network import Network from ananse.commands import network @pytest.fixture def binding_fname(): return "tests/example_data/binding2.tsv" @pytest.fixture def network_obj(): return Network(genome="", gene_bed="ananse/db/hg38.genes.bed") def test_unique_enhancer(network_obj, binding_fname): regions = network_obj.unique_enhancers(binding_fname) regions = regions.as_df() assert regions.shape[0] == 6 assert sorted(list(regions["Chromosome"].unique())) == ["chr1", "chr10", "chr17"] assert sorted(list(regions["Start"].unique())) == [7677184, 7687827] def test_distance_weight(network_obj): dw = network_obj.distance_weight( include_promoter=True, promoter_region=20, full_weight_region=50, maximum_distance=100, alpha=5, ) assert list(dw.columns) == ["weight", "dist"] dw = dw.set_index("dist") assert dw.loc[0, "weight"] == 1 assert dw.loc[25, "weight"] == 1 assert dw.loc[50, "weight"] == 1 assert dw.loc[51, "weight"] < 1 assert np.isclose(dw.loc[100, "weight"], 0, atol=1e-4) assert dw.shape[0] == 101 dw = network_obj.distance_weight( include_promoter=False, promoter_region=20, full_weight_region=50, maximum_distance=100, alpha=5, ) assert list(dw.columns) == ["weight", "dist"] dw = dw.set_index("dist") assert dw.loc[0, "weight"] == 0 assert dw.loc[20, "weight"] == 0 assert dw.loc[21, "weight"] == 1 assert dw.shape[0] == 101 def test_command(): with NamedTemporaryFile() as tmp: fname = tmp.name Args = namedtuple( "args", "genome annotation include_promoter include_enhancer binding fin_expression outfile ncore", ) args = Args( genome="hg38", annotation=None, include_promoter=True, include_enhancer=True, binding="tests/data/network/binding.h5", fin_expression="tests/data/network/heart_expression.txt", outfile=fname, ncore=2, ) network(args) df = pd.read_table(fname, sep="\t") assert df.shape[0] == 30690 assert list(df.columns).__eq__(["tf_target", "prob"])
ANANSE-master
tests/continuous_integration/test_05_network.py
from ananse.influence import read_expression def test_read_expression(): res = read_expression("tests/data/dge.tsv") assert set(res.keys()) == {"ANPEP", "CD24", "COL6A3", "DAB2", "DMKN"} assert res["ANPEP"].score - 7.44242618323665 < 0.001 assert res["ANPEP"].realfc - 7.44242618323665 < 0.001 assert res["ANPEP"].absfc - 7.44242618323665 < 0.001 assert res["COL6A3"].score == 0 assert res["COL6A3"].realfc - 11.0553152937569 < 0.001 assert res["COL6A3"].absfc - 11.0553152937569 < 0.001 test_read_expression()
ANANSE-master
tests/continuous_integration/test_06_influence.py
ANANSE-master
tests/continuous_integration/__init__.py
import subprocess as sp # run tests locally with: # pytest -vv --disable-pytest-warnings # pytest -vv --disable-pytest-warnings tests/continuous_integration/test_01* # pytest -vv --disable-pytest-warnings -k [substring] # TODO: apply to all code --> targets = ["ananse/", "tests/"] targets = [ "ananse/commands/__init__.py", "ananse/commands/enhancer_binding.py", "ananse/commands/network.py", "ananse/__init__.py", "ananse/enhancer_binding.py", "ananse/distributions.py", "ananse/network.py", "ananse/utils.py", "tests/", ] def test_import_ananse(): import ananse assert str(ananse.__file__).endswith("ANANSE/ananse/__init__.py") def test_black_formatting(): sp.check_call(" ".join(["black setup.py"] + targets), shell=True) def test_flake8_formatting(): ret = sp.check_call(" ".join(["flake8 setup.py"] + targets), shell=True) assert ret == 0
ANANSE-master
tests/continuous_integration/test_01_basics.py
import os import genomepy.utils import pytest import ananse.enhancer_binding from ananse.commands.enhancer_binding import run_binding import ananse.utils from .test_02_utils import write_file, write_bam, h0, h1, line1, line2, line3 # prep test_dir = os.path.dirname(os.path.dirname(__file__)) outdir = os.path.join(test_dir, "output") genomepy.utils.mkdir_p(outdir) # beds genome = os.path.join(outdir, "genome.fa") write_file(genome, [">chr1", "N" * 50000]) bed1 = os.path.join(outdir, "bed1.bed") write_file(bed1, ["chr1\t0\t1000\n", "chr1\t2000\t3000\n"]) bed2 = os.path.join(outdir, "bed2.bed") write_file(bed2, ["chr1\t4000\t5000\n", "chr1\t2000\t3000\n"]) sp_bed_input = os.path.join(outdir, "sp_input.bed") write_file(sp_bed_input, ["chr1\t10003\t10203\n", "chr1\t10203\t10403\n"]) # bams bam1 = os.path.join(outdir, "bam1.bam") write_bam(bam1, [h0, h1, line1, line2, line2]) ananse.utils.bam_index(bam1) bam2 = os.path.join(outdir, "bam2.bam") write_bam(bam2, [h0, h1, line1, line3, line3]) ananse.utils.bam_index(bam2) # shared in/outputs combined_bed = os.path.join(outdir, "combined.bed") raw_peak_scores = os.path.join(outdir, "raw_scoredpeaks.bed") scored_peaks = os.path.join(outdir, "scoredpeaks.bed") raw_motif_scores = os.path.join(outdir, "raw_scoredmotifs.bed") scored_motifs = os.path.join(outdir, "scoredmotifs.bed") outfile = os.path.join(outdir, "binding.tsv") def test_is_narrowpeak(): np = os.path.join(outdir, "f.narrowPeak") write_file(np, ["chr1\t629812\t630105\tnarrowPeak1\t6047\t.\t0\t0\t0\t122"]) bp = os.path.join(outdir, "f.broadPeak") write_file( bp, [ "chr1\t778061\t779255\tbroadRegion1\t660\t.\t778061\t" + "779255\t0\t3\t1,638,1\t0,17,1193\t0\t0\t0" ], ) cbed = ananse.enhancer_binding.CombineBedFiles(genome=genome, peakfiles=[]) assert cbed.is_narrowpeak(np) is True assert cbed.is_narrowpeak(bp) is False def test_bed_resize(): cbed = ananse.enhancer_binding.CombineBedFiles(genome=genome, peakfiles=[]) bed_out = os.path.join(outdir, "bed_out.bed") # default width, extended width with outlier, extended width with fixed outlier for n in range(3): width = [200, 2000, 2000][n] fix_outliers = [False, False, True][n] nlines = [2, 1, 2][n] estart = [400, 1500, 0][n] estop = [600, 3500, 2000][n] cbed.bed_resize(genome, bed1, bed_out, width=width, fix_outliers=fix_outliers) with open(bed_out) as f: lines = f.readlines() assert len(lines) == nlines chrom, start, stop = lines[0].split()[0:3] assert int(start) == estart assert int(stop) == estop assert int(stop) - int(start) == width def test_cbedf(): cbed = ananse.enhancer_binding.CombineBedFiles( genome=genome, peakfiles=[bed1, bed2] ) width = 200 cbed.run(outfile=combined_bed, width=width, force=True) with open(combined_bed) as f: lines = f.readlines() # 3 unique regions over the 2 bed files assert len(lines) == 3 # width is set correctly for line in lines: chrom, start, stop = line.split()[0:3] assert int(stop) - int(start) == width def test_compatibility_check(): incompatible = os.path.join(outdir, "incompatible.bed") write_file(incompatible, ["1\t0\t200"]) sp = ananse.enhancer_binding.ScorePeaks( bams=bam1, bed=incompatible, ncore=1, verbose=True ) with pytest.raises(SystemExit): sp.compatibility_check() def test_peaks_count(): sp = ananse.enhancer_binding.ScorePeaks( bams=[bam1, bam2], bed=sp_bed_input, ncore=1, verbose=True ) coverage_files = sp.peaks_count(outdir) assert len(coverage_files) == 2 assert os.path.join(outdir, "bam1.regions.bed") in coverage_files assert os.path.join(outdir, "bam2.regions.bed") in coverage_files def test_peaks_merge(): sp = ananse.enhancer_binding.ScorePeaks(bams=[], bed=None, ncore=1, verbose=True) coverage_files = [ os.path.join(outdir, "bam1.regions.bed"), os.path.join(outdir, "bam2.regions.bed"), ] sp.peaks_merge(coverage_files, raw_peak_scores, sp.ncore) with open(raw_peak_scores) as f: content = f.readlines()[0] assert len(content.strip().split("\t")) == 4 def test_normalize_peaks(): sp = ananse.enhancer_binding.ScorePeaks(bams=[], bed=None, ncore=1, verbose=True) raw_cov = os.path.join(outdir, "raw_cov.bed") write_file(raw_cov, ["chr1\t0\t200\t10", "chr1\t0\t200\t20", "chr1\t0\t200\t30"]) norm_cov = os.path.join(outdir, "norm_cov.bed") sp.peaks_fit(raw_cov, norm_cov, dist_func="scale_dist") scores = [] norm_scores = [] with open(norm_cov) as bed: for line in bed: line = line.strip().split() scores.append(line[1]) norm_scores.append(line[2]) assert len(scores) == 3 + 1 # lines + header assert scores[1:] == ["10", "20", "30"] assert norm_scores[1:] == ["0.0", "0.5", "1.0"] def test_sp(): sp = ananse.enhancer_binding.ScorePeaks( bams=[bam1, bam2], bed=sp_bed_input, ncore=1, verbose=True ) sp.run(outfile=scored_peaks, dist_func="scale_dist", force=True) with open(scored_peaks) as f: lines = f.readlines() peak1 = lines[1].split() assert len(peak1) == 6 assert peak1[1] == "0.375" # raw score assert peak1[2] == "1.0" # norm score (scaled) def test_motifs_get_scores(): # scan_regionfile_to_table output: # region GM.5.0.Sox.0001 GM.5.0.Mixed.0002 # chr1:10003-10203 -4.4961200165161355 -3.1206201127508577 # chr1:10203-10403 -4.4961200165161355 -3.1206201127508577 # desired output: # motif region zscore # GM.5.0.Mixed.0002 chr1:10003-10203 -3.1200 # GM.5.0.Sox.0001 chr1:10203-10403 -2.4961 sm = ananse.enhancer_binding.ScoreMotifs(None, None) sm.motifs_get_scores(raw_motif_scores, debug=True) with open(raw_motif_scores) as f: content = f.readlines() headers = content[0].strip().split("\t") motif1 = content[1].strip().split("\t") assert headers == ["motif", "region", "zscore"] assert motif1 == ["GM.5.0.Sox.0001", "chr1:400-600", "-0.544"] # TODO: get gimme to make small & quick(!) output for testing # fake_cg_index = "~/.cache/gimmemotifs/genome.fa.gcfreq.100.feather" # try: # import pandas as pd # import numpy as np # df = pd.DataFrame({ # "chrom": ["chr1"], "start": ["0"], "end": ["100"], # "w100": ["0.0"], "n100": ["0.0"], "w200": [np.NaN], # "n200": [np.NaN], "w500": [np.NaN], "n500": [np.NaN], # }) # df.to_feather(fake_cg_index) # # pfmfile = os.path.join(test_dir, "example_data", "debug.pfm") # sm = ananse.enhancer_binding.ScoreMotifs(genome, combined_bed, pfmfile=pfmfile) # sm.get_motif_scores(combined_bed, raw_motif_scores) # finally: # genomepy.utils.rm_rf(fake_cg_index) def test_normalize_motifs(): sm = ananse.enhancer_binding.ScoreMotifs(None, None) sm.motifs_normalize(raw_motif_scores, scored_motifs) with open(raw_motif_scores) as f: lines1 = f.readlines() with open(scored_motifs) as f: lines2 = f.readlines() assert len(lines2[0].split()) == len(lines1[0].split()) + 1 def test_filter_transcription_factors(): pfmfile = os.path.join(test_dir, "data", "debug.pfm") b = ananse.enhancer_binding.Binding(None, None, pfmfile=pfmfile) # curation filter m2f = b.filter_transcription_factors(curation_filter=None) assert m2f.shape[0] == 9 # all TFs in the file m2f = b.filter_transcription_factors(curation_filter=True) assert m2f.shape[0] == 8 # all curated TFs m2f = b.filter_transcription_factors(curation_filter=False) assert m2f.shape[0] == 1 # all non-curated TFs # tf filter tf_list = os.path.join(outdir, "tf_list.txt") write_file(tf_list, ["SOX12"]) m2f = b.filter_transcription_factors(tf_list=tf_list, whitelist=True) assert m2f.shape[0] == 1 m2f = b.filter_transcription_factors(tf_list=tf_list, whitelist=False) assert m2f.shape[0] == 8 def test_get_binding_score(): pfmfile = os.path.join(test_dir, "data", "debug.pfm") b = ananse.enhancer_binding.Binding(None, None, pfmfile=pfmfile) b.get_binding_score(scored_motifs, scored_peaks, outfile) assert os.path.exists(outfile) def test_run_binding(capsys): # test API wrapper run_binding(genome=genome, bams=[bam1], peakfiles=bed1, outdir=outdir, force=False) with pytest.raises(SystemExit): run_binding( genome="/not/a/real/genome.fa", bams=[bam1], peakfiles=bed1, outdir=outdir, force=False, ) captured = capsys.readouterr().err.strip() assert "Could not find /not/a/real/genome.fa!" in captured
ANANSE-master
tests/continuous_integration/test_04_enhancer_binding.py
import os import tempfile import time import genomepy.utils import pysam import ananse.utils # prep test_dir = os.path.dirname(os.path.dirname(__file__)) outdir = os.path.join(test_dir, "output") genomepy.utils.mkdir_p(outdir) def write_file(filename, lines): with open(filename, "w") as f: for line in lines: if not line.endswith("\n"): line = line + "\n" f.write(line) def write_bam(filename, lines): tmp_sam = os.path.join(outdir, "tmp.sam") write_file(tmp_sam, lines) pysam.view(tmp_sam, "-b", "-o", filename, catch_stdout=False) genomepy.utils.rm_rf(tmp_sam) def compare_contents(file1, file2, ftype="bed"): if ftype == "bed": with open(file1) as f: contents1 = f.readlines() with open(file2) as f: contents2 = f.readlines() else: contents1 = pysam.view(file1) contents2 = pysam.view(file2) return contents1 == contents2 # test BED functions unsorted_bed = os.path.join(outdir, "unsorted.bed") write_file(unsorted_bed, ["chr1\t817046\t817246\n", "chr1\t778558\t778758\n"]) sorted_bed = os.path.join(outdir, "sorted.bed") write_file(sorted_bed, ["chr1\t778558\t778758\n", "chr1\t817046\t817246\n"]) second_bed = os.path.join(outdir, "second.bed") write_file(second_bed, ["chr1\t827457\t827657\n"]) def test_bed_sort(): assert not compare_contents(unsorted_bed, sorted_bed, ftype="bed") ananse.utils.bed_sort(unsorted_bed) assert compare_contents(unsorted_bed, sorted_bed, ftype="bed") def test_bed_merge(): merged_bed = os.path.join(outdir, "merged.bed") # 1 bed = nothing changes ananse.utils.bed_merge([sorted_bed], merged_bed) assert compare_contents(sorted_bed, merged_bed, ftype="bed") # >1 bed, same content ananse.utils.bed_merge([unsorted_bed, sorted_bed], merged_bed) assert compare_contents(sorted_bed, merged_bed, ftype="bed") with open(merged_bed) as mb: assert len(mb.readlines()) == 2 # >1 beds, different content ananse.utils.bed_merge([unsorted_bed, second_bed], merged_bed) with open(merged_bed) as mb: assert len(mb.readlines()) == 3 # test BAM functions h0 = "@HD VN:1.6 SO:coordinate" h1 = "@SQ SN:chr1 LN:50000" line1 = ( "read1 147 chr1 10003 40 11S90M = 10048 -46 " + "CCCTACCCTCTCCCTATCCCTAACCCTAACCCCAACCCTAACCCTATCCCCAACCCTAACCCTAACCCTAACCCTAACCCTAACCCTAACCCTAACCCTAA " + "A77--7-7---7-7---A77---AA7----<7-AAJAA-7JJFF<--F-A-AFFFF<FJJJJF-AFJF7F-JJJFJFFFJFF<FJJJJFJJFJJFFFFFAA " ) line2 = ( "read2 83 chr1 10004 30 2S45M1D54M = 10074 -30 " + "ATCCCTAACCCTAACCCTAACCCTAACCCTACCCCTACCCCTAACCCAACCCTAACCCTAACCCTAACCCTAACCCTAACCCTAACCCTAACCCTAACCCT " + "--JAA7F-FAFA-7JJFA--F<7-FF<<FAF7<7F7A-FFAF7-FJJJFJJ----J<JFA-JAF7JFJFJF<<JFJF<JJJFFJJJAAAA-JFFFA-FAA- " ) line3 = ( "read3 163 chr1 10027 40 100M = 10032 105 " + "ACCCGAACCCTAACCCTAACCCTAACCCTAACCCGAACCCTAACCCTAACCCTAACCCTAACCCTAACCCTAACCCTAACCCAACCCTAACCCGAACCCA " + "AAFFFJJJJJJJJJJJFJJJFJJJFJFJJFJJJJ<-FJJFJAFFJA7AFAJJJJFJFJ-<F-AAJJ<FF7-J-AAJ--<JJJ--AAJ-77-AA-7A<-A- " ) unsorted_bam = os.path.join(outdir, "unsorted.bam") write_bam(unsorted_bam, [h0, h1, line2, line1]) sorted_bam = os.path.join(outdir, "sorted.bam") write_bam(sorted_bam, [h0, h1, line1, line2]) second_bam = os.path.join(outdir, "second.bam") write_bam(second_bam, [h0, h1, line3]) def test_bam_index(): ncores = os.cpu_count() # test max cores genomepy.utils.rm_rf(f"{sorted_bam}.bai") assert not os.path.exists(f"{sorted_bam}.bai") ananse.utils.bam_index(sorted_bam, ncore=ncores) assert os.path.exists(f"{sorted_bam}.bai") # test force t0 = os.path.getmtime(f"{sorted_bam}.bai") time.sleep(1) ananse.utils.bam_index(sorted_bam, force=False, ncore=ncores) t1 = os.path.getmtime(f"{sorted_bam}.bai") assert t0 == t1 ananse.utils.bam_index(sorted_bam, force=True, ncore=ncores) t1 = os.path.getmtime(f"{sorted_bam}.bai") assert t0 != t1 def test_bam_sort(): ncores = -999 # test min cores assert not compare_contents(sorted_bam, unsorted_bam, ftype="bam") ananse.utils.bam_sort(unsorted_bam, ncore=ncores) assert compare_contents(sorted_bam, unsorted_bam, ftype="bam") assert os.path.exists(f"{unsorted_bam}.bai") # bam is indexed # bam is identical to the already sorted bam ananse.utils.bam_index(sorted_bam, force=False) assert os.path.getsize(f"{unsorted_bam}.bai") == os.path.getsize( f"{sorted_bam}.bai" ) def test_bam_merge(): ncores = min(2, os.cpu_count()) # test average cores merged_bam = os.path.join(outdir, "merged.bam") # 1 bam: copy ananse.utils.bam_merge([sorted_bam], merged_bam, ncore=ncores) assert compare_contents(sorted_bam, merged_bam, ftype="bam") assert os.path.getsize(f"{sorted_bam}.bai") == os.path.getsize(f"{merged_bam}.bai") # >1 bam: merge ananse.utils.bam_merge([sorted_bam, second_bam], merged_bam, ncore=ncores) l1 = pysam.view(sorted_bam).strip().split("\n") l2 = pysam.view(second_bam).strip().split("\n") l3 = pysam.view(merged_bam).strip().split("\n") assert len(l1) + len(l2) == len(l3) == 3 def test_mosdepth(): bed_input = os.path.join(outdir, "mosdepth_input.bed") write_file(bed_input, ["chr1\t10003\t10203\n", "chr1\t10203\t10403\n"]) # bam = sorted & indexed (required) bam_input = os.path.join(outdir, "mosdepth_input.bam") write_bam(bam_input, [h0, h1, line1, line2, line3]) ananse.utils.bam_index(bam_input, ncore=os.cpu_count()) bed_output = os.path.join(outdir, "mosdepth_output.bed") ananse.utils.mosdepth(bed_input, bam_input, bed_output, ncore=1) with open(bed_output) as f: score = f.readlines()[0].strip().split("\t")[3] assert score == "1.00" # test other functions def test_cleanpath(): path = "./tests/continuous_integration/test_02_utils.py" expected = __file__ res = ananse.utils.cleanpath(path) assert res == expected path = "~/../.." expected = "/" res = ananse.utils.cleanpath(path) assert res == expected def test_mytmpdir(): tmpdir = ananse.utils.mytmpdir() assert os.path.exists(tmpdir) assert tempfile.gettempdir() in tmpdir def test_clean_tmp(): tmpdir = ananse.utils.mytmpdir() assert os.path.exists(tmpdir) ananse.utils.clean_tmp() assert not os.path.exists(tmpdir)
ANANSE-master
tests/continuous_integration/test_02_utils.py
# source: # https://stackoverflow.com/questions/6620471/fitting-empirical-distribution-to-theoretical-ones-with-scipy-python import warnings import numpy as np import pandas as pd import matplotlib as mpl import matplotlib.pyplot as plt import scipy.stats as st from tqdm import tqdm mpl.rcParams["figure.figsize"] = (16.0, 12.0) plt.style.use("ggplot") # Create models from data def best_fit_distribution(data, bins=200, ax=None): """Find the best fitting distribution to the data""" # Get histogram of original data y, x = np.histogram(data, bins=bins, density=True) x = (x + np.roll(x, -1))[:-1] / 2.0 # Distributions to check DISTRIBUTIONS = [ st.alpha, st.anglit, st.arcsine, st.argus, st.beta, st.betaprime, st.bradford, st.burr, st.burr12, st.cauchy, st.chi, st.chi2, st.cosine, st.crystalball, st.dgamma, st.dweibull, st.erlang, st.expon, st.exponnorm, st.exponweib, st.exponpow, st.f, st.fatiguelife, st.fisk, st.foldcauchy, st.foldnorm, st.genlogistic, st.gennorm, st.genpareto, st.genexpon, st.genextreme, st.gausshyper, st.gamma, st.gengamma, st.genhalflogistic, st.geninvgauss, st.gilbrat, st.gompertz, st.gumbel_r, st.gumbel_l, st.halfcauchy, st.halflogistic, st.halfnorm, st.halfgennorm, st.hypsecant, st.invgamma, st.invgauss, st.invweibull, st.johnsonsb, st.johnsonsu, st.kappa4, st.kappa3, st.ksone, st.kstwo, st.kstwobign, st.laplace, st.laplace_asymmetric, st.levy, st.levy_l, # st.levy_stable, # unstable in v1.6.0 st.logistic, st.loggamma, st.loglaplace, st.lognorm, st.loguniform, st.lomax, st.maxwell, st.mielke, st.moyal, st.nakagami, st.ncx2, st.ncf, st.nct, st.norm, st.norminvgauss, st.pareto, st.pearson3, st.powerlaw, st.powerlognorm, st.powernorm, st.rdist, st.rayleigh, st.rice, st.recipinvgauss, st.semicircular, st.skewnorm, st.t, st.trapezoid, st.triang, st.truncexpon, st.truncnorm, st.tukeylambda, st.uniform, # st.vonmises, # does not work in v1.6.0 st.vonmises_line, st.wald, st.weibull_min, st.weibull_max, st.wrapcauchy, ] # Best holders best_distribution = st.norm best_params = (0.0, 1.0) best_sse = np.inf # Estimate distribution parameters from data for distribution in tqdm(DISTRIBUTIONS): # Try to fit the distribution try: # Ignore warnings from data that can't be fit with warnings.catch_warnings(): warnings.filterwarnings("ignore") # fit dist to data params = distribution.fit(data) # Separate parts of parameters arg = params[:-2] loc = params[-2] scale = params[-1] # Calculate fitted PDF and error with fit in distribution pdf = distribution.pdf(x, loc=loc, scale=scale, *arg) sse = np.sum(np.power(y - pdf, 2.0)) # if ax is passed, add to plot try: if ax: pd.Series(pdf, x).plot( label=distribution.name, legend=True, ax=ax ) except Exception: pass # identify if this distribution is better if best_sse > sse > 0: best_distribution = distribution best_params = params best_sse = sse except Exception: pass return best_distribution.name, best_params def make_pdf(dist, params, size=10000): """Generate distributions's Probability Distribution Function""" # Separate parts of parameters arg = params[:-2] loc = params[-2] scale = params[-1] # Get sane start and end points of distribution start = ( dist.ppf(0.01, *arg, loc=loc, scale=scale) if arg else dist.ppf(0.01, loc=loc, scale=scale) ) end = ( dist.ppf(0.99, *arg, loc=loc, scale=scale) if arg else dist.ppf(0.99, loc=loc, scale=scale) ) # Build PDF and turn into pandas Series x = np.linspace(start, end, size) y = dist.pdf(x, loc=loc, scale=scale, *arg) pdf = pd.Series(y, x) return pdf def find_best_pdf(data, outfile=None): # Plot for comparison fig, (ax1, ax2) = plt.subplots(1, 2) # Find best fit distribution best_fit_name, best_fit_params = best_fit_distribution(data, 200, ax1) best_dist = getattr(st, best_fit_name) data.plot( kind="hist", density=True, bins=50, alpha=0.5, label="Data", legend=True, ax=ax1, color=mpl.rcParams["axes.prop_cycle"].by_key()["color"][1], ) # Save plot limits dataYLim = ax1.get_ylim() dataXLim = ax1.get_xlim() # Update plots ax1.set_ylim(dataYLim) ax1.set_xlim(dataXLim) ax1.set_title("All Fitted Distributions\n") ax1.set_xlabel("Score") # Make PDF with best params pdf = make_pdf(best_dist, best_fit_params) # Display pdf.plot(lw=2, label="PDF", legend=True, ax=ax2) data.plot( kind="hist", density=True, bins=50, alpha=0.5, label="Data", legend=True, ax=ax2 ) param_names = ( (best_dist.shapes + ", loc, scale").split(", ") if best_dist.shapes else ["loc", "scale"] ) param_str = ", ".join( ["{}={:0.2f}".format(k, v) for k, v in zip(param_names, best_fit_params)] ) dist_str = "{}({})".format(best_fit_name, param_str) ax2.set_ylim(dataYLim) ax2.set_xlim(dataXLim) ax2.set_title("Best fit distribution \n" + dist_str) ax2.set_xlabel("Score") if outfile: fig.savefig(outfile) fig.show() # Load data peak_rank_file = "db/peak_rank.txt" # "ananse/db/peak_rank.txt" scores = pd.read_csv(peak_rank_file, header=None)[0] data = pd.Series(scores + 1) outfile = "../tests/output/distributions.png" # "tests/output/distributions.png" # run find_best_pdf(data, outfile)
ANANSE-master
tests/benchmark/find_distribution.py
import os # import numpy as np import pandas as pd import seaborn as sns def distplot(infile, score_col=4, show=False): """ generate simple distplot from bedfile """ # https://stackoverflow.com/questions/18534562/scipy-lognormal-fitting # https://stackoverflow.com/questions/41940726/scipy-lognorm-fitting-to-histogram # https://stackoverflow.com/questions/26406056/a-lognormal-distribution-in-python # https://stackoverflow.com/questions/15630647/fitting-lognormal-distribution-using-scipy-vs-matlab bed = pd.read_csv(infile, header=None, sep="\t") scores = pd.Series(bed[score_col]) bins = min(30, len(scores)) # too many bins = bad fig = sns.histplot(scores, kde=True, stat="density", bins=bins, alpha=0.2) fig.set_yscale("log") # most methods are log scaled # # exclude outliers from plot # y_min = np.percentile(scores, 1) # y_max = np.percentile(scores, 99) # fig.axes.set_ylim([y_min, y_max]) title = os.path.splitext(os.path.basename(infile))[0].replace(".out", "") fig.set_title(f"{title} score distribution") fig.xaxis.set_label_text("Score") if show: fig.figure.show() else: outfile = infile.replace(".bed", ".png") fig.figure.savefig(outfile, orientation="landscape") fig.figure.clear() # distplot("../tests/output/ScorePeaks_scale.out.bed", show=True) # distplot("../tests/output/ScorePeaks_logscale.out.bed", show=True) # distplot("../tests/output/ScorePeaks_lognorm.out.bed", show=True) # distplot("../tests/output/ScorePeaks_loglaplace.out.bed", show=True) # distplot("../tests/output/ScorePeaks_peakrank.out.bed", show=True) # distplot("../tests/output/ScorePeaks_peakrankfile.out.bed", show=True) # from matplotlib import pyplot as plt # # fig, (ax1) = plt.subplots(1, 1) # scores.plot(kind='hist', density=True, bins=bins, alpha=0.5, ax=ax1) # ax1.set_title(f"{title} score distribution") # ax1.set_xlabel('Score') # fig.show() # from matplotlib import pyplot as plt # from matplotlib.ticker import FormatStrFormatter # # fig, (ax1, ax2) = plt.subplots(1, 2) # fig.suptitle(f"{title} score distribution") # # sns.histplot(scores, ax=ax1, kde=True, stat="density") # ax1.set_title("raw score") # ax1.xaxis.set_label_text("Score") # ax1.xaxis.set_major_locator(plt.MaxNLocator(6)) # ax1.xaxis.set_major_formatter(FormatStrFormatter('%i')) # # sns.histplot(np.log10(scores+1), ax=ax2, kde=True, stat="density") # log_scale=10 # ax2.set_title(f"log10 score") # ax2.xaxis.set_label_text("Score") # # fig.xaxis.set_major_locator(plt.MaxNLocator(10)) # fig.xaxis.set_tick_params(rotation=15) # for long floats # fig.xaxis.set_major_formatter(FormatStrFormatter('%i')) # integer. for floats, use '%.3f' # fig.set_size_inches(10, 5) # fig.savefig(outfile, orientation='landscape')
ANANSE-master
tests/benchmark/utils.py
import os import genomepy.utils from ananse.enhancer_binding import ( CombineBedFiles, ScorePeaks, ScoreMotifs, Binding, ) from tests.benchmark.utils import distplot # prep run_gimme = False # takes ages test_dir = os.path.dirname(os.path.dirname(__file__)) data_dir = os.path.join(test_dir, "data") genomepy.utils.mkdir_p(data_dir) outdir = os.path.join(test_dir, "output") genomepy.utils.mkdir_p(outdir) intermediate_dir = os.path.join(outdir, "intermediate_results") genomepy.utils.mkdir_p(intermediate_dir) ncore = max(1, os.cpu_count() - 2) # H3K27Ac data genome = os.path.join(data_dir, "hg38.fa") peakfiles = os.path.join(data_dir, "hg38-keratinocyte_H3K27ac_peaks.broadPeak") bams = os.path.join(data_dir, "hg38-keratinocyte_H3K27ac_rep1.samtools-coordinate.bam") # download test data locally for file in [genome, peakfiles, bams]: if not os.path.exists(file): url = "https://mbdata.science.ru.nl/ANANSE/tests/data/" + file genomepy.utils.download_file(url, file) cbed = CombineBedFiles(genome=genome, peakfiles=peakfiles, verbose=True) combined_bed = os.path.join(intermediate_dir, "combined.bed") cbed.run(outfile=combined_bed, width=200, force=False) sp = ScorePeaks(bams=bams, bed=combined_bed, ncore=ncore, verbose=True) # benchmark peak normalization for func, kwargs in zip( [ "peak_rank_file_dist", # Quan's file "peak_rank_dist", # scalable version of Quan's file "scale_dist", # no normalization "log_scale_dist", # no normalization, but with a log "scipy_dist", # see kwargs "scipy_dist", # see kwargs ], [{}, {}, {}, {}, {"dist": "loglaplace"}, {"dist": "lognorm"}], # fits best ): suffix = kwargs.get("dist") if not suffix: suffix = func scored_peaks = os.path.join(intermediate_dir, f"scoredpeaks_{suffix}.bed") sp.run(outfile=scored_peaks, dist_func=func, force=False, **kwargs) distplot(scored_peaks, score_col=5) if run_gimme: scored_peaks = os.path.join(intermediate_dir, "scoredpeaks.bed") sp = ScorePeaks(bams=bams, bed=combined_bed, ncore=ncore, verbose=True) sp.run(outfile=scored_peaks, dist_func="peak_rank_dist", force=False) sm = ScoreMotifs( genome=genome, bed=scored_peaks, pfmfile=None, ncore=ncore, verbose=True ) scored_motifs = os.path.join(intermediate_dir, "scoredmotifs.bed") sm.run(outfile=scored_motifs, force=True) b = Binding( peak_weights=scored_peaks, motif_weights=scored_motifs, pfmfile=None, model=None, curation_filter=None, tf_list=None, whitelist=True, ncore=ncore, verbose=True, ) outfile = os.path.join(outdir, "binding.tsv") b.run(outfile=outfile, force=True)
ANANSE-master
tests/benchmark/enhancer_binding.py
from setuptools import setup, find_packages setup( name = 'JEPA-pytorch', packages = find_packages(exclude=[]), version = '0.0.1', license='MIT', description = 'JEPA - Pytorch', author = 'Phil Wang', author_email = 'lucidrains@gmail.com', long_description_content_type = 'text/markdown', url = 'https://github.com/lucidrains/JEPA-pytorch', keywords = [ 'artificial general intelligence' ], install_requires=[ 'einops>=0.4', 'torch>=1.6', ], classifiers=[ 'Development Status :: 4 - Beta', 'Intended Audience :: Developers', 'Topic :: Scientific/Engineering :: Artificial Intelligence', 'License :: OSI Approved :: MIT License', 'Programming Language :: Python :: 3.6', ], )
JEPA-pytorch-main
setup.py
from jepa_pytorch.jepa_pytorch import JEPA
JEPA-pytorch-main
jepa_pytorch/__init__.py
import torch from torch import nn, einsum from einops import rearrange class JEPA(nn.Module): def __init__(self): super().__init__() def forward(self, x): return x
JEPA-pytorch-main
jepa_pytorch/jepa_pytorch.py
from setuptools import setup, find_packages setup( name = 'compositional-attention-pytorch', packages = find_packages(exclude=[]), version = '0.0.1', license='MIT', description = 'Compositional Attention - Pytorch', author = 'Phil Wang', author_email = 'lucidrains@gmail.com', url = 'https://github.com/lucidrains/compositional-attention-pytorch', keywords = [ 'artificial intelligence', 'deep learning', 'attention mechanism' ], install_requires=[ 'einops>=0.4', 'einops-exts', 'torch>=1.6', ], classifiers=[ 'Development Status :: 4 - Beta', 'Intended Audience :: Developers', 'Topic :: Scientific/Engineering :: Artificial Intelligence', 'License :: OSI Approved :: MIT License', 'Programming Language :: Python :: 3.6', ], )
compositional-attention-pytorch-main
setup.py
import torch import torch.nn.functional as F from torch import nn, einsum from einops import rearrange from einops_exts import rearrange_many def exists(val): return val is not None def stable_softmax(t, dim = -1): t = t - t.amax(dim = dim, keepdim = True).detach() return t.softmax(dim = dim) class CompositionalAttention(nn.Module): def __init__( self, dim, dim_head = 64, num_searches = 8, num_retrievals = 2, dropout = 0., prenorm = False, causal = False ): super().__init__() self.norm = nn.LayerNorm(dim) if prenorm else nn.Identity() self.scale = dim_head ** -0.5 inner_search_dim = dim_head * num_searches inner_retrieval_dim = dim_head * num_retrievals self.num_searches = num_searches self.num_retrievals = num_retrievals self.to_searches_queries = nn.Linear(dim, inner_search_dim, bias = False) self.to_searches_keys = nn.Linear(dim, inner_search_dim, bias = False) self.to_retrieval_values = nn.Linear(dim, inner_retrieval_dim, bias = False) self.to_retrieval_queries = nn.Linear(dim, inner_search_dim, bias = False) self.to_retrieval_keys = nn.Linear(dim_head, dim_head, bias = False) self.to_out = nn.Linear(inner_search_dim, dim, bias = False) self.search_dropout = nn.Dropout(dropout) self.retrieval_dropout = nn.Dropout(dropout) # autoregressive variant for self-experimentation self.causal = causal def forward(self, x, mask = None): """ einstein notation: b - batch n - sequence dimension i - sequence dimension (source) j - sequence dimension (target, aggregation dimension) s - number of searches r - number of retrievals d - feature dimension """ x = self.norm(x) s = self.num_searches r = self.num_retrievals # get search queries and keys sq, sk = self.to_searches_queries(x), self.to_searches_keys(x) sq, sk = rearrange_many((sq, sk), 'b n (s d) -> b s n d', s = s) sq = sq * self.scale # search similarity and attention search_sim = einsum('b s i d, b s j d -> b s i j', sq, sk) if exists(mask): mask = rearrange(mask, 'b j -> b 1 1 j') search_sim = search_sim.masked_fill(~mask, -torch.finfo(search_sim.dtype).max) if self.causal: i, j = search_sim.shape[-2:] causal_mask = torch.ones((i, j), device = x.device, dtype = torch.bool).triu(j - i + 1) search_sim = search_sim.masked_fill(causal_mask, -torch.finfo(search_sim.dtype).max) search_attn = stable_softmax(search_sim, dim = -1) search_attn = self.search_dropout(search_attn) # get retrieval values rv = self.to_retrieval_values(x) rv = rearrange(rv, 'b n (r d) -> b r n d', r = r) retrieved = einsum('b s i j, b r j d -> b s r i d', search_attn, rv) # get retrieval queries and keys rq, rk = self.to_retrieval_queries(x), self.to_retrieval_keys(retrieved) rq = rearrange(rq, 'b n (s d) -> b s n d', s = s) rq = rq * self.scale # get retrieval attention retrieval_sim = einsum('b s n d , b s r n d -> b s n r', rq, rk) retrieval_attn = stable_softmax(retrieval_sim, dim = -1) retrieval_attn = self.retrieval_dropout(retrieval_attn) # aggregate retrievals out = einsum('b s n r, b s r n d -> b s n d', retrieval_attn, retrieved) # combine search results out out = rearrange(out, 'b s n d -> b n (s d)') return self.to_out(out)
compositional-attention-pytorch-main
compositional_attention_pytorch/compositional_attention_pytorch.py
from compositional_attention_pytorch.compositional_attention_pytorch import CompositionalAttention
compositional-attention-pytorch-main
compositional_attention_pytorch/__init__.py
from setuptools import setup, find_packages setup( name = 'VN-transformer', packages = find_packages(exclude=[]), version = '0.1.0', license='MIT', description = 'Vector Neuron Transformer (VN-Transformer)', author = 'Phil Wang', author_email = 'lucidrains@gmail.com', long_description_content_type = 'text/markdown', url = 'https://github.com/lucidrains/VN-transformer', keywords = [ 'artificial intelligence', 'deep learning', 'equivariance', 'vector neurons', 'transformers', 'attention mechanism' ], install_requires=[ 'einops>=0.6.0', 'torch>=1.6' ], setup_requires=[ 'pytest-runner', ], tests_require=[ 'pytest' ], classifiers=[ 'Development Status :: 4 - Beta', 'Intended Audience :: Developers', 'Topic :: Scientific/Engineering :: Artificial Intelligence', 'License :: OSI Approved :: MIT License', 'Programming Language :: Python :: 3.8', ], )
VN-transformer-main
setup.py
import torch import torch.nn.functional as F from torch.optim import Adam from einops import rearrange, repeat import sidechainnet as scn from VN_transformer import VNTransformer BATCH_SIZE = 1 GRADIENT_ACCUMULATE_EVERY = 16 MAX_SEQ_LEN = 256 DEFAULT_TYPE = torch.float64 torch.set_default_dtype(DEFAULT_TYPE) def cycle(loader, len_thres = MAX_SEQ_LEN): while True: for data in loader: if data.seqs.shape[1] > len_thres: continue yield data transformer = VNTransformer( num_tokens = 24, dim = 64, depth = 4, dim_head = 64, heads = 8, dim_feat = 64, bias_epsilon = 1e-6, l2_dist_attn = True, flash_attn = False ).cuda() data = scn.load( casp_version = 12, thinning = 30, with_pytorch = 'dataloaders', batch_size = BATCH_SIZE, dynamic_batching = False ) # Add gaussian noise to the coords # Testing the refinement algorithm dl = cycle(data['train']) optim = Adam(transformer.parameters(), lr = 1e-4) for _ in range(10000): for _ in range(GRADIENT_ACCUMULATE_EVERY): batch = next(dl) seqs, coords, masks = batch.seqs, batch.crds, batch.msks seqs = seqs.cuda().argmax(dim = -1) coords = coords.cuda().type(torch.get_default_dtype()) masks = masks.cuda().bool() l = seqs.shape[1] coords = rearrange(coords, 'b (l s) c -> b l s c', s = 14) # Keeping only the backbone coordinates coords = coords[:, :, 0:3, :] coords = rearrange(coords, 'b l s c -> b (l s) c') seq = repeat(seqs, 'b n -> b (n c)', c = 3) masks = repeat(masks, 'b n -> b (n c)', c = 3) noised_coords = coords + torch.randn_like(coords).cuda() type1_out, _ = transformer( noised_coords, feats = seq, mask = masks ) denoised_coords = noised_coords + type1_out loss = F.mse_loss(denoised_coords[masks], coords[masks]) (loss / GRADIENT_ACCUMULATE_EVERY).backward() print('loss:', loss.item()) optim.step() optim.zero_grad()
VN-transformer-main
denoise.py
import torch import torch.nn.functional as F from torch import nn, einsum, Tensor from einops import rearrange, repeat, reduce from einops.layers.torch import Rearrange, Reduce from VN_transformer.attend import Attend # helper def exists(val): return val is not None def default(val, d): return val if exists(val) else d def inner_dot_product(x, y, *, dim = -1, keepdim = True): return (x * y).sum(dim = dim, keepdim = keepdim) # layernorm class LayerNorm(nn.Module): def __init__(self, dim): super().__init__() self.gamma = nn.Parameter(torch.ones(dim)) self.register_buffer('beta', torch.zeros(dim)) def forward(self, x): return F.layer_norm(x, x.shape[-1:], self.gamma, self.beta) # equivariant modules class VNLinear(nn.Module): def __init__( self, dim_in, dim_out, bias_epsilon = 0. ): super().__init__() self.weight = nn.Parameter(torch.randn(dim_out, dim_in)) self.bias = None self.bias_epsilon = bias_epsilon # in this paper, they propose going for quasi-equivariance with a small bias, controllable with epsilon, which they claim lead to better stability and results if bias_epsilon > 0.: self.bias = nn.Parameter(torch.randn(dim_out)) def forward(self, x): out = einsum('... i c, o i -> ... o c', x, self.weight) if exists(self.bias): bias = F.normalize(self.bias, dim = -1) * self.bias_epsilon out = out + rearrange(bias, '... -> ... 1') return out class VNReLU(nn.Module): def __init__(self, dim, eps = 1e-6): super().__init__() self.eps = eps self.W = nn.Parameter(torch.randn(dim, dim)) self.U = nn.Parameter(torch.randn(dim, dim)) def forward(self, x): q = einsum('... i c, o i -> ... o c', x, self.W) k = einsum('... i c, o i -> ... o c', x, self.U) qk = inner_dot_product(q, k) k_norm = k.norm(dim = -1, keepdim = True).clamp(min = self.eps) q_projected_on_k = q - inner_dot_product(q, k / k_norm) * k out = torch.where( qk >= 0., q, q_projected_on_k ) return out class VNAttention(nn.Module): def __init__( self, dim, dim_head = 64, heads = 8, dim_coor = 3, bias_epsilon = 0., l2_dist_attn = False, flash = False, num_latents = None # setting this would enable perceiver-like cross attention from latents to sequence, with the latents derived from VNWeightedPool ): super().__init__() assert not (l2_dist_attn and flash), 'l2 distance attention is not compatible with flash attention' self.scale = (dim_coor * dim_head) ** -0.5 dim_inner = dim_head * heads self.heads = heads self.to_q_input = None if exists(num_latents): self.to_q_input = VNWeightedPool(dim, num_pooled_tokens = num_latents, squeeze_out_pooled_dim = False) self.to_q = VNLinear(dim, dim_inner, bias_epsilon = bias_epsilon) self.to_k = VNLinear(dim, dim_inner, bias_epsilon = bias_epsilon) self.to_v = VNLinear(dim, dim_inner, bias_epsilon = bias_epsilon) self.to_out = VNLinear(dim_inner, dim, bias_epsilon = bias_epsilon) if l2_dist_attn and not exists(num_latents): # tied queries and keys for l2 distance attention, and not perceiver-like attention self.to_k = self.to_q self.attend = Attend(flash = flash, l2_dist = l2_dist_attn) def forward(self, x, mask = None): """ einstein notation b - batch n - sequence h - heads d - feature dimension (channels) c - coordinate dimension (3 for 3d space) i - source sequence dimension j - target sequence dimension """ c = x.shape[-1] if exists(self.to_q_input): q_input = self.to_q_input(x, mask = mask) else: q_input = x q, k, v = self.to_q(q_input), self.to_k(x), self.to_v(x) q, k, v = map(lambda t: rearrange(t, 'b n (h d) c -> b h n (d c)', h = self.heads), (q, k, v)) out = self.attend(q, k, v, mask = mask) out = rearrange(out, 'b h n (d c) -> b n (h d) c', c = c) return self.to_out(out) def VNFeedForward(dim, mult = 4, bias_epsilon = 0.): dim_inner = int(dim * mult) return nn.Sequential( VNLinear(dim, dim_inner, bias_epsilon = bias_epsilon), VNReLU(dim_inner), VNLinear(dim_inner, dim, bias_epsilon = bias_epsilon) ) class VNLayerNorm(nn.Module): def __init__(self, dim, eps = 1e-6): super().__init__() self.eps = eps self.ln = LayerNorm(dim) def forward(self, x): norms = x.norm(dim = -1) x = x / rearrange(norms.clamp(min = self.eps), '... -> ... 1') ln_out = self.ln(norms) return x * rearrange(ln_out, '... -> ... 1') class VNWeightedPool(nn.Module): def __init__( self, dim, dim_out = None, num_pooled_tokens = 1, squeeze_out_pooled_dim = True ): super().__init__() dim_out = default(dim_out, dim) self.weight = nn.Parameter(torch.randn(num_pooled_tokens, dim, dim_out)) self.squeeze_out_pooled_dim = num_pooled_tokens == 1 and squeeze_out_pooled_dim def forward(self, x, mask = None): if exists(mask): mask = rearrange(mask, 'b n -> b n 1 1') x = x.masked_fill(~mask, 0.) numer = reduce(x, 'b n d c -> b d c', 'sum') denom = mask.sum(dim = 1) mean_pooled = numer / denom.clamp(min = 1e-6) else: mean_pooled = reduce(x, 'b n d c -> b d c', 'mean') out = einsum('b d c, m d e -> b m e c', mean_pooled, self.weight) if not self.squeeze_out_pooled_dim: return out out = rearrange(out, 'b 1 d c -> b d c') return out # equivariant VN transformer encoder class VNTransformerEncoder(nn.Module): def __init__( self, dim, *, depth, dim_head = 64, heads = 8, dim_coor = 3, ff_mult = 4, final_norm = False, bias_epsilon = 0., l2_dist_attn = False, flash_attn = False ): super().__init__() self.dim = dim self.dim_coor = dim_coor self.layers = nn.ModuleList([]) for _ in range(depth): self.layers.append(nn.ModuleList([ VNAttention(dim = dim, dim_head = dim_head, heads = heads, bias_epsilon = bias_epsilon, l2_dist_attn = l2_dist_attn, flash = flash_attn), VNLayerNorm(dim), VNFeedForward(dim = dim, mult = ff_mult, bias_epsilon = bias_epsilon), VNLayerNorm(dim) ])) self.norm = VNLayerNorm(dim) if final_norm else nn.Identity() def forward( self, x, mask = None ): *_, d, c = x.shape assert x.ndim == 4 and d == self.dim and c == self.dim_coor, 'input needs to be in the shape of (batch, seq, dim ({self.dim}), coordinate dim ({self.dim_coor}))' for attn, attn_post_ln, ff, ff_post_ln in self.layers: x = attn_post_ln(attn(x, mask = mask)) + x x = ff_post_ln(ff(x)) + x return self.norm(x) # invariant layers class VNInvariant(nn.Module): def __init__( self, dim, dim_coor = 3, ): super().__init__() self.mlp = nn.Sequential( VNLinear(dim, dim_coor), VNReLU(dim_coor), Rearrange('... d e -> ... e d') ) def forward(self, x): return einsum('b n d i, b n i o -> b n o', x, self.mlp(x)) # main class class VNTransformer(nn.Module): def __init__( self, *, dim, depth, num_tokens = None, dim_feat = None, dim_head = 64, heads = 8, dim_coor = 3, reduce_dim_out = True, bias_epsilon = 0., l2_dist_attn = False, flash_attn = False, translation_equivariance = False, translation_invariant = False ): super().__init__() self.token_emb = nn.Embedding(num_tokens, dim) if exists(num_tokens) else None dim_feat = default(dim_feat, 0) self.dim_feat = dim_feat self.dim_coor_total = dim_coor + dim_feat assert (int(translation_equivariance) + int(translation_invariant)) <= 1 self.translation_equivariance = translation_equivariance self.translation_invariant = translation_invariant self.vn_proj_in = nn.Sequential( Rearrange('... c -> ... 1 c'), VNLinear(1, dim, bias_epsilon = bias_epsilon) ) self.encoder = VNTransformerEncoder( dim = dim, depth = depth, dim_head = dim_head, heads = heads, bias_epsilon = bias_epsilon, dim_coor = self.dim_coor_total, l2_dist_attn = l2_dist_attn, flash_attn = flash_attn ) if reduce_dim_out: self.vn_proj_out = nn.Sequential( VNLayerNorm(dim), VNLinear(dim, 1, bias_epsilon = bias_epsilon), Rearrange('... 1 c -> ... c') ) else: self.vn_proj_out = nn.Identity() def forward( self, coors, *, feats = None, mask = None, return_concatted_coors_and_feats = False ): if self.translation_equivariance or self.translation_invariant: coors_mean = reduce(coors, '... c -> c', 'mean') coors = coors - coors_mean x = coors if exists(feats): if feats.dtype == torch.long: assert exists(self.token_emb), 'num_tokens must be given to the VNTransformer (to build the Embedding), if the features are to be given as indices' feats = self.token_emb(feats) assert feats.shape[-1] == self.dim_feat, f'dim_feat should be set to {feats.shape[-1]}' x = torch.cat((x, feats), dim = -1) assert x.shape[-1] == self.dim_coor_total x = self.vn_proj_in(x) x = self.encoder(x, mask = mask) x = self.vn_proj_out(x) coors_out, feats_out = x[..., :3], x[..., 3:] if self.translation_equivariance: coors_out = coors_out + coors_mean if not exists(feats): return coors_out if return_concatted_coors_and_feats: return torch.cat((coors_out, feats_out), dim = -1) return coors_out, feats_out
VN-transformer-main
VN_transformer/VN_transformer.py
from VN_transformer.VN_transformer import ( VNTransformer, VNLinear, VNLayerNorm, VNFeedForward, VNAttention, VNWeightedPool, VNTransformerEncoder, VNInvariant )
VN-transformer-main
VN_transformer/__init__.py
import torch from torch import sin, cos, atan2, acos def rot_z(gamma): return torch.tensor([ [cos(gamma), -sin(gamma), 0], [sin(gamma), cos(gamma), 0], [0, 0, 1] ], dtype=gamma.dtype) def rot_y(beta): return torch.tensor([ [cos(beta), 0, sin(beta)], [0, 1, 0], [-sin(beta), 0, cos(beta)] ], dtype=beta.dtype) def rot(alpha, beta, gamma): return rot_z(alpha) @ rot_y(beta) @ rot_z(gamma)
VN-transformer-main
VN_transformer/rotations.py
from functools import wraps from packaging import version from collections import namedtuple import torch from torch import nn, einsum import torch.nn.functional as F from einops import rearrange, reduce # constants FlashAttentionConfig = namedtuple('FlashAttentionConfig', ['enable_flash', 'enable_math', 'enable_mem_efficient']) # helpers def exists(val): return val is not None def once(fn): called = False @wraps(fn) def inner(x): nonlocal called if called: return called = True return fn(x) return inner print_once = once(print) # main class class Attend(nn.Module): def __init__( self, dropout = 0., flash = False, l2_dist = False ): super().__init__() assert not (flash and l2_dist), 'flash attention is not compatible with l2 distance' self.l2_dist = l2_dist self.dropout = dropout self.attn_dropout = nn.Dropout(dropout) self.flash = flash assert not (flash and version.parse(torch.__version__) < version.parse('2.0.0')), 'in order to use flash attention, you must be using pytorch 2.0 or above' # determine efficient attention configs for cuda and cpu self.cpu_config = FlashAttentionConfig(True, True, True) self.cuda_config = None if not torch.cuda.is_available() or not flash: return device_properties = torch.cuda.get_device_properties(torch.device('cuda')) if device_properties.major == 8 and device_properties.minor == 0: print_once('A100 GPU detected, using flash attention if input tensor is on cuda') self.cuda_config = FlashAttentionConfig(True, False, False) else: print_once('Non-A100 GPU detected, using math or mem efficient attention if input tensor is on cuda') self.cuda_config = FlashAttentionConfig(False, True, True) def flash_attn(self, q, k, v, mask = None): _, heads, q_len, _, k_len, is_cuda, device = *q.shape, k.shape[-2], q.is_cuda, q.device # Check if mask exists and expand to compatible shape # The mask is B L, so it would have to be expanded to B H N L if exists(mask): mask = mask.expand(-1, heads, q_len, -1) # Check if there is a compatible device for flash attention config = self.cuda_config if is_cuda else self.cpu_config # pytorch 2.0 flash attn: q, k, v, mask, dropout, softmax_scale with torch.backends.cuda.sdp_kernel(**config._asdict()): out = F.scaled_dot_product_attention( q, k, v, attn_mask = mask, dropout_p = self.dropout if self.training else 0. ) return out def forward(self, q, k, v, mask = None): """ einstein notation b - batch h - heads n, i, j - sequence length (base sequence length, source, target) d - feature dimension """ q_len, k_len, device = q.shape[-2], k.shape[-2], q.device scale = q.shape[-1] ** -0.5 if exists(mask) and mask.ndim != 4: mask = rearrange(mask, 'b j -> b 1 1 j') if self.flash: return self.flash_attn(q, k, v, mask = mask) # similarity sim = einsum(f"b h i d, b h j d -> b h i j", q, k) * scale # l2 distance if self.l2_dist: # -cdist squared == (-q^2 + 2qk - k^2) # so simply work off the qk above q_squared = reduce(q ** 2, 'b h i d -> b h i 1', 'sum') k_squared = reduce(k ** 2, 'b h j d -> b h 1 j', 'sum') sim = sim * 2 - q_squared - k_squared # key padding mask if exists(mask): sim = sim.masked_fill(~mask, -torch.finfo(sim.dtype).max) # attention attn = sim.softmax(dim=-1) attn = self.attn_dropout(attn) # aggregate values out = einsum(f"b h i j, b h j d -> b h i d", attn, v) return out
VN-transformer-main
VN_transformer/attend.py
import pytest import torch from VN_transformer.VN_transformer import VNTransformer, VNInvariant, VNAttention from VN_transformer.rotations import rot torch.set_default_dtype(torch.float64) # test invariant layers def test_vn_invariant(): layer = VNInvariant(64) coors = torch.randn(1, 32, 64, 3) R = rot(*torch.randn(3)) out1 = layer(coors) out2 = layer(coors @ R) assert torch.allclose(out1, out2, atol = 1e-6) # test equivariance @pytest.mark.parametrize('l2_dist_attn', [True, False]) def test_equivariance(l2_dist_attn): model = VNTransformer( dim = 64, depth = 2, dim_head = 64, heads = 8, l2_dist_attn = l2_dist_attn ) coors = torch.randn(1, 32, 3) mask = torch.ones(1, 32).bool() R = rot(*torch.randn(3)) out1 = model(coors @ R, mask = mask) out2 = model(coors, mask = mask) @ R assert torch.allclose(out1, out2, atol = 1e-6), 'is not equivariant' # test vn perceiver attention equivariance @pytest.mark.parametrize('l2_dist_attn', [True, False]) def test_perceiver_vn_attention_equivariance(l2_dist_attn): model = VNAttention( dim = 64, dim_head = 64, heads = 8, num_latents = 2, l2_dist_attn = l2_dist_attn ) coors = torch.randn(1, 32, 64, 3) mask = torch.ones(1, 32).bool() R = rot(*torch.randn(3)) out1 = model(coors @ R, mask = mask) out2 = model(coors, mask = mask) @ R assert out1.shape[1] == 2 assert torch.allclose(out1, out2, atol = 1e-6), 'is not equivariant' # test SO(3) early fusion equivariance @pytest.mark.parametrize('l2_dist_attn', [True, False]) def test_equivariance_with_early_fusion(l2_dist_attn): model = VNTransformer( dim = 64, depth = 2, dim_head = 64, heads = 8, dim_feat = 64, l2_dist_attn = l2_dist_attn ) feats = torch.randn(1, 32, 64) coors = torch.randn(1, 32, 3) mask = torch.ones(1, 32).bool() R = rot(*torch.randn(3)) out1, _ = model(coors @ R, feats = feats, mask = mask, return_concatted_coors_and_feats = False) out2, _ = model(coors, feats = feats, mask = mask, return_concatted_coors_and_feats = False) out2 = out2 @ R assert torch.allclose(out1, out2, atol = 1e-6), 'is not equivariant' # test SE(3) early fusion equivariance @pytest.mark.parametrize('l2_dist_attn', [True, False]) def test_se3_equivariance_with_early_fusion(l2_dist_attn): model = VNTransformer( dim = 64, depth = 2, dim_head = 64, heads = 8, dim_feat = 64, translation_equivariance = True, l2_dist_attn = l2_dist_attn ) feats = torch.randn(1, 32, 64) coors = torch.randn(1, 32, 3) mask = torch.ones(1, 32).bool() T = torch.randn(3) R = rot(*torch.randn(3)) out1, _ = model((coors + T) @ R, feats = feats, mask = mask, return_concatted_coors_and_feats = False) out2, _ = model(coors, feats = feats, mask = mask, return_concatted_coors_and_feats = False) out2 = (out2 + T) @ R assert torch.allclose(out1, out2, atol = 1e-6), 'is not equivariant'
VN-transformer-main
tests/test.py
from setuptools import setup, find_packages setup( name = 'gated-state-spaces-pytorch', packages = find_packages(exclude=[]), version = '0.1.0', license='MIT', description = 'Gated State Spaces - GSS - Pytorch', author = 'Phil Wang', author_email = 'lucidrains@gmail.com', long_description_content_type = 'text/markdown', url = 'https://github.com/lucidrains/gated-state-spaces-pytorch', keywords = [ 'artificial intelligence', 'deep learning', 'state spaces', 'long context' ], install_requires=[ 'einops>=0.4', 'scipy', 'torch>=1.6', ], classifiers=[ 'Development Status :: 4 - Beta', 'Intended Audience :: Developers', 'Topic :: Scientific/Engineering :: Artificial Intelligence', 'License :: OSI Approved :: MIT License', 'Programming Language :: Python :: 3.6', ], )
gated-state-spaces-pytorch-main
setup.py
import gzip import random import numpy as np import torch import torch.optim as optim import tqdm from torch.nn import functional as F from torch.utils.data import DataLoader, Dataset from gated_state_spaces_pytorch import GatedStateSpacesLM from gated_state_spaces_pytorch.autoregressive_wrapper import AutoregressiveWrapper # constants NUM_BATCHES = int(1e5) BATCH_SIZE = 4 GRADIENT_ACCUMULATE_EVERY = 4 LEARNING_RATE = 2e-4 VALIDATE_EVERY = 100 GENERATE_EVERY = 500 GENERATE_LENGTH = 1024 SEQ_LEN = 4096 # helpers def cycle(loader): while True: for data in loader: yield data def decode_token(token): return str(chr(max(32, token))) def decode_tokens(tokens): return "".join(list(map(decode_token, tokens))) # instantiate GPT-like decoder model model = GatedStateSpacesLM( num_tokens = 256, dim = 512, depth = 8 ) model = AutoregressiveWrapper(model) model.cuda() # prepare enwik8 data with gzip.open("./data/enwik8.gz") as file: X = np.fromstring(file.read(int(95e6)), dtype=np.uint8) trX, vaX = np.split(X, [int(90e6)]) data_train, data_val = torch.from_numpy(trX), torch.from_numpy(vaX) class TextSamplerDataset(Dataset): def __init__(self, data, seq_len): super().__init__() self.data = data self.seq_len = seq_len def __getitem__(self, index): rand_start = torch.randint(0, self.data.size(0) - self.seq_len, (1,)) full_seq = self.data[rand_start : rand_start + self.seq_len + 1].long() return full_seq.cuda() def __len__(self): return self.data.size(0) // self.seq_len train_dataset = TextSamplerDataset(data_train, SEQ_LEN) val_dataset = TextSamplerDataset(data_val, SEQ_LEN) train_loader = cycle(DataLoader(train_dataset, batch_size=BATCH_SIZE)) val_loader = cycle(DataLoader(val_dataset, batch_size=BATCH_SIZE)) # optimizer optim = torch.optim.Adam(model.parameters(), lr=LEARNING_RATE) # training for i in tqdm.tqdm(range(NUM_BATCHES), mininterval=10.0, desc="training"): model.train() for __ in range(GRADIENT_ACCUMULATE_EVERY): loss = model(next(train_loader)) loss.backward() print(f"training loss: {loss.item()}") torch.nn.utils.clip_grad_norm_(model.parameters(), 0.5) optim.step() optim.zero_grad() if i % VALIDATE_EVERY == 0: model.eval() with torch.no_grad(): loss = model(next(val_loader)) print(f"validation loss: {loss.item()}") if i % GENERATE_EVERY == 0: model.eval() inp = random.choice(val_dataset)[:-1] prime = decode_tokens(inp) print(f"%s \n\n %s", (prime, "*" * 100)) sample = model.generate(inp[None, ...], GENERATE_LENGTH) output_str = decode_tokens(sample[0]) print(output_str)
gated-state-spaces-pytorch-main
train.py
import torch import torch.nn.functional as F from torch import nn, einsum from torch.fft import rfft, irfft from einops import rearrange # functions def exists(val): return val is not None # classes class DSS(nn.Module): def __init__( self, *, dim, kernel_N = 512, dss_kernel_lambda_imag_exp = True ): super().__init__() self.norm = nn.LayerNorm(dim) # Lambda self.Lambda_real = nn.Parameter(torch.randn(kernel_N)) self.Lambda_imag = nn.Parameter(torch.randn(kernel_N)) # C self.C_real = nn.Parameter(torch.randn(dim, kernel_N)) self.C_imag = nn.Parameter(torch.randn(dim, kernel_N)) # params D self.param_D = nn.Parameter(torch.randn(dim)) # whether to exponentiate lambda imag @albertfgu says it is not accurate to s4 original designs (but it is present in the pseudocode) self.dss_kernel_lambda_imag_exp = dss_kernel_lambda_imag_exp def forward(self, x): """ einstein notation: b - batch l - sequence length d - dimension """ device, seq_len = x.device, x.shape[1] u = self.norm(x) # learned weighted residual residual = u * self.param_D # derive simple dss kernel Lambda_imag = self.Lambda_imag.exp() if self.dss_kernel_lambda_imag_exp else self.Lambda_imag Lambda = -self.Lambda_real.exp() + 1j * Lambda_imag C = self.C_real + 1j * self.C_imag arange = torch.arange(seq_len, device = device) S = (rearrange(Lambda, 'n -> n 1') * rearrange(arange, 'l -> 1 l')).exp() C = C * (Lambda.exp() - 1) / Lambda K = einsum('h n, n l -> l h', C, S).real # conv1d fft O(nlog(n)) u_f = rfft(u, n = seq_len * 2, dim = -2) K_f = rfft(K, n = seq_len * 2, dim = -2) y = irfft(u_f * K_f, seq_len * 2, dim = -2)[..., :seq_len, :] return y + residual class GSS(nn.Module): """ Pseudocode 3.2 """ def __init__( self, *, dim, dim_expansion_factor = 4, dss_kernel_N = 512, dss_kernel_H = 256, reverse_seq = False, dss_kernel_lambda_imag_exp = True ): super().__init__() self.reverse_seq = reverse_seq self.norm = nn.LayerNorm(dim) dim_hidden = int(dim_expansion_factor * dim) self.to_u = nn.Sequential(nn.Linear(dim, dim_hidden, bias = False), nn.GELU()) self.to_v = nn.Sequential(nn.Linear(dim, dss_kernel_H, bias = False), nn.GELU()) self.dss = DSS(dim = dss_kernel_H, kernel_N = dss_kernel_N, dss_kernel_lambda_imag_exp = dss_kernel_lambda_imag_exp) self.to_gate = nn.Linear(dss_kernel_H, dim_hidden, bias = False) self.to_out = nn.Linear(dim_hidden, dim) def forward(self, x): if self.reverse_seq: x = torch.flip(x, dims = (1,)) residual, x = x.clone(), self.norm(x) u = self.to_u(x) v = self.to_v(x) v = self.dss(v) uc = self.to_gate(v) out = self.to_out(uc * u) out = out + residual if self.reverse_seq: out = torch.flip(out, dims = (1,)) return out # Gated State Spaces LM class GatedStateSpacesLM(nn.Module): def __init__( self, *, num_tokens, dim, depth, dim_expansion_factor = 4, dss_kernel_N = 512, dss_kernel_H = 256, dss_kernel_lambda_imag_exp = True ): super().__init__() self.token_emb = nn.Embedding(num_tokens, dim) self.layers = nn.ModuleList([]) for _ in range(depth): self.layers.append( GSS( dim = dim, dss_kernel_H = dss_kernel_H, dss_kernel_N = dss_kernel_N, dim_expansion_factor = dim_expansion_factor, dss_kernel_lambda_imag_exp = dss_kernel_lambda_imag_exp ) ) self.to_logits = nn.Linear(dim, num_tokens, bias = False) def forward(self, x, labels = None): x = self.token_emb(x) for gss in self.layers: x = gss(x) logits = self.to_logits(x) if not exists(labels): return logits logits = rearrange(logits, 'b n c -> b c n') return F.cross_entropy(logits, labels)
gated-state-spaces-pytorch-main
gated_state_spaces_pytorch/gss.py
import torch import torch.nn.functional as F from einops import rearrange from torch import nn # helper function def exists(val): return val is not None def eval_decorator(fn): def inner(model, *args, **kwargs): was_training = model.training model.eval() out = fn(model, *args, **kwargs) model.train(was_training) return out return inner # top k filtering def top_k(logits, thres=0.9): k = int((1 - thres) * logits.shape[-1]) val, ind = torch.topk(logits, k) probs = torch.full_like(logits, float('-inf')) probs.scatter_(1, ind, val) return probs class AutoregressiveWrapper(nn.Module): def __init__(self, net, pad_value=0, max_seq_len=4096): super().__init__() self.max_seq_len = max_seq_len self.pad_value = pad_value self.net = net @torch.no_grad() @eval_decorator def generate( self, start_tokens, seq_len, eos_token=None, temperature=1.0, filter_thres=0.9, **kwargs ): b, n, device = *start_tokens.shape, start_tokens.device out = start_tokens for _ in range(seq_len): logits = self.net( out[:, -self.max_seq_len:], **kwargs )[:, -1] filtered_logits = top_k(logits, thres = filter_thres) probs = F.softmax(filtered_logits / temperature, dim=-1) sample = torch.multinomial(probs, 1) out = torch.cat((out, sample), dim=-1) if exists(eos_token): is_eos_token = out == eos_token if is_eos_token.any(dim=-1).all(): # mask out everything after the eos tokens shifted_is_eos_tokens = F.pad(is_eos_tokens, (1, -1)) mask = shifted_is_eos_tokens.float().cumsum(dim=-1) >= 1 out = out.masked_fill(mask, self.pad_value) break return out[:, n:] def forward(self, x, **kwargs): inp, labels = x[:, :-1], x[:, 1:] return self.net(inp, labels = labels, **kwargs)
gated-state-spaces-pytorch-main
gated_state_spaces_pytorch/autoregressive_wrapper.py
import torch import torch.nn.functional as F from torch import nn, einsum from torch.fft import rfft, irfft from einops import rearrange from scipy.fftpack import next_fast_len # functions def exists(val): return val is not None def append_dims(x, num_dims): if num_dims <= 0: return x return x.view(*x.shape, *((1,) * num_dims)) def conv1d_fft(x, weights, dim = -2, weight_dim = -1): # O(N log(N)) 1d convolution using some fourier trick assert weight_dim >= dim N = x.shape[dim] M = weights.shape[weight_dim] fast_len = next_fast_len(N + M - 1) f_x = torch.fft.rfft(x, n = fast_len, dim = dim) f_weight = torch.fft.rfft(weights, n = fast_len, dim = weight_dim) f_v_weight = f_x * append_dims(f_weight.conj(), weight_dim - dim) out = torch.fft.irfft(f_v_weight, fast_len, dim = dim) out = out.roll(-1, dims = (dim,)) indices = torch.arange(start = fast_len - N, end = fast_len, dtype = torch.long, device = x.device) out = out.index_select(dim, indices) return out # classes class EfficientDsConv(nn.Module): def __init__( self, *, dim, heads ): super().__init__() assert (dim % heads) == 0 self.heads = heads self.norm = nn.LayerNorm(dim) self.to_weight = nn.Linear(dim, heads, bias = False) # params D self.param_D = nn.Parameter(torch.randn(dim)) def forward(self, x): """ einstein notation: b - batch h - heads (or groups) l - sequence length d - dimension """ device, seq_len = x.device, x.shape[1] u = self.norm(x) # learned weighted residual residual = u * self.param_D # dsconv kernel depends on sequence length K = self.to_weight(x) K = torch.flip(K, dims = (1,)) # conv1d fft O(nlog(n)) u = rearrange(u, '... (h d) -> ... h d', h = self.heads) out = conv1d_fft(u, K, dim = -3, weight_dim = -2) out = rearrange(out, '... h d -> ... (h d)') return out + residual class GatedDsConv(nn.Module): """ Pseudocode 3.2 """ """ except state spaces replaced with regular learned convolution kernel """ def __init__( self, *, dim, heads = 8, dim_dsconv = 512, dim_expansion_factor = 4, reverse_seq = False ): super().__init__() assert (dim_dsconv % heads) == 0 self.reverse_seq = reverse_seq self.norm = nn.LayerNorm(dim) dim_hidden = int(dim_expansion_factor * dim) self.to_u = nn.Sequential(nn.Linear(dim, dim_hidden, bias = False), nn.GELU()) self.to_v = nn.Sequential(nn.Linear(dim, dim_dsconv, bias = False), nn.GELU()) self.dsconv = EfficientDsConv(dim = dim_dsconv, heads = heads) self.to_gate = nn.Linear(dim_dsconv, dim_hidden, bias = False) self.to_out = nn.Linear(dim_hidden, dim) def forward(self, x): if self.reverse_seq: x = torch.flip(x, dims = (1,)) residual, x = x.clone(), self.norm(x) u = self.to_u(x) v = self.to_v(x) v = self.dsconv(v) uc = self.to_gate(v) out = self.to_out(uc * u) out = out + residual if self.reverse_seq: out = torch.flip(out, dims = (1,)) return out # Gated Dsconv LM class GatedDsConvLM(nn.Module): def __init__( self, *, num_tokens, dim, depth, heads = 8, dim_dsconv = 512, max_seq_len = 2048, dim_expansion_factor = 4, ): super().__init__() self.token_emb = nn.Embedding(num_tokens, dim) self.max_seq_len = max_seq_len self.layers = nn.ModuleList([]) for _ in range(depth): self.layers.append( GatedDsConv( dim = dim, heads = heads, dim_dsconv = dim_dsconv, dim_expansion_factor = dim_expansion_factor ) ) self.to_logits = nn.Linear(dim, num_tokens, bias = False) def forward(self, x, labels = None): assert x.shape[1] <= self.max_seq_len x = self.token_emb(x) for dsconv in self.layers: x = dsconv(x) logits = self.to_logits(x) if not exists(labels): return logits logits = rearrange(logits, 'b n c -> b c n') return F.cross_entropy(logits, labels)
gated-state-spaces-pytorch-main
gated_state_spaces_pytorch/dsconv.py
from gated_state_spaces_pytorch.gss import GSS, GatedStateSpacesLM from gated_state_spaces_pytorch.dsconv import GatedDsConv, GatedDsConvLM from gated_state_spaces_pytorch.mhesa import GatedExponentialSmoothingLM, GatedMHESA
gated-state-spaces-pytorch-main
gated_state_spaces_pytorch/__init__.py
import torch import torch.nn.functional as F from torch import nn, einsum from torch.fft import rfft, irfft from einops import rearrange from scipy.fftpack import next_fast_len # functions def exists(val): return val is not None def append_dims(x, num_dims): if num_dims <= 0: return x return x.view(*x.shape, *((1,) * num_dims)) def conv1d_fft(x, weights, dim = -2, weight_dim = -1): # O(N log(N)) 1d convolution using some fourier trick assert weight_dim >= dim N = x.shape[dim] M = weights.shape[weight_dim] fast_len = next_fast_len(N + M - 1) f_x = torch.fft.rfft(x, n = fast_len, dim = dim) f_weight = torch.fft.rfft(weights, n = fast_len, dim = weight_dim) f_v_weight = f_x * append_dims(f_weight.conj(), weight_dim - dim) out = torch.fft.irfft(f_v_weight, fast_len, dim = dim) out = out.roll(-1, dims = (dim,)) indices = torch.arange(start = fast_len - N, end = fast_len, dtype = torch.long, device = x.device) out = out.index_select(dim, indices) return out # classes class MHESA(nn.Module): """ used for time-series in ETSFormer https://arxiv.org/abs/2202.01381 """ def __init__( self, *, dim, heads, reverse_seq = False ): super().__init__() assert (dim % heads) == 0 self.reverse_seq = reverse_seq self.heads = heads self.norm = nn.LayerNorm(dim) self.alphas = nn.Parameter(torch.randn(heads)) self.dampen_factors = nn.Parameter(torch.randn(heads)) # params D self.param_D = nn.Parameter(torch.randn(dim)) def forward(self, x): """ einstein notation: b - batch h - heads l - sequence length d - dimension """ if self.reverse_seq: x = torch.flip(x, dims = (1,)) device, seq_len = x.device, x.shape[1] u = self.norm(x) # learned weighted residual residual = u * self.param_D # weights derived from alphas (learned exponential smoothing decay rate) alphas = self.alphas.sigmoid() dampen_factors = self.dampen_factors.sigmoid() reversed_powers = torch.arange(seq_len - 1, -1, -1, device = device) K = alphas * (((1 - alphas) * dampen_factors) ** rearrange(reversed_powers, '... l -> ... l 1')) # conv1d fft O(nlog(n)) u = rearrange(u, '... (h d) -> ... h d', h = self.heads) out = conv1d_fft(u, K, dim = -3, weight_dim = -2) out = rearrange(out, '... h d -> ... (h d)') out = out + residual if self.reverse_seq: out = torch.flip(out, dims = (1,)) return out class GatedMHESA(nn.Module): """ Pseudocode 3.2 """ """ except state spaces replaced with multi-head exponential smoothing with learned alpha """ """ used for time-series in ETSFormer https://arxiv.org/abs/2202.01381 """ def __init__( self, *, dim, heads = 8, dim_mhesa = 512, dim_expansion_factor = 4, ): super().__init__() assert (dim_mhesa % heads) == 0 self.norm = nn.LayerNorm(dim) dim_hidden = int(dim_expansion_factor * dim) self.to_u = nn.Sequential(nn.Linear(dim, dim_hidden, bias = False), nn.GELU()) self.to_v = nn.Sequential(nn.Linear(dim, dim_mhesa, bias = False), nn.GELU()) self.mhesa = MHESA(dim = dim_mhesa, heads = heads) self.to_gate = nn.Linear(dim_mhesa, dim_hidden, bias = False) self.to_out = nn.Linear(dim_hidden, dim) def forward(self, x): residual, x = x.clone(), self.norm(x) u = self.to_u(x) v = self.to_v(x) v = self.mhesa(v) uc = self.to_gate(v) out = self.to_out(uc * u) return out + residual # Gated Dsconv LM class GatedExponentialSmoothingLM(nn.Module): def __init__( self, *, num_tokens, dim, depth, heads = 8, dim_mhesa = 512, dim_expansion_factor = 4, ): super().__init__() self.token_emb = nn.Embedding(num_tokens, dim) self.layers = nn.ModuleList([]) for _ in range(depth): self.layers.append( GatedMHESA( dim = dim, heads = heads, dim_mhesa = dim_mhesa, dim_expansion_factor = dim_expansion_factor ) ) self.to_logits = nn.Linear(dim, num_tokens, bias = False) def forward(self, x, labels = None): x = self.token_emb(x) for mhesa in self.layers: x = mhesa(x) logits = self.to_logits(x) if not exists(labels): return logits logits = rearrange(logits, 'b n c -> b c n') return F.cross_entropy(logits, labels)
gated-state-spaces-pytorch-main
gated_state_spaces_pytorch/mhesa.py
from setuptools import setup, find_packages setup( name = 'product_key_memory', packages = find_packages(), version = '0.2.10', license = 'MIT', description = 'Product Key Memory', long_description_content_type = 'text/markdown', author = 'Aran Komatsuzaki, Phil Wang', author_email = 'aran1234321@gmail.com, lucidrains@gmail.com', url = 'https://github.com/lucidrains/product-key-memory', keywords = [ 'transformers', 'artificial intelligence' ], install_requires=[ 'colt5-attention>=0.10.14', 'einops>=0.6', 'torch' ], classifiers=[ 'Development Status :: 4 - Beta', 'Intended Audience :: Developers', 'Topic :: Scientific/Engineering :: Artificial Intelligence', 'License :: OSI Approved :: MIT License', 'Programming Language :: Python :: 3.6', ], )
product-key-memory-master
setup.py
import gzip import random import tqdm import numpy as np import torch from torch.optim import Adam from torch.nn import functional as F from torch.utils.data import DataLoader, Dataset from product_key_memory.transformer import Transformer # constants NUM_BATCHES = int(1e5) BATCH_SIZE = 4 GRADIENT_ACCUMULATE_EVERY = 4 LEARNING_RATE = 1e-4 VALIDATE_EVERY = 100 PRIME_LENGTH = 128 GENERATE_EVERY = 500 GENERATE_LENGTH = 512 SEQ_LEN = 512 # helpers def cycle(loader): while True: for data in loader: yield data def decode_token(token): return str(chr(max(32, token))) def decode_tokens(tokens): return "".join(list(map(decode_token, tokens))) # instantiate transformer model = Transformer( num_tokens = 256, dim = 512, depth = 8, seq_len = SEQ_LEN, pkm_layers = (4,), pkm_kwargs = dict( heads = 4, num_keys = 128, topk = 32, dim_head = 128, input_dropout = 0., query_dropout = 0., value_dropout = 0., attn_dropout = 0., use_layernorm = True, pre_layernorm = True, differentiable_topk = False, concat_values_and_combine = False ) ).cuda() # prepare enwik8 data with gzip.open("./data/enwik8.gz") as file: data = np.frombuffer(file.read(int(95e6)), dtype=np.uint8).copy() np_train, np_valid = np.split(data, [int(90e6)]) data_train, data_val = torch.from_numpy(np_train), torch.from_numpy(np_valid) class TextSamplerDataset(Dataset): def __init__(self, data, seq_len): super().__init__() self.data = data self.seq_len = seq_len def __getitem__(self, index): rand_start = torch.randint(0, self.data.size(0) - self.seq_len, (1,)) full_seq = self.data[rand_start : rand_start + self.seq_len + 1].long() return full_seq.cuda() def __len__(self): return self.data.size(0) // self.seq_len train_dataset = TextSamplerDataset(data_train, SEQ_LEN) val_dataset = TextSamplerDataset(data_val, SEQ_LEN) train_loader = cycle(DataLoader(train_dataset, batch_size=BATCH_SIZE)) val_loader = cycle(DataLoader(val_dataset, batch_size=BATCH_SIZE)) # optimizer optim = Adam(model.parameters(), lr = LEARNING_RATE) # training for i in tqdm.tqdm(range(NUM_BATCHES), mininterval = 10.0, desc = "training"): model.train() for _ in range(GRADIENT_ACCUMULATE_EVERY): loss = model(next(train_loader)) loss.backward(loss / GRADIENT_ACCUMULATE_EVERY) print(f"training loss: {loss.item()}") torch.nn.utils.clip_grad_norm_(model.parameters(), 0.5) optim.step() optim.zero_grad() if i % VALIDATE_EVERY == 0: model.eval() with torch.no_grad(): loss = model(next(val_loader)) print(f"validation loss: {loss.item()}") if i % GENERATE_EVERY == 0: model.eval() inp = random.choice(val_dataset)[:PRIME_LENGTH] prime = decode_tokens(inp) print(f"%s \n\n %s", (prime, "*" * 100)) sample = model.generate(inp[None, ...], GENERATE_LENGTH) output_str = decode_tokens(sample[0]) print(output_str, "\n")
product-key-memory-master
train.py
import math import torch from torch import nn, einsum from einops import rearrange from einops.layers.torch import Rearrange, Reduce from colt5_attention import topk as coor_descent_topk # helper functions def exists(val): return val is not None def default(val, d): return val if exists(val) else d def log(t, eps = 1e-20): return torch.log(t.clamp(min = eps)) def gumbel_noise(t): noise = torch.zeros_like(t).uniform_(0, 1) return -log(-log(noise)) # init def init_(t, dim = None): dim = default(dim, t.shape[-1]) std = 1. / math.sqrt(dim) return nn.init.normal_(t, mean=0, std=std) # optimizer def list_subtract(l, r): return [el for el in l if el not in set(r)] def fetch_pkm_value_parameters(module): params = [] for m in module.modules(): if isinstance(m, PKM): params.append(m.values.weight) rest = list_subtract(module.parameters(), params) return params, rest def fetch_optimizer_parameters(module, pkm_learning_rate = 1e-2): pkm_params, rest = fetch_pkm_value_parameters(module) return [{'params': rest}, {'params': pkm_params, 'lr': pkm_learning_rate}] # norm class MaskedBatchNorm1D(nn.Module): def __init__(self, fn): super().__init__() self.fn = fn def forward( self, x, mask = None ): if exists(mask): initial_x = x x = x[mask] x = self.fn(x) if exists(mask): initial_x[mask] = x x = initial_x return x class PKM(nn.Module): def __init__( self, dim, heads = 4, num_keys = 128, topk = 32, dim_head = 128, input_dropout = 0., query_dropout = 0., value_dropout = 0., attn_dropout = 0., use_layernorm = True, pre_layernorm = False, differentiable_topk = False, concat_values_and_combine = False, norm_output = False ): super().__init__() self.topk = topk self.heads = heads self.num_keys = num_keys dim_query = dim_head * heads * 2 self.to_queries = nn.Linear(dim, dim_query, bias = False) # pre-layernorm pattern self.pre_layernorm = nn.LayerNorm(dim) if pre_layernorm else nn.Identity() # batchnorm would break causality self.use_layernorm = use_layernorm if use_layernorm: self.norm = nn.LayerNorm(dim_head) else: self.norm = MaskedBatchNorm1D(nn.BatchNorm1d(dim_head)) # keys self.keys = nn.Parameter(torch.zeros(heads, num_keys, 2, dim_head)) init_(self.keys) # values self.concat_values_and_combine = concat_values_and_combine if concat_values_and_combine: values = nn.Embedding(num_keys ** 2, dim_head) self.values = nn.Sequential( values, Reduce('b (h k) d -> b h d', 'sum', h = heads), Rearrange('b n d -> b (n d)'), nn.Linear(dim_head * heads, dim, bias = False) ) else: values = nn.EmbeddingBag(num_keys ** 2, dim, mode = 'sum') self.values = values init_(values.weight) # dropouts self.input_dropout = nn.Dropout(input_dropout) self.query_dropout = nn.Dropout(query_dropout) self.value_dropout = nn.Dropout(value_dropout) self.attn_dropout = nn.Dropout(attn_dropout) # use a differentiable topk, based on coordinate descent self.differentiable_topk = differentiable_topk # https://arxiv.org/abs/2302.06461 # claims to boost performance of softmax key / value networks by simply layernorming the output self.output_norm = nn.LayerNorm(dim) if norm_output else nn.Identity() def forward( self, x, input_mask = None, gumbel_noise_scale = 0., **kwargs ): b, t, h = *x.shape[:2], self.heads x = self.pre_layernorm(x) x = self.input_dropout(x) queries = self.to_queries(x) # split out query heads queries = rearrange(queries, 'b t (p h d) -> (b p h) t d', p = 2, h = h) # norm and dropout queries norm_kwargs = dict(mask = input_mask) if not self.use_layernorm else dict() queries = self.norm(queries, **norm_kwargs) queries = self.query_dropout(queries) # ready queries queries = rearrange(queries, '(b p h) t d -> p b t h d', p = 2, h = h) # similarity to keys dots = einsum('p b t h d, h n p d -> b t h p n', queries, self.keys) # gumbel noise if gumbel_noise_scale > 0.: dots = dots + gumbel_noise(dots) * gumbel_noise_scale # topk scores if self.differentiable_topk: scores, indices, *_ = coor_descent_topk(dots, k = self.topk, fused = True) else: scores, indices = dots.topk(k = self.topk, dim = -1) # scores are factorized (scores_x, scores_y), (indices_x, indices_y) = map(lambda t: t.chunk(2, dim = 3), (scores, indices)) all_topk = self.topk ** 2 all_scores = rearrange(( rearrange(scores_x, '... k -> ... k 1') + rearrange(scores_y, '... k -> ... 1 k') ), 'b t h ... -> b t h (...)') all_indices = rearrange(( rearrange(indices_x, '... k -> ... k 1') * self.num_keys + rearrange(indices_y, '... k -> ... 1 k') ), 'b t h ... -> b t h (...)') final_topk, final_indices = all_scores.topk(self.topk, dim=-1) value_indices = all_indices.gather(-1, final_indices) # attention attn = final_topk.softmax(dim=-1) attn = self.attn_dropout(attn) value_indices, attn = map(lambda t: rearrange(t, 'b t h k -> (b t) (h k)'), (value_indices, attn)) # aggregate if self.concat_values_and_combine: out = self.values(value_indices) else: out = self.values(value_indices, per_sample_weights = attn) out = self.value_dropout(out) # maybe layernorm the output out = self.output_norm(out) return rearrange(out, '(b t) d -> b t d', b = b)
product-key-memory-master
product_key_memory/product_key_memory.py
from product_key_memory.product_key_memory import PKM, fetch_pkm_value_parameters, fetch_optimizer_parameters ProductKeyMemory = PKM
product-key-memory-master
product_key_memory/__init__.py
import json import torch from torch import nn, einsum import torch.nn.functional as F from einops import rearrange from product_key_memory.product_key_memory import PKM # helper function def exists(val): return val is not None def default(val, d): return val if exists(val) else d # sampling helpers def eval_decorator(fn): def inner(model, *args, **kwargs): was_training = model.training model.eval() out = fn(model, *args, **kwargs) model.train(was_training) return out return inner def top_k(logits, thres = 0.9): k = int((1 - thres) * logits.shape[-1]) val, ind = torch.topk(logits, k) probs = torch.full_like(logits, -torch.finfo(logits.dtype).max) probs.scatter_(1, ind, val) return probs # feedforward class Attention(nn.Module): def __init__( self, dim, dim_head = 64, heads = 8 ): super().__init__() self.scale = dim_head ** -0.5 self.heads = heads dim_inner = heads * dim_head self.to_qkv = nn.Linear(dim, dim_inner * 3, bias = False) self.to_out = nn.Linear(dim_inner, dim, bias = False) def forward(self, x): n, h, device = x.shape[1], self.heads, x.device q, k, v = rearrange(self.to_qkv(x), 'b n (qkv h d) -> qkv b h n d', h = h, qkv = 3) q = q * self.scale sim = einsum('b h i d, b h j d -> b h i j', q, k) causal_mask = torch.ones((n, n), device = device, dtype = torch.bool).triu(1) sim = sim.masked_fill(causal_mask, -torch.finfo(sim.dtype).max) attn = sim.softmax(dim = -1) out = einsum('b h i j, b h j d -> b h i d', attn, v) out = rearrange(out, 'b h n d -> b n (h d)') return self.to_out(out) def FeedForward(dim, mult = 4): return nn.Sequential( nn.LayerNorm(dim), nn.Linear(dim, dim * mult), nn.GELU(), nn.Linear(dim * mult, dim) ) # transformer class Transformer(nn.Module): def __init__( self, *, dim, num_tokens, depth, seq_len, pkm_layers = None, dim_head = 64, heads = 8, pad_value = 0, pkm_kwargs: dict = dict() ): super().__init__() self.seq_len = seq_len self.pad_value = pad_value pkm_layers = default(pkm_layers, depth // 2) pkm_layers = (pkm_layers,) if not isinstance(pkm_layers, tuple) else pkm_layers pkm_layers = set(pkm_layers) if len(pkm_layers) > 0: print(f'using PKM at layers {pkm_layers}') print(json.dumps(pkm_kwargs, indent = 2)) print('\n\n') self.token_emb = nn.Embedding(num_tokens, dim) self.pos_emb = nn.Embedding(seq_len, dim) self.layers = nn.ModuleList([]) for ind in range(depth): layer = ind + 1 use_pkm = layer in pkm_layers self.layers.append(nn.ModuleList([ Attention(dim, dim_head = dim_head, heads = heads), FeedForward(dim) if not use_pkm else PKM(dim, **pkm_kwargs) ])) self.to_logits = nn.Sequential( nn.LayerNorm(dim), nn.Linear(dim, num_tokens) ) @torch.no_grad() @eval_decorator def generate( self, prompt, seq_len, temperature = 1.0, filter_thres = 0.9 ): b, n, device = *prompt.shape, prompt.device out = prompt for _ in range(seq_len): logits = self.forward(out[:, -self.seq_len:], return_loss = False) logits = logits[:, -1] filtered_logits = top_k(logits, thres = filter_thres) probs = F.softmax(filtered_logits / temperature, dim = -1) sample = torch.multinomial(probs, 1) out = torch.cat((out, sample), dim = -1) return out[:, n:] def forward(self, x, return_loss = True): if return_loss: x, labels = x[:, :-1], x[:, 1:] x = self.token_emb(x) x = x + self.pos_emb(torch.arange(x.shape[1], device = x.device)) for attn, ff in self.layers: x = attn(x) + x x = ff(x) + x logits = self.to_logits(x) if not return_loss: return logits logits = rearrange(logits, 'b c n -> b n c') return F.cross_entropy(logits, labels)
product-key-memory-master
product_key_memory/transformer.py
from setuptools import setup, find_packages setup( name = 'med-seg-diff-pytorch', packages = find_packages(exclude=[]), version = '0.2.6', license='MIT', description = 'MedSegDiff - SOTA medical image segmentation - Pytorch', author = 'Phil Wang', author_email = 'lucidrains@gmail.com', long_description_content_type = 'text/markdown', url = 'https://github.com/lucidrains/med-seg-diff-pytorch', keywords = [ 'artificial intelligence', 'deep learning', 'denoising diffusion', 'medical segmentation' ], install_requires=[ 'beartype', 'einops', 'lion-pytorch', 'torch', 'torchvision', 'tqdm', 'accelerate', 'wandb' ], classifiers=[ 'Development Status :: 4 - Beta', 'Intended Audience :: Developers', 'Topic :: Scientific/Engineering :: Artificial Intelligence', 'License :: OSI Approved :: MIT License', 'Programming Language :: Python :: 3.6', ], )
med-seg-diff-pytorch-main
setup.py
import os import argparse from tqdm import tqdm import torch import torchvision.transforms as transforms from med_seg_diff_pytorch import Unet, MedSegDiff from med_seg_diff_pytorch.dataset import ISICDataset, GenericNpyDataset from accelerate import Accelerator import skimage.io as io ## Parse CLI arguments ## def parse_args(): parser = argparse.ArgumentParser() parser.add_argument('-od', '--output_dir', type=str, default="output", help="Output dir.") parser.add_argument('-ld', '--logging_dir', type=str, default="logs", help="Logging dir.") parser.add_argument('-mp', '--mixed_precision', type=str, default="no", choices=["no", "fp16", "bf16"], help="Whether to do mixed precision") parser.add_argument('-img', '--img_folder', type=str, default='ISBI2016_ISIC_Part3B_Training_Data', help='The image file path from data_path') parser.add_argument('-csv', '--csv_file', type=str, default='ISBI2016_ISIC_Part3B_Training_GroundTruth.csv', help='The csv file to load in from data_path') parser.add_argument('-sc', '--self_condition', action='store_true', help='Whether to do self condition') parser.add_argument('-ic', '--mask_channels', type=int, default=1, help='input channels for training (default: 3)') parser.add_argument('-c', '--input_img_channels', type=int, default=3, help='output channels for training (default: 3)') parser.add_argument('-is', '--image_size', type=int, default=128, help='input image size (default: 128)') parser.add_argument('-dd', '--data_path', default='./data', help='directory of input image') parser.add_argument('-d', '--dim', type=int, default=64, help='dim (default: 64)') parser.add_argument('-e', '--epochs', type=int, default=10000, help='number of epochs (default: 10000)') parser.add_argument('-bs', '--batch_size', type=int, default=8, help='batch size to train on (default: 8)') parser.add_argument('--timesteps', type=int, default=1000, help='number of timesteps (default: 1000)') parser.add_argument('-ds', '--dataset', default='generic', help='Dataset to use') parser.add_argument('--save_every', type=int, default=100, help='save_every n epochs (default: 100)') parser.add_argument('--num_ens', type=int, default=5, help='number of times to sample to make an ensable of predictions like in the paper (default: 5)') parser.add_argument('--load_model_from', default=None, help='path to pt file to load from') parser.add_argument('--save_uncertainty', action='store_true', help='Whether to store the uncertainty in predictions (only works for ensablmes)') return parser.parse_args() def load_data(args): # Load dataset if args.dataset == 'ISIC': transform_list = [transforms.Resize((args.image_size, args.image_size)), transforms.ToTensor(), ] transform_train = transforms.Compose(transform_list) dataset = ISICDataset(args.data_path, args.csv_file, args.img_folder, transform=transform_train, training=False, flip_p=0.5) elif args.dataset == 'generic': transform_list = [transforms.ToPILImage(), transforms.Resize(args.image_size), transforms.ToTensor()] transform_train = transforms.Compose(transform_list) dataset = GenericNpyDataset(args.data_path, transform=transform_train, test_flag=True) else: raise NotImplementedError(f"Your dataset {args.dataset} hasn't been implemented yet.") ## Define PyTorch data generator training_generator = torch.utils.data.DataLoader( dataset, batch_size=args.batch_size, shuffle=False) return training_generator def main(): args = parse_args() logging_dir = os.path.join(args.output_dir, args.logging_dir) inference_dir = os.path.join(args.output_dir, 'inference') os.makedirs(inference_dir, exist_ok=True) accelerator = Accelerator( mixed_precision=args.mixed_precision, ) # if accelerator.is_main_process: # accelerator.init_trackers("med-seg-diff", config=vars(args)) ## DEFINE MODEL ## model = Unet( dim=args.dim, image_size=args.image_size, dim_mults=(1, 2, 4, 8), mask_channels=args.mask_channels, input_img_channels=args.input_img_channels, self_condition=args.self_condition ) ## LOAD DATA ## data_loader = load_data(args) diffusion = MedSegDiff( model, timesteps=args.timesteps ).to(accelerator.device) if args.load_model_from is not None: save_dict = torch.load(args.load_model_from) diffusion.model.load_state_dict(save_dict['model_state_dict']) for (imgs, masks, fnames) in tqdm(data_loader): # pre allocate preds preds = torch.zeros((imgs.shape[0], args.num_ens, imgs.shape[2], imgs.shape[3])) for i in range(args.num_ens): preds[:, i:i+1, :, :] = diffusion.sample(imgs).cpu().detach() preds_mean = preds.mean(dim=1) preds_std = preds.std(dim=1) for idx in range(preds.shape[0]): io.imsave(os.path.join(inference_dir, fnames[idx].replace('.npy', '.png')), preds_mean[idx, :, :]) if args.save_uncertainty: io.imsave(os.path.join(inference_dir, fnames[idx].replace('.npy', '_std.png')), preds_std[idx, :, :]) if __name__ == '__main__': main()
med-seg-diff-pytorch-main
sample.py
import os import argparse from tqdm import tqdm import torch import numpy as np import torchvision.transforms as transforms from torch.optim import AdamW from lion_pytorch import Lion from med_seg_diff_pytorch import Unet, MedSegDiff from med_seg_diff_pytorch.dataset import ISICDataset, GenericNpyDataset from accelerate import Accelerator import wandb ## Parse CLI arguments ## def parse_args(): parser = argparse.ArgumentParser() parser.add_argument('-slr', '--scale_lr', action='store_true', help="Whether to scale lr.") parser.add_argument('-rt', '--report_to', type=str, default="wandb", choices=["wandb"], help="Where to log to. Currently only supports wandb") parser.add_argument('-ld', '--logging_dir', type=str, default="logs", help="Logging dir.") parser.add_argument('-od', '--output_dir', type=str, default="output", help="Output dir.") parser.add_argument('-mp', '--mixed_precision', type=str, default="no", choices=["no", "fp16", "bf16"], help="Whether to do mixed precision") parser.add_argument('-ga', '--gradient_accumulation_steps', type=int, default=4, help="The number of gradient accumulation steps.") parser.add_argument('-img', '--img_folder', type=str, default='ISBI2016_ISIC_Part3B_Training_Data', help='The image file path from data_path') parser.add_argument('-csv', '--csv_file', type=str, default='ISBI2016_ISIC_Part3B_Training_GroundTruth.csv', help='The csv file to load in from data_path') parser.add_argument('-sc', '--self_condition', action='store_true', help='Whether to do self condition') parser.add_argument('-lr', '--learning_rate', type=float, default=5e-4, help='learning rate') parser.add_argument('-ab1', '--adam_beta1', type=float, default=0.95, help='The beta1 parameter for the Adam optimizer.') parser.add_argument('-ab2', '--adam_beta2', type=float, default=0.999, help='The beta2 parameter for the Adam optimizer.') parser.add_argument('-aw', '--adam_weight_decay', type=float, default=1e-6, help='Weight decay magnitude for the Adam optimizer.') parser.add_argument('-ae', '--adam_epsilon', type=float, default=1e-08, help='Epsilon value for the Adam optimizer.') parser.add_argument('-ul', '--use_lion', type=bool, default=False, help='use Lion optimizer') parser.add_argument('-ic', '--mask_channels', type=int, default=1, help='input channels for training (default: 3)') parser.add_argument('-c', '--input_img_channels', type=int, default=3, help='output channels for training (default: 3)') parser.add_argument('-is', '--image_size', type=int, default=128, help='input image size (default: 128)') parser.add_argument('-dd', '--data_path', default='./data', help='directory of input image') parser.add_argument('-d', '--dim', type=int, default=64, help='dim (default: 64)') parser.add_argument('-e', '--epochs', type=int, default=10000, help='number of epochs (default: 10000)') parser.add_argument('-bs', '--batch_size', type=int, default=8, help='batch size to train on (default: 8)') parser.add_argument('--timesteps', type=int, default=1000, help='number of timesteps (default: 1000)') parser.add_argument('-ds', '--dataset', default='generic', help='Dataset to use') parser.add_argument('--save_every', type=int, default=100, help='save_every n epochs (default: 100)') parser.add_argument('--load_model_from', default=None, help='path to pt file to load from') return parser.parse_args() def load_data(args): # Load dataset if args.dataset == 'ISIC': transform_list = [transforms.Resize((args.image_size, args.image_size)), transforms.ToTensor(), ] transform_train = transforms.Compose(transform_list) dataset = ISICDataset(args.data_path, args.csv_file, args.img_folder, transform=transform_train, training=True, flip_p=0.5) elif args.dataset == 'generic': transform_list = [transforms.ToPILImage(), transforms.Resize(args.image_size), transforms.ToTensor()] transform_train = transforms.Compose(transform_list) dataset = GenericNpyDataset(args.data_path, transform=transform_train, test_flag=False) else: raise NotImplementedError(f"Your dataset {args.dataset} hasn't been implemented yet.") ## Define PyTorch data generator training_generator = torch.utils.data.DataLoader( dataset, batch_size=args.batch_size, shuffle=True) return training_generator def main(): args = parse_args() checkpoint_dir = os.path.join(args.output_dir, 'checkpoints') logging_dir = os.path.join(args.output_dir, args.logging_dir) os.makedirs(checkpoint_dir, exist_ok=True) accelerator = Accelerator( gradient_accumulation_steps=args.gradient_accumulation_steps, mixed_precision=args.mixed_precision, log_with=args.report_to, logging_dir=logging_dir, ) if accelerator.is_main_process: accelerator.init_trackers("med-seg-diff", config=vars(args)) ## DEFINE MODEL ## model = Unet( dim=args.dim, image_size=args.image_size, dim_mults=(1, 2, 4, 8), mask_channels=args.mask_channels, input_img_channels=args.input_img_channels, self_condition=args.self_condition ) ## LOAD DATA ## data_loader = load_data(args) # training_generator = tqdm(data_loader, total=int(len(data_loader))) if args.scale_lr: args.learning_rate = ( args.learning_rate * args.gradient_accumulation_steps * args.batch_size * accelerator.num_processes ) ## Initialize optimizer if not args.use_lion: optimizer = AdamW( model.parameters(), lr=args.learning_rate, betas=(args.adam_beta1, args.adam_beta2), weight_decay=args.adam_weight_decay, eps=args.adam_epsilon, ) else: optimizer = Lion( model.parameters(), lr=args.learning_rate, betas=(args.adam_beta1, args.adam_beta2), weight_decay=args.adam_weight_decay ) ## TRAIN MODEL ## counter = 0 model, optimizer, data_loader = accelerator.prepare( model, optimizer, data_loader ) diffusion = MedSegDiff( model, timesteps=args.timesteps ).to(accelerator.device) if args.load_model_from is not None: save_dict = torch.load(args.load_model_from) diffusion.model.load_state_dict(save_dict['model_state_dict']) optimizer.load_state_dict(save_dict['optimizer_state_dict']) accelerator.print(f'Loaded from {args.load_model_from}') ## Iterate across training loop for epoch in range(args.epochs): running_loss = 0.0 print('Epoch {}/{}'.format(epoch + 1, args.epochs)) for (img, mask) in tqdm(data_loader): with accelerator.accumulate(model): loss = diffusion(mask, img) running_loss += loss.item() * img.size(0) accelerator.log({'loss': loss}) # Log loss to wandb accelerator.backward(loss) optimizer.step() optimizer.zero_grad() counter += 1 epoch_loss = running_loss / len(data_loader) print('Training Loss : {:.4f}'.format(epoch_loss)) ## INFERENCE ## if epoch % args.save_every == 0: torch.save({ 'epoch': epoch, 'model_state_dict': diffusion.model.state_dict(), 'optimizer_state_dict': optimizer.state_dict(), 'loss': loss, }, os.path.join(checkpoint_dir, f'state_dict_epoch_{epoch}_loss_{epoch_loss}.pt')) pred = diffusion.sample(img).cpu().detach().numpy() for tracker in accelerator.trackers: if tracker.name == "wandb": # save just one image per batch tracker.log( {'pred-img-mask': [wandb.Image(pred[0, 0, :, :]), wandb.Image(img[0, 0, :, :]), wandb.Image(mask[0, 0, :, :])]} ) if __name__ == '__main__': main()
med-seg-diff-pytorch-main
driver.py
from med_seg_diff_pytorch.med_seg_diff_pytorch import MedSegDiff, Unet
med-seg-diff-pytorch-main
med_seg_diff_pytorch/__init__.py
import os import numpy as np os.environ['KMP_DUPLICATE_LIB_OK'] = 'True' import torch from torch.utils.data import Dataset from PIL import Image import pandas as pd import random import torchvision.transforms.functional as F class ISICDataset(Dataset): def __init__(self, data_path, csv_file, img_folder, transform=None, training=True, flip_p=0.5): df = pd.read_csv(os.path.join(data_path, csv_file), encoding='gbk') self.img_folder = img_folder self.name_list = df.iloc[:, 0].tolist() self.label_list = df.iloc[:, 1].tolist() self.data_path = data_path self.transform = transform self.training = training self.flip_p = flip_p def __len__(self): return len(self.name_list) def __getitem__(self, index): """Get the images""" name = self.name_list[index] + '.jpg' img_path = os.path.join(self.data_path, self.img_folder, name) mask_name = name.split('.')[0] + '_Segmentation.png' msk_path = os.path.join(self.data_path, self.img_folder, mask_name) img = Image.open(img_path).convert('RGB') mask = Image.open(msk_path).convert('L') if self.training: label = 0 if self.label_list[index] == 'benign' else 1 else: label = int(self.label_list[index]) if self.transform: # save random state so that if more elaborate transforms are used # the same transform will be applied to both the mask and the img state = torch.get_rng_state() img = self.transform(img) torch.set_rng_state(state) mask = self.transform(mask) if random.random() < self.flip_p: img = F.vflip(img) mask = F.vflip(mask) if self.training: return (img, mask) return (img, mask, label) class GenericNpyDataset(torch.utils.data.Dataset): def __init__(self, directory: str, transform, test_flag: bool = True): ''' Genereic dataset for loading npy files. The npy store 3D arrays with the first two dimensions being the image and the third dimension being the channels. channel 0 is the image and the other channel is the label. ''' super().__init__() self.directory = os.path.expanduser(directory) self.transform = transform self.test_flag = test_flag self.filenames = [x for x in os.listdir(self.directory) if x.endswith('.npy')] def __getitem__(self, x: int): fname = self.filenames[x] npy_img = np.load(os.path.join(self.directory, fname)) img = npy_img[:, :, :1] img = torch.from_numpy(img).permute(2, 0, 1) mask = npy_img[:, :, 1:] mask = np.where(mask > 0, 1, 0) image = img[:, ...] mask = torch.from_numpy(mask).permute(2, 0, 1).float() if self.transform: # save random state so that if more elaborate transforms are used # the same transform will be applied to both the mask and the img state = torch.get_rng_state() image = self.transform(image) torch.set_rng_state(state) mask = self.transform(mask) if self.test_flag: return image, mask, fname return image, mask def __len__(self) -> int: return len(self.filenames)
med-seg-diff-pytorch-main
med_seg_diff_pytorch/dataset.py
import math import copy from random import random from functools import partial from collections import namedtuple from beartype import beartype import torch from torch import nn, einsum import torch.nn.functional as F from torch.fft import fft2, ifft2 from einops import rearrange, reduce from einops.layers.torch import Rearrange from tqdm.auto import tqdm # constants ModelPrediction = namedtuple('ModelPrediction', ['pred_noise', 'pred_x_start']) # helpers functions def exists(x): return x is not None def default(val, d): if exists(val): return val return d() if callable(d) else d def identity(t, *args, **kwargs): return t # normalization functions def normalize_to_neg_one_to_one(img): return img * 2 - 1 def unnormalize_to_zero_to_one(t): return (t + 1) * 0.5 # small helper modules class Residual(nn.Module): def __init__(self, fn): super().__init__() self.fn = fn def forward(self, x, *args, **kwargs): return self.fn(x, *args, **kwargs) + x def Upsample(dim, dim_out = None): return nn.Sequential( nn.Upsample(scale_factor = 2, mode = 'nearest'), nn.Conv2d(dim, default(dim_out, dim), 3, padding = 1) ) def Downsample(dim, dim_out = None): return nn.Sequential( Rearrange('b c (h p1) (w p2) -> b (c p1 p2) h w', p1 = 2, p2 = 2), nn.Conv2d(dim * 4, default(dim_out, dim), 1) ) class LayerNorm(nn.Module): def __init__(self, dim, bias = False): super().__init__() self.g = nn.Parameter(torch.ones(1, dim, 1, 1)) self.b = nn.Parameter(torch.zeros(1, dim, 1, 1)) if bias else None def forward(self, x): eps = 1e-5 if x.dtype == torch.float32 else 1e-3 var = torch.var(x, dim = 1, unbiased = False, keepdim = True) mean = torch.mean(x, dim = 1, keepdim = True) return (x - mean) * (var + eps).rsqrt() * self.g + default(self.b, 0) class SinusoidalPosEmb(nn.Module): def __init__(self, dim): super().__init__() self.dim = dim def forward(self, x): device = x.device half_dim = self.dim // 2 emb = math.log(10000) / (half_dim - 1) emb = torch.exp(torch.arange(half_dim, device=device) * -emb) emb = x[:, None] * emb[None, :] emb = torch.cat((emb.sin(), emb.cos()), dim=-1) return emb # building block modules class Block(nn.Module): def __init__(self, dim, dim_out, groups = 8): super().__init__() self.proj = nn.Conv2d(dim, dim_out, 3, padding = 1) self.norm = nn.GroupNorm(groups, dim_out) self.act = nn.SiLU() def forward(self, x, scale_shift = None): x = self.proj(x) x = self.norm(x) if exists(scale_shift): scale, shift = scale_shift x = x * (scale + 1) + shift x = self.act(x) return x class ResnetBlock(nn.Module): def __init__(self, dim, dim_out, *, time_emb_dim = None, groups = 8): super().__init__() self.mlp = nn.Sequential( nn.SiLU(), nn.Linear(time_emb_dim, dim_out * 2) ) if exists(time_emb_dim) else None self.block1 = Block(dim, dim_out, groups = groups) self.block2 = Block(dim_out, dim_out, groups = groups) self.res_conv = nn.Conv2d(dim, dim_out, 1) if dim != dim_out else nn.Identity() def forward(self, x, time_emb = None): scale_shift = None if exists(self.mlp) and exists(time_emb): time_emb = self.mlp(time_emb) time_emb = rearrange(time_emb, 'b c -> b c 1 1') scale_shift = time_emb.chunk(2, dim = 1) h = self.block1(x, scale_shift = scale_shift) h = self.block2(h) return h + self.res_conv(x) def FeedForward(dim, mult = 4): inner_dim = int(dim * mult) return nn.Sequential( LayerNorm(dim), nn.Conv2d(dim, inner_dim, 1), nn.GELU(), nn.Conv2d(inner_dim, dim, 1), ) class LinearAttention(nn.Module): def __init__(self, dim, heads = 4, dim_head = 32): super().__init__() self.scale = dim_head ** -0.5 self.heads = heads hidden_dim = dim_head * heads self.prenorm = LayerNorm(dim) self.to_qkv = nn.Conv2d(dim, hidden_dim * 3, 1, bias = False) self.to_out = nn.Sequential( nn.Conv2d(hidden_dim, dim, 1), LayerNorm(dim) ) def forward(self, x): b, c, h, w = x.shape x = self.prenorm(x) qkv = self.to_qkv(x).chunk(3, dim = 1) q, k, v = map(lambda t: rearrange(t, 'b (h c) x y -> b h c (x y)', h = self.heads), qkv) q = q.softmax(dim = -2) k = k.softmax(dim = -1) q = q * self.scale context = torch.einsum('b h d n, b h e n -> b h d e', k, v) out = torch.einsum('b h d e, b h d n -> b h e n', context, q) out = rearrange(out, 'b h c (x y) -> b (h c) x y', h = self.heads, x = h, y = w) return self.to_out(out) class Attention(nn.Module): def __init__(self, dim, heads = 4, dim_head = 32): super().__init__() self.scale = dim_head ** -0.5 self.heads = heads hidden_dim = dim_head * heads self.prenorm = LayerNorm(dim) self.to_qkv = nn.Conv2d(dim, hidden_dim * 3, 1, bias = False) self.to_out = nn.Conv2d(hidden_dim, dim, 1) def forward(self, x): b, c, h, w = x.shape x = self.prenorm(x) qkv = self.to_qkv(x).chunk(3, dim = 1) q, k, v = map(lambda t: rearrange(t, 'b (h c) x y -> b h c (x y)', h = self.heads), qkv) q = q * self.scale sim = einsum('b h d i, b h d j -> b h i j', q, k) attn = sim.softmax(dim = -1) out = einsum('b h i j, b h d j -> b h i d', attn, v) out = rearrange(out, 'b h (x y) d -> b (h d) x y', x = h, y = w) return self.to_out(out) class Transformer(nn.Module): def __init__( self, dim, dim_head = 32, heads = 4, depth = 1 ): super().__init__() self.layers = nn.ModuleList([]) for _ in range(depth): self.layers.append(nn.ModuleList([ Residual(Attention(dim, dim_head = dim_head, heads = heads)), Residual(FeedForward(dim)) ])) def forward(self, x): for attn, ff in self.layers: x = attn(x) x = ff(x) return x # conditioning class class Conditioning(nn.Module): def __init__(self, fmap_size, dim): super().__init__() self.ff_parser_attn_map = nn.Parameter(torch.ones(dim, fmap_size, fmap_size)) self.norm_input = LayerNorm(dim, bias = True) self.norm_condition = LayerNorm(dim, bias = True) self.block = ResnetBlock(dim, dim) def forward(self, x, c): # ff-parser in the paper, for modulating out the high frequencies dtype = x.dtype x = fft2(x) x = x * self.ff_parser_attn_map x = ifft2(x).real x = x.type(dtype) # eq 3 in paper normed_x = self.norm_input(x) normed_c = self.norm_condition(c) c = (normed_x * normed_c) * c # add an extra block to allow for more integration of information # there is a downsample right after the Condition block (but maybe theres a better place to condition than right before the downsample) return self.block(c) # model @beartype class Unet(nn.Module): def __init__( self, dim, image_size, mask_channels = 1, input_img_channels = 3, init_dim = None, out_dim = None, dim_mults: tuple = (1, 2, 4, 8), full_self_attn: tuple = (False, False, False, True), attn_dim_head = 32, attn_heads = 4, mid_transformer_depth = 1, self_condition = False, resnet_block_groups = 8, conditioning_klass = Conditioning, skip_connect_condition_fmaps = False # whether to concatenate the conditioning fmaps in the latter decoder upsampling portion of unet ): super().__init__() self.image_size = image_size # determine dimensions self.input_img_channels = input_img_channels self.mask_channels = mask_channels self.self_condition = self_condition output_channels = mask_channels mask_channels = mask_channels * (2 if self_condition else 1) init_dim = default(init_dim, dim) self.init_conv = nn.Conv2d(mask_channels, init_dim, 7, padding = 3) self.cond_init_conv = nn.Conv2d(input_img_channels, init_dim, 7, padding = 3) dims = [init_dim, *map(lambda m: dim * m, dim_mults)] in_out = list(zip(dims[:-1], dims[1:])) block_klass = partial(ResnetBlock, groups = resnet_block_groups) # time embeddings time_dim = dim * 4 self.time_mlp = nn.Sequential( SinusoidalPosEmb(dim), nn.Linear(dim, time_dim), nn.GELU(), nn.Linear(time_dim, time_dim) ) # attention related params attn_kwargs = dict( dim_head = attn_dim_head, heads = attn_heads ) # layers num_resolutions = len(in_out) assert len(full_self_attn) == num_resolutions self.conditioners = nn.ModuleList([]) self.skip_connect_condition_fmaps = skip_connect_condition_fmaps # downsampling encoding blocks self.downs = nn.ModuleList([]) curr_fmap_size = image_size for ind, ((dim_in, dim_out), full_attn) in enumerate(zip(in_out, full_self_attn)): is_last = ind >= (num_resolutions - 1) attn_klass = Attention if full_attn else LinearAttention self.conditioners.append(conditioning_klass(curr_fmap_size, dim_in)) self.downs.append(nn.ModuleList([ block_klass(dim_in, dim_in, time_emb_dim = time_dim), block_klass(dim_in, dim_in, time_emb_dim = time_dim), Residual(attn_klass(dim_in, **attn_kwargs)), Downsample(dim_in, dim_out) if not is_last else nn.Conv2d(dim_in, dim_out, 3, padding = 1) ])) if not is_last: curr_fmap_size //= 2 # middle blocks mid_dim = dims[-1] self.mid_block1 = block_klass(mid_dim, mid_dim, time_emb_dim = time_dim) self.mid_transformer = Transformer(mid_dim, depth = mid_transformer_depth, **attn_kwargs) self.mid_block2 = block_klass(mid_dim, mid_dim, time_emb_dim = time_dim) # condition encoding path will be the same as the main encoding path self.cond_downs = copy.deepcopy(self.downs) self.cond_mid_block1 = copy.deepcopy(self.mid_block1) # upsampling decoding blocks self.ups = nn.ModuleList([]) for ind, ((dim_in, dim_out), full_attn) in enumerate(zip(reversed(in_out), reversed(full_self_attn))): is_last = ind == (len(in_out) - 1) attn_klass = Attention if full_attn else LinearAttention skip_connect_dim = dim_in * (2 if self.skip_connect_condition_fmaps else 1) self.ups.append(nn.ModuleList([ block_klass(dim_out + skip_connect_dim, dim_out, time_emb_dim = time_dim), block_klass(dim_out + skip_connect_dim, dim_out, time_emb_dim = time_dim), Residual(attn_klass(dim_out, **attn_kwargs)), Upsample(dim_out, dim_in) if not is_last else nn.Conv2d(dim_out, dim_in, 3, padding = 1) ])) # projection out to predictions self.final_res_block = block_klass(dim * 2, dim, time_emb_dim = time_dim) self.final_conv = nn.Conv2d(dim, output_channels, 1) def forward( self, x, time, cond, x_self_cond = None ): dtype, skip_connect_c = x.dtype, self.skip_connect_condition_fmaps if self.self_condition: x_self_cond = default(x_self_cond, lambda: torch.zeros_like(x)) x = torch.cat((x_self_cond, x), dim = 1) x = self.init_conv(x) r = x.clone() c = self.cond_init_conv(cond) t = self.time_mlp(time) h = [] for (block1, block2, attn, downsample), (cond_block1, cond_block2, cond_attn, cond_downsample), conditioner in zip(self.downs, self.cond_downs, self.conditioners): x = block1(x, t) c = cond_block1(c, t) h.append([x, c] if skip_connect_c else [x]) x = block2(x, t) c = cond_block2(c, t) x = attn(x) c = cond_attn(c) # condition using modulation of fourier frequencies with attentive map # you can test your own conditioners by passing in a different conditioner_klass , if you believe you can best the paper c = conditioner(x, c) h.append([x, c] if skip_connect_c else [x]) x = downsample(x) c = cond_downsample(c) x = self.mid_block1(x, t) c = self.cond_mid_block1(c, t) x = x + c # seems like they summed the encoded condition to the encoded input representation x = self.mid_transformer(x) x = self.mid_block2(x, t) for block1, block2, attn, upsample in self.ups: x = torch.cat((x, *h.pop()), dim = 1) x = block1(x, t) x = torch.cat((x, *h.pop()), dim = 1) x = block2(x, t) x = attn(x) x = upsample(x) x = torch.cat((x, r), dim = 1) x = self.final_res_block(x, t) return self.final_conv(x) # gaussian diffusion trainer class def extract(a, t, x_shape): b, *_ = t.shape out = a.gather(-1, t) return out.reshape(b, *((1,) * (len(x_shape) - 1))) def linear_beta_schedule(timesteps): scale = 1000 / timesteps beta_start = scale * 0.0001 beta_end = scale * 0.02 return torch.linspace(beta_start, beta_end, timesteps, dtype = torch.float64) def cosine_beta_schedule(timesteps, s = 0.008): """ cosine schedule as proposed in https://openreview.net/forum?id=-NEXDKk8gZ """ steps = timesteps + 1 x = torch.linspace(0, timesteps, steps, dtype = torch.float64) alphas_cumprod = torch.cos(((x / timesteps) + s) / (1 + s) * math.pi * 0.5) ** 2 alphas_cumprod = alphas_cumprod / alphas_cumprod[0] betas = 1 - (alphas_cumprod[1:] / alphas_cumprod[:-1]) return torch.clip(betas, 0, 0.999) class MedSegDiff(nn.Module): def __init__( self, model, *, timesteps = 1000, sampling_timesteps = None, objective = 'pred_noise', beta_schedule = 'cosine', ddim_sampling_eta = 1. ): super().__init__() self.model = model if isinstance(model, Unet) else model.module self.input_img_channels = self.model.input_img_channels self.mask_channels = self.model.mask_channels self.self_condition = self.model.self_condition self.image_size = self.model.image_size self.objective = objective assert objective in {'pred_noise', 'pred_x0', 'pred_v'}, 'objective must be either pred_noise (predict noise) or pred_x0 (predict image start) or pred_v (predict v [v-parameterization as defined in appendix D of progressive distillation paper, used in imagen-video successfully])' if beta_schedule == 'linear': betas = linear_beta_schedule(timesteps) elif beta_schedule == 'cosine': betas = cosine_beta_schedule(timesteps) else: raise ValueError(f'unknown beta schedule {beta_schedule}') alphas = 1. - betas alphas_cumprod = torch.cumprod(alphas, dim=0) alphas_cumprod_prev = F.pad(alphas_cumprod[:-1], (1, 0), value = 1.) timesteps, = betas.shape self.num_timesteps = int(timesteps) # sampling related parameters self.sampling_timesteps = default(sampling_timesteps, timesteps) # default num sampling timesteps to number of timesteps at training assert self.sampling_timesteps <= timesteps self.is_ddim_sampling = self.sampling_timesteps < timesteps self.ddim_sampling_eta = ddim_sampling_eta # helper function to register buffer from float64 to float32 register_buffer = lambda name, val: self.register_buffer(name, val.to(torch.float32)) register_buffer('betas', betas) register_buffer('alphas_cumprod', alphas_cumprod) register_buffer('alphas_cumprod_prev', alphas_cumprod_prev) # calculations for diffusion q(x_t | x_{t-1}) and others register_buffer('sqrt_alphas_cumprod', torch.sqrt(alphas_cumprod)) register_buffer('sqrt_one_minus_alphas_cumprod', torch.sqrt(1. - alphas_cumprod)) register_buffer('log_one_minus_alphas_cumprod', torch.log(1. - alphas_cumprod)) register_buffer('sqrt_recip_alphas_cumprod', torch.sqrt(1. / alphas_cumprod)) register_buffer('sqrt_recipm1_alphas_cumprod', torch.sqrt(1. / alphas_cumprod - 1)) # calculations for posterior q(x_{t-1} | x_t, x_0) posterior_variance = betas * (1. - alphas_cumprod_prev) / (1. - alphas_cumprod) # above: equal to 1. / (1. / (1. - alpha_cumprod_tm1) + alpha_t / beta_t) register_buffer('posterior_variance', posterior_variance) # below: log calculation clipped because the posterior variance is 0 at the beginning of the diffusion chain register_buffer('posterior_log_variance_clipped', torch.log(posterior_variance.clamp(min =1e-20))) register_buffer('posterior_mean_coef1', betas * torch.sqrt(alphas_cumprod_prev) / (1. - alphas_cumprod)) register_buffer('posterior_mean_coef2', (1. - alphas_cumprod_prev) * torch.sqrt(alphas) / (1. - alphas_cumprod)) @property def device(self): return next(self.parameters()).device def predict_start_from_noise(self, x_t, t, noise): return ( extract(self.sqrt_recip_alphas_cumprod, t, x_t.shape) * x_t - extract(self.sqrt_recipm1_alphas_cumprod, t, x_t.shape) * noise ) def predict_noise_from_start(self, x_t, t, x0): return ( (extract(self.sqrt_recip_alphas_cumprod, t, x_t.shape) * x_t - x0) / \ extract(self.sqrt_recipm1_alphas_cumprod, t, x_t.shape) ) def predict_v(self, x_start, t, noise): return ( extract(self.sqrt_alphas_cumprod, t, x_start.shape) * noise - extract(self.sqrt_one_minus_alphas_cumprod, t, x_start.shape) * x_start ) def predict_start_from_v(self, x_t, t, v): return ( extract(self.sqrt_alphas_cumprod, t, x_t.shape) * x_t - extract(self.sqrt_one_minus_alphas_cumprod, t, x_t.shape) * v ) def q_posterior(self, x_start, x_t, t): posterior_mean = ( extract(self.posterior_mean_coef1, t, x_t.shape) * x_start + extract(self.posterior_mean_coef2, t, x_t.shape) * x_t ) posterior_variance = extract(self.posterior_variance, t, x_t.shape) posterior_log_variance_clipped = extract(self.posterior_log_variance_clipped, t, x_t.shape) return posterior_mean, posterior_variance, posterior_log_variance_clipped def model_predictions(self, x, t, c, x_self_cond = None, clip_x_start = False): model_output = self.model(x, t, c, x_self_cond) maybe_clip = partial(torch.clamp, min = -1., max = 1.) if clip_x_start else identity if self.objective == 'pred_noise': pred_noise = model_output x_start = self.predict_start_from_noise(x, t, pred_noise) x_start = maybe_clip(x_start) elif self.objective == 'pred_x0': x_start = model_output x_start = maybe_clip(x_start) pred_noise = self.predict_noise_from_start(x, t, x_start) elif self.objective == 'pred_v': v = model_output x_start = self.predict_start_from_v(x, t, v) x_start = maybe_clip(x_start) pred_noise = self.predict_noise_from_start(x, t, x_start) return ModelPrediction(pred_noise, x_start) def p_mean_variance(self, x, t, c, x_self_cond = None, clip_denoised = True): preds = self.model_predictions(x, t, c, x_self_cond) x_start = preds.pred_x_start if clip_denoised: x_start.clamp_(-1., 1.) model_mean, posterior_variance, posterior_log_variance = self.q_posterior(x_start = x_start, x_t = x, t = t) return model_mean, posterior_variance, posterior_log_variance, x_start @torch.no_grad() def p_sample(self, x, t, c, x_self_cond = None, clip_denoised = True): b, *_, device = *x.shape, x.device batched_times = torch.full((x.shape[0],), t, device = x.device, dtype = torch.long) model_mean, _, model_log_variance, x_start = self.p_mean_variance(x = x, t = batched_times, c = c, x_self_cond = x_self_cond, clip_denoised = clip_denoised) noise = torch.randn_like(x) if t > 0 else 0. # no noise if t == 0 pred_img = model_mean + (0.5 * model_log_variance).exp() * noise return pred_img, x_start @torch.no_grad() def p_sample_loop(self, shape, cond): batch, device = shape[0], self.betas.device img = torch.randn(shape, device = device) x_start = None for t in tqdm(reversed(range(0, self.num_timesteps)), desc = 'sampling loop time step', total = self.num_timesteps): self_cond = x_start if self.self_condition else None img, x_start = self.p_sample(img, t, cond, self_cond) img = unnormalize_to_zero_to_one(img) return img @torch.no_grad() def ddim_sample(self, shape, cond_img, clip_denoised = True): batch, device, total_timesteps, sampling_timesteps, eta, objective = shape[0], self.betas.device, self.num_timesteps, self.sampling_timesteps, self.ddim_sampling_eta, self.objective times = torch.linspace(-1, total_timesteps - 1, steps=sampling_timesteps + 1) # [-1, 0, 1, 2, ..., T-1] when sampling_timesteps == total_timesteps times = list(reversed(times.int().tolist())) time_pairs = list(zip(times[:-1], times[1:])) # [(T-1, T-2), (T-2, T-3), ..., (1, 0), (0, -1)] img = torch.randn(shape, device = device) x_start = None for time, time_next in tqdm(time_pairs, desc = 'sampling loop time step'): time_cond = torch.full((batch,), time, device=device, dtype=torch.long) self_cond = x_start if self.self_condition else None pred_noise, x_start, *_ = self.model_predictions(img, time_cond, cond_img, self_cond, clip_x_start = clip_denoised) if time_next < 0: img = x_start continue alpha = self.alphas_cumprod[time] alpha_next = self.alphas_cumprod[time_next] sigma = eta * ((1 - alpha / alpha_next) * (1 - alpha_next) / (1 - alpha)).sqrt() c = (1 - alpha_next - sigma ** 2).sqrt() noise = torch.randn_like(img) img = x_start * alpha_next.sqrt() + \ c * pred_noise + \ sigma * noise img = unnormalize_to_zero_to_one(img) return img @torch.no_grad() def sample(self, cond_img): batch_size, device = cond_img.shape[0], self.device cond_img = cond_img.to(self.device) image_size, mask_channels = self.image_size, self.mask_channels sample_fn = self.p_sample_loop if not self.is_ddim_sampling else self.ddim_sample return sample_fn((batch_size, mask_channels, image_size, image_size), cond_img) def q_sample(self, x_start, t, noise=None): noise = default(noise, lambda: torch.randn_like(x_start)) return ( extract(self.sqrt_alphas_cumprod, t, x_start.shape) * x_start + extract(self.sqrt_one_minus_alphas_cumprod, t, x_start.shape) * noise ) def p_losses(self, x_start, t, cond, noise = None): b, c, h, w = x_start.shape noise = default(noise, lambda: torch.randn_like(x_start)) # noise sample x = self.q_sample(x_start = x_start, t = t, noise = noise) # if doing self-conditioning, 50% of the time, predict x_start from current set of times # and condition with unet with that # this technique will slow down training by 25%, but seems to lower FID significantly x_self_cond = None if self.self_condition and random() < 0.5: with torch.no_grad(): # predicting x_0 x_self_cond = self.model_predictions(x, t, cond).pred_x_start x_self_cond.detach_() # predict and take gradient step model_out = self.model(x, t, cond, x_self_cond) if self.objective == 'pred_noise': target = noise elif self.objective == 'pred_x0': target = x_start elif self.objective == 'pred_v': v = self.predict_v(x_start, t, noise) target = v else: raise ValueError(f'unknown objective {self.objective}') return F.mse_loss(model_out, target) def forward(self, img, cond_img, *args, **kwargs): if img.ndim == 3: img = rearrange(img, 'b h w -> b 1 h w') if cond_img.ndim == 3: cond_img = rearrange(cond_img, 'b h w -> b 1 h w') device = self.device img, cond_img = img.to(device), cond_img.to(device) b, c, h, w, device, img_size, img_channels, mask_channels = *img.shape, img.device, self.image_size, self.input_img_channels, self.mask_channels assert h == img_size and w == img_size, f'height and width of image must be {img_size}' assert cond_img.shape[1] == img_channels, f'your input medical must have {img_channels} channels' assert img.shape[1] == mask_channels, f'the segmented image must have {mask_channels} channels' times = torch.randint(0, self.num_timesteps, (b,), device = device).long() img = normalize_to_neg_one_to_one(img) return self.p_losses(img, times, cond_img, *args, **kwargs)
med-seg-diff-pytorch-main
med_seg_diff_pytorch/med_seg_diff_pytorch.py
from setuptools import setup, find_packages setup( name = 'nuwa-pytorch', packages = find_packages(exclude=[]), include_package_data = True, version = '0.7.8', license='MIT', description = 'NÜWA - Pytorch', long_description_content_type = 'text/markdown', author = 'Phil Wang', author_email = 'lucidrains@gmail.com', url = 'https://github.com/lucidrains/nuwa-pytorch', keywords = [ 'artificial intelligence', 'attention mechanism', 'transformers' ], install_requires=[ 'einops>=0.4.1', 'ftfy', 'pillow', 'regex', 'torch>=1.6', 'torchvision', 'tqdm', 'unfoldNd', 'vector-quantize-pytorch>=0.4.10' ], classifiers=[ 'Development Status :: 4 - Beta', 'Intended Audience :: Developers', 'Topic :: Scientific/Engineering :: Artificial Intelligence', 'License :: OSI Approved :: MIT License', 'Programming Language :: Python :: 3.6', ], )
nuwa-pytorch-main
setup.py
import torch import torchvision.transforms as T from PIL import Image # constants CHANNELS_TO_MODE = { 1 : 'L', 3 : 'RGB', 4 : 'RGBA' } def seek_all_images(img, channels = 3): assert channels in CHANNELS_TO_MODE, f'channels {channels} invalid' mode = CHANNELS_TO_MODE[channels] i = 0 while True: try: img.seek(i) yield img.convert(mode) except EOFError: break i += 1 # tensor of shape (frame, channels, height, width) -> gif def video_tensor_to_gif(tensor, path, duration = 80, loop = 0, optimize = True): images = map(T.ToPILImage(), tensor.unbind(0)) first_img, *rest_imgs = images first_img.save(path, save_all = True, append_images = rest_imgs, duration = duration, loop = loop, optimize = optimize) return images # gif -> (frame, channels, height, width) tensor def gif_to_tensor(path, channels = 3): img = Image.open(path) tensors = tuple(map(T.ToTensor(), seek_all_images(img, channels = channels))) return torch.stack(tensors, dim = 0)
nuwa-pytorch-main
nuwa_pytorch/image_utils.py
from random import randrange from pathlib import Path import torch from torch import nn from torch.utils.data import Dataset, DataLoader from torch.nn.utils.rnn import pad_sequence from einops import rearrange from tqdm import tqdm import numpy as np from shutil import rmtree from nuwa_pytorch.tokenizer import tokenizer from nuwa_pytorch.optimizer import get_optimizer from nuwa_pytorch.image_utils import gif_to_tensor from nuwa_pytorch import NUWA import torchvision.transforms as T from torchvision.utils import make_grid, save_image # helper functions def exists(val): return val is not None def noop(*args, **kwargs): pass def cycle(dl): while True: for data in dl: yield data def cast_tuple(t): return t if isinstance(t, (tuple, list)) else (t,) def yes_or_no(question): answer = input(f'{question} (y/n) ') return answer.lower() in ('yes', 'y') def accum_log(log, new_logs): for key, new_value in new_logs.items(): old_value = log.get(key, 0.) log[key] = old_value + new_value return log # dataloader helper functions def pad_collate_fn(batch): texts, videos = zip(*batch) return pad_sequence(texts, batch_first = True), torch.stack(videos) # data pipeline functions def convert_video_tensor_dataset_to_indices( *, vae, raw_video_dataset, num_frames, path, ): vae_device = next(vae.parameters()).device num_videos = len(raw_video_dataset) assert num_videos > 0, 'there must be at least 1 video' fmap_size = vae.image_size // (vae.num_layers ** 2) shape = (num_videos, num_frames * fmap_size * fmap_size) video_indices_memmap = np.memmap(path, mode = 'w+', dtype = np.int64, shape = shape) for ind in tqdm(range(num_videos)): _, video = raw_video_dataset[ind] video = rearrange(video, '... -> 1 ...') video = video.to(vae_device) indices = vae.get_video_indices(video) indices = rearrange(indices, '1 f h w -> (f h w)') video_indices_memmap[ind] = indices.cpu().numpy() print(f'completed conversion of {num_videos} videos to indices at {path}') # dataset class class MnistDataset(Dataset): def __init__( self, num_videos, videos_memmap_path, text_memmap_path, num_digits = 2, num_frames = 10, image_size = 64, channels = 1, random_rotate = False ): super().__init__() self.num_videos = num_videos self.videos_memmap = np.memmap(videos_memmap_path, mode = 'r', dtype = np.uint8, shape = (num_videos, num_frames, channels, image_size, image_size)) self.text_memmap = np.memmap(text_memmap_path, mode = 'r', dtype = np.uint8, shape = (num_videos, num_digits)) self.random_rotate = random_rotate def __len__(self): return self.num_videos def __getitem__(self, idx): video = torch.from_numpy(self.videos_memmap[idx].copy()).float() label = torch.from_numpy(self.text_memmap[idx].copy()) video /= 255 video = video.to(torch.float32) text = tokenizer.encode(' '.join(map(str, label.tolist()))) text = torch.Tensor(text).long() if self.random_rotate: video = T.functional.rotate(video, choice([0, 90, 180, 270])) return text, video class VideoIndicesDataset(Dataset): def __init__( self, *, videos_memmap_path, text_memmap_path, vae, num_videos, num_frames, num_digits = 2, ): self.num_videos = num_videos fmap_size = vae.image_size // (vae.num_layers ** 2) self.videos_memmap = np.memmap(videos_memmap_path, mode = 'r', dtype = np.int64, shape = (num_videos, num_frames * (fmap_size ** 2))) self.text_memmap = np.memmap(text_memmap_path, mode = 'r', dtype = np.uint8, shape = (num_videos, num_digits)) def __len__(self): return self.num_videos def __getitem__(self, idx): video = torch.from_numpy(self.videos_memmap[idx].copy()) text = torch.from_numpy(self.text_memmap[idx].copy()) text = tokenizer.encode(' '.join(map(str, text.tolist()))) text = torch.Tensor(text).long() video = video.long() return text, video # dataset for training from folder of videos as gifs class GifVideoDataset(Dataset): def __init__( self, *, folder, channels = 1 ): folder = Path(folder) gifs = folder.glob('**/*.gif') txts = folder.glob('**/*.txt') gif_path_stems = set(map(lambda t: str(t.with_suffix('')), gifs)) txt_path_stems = set(map(lambda t: str(t.with_suffix('')), txts)) self.path_stems = list(gif_path_stems.intersection(txt_path_stems)) self.channels = channels print(f'{len(self.path_stems)} video / text pairs found') def __len__(self): return len(self.path_stems) def __getitem__(self, idx): path_stem = self.path_stems[idx] txt_path = Path(f'{path_stem}.txt') txt_str = txt_path.read_text() text_tensor = torch.Tensor(tokenizer.encode(txt_str)).long() video_tensor = gif_to_tensor(f'{path_stem}.gif', channels = self.channels) return text_tensor, video_tensor # training class class NUWATrainer(nn.Module): def __init__( self, *, nuwa, dataset, num_train_steps, lr = 3e-4, wd = 0.01, batch_size = 4, grad_accum_every = 8, max_grad_norm = 0.5, save_model_every = 2500, save_results_every = 1000, results_folder = './results-nuwa', num_sampled_frames = float('inf') ): super().__init__() assert isinstance(nuwa, NUWA), 'nuwa must be an instance of NUWA' self.nuwa = nuwa self.steps = 0 self.num_train_steps = num_train_steps self.batch_size = batch_size self.grad_accum_every = grad_accum_every self.max_grad_norm = max_grad_norm self.optim = get_optimizer(nuwa.parameters(), lr = lr, wd = wd) # dataset self.ds = dataset # dataloader self.dl = cycle(DataLoader( self.ds, batch_size = batch_size, collate_fn = pad_collate_fn, shuffle = True )) self.save_model_every = save_model_every self.save_results_every = save_results_every self.num_sampled_frames = num_sampled_frames self.results_folder = Path(results_folder) if len([*self.results_folder.glob('**/*')]) > 0 and yes_or_no('do you want to clear previous experiment checkpoints and results?'): rmtree(str(self.results_folder)) self.results_folder.mkdir(parents = True, exist_ok = True) def train_step(self): device = next(self.nuwa.parameters()).device self.nuwa.train() logs = {} for _ in range(self.grad_accum_every): text, video = next(self.dl) text, video = map(lambda t: t.to(device), (text, video)) loss = self.nuwa( text = text, video = video, return_loss = True ) accum_log(logs, {'loss': loss.item() / self.grad_accum_every}) (loss / self.grad_accum_every).backward() print(f'{self.steps} loss: {logs["loss"]}') torch.nn.utils.clip_grad_norm_(self.nuwa.parameters(), self.max_grad_norm) self.optim.step() self.optim.zero_grad() if not (self.steps % self.save_results_every): self.nuwa.eval() print(f'{self.steps} sampling') rand_idx = randrange(0, len(self.ds)) text, video = self.ds[rand_idx] text, video = next(self.dl) text = text.to(device) video = self.nuwa.generate(text = text[:1], num_frames = min(video.shape[1], self.num_sampled_frames)) one_video = video[0].cpu().clamp(0., 1.) text_str = tokenizer.decode(text[0]) logs['sampled_text'] = text_str logs['sampled_video'] = one_video.numpy() image = rearrange(one_video, 'f c h w -> c (f h) w') save_image(image, str(self.results_folder / f'{self.steps}.png')) print(f'{self.steps}: saving to {str(self.results_folder)}') if not (self.steps % self.save_model_every): state_dict = self.nuwa.state_dict() model_path = str(self.results_folder / f'nuwa.{self.steps}.pt') torch.save(state_dict, model_path) print(f'{self.steps}: saving model to {str(self.results_folder)}') self.steps += 1 return logs def train(self, log_fn = noop): while self.steps < self.num_train_steps: logs = self.train_step() log_fn(logs) print('training complete')
nuwa-pytorch-main
nuwa_pytorch/train_nuwa.py
import torch import torch.nn as nn from operator import itemgetter from torch.autograd.function import Function from torch.utils.checkpoint import get_device_states, set_device_states # for routing arguments into the functions of the reversible layer def route_args(router, args, depth): routed_args = [(dict(), dict()) for _ in range(depth)] matched_keys = [key for key in args.keys() if key in router] for key in matched_keys: val = args[key] for depth, ((f_args, g_args), routes) in enumerate(zip(routed_args, router[key])): new_f_args, new_g_args = map(lambda route: ({key: val} if route else {}), routes) routed_args[depth] = ({**f_args, **new_f_args}, {**g_args, **new_g_args}) return routed_args # following example for saving and setting rng here https://pytorch.org/docs/stable/_modules/torch/utils/checkpoint.html class Deterministic(nn.Module): def __init__(self, net): super().__init__() self.net = net self.cpu_state = None self.cuda_in_fwd = None self.gpu_devices = None self.gpu_states = None def record_rng(self, *args): self.cpu_state = torch.get_rng_state() if torch.cuda._initialized: self.cuda_in_fwd = True self.gpu_devices, self.gpu_states = get_device_states(*args) def forward(self, *args, record_rng = False, set_rng = False, **kwargs): if record_rng: self.record_rng(*args) if not set_rng: return self.net(*args, **kwargs) rng_devices = [] if self.cuda_in_fwd: rng_devices = self.gpu_devices with torch.random.fork_rng(devices=rng_devices, enabled=True): torch.set_rng_state(self.cpu_state) if self.cuda_in_fwd: set_device_states(self.gpu_devices, self.gpu_states) return self.net(*args, **kwargs) # heavily inspired by https://github.com/RobinBruegger/RevTorch/blob/master/revtorch/revtorch.py # once multi-GPU is confirmed working, refactor and send PR back to source class ReversibleBlock(nn.Module): def __init__(self, f, g): super().__init__() self.f = Deterministic(f) self.g = Deterministic(g) def forward(self, x, f_args = {}, g_args = {}): x1, x2 = torch.chunk(x, 2, dim=2) y1, y2 = None, None with torch.no_grad(): y1 = x1 + self.f(x2, record_rng=self.training, **f_args) y2 = x2 + self.g(y1, record_rng=self.training, **g_args) return torch.cat([y1, y2], dim=2) def backward_pass(self, y, dy, f_args = {}, g_args = {}): y1, y2 = torch.chunk(y, 2, dim=2) del y dy1, dy2 = torch.chunk(dy, 2, dim=2) del dy with torch.enable_grad(): y1.requires_grad = True gy1 = self.g(y1, set_rng=True, **g_args) torch.autograd.backward(gy1, dy2) with torch.no_grad(): x2 = y2 - gy1 del y2, gy1 dx1 = dy1 + y1.grad del dy1 y1.grad = None with torch.enable_grad(): x2.requires_grad = True fx2 = self.f(x2, set_rng=True, **f_args) torch.autograd.backward(fx2, dx1, retain_graph=True) with torch.no_grad(): x1 = y1 - fx2 del y1, fx2 dx2 = dy2 + x2.grad del dy2 x2.grad = None x = torch.cat([x1, x2.detach()], dim=2) dx = torch.cat([dx1, dx2], dim=2) return x, dx class _ReversibleFunction(Function): @staticmethod def forward(ctx, x, blocks, args): ctx.args = args for block, kwarg in zip(blocks, args): x = block(x, **kwarg) ctx.y = x.detach() ctx.blocks = blocks return x @staticmethod def backward(ctx, dy): y = ctx.y args = ctx.args for block, kwargs in zip(ctx.blocks[::-1], args[::-1]): y, dy = block.backward_pass(y, dy, **kwargs) return dy, None, None class ReversibleSequence(nn.Module): def __init__(self, blocks, args_route = {}): super().__init__() self.args_route = args_route self.blocks = nn.ModuleList([ReversibleBlock(f=f, g=g) for f, g in blocks]) def forward(self, x, **kwargs): x = torch.cat([x, x], dim=-1) blocks = self.blocks args = route_args(self.args_route, kwargs, len(blocks)) args = list(map(lambda x: {'f_args': x[0], 'g_args': x[1]}, args)) layers_and_args = list(zip(blocks, args)) out = _ReversibleFunction.apply(x, blocks, args) return torch.stack(out.chunk(2, dim=-1)).sum(dim=0)
nuwa-pytorch-main
nuwa_pytorch/reversible.py
from nuwa_pytorch.nuwa_pytorch import NUWA, NUWASketch, NUWAVideoAudio, Sparse3DNA, CrossModalityCrossAttention from nuwa_pytorch.vqgan_vae import VQGanVAE from nuwa_pytorch.train_vqgan_vae import VQGanVAETrainer from nuwa_pytorch.train_nuwa import NUWATrainer
nuwa-pytorch-main
nuwa_pytorch/__init__.py
# take from https://github.com/openai/CLIP/blob/main/clip/simple_tokenizer.py # to give users a quick easy start to training DALL-E without doing BPE import torch import html import os from functools import lru_cache from pathlib import Path import ftfy import regex as re # OpenAI simple tokenizer @lru_cache() def default_bpe(): return os.path.join(os.path.dirname(os.path.abspath(__file__)), "data/bpe_simple_vocab_16e6.txt") @lru_cache() def bytes_to_unicode(): bs = list(range(ord("!"), ord("~") + 1)) + list(range(ord("¡"), ord("¬") + 1)) + list(range(ord("®"), ord("ÿ") + 1)) cs = bs[:] n = 0 for b in range(2 ** 8): if b not in bs: bs.append(b) cs.append(2 ** 8 + n) n += 1 cs = [chr(n) for n in cs] return dict(zip(bs, cs)) def get_pairs(word): pairs = set() prev_char = word[0] for char in word[1:]: pairs.add((prev_char, char)) prev_char = char return pairs def basic_clean(text): text = ftfy.fix_text(text) text = html.unescape(html.unescape(text)) return text.strip() def whitespace_clean(text): text = re.sub(r'\s+', ' ', text) text = text.strip() return text class SimpleTokenizer(object): def __init__(self, bpe_path = default_bpe()): self.byte_encoder = bytes_to_unicode() self.byte_decoder = {v: k for k, v in self.byte_encoder.items()} merges = Path(bpe_path).read_text(encoding='utf8').split('\n') merges = merges[1:49152 - 256 - 2 + 1] merges = [tuple(merge.split()) for merge in merges] vocab = list(bytes_to_unicode().values()) vocab = vocab + [v + '</w>' for v in vocab] for merge in merges: vocab.append(''.join(merge)) vocab.extend(['<|startoftext|>', '<|endoftext|>']) self.vocab_size = 49408 self.encoder = dict(zip(vocab, range(len(vocab)))) self.decoder = {v: k for k, v in self.encoder.items()} self.bpe_ranks = dict(zip(merges, range(len(merges)))) self.cache = {'<|startoftext|>': '<|startoftext|>', '<|endoftext|>': '<|endoftext|>'} self.pat = re.compile( r"""<\|startoftext\|>|<\|endoftext\|>|'s|'t|'re|'ve|'m|'ll|'d|[\p{L}]+|[\p{N}]|[^\s\p{L}\p{N}]+""", re.IGNORECASE) def bpe(self, token): if token in self.cache: return self.cache[token] word = tuple(token[:-1]) + (token[-1] + '</w>',) pairs = get_pairs(word) if not pairs: return token + '</w>' while True: bigram = min(pairs, key=lambda pair: self.bpe_ranks.get(pair, float('inf'))) if bigram not in self.bpe_ranks: break first, second = bigram new_word = [] i = 0 while i < len(word): try: j = word.index(first, i) new_word.extend(word[i:j]) i = j except: new_word.extend(word[i:]) break if word[i] == first and i < len(word) - 1 and word[i + 1] == second: new_word.append(first + second) i += 2 else: new_word.append(word[i]) i += 1 new_word = tuple(new_word) word = new_word if len(word) == 1: break else: pairs = get_pairs(word) word = ' '.join(word) self.cache[token] = word return word def encode(self, text): bpe_tokens = [] text = whitespace_clean(basic_clean(text)).lower() for token in re.findall(self.pat, text): token = ''.join(self.byte_encoder[b] for b in token.encode('utf-8')) bpe_tokens.extend(self.encoder[bpe_token] for bpe_token in self.bpe(token).split(' ')) return bpe_tokens def decode(self, tokens, remove_start_end = True, pad_tokens = {}): if torch.is_tensor(tokens): tokens = tokens.tolist() if remove_start_end: tokens = [token for token in tokens if token not in (49406, 40407, 0)] text = ''.join([self.decoder[token] for token in tokens if token not in pad_tokens]) text = bytearray([self.byte_decoder[c] for c in text]).decode('utf-8', errors="replace").replace('</w>', ' ') return text def tokenize(self, texts, context_length = 256, truncate_text = False): if isinstance(texts, str): texts = [texts] all_tokens = [self.encode(text) for text in texts] result = torch.zeros(len(all_tokens), context_length, dtype=torch.long) for i, tokens in enumerate(all_tokens): if len(tokens) > context_length: if truncate_text: tokens = tokens[:context_length] else: raise RuntimeError(f"Input {texts[i]} is too long for context length {context_length}") result[i, :len(tokens)] = torch.tensor(tokens) return result tokenizer = SimpleTokenizer()
nuwa-pytorch-main
nuwa_pytorch/tokenizer.py
from math import sqrt import copy from random import choice from pathlib import Path from shutil import rmtree import torch from torch import nn import numpy as np from PIL import Image from torchvision.datasets import ImageFolder import torchvision.transforms as T from torch.utils.data import Dataset, DataLoader, random_split from torchvision.utils import make_grid, save_image from einops import rearrange from nuwa_pytorch.vqgan_vae import VQGanVAE from nuwa_pytorch.optimizer import get_optimizer # helpers def exists(val): return val is not None def noop(*args, **kwargs): pass def cycle(dl): while True: for data in dl: yield data def cast_tuple(t): return t if isinstance(t, (tuple, list)) else (t,) def yes_or_no(question): answer = input(f'{question} (y/n) ') return answer.lower() in ('yes', 'y') def accum_log(log, new_logs): for key, new_value in new_logs.items(): old_value = log.get(key, 0.) log[key] = old_value + new_value return log # classes class MemmappedImageDataset(Dataset): def __init__( self, *, path, shape, random_rotate = True ): super().__init__() path = Path(path) assert path.exists(), f'path {path} must exist' self.memmap = np.memmap(str(path), mode = 'r', dtype = np.uint8, shape = shape) self.random_rotate = random_rotate image_size = shape[-1] self.transform = T.Compose([ T.Resize(image_size), T.CenterCrop(image_size), T.ToTensor() ]) def __len__(self): return self.memmap.shape[0] def __getitem__(self, index): arr = self.memmap[index] if arr.shape[0] == 1: arr = rearrange(arr, '1 ... -> ...') img = Image.fromarray(arr) img = self.transform(img) if self.random_rotate: img = T.functional.rotate(img, choice([0, 90, 180, 270])) return img class ImageDataset(Dataset): def __init__( self, folder, image_size, exts = ['jpg', 'jpeg', 'png'] ): super().__init__() self.folder = folder self.image_size = image_size self.paths = [p for ext in exts for p in Path(f'{folder}').glob(f'**/*.{ext}')] print(f'{len(self.paths)} training samples found at {folder}') self.transform = T.Compose([ T.Lambda(lambda img: img.convert('RGB') if img.mode != 'RGB' else img), T.Resize(image_size), T.RandomHorizontalFlip(), T.CenterCrop(image_size), T.ToTensor() ]) def __len__(self): return len(self.paths) def __getitem__(self, index): path = self.paths[index] img = Image.open(path) return self.transform(img) # exponential moving average wrapper class EMA(nn.Module): def __init__( self, model, beta = 0.99, ema_update_after_step = 1000, ema_update_every = 10, ): super().__init__() self.beta = beta self.online_model = model self.ema_model = copy.deepcopy(model) self.ema_update_after_step = ema_update_after_step # only start EMA after this step number, starting at 0 self.ema_update_every = ema_update_every self.register_buffer('initted', torch.Tensor([False])) self.register_buffer('step', torch.tensor([0.])) def update(self): self.step += 1 if self.step <= self.ema_update_after_step or (self.step % self.ema_update_every) != 0: return if not self.initted: self.ema_model.state_dict(self.online_model.state_dict()) self.initted.data.copy_(torch.Tensor([True])) self.update_moving_average(self.ema_model, self.online_model) def update_moving_average(self, ma_model, current_model): def calculate_ema(beta, old, new): if not exists(old): return new return old * beta + (1 - beta) * new for current_params, ma_params in zip(current_model.parameters(), ma_model.parameters()): old_weight, up_weight = ma_params.data, current_params.data ma_params.data = calculate_ema(self.beta, old_weight, up_weight) for current_buffer, ma_buffer in zip(current_model.buffers(), ma_model.buffers()): new_buffer_value = calculate_ema(self.beta, ma_buffer, current_buffer) ma_buffer.copy_(new_buffer_value) def __call__(self, *args, **kwargs): return self.ema_model(*args, **kwargs) # main trainer class class VQGanVAETrainer(nn.Module): def __init__( self, vae, *, num_train_steps, lr, batch_size, grad_accum_every, wd = 0., images_memmap_path = None, images_memmap_shape = None, folder = None, save_results_every = 100, save_model_every = 1000, results_folder = './results', valid_frac = 0.05, random_split_seed = 42, ema_beta = 0.995, ema_update_after_step = 2000, ema_update_every = 10, apply_grad_penalty_every = 4, ): super().__init__() assert isinstance(vae, VQGanVAE), 'vae must be instance of VQGanVAE' image_size = vae.image_size self.vae = vae self.ema_vae = EMA(vae, ema_update_after_step = ema_update_after_step, ema_update_every = ema_update_every) self.register_buffer('steps', torch.Tensor([0])) self.num_train_steps = num_train_steps self.batch_size = batch_size self.grad_accum_every = grad_accum_every all_parameters = set(vae.parameters()) discr_parameters = set(vae.discr.parameters()) vae_parameters = all_parameters - discr_parameters self.optim = get_optimizer(vae_parameters, lr = lr, wd = wd) self.discr_optim = get_optimizer(discr_parameters, lr = lr, wd = wd) # create dataset assert exists(folder) ^ exists(images_memmap_path), 'either folder or memmap path to images must be supplied' if exists(images_memmap_path): assert exists(images_memmap_shape), 'shape of memmapped images must be supplied' if exists(folder): self.ds = ImageDataset(folder, image_size = image_size) elif exists(images_memmap_path): self.ds = MemmappedImageDataset(path = images_memmap_path, shape = images_memmap_shape) # split for validation if valid_frac > 0: train_size = int((1 - valid_frac) * len(self.ds)) valid_size = len(self.ds) - train_size self.ds, self.valid_ds = random_split(self.ds, [train_size, valid_size], generator = torch.Generator().manual_seed(random_split_seed)) print(f'training with dataset of {len(self.ds)} samples and validating with randomly splitted {len(self.valid_ds)} samples') else: self.valid_ds = self.ds print(f'training with shared training and valid dataset of {len(self.ds)} samples') # dataloader self.dl = cycle(DataLoader( self.ds, batch_size = batch_size, shuffle = True )) self.valid_dl = cycle(DataLoader( self.valid_ds, batch_size = batch_size, shuffle = True )) self.save_model_every = save_model_every self.save_results_every = save_results_every self.apply_grad_penalty_every = apply_grad_penalty_every self.results_folder = Path(results_folder) if len([*self.results_folder.glob('**/*')]) > 0 and yes_or_no('do you want to clear previous experiment checkpoints and results?'): rmtree(str(self.results_folder)) self.results_folder.mkdir(parents = True, exist_ok = True) def train_step(self): device = next(self.vae.parameters()).device steps = int(self.steps.item()) apply_grad_penalty = not (steps % self.apply_grad_penalty_every) self.vae.train() # logs logs = {} # update vae (generator) for _ in range(self.grad_accum_every): img = next(self.dl) img = img.to(device) loss = self.vae( img, return_loss = True, apply_grad_penalty = apply_grad_penalty ) accum_log(logs, {'loss': loss.item() / self.grad_accum_every}) (loss / self.grad_accum_every).backward() self.optim.step() self.optim.zero_grad() # update discriminator if exists(self.vae.discr): self.discr_optim.zero_grad() discr_loss = 0 for _ in range(self.grad_accum_every): img = next(self.dl) img = img.to(device) loss = self.vae(img, return_discr_loss = True) accum_log(logs, {'discr_loss': loss.item() / self.grad_accum_every}) (loss / self.grad_accum_every).backward() self.discr_optim.step() # log print(f"{steps}: vae loss: {logs['loss']} - discr loss: {logs['discr_loss']}") # update exponential moving averaged generator self.ema_vae.update() # sample results every so often if not (steps % self.save_results_every): for model, filename in ((self.ema_vae.ema_model, f'{steps}.ema'), (self.vae, str(steps))): model.eval() imgs = next(self.dl) imgs = imgs.to(device) recons = model(imgs) nrows = int(sqrt(self.batch_size)) imgs_and_recons = torch.stack((imgs, recons), dim = 0) imgs_and_recons = rearrange(imgs_and_recons, 'r b ... -> (b r) ...') imgs_and_recons = imgs_and_recons.detach().cpu().float().clamp(0., 1.) grid = make_grid(imgs_and_recons, nrow = 2, normalize = True, value_range = (0, 1)) logs['reconstructions'] = grid save_image(grid, str(self.results_folder / f'{filename}.png')) print(f'{steps}: saving to {str(self.results_folder)}') # save model every so often if not (steps % self.save_model_every): state_dict = self.vae.state_dict() model_path = str(self.results_folder / f'vae.{steps}.pt') torch.save(state_dict, model_path) ema_state_dict = self.ema_vae.state_dict() model_path = str(self.results_folder / f'vae.{steps}.ema.pt') torch.save(ema_state_dict, model_path) print(f'{steps}: saving model to {str(self.results_folder)}') self.steps += 1 return logs def train(self, log_fn = noop): device = next(self.vae.parameters()).device while self.steps < self.num_train_steps: logs = self.train_step() log_fn(logs) print('training complete')
nuwa-pytorch-main
nuwa_pytorch/train_vqgan_vae.py
import torch import torch.nn as nn from torch.autograd.function import Function from contextlib import contextmanager from nuwa_pytorch.reversible import Deterministic from einops import reduce # helpers def exists(val): return val is not None @contextmanager def null_context(): yield def split_at_index(dim, index, t): pre_slices = (slice(None),) * dim l = (*pre_slices, slice(None, index)) r = (*pre_slices, slice(index, None)) return t[l], t[r] # reversible self attention block class ReversibleSelfAttnBlock(nn.Module): def __init__(self, f, g, j, k): super().__init__() self.f = Deterministic(f) self.g = Deterministic(g) self.j = Deterministic(j) self.k = Deterministic(k) def forward(self, x, m, _reverse = True, **kwargs): x1, x2 = torch.chunk(x, 2, dim = 2) m1, m2 = torch.chunk(m, 2, dim = 2) y1, y2, n1, n2 = None, None, None, None fn_context = torch.no_grad if _reverse else null_context record_rng = self.training and _reverse with fn_context(): y1 = x1 + self.f(x2, record_rng = record_rng) y2 = x2 + self.g(y1, record_rng = record_rng) n1 = m1 + self.j(m2, record_rng = record_rng) n2 = m2 + self.k(n1, record_rng = record_rng) return torch.cat((y1, y2), dim = 2), torch.cat((n1, n2), dim = 2) def backward_pass(self, y, n, dy, dn, **kwargs): y1, y2 = torch.chunk(y, 2, dim = 2) del y dy1, dy2 = torch.chunk(dy, 2, dim = 2) del dy with torch.enable_grad(): y1.requires_grad = True gy1 = self.g(y1, set_rng = True) torch.autograd.backward(gy1, dy2) with torch.no_grad(): x2 = y2 - gy1 del y2, gy1 dx1 = dy1 + y1.grad del dy1 y1.grad = None with torch.enable_grad(): x2.requires_grad = True fx2 = self.f(x2, set_rng = True) torch.autograd.backward(fx2, dx1, retain_graph = True) with torch.no_grad(): x1 = y1 - fx2 del y1, fx2 dx2 = dy2 + x2.grad del dy2 x2.grad = None x = torch.cat([x1, x2.detach()], dim = 2) dx = torch.cat([dx1, dx2], dim = 2) n1, n2 = torch.chunk(n, 2, dim = 2) del n dn1, dn2 = torch.chunk(dn, 2, dim = 2) del dn with torch.enable_grad(): n1.requires_grad = True gn1 = self.k(n1, set_rng = True) torch.autograd.backward(gn1, dn2) with torch.no_grad(): m2 = n2 - gn1 del n2, gn1 dm1 = dn1 + n1.grad del dn1 n1.grad = None with torch.enable_grad(): m2.requires_grad = True fm2 = self.j(m2, set_rng = True) torch.autograd.backward(fm2, dm1, retain_graph=True) with torch.no_grad(): m1 = n1 - fm2 del n1, fm2 dm2 = dn2 + m2.grad del dn2 m2.grad = None m = torch.cat([m1, m2.detach()], dim = 2) dm = torch.cat([dm1, dm2], dim = 2) return x, m, dx, dm class ReversibleCrossAttnBlock(nn.Module): def __init__(self, f, g, j, k): super().__init__() self.f = Deterministic(f) self.g = Deterministic(g) self.j = Deterministic(j) self.k = Deterministic(k) def forward(self, x, m, *, context, context_mask, video_mask = None, audio_mask = None, _reverse = True, **kwargs): x1, x2 = torch.chunk(x, 2, dim = 2) m1, m2 = torch.chunk(m, 2, dim = 2) y1, y2, n1, n2 = None, None, None, None fn_context = torch.no_grad if _reverse else null_context record_rng = self.training and _reverse with fn_context(): y1 = x1 + self.f(x2, context = context, context_mask = context_mask, mask = video_mask, record_rng = record_rng) y2 = x2 + self.g(y1, record_rng = record_rng) n1 = m1 + self.j(m2, context = context, context_mask = context_mask, mask = audio_mask, record_rng = record_rng) n2 = m2 + self.k(n1, record_rng = record_rng) return torch.cat((y1, y2), dim = 2), torch.cat((n1, n2), dim = 2) def backward_pass(self, y, n, dy, dn, *, context, context_mask, video_mask = None, audio_mask = None, **kwargs): y1, y2 = torch.chunk(y, 2, dim = 2) del y dy1, dy2 = torch.chunk(dy, 2, dim = 2) del dy with torch.enable_grad(): y1.requires_grad = True gy1 = self.g(y1, set_rng = True) torch.autograd.backward(gy1, dy2) with torch.no_grad(): x2 = y2 - gy1 del y2, gy1 dx1 = dy1 + y1.grad del dy1 y1.grad = None with torch.enable_grad(): x2.requires_grad = True fx2 = self.f(x2, set_rng = True, context = context, context_mask = context_mask, mask = video_mask) torch.autograd.backward(fx2, dx1, retain_graph = True) with torch.no_grad(): x1 = y1 - fx2 del y1, fx2 dx2 = dy2 + x2.grad del dy2 x2.grad = None x = torch.cat([x1, x2.detach()], dim = 2) dx = torch.cat([dx1, dx2], dim = 2) n1, n2 = torch.chunk(n, 2, dim = 2) del n dn1, dn2 = torch.chunk(dn, 2, dim = 2) del dn with torch.enable_grad(): n1.requires_grad = True gn1 = self.k(n1, set_rng = True) torch.autograd.backward(gn1, dn2) with torch.no_grad(): m2 = n2 - gn1 del n2, gn1 dm1 = dn1 + n1.grad del dn1 n1.grad = None with torch.enable_grad(): m2.requires_grad = True fm2 = self.j(m2, set_rng = True, context = context, context_mask = context_mask, mask = audio_mask) torch.autograd.backward(fm2, dm1, retain_graph=True) with torch.no_grad(): m1 = n1 - fm2 del n1, fm2 dm2 = dn2 + m2.grad del dn2 m2.grad = None m = torch.cat([m1, m2.detach()], dim = 2) dm = torch.cat([dm1, dm2], dim = 2) return x, m, dx, dm # reversible cross attention block class ReversibleCrossModalityAttnBlock(nn.Module): def __init__(self, f, g, j, k): super().__init__() self.f = Deterministic(f) self.g = Deterministic(g) self.j = Deterministic(j) self.k = Deterministic(k) def forward(self, x, m, *, video_mask = None, audio_mask = None, _reverse = True, **kwargs): x1, x2 = torch.chunk(x, 2, dim = 2) m1, m2 = torch.chunk(m, 2, dim = 2) y1, y2, n1, n2 = None, None, None, None fn_context = torch.no_grad if _reverse else null_context record_rng = self.training and _reverse with fn_context(): y1 = x1 + self.f(x2, m2, record_rng = record_rng, mask = video_mask, context_mask = audio_mask) y2 = x2 + self.k(y1, record_rng = record_rng) n1 = m1 + self.j(m2, y2, record_rng = record_rng, mask = audio_mask, context_mask = video_mask) n2 = m2 + self.g(n1, record_rng = record_rng) return torch.cat((y1, y2), dim = 2), torch.cat((n1, n2), dim = 2) def backward_pass(self, y, n, dy, dn, video_mask = None, audio_mask = None, **kwargs): n1, n2 = torch.chunk(n, 2, dim = 2) del n dn1, dn2 = torch.chunk(dn, 2, dim = 2) del dn y1, y2 = torch.chunk(y, 2, dim = 2) del y dy1, dy2 = torch.chunk(dy, 2, dim = 2) del dy with torch.enable_grad(): n1.requires_grad = True gn1 = self.g(n1, set_rng = True) torch.autograd.backward(gn1, dn2) with torch.no_grad(): m2 = n2 - gn1 del n2, gn1 dm1 = dn1 + n1.grad del dn1 n1.grad = None with torch.enable_grad(): m2.requires_grad = True y2.requires_grad = True fm2 = self.j(m2, y2, set_rng=True, mask = audio_mask, context_mask = video_mask) torch.autograd.backward(fm2, dm1) with torch.no_grad(): m1 = n1 - fm2 del n1, fm2 dm2 = dn2 + m2.grad dx2 = dy2 + y2.grad del dn2 del dy2 m2.grad = None y2.grad = None with torch.enable_grad(): y1.requires_grad = True gy1 = self.k(y1, set_rng = True) torch.autograd.backward(gy1, dx2) with torch.no_grad(): x2 = y2 - gy1 del y2, gy1 dx1 = dy1 + y1.grad del dy1 y1.grad = None with torch.enable_grad(): x2.requires_grad = True m2.requires_grad = True fx2 = self.f(x2, m2, set_rng = True, mask = video_mask, context_mask = audio_mask) torch.autograd.backward(fx2, dx1) with torch.no_grad(): x1 = y1 - fx2 del y1, fx2 dx2 = dx2 + x2.grad dm2 = dm2 + m2.grad x2.grad = None m2.grad = None with torch.no_grad(): m = torch.cat([m1, m2.detach()], dim = 2) dm = torch.cat([dm1, dm2], dim = 2) x = torch.cat([x1, x2.detach()], dim = 2) dx = torch.cat([dx1, dx2], dim = 2) return x, m, dx, dm # reverse and non reverse functions class ReversibleFunction(Function): @staticmethod def forward(ctx, inp, ind, blocks, kwargs): x, m = split_at_index(1, ind, inp) for block in blocks: x, m = block(x, m, _reverse = True, **kwargs) ctx.blocks = blocks ctx.kwargs = kwargs ctx.ind = ind ctx.save_for_backward(x.detach(), m.detach()) return torch.cat((x, m), dim = 1) @staticmethod def backward(ctx, d): ind = ctx.ind blocks = ctx.blocks kwargs = ctx.kwargs dy, dn = split_at_index(1, ind, d) y, n = ctx.saved_tensors for block in blocks[::-1]: y, n, dy, dn = block.backward_pass(y, n, dy, dn, **kwargs) d = torch.cat((dy, dn), dim = 1) return d, None, None, None reversible_apply = ReversibleFunction.apply def irreversible_apply(inputs, ind, blocks, kwargs): x, m = split_at_index(1, ind, inputs) for block in blocks: x, m = block(x, m, _reverse = False, **kwargs) return torch.cat((x, m), dim = 1) # main reversible sequence class class DualModalityReversibleSequence(nn.Module): def __init__(self, input_blocks, block_types): super().__init__() self.block_types = block_types blocks = nn.ModuleList([]) for block, block_type in zip(input_blocks, block_types): if block_type == 'intra_modality_self_attn': reversible_klass = ReversibleSelfAttnBlock elif block_type == 'intra_modality_cross_attn': reversible_klass = ReversibleCrossAttnBlock elif block_type == 'inter_modality_cross_attn': reversible_klass = ReversibleCrossModalityAttnBlock else: raise ValueError(f'unknown layer type {block_type}') blocks.append(reversible_klass(*block)) self.blocks = blocks def forward( self, video, audio, *, context, context_mask = None, video_mask = None, audio_mask = None, reverse = True ): blocks = self.blocks video, audio = list(map(lambda t: torch.cat((t, t), dim = -1), (video, audio))) kwargs = {'context': context, 'context_mask': context_mask, 'video_mask': video_mask, 'audio_mask': audio_mask} fn = reversible_apply if reverse else irreversible_apply ind = video.shape[1] inp = torch.cat((video, audio), dim = 1) out = fn(inp, ind, blocks, kwargs) video, audio = split_at_index(1, ind, out) return list(map(lambda t: reduce(t, 'b n (c d) -> b n d', 'mean', c = 2), (video, audio)))
nuwa-pytorch-main
nuwa_pytorch/reversible_video_audio.py
import torch from torch.optim import AdamW, Adam # adamw functions def separate_weight_decayable_params(params): no_wd_params = set([param for param in params if param.ndim < 2]) wd_params = set(params) - no_wd_params return wd_params, no_wd_params def get_optimizer( params, lr = 3e-4, wd = 1e-1, filter_by_requires_grad = False ): if filter_by_requires_grad: params = list(filter(lambda t: t.requires_grad, params)) if wd == 0: return Adam(list(params), lr = lr) params = set(params) wd_params, no_wd_params = separate_weight_decayable_params(params) param_groups = [ {'params': list(wd_params)}, {'params': list(no_wd_params), 'weight_decay': 0}, ] return AdamW(param_groups, lr = lr, weight_decay = wd)
nuwa-pytorch-main
nuwa_pytorch/optimizer.py
import copy import math from functools import partial, wraps from math import sqrt from vector_quantize_pytorch import VectorQuantize as VQ import torchvision import torch from torch import nn, einsum import torch.nn.functional as F from torch.autograd import grad as torch_grad from einops import rearrange, reduce, repeat # constants MList = nn.ModuleList # helper functions def exists(val): return val is not None def default(val, d): return val if exists(val) else d # decorators def eval_decorator(fn): def inner(model, *args, **kwargs): was_training = model.training model.eval() out = fn(model, *args, **kwargs) model.train(was_training) return out return inner def remove_vgg(fn): @wraps(fn) def inner(self, *args, **kwargs): has_vgg = hasattr(self, 'vgg') if has_vgg: vgg = self.vgg delattr(self, 'vgg') out = fn(self, *args, **kwargs) if has_vgg: self.vgg = vgg return out return inner # keyword argument helpers def pick_and_pop(keys, d): values = list(map(lambda key: d.pop(key), keys)) return dict(zip(keys, values)) def group_dict_by_key(cond, d): return_val = [dict(),dict()] for key in d.keys(): match = bool(cond(key)) ind = int(not match) return_val[ind][key] = d[key] return (*return_val,) def string_begins_with(prefix, str): return str.startswith(prefix) def group_by_key_prefix(prefix, d): return group_dict_by_key(partial(string_begins_with, prefix), d) def groupby_prefix_and_trim(prefix, d): kwargs_with_prefix, kwargs = group_dict_by_key(partial(string_begins_with, prefix), d) kwargs_without_prefix = dict(map(lambda x: (x[0][len(prefix):], x[1]), tuple(kwargs_with_prefix.items()))) return kwargs_without_prefix, kwargs # tensor helper functions def gradient_penalty(images, output, weight = 10): batch_size = images.shape[0] gradients = torch_grad(outputs = output, inputs = images, grad_outputs = torch.ones(output.size(), device = images.device), create_graph = True, retain_graph = True, only_inputs = True)[0] gradients = rearrange(gradients, 'b ... -> b (...)') return weight * ((gradients.norm(2, dim=1) - 1) ** 2).mean() def l2norm(t): return F.normalize(t, dim = -1) def leaky_relu(p = 0.1): return nn.LeakyReLU(0.1) def stable_softmax(t, dim = -1, alpha = 32 ** 2): t = t / alpha t = t - torch.amax(t, dim = dim, keepdim = True).detach() return (t * alpha).softmax(dim = dim) def safe_div(numer, denom, eps = 1e-6): return numer / (denom + eps) # gan losses def hinge_discr_loss(fake, real): return (F.relu(1 + fake) + F.relu(1 - real)).mean() def hinge_gen_loss(fake): return -fake.mean() def bce_discr_loss(fake, real): return (-log(1 - sigmoid(fake)) - log(sigmoid(real))).mean() def bce_gen_loss(fake): return -log(sigmoid(fake)).mean() def grad_layer_wrt_loss(loss, layer): return torch_grad( outputs = loss, inputs = layer, grad_outputs = torch.ones_like(loss), retain_graph = True )[0].detach() # vqgan vae class LayerNormChan(nn.Module): def __init__( self, dim, eps = 1e-5 ): super().__init__() self.eps = eps self.g = nn.Parameter(torch.ones(1, dim, 1, 1)) self.b = nn.Parameter(torch.zeros(1, dim, 1, 1)) def forward(self, x): var = torch.var(x, dim = 1, unbiased = False, keepdim = True) mean = torch.mean(x, dim = 1, keepdim = True) return (x - mean) / (var + self.eps).sqrt() * self.g + self.b class Discriminator(nn.Module): def __init__( self, dims, channels = 3, groups = 16, init_kernel_size = 5 ): super().__init__() dim_pairs = zip(dims[:-1], dims[1:]) self.layers = MList([nn.Sequential(nn.Conv2d(channels, dims[0], init_kernel_size, padding = init_kernel_size // 2), leaky_relu())]) for dim_in, dim_out in dim_pairs: self.layers.append(nn.Sequential( nn.Conv2d(dim_in, dim_out, 4, stride = 2, padding = 1), nn.GroupNorm(groups, dim_out), leaky_relu() )) dim = dims[-1] self.to_logits = nn.Sequential( # return 5 x 5, for PatchGAN-esque training nn.Conv2d(dim, dim, 1), leaky_relu(), nn.Conv2d(dim, 1, 4) ) def forward(self, x): for net in self.layers: x = net(x) return self.to_logits(x) class ContinuousPositionBias(nn.Module): """ from https://arxiv.org/abs/2111.09883 """ def __init__(self, *, dim, heads, layers = 2): super().__init__() self.net = MList([]) self.net.append(nn.Sequential(nn.Linear(2, dim), leaky_relu())) for _ in range(layers - 1): self.net.append(nn.Sequential(nn.Linear(dim, dim), leaky_relu())) self.net.append(nn.Linear(dim, heads)) self.register_buffer('rel_pos', None, persistent = False) def forward(self, x): n, device = x.shape[-1], x.device fmap_size = int(sqrt(n)) if not exists(self.rel_pos): pos = torch.arange(fmap_size, device = device) grid = torch.stack(torch.meshgrid(pos, pos, indexing = 'ij')) grid = rearrange(grid, 'c i j -> (i j) c') rel_pos = rearrange(grid, 'i c -> i 1 c') - rearrange(grid, 'j c -> 1 j c') rel_pos = torch.sign(rel_pos) * torch.log(rel_pos.abs() + 1) self.register_buffer('rel_pos', rel_pos, persistent = False) rel_pos = self.rel_pos.float() for layer in self.net: rel_pos = layer(rel_pos) bias = rearrange(rel_pos, 'i j h -> h i j') return x + bias class GLUResBlock(nn.Module): def __init__(self, chan, groups = 16): super().__init__() self.net = nn.Sequential( nn.Conv2d(chan, chan * 2, 3, padding = 1), nn.GLU(dim = 1), nn.GroupNorm(groups, chan), nn.Conv2d(chan, chan * 2, 3, padding = 1), nn.GLU(dim = 1), nn.GroupNorm(groups, chan), nn.Conv2d(chan, chan, 1) ) def forward(self, x): return self.net(x) + x class ResBlock(nn.Module): def __init__(self, chan, groups = 16): super().__init__() self.net = nn.Sequential( nn.Conv2d(chan, chan, 3, padding = 1), nn.GroupNorm(groups, chan), leaky_relu(), nn.Conv2d(chan, chan, 3, padding = 1), nn.GroupNorm(groups, chan), leaky_relu(), nn.Conv2d(chan, chan, 1) ) def forward(self, x): return self.net(x) + x class VQGanAttention(nn.Module): def __init__( self, *, dim, dim_head = 64, heads = 8, dropout = 0. ): super().__init__() self.heads = heads self.scale = nn.Parameter(torch.ones(1, heads, 1, 1) * math.log(0.01)) inner_dim = heads * dim_head self.dropout = nn.Dropout(dropout) self.post_norm = LayerNormChan(dim) self.cpb = ContinuousPositionBias(dim = dim // 4, heads = heads) self.to_qkv = nn.Conv2d(dim, inner_dim * 3, 1, bias = False) self.to_out = nn.Conv2d(inner_dim, dim, 1) def forward(self, x): h = self.heads height, width, residual = *x.shape[-2:], x.clone() q, k, v = self.to_qkv(x).chunk(3, dim = 1) q, k, v = map(lambda t: rearrange(t, 'b (h c) x y -> b h c (x y)', h = h), (q, k, v)) q, k = map(l2norm, (q, k)) sim = einsum('b h c i, b h c j -> b h i j', q, k) * self.scale.exp() sim = self.cpb(sim) attn = stable_softmax(sim, dim = -1) attn = self.dropout(attn) out = einsum('b h i j, b h c j -> b h c i', attn, v) out = rearrange(out, 'b h c (x y) -> b (h c) x y', x = height, y = width) out = self.to_out(out) return self.post_norm(out) + residual class VQGanVAE(nn.Module): def __init__( self, *, dim, image_size, channels = 3, num_layers = 4, layer_mults = None, l2_recon_loss = False, use_hinge_loss = True, num_resnet_blocks = 1, vgg = None, vq_codebook_dim = 256, vq_codebook_size = 512, vq_decay = 0.8, vq_commitment_weight = 1., vq_kmeans_init = True, vq_use_cosine_sim = True, use_attn = True, attn_dim_head = 64, attn_heads = 8, resnet_groups = 16, attn_dropout = 0., first_conv_kernel_size = 5, use_vgg_and_gan = True, **kwargs ): super().__init__() assert dim % resnet_groups == 0, f'dimension {dim} must be divisible by {resnet_groups} (groups for the groupnorm)' vq_kwargs, kwargs = groupby_prefix_and_trim('vq_', kwargs) self.image_size = image_size self.channels = channels self.num_layers = num_layers self.fmap_size = image_size // (num_layers ** 2) self.codebook_size = vq_codebook_size self.encoders = MList([]) self.decoders = MList([]) layer_mults = default(layer_mults, list(map(lambda t: 2 ** t, range(num_layers)))) assert len(layer_mults) == num_layers, 'layer multipliers must be equal to designated number of layers' layer_dims = [dim * mult for mult in layer_mults] dims = (dim, *layer_dims) codebook_dim = layer_dims[-1] dim_pairs = zip(dims[:-1], dims[1:]) append = lambda arr, t: arr.append(t) prepend = lambda arr, t: arr.insert(0, t) if not isinstance(num_resnet_blocks, tuple): num_resnet_blocks = (*((0,) * (num_layers - 1)), num_resnet_blocks) if not isinstance(use_attn, tuple): use_attn = (*((False,) * (num_layers - 1)), use_attn) assert len(num_resnet_blocks) == num_layers, 'number of resnet blocks config must be equal to number of layers' assert len(use_attn) == num_layers for layer_index, (dim_in, dim_out), layer_num_resnet_blocks, layer_use_attn in zip(range(num_layers), dim_pairs, num_resnet_blocks, use_attn): append(self.encoders, nn.Sequential(nn.Conv2d(dim_in, dim_out, 4, stride = 2, padding = 1), leaky_relu())) prepend(self.decoders, nn.Sequential(nn.Upsample(scale_factor = 2, mode = 'bilinear', align_corners = False), nn.Conv2d(dim_out, dim_in, 3, padding = 1), leaky_relu())) if layer_use_attn: prepend(self.decoders, VQGanAttention(dim = dim_out, heads = attn_heads, dim_head = attn_dim_head, dropout = attn_dropout)) for _ in range(layer_num_resnet_blocks): append(self.encoders, ResBlock(dim_out, groups = resnet_groups)) prepend(self.decoders, GLUResBlock(dim_out, groups = resnet_groups)) if layer_use_attn: append(self.encoders, VQGanAttention(dim = dim_out, heads = attn_heads, dim_head = attn_dim_head, dropout = attn_dropout)) prepend(self.encoders, nn.Conv2d(channels, dim, first_conv_kernel_size, padding = first_conv_kernel_size // 2)) append(self.decoders, nn.Conv2d(dim, channels, 1)) self.vq = VQ( dim = layer_dims[-1], codebook_dim = vq_codebook_dim, codebook_size = vq_codebook_size, decay = vq_decay, commitment_weight = vq_commitment_weight, accept_image_fmap = True, kmeans_init = vq_kmeans_init, use_cosine_sim = vq_use_cosine_sim, **vq_kwargs ) # reconstruction loss self.recon_loss_fn = F.mse_loss if l2_recon_loss else F.l1_loss # turn off GAN and perceptual loss if grayscale self.vgg = None self.discr = None self.use_vgg_and_gan = use_vgg_and_gan if not use_vgg_and_gan: return # preceptual loss if exists(vgg): self.vgg = vgg else: self.vgg = torchvision.models.vgg16(pretrained = True) self.vgg.classifier = nn.Sequential(*self.vgg.classifier[:-2]) # gan related losses self.discr = Discriminator(dims = dims, channels = channels) self.discr_loss = hinge_discr_loss if use_hinge_loss else bce_discr_loss self.gen_loss = hinge_gen_loss if use_hinge_loss else bce_gen_loss def copy_for_eval(self): device = next(self.parameters()).device vae_copy = copy.deepcopy(self.cpu()) if vae_copy.use_vgg_and_gan: del vae_copy.discr del vae_copy.vgg vae_copy.eval() return vae_copy.to(device) @remove_vgg def state_dict(self, *args, **kwargs): return super().state_dict(*args, **kwargs) @remove_vgg def load_state_dict(self, *args, **kwargs): return super().load_state_dict(*args, **kwargs) @property def codebook(self): return self.vq.codebook def encode(self, fmap): for enc in self.encoders: fmap = enc(fmap) return self.vq(fmap) def decode(self, fmap): for dec in self.decoders: fmap = dec(fmap) return fmap @torch.no_grad() @eval_decorator def codebook_indices_to_video(self, indices): b = indices.shape[0] codes = self.codebook[indices] codes = rearrange(codes, 'b (f h w) d -> (b f) d h w', h = self.fmap_size, w = self.fmap_size) video = self.decode(codes) return rearrange(video, '(b f) ... -> b f ...', b = b) @torch.no_grad() @eval_decorator def get_video_indices(self, video): b, f, _, h, w = video.shape images = rearrange(video, 'b f ... -> (b f) ...') _, indices, _ = self.encode(images) return rearrange(indices, '(b f) ... -> b f ...', b = b) def forward( self, img, return_loss = False, return_discr_loss = False, return_recons = False, apply_grad_penalty = False ): batch, channels, height, width, device = *img.shape, img.device assert height == self.image_size and width == self.image_size, 'height and width of input image must be equal to {self.image_size}' assert channels == self.channels, 'number of channels on image or sketch is not equal to the channels set on this VQGanVAE' fmap, indices, commit_loss = self.encode(img) fmap = self.decode(fmap) if not return_loss and not return_discr_loss: return fmap assert return_loss ^ return_discr_loss, 'you should either return autoencoder loss or discriminator loss, but not both' # whether to return discriminator loss if return_discr_loss: assert exists(self.discr), 'discriminator must exist to train it' fmap.detach_() img.requires_grad_() fmap_discr_logits, img_discr_logits = map(self.discr, (fmap, img)) loss = self.discr_loss(fmap_discr_logits, img_discr_logits) if apply_grad_penalty: gp = gradient_penalty(img, img_discr_logits) loss = loss + gp if return_recons: return loss, fmap return loss # reconstruction loss recon_loss = self.recon_loss_fn(fmap, img) # early return if training on grayscale if not self.use_vgg_and_gan: if return_recons: return recon_loss, fmap return recon_loss # perceptual loss img_vgg_input = img fmap_vgg_input = fmap if img.shape[1] == 1: # handle grayscale for vgg img_vgg_input, fmap_vgg_input = map(lambda t: repeat(t, 'b 1 ... -> b c ...', c = 3), (img_vgg_input, fmap_vgg_input)) img_vgg_feats = self.vgg(img_vgg_input) recon_vgg_feats = self.vgg(fmap_vgg_input) perceptual_loss = F.mse_loss(img_vgg_feats, recon_vgg_feats) # generator loss gen_loss = self.gen_loss(self.discr(fmap)) # calculate adaptive weight last_dec_layer = self.decoders[-1].weight norm_grad_wrt_gen_loss = grad_layer_wrt_loss(gen_loss, last_dec_layer).norm(p = 2) norm_grad_wrt_perceptual_loss = grad_layer_wrt_loss(perceptual_loss, last_dec_layer).norm(p = 2) adaptive_weight = safe_div(norm_grad_wrt_perceptual_loss, norm_grad_wrt_gen_loss) adaptive_weight.clamp_(max = 1e4) # combine losses loss = recon_loss + perceptual_loss + commit_loss + adaptive_weight * gen_loss if return_recons: return loss, fmap return loss
nuwa-pytorch-main
nuwa_pytorch/vqgan_vae.py
import functools from functools import partial import torch from torch import nn, einsum import torch.nn.functional as F from einops import rearrange, reduce, repeat from einops.layers.torch import Rearrange, Reduce from nuwa_pytorch.reversible import ReversibleSequence from nuwa_pytorch.reversible_video_audio import DualModalityReversibleSequence from unfoldNd import unfoldNd from tqdm import tqdm # constants MList = nn.ModuleList # helper functions def exists(val): return val is not None def default(val, d): return val if exists(val) else d def cast_tuple(val, size = 1): return val if isinstance(val, tuple) else (val,) * size def calc_same_padding(kernel_size, dilation = 1): return dilation * (kernel_size - 1) // 2 def padding_to_multiple_of(n, mult): remainder = n % mult if remainder == 0: return 0 return mult - remainder # decorators def eval_decorator(fn): def inner(model, *args, **kwargs): was_training = model.training model.eval() out = fn(model, *args, **kwargs) model.train(was_training) return out return inner # tensor helper functions def log(t, eps = 1e-20): return torch.log(t.clamp(min = eps)) def sigmoid(t): return torch.where(t >= 0, 1 / (1 + torch.exp(-t)), t.exp() / (1 + t.exp())) def gumbel_noise(t): noise = torch.zeros_like(t).uniform_(0, 1) return -log(-log(noise)) def gumbel_sample(t, temperature = 1., dim = -1): return ((t / temperature) + gumbel_noise(t)).argmax(dim = dim) def safe_div(numer, denom, eps = 1e-6): return numer / (denom + eps) def prob_mask_like(shape, prob, device): return torch.zeros(shape, device = device).float().uniform_(0, 1) < prob def batch_process(t, fn, chunks = 10, dim = 0): chunks = [fn(t_chunk) for t_chunk in t.chunk(chunks, dim = dim)] return torch.cat(chunks, dim = dim) def mult_reduce(arr): return functools.reduce(lambda x, y: x * y, arr, 1) # gradient control def frac_gradient(t, frac): return t * frac + t.detach() * (1 - frac) # normalizations class StableLayerNorm(nn.Module): def __init__(self, dim): super().__init__() self.norm = nn.LayerNorm(dim) def forward(self, x): x = x / x.amax(dim = -1, keepdim = True).detach() return self.norm(x) class PreNorm(nn.Module): def __init__( self, *, dim, fn ): super().__init__() self.norm = nn.LayerNorm(dim) self.fn = fn def forward(self, x, **kwargs): x = self.norm(x) return self.fn(x, **kwargs) class SandwichNorm(nn.Module): def __init__( self, *, dim, fn ): super().__init__() self.prenorm = nn.LayerNorm(dim) self.postnorm = nn.LayerNorm(dim) self.fn = fn def forward(self, x, **kwargs): x = self.prenorm(x) x = self.fn(x, **kwargs) x = self.postnorm(x) return x # relative positional embedding (rotary) class RotaryEmbedding(nn.Module): def __init__(self, dim): super().__init__() inv_freq = 1. / (10000 ** (torch.arange(0, dim, 2).float() / dim)) self.register_buffer('inv_freq', inv_freq) def forward(self, seq_len, device): inv_freq = self.inv_freq t = torch.arange(seq_len, device = device).type_as(inv_freq) freqs = torch.einsum('i , j -> i j', t, inv_freq) return torch.cat((freqs, freqs), dim = -1) def rotate_half(x): x = rearrange(x, '... (j d) -> ... j d', j = 2) x1, x2 = x.unbind(dim = -2) return torch.cat((-x2, x1), dim = -1) def apply_rotary_pos_emb(freqs, t): rot_dim = freqs.shape[-1] t, t_pass = t[..., :rot_dim], t[..., rot_dim:] t = (t * freqs.cos()) + (rotate_half(t) * freqs.sin()) return torch.cat((t, t_pass), dim = -1) # helper classes class ShiftAudioTokens(nn.Module): def __init__( self, fn, audio_tokens_per_timestep = 1 ): super().__init__() self.fn = fn self.audio_tokens_per_timestep = audio_tokens_per_timestep def forward(self, x, **kwargs): n = x.shape[1] # pad to nearest time step padding = self.audio_tokens_per_timestep - (n % self.audio_tokens_per_timestep) x = F.pad(x, (0, 0, 0, padding), value = 0.) # shift along time x_shift, x = x.chunk(2, dim = -1) x_shift = F.pad(x_shift, (0, 0, 1, -1), value = 0.) x = torch.cat((x_shift, x), dim = -1) # remove padding if needed return self.fn(x[:, :n], **kwargs) class ShiftVideoTokens(nn.Module): def __init__( self, fn, image_size, shift_space = True, shift_time = False ): super().__init__() self.fn = fn self.image_size = image_size self.shift_time = shift_time self.shift_space = shift_space def forward(self, x, **kwargs): if not self.shift_time and not self.shift_space: return self.fn(x, **kwargs) image_size = self.image_size img_seq_len = image_size ** 2 x_bos, x_video = x[:, :1], x[:, 1:] n = x_video.shape[1] # pad to nearest frame padding = img_seq_len - (n % img_seq_len) x_video = F.pad(x_video, (0, 0, 0, padding), value = 0.) # reshape to video x_video = rearrange(x_video, 'b (f h w) d -> b f h w d', h = image_size, w = image_size) x_image_h = x_image_w = x_frame = None # chunk depending on whether shifting time, space, or both if self.shift_space and self.shift_time: x_frame, x_image_h, x_image_w, *x_rest = x_video.chunk(5, dim = -1) elif self.shift_space: x_image_h, x_image_w, *x_rest = x_video.chunk(4, dim = -1) elif self.shift_time: x_frame, *x_rest = x_video.chunk(3, dim = -1) # shifts if self.shift_space: x_image_h = F.pad(x_image_h, (0, 0, 0, 0, 1, -1)) x_image_w = F.pad(x_image_w, (0, 0, 1, -1)) if self.shift_time: x_frame = F.pad(x_frame, (0, 0, 0, 0, 0, 0, 1, -1)) # concat x_shifted = [x_frame, x_image_h, x_image_w, *x_rest] x_shifted = list(filter(exists, x_shifted)) x_video = torch.cat(x_shifted, dim = -1) # merge text and image sequence back together x_video = rearrange(x_video, 'b f h w d -> b (f h w) d') x_video = x_video[:, :n] x = torch.cat((x_bos, x_video), dim = 1) return self.fn(x, **kwargs) class GEGLU(nn.Module): def forward(self, x): x, gate = x.chunk(2, dim = -1) return x * F.gelu(gate) class FeedForward(nn.Module): def __init__( self, *, dim, mult = 4, dropout = 0., chunk_size = None, # chunk size to process feedforward, along sequence length, from Reformer paper. None means do not chunk ): super().__init__() inner_dim = (dim * mult * 2) // 3 self.chunk_size = chunk_size self.net = nn.Sequential( nn.Linear(dim, inner_dim * 2, bias = False), GEGLU(), nn.Dropout(dropout), nn.Linear(inner_dim, dim, bias = False) ) def forward(self, x): if not exists(self.chunk_size): return self.net(x) x_chunks = x.split(self.chunk_size, dim = -2) out_chunks = [self.net(c) for c in x_chunks] return torch.cat(out_chunks, dim = -2) # attention classes class Attention(nn.Module): def __init__( self, *, dim, heads = 8, dim_head = 64, causal = False, dropout = 0. ): super().__init__() inner_dim = heads * dim_head self.heads = heads self.causal = causal self.scale = dim_head ** -0.5 self.null_k = nn.Parameter(torch.randn(heads, 1, dim_head)) self.null_v = nn.Parameter(torch.randn(heads, 1, dim_head)) self.talking_heads = nn.Conv2d(heads, heads, 1, bias = False) self.dropout = nn.Dropout(dropout) self.to_q = nn.Linear(dim, inner_dim, bias = False) self.to_kv = nn.Linear(dim, inner_dim * 2, bias = False) self.to_out = nn.Linear(inner_dim, dim, bias = False) def forward( self, x, mask = None, context = None, context_mask = None, rotary_pos_emb = None ): b, h, device = x.shape[0], self.heads, x.device has_context = exists(context) kv_input = context if has_context else x qkv = (self.to_q(x), *self.to_kv(kv_input).chunk(2, dim = -1)) q, k, v = map(lambda t: rearrange(t, 'b n (h d) -> b h n d', h = h), qkv) # add rotary positional embedding, if exists if not has_context and exists(rotary_pos_emb): apply_rotary = partial(apply_rotary_pos_emb, rotary_pos_emb) q, k, v = map(apply_rotary, (q, k, v)) # add null key / values, needed for condition dropout null_k = repeat(self.null_k, 'h 1 d -> b h 1 d', b = b) null_v = repeat(self.null_v, 'h 1 d -> b h 1 d', b = b) k = torch.cat((null_k, k), dim = -2) v = torch.cat((null_v, v), dim = -2) # scale q = q * self.scale # similarity sim = einsum('b h i d, b h j d -> b h i j', q, k) # masking mask_value = -torch.finfo(x.dtype).max key_mask = mask if not has_context else context_mask if exists(key_mask): key_mask = F.pad(key_mask, (1, 0), value = True) # always pay attention to null key / value key_mask = rearrange(key_mask, 'b j -> b 1 1 j') sim = sim.masked_fill(~key_mask, mask_value) if self.causal: i, j = sim.shape[-2:] mask = torch.ones(i, j, device = device, dtype = torch.bool).triu_(j - i + 1) sim = sim.masked_fill(mask, mask_value) # attention attn = sim.softmax(dim = -1, dtype = torch.float32) attn = self.talking_heads(attn) attn = self.dropout(attn) # aggregate, merge, and combine heads out = einsum('b h i j, b h j d -> b h i d', attn, v) out = rearrange(out, 'b h n d -> b n (h d)') return self.to_out(out) class Sparse3DNA(nn.Module): def __init__( self, dim, video_shape, kernel_size = 3, dilation = 1, heads = 8, dim_head = 64, dropout = 0., causal = False, query_num_frames_chunk = None, rel_pos_bias = False ): super().__init__() inner_dim = dim_head * heads self.heads = heads self.scale = dim_head ** -0.5 self.dropout = nn.Dropout(dropout) self.to_q = nn.Linear(dim, inner_dim, bias = False) self.to_kv = nn.Linear(dim, inner_dim * 2, bias = False) self.talking_heads = nn.Conv2d(heads, heads, 1, bias = False) self.to_out = nn.Linear(inner_dim, dim) self.dilation = cast_tuple(dilation, size = 3) self.kernel_size = cast_tuple(kernel_size, size = 3) assert all(map(lambda n: n % 2 == 1, self.kernel_size)), 'kernel size must be odd' self.kernel_numel = mult_reduce(self.kernel_size) # relative positional bias per head, if needed self.rel_pos_bias = AxialPositionalEmbedding(heads, shape = self.kernel_size) if rel_pos_bias else None # calculate padding self.padding_frame = calc_same_padding(self.kernel_size[0], self.dilation[0]) self.padding_height = calc_same_padding(self.kernel_size[1], self.dilation[1]) self.padding_width = calc_same_padding(self.kernel_size[2], self.dilation[2]) # use separate padding for causal convolution vs non-causal if causal: self.video_padding = (self.padding_width * 2, 0, self.padding_height * 2, 0, self.padding_frame * 2, 0) else: self.video_padding = (self.padding_width, self.padding_width, self.padding_height, self.padding_height, self.padding_frame, self.padding_frame) # save video shape and calculate max number of tokens self.video_shape = video_shape max_frames, fmap_size, _ = video_shape max_num_tokens = torch.empty(video_shape).numel() self.max_num_tokens = max_num_tokens # how many query tokens to process at once to limit peak memory usage, by multiple of frame tokens (fmap_size ** 2) self.query_num_frames_chunk = default(query_num_frames_chunk, max_frames) # precalculate causal mask ones = torch.ones((max_num_tokens,)) ones = rearrange(ones, '(f h w) -> 1 1 f h w', f = max_frames, h = fmap_size, w = fmap_size) ones = F.pad(ones, self.video_padding, value = 0.) ones = unfoldNd(ones, kernel_size = self.kernel_size, dilation = self.dilation) ones = rearrange(ones, '1 k n -> n k') # mask out padding padding_mask = ones == 0. # bos tokens never get masked out mask = F.pad(padding_mask, (1, 0), value = False) self.register_buffer('mask', mask) def forward(self, x, **kwargs): b, n, _, h, device = *x.shape, self.heads, x.device # more variables dilation = self.dilation kernel_size = self.kernel_size video_padding = self.video_padding fmap_size = self.video_shape[1] bos_only = n == 1 tokens_per_frame = fmap_size ** 2 padding = padding_to_multiple_of(n - 1, tokens_per_frame) num_frames = (n + padding) // tokens_per_frame # pad for last token in video padded_x = F.pad(x, (0, 0, 0, padding), value = 0.) if padding > 0 else x # derive queries / keys / values q, k, v = (self.to_q(x), *self.to_kv(padded_x).chunk(2, dim = -1)) # early return if <bos> if bos_only: return self.to_out(v) # split out heads q, k, v = map(lambda t: rearrange(t, 'b n (h d) -> (b h) n d', h = h), (q, k, v)) # scale queries q = q * self.scale # take care of bos q = q[:, 1:] bos_value = v[:, :1] # compute keys and values (k_bos, k), (v_bos, v) = map(lambda t: (t[:, :1], t[:, 1:]), (k, v)) # reshape keys and values to video and add appropriate padding along all dimensions (frames, height, width) k, v = map(lambda t: rearrange(t, 'b (f h w) d -> b d f h w', f = num_frames, h = fmap_size), (k, v)) k, v = map(lambda t: F.pad(t, video_padding), (k, v)) # axial relative pos bias rel_pos_bias = None if exists(self.rel_pos_bias): rel_pos_bias = rearrange(self.rel_pos_bias(), 'j h -> h 1 j') rel_pos_bias = F.pad(rel_pos_bias, (1, 0), value = 0.) # put the attention processing code in a function # to allow for processing queries in chunks of frames out = [] def attend(q, k, v, mask, k_bos, v_bos, kernel_size): chunk_length = q.shape[1] k, v = map(lambda t: unfoldNd(t, kernel_size = kernel_size, dilation = dilation), (k, v)) k, v = map(lambda t: rearrange(t, 'b (d j) i -> b i j d', j = self.kernel_numel), (k, v)) k, v = map(lambda t: t[:, :chunk_length], (k, v)) # append bos keys and values k_bos, v_bos = map(lambda t: repeat(t, 'b 1 d -> b n 1 d', n = k.shape[1]), (k_bos, v_bos)) k = torch.cat((k_bos, k), dim = 2) v = torch.cat((v_bos, v), dim = 2) # calculate sim sim = einsum('b i d, b i j d -> b i j', q, k) # add rel pos bias, if needed if exists(rel_pos_bias): sim = sim + rel_pos_bias # causal mask if exists(mask): mask_value = -torch.finfo(sim.dtype).max mask = rearrange(mask, 'i j -> 1 i j') sim = sim.masked_fill(mask, mask_value) # attention attn = sim.softmax(dim = -1, dtype = torch.float32) attn = rearrange(attn, '(b h) ... -> b h ...', h = h) attn = self.talking_heads(attn) attn = rearrange(attn, 'b h ... -> (b h) ...') attn = self.dropout(attn) # aggregate values return einsum('b i j, b i j d -> b i d', attn, v) # process queries in chunks frames_per_chunk = min(self.query_num_frames_chunk, num_frames) chunk_size = frames_per_chunk * tokens_per_frame q_chunks = q.split(chunk_size, dim = 1) mask = self.mask[:(n - 1)] mask_chunks = mask.split(chunk_size, dim = 0) for ind, (q_chunk, mask_chunk) in enumerate(zip(q_chunks, mask_chunks)): q_chunk = q_chunks[ind] mask_chunk = mask_chunks[ind] # slice the keys and values to the appropriate frames, accounting for padding along frames dimension kv_start_pos = ind * frames_per_chunk kv_end_pos = kv_start_pos + (ind + frames_per_chunk + self.padding_frame * 2) kv_frame_range = slice(kv_start_pos, kv_end_pos) k_slice, v_slice = map(lambda t: t[:, :, kv_frame_range], (k, v)) # calculate output chunk out_chunk = attend( q = q_chunk, k = k_slice, v = v_slice, mask = mask_chunk, k_bos = k_bos, v_bos = v_bos, kernel_size = kernel_size, ) out.append(out_chunk) # combine all chunks out = torch.cat(out, dim = 1) # append bos value out = torch.cat((bos_value, out), dim = 1) # bos will always adopt its own value, since it pays attention only to itself # merge heads out = rearrange(out, '(b h) n d -> b n (h d)', h = h) return self.to_out(out) class SparseCausal2DNA(nn.Module): def __init__( self, *, dim, height = 1, heads = 8, dim_head = 64, dropout = 0., kernel_size = 5, dilation = 1, rel_pos_bias = False ): super().__init__() inner_dim = heads * dim_head self.heads = heads self.scale = dim_head ** -0.5 self.talking_heads = nn.Conv3d(heads, heads, 1, bias = False) self.dropout = nn.Dropout(dropout) self.to_qkv = nn.Linear(dim, inner_dim * 3, bias = False) self.to_out = nn.Linear(inner_dim, dim, bias = False) # handle variables for unfold self.height = height # width is the sequence length, time-axis - (batch, seq) -> (batch, time, height) self.kernel_size = (kernel_size, height) self.dilation = (dilation, 1) self.causal_padding = (0, 0, calc_same_padding(kernel_size, dilation) * 2, 0) self.rel_pos_bias = AxialPositionalEmbedding(heads, shape = self.kernel_size) if exists(rel_pos_bias) else None # causal mask self.register_buffer('mask', None, persistent = False) def get_mask(self, t): if exists(self.mask) and self.mask.shape[-3] == t.shape[-3]: return self.mask device, seq_len = t.device, t.shape[-3] * self.height ones = torch.ones((seq_len,), device = device) ones = rearrange(ones, '(n m) -> 1 1 n m', m = self.height) ones = F.pad(ones, self.causal_padding, value = 0.) ones = unfoldNd(ones, kernel_size = self.kernel_size, dilation = self.dilation) ones = rearrange(ones, '1 d n -> n d') padding_mask = rearrange(ones, 'n j -> n 1 j') == 0. mask = F.pad(padding_mask, (1, 0), value = False) self.register_buffer('mask', mask, persistent = False) return mask def forward( self, x, **kwargs ): b, n, h, device = x.shape[0], x.shape[1], self.heads, x.device tokens_per_timestep = self.height kernel_numel = self.kernel_size[0] * self.kernel_size[1] # pad to right length bos_only = n == 1 seq_pad = padding_to_multiple_of(n - 1, tokens_per_timestep) # pad for last token in video padded_x = F.pad(x, (0, 0, 0, seq_pad), value = 0.) if seq_pad > 0 else x # derive queries, keys, values q, k, v = self.to_qkv(padded_x).chunk(3, dim = -1) # handle bos only if bos_only: return self.to_out(v) out_bos = v[:, :1] # split heads q, k, v = map(lambda t: rearrange(t, 'b n (h d) -> b h n d', h = h), (q, k, v)) # scale q = q * self.scale # handle bos (q_bos, q), (k_bos, k), (v_bos, v) = map(lambda t: (t[:, :, 0], t[:, :, 1:]), (q, k, v)) # reshape key / values to be unfolded k, v = map(lambda t: rearrange(t, 'b h (x y) d -> (b h) d x y ', y = tokens_per_timestep), (k, v)) k, v = map(lambda t: F.pad(t, self.causal_padding), (k, v)) k, v = map(lambda t: F.unfold(t, kernel_size = self.kernel_size, dilation = self.dilation), (k, v)) k, v = map(lambda t: rearrange(t, '(b h f) (d j) i -> b h i (f j) d', b = b, h = h, j = kernel_numel), (k, v)) # add bos k_bos_repeated, v_bos_repeated = map(lambda t: repeat(t, 'b h d -> b h i 1 d', i = k.shape[-3]), (k_bos, v_bos)) k = torch.cat((k_bos_repeated, k), dim = -2) v = torch.cat((v_bos_repeated, v), dim = -2) q = rearrange(q, 'b h (x y) d -> b h x y d', y = tokens_per_timestep) sim = einsum('b h n i d, b h n j d -> b h n i j', q, k) # rel pos bias if exists(self.rel_pos_bias): rel_pos_bias = self.rel_pos_bias() rel_pos_bias = rearrange(rel_pos_bias, 'j h -> h 1 1 j') rel_pos_bias = F.pad(rel_pos_bias, (1, 0), value = 0.) sim = sim + rel_pos_bias # causal + padding mask mask_value = -torch.finfo(x.dtype).max mask = self.get_mask(sim) sim = sim.masked_fill(mask, mask_value) # attention attn = sim.softmax(dim = -1, dtype = torch.float32) attn = self.talking_heads(attn) attn = self.dropout(attn) # aggregate, merge, and combine heads out = einsum('b h n i j, b h n j d -> b h n i d', attn, v) out = rearrange(out, 'b h x y d -> b (x y) (h d)') # add output for bos back out = torch.cat((out_bos, out), dim = -2) return self.to_out(out[:, :n]) class SparseCross2DNA(nn.Module): def __init__( self, *, dim, image_size, heads = 8, dim_head = 64, dropout = 0., kernel_size = 3, dilation = 1, ): super().__init__() inner_dim = heads * dim_head self.heads = heads self.scale = dim_head ** -0.5 self.null_k = nn.Parameter(torch.randn(heads, 1, dim_head)) self.null_v = nn.Parameter(torch.randn(heads, 1, dim_head)) self.talking_heads = nn.Conv3d(heads, heads, 1, bias = False) self.dropout = nn.Dropout(dropout) self.to_q = nn.Linear(dim, inner_dim, bias = False) self.to_kv = nn.Linear(dim, inner_dim * 2, bias = False) self.to_out = nn.Linear(inner_dim, dim, bias = False) # handle variables for 2d unfold self.image_size = image_size self.kernel_size = kernel_size self.dilation = dilation self.padding = calc_same_padding(kernel_size, dilation) def forward( self, x, *, context, context_mask = None, **kwargs ): b, n, h, device = x.shape[0], x.shape[1], self.heads, x.device fmap_size, kernel_size, dilation, padding = self.image_size, self.kernel_size, self.dilation, self.padding context_len = context.shape[-2] tokens_per_frame = fmap_size * fmap_size kernel_numel = kernel_size * kernel_size # always have context mask avaiable if not exists(context_mask): context_mask = torch.ones((b, context_len), dtype = torch.bool, device = device) mask_value = -torch.finfo(x.dtype).max # derive queries, keys, values qkv = (self.to_q(x), *self.to_kv(context).chunk(2, dim = -1)) q, k, v = map(lambda t: rearrange(t, 'b n (h d) -> b h n d', h = h), qkv) # scale q = q * self.scale # handle bos q_bos, q = q[:, :, 0], q[:, :, 1:] null_k_for_bos = repeat(self.null_k, 'h 1 d -> b h 1 d', b = b) null_v_for_bos = repeat(self.null_v, 'h 1 d -> b h 1 d', b = b) k_for_bos = torch.cat((null_k_for_bos, k), dim = -2) v_for_bos = torch.cat((null_v_for_bos, v), dim = -2) sim_bos = einsum('b h d, b h j d -> b h j', q_bos, k_for_bos) bos_context_mask = rearrange(context_mask, 'b j -> b 1 j') bos_context_mask = F.pad(bos_context_mask, (1, 0), value = True) sim_bos = sim_bos.masked_fill(~bos_context_mask, mask_value) attn_bos = sim_bos.softmax(dim = -1, dtype = torch.float32) out_bos = einsum('b h j, b h j d -> b h d', attn_bos, v_for_bos) out_bos = rearrange(out_bos, 'b h d -> b 1 (h d)') # early return if only bos token if n == 1: return self.to_out(out_bos) # reshape key / values to be unfolded k, v = map(lambda t: rearrange(t, 'b h (f x y) d -> (b h f) d x y', x = fmap_size, y = fmap_size), (k, v)) k, v = map(lambda t: F.unfold(t, kernel_size = kernel_size, dilation = dilation, padding = padding), (k, v)) k, v = map(lambda t: rearrange(t, '(b h f) (d j) i -> b h i (f j) d', b = b, h = h, j = kernel_numel), (k, v)) # add null key / values, needed for condition dropout null_k = repeat(self.null_k, 'h 1 d -> b h i 1 d', b = b, i = tokens_per_frame) null_v = repeat(self.null_v, 'h 1 d -> b h i 1 d', b = b, i = tokens_per_frame) k = torch.cat((null_k, k), dim = -2) v = torch.cat((null_v, v), dim = -2) # pad queries to nearest frame q_padding = padding_to_multiple_of(q.shape[-2], tokens_per_frame) q = F.pad(q, (0, 0, 0, q_padding), value = 0.) # similarity q = rearrange(q, 'b h (f i) d -> b h f i d', i = tokens_per_frame) sim = einsum('b h f i d, b h i j d -> b h f i j', q, k) # masking context_mask = rearrange(context_mask, 'b (f x y) -> (b f) 1 x y', x = fmap_size, y = fmap_size) context_mask = F.unfold(context_mask.float(), kernel_size = kernel_size, dilation = dilation, padding = padding) context_mask = context_mask == 1. context_mask = rearrange(context_mask, '(b f) j i -> b 1 1 i (f j)', b = b, j = kernel_numel) context_mask = F.pad(context_mask, (1, 0), value = True) # always pay attention to null key / value sim = sim.masked_fill(~context_mask, mask_value) # attention attn = sim.softmax(dim = -1, dtype = torch.float32) attn = self.talking_heads(attn) attn = self.dropout(attn) # aggregate, merge, and combine heads out = einsum('b h f i j, b h i j d -> b h f i d', attn, v) out = rearrange(out, 'b h f n d -> b (f n) (h d)') # add output for bos back out = torch.cat((out_bos, out), dim = 1) return self.to_out(out[:, :n]) """ For efficient audio <-> video attention Largely inspired by chunk cross attention from https://arxiv.org/abs/2112.04426 """ class CrossModalityCrossAttention(nn.Module): def __init__( self, *, dim, chunk_size, context_chunk_size, heads = 8, dim_head = 64, context_dim = None, has_start_token = True, context_has_start_token = True, norm = False, norm_context = False, dropout = 0. ): super().__init__() context_dim = default(context_dim, dim) self.heads = heads self.scale = dim_head ** -0.5 inner_dim = dim_head * heads self.norm = nn.LayerNorm(dim) if norm else nn.Identity() self.context_norm = nn.LayerNorm(context_dim) if norm_context else nn.Identity() self.to_q = nn.Linear(dim, inner_dim, bias = False) self.to_kv = nn.Linear(context_dim, inner_dim * 2, bias = False) self.to_out = nn.Linear(inner_dim, dim, bias = False) self.null_k = nn.Parameter(torch.randn(heads, dim_head)) self.null_v = nn.Parameter(torch.randn(heads, dim_head)) self.talking_heads = nn.Conv3d(heads, heads, 1) self.dropout = nn.Dropout(dropout) self.has_start_token = has_start_token self.context_has_start_token = context_has_start_token self.chunk_size = chunk_size self.context_chunk_size = context_chunk_size def forward( self, seq, context, mask = None, context_mask = None ): seq_shape, device = seq.shape, seq.device # get lengths of sequence and context, excluding start token seq_len = seq.shape[-2] - (1 if self.has_start_token else 0) context_len = context.shape[-2] - (1 if self.context_has_start_token else 0) # determine padding # depending on whether start token exists seq_left_pad = -1 if self.has_start_token else 0 seq_right_pad = padding_to_multiple_of(seq_len, self.chunk_size) seq_out_left_pad = -seq_left_pad seq_out_right_pad = -seq_right_pad context_left_pad = self.context_chunk_size - (1 if self.context_chunk_size else 0) context_right_pad = padding_to_multiple_of(context_len, self.context_chunk_size) # do actual padding so divisible by chunk size (video frame) seq = F.pad(seq, (0, 0, seq_left_pad, seq_right_pad), value = 0.) context = F.pad(context, (0, 0, context_left_pad, context_right_pad), value = 0.) if exists(context_mask): context_mask = F.pad(context_mask, (context_left_pad, context_right_pad), value = False) # break into chunks """ b - batch n - num chunks c - chunks d - feature dimension h - heads """ seq = rearrange(seq, 'b (n c) d -> b n c d', c = self.chunk_size) context = rearrange(context, 'b (n c) d -> b n c d', c = self.context_chunk_size) if exists(context_mask): context_mask = rearrange(context_mask, 'b (n c) -> b n c', c = self.context_chunk_size) # determine if sequence is longer than context, or vice versa, when aligned for time seq_num_chunks = seq.shape[-3] context_num_chunks = context.shape[-3] if seq_num_chunks <= context_num_chunks: context = context[:, :seq_num_chunks] if exists(context_mask): context_mask = context_mask[:, :seq_num_chunks] else: # handle the case where the sequence has more chunks # in which case the sequence is curtailed, and output of attention is 0 for the excised right portion seq = seq[:, :context_num_chunks] seq_out_right_pad += self.chunk_size * (seq_num_chunks - context_num_chunks) # early exit if nothing to attend to if context.shape[1] == 0: return torch.zeros(seq_shape, device = device) # pre layernorm seq = self.norm(seq) context = self.context_norm(context) # attention time! q = self.to_q(seq) k, v = self.to_kv(context).chunk(2, dim = -1) q, k, v = map(lambda t: rearrange(t, 'b n c (h d) -> b h n c d', h = self.heads), (q, k, v)) q = q * self.scale null_k, null_v = map(lambda t: repeat(t, 'h d -> b h n 1 d', b = q.shape[0], n = q.shape[2]), (self.null_k, self.null_v)) k = torch.cat((null_k, k), dim = -2) v = torch.cat((null_v, v), dim = -2) sim = einsum('b h n i d, b h n j d -> b h n i j', q, k) if exists(context_mask): max_neg_value = -torch.finfo(sim.dtype).max context_mask = rearrange(context_mask, 'b n c -> b 1 n 1 c') context_mask = F.pad(context_mask, (1, 0), value = True) # null key / value sim = sim.masked_fill(~context_mask, max_neg_value) attn = sim.softmax(dim = -1, dtype = torch.float32) attn = self.dropout(attn) attn = self.talking_heads(attn) out = einsum('b h n i j, b h n j d -> b h n i d', attn, v) out = rearrange(out, 'b h n c d -> b (n c) (h d)') out = self.to_out(out) # shift back to original sequence out = F.pad(out, (0, 0, seq_out_left_pad, seq_out_right_pad), value = 0.) # mask src sequence, if mask was passed in (extra insurance) if exists(mask): mask = rearrange(mask, '... -> ... 1') out = out.masked_fill(~mask, 0.) return out # transformer class Transformer(nn.Module): def __init__( self, *, dim, depth, causal = False, heads = 8, dim_head = 64, ff_mult = 4, cross_attend = False, attn_dropout = 0., ff_dropout = 0., ff_chunk_size = None, cross_2dna_attn = False, cross_2dna_image_size = None, cross_2dna_kernel_size = 3, cross_2dna_dilations = (1,), sparse_3dna_attn = False, sparse_3dna_kernel_size = 3, sparse_3dna_video_shape = None, sparse_3dna_query_num_frames_chunk = None, sparse_3dna_dilations = (1,), sparse_3dna_rel_pos_bias = False, shift_video_tokens = False, rotary_pos_emb = False ): super().__init__() assert not (sparse_3dna_attn and not exists(sparse_3dna_video_shape)), 'sparse_3dna_video_shape must be defined if turned on' assert not (cross_2dna_attn and not exists(cross_2dna_image_size)), 'cross_2dna_image_size must be defined' self.layers = MList([]) for ind in range(depth): if sparse_3dna_attn: dilation = sparse_3dna_dilations[ind % len(sparse_3dna_dilations)] self_attn = Sparse3DNA( dim = dim, heads = heads, dim_head = dim_head, causal = causal, kernel_size = sparse_3dna_kernel_size, dilation = dilation, video_shape = sparse_3dna_video_shape, query_num_frames_chunk = sparse_3dna_query_num_frames_chunk, rel_pos_bias = sparse_3dna_rel_pos_bias, ) else: self_attn = Attention( dim = dim, heads = heads, dim_head = dim_head, causal = causal, dropout = attn_dropout ) cross_attn = None if cross_attend: if cross_2dna_attn: dilation = cross_2dna_dilations[ind % len(cross_2dna_dilations)] cross_attn = SparseCross2DNA( dim = dim, heads = heads, dim_head = dim_head, dropout = attn_dropout, image_size = cross_2dna_image_size, kernel_size = cross_2dna_kernel_size, dilation = dilation ) else: cross_attn = Attention( dim = dim, heads = heads, dim_head = dim_head, dropout = attn_dropout ) ff = FeedForward(dim = dim, mult = ff_mult, dropout = ff_dropout, chunk_size = ff_chunk_size) if sparse_3dna_attn and shift_video_tokens: fmap_size = sparse_3dna_video_shape[-1] self_attn = ShiftVideoTokens(self_attn, image_size = fmap_size) ff = ShiftVideoTokens(ff, image_size = fmap_size) self.layers.append(MList([ SandwichNorm(dim = dim, fn = self_attn), SandwichNorm(dim = dim, fn = cross_attn) if cross_attend else None, SandwichNorm(dim = dim, fn = ff) ])) self.norm = StableLayerNorm(dim) def forward( self, x, mask = None, context = None, context_mask = None ): for attn, cross_attn, ff in self.layers: x = attn(x, mask = mask) + x if exists(cross_attn): x = cross_attn(x, context = context, mask = mask, context_mask = context_mask) + x x = ff(x) + x return self.norm(x) class ReversibleTransformer(nn.Module): def __init__( self, *, dim, depth, causal = False, heads = 8, dim_head = 64, ff_mult = 4, cross_attend = False, attn_dropout = 0., ff_dropout = 0., ff_chunk_size = None, cross_2dna_attn = False, cross_2dna_image_size = None, cross_2dna_kernel_size = 3, cross_2dna_dilations = (1,), sparse_3dna_attn = False, sparse_3dna_kernel_size = 3, sparse_3dna_video_shape = None, sparse_3dna_query_num_frames_chunk = None, sparse_3dna_dilations = (1,), sparse_3dna_rel_pos_bias = False, shift_video_tokens = False, rotary_pos_emb = False ): super().__init__() assert not (sparse_3dna_attn and not exists(sparse_3dna_video_shape)), 'sparse_3dna_video_shape must be defined if turned on' assert not (cross_2dna_attn and not exists(cross_2dna_image_size)), 'cross_2dna_image_size must be defined' self.layers = MList([]) for ind in range(depth): if sparse_3dna_attn: dilation = sparse_3dna_dilations[ind % len(sparse_3dna_dilations)] image_size = sparse_3dna_video_shape[-1] self_attn = Sparse3DNA( dim = dim, heads = heads, dim_head = dim_head, causal = causal, kernel_size = sparse_3dna_kernel_size, dilation = dilation, video_shape = sparse_3dna_video_shape, query_num_frames_chunk = sparse_3dna_query_num_frames_chunk, rel_pos_bias = sparse_3dna_rel_pos_bias, ) else: image_size = None self_attn = Attention( dim = dim, heads = heads, dim_head = dim_head, causal = causal, dropout = attn_dropout ) wrapper_fn = partial(ShiftVideoTokens, image_size = image_size, shift_space = sparse_3dna_attn and shift_video_tokens) self.layers.append(MList([ SandwichNorm(dim = dim, fn = wrapper_fn(self_attn)), SandwichNorm(dim = dim, fn = wrapper_fn(FeedForward(dim = dim, mult = ff_mult, dropout = ff_dropout, chunk_size = ff_chunk_size))) ])) if not cross_attend: continue if cross_2dna_attn: dilation = cross_2dna_dilations[ind % len(cross_2dna_dilations)] cross_attn = SparseCross2DNA( dim = dim, heads = heads, dim_head = dim_head, dropout = attn_dropout, image_size = cross_2dna_image_size, kernel_size = cross_2dna_kernel_size, dilation = dilation ) else: cross_attn = Attention( dim = dim, heads = heads, dim_head = dim_head, dropout = attn_dropout ) self.layers.append(MList([ SandwichNorm(dim = dim, fn = cross_attn), SandwichNorm(dim = dim, fn = wrapper_fn(FeedForward(dim = dim, mult = ff_mult, dropout = ff_dropout, chunk_size = ff_chunk_size))) ])) attn_context_layer = ((True, False),) if cross_attend else tuple() route_attn = ((True, False), *attn_context_layer) * depth route_context = ((False, False), *attn_context_layer) * depth context_route_map = {'context': route_context, 'context_mask': route_context} if cross_attend else {} attn_route_map = {'mask': route_attn, 'rotary_pos_emb': route_attn} self.net = ReversibleSequence(self.layers, args_route = {**context_route_map, **attn_route_map}) self.norm = StableLayerNorm(dim) def forward( self, x, **kwargs ): x = self.net(x, **kwargs) return self.norm(x) # dual modality decoder (for video and audio synthesis) class DualModalityDecoder(nn.Module): def __init__( self, *, dim, depth, num_audio_tokens_per_video_frame, num_video_tokens_per_frame, sparse_3dna_video_shape, heads = 8, dim_head = 64, ff_mult = 4, attn_dropout = 0., ff_dropout = 0., ff_chunk_size = None, sparse_3dna_kernel_size = 3, sparse_3dna_query_num_frames_chunk = None, sparse_3dna_dilations = (1,), sparse_3dna_rel_pos_bias = False, sparse_2dna_kernel_size = 7, sparse_2dna_dilation = (1,), sparse_2dna_rel_pos_bias = False, shift_video_tokens = False, shift_audio_tokens = False, audio_tokens_per_timestep = 1, cross_modality_attn_every = 3 ): super().__init__() self.layers = MList([]) self.layer_types = [] def video_intra_modality_attn(): dilation = sparse_3dna_dilations[ind % len(sparse_3dna_dilations)] self_attn = Sparse3DNA( dim = dim, heads = heads, dim_head = dim_head, causal = True, kernel_size = sparse_3dna_kernel_size, dilation = dilation, video_shape = sparse_3dna_video_shape, query_num_frames_chunk = sparse_3dna_query_num_frames_chunk, rel_pos_bias = sparse_3dna_rel_pos_bias, ) cross_attn = Attention( dim = dim, heads = heads, dim_head = dim_head, dropout = attn_dropout ) ff = FeedForward(dim = dim, mult = ff_mult, dropout = ff_dropout, chunk_size = ff_chunk_size) if shift_video_tokens: fmap_size = sparse_3dna_video_shape[-1] self_attn = ShiftVideoTokens(self_attn, image_size = fmap_size) ff = ShiftVideoTokens(ff, image_size = fmap_size) return MList([ SandwichNorm(dim = dim, fn = self_attn), SandwichNorm(dim = dim, fn = cross_attn), SandwichNorm(dim = dim, fn = ff) ]) def audio_intra_modality_attn(): dilation = sparse_2dna_dilation[ind % len(sparse_2dna_dilation)] self_attn = SparseCausal2DNA( dim = dim, heads = heads, dim_head = dim_head, kernel_size = sparse_2dna_kernel_size, dilation = dilation, dropout = attn_dropout, rel_pos_bias = sparse_2dna_rel_pos_bias ) cross_attn = Attention( dim = dim, heads = heads, dim_head = dim_head, dropout = attn_dropout ) ff = FeedForward(dim = dim, mult = ff_mult, dropout = ff_dropout, chunk_size = ff_chunk_size) if shift_audio_tokens: self_attn = ShiftAudioTokens(self_attn, audio_tokens_per_timestep = audio_tokens_per_timestep) ff = ShiftAudioTokens(ff, audio_tokens_per_timestep = audio_tokens_per_timestep) return MList([ SandwichNorm(dim = dim, fn = self_attn), SandwichNorm(dim = dim, fn = cross_attn), SandwichNorm(dim = dim, fn = ff) ]) def inter_modality_attn(chunk_size, context_chunk_size): cross_modality_attn = CrossModalityCrossAttention( dim = dim, heads = heads, dim_head = dim_head, chunk_size = chunk_size, context_chunk_size = context_chunk_size, has_start_token = True, context_has_start_token = True ) cross_modality_ff = FeedForward(dim = dim, mult = ff_mult, dropout = ff_dropout, chunk_size = ff_chunk_size) return MList([ SandwichNorm(dim = dim, fn = cross_modality_attn), SandwichNorm(dim = dim, fn = cross_modality_ff), ]) for ind in range(depth): video_modality_attn = video_intra_modality_attn() audio_modality_attn = audio_intra_modality_attn() self.layer_types.append('intra_modality') self.layers.append(MList([ video_modality_attn, audio_modality_attn, ])) if ((ind + 1) % cross_modality_attn_every) == 0: self.layer_types.append('inter_modality') video_to_audio_attn = inter_modality_attn(num_video_tokens_per_frame, num_audio_tokens_per_video_frame) audio_to_video_attn = inter_modality_attn(num_audio_tokens_per_video_frame, num_video_tokens_per_frame) self.layers.append(MList([ video_to_audio_attn, audio_to_video_attn ])) self.video_norm = StableLayerNorm(dim) self.audio_norm = StableLayerNorm(dim) def forward( self, video, audio, *, context, audio_mask = None, video_mask = None, context_mask = None, **kwargs ): for blocks, layer_type in zip(self.layers, self.layer_types): if layer_type == 'intra_modality': (video_self_attn, video_cross_attn, video_ff), (audio_self_attn, audio_cross_attn, audio_ff) = blocks video_ = video_self_attn(video, mask = video_mask) + video video_ = video_cross_attn(video_, context = context, mask = video_mask, context_mask = context_mask) + video_ video_ = video_ff(video_) + video_ audio_ = audio_self_attn(audio, mask = audio_mask) + audio audio_ = audio_cross_attn(audio_, context = context, mask = audio_mask, context_mask = context_mask) + audio_ audio_ = audio_ff(audio_) + audio_ elif layer_type == 'inter_modality': (video_to_audio_attn, video_ff), (audio_to_video_attn, audio_ff) = blocks video_ = video_to_audio_attn( video, context = audio, mask = video_mask, context_mask = audio_mask ) + video audio_ = audio_to_video_attn( audio, context = video, mask = audio_mask, context_mask = video_mask ) + audio video_ = video_ff(video_) + video_ audio_ = audio_ff(audio_) + audio_ else: raise ValueError(f'unknown layer type {layer_type}') video, audio = video_, audio_ return self.video_norm(video), self.audio_norm(audio) class ReversibleDualModalityDecoder(nn.Module): def __init__( self, *, dim, depth, num_audio_tokens_per_video_frame, num_video_tokens_per_frame, sparse_3dna_video_shape, heads = 8, dim_head = 64, ff_mult = 4, attn_dropout = 0., ff_dropout = 0., ff_chunk_size = None, sparse_3dna_kernel_size = 3, sparse_3dna_query_num_frames_chunk = None, sparse_3dna_dilations = (1,), sparse_3dna_rel_pos_bias = False, sparse_2dna_kernel_size = 7, sparse_2dna_dilation = (1,), sparse_2dna_rel_pos_bias = False, shift_video_tokens = False, shift_audio_tokens = False, audio_tokens_per_timestep = 1, cross_modality_attn_every = 3 ): super().__init__() self.layers = MList([]) self.layer_types = [] norm_wrapper = lambda fn: SandwichNorm(dim = dim, fn = fn) create_ff = lambda: FeedForward(dim = dim, mult = ff_mult, dropout = ff_dropout, chunk_size = ff_chunk_size) for ind in range(depth): video_dilation = sparse_3dna_dilations[ind % len(sparse_3dna_dilations)] audio_dilation = sparse_2dna_dilation[ind % len(sparse_2dna_dilation)] video_self_attn = Sparse3DNA( dim = dim, heads = heads, dim_head = dim_head, causal = True, kernel_size = sparse_3dna_kernel_size, dilation = video_dilation, video_shape = sparse_3dna_video_shape, query_num_frames_chunk = sparse_3dna_query_num_frames_chunk, rel_pos_bias = sparse_3dna_rel_pos_bias, ) audio_self_attn = SparseCausal2DNA( dim = dim, heads = heads, dim_head = dim_head, dropout = attn_dropout, kernel_size = sparse_2dna_kernel_size, dilation = audio_dilation, rel_pos_bias = sparse_2dna_rel_pos_bias ) video_ff = create_ff() audio_ff = create_ff() if shift_video_tokens: fmap_size = sparse_3dna_video_shape[-1] video_self_attn = ShiftVideoTokens(video_self_attn, image_size = fmap_size) video_ff = ShiftVideoTokens(video_ff, image_size = fmap_size) if shift_audio_tokens: audio_self_attn = ShiftAudioTokens(audio_self_attn, audio_tokens_per_timestep = audio_tokens_per_timestep) audio_ff = ShiftAudioTokens(audio_ff, audio_tokens_per_timestep = audio_tokens_per_timestep) self.layers.append(MList([ norm_wrapper(video_self_attn), norm_wrapper(video_ff), norm_wrapper(audio_self_attn), norm_wrapper(audio_ff) ])) self.layer_types.append('intra_modality_self_attn') video_cross_attn = Attention( dim = dim, heads = heads, dim_head = dim_head, dropout = attn_dropout ) audio_cross_attn = Attention( dim = dim, heads = heads, dim_head = dim_head, dropout = attn_dropout ) video_cross_ff = create_ff() audio_cross_ff = create_ff() self.layers.append(MList([ norm_wrapper(video_cross_attn), norm_wrapper(video_cross_ff), norm_wrapper(audio_cross_attn), norm_wrapper(audio_cross_ff) ])) self.layer_types.append('intra_modality_cross_attn') if ((ind + 1) % cross_modality_attn_every) == 0: video_to_audio_attn = CrossModalityCrossAttention( dim = dim, heads = heads, dim_head = dim_head, chunk_size = num_video_tokens_per_frame, context_chunk_size = num_audio_tokens_per_video_frame, has_start_token = True, context_has_start_token = True ) video_cross_modality_ff = create_ff() audio_to_video_attn = CrossModalityCrossAttention( dim = dim, heads = heads, dim_head = dim_head, chunk_size = num_audio_tokens_per_video_frame, context_chunk_size = num_video_tokens_per_frame, has_start_token = True, context_has_start_token = True ) audio_cross_modality_ff = create_ff() self.layers.append(MList([ video_to_audio_attn, video_cross_modality_ff, audio_to_video_attn, audio_cross_modality_ff ])) self.layer_types.append('inter_modality_cross_attn') self.net = DualModalityReversibleSequence(self.layers, self.layer_types) self.video_norm = StableLayerNorm(dim) self.audio_norm = StableLayerNorm(dim) def forward( self, video, audio, *, context, audio_mask = None, video_mask = None, context_mask = None, **kwargs ): video, audio = self.net( video, audio, context = context, audio_mask = audio_mask, video_mask = video_mask, context_mask = context_mask ) return self.video_norm(video), self.audio_norm(audio) # embeddings class Embedding(nn.Module): def __init__(self, *shape, frac_gradient = 1.): super().__init__() self.frac_gradient = frac_gradient self.embed = nn.Embedding(*shape) def forward(self, x): x = self.embed(x) if self.training and self.frac_gradient < 1: x = frac_gradient(x, self.frac_gradient) return x # positional embedding class AxialPositionalEmbedding(nn.Module): def __init__( self, dim, *, shape ): super().__init__() shape = tuple(filter(lambda t: t > 1, shape)) self.dim = dim self.shape = shape self.num_axials = len(shape) for axial_ind, axial_len in enumerate(shape): axial_pos = nn.Parameter(torch.randn(axial_len, dim)) setattr(self, f'axial{axial_ind + 1}', axial_pos) def forward(self, *, flatten = True): positions = None for axial_ind in range(self.num_axials): axial_pos = getattr(self, f'axial{axial_ind + 1}') if not exists(positions): positions = axial_pos continue positions = rearrange(positions, '... d -> ... 1 d') positions = positions + axial_pos if flatten: positions = rearrange(positions, '... d -> (...) d') return positions # sampling helpers def top_k(logits, thres = 0.5): num_logits = logits.shape[-1] k = max(int((1 - thres) * num_logits), 1) val, ind = torch.topk(logits, k) probs = torch.full_like(logits, float('-inf')) probs.scatter_(1, ind, val) return probs # main class class NUWA(nn.Module): def __init__( self, *, dim, vae = None, image_size = None, max_video_frames = 5, text_num_tokens = 49408, text_max_seq_len = 256, text_enc_depth = 6, text_enc_dim_head = 64, text_enc_heads = 8, text_rotary_pos_emb = True, enc_reversible = False, dec_depth = 6, dec_dim_head = 64, dec_heads = 8, dec_reversible = False, attn_dropout = 0., ff_dropout = 0., ff_chunk_size = None, embed_gradient_frac = 0.2, shift_video_tokens = True, sparse_3dna_kernel_size = 3, sparse_3dna_query_num_frames_chunk = None, sparse_3dna_dilation = 1, sparse_3dna_rel_pos_bias = False ): super().__init__() assert exists(vae) ^ exists(image_size), 'either VAE or image size must be specified' self.vae = None if exists(vae): self.vae = vae.copy_for_eval() image_size = vae.image_size vae_num_layers = vae.num_layers num_image_tokens = vae.codebook_size self.text_max_seq_len = text_max_seq_len self.text_embedding = Embedding(text_num_tokens, dim, frac_gradient = embed_gradient_frac) # positional embedding for text self.text_abs_pos_emb = Embedding(text_max_seq_len, dim) if not text_rotary_pos_emb else None self.text_rotary_pos_emb = RotaryEmbedding(dim = min(32, text_enc_dim_head)) if text_rotary_pos_emb else None enc_transformer_klass = Transformer if not enc_reversible else ReversibleTransformer self.text_transformer = enc_transformer_klass( dim = dim, depth = text_enc_depth, heads = text_enc_heads, dim_head = text_enc_dim_head, attn_dropout = attn_dropout, ff_dropout = ff_dropout, rotary_pos_emb = text_rotary_pos_emb ) self.video_bos = nn.Parameter(torch.randn(dim)) self.image_embedding = Embedding(num_image_tokens, dim, frac_gradient = embed_gradient_frac) fmap_size = image_size // (2 ** vae_num_layers) self.video_fmap_size = fmap_size self.max_video_frames = max_video_frames video_shape = (max_video_frames, fmap_size, fmap_size) self.video_pos_emb = AxialPositionalEmbedding(dim, shape = video_shape) # cycle dilation for sparse 3d-nearby attention sparse_3dna_dilations = tuple(range(1, sparse_3dna_dilation + 1)) if not isinstance(sparse_3dna_dilation, (list, tuple)) else sparse_3dna_dilation dec_transformer_klass = Transformer if not dec_reversible else ReversibleTransformer self.video_transformer = dec_transformer_klass( dim = dim, depth = dec_depth, heads = dec_heads, dim_head = dec_dim_head, causal = True, cross_attend = True, attn_dropout = attn_dropout, ff_dropout = ff_dropout, ff_chunk_size = ff_chunk_size, shift_video_tokens = shift_video_tokens, sparse_3dna_video_shape = video_shape, sparse_3dna_attn = True, sparse_3dna_kernel_size = sparse_3dna_kernel_size, sparse_3dna_dilations = sparse_3dna_dilations, sparse_3dna_query_num_frames_chunk = sparse_3dna_query_num_frames_chunk, sparse_3dna_rel_pos_bias = sparse_3dna_rel_pos_bias ) self.to_logits = nn.Linear(dim, num_image_tokens, bias = False) def embed_text(self, text, mask = None): batch, seq_len, device = *text.shape, text.device assert seq_len <= self.text_max_seq_len, 'your input text has a greater length than what was designated on initialization' tokens = self.text_embedding(text) if exists(self.text_abs_pos_emb): pos_emb = self.text_abs_pos_emb(torch.arange(seq_len, device = device)) tokens = tokens + rearrange(pos_emb, 'n d -> 1 n d') rotary_pos_emb = None if exists(self.text_rotary_pos_emb): rotary_pos_emb = self.text_rotary_pos_emb(seq_len, device = device) return self.text_transformer( tokens, mask = mask, rotary_pos_emb = rotary_pos_emb ) @torch.no_grad() @eval_decorator def generate( self, *, text, filter_thres = 0.9, temperature = 1., decode_max_batchsize = 10, cond_scale = 2., num_frames = None ): batch, seq_len, device = *text.shape, text.device text_mask = text != 0 text_embeds = self.embed_text(text, mask = text_mask) bos = repeat(self.video_bos, 'd -> b 1 d', b = batch) video_indices = torch.empty((batch, 0), device = device, dtype = torch.long) num_tokens_per_frame = self.video_fmap_size ** 2 num_frames = default(num_frames, self.max_video_frames) total_video_tokens = num_tokens_per_frame * num_frames max_video_tokens = num_tokens_per_frame * self.max_video_frames pos_emb = self.video_pos_emb() for ind in tqdm(range(total_video_tokens)): video_indices_input = video_indices num_video_tokens = video_indices.shape[1] if num_video_tokens > max_video_tokens: curr_frame_tokens = num_video_tokens % num_tokens_per_frame lookback_tokens = (self.max_video_frames - (0 if curr_frame_tokens == 0 else 1)) * num_tokens_per_frame + curr_frame_tokens video_indices_input = video_indices[:, -lookback_tokens:] frame_embeddings = self.image_embedding(video_indices_input) frame_embeddings = pos_emb[:frame_embeddings.shape[1]] + frame_embeddings frame_embeddings = torch.cat((bos, frame_embeddings), dim = 1) frame_embeddings = self.video_transformer( frame_embeddings, context = text_embeds, context_mask = text_mask ) logits = self.to_logits(frame_embeddings) if cond_scale != 1: # discovery by Katherine Crowson # https://twitter.com/RiversHaveWings/status/1478093658716966912 uncond_frame_embeddings = self.video_transformer( frame_embeddings, context = text_embeds, context_mask = torch.zeros_like(text_mask).bool() ) uncond_logits = self.to_logits(uncond_frame_embeddings) logits = uncond_logits + (logits - uncond_logits) * cond_scale logits = logits[:, -1, :] filtered_logits = top_k(logits, thres = filter_thres) sample = gumbel_sample(filtered_logits, temperature = temperature, dim = -1) sample = rearrange(sample, 'b -> b 1') video_indices = torch.cat((video_indices, sample), dim = 1) codes = self.vae.codebook[video_indices] codes = rearrange(codes, 'b (f h w) d -> (b f) d h w', h = self.video_fmap_size, w = self.video_fmap_size) image_reconstructions = batch_process(codes, self.vae.decode, chunks = decode_max_batchsize) video = rearrange(image_reconstructions, '(b f) d h w -> b f d h w', b = batch) return video def forward( self, *, text, video = None, return_loss = False, cond_dropout_prob = 0.2 ): batch, seq_len, frames, device = *text.shape, video.shape[1], text.device text_mask = text != 0 text_embeds = self.embed_text(text, mask = text_mask) if video.dtype == torch.long: frame_indices = video else: assert frames == self.max_video_frames, f'you must give the full video frames ({self.max_video_frames}) during training' assert exists(self.vae), 'VAE must be passed in if you wish for video to be encoded to ids automatically' frame_indices = self.vae.get_video_indices(video) frame_indices = rearrange(frame_indices, 'b ... -> b (...)') frame_indices_input = frame_indices[:, :-1] if return_loss else frame_indices frame_embeddings = self.image_embedding(frame_indices_input) frame_embeddings = self.video_pos_emb()[:-1] + frame_embeddings bos = repeat(self.video_bos, 'd -> b 1 d', b = batch) frame_embeddings = torch.cat((bos, frame_embeddings), dim = 1) if self.training and cond_dropout_prob > 0: # dropout condition randomly # presented in https://openreview.net/forum?id=qw8AKxfYbI uncond_mask = prob_mask_like((batch,), cond_dropout_prob, device = device) text_mask *= rearrange(~uncond_mask, 'b -> b 1') frame_embeddings = self.video_transformer( frame_embeddings, context = text_embeds, context_mask = text_mask ) logits = self.to_logits(frame_embeddings) if not return_loss: return logits loss = F.cross_entropy(rearrange(logits, 'b n c -> b c n'), frame_indices) return loss # generating video and audio class NUWAVideoAudio(nn.Module): def __init__( self, *, vae, dim, image_size, num_audio_tokens, num_audio_tokens_per_video_frame, audio_tokens_per_timestep = 1, max_video_frames = 5, text_num_tokens = 49408, text_max_seq_len = 256, text_enc_depth = 6, text_enc_dim_head = 64, text_enc_heads = 8, text_rotary_pos_emb = False, enc_reversible = False, dec_reversible = True, dec_depth = 6, dec_dim_head = 64, dec_heads = 8, attn_dropout = 0., ff_dropout = 0., ff_chunk_size = None, embed_gradient_frac = 0.2, shift_video_tokens = True, shift_audio_tokens = True, sparse_3dna_kernel_size = 3, sparse_3dna_query_num_frames_chunk = None, sparse_3dna_dilation = 1, sparse_3dna_rel_pos_bias = True, sparse_2dna_kernel_size = 7, sparse_2dna_dilation = 1, sparse_2dna_rel_pos_bias = True, audio_loss_weight = 1., cross_modality_attn_every = 3 ): super().__init__() self.vae = vae.copy_for_eval() vae_num_layers = vae.num_layers num_image_tokens = vae.codebook_size self.text_max_seq_len = text_max_seq_len self.text_embedding = Embedding(text_num_tokens, dim, frac_gradient = embed_gradient_frac) self.text_abs_pos_emb = Embedding(text_max_seq_len, dim) if not text_rotary_pos_emb else None self.text_rotary_pos_emb = RotaryEmbedding(dim = min(32, text_enc_dim_head)) if text_rotary_pos_emb else None enc_transformer_klass = Transformer if not enc_reversible else ReversibleTransformer self.text_transformer = enc_transformer_klass( dim = dim, depth = text_enc_depth, heads = text_enc_heads, dim_head = text_enc_dim_head, attn_dropout = attn_dropout, ff_dropout = ff_dropout ) # video related params self.video_bos = nn.Parameter(torch.randn(dim)) self.image_embedding = Embedding(num_image_tokens, dim, frac_gradient = embed_gradient_frac) fmap_size = image_size // (2 ** vae_num_layers) self.video_fmap_size = fmap_size self.max_video_frames = max_video_frames video_shape = (max_video_frames, fmap_size, fmap_size) self.video_pos_emb = AxialPositionalEmbedding(dim, shape = video_shape) # audio related params self.audio_bos = nn.Parameter(torch.randn(dim)) self.audio_embedding = Embedding(num_audio_tokens, dim, frac_gradient = embed_gradient_frac) max_audio_seq_len = num_audio_tokens_per_video_frame * max_video_frames self.audio_pos_emb = AxialPositionalEmbedding(dim, shape = (num_audio_tokens // audio_tokens_per_timestep, audio_tokens_per_timestep)) self.audio_loss_weight = audio_loss_weight # num tokens per video frame self.num_video_tokens_per_frame = fmap_size ** 2 self.num_audio_tokens_per_video_frame = num_audio_tokens_per_video_frame # cycle dilation for sparse 3d-nearby attention sparse_3dna_dilations = tuple(range(1, sparse_3dna_dilation + 1)) if not isinstance(sparse_3dna_dilation, (list, tuple)) else sparse_3dna_dilation sparse_2dna_dilation = tuple(range(1, sparse_2dna_dilation + 1)) if not isinstance(sparse_2dna_dilation, (list, tuple)) else sparse_2dna_dilation decoder_klass = ReversibleDualModalityDecoder if dec_reversible else DualModalityDecoder self.video_audio_transformer = decoder_klass( dim = dim, depth = dec_depth, heads = dec_heads, dim_head = dec_dim_head, attn_dropout = attn_dropout, ff_dropout = ff_dropout, ff_chunk_size = ff_chunk_size, audio_tokens_per_timestep = audio_tokens_per_timestep, shift_audio_tokens = shift_audio_tokens, shift_video_tokens = shift_video_tokens, sparse_3dna_video_shape = video_shape, sparse_3dna_kernel_size = sparse_3dna_kernel_size, sparse_3dna_dilations = sparse_3dna_dilations, sparse_3dna_query_num_frames_chunk = sparse_3dna_query_num_frames_chunk, sparse_3dna_rel_pos_bias = sparse_3dna_rel_pos_bias, num_audio_tokens_per_video_frame = num_audio_tokens_per_video_frame, num_video_tokens_per_frame = fmap_size * fmap_size, cross_modality_attn_every = cross_modality_attn_every, sparse_2dna_kernel_size = sparse_2dna_kernel_size, sparse_2dna_dilation = sparse_2dna_dilation, sparse_2dna_rel_pos_bias = sparse_2dna_rel_pos_bias ) self.to_video_logits = nn.Linear(dim, num_image_tokens, bias = False) self.to_audio_logits = nn.Linear(dim, num_audio_tokens, bias = False) def embed_text(self, text, mask = None): batch, seq_len, device = *text.shape, text.device assert seq_len <= self.text_max_seq_len, 'your input text has a greater length than what was designated on initialization' tokens = self.text_embedding(text) if exists(self.text_abs_pos_emb): pos_emb = self.text_abs_pos_emb(torch.arange(seq_len, device = device)) tokens = tokens + rearrange(pos_emb, 'n d -> 1 n d') rotary_pos_emb = None if exists(self.text_rotary_pos_emb): rotary_pos_emb = self.text_rotary_pos_emb(seq_len, device = device) return self.text_transformer( tokens, mask = mask, rotary_pos_emb = rotary_pos_emb ) @torch.no_grad() @eval_decorator def generate( self, *, text, filter_thres = 0.9, temperature = 1., decode_max_batchsize = 10, cond_scale = 2., num_frames = None ): batch, seq_len, device = *text.shape, text.device num_tokens_per_frame, num_audio_tokens_per_video_frame = self.num_video_tokens_per_frame, self.num_audio_tokens_per_video_frame text_mask = text != 0 text_embeds = self.embed_text(text, mask = text_mask) video_bos = repeat(self.video_bos, 'd -> b 1 d', b = batch) audio_bos = repeat(self.audio_bos, 'd -> b 1 d', b = batch) video_indices = torch.empty((batch, 0), device = device, dtype = torch.long) audio_indices = torch.empty((batch, 0), device = device, dtype = torch.long) num_frames = default(num_frames, self.max_video_frames) total_video_tokens = num_frames * num_tokens_per_frame total_audio_tokens = num_frames * num_audio_tokens_per_video_frame video_pos_emb = self.video_pos_emb() is_decoding_video = True # toggle to False to decode audio, alternating between video and audio while video_indices.shape[1] < total_video_tokens \ or audio_indices.shape[1] < total_audio_tokens: video_indices_input = video_indices audio_indices_input = audio_indices num_video_tokens = video_indices.shape[1] if num_video_tokens > total_video_tokens: curr_frame_tokens = num_video_tokens % num_tokens_per_frame lookback_tokens = (self.max_video_frames - (0 if curr_frame_tokens == 0 else 1)) * num_tokens_per_frame + curr_frame_tokens video_indices_input = video_indices[:, -lookback_tokens:] # prep video embeddings frame_embeddings = self.image_embedding(video_indices_input) frame_embeddings = video_pos_emb[:frame_embeddings.shape[1]] + frame_embeddings frame_embeddings = torch.cat((video_bos, frame_embeddings), dim = 1) # prep audio embeddings audio_embeddings = self.audio_embedding(audio_indices_input) audio_pos_emb = self.audio_pos_emb()[:audio_embeddings.shape[1]] audio_pos_emb = rearrange(audio_pos_emb, 'n d -> 1 n d') audio_embeddings = audio_embeddings + audio_pos_emb audio_embeddings = torch.cat((audio_bos, audio_embeddings), dim = 1) frame_embeddings, audio_embeddings = self.video_audio_transformer( frame_embeddings, audio_embeddings, context = text_embeds, context_mask = text_mask ) logits = self.to_video_logits(frame_embeddings) if is_decoding_video else self.to_audio_logits(audio_embeddings) if cond_scale != 1: # discovery by Katherine Crowson # https://twitter.com/RiversHaveWings/status/1478093658716966912 uncond_frame_embeddings, uncond_audio_embeddings = self.video_audio_transformer( frame_embeddings, audio_embeddings, context = text_embeds, context_mask = torch.zeros_like(text_mask).bool() ) uncond_logits = self.to_video_logits(uncond_frame_embeddings) if is_decoding_video else self.to_audio_logits(uncond_audio_embeddings) logits = uncond_logits + (logits - uncond_logits) * cond_scale logits = logits[:, -1, :] filtered_logits = top_k(logits, thres = filter_thres) sample = gumbel_sample(filtered_logits, temperature = temperature, dim = -1) sample = rearrange(sample, 'b -> b 1') if is_decoding_video: video_indices = torch.cat((video_indices, sample), dim = 1) at_frame_boundary = (video_indices.shape[1] % num_tokens_per_frame) == 0 else: audio_indices = torch.cat((audio_indices, sample), dim = 1) at_frame_boundary = (audio_indices.shape[1] % num_audio_tokens_per_video_frame) == 0 # alternate between audio and video decoding, one video frame at a time if at_frame_boundary: is_decoding_video = not is_decoding_video # decoding video codebook indices with VQGan codes = self.vae.codebook[video_indices] codes = rearrange(codes, 'b (f h w) d -> (b f) d h w', h = self.video_fmap_size, w = self.video_fmap_size) image_reconstructions = batch_process(codes, self.vae.decode, chunks = decode_max_batchsize) video = rearrange(image_reconstructions, '(b f) d h w -> b f d h w', b = batch) # just return audio token indices for now audio = audio_indices return video, audio def forward( self, *, text, video, audio, return_loss = False, cond_dropout_prob = 0.2 ): batch, seq_len, frames, device = *text.shape, video.shape[1], text.device text_mask = text != 0 text_embeds = self.embed_text(text, mask = text_mask) # prep video representation if video.dtype == torch.long: frame_indices = video else: assert frames == self.max_video_frames, f'you must give the full video frames ({self.max_video_frames}) during training' assert exists(self.vae), 'VAE must be passed in if you wish for video to be encoded to ids automatically' frame_indices = self.vae.get_video_indices(video) frame_indices = rearrange(frame_indices, 'b ... -> b (...)') frame_indices_input = frame_indices[:, :-1] if return_loss else frame_indices frame_embeddings = self.image_embedding(frame_indices_input) frame_embeddings = self.video_pos_emb()[:-1] + frame_embeddings video_bos = repeat(self.video_bos, 'd -> b 1 d', b = batch) frame_embeddings = torch.cat((video_bos, frame_embeddings), dim = 1) # prep audio representations audio_indices_input = audio[:, :-1] if return_loss else audio audio_embeddings = self.audio_embedding(audio_indices_input) audio_pos_emb = self.audio_pos_emb()[:audio_embeddings.shape[1]] audio_embeddings = audio_embeddings + rearrange(audio_pos_emb, 'n d -> 1 n d') audio_bos = repeat(self.audio_bos, 'd -> b 1 d', b = batch) audio_embeddings = torch.cat((audio_bos, audio_embeddings), dim = 1) # null conditions, for super-conditioning if self.training and cond_dropout_prob > 0: # dropout condition randomly # presented in https://openreview.net/forum?id=qw8AKxfYbI uncond_mask = prob_mask_like((batch,), cond_dropout_prob, device = device) text_mask *= rearrange(~uncond_mask, 'b -> b 1') # twin attention towers for video and audio, with efficient chunked cross modality attention frame_embeddings, audio_embeddings = self.video_audio_transformer( frame_embeddings, audio_embeddings, context = text_embeds, context_mask = text_mask ) video_logits = self.to_video_logits(frame_embeddings) audio_logits = self.to_audio_logits(audio_embeddings) if not return_loss: return video_logits, audio_logits video_loss = F.cross_entropy(rearrange(video_logits, 'b n c -> b c n'), frame_indices) audio_loss = F.cross_entropy(rearrange(audio_logits, 'b n c -> b c n'), audio) return video_loss + audio_loss * self.audio_loss_weight # main class for learning on sketches class NUWASketch(nn.Module): def __init__( self, *, vae, sketch_vae, dim, image_size, max_video_frames = 5, sketch_max_video_frames = 2, sketch_enc_depth = 6, sketch_enc_dim_head = 64, sketch_enc_heads = 8, sketch_enc_use_sparse_3dna = False, enc_reversible = False, dec_depth = 6, dec_dim_head = 64, dec_heads = 8, dec_reversible = False, attn_dropout = 0., ff_dropout = 0., ff_chunk_size = None, embed_gradient_frac = 0.2, shift_video_tokens = True, cross_2dna_kernel_size = 3, cross_2dna_dilation = 1, sparse_3dna_kernel_size = 3, sparse_3dna_dilation = 1, sparse_3dna_query_num_frames_chunk = None, ): super().__init__() self.image_size = image_size self.sketch_vae = sketch_vae sketch_vae_num_layers = sketch_vae.num_layers sketch_num_image_tokens = sketch_vae.codebook_size sketch_fmap_size = image_size // (2 ** sketch_vae_num_layers) sketch_shape = (sketch_max_video_frames, sketch_fmap_size, sketch_fmap_size) self.sketch_max_video_frames = sketch_max_video_frames self.sketch_embedding = Embedding(sketch_num_image_tokens, dim, frac_gradient = embed_gradient_frac) self.sketch_pos_emb = AxialPositionalEmbedding(dim, shape = sketch_shape) # sparse 3dna kwargs sparse_3dna_dilations = tuple(range(1, sparse_3dna_dilation + 1)) if not isinstance(sparse_3dna_dilation, (list, tuple)) else sparse_3dna_dilation # encoder enc_transformer_klass = Transformer if not enc_reversible else ReversibleTransformer self.sketch_transformer = enc_transformer_klass( dim = dim, depth = sketch_enc_depth, heads = sketch_enc_heads, dim_head = sketch_enc_dim_head, attn_dropout = attn_dropout, ff_dropout = ff_dropout, shift_video_tokens = shift_video_tokens, sparse_3dna_video_shape = sketch_shape, sparse_3dna_kernel_size = sparse_3dna_kernel_size, sparse_3dna_dilations = sparse_3dna_dilations, sparse_3dna_query_num_frames_chunk = sparse_3dna_query_num_frames_chunk, sparse_3dna_attn = sketch_enc_use_sparse_3dna ) # decoder parameters self.vae = vae.copy_for_eval() vae_num_layers = vae.num_layers num_image_tokens = vae.codebook_size self.video_bos = nn.Parameter(torch.randn(dim)) self.image_embedding = Embedding(num_image_tokens, dim, frac_gradient = embed_gradient_frac) fmap_size = image_size // (2 ** vae_num_layers) assert fmap_size == sketch_fmap_size, 'feature map size of video must be equal to the feature map size of sketches (VAEs must have same number of layers)' self.video_fmap_size = fmap_size self.max_video_frames = max_video_frames video_shape = (max_video_frames, fmap_size, fmap_size) self.video_pos_emb = AxialPositionalEmbedding(dim, shape = video_shape) # cycle dilation for sparse 3d-nearby attention cross_2dna_dilations = tuple(range(1, cross_2dna_dilation + 1)) if not isinstance(cross_2dna_dilation, (list, tuple)) else cross_2dna_dilation dec_transformer_klass = Transformer if not dec_reversible else ReversibleTransformer self.video_transformer = dec_transformer_klass( dim = dim, depth = dec_depth, heads = dec_heads, dim_head = dec_dim_head, causal = True, cross_attend = True, cross_2dna_attn = True, cross_2dna_image_size = fmap_size, cross_2dna_kernel_size = cross_2dna_kernel_size, cross_2dna_dilations = cross_2dna_dilations, attn_dropout = attn_dropout, ff_dropout = ff_dropout, ff_chunk_size = ff_chunk_size, shift_video_tokens = shift_video_tokens, sparse_3dna_video_shape = video_shape, sparse_3dna_kernel_size = sparse_3dna_kernel_size, sparse_3dna_dilations = sparse_3dna_dilations, sparse_3dna_query_num_frames_chunk = sparse_3dna_query_num_frames_chunk, sparse_3dna_attn = True ) self.to_logits = nn.Linear(dim, num_image_tokens, bias = False) def embed_sketch(self, sketch, mask = None): batch, frames, channels, image_size, _, device = *sketch.shape, sketch.device if exists(mask): assert mask.shape[:2] == (batch, frames), 'sketch mask must be in shape of (batch x frame)' sketch_indices = self.sketch_vae.get_video_indices(sketch) sketch_indices = rearrange(sketch_indices, 'b ... -> b (...)') sketch_tokens = self.sketch_embedding(sketch_indices) num_tokens = sketch_tokens.shape[1] sketch_pos_emb = self.sketch_pos_emb() sketch_pos_emb = sketch_pos_emb[:num_tokens] sketch_tokens = sketch_tokens + sketch_pos_emb if exists(mask): mask = repeat(mask, 'b f -> b (f n)', n = (num_tokens // frames)) else: mask = torch.ones((batch, num_tokens), dtype = torch.bool, device = device) embed = self.sketch_transformer(sketch_tokens, mask = mask) return embed, mask @torch.no_grad() @eval_decorator def generate( self, *, sketch, sketch_mask = None, filter_thres = 0.9, temperature = 1., decode_max_batchsize = 10, cond_scale = 2., num_frames = None ): batch, device = sketch.shape[0], sketch.device sketch_embeds, decoder_context_mask = self.embed_sketch(sketch, mask = sketch_mask) bos = repeat(self.video_bos, 'd -> b 1 d', b = batch) video_indices = torch.empty((batch, 0), device = device, dtype = torch.long) num_tokens_per_frame = self.video_fmap_size ** 2 num_frames = default(num_frames, self.max_video_frames) total_video_tokens = num_tokens_per_frame * num_frames max_video_tokens = num_tokens_per_frame * self.max_video_frames pos_emb = self.video_pos_emb() for ind in tqdm(range(total_video_tokens)): video_indices_input = video_indices num_video_tokens = video_indices.shape[1] if num_video_tokens > max_video_tokens: curr_frame_tokens = num_video_tokens % num_tokens_per_frame lookback_tokens = (self.max_video_frames - (0 if curr_frame_tokens == 0 else 1)) * num_tokens_per_frame + curr_frame_tokens video_indices_input = video_indices[:, -lookback_tokens:] frame_embeddings = self.image_embedding(video_indices_input) frame_embeddings = pos_emb[:frame_embeddings.shape[1]] + frame_embeddings frame_embeddings = torch.cat((bos, frame_embeddings), dim = 1) frame_embeddings = self.video_transformer( frame_embeddings, context = sketch_embeds, context_mask = decoder_context_mask ) logits = self.to_logits(frame_embeddings) if cond_scale != 1: # discovery by Katherine Crowson # https://twitter.com/RiversHaveWings/status/1478093658716966912 uncond_frame_embeddings = self.video_transformer( frame_embeddings, context = sketch_embeds, context_mask = torch.zeros_like(decoder_context_mask).bool() ) uncond_logits = self.to_logits(uncond_frame_embeddings) logits = uncond_logits + (logits - uncond_logits) * cond_scale logits = logits[:, -1, :] filtered_logits = top_k(logits, thres = filter_thres) sample = gumbel_sample(filtered_logits, temperature = temperature, dim = -1) sample = rearrange(sample, 'b -> b 1') video_indices = torch.cat((video_indices, sample), dim = 1) codes = self.vae.codebook[video_indices] codes = rearrange(codes, 'b (f h w) d -> (b f) d h w', h = self.video_fmap_size, w = self.video_fmap_size) image_reconstructions = batch_process(codes, self.vae.decode, chunks = decode_max_batchsize) video = rearrange(image_reconstructions, '(b f) d h w -> b f d h w', b = batch) return video def forward( self, *, sketch, sketch_mask = None, video = None, return_loss = False, cond_dropout_prob = 0.2 ): # handle one sketch gracefully if sketch.ndim == 4: sketch = rearrange(sketch, 'b c h w -> b 1 c h w') # get a bunch of variables batch, sketch_frames, sketch_channels, sketch_image_size, _, frames, device = *sketch.shape, video.shape[1], sketch.device # guardrails assert sketch_image_size == self.image_size, 'sketch image size must be equal' assert sketch_frames <= self.sketch_max_video_frames, 'sketch frames must be less than max sketch video frames' # get sketch embeddings, and calculate mask (for now, assume no padding) sketch_embeds, decoder_context_mask = self.embed_sketch(sketch, mask = sketch_mask) assert frames == self.max_video_frames, f'you must give the full video frames ({self.max_video_frames}) during training' frame_indices = self.vae.get_video_indices(video) frame_indices = rearrange(frame_indices, 'b ... -> b (...)') frame_indices_input = frame_indices[:, :-1] if return_loss else frame_indices frame_embeddings = self.image_embedding(frame_indices_input) frame_embeddings = self.video_pos_emb()[:-1] + frame_embeddings bos = repeat(self.video_bos, 'd -> b 1 d', b = batch) frame_embeddings = torch.cat((bos, frame_embeddings), dim = 1) if self.training and cond_dropout_prob > 0: # dropout condition randomly # presented in https://openreview.net/forum?id=qw8AKxfYbI uncond_mask = prob_mask_like((batch,), cond_dropout_prob, device = device) sketch_mask *= rearrange(~uncond_mask, 'b -> b 1') frame_embeddings = self.video_transformer( frame_embeddings, context = sketch_embeds, context_mask = decoder_context_mask ) logits = self.to_logits(frame_embeddings) if not return_loss: return logits loss = F.cross_entropy(rearrange(logits, 'b n c -> b c n'), frame_indices) return loss
nuwa-pytorch-main
nuwa_pytorch/nuwa_pytorch.py
#!/usr/bin/env python # -*- encoding: utf-8 -*- from __future__ import absolute_import, print_function import io import os import sys from glob import glob from os.path import basename from os.path import dirname from os.path import join from os.path import splitext from setuptools import find_packages from setuptools import setup from setuptools import Extension from setuptools.command.install import install # ================================ C++ extension import numpy PROJ_DIR = os.path.dirname(os.path.realpath(__file__)) # CPP_SRC_PATH = join(PROJ_DIR, 'cpp', 'src') CPP_SRC_PATH = join('cpp', 'src') # Obtain the numpy include directory. This logic works across numpy versions. try: numpy_include = numpy.get_include() except AttributeError: numpy_include = numpy.get_numpy_include() # gather up all the source files # srcFiles = [join(PROJ_DIR, 'python', 'bolt', 'native.i')] srcFiles = [join('python', 'bolt', 'native.i')] includeDirs = [numpy_include] paths = [CPP_SRC_PATH] for path in paths: srcDir = path for root, dirNames, fileNames in os.walk(srcDir): for dirName in dirNames: absPath = os.path.join(root, dirName) if absPath.startswith("cpp/src/external"): continue print('adding dir to path: %s' % absPath) globStr = "%s/*.cpp" % absPath files = glob(globStr) if 'eigen/src' not in absPath: # just include top level includeDirs.append(absPath) srcFiles += files # set the compiler flags so it'll build on different platforms (feel free # to file a pull request with a fix if it doesn't work on yours) # note that -march=native implies -mavx and -mavx2; Bolt requires AVX2 extra_args = ['-std=c++14', '-fno-rtti', '-march=native', '-ffast-math'] if sys.platform == 'darwin': extra_args.append('-mmacosx-version-min=10.9') os.environ['LDFLAGS'] = '-mmacosx-version-min=10.9 -stdlib=libc++ -framework Accelerate' os.environ["CC"] = "g++" # force compiling c as c++ else: # based on Issue #4 if "CC" not in os.environ: os.environ['CC'] = "clang" if "CXX" not in os.environ: os.environ['CXX'] = "clang++" # extra_args += ['-stdlib=libc++'] # os.environ['CC'] = "clang" # os.environ['CXX'] = "clang++" # os.environ['LDFLAGS'] = '-lc++' # else: # os.environ["CC"] = "clang++" # force compiling c as c++ # inplace extension module includeDirs += [join(PROJ_DIR, 'python', 'bolt')] if 'EIGEN_INCLUDE_DIR' in os.environ: includeDirs += [ os.environ['EIGEN_INCLUDE_DIR'], os.environ['EIGEN_INCLUDE_DIR'] + '/Eigen' ] else: includeDirs += [ join(PROJ_DIR, 'cpp', 'src', 'external', 'eigen'), join(PROJ_DIR, 'cpp', 'src', 'external', 'eigen', 'Eigen') ] nativeExt = Extension("bolt._bolt", # must match cpp header name with leading _ srcFiles, define_macros=[('NDEBUG', '1')], include_dirs=includeDirs, # swig_opts=['-c++', '-modern'], swig_opts=['-c++'], extra_compile_args=extra_args # extra_link_args=['-stdlib=libc++'], ) # ================================ Python modules # glob_str = join('python', 'bolt') + '*.py' # modules = [splitext(basename(path))[0] for path in glob(glob_str)] # ================================ Call to setup() # This ensures that the extension (which generates bolt.py) is built # before py_modules are copied. class CustomInstall(install): def run(self): self.run_command('build_ext') self.do_egg_install() setup( cmdclass={'install': CustomInstall}, name='pybolt', version='0.1.4', license='MPL', description='Fast approximate matrix and vector operations', author='Davis Blalock', author_email='dblalock@mit.edu', url='https://github.com/dblalock/bolt', download_url='https://github.com/dblalock/bolt/archive/0.1.tar.gz', packages=['bolt'], package_dir={'bolt': 'python/bolt'}, py_modules=['python/bolt/bolt'], include_package_data=True, zip_safe=False, classifiers=[ # complete classifier list: # http://pypi.python.org/pypi?%3Aaction=list_classifiers 'Development Status :: 3 - Alpha', 'Intended Audience :: Developers', 'License :: OSI Approved :: Mozilla Public License 2.0 (MPL 2.0)', 'Operating System :: Unix', 'Operating System :: POSIX', 'Programming Language :: C', 'Programming Language :: C++', 'Programming Language :: Python', 'Programming Language :: Python :: 2.7', 'Programming Language :: Python :: Implementation :: CPython', 'Topic :: Scientific/Engineering :: Artificial Intelligence', 'Topic :: Utilities', ], keywords=[ 'Machine Learning', 'Compression', 'Big Data', # eg: 'keyword1', 'keyword2', 'keyword3', ], install_requires=[ 'numpy', 'scikit-learn', #'kmc2' # 'sphinx_rtd_theme' # for docs ], extras_require={ # eg: # 'rst': ['docutils>=0.11'], # ':python_version=="2.6"': ['argparse'], }, ext_modules=[ nativeExt ], )
bolt-master
setup.py
#!/usr/bin/env python # TODO maybe have sklearn transforms for dot prod and Lp dists # TODO add L1 distance from . import bolt # inner bolt because of SWIG import kmc2 # state-of-the-art kmeans initialization (as of NIPS 2016) import numpy as np from sklearn import cluster, exceptions # ================================================================ Distances def dists_elemwise_sq(x, q): diffs = x - q return diffs * diffs def dists_elemwise_l1(x, q): return np.abs(x - q) def dists_elemwise_dot(x, q): return x * q # ================================================================ Preproc def _insert_zeros(X, nzeros): """injects nzeros zero columns spaced as far apart as possible""" if nzeros < 1: return X N, D = X.shape D_new = D + nzeros X_new = np.zeros((N, D_new), dtype=X.dtype) nonzeros_per_zero = D // nzeros if nonzeros_per_zero < 1: X_new[:, :D] = X return X_new stripe_width = nonzeros_per_zero for i in range(nzeros): in_start = stripe_width * i in_end = in_start + stripe_width out_start = i * (stripe_width + 1) out_end = out_start + stripe_width X_new[:, out_start:out_end] = X[:, in_start:in_end] out_end += 1 remaining_len = D - in_end out_remaining_len = D_new - out_end # print "D, remaining_incols, remaining_outcols, in_end, out_end: ", \ # D, remaining_len, out_remaining_len, in_end, out_end assert remaining_len == out_remaining_len assert remaining_len >= 0 if remaining_len: X_new[:, out_end:out_end+remaining_len] = X[:, in_end:D] # check that we copied both the beginning and end properly # assert np.array_equal(X[:, 0], X_new[:, 1]) assert np.array_equal(X[:, 0], X_new[:, 0]) if remaining_len > 0: assert np.array_equal(X[:, -1], X_new[:, -1]) return X_new def _ensure_num_cols_multiple_of(X, multiple_of): """Adds as many columns of zeros as necessary to ensure that X.shape[1] % multiple_of == 0""" remainder = X.shape[1] % multiple_of if remainder > 0: return _insert_zeros(X, multiple_of - remainder) return X # ================================================================ kmeans def kmeans(X, k, max_iter=16, init='kmc2'): X = X.astype(np.float32) np.random.seed(123) # if k is huge, initialize centers with cartesian product of centroids # in two subspaces if init == 'subspaces': sqrt_k = int(np.sqrt(k) + .5) if sqrt_k ** 2 != k: raise ValueError("K must be a square number if init='subspaces'") _, D = X.shape centroids0, _ = kmeans(X[:, :D/2], sqrt_k, max_iter=1) centroids1, _ = kmeans(X[:, D/2:], sqrt_k, max_iter=1) seeds = np.empty((k, D), dtype=np.float32) for i in range(sqrt_k): for j in range(sqrt_k): row = i * sqrt_k + j seeds[row, :D/2] = centroids0[i] seeds[row, D/2:] = centroids1[j] elif init == 'kmc2': seeds = kmc2.kmc2(X, k).astype(np.float32) else: raise ValueError("init parameter must be one of {'kmc2', 'subspaces'}") estimator = cluster.MiniBatchKMeans(k, init=seeds, max_iter=max_iter).fit(X) return estimator.cluster_centers_, estimator.labels_ # ================================================================ PQ # TODO rm after debug def _encode_X_pq(X, codebooks, elemwise_dist_func=dists_elemwise_sq): ncentroids, ncodebooks, subvect_len = codebooks.shape assert X.shape[1] == (ncodebooks * subvect_len) idxs = np.empty((X.shape[0], ncodebooks), dtype=np.int) X = X.reshape((X.shape[0], ncodebooks, subvect_len)) for i, row in enumerate(X): row = row.reshape((1, ncodebooks, subvect_len)) dists = elemwise_dist_func(codebooks, row) dists = np.sum(dists, axis=2) idxs[i, :] = np.argmin(dists, axis=0) # return idxs + self._offsets_ # offsets let us index into raveled dists return idxs # [N x ncodebooks] def _learn_centroids(X, ncentroids, ncodebooks): subvect_len = int(X.shape[1] / ncodebooks) assert subvect_len * ncodebooks == X.shape[1] # must divide evenly ret = np.empty((ncentroids, ncodebooks, subvect_len)) for i in range(ncodebooks): start_col = i * subvect_len end_col = start_col + subvect_len X_in = X[:, start_col:end_col] centroids, labels = kmeans(X_in, ncentroids) ret[:, i, :] = centroids return ret.astype(np.float32) def _learn_best_quantization(luts): # luts can be a bunch of vstacked luts best_loss = np.inf best_alpha = None best_floors = None best_scale_by = None for alpha in [0, .001, .002, .005, .01, .02, .05, .1]: alpha_pct = int(100 * alpha) # compute quantized luts this alpha would yield floors = np.percentile(luts, alpha_pct, axis=0) luts_offset = np.maximum(0, luts - floors) # clip at 0 ceil = np.percentile(luts_offset, 100 - alpha_pct) scale_by = 255. / ceil luts_quantized = np.floor(luts_offset * scale_by).astype(np.int) luts_quantized = np.minimum(255, luts_quantized) # clip at 255 # compute err luts_ideal = (luts - luts_offset) * scale_by diffs = luts_ideal - luts_quantized loss = np.sum(diffs * diffs) # print "alpha = {}\t-> loss = {}".format(alpha, loss) # # yep, almost exactly alpha saturate in either direction # print "fraction of 0s, 255s = {}, {}".format( # np.mean(luts_offset == 0), np.mean(luts_quantized == 255)) if loss <= best_loss: best_loss = loss best_alpha = alpha best_floors = floors best_scale_by = scale_by # print "best alpha, loss = ", best_alpha, best_loss # print "best floors, scale = ", best_floors, best_scale_by return best_floors, best_scale_by, best_alpha def _extract_random_rows(X, how_many, remove_from_X=True): if how_many > len(X): raise IndexError("how_many ({}) > len(X) ({})".format(how_many, len(X))) split_start = np.random.randint(len(X) - how_many - 1) split_end = split_start + how_many rows = np.copy(X[split_start:split_end]) if remove_from_X: return np.vstack((X[:split_start], X[split_end:])), rows return X, rows def _fit_pq_lut(q, centroids, elemwise_dist_func): _, nsubvects, subvect_len = centroids.shape assert len(q) == nsubvects * subvect_len q = q.reshape((1, nsubvects, subvect_len)) q_dists_ = elemwise_dist_func(centroids, q) q_dists_ = np.sum(q_dists_, axis=-1) return np.asfortranarray(q_dists_) # ncentroids, nsubvects, col-major def _learn_quantization_params(X, centroids, elemwise_dist_func, Q=None, # plot=True): plot=False): """learn distros of entries in each lut""" if Q is None: num_rows = int(min(10*1000, len(X) / 2)) how_many = int(min(1000, num_rows // 2)) _, Q = _extract_random_rows( X[num_rows:], how_many=how_many, remove_from_X=False) X = X[:num_rows] # limit to first 10k rows of X # compute luts for all the queries luts = [_fit_pq_lut(q, centroids=centroids, elemwise_dist_func=elemwise_dist_func) for q in Q] luts = np.vstack(luts) if plot: import matplotlib.pyplot as plt import seaborn as sb # print "plotting LUT distributions..." plot_luts = np.asfortranarray(luts[:5000]) _, ax = plt.subplots(figsize=(10, 4)) sb.violinplot(data=plot_luts, inner="box", cut=0, ax=ax) ax.set_title('Distributions of distances within each LUT') ax.set_xlabel('LUT') ax.set_ylabel('Distance to query') ax.set_ylim([0, np.max(plot_luts)]) plt.show() # print "lut stats (min, mean, max):" # print np.min(luts, axis=0) # print np.mean(luts, axis=0) # print np.max(luts, axis=0) assert luts.shape == (centroids.shape[0] * len(Q), centroids.shape[1]) offsets, scaleby, _ = _learn_best_quantization(luts) return offsets.astype(np.float32), scaleby class MockEncoder(object): """Stand-in for cpp impl; only for debuging""" def __init__(self, nbytes): self._enc_bytes = nbytes self.ncodebooks = 2 * nbytes self._encoder = bolt.BoltEncoder(nbytes) def set_centroids(self, centroids): # accept centroids as 2D array like cpp; but we'll need them 3D nrows, ndims = centroids.shape ncentroids = 16 codebook_sz = ncentroids * ndims self.centroids = np.empty((ncentroids, self.ncodebooks, ndims)) for m in range(self.ncodebooks): start_idx = m * ncentroids # start idx of block end_idx = start_idx + ncentroids block = centroids[start_idx:end_idx] self.centroids[:, m, :] = block # check whether centroids bridge is broken self._encoder.set_centroids(centroids) raw_centroids = self._encoder.centroids() cpp_centroids = np.full(raw_centroids.shape, -1) # print "ncentroids, ncodebooks, ndims ", self.centroids.shape inbuff = raw_centroids.ravel() outbuff = np.zeros(raw_centroids.size) - 1 for m in range(self.ncodebooks): start_idx = m * codebook_sz # start idx of block for i in range(ncentroids): # for each row in block for j in range(ndims): # for each col in block in_idx = start_idx + (ndims * i) + j out_idx = start_idx + (ncentroids * j) + i outbuff[in_idx] = inbuff[out_idx] cpp_centroids = outbuff.reshape(centroids.shape) # print "py, cpp centroids: " # print centroids[:20] # print cpp_centroids[:20] # print centroids.shape # print cpp_centroids.shape assert np.allclose(centroids, cpp_centroids) def set_data(self, X): self.X = X self.X_enc = _encode_X_pq(X, self.centroids) ncodebooks = self.centroids.shape[1] enc_offsets = np.arange(ncodebooks, dtype=np.int) * 16 self._encoder.set_data(X) raw_Xenc = self._encoder.codes() assert 2 * raw_Xenc.shape[1] == ncodebooks cpp_Xenc = np.empty((raw_Xenc.shape[0], ncodebooks), dtype=np.uint8) # cpp returns codes in bitpacked form, so unpack them for in_j, out_j in enumerate(range(0, ncodebooks, 2)): col = raw_Xenc[:, in_j] cpp_Xenc[:, out_j] = np.bitwise_and(col, 15) for in_j, out_j in enumerate(range(1, ncodebooks, 2)): col = raw_Xenc[:, in_j] cpp_Xenc[:, out_j] = np.bitwise_and(col, 255 - 15) >> 4 # print "python X enc" # print self.X_enc.shape # print self.X_enc[:20] # print "cpp X enc" # print cpp_Xenc.shape # print cpp_Xenc[:20] # print "raw cpp X_enc" # print raw_Xenc[:20] self.X_enc += enc_offsets def set_offsets(self, offsets): assert self.scale > 0 self._offsets_ = offsets self._encoder.set_offsets(offsets) def set_scale(self, scale): self.scale = scale self._encoder.set_scale(scale) def _quantize_lut(self, raw_lut): lut = np.floor(raw_lut * self.scale + self._offsets_) return np.maximum(0, np.minimum(lut, 255)).astype(np.uint16) def _dists(self, raw_lut): lut = np.asfortranarray(self._quantize_lut(raw_lut)) centroid_dists = lut.T.ravel()[self.X_enc.ravel()] return np.sum(centroid_dists.reshape(self.X_enc.shape), axis=-1) # dists = np.sum(centroid_dists.reshape(self.X_enc.shape), axis=-1) def dists_sq(self, q): lut = _fit_pq_lut(q, centroids=self.centroids, elemwise_dist_func=dists_elemwise_sq) offsets_cpp = self._encoder.get_offsets() scale_cpp = self._encoder.get_scale() # print "py, cpp offsets:" # print self.offsets # print offsets_cpp # print "py, cpp scale factors:" # print self.scale # print scale_cpp lut_py = self._quantize_lut(lut) # print "lets try to read the cpp lut..." # self._encoder.lut_l2(q) self._encoder.lut_dot(q) lut_cpp = self._encoder.get_lut() # print "py, cpp lut:" # within +/- 1 using naive lut impl in cpp # print lut_py # print lut_cpp # return self._dists(lut) dists_py = self._dists(lut) dists_cpp = self._encoder.dists_sq(q)[:len(dists_py)] # strip padding # print "py, cpp initial dists:" # print dists_py[:20] # print dists_cpp[:20] # print "py, cpp final dists:" # print dists_py[-20:] # print dists_cpp[-20:] return dists_py # return dists_cpp def dot_prods(self, q): lut = _fit_pq_lut(q, centroids=self.centroids, elemwise_dist_func=dists_elemwise_dot) return self._dists(lut) class Reductions: SQUARED_EUCLIDEAN = 'l2' DOT_PRODUCT = 'dot' class Accuracy: LOWEST = 'lowest' LOW = 'low' MEDIUM = 'medium' HIGH = 'high' _acc_to_nbytes = { Accuracy.LOWEST: 2, Accuracy.LOW: 8, Accuracy.MEDIUM: 16, Accuracy.HIGH: 32, } class Encoder(object): def __init__(self, reduction=Reductions.SQUARED_EUCLIDEAN, accuracy=Accuracy.MEDIUM, norm_mean=None): self._enc_bytes = _acc_to_nbytes[accuracy] self.reduction = reduction self.norm_mean = norm_mean if norm_mean is not None \ else reduction != Reductions.DOT_PRODUCT def _preproc(self, X): # TODO rows of X also needs to have variance >> 1 to avoid # everything going to 0 when bolt_encode converts to ints in argmin one_d = len(X.shape) == 1 if one_d: X = X.reshape((1, -1)) ncodebooks = self._enc_bytes * 2 X = X.astype(np.float32) if self.norm_mean: # X = X - self.means_ X -= self.means_ out = _ensure_num_cols_multiple_of(X.astype(np.float32), ncodebooks) return out.ravel() if one_d else out @property def nbytes(self): try: return self._nbytes_ except AttributeError: raise exceptions.NotFittedError("Encoder has not yet been given " "a dataset; call fit() first") def fit(self, X, just_train=False, Q=None): if not len(X.shape) == 2: raise IndexError("X must be [num_examples x num_dimensions]!") if X.shape[1] < 2 * self._enc_bytes: raise ValueError("num_dimensions must be at least 2 * nbytes") ncentroids = 16 self._nbytes_ = self._enc_bytes * len(X) # self.DEBUG = False # self.DEBUG = True self.means_ = np.mean(X, axis=0) if self.norm_mean \ else np.zeros(X.shape[1]) self.means_ = self.means_.astype(np.float32) # self.means_ = np.zeros_like(self.means_) # TODO rm # self.means_ = np.ones_like(self.means_) # TODO rm X = self._preproc(X) self._ndims_ = X.shape[1] self._ncodebooks = self._enc_bytes * 2 centroids = _learn_centroids(X, ncentroids=ncentroids, ncodebooks=self._ncodebooks) centroids = centroids.astype(np.float32) # print "X shape, centroids shape: ", X.shape, centroids.shape # print "X means before preproc:", self.means_ # print "X means after preproc:", np.mean(X, axis=0) # print "means of centroids:", np.mean(centroids, axis=0) if self.DEBUG: self._encoder_ = MockEncoder(self._enc_bytes) else: self._encoder_ = bolt.BoltEncoder(self._enc_bytes) # print "centroids shape: ", centroids.shape # compute lut offsets and scaleby for l2 and dot here; we'll have # to switch off which ones are used based on which method gets called if self.reduction == Reductions.SQUARED_EUCLIDEAN: elemwise_dist_func = dists_elemwise_sq elif self.reduction == Reductions.DOT_PRODUCT: elemwise_dist_func = dists_elemwise_dot else: self._bad_reduction() offsets, self.scale = _learn_quantization_params( X, centroids, elemwise_dist_func) # account for fact that cpp's fma applies scale first, then adds offset # self._offsets_ = -offsets / self.scale self._offsets_ = -offsets * self.scale self._total_offset_ = np.sum(self._offsets_) # offsets_sq, self.scale_sq_ = _learn_quantization_params( # X, centroids, dists_elemwise_sq) # offsets_dot, self.scale_dot_ = _learn_quantization_params( # X, centroids, dists_elemwise_dot) self._encoder_.set_scale(self.scale) self._encoder_.set_offsets(self._offsets_) # # account for fact that cpp applies scale first, then offset, in fma # self.offsets_sq_ = -offsets_sq / self.scale_sq_ # self.offsets_dot_ = -offsets_dot / self.scale_dot_ # # TODO rm after debug # self.offsets_sq_ *= 5 # self.offsets_sq_[:] = 0. # self.offsets_dot_[:] = 0. # self.scale_sq_ = 1. # self.scale_dot_ = 1. # print "centroids shape", centroids.shape # munge centroids into contiguous 2D array; # starts as [ncentroids, ncodebooks, subvect_len] and # needs to be [ncentroids * ncodebooks, subvect_len subvect_len = centroids.shape[-1] flat_centroids = np.empty((self._ncodebooks * ncentroids, subvect_len), dtype=np.float32) for m in range(self._ncodebooks): codebook = centroids[:, m, :] start_row = m * ncentroids end_row = start_row + ncentroids flat_centroids[start_row:end_row, :] = codebook # print "centroids shape: ", centroids.shape # print "flat centroids shape: ", flat_centroids.shape self._encoder_.set_centroids(flat_centroids) if not just_train: self._encoder_.set_data(X) self._n = len(X) return self def set_data(self, X): """set data to actually encode; separate from fit() because fit() could use different training data than what we actully compress""" self._encoder_.set_data(self._preproc(X)) self._n = len(X) def transform(self, q, unquantize=False): if self.reduction == Reductions.DOT_PRODUCT: func = self._encoder_.dot_prods elif self.reduction == Reductions.SQUARED_EUCLIDEAN: func = self._encoder_.dists_sq else: self._bad_reduction() ret = func(self._preproc(q))[:self._n] return (ret - self._total_offset_) / self.scale if unquantize else ret def knn(self, q, k): if self.reduction == Reductions.DOT_PRODUCT: return self._encoder_.knn_mips(self._preproc(q), k) elif self.reduction == Reductions.SQUARED_EUCLIDEAN: return self._encoder_.knn_l2(self._preproc(q), k) def _bad_reduction(self): raise ValueError("Unreconized reduction '{}'!".format(self.reduction)) # def dot(self, q, unquantize=False): # self._check_reduction(Reductions.DOT_PRODUCT) # ret = self._encoder_.dot_prods(self._preproc(q))[:self._n] # return (ret - self._offsets_) * self.scale if unquantize else ret # def dists_sq(self, q, unquantize=False): # self._check_reduction(Reductions.SQUARED_EUCLIDEAN) # ret = self._encoder_.dists_sq(self._preproc(q))[:self._n] # return (ret - self._offsets_) * self.scale if unquantize else ret # def knn_dot(self, q, k): # self._check_reduction(Reductions.DOT_PRODUCT) # return self._encoder_.knn_mips(self._preproc(q), k) # def knn_l2(self, q, k): # self._check_reduction(Reductions.SQUARED_EUCLIDEAN) # return self._encoder_.knn_l2(self._preproc(q), k) def _test_insert_zeros(): X = np.random.randn(4, 1000) for ncols in range(1, X.shape[1] + 1): for nzeros in np.arange(64): _insert_zeros(X[:, :ncols], nzeros) if __name__ == '__main__': _test_insert_zeros()
bolt-master
python/bolt/bolt_api.py
#!/usr/bin/env python # note that we import module generate py file, not the generated # wrapper so (which is _bolt) from .bolt_api import * # noqa
bolt-master
python/bolt/__init__.py
#!/usr/bin/env python # from future import absolute_import, division, print_function import os import numpy as np # import pathlib as pl from sklearn import linear_model from scipy import signal from python.datasets import caltech, sharee, incart, ucr from python import misc_algorithms as algo from python import window from joblib import Memory # _memory = Memory('.', verbose=0, compress=7) # compression between 1 and 9 # _memory = Memory('.', verbose=0, compress=3) # compression between 1 and 9 _memory = Memory('.', verbose=0) _dir = os.path.dirname(os.path.abspath(__file__)) CIFAR10_DIR = os.path.join(_dir, '..', 'assets', 'cifar10-softmax') CIFAR100_DIR = os.path.join(_dir, '..', 'assets', 'cifar100-softmax') # ================================================================ types class MatmulTask(object): def __init__(self, X_train, Y_train, X_test, Y_test, W_train, W_test=None, name=None, info=None): self.X_train = X_train self.Y_train = Y_train self.X_test = X_test self.Y_test = Y_test self.W_train = W_train self.W_test = W_test if W_test is not None else W_train self.name = name self.info = info if info is not None else {} self.train_mats = (self.X_train, self.Y_train, self.W_train) self.test_mats = (self.X_test, self.Y_test, self.W_test) self.initial_hashes = self._hashes() def __str__(self): train_str = '{} @ {} = {}'.format( self.X_train.shape, self.W_train.shape, self.Y_train.shape) test_str = '{} @ {} = {}'.format( self.X_test.shape, self.W_test.shape, self.Y_test.shape) s = "train:\t{}\ntest:\t{}".format(train_str, test_str) if self.name: s = "---- {}\n{}".format(self.name, s) return s def validate_shapes(self): for (X, Y, W) in [self.train_mats, self.test_mats]: N, D = X.shape D2, M = W.shape assert D == D2 assert (N, M) == Y.shape def validate_hashes(self): assert self._hashes() == self.initial_hashes def validate(self, verbose=1, mse_thresh=1e-7, train=True, test=True): self.validate_shapes() self.validate_hashes() which_mats = [] if train: which_mats.append(self.train_mats) if test: which_mats.append(self.test_mats) for (X, Y, W) in which_mats: Y_hat = X @ W diffs = Y - Y_hat mse = np.mean(diffs * diffs) / np.var(Y) if verbose > 0: print("mse: ", mse) assert mse < mse_thresh def _hashes(self): return { 'X_train': self.X_train.std(), 'Y_train': self.Y_train.std(), 'W_train': self.W_train.std(), 'X_test': self.X_test.std(), 'Y_test': self.Y_test.std(), 'W_test': self.W_test.std() } # ================================================================ ECG def _load_x_y_w_for_ar_model(data, window_len=4, verbose=1, N_train=-1, # estimator='minlog'): estimator='ridge'): # # TODO rm after debug # print("initial data shape: ", data.shape) # new_data = np.zeros((len(data), 4), dtype=data.dtype) # new_data[:, :3] = data # new_data[:, 3] = np.random.randn(len(data)) * np.std(data) * .01 + np.mean(data) # data = new_data data = data[1:] - data[:-1] # predict 1st derivatives so nontrivial windows = window.sliding_window( data, ws=(window_len, data.shape[1]), ss=(1, 1)) X = windows.reshape(windows.shape[0], -1)[:-1] Y = data[window_len:] # TODO rm # Y[1:] = Y[1:] - Y[:-1] # predict differences, not raw values N = len(X) if N_train < data.shape[1]: N_train = N // 2 # TODO more flexible train/test split # N_test = N - N_train X_train, Y_train = X[:N_train], Y[:N_train] X_test, Y_test = X[N_train:], Y[N_train:] # fit the autoregressive model (just a filter) # est = linear_model.LinearRegression(fit_intercept=False) if estimator == 'ridge': est = linear_model.Ridge( # alpha=.01*len(Y_train)*np.var(data), fit_intercept=False) # alpha=(.01 * np.var(data)), fit_intercept=False) alpha=(.1 * np.var(data)), fit_intercept=False) # est = linear_model.Lasso( # # alpha=.001*np.sum(np.abs(Y_train)), fit_intercept=False) # # alpha=1e-4*(Y_train * Y_train).sum(), fit_intercept=False) # alpha=(1e-2 * Y_train.var()), fit_intercept=False) est.fit(X_train, Y_train) W = est.coef_.T else: W = algo.linear_regression_log_loss(X_train, Y_train) if verbose > 0: # print("ts ar model: data.shape: ", data.shape) # print("ts ar model: windows.shape: ", windows.shape) print("ts ar model: X shape: ", X.shape) print("ts ar model: Y shape: ", Y.shape) try: print("train r^2:", est.score(X_train, Y_train)) print("test r^2:", est.score(X_test, Y_test)) except UnboundLocalError: # not using sklearn estimator pass diffs = Y[1:] - Y[:-1] # print("column variances of diffs", np.var(diffs, axis=0)) # print("column variances of Y", np.var(Y, axis=0)) # print("var(diffs), var(Y)", np.var(diffs), np.var(Y)) print("var(diffs) / var(Y)", np.var(diffs) / np.var(Y)) # print("coeffs: ") # for i in range(0, len(W), 10): # print(W[i:(i + 10)]) # Y_hat_train = est.predict(X_train) # Y_hat_test = est.predict(X_test) # print("Y_hat_train var / 1e3", np.var(Y_hat_train, axis=0) / 1e3) # print("Y_train var / 1e3", np.var(Y_train, axis=0) / 1e3) # print("Y_hat_test var / 1e3", np.var(Y_hat_test, axis=0) / 1e3) # print("Y_test var / 1e3", np.var(Y_test, axis=0) / 1e3) # import sys; sys.exit() # print(W.shape) # print(est.score(X, Y)) # Y_hat = est.predict(X) # diffs = Y - Y_hat # print("normalized mse: ", np.mean(diffs * diffs) / np.var(Y)) # Y_hat = X @ W # diffs = Y - Y_hat # print("normalized mse: ", np.mean(diffs * diffs) / np.var(Y)) # return X_test, Y_test, W # Y_hat = X @ W return MatmulTask(X_train=X_train, Y_train=Y_train, X_test=X_test, Y_test=Y_test, W_train=W) # def load_ecg_x_y_w_for_recording(recording, window_len=4): # return _load_x_y_w_for_ar_model(recording, window_len=window_len) # @_memory.cache # def load_ecg_recordings(limit_nhours=2): # generator = limit_nhours is not None and limit_nhours > 0 # return sharee.load_recordings( # limit_nhours=limit_nhours, generator=generator) # ------------------------------------------------ sharee # @_memory.cache() # caching is no faster than just recomputing with ridge # @_memory.cache() def load_sharee_x_y_w_for_recording_id(rec_id, window_len=4, limit_nhours=.5): rec = sharee.load_recording(rec_id, limit_nhours=limit_nhours) return _load_x_y_w_for_ar_model(rec, window_len=window_len) def load_sharee_tasks(window_len=4, validate=False, **kwargs): rec_ids = sharee.load_recording_ids() for i, rec_id in enumerate(rec_ids): task = load_sharee_x_y_w_for_recording_id( rec_id, window_len=window_len) # task.info = {'rec_id: ', rec_id} task.name = rec_id if validate: print("validating ecg task {}/{}...".format(i + 1, len(rec_ids))) task.validate(mse_thresh=.25) # normalized mse; >0 since lstsq yield task # ------------------------------------------------ incart # @_memory.cache() def load_incart_x_y_w_for_recording_id(rec_id, window_len=4, limit_nhours=1): rec = incart.load_recording(rec_id, limit_nhours=limit_nhours) return _load_x_y_w_for_ar_model(rec, window_len=window_len) def load_incart_tasks(window_len=4, validate=False, **kwargs): rec_ids = incart.load_recording_ids() for i, rec_id in enumerate(rec_ids): task = load_incart_x_y_w_for_recording_id( rec_id, window_len=window_len) task.name = rec_id if validate: print("validating ecg task {}/{}...".format(i + 1, len(rec_ids))) task.validate(mse_thresh=.25) # normalized mse; >0 since lstsq yield task # ------------------------------------------------ wrapper def load_ecg_x_y_w_for_recording_id(*args, **kwargs): return load_incart_x_y_w_for_recording_id(*args, **kwargs) def load_ecg_tasks(*args, **kwargs): return load_incart_tasks(*args, **kwargs) # ================================================================ caltech # def load_caltech_imgs(ntrain_classes=50, limit_per_class=10): # # imgs = caltech.load_caltech101(resample=None, crop=None) # (imgs, y), label2name = caltech.load_caltech101( # limit_per_class=limit_per_class) # # print(len(imgs)) # # print(sum([img.size for img in imgs])) # # print("class counts: ", np.bincount(y)) # # split by class; more relaxed than assuming you have examples from # # the same dataset/class you're later going to apply your filter to # train_idxs = np.where(y < ntrain_classes)[0] # test_idxs = np.where(y >= ntrain_classes)[0] # imgs_train = [imgs[i] for i in train_idxs] # imgs_test = [imgs[i] for i in test_idxs] # return imgs_train, imgs_test @_memory.cache def load_caltech_img_ids(ntrain_classes=50, limit_per_class_train=10, limit_per_class_test=10, verbose=1): limit_per_class = max(limit_per_class_train, limit_per_class_test) (imgs, y), label2name = caltech.load_caltech101_ids( limit_per_class=limit_per_class) # split by class; more relaxed than assuming you have examples from # the same dataset/class you're later going to apply your filter to imgs_ids_train = [] imgs_ids_test = [] if verbose > 0: print("limiting ntrain per class to ", limit_per_class_train) print("limiting ntest per class to ", limit_per_class_test) # keep fewer idxs for train or test if requested if limit_per_class_train > 0: train_idxs = np.where(y < ntrain_classes)[0] if limit_per_class_train < limit_per_class: y_train = y[train_idxs] keep_idxs = [] for c in np.unique(y_train): c_idxs = np.where(y_train == c)[0][:limit_per_class_train] keep_idxs += list(c_idxs) train_idxs = train_idxs[np.array(keep_idxs)] imgs_ids_train = [imgs[i] for i in train_idxs] if limit_per_class_test > 0: test_idxs = np.where(y >= ntrain_classes)[0] if limit_per_class_test < limit_per_class: y_test = y[test_idxs] keep_idxs = [] for c in np.unique(y_test): c_idxs = np.where(y_test == c)[0][:limit_per_class_test] keep_idxs += list(c_idxs) test_idxs = test_idxs[np.array(keep_idxs)] imgs_ids_test = [imgs[i] for i in test_idxs] return imgs_ids_train, imgs_ids_test def _load_dummy_caltech_filter_3x3(order='hwc'): filt = [[-1, 2, -1], [-1, 2, -1], [-1, 2, -1]] if order == 'hwc': filt = np.array(filt)[..., np.newaxis] filt = np.tile(filt, (1, 1, 3)) else: assert order == 'chw' filt = np.array(filt)[np.newaxis, ...] filt = np.tile(filt, (3, 1, 1)) return filt def _lift_grayscale_filt_to_rgb(filt, order='hwc'): if order == 'hwc': filt = np.array(filt)[..., np.newaxis] filt = np.tile(filt, (1, 1, 3)) else: assert order == 'chw' filt = np.array(filt)[np.newaxis, ...] filt = np.tile(filt, (3, 1, 1)) return filt def _lift_vert_filter_to_rgb_pair(filt_v, order='hwc'): filt_v = np.array(filt_v) filt_h = np.ascontiguousarray(filt_v.T) filt_v = _lift_grayscale_filt_to_rgb(filt_v, order=order) filt_h = _lift_grayscale_filt_to_rgb(filt_h, order=order) return filt_v, filt_h def load_filters_sobel_3x3(order='hwc'): filt_v = [[-1, 0, 1], [-2, 0, 2], [-1, 0, 1]] filt_v = np.array(filt_v, dtype=np.float32) / 2. return _lift_vert_filter_to_rgb_pair(filt_v, order=order) def load_filters_sobel_5x5(order='hwc'): filt_v = [[-5, -4, 0, 4, 5], [-8, -10, 0, 10, 8], [-10, 20, 0, 20, 10], [-8, -10, 0, 10, 8], [-5, -4, 0, 4, 5]] filt_v = np.array(filt_v, dtype=np.float32) / 20. return _lift_vert_filter_to_rgb_pair(filt_v) def load_filters_gaussian_3x3(order='hwc'): x = np.array([1, 2, 1]) filt = (np.outer(x, x) / 16.).astype(np.float32) return [_lift_grayscale_filt_to_rgb(filt, order=order)] def load_filters_gaussian_5x5(order='hwc'): x = np.array([1, 4, 6, 4, 1]) filt = (np.outer(x, x) / 256.).astype(np.float32) return [_lift_grayscale_filt_to_rgb(filt, order=order)] def load_filters_sharpen_5x5(order='hwc'): # from https://en.wikipedia.org/wiki/Kernel_(image_processing) x = np.array([1, 4, 6, 4, 1]) x = np.outer(x, x) x[2, 2] = -476 filt = (x / -256.).astype(np.float32) return [_lift_grayscale_filt_to_rgb(filt, order=order)] def load_filters_gaussian( order='hwc', shape=(5, 5), sigmas=(1, 2)): filts = [] for sigma in sigmas: filt = np.zeros(shape, dtype=np.float32) coeff = 1. / (sigma * np.sqrt(2 * np.pi)) scale = 1. / (2 * sigma * sigma) i0 = int(shape[0] - 1) // 2 j0 = int(shape[1] - 1) // 2 for i in range(shape[0]): for j in range(shape[1]): dist_sq = (i - i0)**2 + (j - j0)**2 filt[i, j] = np.exp(-dist_sq * scale) filt *= coeff filts.append(filt) return [_lift_grayscale_filt_to_rgb(filt, order=order) for filt in filts] def _filters_list_to_mat(filters): filters_flat = [filt.ravel() for filt in filters] return np.vstack(filters_flat).T def caltech_x_y_for_img(img, filt_spatial_shape, filters_list=None, W=None, strides=(1, 1), order='chw'): # extract and flatten windows into rows of X matrix if order == 'hwc': windows = window.extract_conv2d_windows( img, filt_shape=filt_spatial_shape, strides=strides) filt_sz = img.shape[-1] * np.prod(filt_spatial_shape) X = windows.reshape(-1, filt_sz) else: assert order == 'chw' assert img.shape[2] == 3 # assumes img in hwc order X_subs_list = [] filt_spatial_sz = np.prod(filt_spatial_shape) for c in range(3): windows = window.extract_conv2d_windows( img[:, :, c][..., np.newaxis], filt_shape=filt_spatial_shape, strides=strides) X_subs_list.append(windows.reshape(-1, filt_spatial_sz)) X = np.hstack(X_subs_list) assert X.max() <= 255 assert X.min() >= 0 W = _filters_list_to_mat(filters_list) if W is None else W return X, X @ W @_memory.cache # cache raw images to avoid IO, but dynamically produce windows def _load_caltech_train_imgs(limit_per_class=10): train_ids, _ = load_caltech_img_ids( limit_per_class_train=limit_per_class, limit_per_class_test=0) imgs = [caltech.load_caltech_img(img_id) for img_id in train_ids] return imgs, train_ids @_memory.cache # cache raw images to avoid IO, but dynamically produce windows def _load_caltech_test_imgs(limit_per_class=10): _, test_ids = load_caltech_img_ids( limit_per_class_train=0, limit_per_class_test=limit_per_class) imgs = [caltech.load_caltech_img(img_id) for img_id in test_ids] return imgs, test_ids # def _load_caltech_train(filters, filt_spatial_shape): # def _load_caltech_train(W, filt_spatial_shape, strides=(3, 3)): # def _load_caltech_train(W, filt_spatial_shape, strides=(1, 1), order='chw', def _load_caltech_train(W, filt_spatial_shape, strides=(2, 2), order='chw', limit_ntrain=-1, limit_per_class=10): train_imgs, _ = _load_caltech_train_imgs(limit_per_class=limit_per_class) # # uncomment to plot imgs to make sure this is working # # which_idxs = np.random.randint(len(train_imgs), size=16) # # imgs = [train_imgs[i] for i in which_idxs] # import matplotlib.pyplot as plt # _, axes = plt.subplots(4, 4, figsize=(9, 9)) # for i, idx in enumerate(which_idxs): # axes.ravel()[i].imshow(train_imgs[idx]) # plt.show() train_mats = [caltech_x_y_for_img(img, W=W, strides=strides, order=order, filt_spatial_shape=filt_spatial_shape) for img in train_imgs] Xs, Ys = list(zip(*train_mats)) X_train = np.vstack(Xs) Y_train = np.vstack(Ys) if limit_ntrain is not None and limit_ntrain > 0: limit_ntrain = int(limit_ntrain) # X_train = X_train[:limit_ntrain] # Y_train = Y_train[:limit_ntrain] X_train = X_train[-limit_ntrain:] Y_train = Y_train[-limit_ntrain:] print("caltech training shape: ", X_train.shape, Y_train.shape) return X_train, Y_train def load_caltech_tasks(order='chw', limit_ntrain=-1, limit_ntest=-1, validate=False, filt='sobel', limit_per_class_train=1, limit_per_class_test=10): if filt == 'sobel': filters = load_filters_sobel_3x3(order=order) # filt_spatial_shape = (3, 3) elif filt == 'gauss3x3': filters = load_filters_gaussian_3x3(order=order) # filt_spatial_shape = (3, 3) elif filt == 'gauss5x5': filters = load_filters_gaussian_5x5(order=order) # filt_spatial_shape = (5, 5) elif filt == 'sharpen5x5': filters = load_filters_sharpen_5x5(order=order) # filt_spatial_shape = (5, 5) else: assert filt == 'dog5x5' filters = load_filters_gaussian(order=order, shape=(5, 5)) # filt_spatial_shape = (5, 5) if order == 'chw': filt_spatial_shape = filters[0].shape[-2:] else: assert order == 'hwc' filt_spatial_shape = filters[0].shape[:2] W = _filters_list_to_mat(filters) X_train, Y_train = _load_caltech_train( W=W, filt_spatial_shape=filt_spatial_shape, order=order, limit_ntrain=limit_ntrain, limit_per_class=limit_per_class_train) test_imgs, test_ids = _load_caltech_test_imgs( limit_per_class=limit_per_class_test) # print("caltech tasks stats:") # print("X train shape: ", X_train.shape) # print("X train nbytes: ", X_train.nbytes) # print("Y train shape: ", Y_train.shape) # print("Y train nbytes: ", Y_train.nbytes) # # print("type(test_imgs)", type(test_imgs)) # print("len(test_imgs)", len(test_imgs)) # _, test_ids = load_caltech_img_ids(limit_per_class) # for i, _ in enumerate(test_imgs): for i, img in enumerate(test_imgs): # if i < 2: # TODO rm after debug # continue # img = img1.copy() if i % 2 else img0.copy() # img = img1 X_test, Y_test = caltech_x_y_for_img( img, filt_spatial_shape=filt_spatial_shape, W=W, order=order) name = f'Caltech {i} ({os.path.dirname(test_ids[i]).split("/")[-1]})' task = MatmulTask(X_train=X_train, Y_train=Y_train, W_train=W, X_test=X_test, Y_test=Y_test, W_test=W, name=name) task.info['problem'] = filt # print(f"task {task.name} matrix hashes:") # import pprint # pprint.pprint(task.hashes()) if limit_ntest is not None and limit_ntest > 0: limit_ntest = int(limit_ntest) task.X_test = task.X_test[:limit_ntest] task.Y_test = task.Y_test[:limit_ntest] # task.info = {'task_id: ', i} # task.name = str(i) if validate: print("validating caltech task {}/{}...".format( i + 1, len(test_imgs))) print("X_train.std()", X_train.std()) print("Y_train.std()", Y_train.std()) print("X_test.std()", X_test.std()) print("Y_test.std()", Y_test.std()) task.validate() # print("about to yield task with name: ", task.name) yield task # print("exiting at load_caltech_tasks()") # import sys; sys.exit() def test_caltech_loading(): imgs_train, imgs_test = _load_caltech_test_imgs() filt = _load_dummy_caltech_filter_3x3() imgs = imgs_train print("imgs[0].shape", imgs[0].shape) print("filt shape: ", filt.shape) X, Y = caltech_x_y_for_img(imgs[0], filt) print("X shape: ", X.shape) print("Y shape: ", Y.shape) # yep, looks like these are equivalent flat_filt = filt.ravel() Y_hat = X @ flat_filt diffs = Y - Y_hat mse = np.sum(diffs * diffs) / np.var(Y) print("mse: ", mse) assert mse < 1e-10 # ================================================================ cifar def load_cifar10_tasks(): SOFTMAX_INPUTS_TRAIN_PATH = 'cifar10_softmax_inputs_train.npy' SOFTMAX_OUTPUTS_TRAIN_PATH = 'cifar10_softmax_outputs_train.npy' SOFTMAX_INPUTS_TEST_PATH = 'cifar10_softmax_inputs_test.npy' SOFTMAX_OUTPUTS_TEST_PATH = 'cifar10_softmax_outputs_test.npy' SOFTMAX_W_PATH = 'cifar10_softmax_W.npy' SOFTMAX_B_PATH = 'cifar10_softmax_b.npy' LABELS_TRAIN_PATH = 'cifar10_labels_train.npy' LABELS_TEST_PATH = 'cifar10_labels_test.npy' def load_mat(fname): fpath = os.path.join(CIFAR10_DIR, fname) return np.load(fpath) X_train = load_mat(SOFTMAX_INPUTS_TRAIN_PATH) Y_train = load_mat(SOFTMAX_OUTPUTS_TRAIN_PATH) X_test = load_mat(SOFTMAX_INPUTS_TEST_PATH) Y_test = load_mat(SOFTMAX_OUTPUTS_TEST_PATH) W = load_mat(SOFTMAX_W_PATH) b = load_mat(SOFTMAX_B_PATH) lbls_train = load_mat(LABELS_TRAIN_PATH).ravel() lbls_test = load_mat(LABELS_TEST_PATH).ravel() # we aren't going to store or approximate the biases, so just subtract # off their contributions at the start Y_train -= b Y_test -= b # # TODO rm all this after debug # logits_test = Y_test + b # print("logits_test.shape", logits_test.shape) # print("lbls_test.shape", lbls_test.shape) # lbls_hat_test = np.argmax(Y_test, axis=1) # print("lbls_hat_test.shape", lbls_hat_test.shape) # acc = np.mean(lbls_hat_test.ravel() == lbls_test.ravel()) # print("Y_test: ", Y_test[:10]) # print("Y_train head: ", Y_train[:10]) # print("Y_train tail: ", Y_train[-10:]) # print("b:\n", b) # # print("lbls hat test:") # # print(lbls_hat_test[:100]) # # print("lbls test:") # # print(lbls_test[:100]) # print("lbls train:") # print(lbls_train[:100]) # print("acc: ", acc) info = {'problem': 'softmax', 'biases': b, 'lbls_train': lbls_train, 'lbls_test': lbls_test} return [MatmulTask(X_train, Y_train, X_test, Y_test, W, name='CIFAR-10 Softmax', info=info)] def load_cifar100_tasks(): SOFTMAX_INPUTS_TRAIN_PATH = 'cifar100_softmax_inputs_train.npy' SOFTMAX_OUTPUTS_TRAIN_PATH = 'cifar100_softmax_outputs_train.npy' SOFTMAX_INPUTS_TEST_PATH = 'cifar100_softmax_inputs_test.npy' SOFTMAX_OUTPUTS_TEST_PATH = 'cifar100_softmax_outputs_test.npy' SOFTMAX_W_PATH = 'cifar100_softmax_W.npy' SOFTMAX_B_PATH = 'cifar100_softmax_b.npy' LABELS_TRAIN_PATH = 'cifar100_labels_train.npy' LABELS_TEST_PATH = 'cifar100_labels_test.npy' def load_mat(fname): fpath = os.path.join(CIFAR100_DIR, fname) return np.load(fpath) X_train = load_mat(SOFTMAX_INPUTS_TRAIN_PATH) Y_train = load_mat(SOFTMAX_OUTPUTS_TRAIN_PATH) X_test = load_mat(SOFTMAX_INPUTS_TEST_PATH) Y_test = load_mat(SOFTMAX_OUTPUTS_TEST_PATH) W = load_mat(SOFTMAX_W_PATH) b = load_mat(SOFTMAX_B_PATH) lbls_train = load_mat(LABELS_TRAIN_PATH).ravel() lbls_test = load_mat(LABELS_TEST_PATH).ravel() # we aren't going to store or approximate the biases, so just subtract # off their contributions at the start Y_train -= b Y_test -= b # # TODO rm all this after debug # logits_test = Y_test + b # print("logits_test.shape", logits_test.shape) # print("lbls_test.shape", lbls_test.shape) # lbls_hat_test = np.argmax(Y_test, axis=1) # print("lbls_hat_test.shape", lbls_hat_test.shape) # acc = np.mean(lbls_hat_test.ravel() == lbls_test.ravel()) # print("Y_test: ", Y_test[:10]) # print("Y_train head: ", Y_train[:10]) # print("Y_train tail: ", Y_train[-10:]) # print("b:\n", b) # # print("lbls hat test:") # # print(lbls_hat_test[:100]) # # print("lbls test:") # # print(lbls_test[:100]) # print("lbls train:") # print(lbls_train[:100].ravel()) # print("acc: ", acc) info = {'problem': 'softmax', 'biases': b, 'lbls_train': lbls_train, 'lbls_test': lbls_test} return [MatmulTask(X_train, Y_train, X_test, Y_test, W, name='CIFAR-100 Softmax', info=info)] def load_cifar_tasks(): return load_cifar10_tasks() + load_cifar100_tasks() # ================================================================ ucr def _learn_neighbor_compression_W_info(X, lbls, k): centroids, lbls_centroids = algo.stochastic_neighbor_compression( X, lbls, k) extra_info = {'lbls_centroids': lbls_centroids} return centroids.T, extra_info def _learn_softmax_W_info(X, lbls): est = linear_model.LogisticRegression( # raise max iters from 100 to avoid convergence messages fit_intercept=False, solver='lbfgs', max_iter=200) est.fit(X, lbls) nclasses, _ = est.coef_.shape return est.coef_.T, {'biases': np.zeros_like(nclasses, dtype=np.float32)} @_memory.cache def _load_ucr_task_for_dset( dset_name, D=320, k=128, min_train_sz=-1, use_test_sz=-1, problem='rbf', verbose=1): dset = ucr.UCRDataset(dset_name) if min_train_sz is None or min_train_sz < k: min_train_sz = k if use_test_sz is None or use_test_sz < 1: use_test_sz = len(dset.X_test) if verbose > 0: print(f"----- loading task for UCR dataset: {dset.name}") nclasses = len(np.unique(dset.y_test)) ntrain = len(dset.X_train) ntest = len(dset.X_test) if nclasses > k: if verbose > 0: print(f"returning None because " + f"nclasses={nclasses} > k={k}") return None # some class will have no centroids if ntrain < min_train_sz: if verbose > 0: print(f"returning None because " + f"num_train={ntrain} < min_train_sz={min_train_sz}") return None if ntest < use_test_sz: if verbose > 0: print(f"returning None because " + f"num_test={ntest} < min_test_sz={use_test_sz}") return None X_train = dset.X_train X_test = dset.X_test[:use_test_sz] dset.y_test = dset.y_test[:use_test_sz] X_train = signal.resample(X_train, D, axis=1).astype(np.float32) X_test = signal.resample(X_test, D, axis=1).astype(np.float32) info = {'problem': problem, 'lbls_train': dset.y_train, 'lbls_test': dset.y_test} if problem in ('1nn', 'rbf'): print(f"compressing training set for dset: {dset.name}") W, extra_info = _learn_neighbor_compression_W_info( X_train, dset.y_train, k) elif problem == 'softmax': W, extra_info = _learn_softmax_W_info( X_train, dset.y_train) else: raise ValueError(f"Unrecognized problem '{problem}'") Y_train = X_train @ W Y_test = X_test @ W info.update(extra_info) return [MatmulTask(X_train, Y_train, X_test, Y_test, W, name=f'ucr {dset.name} k={k}', info=info)] def load_ucr_tasks(limit_ntasks=-1, k=128, **kwargs): all_tasks = [] df = ucr.load_ucr_dset_stats() name2acc = dict(zip(df['Name'], df['l2-1nn-acc'])) for dset_name in ucr.all_ucr_dataset_dirs(): orig_acc = name2acc[os.path.basename(dset_name)] tasks = _load_ucr_task_for_dset(dset_name, k=k, **kwargs) if tasks is not None: for task in tasks: task.info['acc-1nn-raw'] = orig_acc all_tasks += tasks # else: # print("got None instead of tasks for dset: ", dset_name) if ((limit_ntasks is not None) and (limit_ntasks > 0) and (len(all_tasks) >= limit_ntasks)): all_tasks = all_tasks[:limit_ntasks] break return all_tasks # ================================================================ main def test_caltech_tasks(): for _ in load_caltech_tasks(validate=True): pass # need to loop thru since it's a generator def test_ecg_tasks(): # for _ in load_ecg_tasks(validate=True): for i, _ in enumerate(load_ecg_tasks(validate=False)): print("loaded ecg task {}/{}".format(i + 1, sharee.NUM_RECORDINGS)) def test_cifar_tasks(): task = load_cifar10_tasks()[0] print(task) task.validate() task = load_cifar100_tasks()[0] print(task) task.validate() def main(): np.set_printoptions(formatter={'float': lambda f: "{:.3}".format(f)}) train_ids, test_ids = load_caltech_img_ids() print("number of uniq train ids: ", len(np.unique(train_ids))) print("number of uniq test ids: ", len(np.unique(test_ids))) for i, task in enumerate(load_caltech_tasks(validate=True)): pass # test_caltech_tasks() # test_cifar_tasks() # test_ecg_tasks() # load_cifar10_tasks() # load_cifar100_tasks() # print("number of ucr dirs:", len(list(ucr.all_ucr_dataset_dirs()))) # tasks = load_ucr_tasks() # print("number of tasks meeting basic size criteria:", len(tasks)) # print("number of caltech imgs: ", len(_load_caltech_test_imgs())) if __name__ == '__main__': main()
bolt-master
experiments/python/matmul_datasets.py
#!/bin/env python import numpy as np import matplotlib.pyplot as plt def main(): UNDEFINED = 7 M = 40000 # M = 500 # M = 2 # K = 16 # C = 64 try_Cs = np.array([2, 4, 8, 16, 32, 64, 128]) try_Us = np.array([2, 4, 8, 16, 32, 64, 128]) biases = np.zeros((try_Cs.size, try_Us.size)) + UNDEFINED # sses = np.zeros((try_Cs.size, try_Us.size)) + UNDEFINED dists_true = np.zeros((try_Cs.size, try_Us.size, M)) dists_hat = np.zeros((try_Cs.size, try_Us.size, M)) all_errs = np.zeros((try_Cs.size, try_Us.size, M)) for i, C in enumerate(try_Cs): for j, upcast_every in enumerate(try_Us): if upcast_every > C: continue # dists = np.random.randint(256, size=(M * K, C)) orig_dists = np.random.randint(256, size=(M, C)) # print("orig_dists[:10]", orig_dists[:10]) # ya, these are sane dists = orig_dists.reshape(orig_dists.shape[0], -1, upcast_every) while dists.shape[-1] > 2: # print("dists shape: ", dists.shape) # print("dists:\n", dists) dists = (dists[:, :, ::2] + dists[:, :, 1::2] + 1) // 2 # print("dists shape: ", dists.shape) dists = (dists[:, :, 0] + dists[:, :, 1] + 1) // 2 dists = dists.sum(axis=-1) # clipping not needed dists *= upcast_every true_dists = orig_dists.sum(axis=1) errs = dists - true_dists # biases[i, j] = diffs.mean() biases[i, j] = errs.mean() # store true dists so we can compute variance of estimator # dists_true[i, j] = true_dists # dists_hat[i, j] = dists all_errs[i, j] = errs # debias = # sses[i, j] = diffs # diffs = true_dists - dists # print(f"C = {C}, upcast_every={upcast_every}") # print("mean true dist: ", true_dists.mean()) # print("mean diff:", diffs.mean()) print("biases:\n", biases) # col = try_Cs / 4 # row = np.log2(try_Us).astype(np.int) # biases_hat = np.outer(col, row) # print("biases_hat:\n", biases_hat) # biases_hat2 = np.zeros((try_Cs.size, try_Us.size)) - UNDEFINED biases_hat2 = np.zeros((try_Cs.size, try_Us.size)) for i, C in enumerate(try_Cs): for j, upcast_every in enumerate(try_Us): if upcast_every > C: continue biases_hat2[i, j] = C / 4 * np.log2(upcast_every) print("biases_hat2:\n", biases_hat2) print("corrected biases:\n", biases - biases_hat2) all_errs -= biases_hat2[..., np.newaxis] # print("mean corrected errs:\n", all_errs.mean(axis=-1)) print("mean corrected errs:\n", np.var(all_errs, axis=-1)) sq_errs = (all_errs * all_errs).mean(axis=-1) print("empirical mean squared err for C, U", sq_errs) sq_errs_hat = np.zeros((try_Cs.size, try_Us.size)) for i, C in enumerate(try_Cs): for j, upcast_every in enumerate(try_Us): if upcast_every > C: continue sq_errs_hat[i, j] = C / 8 * np.log2(upcast_every) print("estimated mean squared err for C, U", sq_errs_hat) print("takeaway: no idea what closed form for mse is...") # print("biases - biases_hat", biases - biases_hat) # plt.scatter(true_dists, dists) # plt.show() if __name__ == '__main__': np.set_printoptions(formatter={'float': lambda f: "{:5.1f}".format(f)}, linewidth=100) main()
bolt-master
experiments/python/debias_scratch.py
#!/bin/env/python import os import shutil def ls(dir='.'): return os.listdir(dir) def is_hidden(path): return os.path.basename(path).startswith('.') def is_visible(path): return not is_hidden(path) def join_paths(dir, contents): return [os.path.join(dir, f) for f in contents] def files_matching(dir, prefix=None, suffix=None, abs_paths=False, only_files=False, only_dirs=False, recursive=False, only_visible=False, only_hidden=False): files = os.listdir(dir) if recursive: abs_dir = dir paths = join_paths(abs_dir, files) for path in paths: if not os.path.isdir(path): continue matches = files_matching( path, prefix=prefix, suffix=suffix, abs_paths=abs_paths, only_files=only_files, only_dirs=only_dirs, recursive=True) matches = join_paths(path, matches) matches = [os.path.relpath(m, start=dir) for m in matches] files += matches if prefix: files = [f for f in files if f.startswith(prefix)] if suffix: files = [f for f in files if f.endswith(suffix)] if only_files or only_dirs: paths = join_paths(dir, files) if only_files: files = [f for f, p in zip(files, paths) if os.path.isfile(p)] if only_dirs: files = [f for f, p in zip(files, paths) if os.path.isdir(p)] if abs_paths: files = join_paths(os.path.abspath(dir), files) if only_visible: files = [f for f in files if is_visible(f)] if only_hidden: files = [f for f in files if is_hidden(f)] return sorted(files) def list_subdirs(dir, startswith=None, endswith=None, abs_paths=False, recursive=False): return files_matching(dir, startswith, endswith, abs_paths, only_dirs=True, recursive=recursive) def list_files(dir, startswith=None, endswith=None, abs_paths=False, recursive=False): return files_matching(dir, startswith, endswith, abs_paths, only_files=True, recursive=recursive) def list_hidden_files(dir, startswith=None, endswith=None, abs_paths=False, recursive=False): return files_matching(dir, startswith, endswith, abs_paths, only_files=True, recursive=recursive, only_hidden=True) def list_visible_files(dir, startswith=None, endswith=None, abs_paths=False, recursive=False): return files_matching(dir, startswith, endswith, abs_paths, only_files=True, recursive=recursive, only_visible=True) def remove(path): if os.path.exists(path): try: os.remove(path) except (OSError): shutil.rmtree(path) def force_create_dir(dir): if os.path.exists(dir): remove(dir) os.makedirs(dir) def ensure_dir_exists(dir_or_file): if '.' in os.path.basename(dir_or_file): # this looks like a file dirname = os.path.dirname(dir_or_file) else: dirname = dir_or_file if not os.path.exists(dirname): os.makedirs(dirname) def basename(f, noext=False): name = os.path.basename(f) if noext: name = name.split('.')[0] return name
bolt-master
experiments/python/files.py
import os import matplotlib import matplotlib.pyplot as plt import numpy as np import pandas as pd import seaborn as sb import results from files import ensure_dir_exists # CAMERA_READY_FONT = 'Calibri' CAMERA_READY_FONT = 'DejaVu Sans' SAVE_DIR = os.path.expanduser('~/Desktop/bolt/figs/') ensure_dir_exists(SAVE_DIR) def save_fig(name): plt.savefig(os.path.join(SAVE_DIR, name + '.pdf'), bbox_inches='tight') def save_fig_png(name): plt.savefig(os.path.join(SAVE_DIR, name + '.png'), dpi=300, bbox_inches='tight') def set_palette(ncolors=8): # use this to change color palette in all plots pal = sb.color_palette("Set1", n_colors=ncolors) sb.set_palette(pal) return pal def set_xlabels_bold(ax, which_lbl_idxs, rotation=0): xlabels = list(ax.get_xticklabels()) for idx in which_lbl_idxs: xlabels[idx].set_weight('bold') ax.set_xticklabels(xlabels, rotation=rotation) def popcount_fig(fake_data=False): # sb.set_context("poster", rc={"figure.figsize": (8, 4)}) sb.set_context("talk") set_palette(ncolors=2) _, ax = plt.subplots(1, figsize=(6, 4)) # fake_data = data is None if fake_data: # for prototyping / debugging this func bolt_128d_8b = np.random.randn(10) + 12 bolt_128d_16b = np.random.randn(10) + 6 bolt_128d_32b = np.random.randn(10) + 3 popcnt_128d_8b = np.random.randn(10) + 10 popcnt_128d_16b = np.random.randn(10) + 5 popcnt_128d_32b = np.random.randn(10) + 2 dicts = [] dicts += [{'algo': 'Bolt', 'nbytes': '8B', 't': t} for t in bolt_128d_8b] dicts += [{'algo': 'Bolt', 'nbytes': '16B', 't': t} for t in bolt_128d_16b] dicts += [{'algo': 'Bolt', 'nbytes': '32B', 't': t} for t in bolt_128d_32b] dicts += [{'algo': 'Binary Embedding', 'nbytes': '8B', 't': t} for t in popcnt_128d_8b] dicts += [{'algo': 'Binary Embedding', 'nbytes': '16B', 't': t} for t in popcnt_128d_16b] dicts += [{'algo': 'Binary Embedding', 'nbytes': '32B', 't': t} for t in popcnt_128d_32b] df = pd.DataFrame.from_records(dicts) else: df = results.popcount_results() print("df cols: ", df.columns) # df.rename(columns={'algo': 'Algorithm'}, inplace=True) df.rename(columns={'algo': ' '}, inplace=True) # hide from legend sb.barplot(x='nbytes', y='t', hue=' ', ci=95, data=df, ax=ax) ax.set_title('Distance Computations Per Second') ax.set_xlabel('Encoding Length (Bytes)') ax.set_ylabel('Millions of distances / sec') plt.tight_layout() save_fig('popcount_speed') # plt.show() def encoding_fig(fake_data=False, camera_ready=False): sb.set_style('darkgrid') # sb.set_context("talk", rc={"figure.figsize": (6, 6)}) sb.set_context("talk", rc={"figure.figsize": (7, 7)}) # sb.set_context("talk", rc={"figure.figsize": (8, 8)}) # sb.set_context("talk", rc={"figure.figsize": (9, 9)}) # fig, axes = plt.subplots(3, 1) fig, axes = plt.subplots(3, 2) # ALGOS = ['Bolt', 'PQ', 'OPQ', 'PairQ'] ALGOS = ['Bolt', 'PQ', 'OPQ'] algo2offset = {'Bolt': 100, 'PQ': 50, 'OPQ': 30, 'PairQ': 25} lengths = [64, 128, 256, 512, 1024] # results_for_algos_lengths = # sb.set_palette("Set1", n_colors=len(ALGOS)) set_palette(ncolors=len(ALGOS)) if fake_data: data = np.random.randn(1, len(lengths), len(algo2offset)) for i, algo in enumerate(ALGOS): data[:, :, i] += algo2offset[algo] data /= np.arange(len(lengths)).reshape((1, -1, 1)) # ------------------------ data encoding # 8B encodings ax = axes[0, 0] # sb.tsplot(data=data, condition=condition, time=lengths, ax=ax) sb.tsplot(data=data, condition=None, time=lengths, ax=ax) # ax.set_title(prefix + ' Encoding Speed, 8B codes') ax.set_title('Data Encoding Speed', y=1.02) # 16B encodings data /= 2 ax = axes[1, 0] sb.tsplot(data=data, condition=None, time=lengths, ax=ax) # 32B encodings data /= 2 ax = axes[2, 0] sb.tsplot(data=data, condition=None, time=lengths, ax=ax) # ------------------------ query encoding data *= 8 data += np.random.randn(*data.shape) * 5 # 8B encodings ax = axes[0, 1] sb.tsplot(data=data, condition=None, time=lengths, ax=ax) # ax.set_title(prefix + ' Encoding Speed') ax.set_title('Query Encoding Speed', y=1.03, fontsize=16) # 16B encodings data /= 2 ax = axes[1, 1] sb.tsplot(data=data, condition=None, time=lengths, ax=ax) # 32B encodings data /= 2 ax = axes[2, 1] sb.tsplot(data=data, condition=ALGOS, time=lengths, ax=ax) else: # real data NBYTES_LIST = [8, 16, 32] df = results.encode_results() df_x = df[df['task'] == 'encode_x'] df_q = df[df['task'] == 'encode_q'] dfs = [df_x, df_q] # print df_x # return # dfs = [results.encode_data_results(), results.encode_lut_results()] ax_cols = [axes[:, 0], axes[:, 1]] for df, ax_col in zip(dfs, ax_cols): # for each col in subplots for b, nbytes in enumerate(NBYTES_LIST): # for each row in subplots ax = ax_col[b] plot_df = df.loc[df['nbytes'] == nbytes] plot_df = plot_df.loc[plot_df['algo'].isin(ALGOS)] sb.tsplot(value='y', condition='algo', unit='trial', time='D', data=plot_df, ax=ax, ci=95, n_boot=500) # data=plot_df, ax=ax, legend=False, ci=95, n_boot=500) # ------------------------ legend ax = axes.ravel()[-1] leg_lines, leg_labels = ax.get_legend_handles_labels() # ax.legend_.remove() # leg_lines, leg_labels = leg_lines[:len(ALGOS)], leg_labels[:len(ALGOS)] plt.figlegend(leg_lines, leg_labels, loc='lower center', ncol=len(ALGOS), labelspacing=0) # ------------------------ postproc + save plot for ax in axes.ravel(): ax.set_yscale("log") ax.legend_.remove() ax.set_ylim(5e3, 2e7) if camera_ready: # axes[0, 0].set_title('Data Encoding Speed', x=.45, y=1.03, fontsize=16) # axes[0, 1].set_title('Query Encoding Speed', x=.45, y=1.03, fontsize=16) axes[0, 0].set_title('Data Encoding Speed', x=.49, y=1.03, fontsize=18) axes[0, 1].set_title('Query Encoding Speed', x=.5, y=1.03, fontsize=18) else: axes[0, 0].set_title('Data Encoding Speed', y=1.03, fontsize=16) axes[0, 1].set_title('Query Encoding Speed', y=1.03, fontsize=16) # for ax in axes[0, :].ravel(): # ax.set_title('Vector Length') for ax in axes[:-1, :].ravel(): # ax.xaxis.set_visible(False) plt.setp(ax.get_xticklabels(), visible=False) ax.set_xlabel('', labelpad=-10) for ax in axes[-1, :].ravel(): # ax.set_xlabel('Vector Length') ax.set_xlabel('Vector Length', labelpad=7) for ax in axes[:, 0]: if camera_ready: # ax.set_ylabel('Vectors Encoded / s ', fontsize=12) ax.set_ylabel('Vectors Encoded / s', fontsize=13) else: ax.set_ylabel('Vectors Encoded / s') # only bottom row gets xlabels for ax in axes[:-1, :].ravel(): # plt.setp(ax.get_xticklabels(), visible=False) ax.set_xlabel('', labelpad=-10) # show byte counts on the right fmt_str = "{}B Encodings" # if camera_ready: # fmt_str += ' ' for i, ax in enumerate(axes[:, 1].ravel()): ax.yaxis.set_label_position('right') ax.set_ylabel(fmt_str.format((2 ** i) * 8), labelpad=10, fontsize=15) plt.tight_layout() plt.subplots_adjust(bottom=.15) if camera_ready: save_fig_png('encoding_speed') # bypass mpl truetype pdf ineptitude else: save_fig('encoding_speed') # plt.show() # if data_enc: # save_fig('encoding_speed_data') # else: # save_fig('encoding_speed_query') # plt.show() def query_speed_fig(fake_data=False, fname='query_speed', with_matmuls=True, camera_ready=False): # experiment params: fixed N = 100k, D = 256, Q = 1024; # layout: rows = 8B, 16B, 32B; bar graph in each row # alternative: plot in each row vs batch size # algos: Bolt; PQ; OPQ; PairQ; Matmul, batch={1, 16, 64, 256} sb.set_context("talk") # sb.set_style("white") # adds border (spines) we have to remove sb.set_style("darkgrid") # if camera_ready: # white style overwrites our fonts # matplotlib.rcParams['font.family'] = CAMERA_READY_FONT set_palette(ncolors=8) # fig, axes = plt.subplots(3, 1, figsize=(6, 8)) fig, axes = plt.subplots(3, 1, figsize=(6, 8), dpi=300) if fake_data: # for debugging ALGOS = ['Bolt', 'PQ', 'OPQ', 'PairQ', # 'Matmul Batch 1', 'Matmul Batch 16', 'Matmul Batch 64', 'Matmul Batch 256'] # 'Matmul Batch1', 'Matmul Batch16', 'Matmul Batch64', 'Matmul Batch256'] 'Matmul 1', 'Matmul 16', 'Matmul 64', 'Matmul 256'] algo2offset = {'Bolt': 100, 'PQ': 50, 'OPQ': 30, 'PairQ': 25, # 'Matmul Batch 1': 1, 'Matmul Batch 16': 16, # 'Matmul Batch 64': 64, 'Matmul Batch 256': 256} # 'Matmul Batch1': 1, 'Matmul Batch16': 16, # 'Matmul Batch64': 64, 'Matmul Batch256': 256} 'Matmul 1': 1, 'Matmul 16': 16, 'Matmul 64': 64, 'Matmul 256': 256} for i, nbytes in enumerate([8, 16, 32]): bytes_str = '{}B'.format(nbytes) dicts = [] for algo in ALGOS: dps = np.random.randn(10) + 256 / nbytes dps += algo2offset[algo] / nbytes dicts += [{'algo': algo, 'nbytes': bytes_str, 'y': y} for y in dps] df = pd.DataFrame.from_records(dicts) else: # ALGOS = ['Bolt', 'PQ', 'OPQ', 'PairQ', 'Matmul 1', # 'Matmul 16', # 'Matmul 64', 'Matmul 256', 'Matmul 1024'] if with_matmuls: # ALGOS = ['Bolt', 'Binary Embedding', 'PQ', 'OPQ', ALGOS = ['Bolt', 'PQ', 'OPQ', 'Matmul 1024', 'Matmul 256', 'Matmul 1'] else: ALGOS = ['Bolt', 'Binary Embedding', 'PQ', 'OPQ'] df = results.query_speed_results() df['y'] = df['y'] / 1e9 # convert to billions print("df cols: ", df.columns) df.rename(columns={'algo': ' '}, inplace=True) # hide from legend # ax = sb.barplot(x='x', y='y', hue=' ', ci=95, data=df, ax=axes[i]) for i, nbytes in enumerate([8, 16, 32]): bytes_str = '{}B'.format(nbytes) data = df[df['nbytes'] == nbytes] ax = sb.barplot(x='nbytes', y='y', hue=' ', hue_order=ALGOS, ci=95, # data=data, ax=axes[i]) # data=data, ax=axes[i], errwidth=10) data=data, ax=axes[i], capsize=.0004) # data=data, ax=axes[i], capsize=.0004, errwidth=6) # ------------------------ clean up / format axes for ax in axes[:-1]: # remove x labels except for bottom axis plt.setp(ax.get_xticklabels(), visible=False) ax.get_xaxis().set_visible(False) end = .5 * (len(ALGOS) / float((len(ALGOS) + 2))) start = -end tick_positions = np.linspace(start + .02, end - .05, len(ALGOS)) if camera_ready: tick_positions[0] += .02 tick_positions[2] += .02 tick_positions[3] += .01 for ax in axes: ax.set_xlim([start - .02, end + .02]) if camera_ready: # ax.set_ylabel('Billions of\nDistances/s', y=.4, # ax.set_ylabel('Billions of\nDistances/s', y=.5, ax.set_ylabel('Billion\nDistances/s', y=.49, # .5 = centered ? family=CAMERA_READY_FONT) else: ax.set_ylabel('Billions of Distances/s') ax.legend_.remove() if not fake_data: ax.set_ylim(0, 2.5) # add byte counts on the right fmt_str = "{}B Encodings" for i, ax in enumerate(axes): ax2 = ax.twinx() sb.despine(ax=ax2, top=True, left=True, bottom=True, right=True) ax2.get_xaxis().set_visible(False) # ax2.get_yaxis().set_visible(False) # nope, removes ylabel plt.setp(ax2.get_xticklabels(), visible=False) plt.setp(ax2.get_yticklabels(), visible=False) ax2.yaxis.set_label_position('right') if camera_ready: # ax2.set_ylabel(fmt_str.format((2 ** i) * 8), y=.39, ax2.set_ylabel(fmt_str.format((2 ** i) * 8), labelpad=10, fontsize=14, family=CAMERA_READY_FONT) else: ax2.set_ylabel(fmt_str.format((2 ** i) * 8), labelpad=10, fontsize=15) # ------------------------ have bottom / top axes print title, x info if camera_ready: # axes[0].set_title('Distance Computations per Second', x=.39, y=1.02) # axes[0].set_title('Distance Computations per Second', x=.42, y=1.02, # family=CAMERA_READY_FONT) axes[0].set_title('Distance Computations per Second', y=1.02, family=CAMERA_READY_FONT, fontsize=15) else: axes[0].set_title('Distance Computations per Second', y=1.02) # axes[-1].set_xticks(tick_positions) for ax in axes: axes[-1].set_xticks(tick_positions) ax.set_xlim(-.4, .4) # no idea why this makes the bars fit right... xlabels = ["\n".join(name.split(' ')) for name in ALGOS] if not camera_ready: for i, lbl in enumerate(xlabels): if '\n' in lbl: # shift label up by adding another line xlabels[i] = xlabels[i] + '\n' # xlabels = ["\nBatch".join(name.split(' Batch')) for name in ALGOS] # xlabels = ALGOS axes[-1].set_xticklabels(xlabels, rotation=70) if camera_ready: # axes[-1].tick_params(axis='x', which='major', pad=15) # axes[-1].tick_params(axis='x', which='major', pad=13) axes[-1].tick_params(axis='x', which='major', pad=4) # axes[-1].set_xticklabels(xlabels, rotation=70, y=-.02) # else: # axes[-1].set_xticklabels(xlabels, rotation=70) # if camera_ready: # axes[-1].set_xlabel("", labelpad=10) # else: axes[-1].set_xlabel("", labelpad=-20) # plt.setp(axes[-1].get_xlabel(), visible=False) # doesn't work # ------------------------ show / save plot # plt.tight_layout() plt.tight_layout() if camera_ready: plt.subplots_adjust(hspace=.18) # save_fig(fname) # MPL conversion to pdf is selectively braindead for just this plot; it # lays things out horribly in a way that doesn't match the results # of show() at all. Just export as high-density png as a workaround # plt.savefig(os.path.join(SAVE_DIR, fname + '.png'), # dpi=300, bbox_inches='tight') save_fig_png(fname) # plt.show() def query_speed_poster_fig(fname='query_speed', with_matmuls=True, defense=True): # experiment params: fixed N = 100k, D = 256, Q = 1024; # layout: rows = 8B, 16B, 32B; bar graph in each row # alternative: plot in each row vs batch size # algos: Bolt; PQ; OPQ; PairQ; Matmul, batch={1, 16, 64, 256} sb.set_context("talk") # sb.set_style("whitegrid") sb.set_style("darkgrid") # if camera_ready: # white style overwrites our fonts # matplotlib.rcParams['font.family'] = CAMERA_READY_FONT set_palette(ncolors=8) # fig, axes = plt.subplots(3, 1, figsize=(6, 8)) # fig, axes = plt.subplots(3, 1, figsize=(6, 8), dpi=300) # fig, axes = plt.subplots(2, 1, figsize=(6, 6), dpi=300) if defense: fig, axes = plt.subplots(2, 1, figsize=(6, 8), dpi=300) else: fig, axes = plt.subplots(2, 1, figsize=(4, 6), dpi=300) # ALGOS = ['Bolt', 'PQ', 'OPQ', 'PairQ', 'Matmul 1', # 'Matmul 16', # 'Matmul 64', 'Matmul 256', 'Matmul 1024'] if with_matmuls: # ALGOS = ['Ours', 'Binary Embedding', 'PQ', 'OPQ', # 'Matmul Batch=1024', 'Matmul Batch=256', 'Matmul Batch=1'] # ALGOS = ['Ours', 'Matmul Batch=1024', 'Matmul Batch=256', 'Matmul Batch=1'] if defense: ALGOS = ['Ours', 'PQ', 'OPQ', 'Matmul Batch=1024', 'Matmul Batch=256', 'Matmul Batch=1'] else: ALGOS = ['Ours', 'Matmul Batch=1024', 'Matmul Batch=256', 'Matmul Batch=1'] else: ALGOS = ['Bolt', 'Binary Embedding', 'PQ', 'OPQ'] df = results.query_speed_results() df['y'] = df['y'] / 1e9 # convert to billions print("df cols: ", df.columns) df['algo'] = df['algo'].apply(lambda s: 'Ours' if s == 'Bolt' else s) df['algo'] = df['algo'].apply(lambda s: 'Matmul Batch={}'.format(s.split()[1]) if 'Matmul' in s else s) df.rename(columns={'algo': ' '}, inplace=True) # hide from legend # ax = sb.barplot(x='x', y='y', hue=' ', ci=95, data=df, ax=axes[i]) # for i, nbytes in enumerate([8, 16, 32]): for i, nbytes in enumerate([8, 16]): data = df[df['nbytes'] == nbytes] # ax = sb.barplot(x='nbytes', y='y', hue=' ', hue_order=ALGOS, ci=95, ax = sb.barplot(x='nbytes', y='y', hue=' ', hue_order=ALGOS, ci='sd', data=data, ax=axes[i], capsize=.0004) # data=data, ax=axes[i]) # data=data, ax=axes[i], errwidth=10) # data=data, ax=axes[i], capsize=.0004, errwidth=6) # ------------------------ clean up / format axes for ax in axes[:-1]: # remove x labels except for bottom axis plt.setp(ax.get_xticklabels(), visible=False) ax.get_xaxis().set_visible(False) end = .5 * (len(ALGOS) / float((len(ALGOS) + 2))) start = -end tick_positions = np.linspace(start + .02, end - .05, len(ALGOS)) tick_positions[0] += .02 tick_positions[2] += .02 tick_positions[3] += .01 for ax in axes: ax.set_xlim([start - .02, end + .02]) if defense: ax.set_ylabel('Billion Products/s', y=.49, # .5 = centered ? family=CAMERA_READY_FONT) else: ax.set_ylabel('Billion Activations/s', y=.49, # .5 = centered ? family=CAMERA_READY_FONT) ax.legend_.remove() ax.set_ylim(0, 2.5) # add byte counts on the right # fmt_str = "{}B Encodings" sb.set_style("white") # adds border (spines) we have to remove for i, ax in enumerate(axes): ax2 = ax.twinx() sb.despine(ax=ax2, top=True, left=True, bottom=True, right=True) ax2.get_xaxis().set_visible(False) # ax2.get_yaxis().set_visible(False) # nope, removes ylabel ax2.yaxis.set_label_position('right') plt.setp(ax2.get_xticklabels(), visible=False) plt.setp(ax2.get_yticklabels(), visible=False) # lbl = fmt_str.format((2 ** i) * 8) # lbl = {0: 'Fastest Setting', 1: 'Higher Accuracy', 2: 'Highest Accuracy'}[i] lbl = {0: '8B Encodings', 1: '16B Encodings', 2: '32B Encodings'}[i] ax2.set_ylabel(lbl, labelpad=10, fontsize=14, family=CAMERA_READY_FONT) # ------------------------ have bottom / top axes print title, x info # axes[0].set_title('Activations Computed per Second', y=1.02, axes[0].set_title('Activations Computed / Second', y=1.04, family=CAMERA_READY_FONT, fontsize=15) # axes[-1].set_xticks(tick_positions) for ax in axes: axes[-1].set_xticks(tick_positions) ax.set_xlim(-.4, .4) # no idea why this makes the bars fit right... xlabels = ["\n".join(name.split(' ')) for name in ALGOS] # xlabels = ["\nBatch".join(name.split(' Batch')) for name in ALGOS] # xlabels = ALGOS axes[-1].set_xticklabels(xlabels, rotation=70) # get and set them again so we can make the first one bold; can't make # it bold beforehand because need a tick lbl object, not a string xlabels = list(axes[-1].get_xticklabels()) xlabels[0].set_weight('bold') axes[-1].set_xticklabels(xlabels, rotation=70) axes[-1].tick_params(axis='x', which='major', pad=4) axes[-1].set_xlabel("", labelpad=-20) # plt.setp(axes[-1].get_xlabel(), visible=False) # doesn't work # plt.setp(axes[-1].get_xticks(), visible=False) ax.xaxis.set_ticks_position('none') # ------------------------ show / save plot # plt.tight_layout() plt.tight_layout() plt.subplots_adjust(hspace=.18) # save_fig(fname) # MPL conversion to pdf is selectively braindead for just this plot; it # lays things out horribly in a way that doesn't match the results # of show() at all. Just export as high-density png as a workaround # plt.savefig(os.path.join(SAVE_DIR, fname + '.png'), # dpi=300, bbox_inches='tight') save_fig_png(fname + ('_defense' if defense else '')) # plt.show() def matmul_fig(fake_data=False, fname='matmul', camera_ready=False): # two line graphs # lines in both top and bottom = bolt {8,16,32}B, matmul # just use square mats of power-of-two lengths cuz best case for matmuls # in top one, one mat already encoded and Bolt just has to do queries # in bottom one, Bolt has encode one of the mats as data before queries sb.set_style('darkgrid') sb.set_context("talk") # sb.set_palette("Set1", n_colors=len(ALGOS)) pal = set_palette(ncolors=8) fig, axes = plt.subplots(2, 1, figsize=(6, 6)) # axes = axes.reshape((2, 1)) if fake_data: # for debuging / prototyping fig SIZES = np.array([64, 128, 256, 512, 1024, 2048, 4096], dtype=np.float32) matmul_times = (SIZES ** 2.5).reshape((-1, 1)) # strassen-ish scaling bolt_times = ((SIZES ** 3) / 100 + 400).reshape((-1, 1)) # pretend we had 5 trials; each trial gets a col, so rows are lengths matmul_times = np.tile(matmul_times, (1, 5)) bolt_times = np.tile(bolt_times, (1, 5)) matmul_times += np.random.randn(*matmul_times.shape) * SIZES.T.reshape((-1, 1)) / 10. bolt_times += np.random.randn(*bolt_times.shape) * SIZES.T.reshape((-1, 1)) / 10. matmul_times /= 1e9 bolt8_times = bolt_times / 2e9 bolt16_times = bolt_times / 1e9 bolt32_times = bolt_times / .5e9 dicts = [] ALGOS = ['Bolt 8B', 'Bolt 16B', 'Bolt 32B', 'Floats (BLAS)'] algo_times = [bolt8_times, bolt16_times, bolt32_times, matmul_times] for all_times, algo in zip(algo_times, ALGOS): for sz, times_for_sz in zip(SIZES, all_times): dicts += [{'algo': algo, 'trial': i, 'size': sz, 'y': t} for i, t in enumerate(times_for_sz)] df = pd.DataFrame.from_records(dicts) df_enc = df df_no_enc = df sb.tsplot(time='size', value='y', condition='algo', unit='trial', data=df_no_enc, ax=axes[0], n_boot=100) sb.tsplot(time='size', value='y', condition='algo', unit='trial', data=df_enc, ax=axes[1], n_boot=100) else: # ALGOS = ['Bolt 8B', 'Bolt 16B', 'Bolt 32B', 'Floats'] # ALGOS = ['Bolt 32B', 'Bolt 32B + Encode', 'Floats'] # ALGOS = ['Bolt 8B', 'Bolt 32B', 'Bolt 32B + Encode', 'Floats'] ALGOS = ['Bolt 8B', 'Bolt 8B + Encode', 'Bolt 32B', 'Bolt 32B + Encode', 'Floats'] # df = results.matmul_results_square() def clean_df(df): df = df.loc[df['algo'].isin(ALGOS)] non_encode_algos = ['Bolt 8B', 'Bolt 16B', 'Bolt 32B'] # rm_idxs = (df['algo'] == 'Bolt 32B') * (df['enc'] == 1) rm_idxs = (df['algo'].isin(non_encode_algos)) * (df['enc'] == 1) df = df.loc[~rm_idxs] df['algo'].loc[df['algo'] == 'Floats'] = 'Floats (BLAS)' return df df = results.matmul_results(which='square') df = clean_df(df) colors = { 'Bolt 8B': pal[0], 'Bolt 8B + Encode': pal[0], # 'Bolt 16B': pal[2], 'Bolt 16B + Encode': pal[2], 'Bolt 32B': pal[1], 'Bolt 32B + Encode': pal[1], 'Floats (BLAS)': 'k' } df_no_enc = df.loc[df['enc'] != 1] sb.tsplot(time='size', value='y', condition='algo', unit='trial', data=df_no_enc, ax=axes[0], n_boot=100, color=colors, linestyle='solid') df_enc = df.loc[df['enc'] == 1] sb.tsplot(time='size', value='y', condition='algo', unit='trial', data=df_enc, ax=axes[0], n_boot=100, color=colors, linestyle='dotted', lw=4) df = results.matmul_results(which='tall') df = clean_df(df) # print df # return # sb.tsplot(time='size', value='y', condition='algo', unit='trial', # data=df, ax=axes[1], n_boot=100, color=colors) df_no_enc = df.loc[df['enc'] != 1] sb.tsplot(time='size', value='y', condition='algo', unit='trial', data=df_no_enc, ax=axes[1], n_boot=100, color=colors, linestyle='solid') df_enc = df.loc[df['enc'] == 1] sb.tsplot(time='size', value='y', condition='algo', unit='trial', data=df_enc, ax=axes[1], n_boot=100, color=colors, linestyle='dotted', lw=4) # axes[1].set_ylim(1, 1e3) # without encoding at the top; with encoding on the bottom # sb.tsplot(time='size', value='y', condition='algo', unit='trial', # sb.tsplot(time='size', value='y', condition='algo', unit='trial', # data=df_no_enc, ax=axes[0], n_boot=100) # sb.tsplot(time='size', value='y', condition='algo', unit='trial', # data=df_enc, ax=axes[1], n_boot=100) # ------------------------ legend ax = axes.ravel()[-1] leg_lines, leg_labels = ax.get_legend_handles_labels() # for some reason, each algo appears 3x, so just take first leg_lines, leg_labels = leg_lines[:len(ALGOS)], leg_labels[:len(ALGOS)] plt.figlegend(leg_lines, leg_labels, loc='lower center', ncol=len(ALGOS)/2, labelspacing=0) # ------------------------ axis cleanup / formatting # axes[0].set_title('Matrix Multiply Time, One Matrix Encoded', y=1.03, fontsize=16) # axes[1].set_title('Matrix Multiply Time, Neither Matrix Encoded', y=1.03, fontsize=16) axes[0].set_title('Square Matrix Multiply Time', y=1.03, fontsize=16) axes[1].set_title('Tall Matrix Multiply Time', y=1.03, fontsize=16) for ax in axes.ravel(): ax.legend_.remove() ax.set_xscale('log', basex=2) ax.set_yscale('log', basey=10) if not camera_ready: ax.set_ylabel('Wall Time (s)') if camera_ready: axes[0].set_ylabel('Wall Time (s)') axes[1].set_ylabel('Wall Time (s)', labelpad=10) # for ax in axes[:-1].ravel(): # # plt.setp(ax.get_xticklabels(), visible=False) # ax.set_xlabel('', labelpad=-10) # axes[0].set_xlabel('Matrix Side Length, L', labelpad=-1) axes[0].set_xlabel('Matrix Side Length') axes[1].set_xlabel('Matrix Side Length') # ------------------------ show / save plot # plt.tight_layout(h_pad=1.4) plt.tight_layout(h_pad=1.2) plt.subplots_adjust(bottom=.23) if camera_ready: save_fig_png('matmul_speed') # bypass mpl truetype pdf ineptitude else: save_fig('matmul_speed') # plt.show() def recall_r_fig(fake_data=False, suptitle=None, l2=True, fname='l2_recall', camera_ready=False): # experiment params: # datasets = Sift1M, Convnet1M, LabelMe22k, MNIST # bytes = [8, 16, 32] # R = 1, 10, 100, 1000 DATASETS = ['Sift1M', 'Convnet', 'LabelMe', 'MNIST'] ALGOS = ['Bolt', 'PQ', 'OPQ', 'PairQ'] NBYTES_LIST = [8, 16, 32] # Rs = [1, 10, 100, 1000] Rs = [1, 5, 10, 50, 100, 500, 1000] sb.set_style('darkgrid') sb.set_context("talk") set_palette(ncolors=len(ALGOS)) fig, axes = plt.subplots(4, 3, figsize=(6, 9)) if suptitle is None: suptitle = 'Nearest Neighbor Recall' if fake_data: algo2offset = {'Bolt': -.1, 'PQ': -.2, 'OPQ': 0, 'PairQ': .1} data = np.random.rand(1, len(Rs), len(algo2offset)) data = np.sort(data, axis=1) # ensure fake recalls are monotonic for i, algo in enumerate(ALGOS): recall = data[:, :, i] + algo2offset[algo] data[:, :, i] = np.clip(recall, 0., 1.) line_styles_for_nbytes = {8: '-', 16: '-', 32: '-'} # plot the data for d, dataset in enumerate(DATASETS): axes_row = axes[d] for b, nbytes in enumerate(NBYTES_LIST): ax = axes_row[b] if fake_data: # TODO handle real data data_tmp = data * (.5 + nbytes / 64.) # slightly less assert np.max(data_tmp) <= 1. for algo in ALGOS: x = Rs sb.tsplot(data=data_tmp, condition=ALGOS, time=x, ax=ax, n_boot=100, ls=line_styles_for_nbytes[nbytes]) else: # real data DATASETS = ['Sift1M', 'Convnet1M', 'LabelMe', 'MNIST'] # ALGOS = ['PQ', 'OPQ'] # ALGOS = ['Bolt', 'Bolt No Quantize', 'PQ', 'OPQ'] ALGOS = ['Bolt', 'PQ', 'OPQ'] # for thesis defense for d, dset in enumerate(DATASETS): if l2: path = os.path.join('../results/recall_at_r/', dset, 'summary.csv') else: path = os.path.join('../results/recall_at_r_mips/', dset, 'summary.csv') df = pd.read_csv(path) pq4 = (df['_algo'] == 'PQ') & (df['_code_bits'] == 4) df.loc[pq4, '_algo'] = 'Bolt No Quantize' # rm results with bolt rotations bolt_rot = (df['_algo'] == 'Bolt') & (df['opq_iters'] > 0) df = df.loc[~bolt_rot] df.rename(columns={'_algo': 'algo'}, inplace=True) all_nbytes = (df['_code_bits'] * df['_ncodebooks'] / 8).values df['nbytes'] = all_nbytes.astype(np.int) for b, nbytes in enumerate(NBYTES_LIST): ax = axes[d, b] data = df.loc[df['nbytes'] == nbytes] for algo in ALGOS: df_row = data.loc[data['algo'] == algo] # should be 1 row if len(df_row) != 1: print(df_row) print("dset = ", dset) print("algo = ", algo) assert len(df_row) == 1 assert len(df_row) == 1 x = np.array(Rs) y = [df_row['recall@{}'.format(r)].values[0] for r in x] if camera_ready: x = np.log10(x) # print "recall plot: using X values: ", x # TODO rm ax.plot(x, y, label=algo) ax.legend() # ------------------------ legend ax = axes.ravel()[-1] leg_lines, leg_labels = ax.get_legend_handles_labels() # for some reason, each algo appears 3x, so just take first leg_lines, leg_labels = leg_lines[:len(ALGOS)], leg_labels[:len(ALGOS)] plt.figlegend(leg_lines, leg_labels, loc='lower center', ncol=len(ALGOS), labelspacing=0) # ------------------------ axis cleanup / formatting # configure all axes for i, ax_row in enumerate(axes): for j, ax in enumerate(ax_row): title = "{}, {}B".format(DATASETS[i], NBYTES_LIST[j]) if camera_ready: # x_pos = .44 if j == 0 else .45 # ax.set_title(title, x=x_pos, y=1.01, fontsize=15) # ax.set_title(title, x=.45, y=1.01, fontsize=15) # x_pos = .49 if j == 0 else .48 # ax.set_title(title, x=.49, y=1.01, fontsize=15) ax.set_title(title, y=1.01, fontsize=15) else: ax.set_title(title, y=1.01) ax.set_ylim([0, 1]) if not camera_ready: ax.set_xscale("log") # remove all legends except the very last one if (i != len(axes) or j != len(ax_row)) and ax.legend_: ax.legend_.remove() # remove x labels except for bottom axis for ax in axes[:-1, :].ravel(): plt.setp(ax.get_xticklabels(), visible=False) # ax.get_xaxis().set_visible(False) if axes.shape[1] > 1: # hide y axis for axes not in left col for i, ax in enumerate(axes[:, 1:].ravel()): # pass # ax.get_yaxis().set_visible(False) ax.get_yaxis().set_ticklabels([], labelpad=-10, fontsize=1) # ylabel left col for i, ax in enumerate(axes[:, 0].ravel()): ax.set_ylabel("Recall@R") # xlabel bottom rows if camera_ready: for i, ax in enumerate(axes.ravel()): ax.set_xticks([0, 1, 2, 3]) for i, ax in enumerate(axes[-1, :].ravel()): ax.set_xticklabels(['0', '1', '2', '3']) else: for i, ax in enumerate(axes[-1, :].ravel()): # no idea why we need the dummy tick at the beginning ax.set_xticklabels(['', '0', '1', '2', '']) axes[-1, -1].set_xticklabels(['', '0', '1', '2', '3']) axes[-1, 1].set_xlabel("Log10(R)") # ------------------------ show / save plot # plt.tight_layout(h_pad=.02, w_pad=.02) plt.tight_layout(w_pad=.02) # plt.subplots_adjust(top=.88, bottom=.21, hspace=.4) # if camera_ready: # plt.suptitle(suptitle, fontsize=18) # else: # plt.suptitle(suptitle, fontsize=16) plt.suptitle(suptitle, fontsize=16) # plt.subplots_adjust(top=.91, bottom=.11) plt.subplots_adjust(top=.91, bottom=.15) # defense if camera_ready: save_fig_png(fname) # mpl saving as pdf stupid; just bypass it else: save_fig(fname) # plt.show() def distortion_fig(fake_data=False, l2=True, suptitle=None, fname='l2_distortion', camera_ready=False): # experiment params: # datasets = Sift1M, Convnet1M, LabelMe22k, MNIST # bytes = [8, 16, 32] # layout: [ndatasets x nums_bytes] (ie, [4x3]) # each subplot a barplot showing corr with err bars DATASETS = ['Sift1M', 'Convnet1M', 'LabelMe', 'MNIST'] ALGOS = ['Bolt', 'PQ', 'OPQ', 'PairQ'] NBYTES_LIST = [8, 16, 32] figsize = (6, 8) sb.set_style('darkgrid') sb.set_context("talk", rc={'xtick.major.pad': 3}) set_palette(ncolors=len(ALGOS)) # fig, axes = plt.subplots(4, 3) # fig, axes = plt.subplots(4, 1, figsize=figsize) fig, axes = plt.subplots(4, 1, figsize=figsize, dpi=300) axes = axes.reshape((4, 1)) if suptitle is None: suptitle = 'Quality of Approximate Distances' # fake_data = data is None if fake_data: algo2offset = {'Bolt': .4, 'PQ': .3, 'OPQ': .45, 'PairQ': .5} nfake_corrs = 10 dicts = [] for dataset in DATASETS: for nbytes in NBYTES_LIST: for algo in ALGOS: if fake_data: corrs = np.random.rand(nfake_corrs) / 2. corrs += algo2offset[algo] corrs *= .9 + .1 * nbytes / 32. params = {'algo': algo, 'dataset': dataset, 'nbytes': '{}B'.format(nbytes)} dicts += [dict(params, **{'corr': c}) for c in corrs] # data = pd.DataFrame.from_records(dicts, index=[0]) data = pd.DataFrame.from_records(dicts) # print data # return # ------------------------ plot the data for d, dataset in enumerate(DATASETS): # df_dataset = data.loc[data['dataset'] == dataset] df = data.loc[data['dataset'] == dataset] df.rename(columns={'algo': ' '}, inplace=True) # hide from legend ax = axes.ravel()[d] sb.barplot(x='nbytes', y='corr', hue=' ', data=df, ax=ax) else: DATASETS = ['Sift1M', 'Convnet1M', 'LabelMe', 'MNIST'] # ALGOS = ['Bolt', 'PQ', 'OPQ', 'PairQ'] # DATASETS = ['Convnet1M', 'MNIST'] # ALGOS = ['PQ', 'OPQ'] # ALGOS = ['PQ4', 'PQ', 'OPQ'] ALGOS = ['Bolt No Quantize', 'PQ', 'OPQ'] for d, dset in enumerate(DATASETS): if l2: path = os.path.join('../results/correlation_l2/', dset, 'all_results.csv') else: path = os.path.join('../results/correlation_dotprods/', dset, 'all_results.csv') df = pd.read_csv(path) print("path: ", path) pq4 = (df['_algo'] == 'PQ') & (df['_code_bits'] == 4) df.loc[pq4, '_algo'] = 'Bolt No Quantize' bolt_rot = (df['_algo'] == 'Bolt') & (df['opq_iters'] > 0) df = df.loc[~bolt_rot] # print df.loc[df['_algo'] == 'PQ4'] # print df.loc[df['_algo'] == 'PQ4'] # return df.rename(columns={'_algo': ' '}, inplace=True) # df['nbytes'] = df['_code_bits'] * df['_ncodebooks'] / 8 all_nbytes = (df['_code_bits'] * df['_ncodebooks'] / 8).values df['nbytes'] = ["{}B".format(b) for b in all_nbytes.astype(np.int)] ax = axes.ravel()[d] # sb.barplot(x='nbytes', y='corr', hue=' ', data=df, ax=ax) sb.barplot(x='nbytes', y='corr', hue=' ', data=df, ax=ax, capsize=.0025) ax.set_title(dset) # ------------------------ legend ax = axes.ravel()[-1] leg_lines, leg_labels = ax.get_legend_handles_labels() plt.figlegend(leg_lines, leg_labels, loc='lower center', ncol=2, labelspacing=0) # ------------------------ axis cleanup / formatting # configure all axes for i, ax in enumerate(axes.ravel()): # title = "{}".format(DATASETS[i]) # TODO uncomment # ax.set_title(title, y=1.01) # TODO uncomment # ax.set_ylim([0, 1]) ax.set_ylim([.5, 1]) # ax.set_ylim([.75, 1]) ax.set_xlabel('', labelpad=-10) if l2: ax.set_ylabel('Correlation With\nTrue Distance') else: if camera_ready: # ax.set_ylabel('Correlation With\nTrue Dot Product', y=.46, fontsize=13) ax.set_ylabel('Correlation With\nTrue Dot Product', fontsize=13) else: ax.set_ylabel('Correlation With\nTrue Dot Product') if ax.legend_: ax.legend_.remove() # ------------------------ show / save plot # plt.tight_layout() # for fig size 6x9 plt.tight_layout(h_pad=.8) # if camera_ready: # plt.suptitle(suptitle, fontsize=17) # else: # plt.suptitle(suptitle, fontsize=16) plt.suptitle(suptitle, fontsize=16) # plt.subplots_adjust(top=.92, bottom=.08) # for fig size 6x9 # plt.subplots_adjust(top=.90, bottom=.08) plt.subplots_adjust(top=.90, bottom=.1) if camera_ready: save_fig_png(fname) # bypass mpl truetype pdf ineptitude else: save_fig(fname) # plt.show() def kmeans_fig(data=None, fname='kmeans'): # bolt vs raw floats, k=16 on top and k=32 on the bottom ALGOS = ['Bolt', 'Matmul'] Ks = [16, 64] sb.set_context("talk") set_palette() figsize = (6, 6) fig, axes = plt.subplots(2, 1, figsize=figsize) fake_data = data is None if fake_data: dicts = [] bolt_times = np.linspace(0, 100, 21) bolt_errs = np.max(Ks) * np.exp(-.1 * bolt_times) matmul_times = np.linspace(0, 100, 11) matmul_errs = np.max(Ks) * np.exp(-.05 * matmul_times) for i in range(3): # simulate multiple trials # bolt_errs *= (1 + .2 * np.random.randn(*bolt_errs.shape)) # matmul_errs *= (1 + .2 * np.random.randn(*matmul_errs.shape)) bolt_errs += 5 * np.random.randn(*bolt_errs.shape) matmul_errs += 5 * np.random.randn(*matmul_errs.shape) bolt_errs = np.maximum(0, bolt_errs) matmul_errs = np.maximum(0, matmul_errs) bolt_errs = np.sort(bolt_errs)[::-1] matmul_errs = np.sort(matmul_errs)[::-1] for k in Ks: for t, err in zip(bolt_times, bolt_errs): dicts.append({'trial': i, 'algo': 'Bolt', 'k': k, 't': t, 'err': err / k}) for t, err in zip(matmul_times, matmul_errs): dicts.append({'trial': i, 'algo': 'Matmul', 'k': k, 't': t, 'err': err / k}) # data = pd.DataFrame.from_records(dicts, index=[0]) data = pd.DataFrame.from_records(dicts) # print data # return # ------------------------ plot curves for i, k in enumerate(Ks): ax = axes[i] df = data.loc[data['k'] == k] df.rename(columns={'algo': ' '}, inplace=True) # hide from legend # sb.tsplot(value='err', condition=' ', unit='k', time='t', data=df, ax=ax, n_boot=100) sb.tsplot(value='err', condition=' ', unit='trial', time='t', data=df, ax=ax, ci=95, n_boot=500) # ------------------------ configure axes # configure all axes for i, ax in enumerate(axes.ravel()): title = "K-Means Convergence, K={}".format(Ks[i]) ax.set_title(title, y=1.01) # ax.set_xlabel('', labelpad=-10) ax.set_xlabel('Wall Time (s)') # ax.set_ylabel('MSE') ax.set_ylabel('Mean Squared Error') axes[1].legend_.remove() # ------------------------ show / save plot plt.tight_layout() # plt.tight_layout(h_pad=.8) # plt.subplots_adjust(top=.92, bottom=.08) # for fig size 6x9 # plt.subplots_adjust(top=.90, bottom=.08) # save_fig(fname) plt.show() def main(): # camera-ready can't deal with Type 3 fonts, which are what matplotlib # uses by default; 42 is apparently TrueType fonts # matplotlib.use("agg") matplotlib.rcParams['pdf.fonttype'] = 42 # matplotlib.rcParams['font.family'] = 'Helvetica' # matplotlib.rcParams['font.family'] = 'Lucida Sans Unicode' # matplotlib.rcParams['font.family'] = 'Arial' # matplotlib.rcParams['font.family'] = 'Arial Narrow' # matplotlib.rcParams['font.family'] = 'Bitstream Vera Sans' # matplotlib.rcParams['font.family'] = 'Calibri' # used this for cam ready # matplotlib.rcParams['font.family'] = 'Gill Sans MT' # matplotlib.rcParams['font.family'] = 'Franklin Gothic Book' # matplotlib.rcParams['font.family'] = 'Herculanum' # matplotlib.rcParams['font.family'] = 'DejaVu Sans' matplotlib.rcParams['font.family'] = CAMERA_READY_FONT # matplotlib.rcParams['font.sans-serif'] = # matplotlib.rcParams['ps.fonttype'] = 42 # matplotlib.rcParams['text.usetex'] = True # pal = set_palette() # sb.palplot(pal) # plt.show() # ------------------------ begin actual plotting func calls # encoding_fig(camera_ready=True) # # # query_speed_fig(fname='query_speed_with_matmuls', camera_ready=False) # query_speed_fig(fname='query_speed_with_matmuls', camera_ready=True) # query_speed_poster_fig(fname='query_speed_poster') # matmul_fig(camera_ready=True) # # # recall_r_fig(suptitle='Nearest Neighbor Recall', fname='l2_recall') recall_r_fig(suptitle='Nearest Neighbor Recall', fname='l2_recall', camera_ready=True) # # distortion_fig(fake_data=False, fname='l2_distortion') # # distortion_fig(fake_data=False, fname='dotprod_distortion', # # suptitle='Quality of Approximate Dot Products', l2=False) # distortion_fig(fake_data=False, fname='dotprod_distortion', # suptitle='Quality of Approximate Dot Products', l2=False, # camera_ready=True) if __name__ == '__main__': main()
bolt-master
experiments/python/figs.py
#!/bin/env/python from __future__ import division import numpy as np import numba from .utils import top_k_idxs # ================================================================ eigenvecs # @numba.jit(nopython=True) # don't jit since take like 2.5s # def top_principal_component(X, niters=50, return_eigenval=False, def top_principal_component(X, niters=100, return_eigenval=False, momentum=.9, nguesses=32, learning_rate=1., # allow_materialize=False): allow_materialize_XtX=True): N, D = X.shape X = X.astype(np.float32) X = X - X.mean(axis=0) if nguesses > 1: V = np.random.randn(D, nguesses).astype(X.dtype) V /= np.linalg.norm(V, axis=0) # norms = np.sqrt((V * V).sum(axis=0)) # V /= norms prods = X.T @ (X @ V) new_norms = np.linalg.norm(prods, axis=0) # new_norms_sq = (prods * prods).sum(axis=0) v = V[:, np.argmax(new_norms)] # v = V[:, np.argmax(new_norms_sq)] # print("picking v = ", v) else: v = np.random.randn(D).astype(X.dtype) # v = np.ones(D, dtype=np.float32) v = v.astype(np.float32) prev_v = np.zeros_like(v) v_momentum = np.zeros_like(v) v /= (np.linalg.norm(v) + 1e-20) materialize_cost = N * D * D iter_cost_no_materialize = 2 * N * D iter_cost_materialize = D * D materialize = (materialize_cost + (niters * iter_cost_materialize) < (niters * iter_cost_no_materialize)) materialize = materialize and allow_materialize_XtX if materialize: scaleby = np.max(np.linalg.norm(X, axis=0)) X *= 1. / scaleby # precondition by setting largest variance to 1 XtX = X.T @ X for i in range(niters): if materialize: v = XtX @ v else: v = X.T @ (X @ v) v *= 1. / (np.linalg.norm(v) + 1e-20) # v_momentum = .9 * v_momentum + .5 * (v - prev_v) # v_momentum = (.9 * v_momentum + (v - prev_v)).astype(np.float32) v_momentum = momentum * v_momentum + learning_rate * (v - prev_v) v += v_momentum prev_v = v # if i % 5 == 0: # print("v: ", v) v /= (np.linalg.norm(v) + 1e-20) if return_eigenval: new_v = X.T @ (X @ v) lamda = np.linalg.norm(new_v) return v, lamda return v def top_principal_component_v1(X, init='gauss', niters=100, return_eigenval=False, batch_sz=-1, momentum=.9, nguesses=32, verbose=0): N, D = X.shape X = X.astype(np.float32) # Z = X - X.mean(axis=0) if nguesses is not None and nguesses > 1: assert init == 'gauss' if init == 'ones': v = np.ones(D, dtype=X.dtype) elif init == 'gauss': if nguesses > 1: V = np.random.randn(D, nguesses).astype(X.dtype) V /= np.linalg.norm(V, axis=0) prods = X.T @ (X @ V) new_norms = np.linalg.norm(prods, axis=0) # print("new_norms: ", new_norms) # assert np.min(eigenvals > -.001) # should be nonneg v = V[:, np.argmax(new_norms)] # print("picking v = ", v) else: v = np.random.randn(D).astype(X.dtype) elif init == 'variance': v = X.var(axis=0) else: v = init # can also pass in raw vector to initialize it with if batch_sz < 1: # batch_sz = min(2048, N) # batch_sz = min(N, max(2048, N // 4)) # batch_sz = N // 4 batch_sz = N nbatches = int(np.ceil(N / batch_sz)) prev_v = np.zeros_like(v) v_momentum = np.zeros_like(v) v /= (np.linalg.norm(v) + 1e-20) for i in range(niters): v = X @ v # v /= (np.linalg.norm(v) + 1e-20) v = X.T @ v v /= (np.linalg.norm(v) + 1e-20) # v_momentum = .9 * v_momentum + .5 * (v - prev_v) v_momentum = .9 * v_momentum + (v - prev_v) # v_momentum = .95 * v_momentum + (v - prev_v) v += v_momentum prev_v = v if (verbose > 0) and (i % 5 == 0): print("----") print("mom: ", v_momentum) print("v: ", v) # print("v, prev_v dot prod: ", v.T @ prev_v) # for i in range(niters): # perm = np.random.permutation(nbatches) # for b in range(nbatches): # use_b = perm[b] # shuffle order of batches across iters # start_idx = use_b * batch_sz # end_idx = min(N, start_idx + batch_sz) # Zb = Z[start_idx:end_idx] # Xb = X[start_idx:end_idx] # # print("v: ", v) # # print("Z shape", Z.shape) # # print("X shape", X.shape) # # print("X @ v shape", (X @ v).shape) # # update based on Adaptive Synaptogenesis Constructs Neural Codes # # That Benefit Discrimination, theorem 1; could also use Oja's rule # # v += ((Z - v) * (X @ v).reshape(-1, 1)).mean(axis=0) # # v += ((Zb - v) * (Xb @ v).reshape(-1, 1)).sum(axis=0) # dv = ((Zb - v) * (Xb @ v).reshape(-1, 1)).mean(axis=0) # # dv /= np.linalg.norm(dv) # v += dv # # v_momentum = .5 * v_momentum + .5 * dv # # v += v_momentum # # v += dv + v_momentum # v /= (np.linalg.norm(v) + 1e-20) # # v += v_momentum + dv # v += v_momentum # v /= (np.linalg.norm(v) + 1e-20) # v_momentum = .8 * v_momentum + .5 * (v - prev_v) # # v_momentum = .9 * v_momentum + .1 * dv # # v_momentum = .9 * v_momentum + (v - prev_v) # # v_momentum = .5 * v_momentum + .5 * dv # if i % 5 == 0: # print("----") # print("v_momentum: ", v_momentum) # print("prev_v: ", prev_v) # print("v: ", v) # prev_v[:] = v # # v_momentum = .1 * dv v /= (np.linalg.norm(v) + 1e-20) if return_eigenval: new_v = X.T @ (X @ v) lamda = np.linalg.norm(new_v) return v, lamda return v def power_iteration(A, niters=5, init='ones', return_eigenval=False): if init == 'ones': v = A.sum(axis=0) elif init == 'gauss': v = np.random.randn(A.shape[1]).astype(A.dtype) else: v = init # can also pass in raw vector to initialize it with for i in range(niters): v /= (np.linalg.norm(v) + 1e-20) v = (A * v).mean(axis=1) lamda = np.linalg.norm(v) v /= (lamda + 1e-20) if return_eigenval: return v, lamda return v def greedy_eigenvector_threshold(X, subspace_len, sample_how='deterministic', stats_mat='cov', npower_iters=5, nsubspaces=-1): # nsubspaces=-1, col_stds=None): assert sample_how in ('deterministic', 'importance') # print("nsubspaces: ", nsubspaces) # print("X.shape", X.shape) # rm all-zero columns; if whole thing is zero, just return original order # keep_cols = (X != 0).sum(axis=0) != 0 # nnz_cols = np.sum(keep_cols) != 0 # orig_all_idxs = np.arange(X.shape[1]) # if nnz_cols == 0: # return orig_all_idxs # else: # orig_D = X.shape[1] # X = X[:, keep_cols] # numpy funcs for corr, cov are too quick to create nans, so compute stats # manually N, D = X.shape if stats_mat == 'cov': X = (X - X.mean(axis=0)) / np.sqrt(N) cov = X.T @ X elif stats_mat == 'corr': X = (X - X.mean(axis=0)) / (np.linalg.norm(X, axis=0) + 1e-14) cov = X.T @ X else: assert X.shape[0] == X.shape[1] # using X as the cov/corr mat cov = X # if col_stds is None: # col_stds = np.std(cov, axis=0) + 1e-14 if nsubspaces is None or nsubspaces < 0: nsubspaces = int(np.ceil(D / subspace_len)) all_idxs = np.arange(D) if nsubspaces == 1: return all_idxs # find the indices to add to the next subspace v = power_iteration(cov, niters=npower_iters) if sample_how == 'deterministic': idxs = top_k_idxs(np.abs(v), subspace_len, smaller_better=False) elif sample_how == 'importance': probs = np.abs(v) + 1e-14 probs /= np.sum(probs) idxs = np.random.choice(all_idxs, size=subspace_len, p=probs, replace=False) # remove the indices we selected, and recurse mask = np.ones(D, dtype=np.bool) mask[idxs] = False cov = cov[mask][:, mask] # col_stds = col_stds[mask] rest_of_perm = greedy_eigenvector_threshold( cov, subspace_len, sample_how=sample_how, stats_mat=None, npower_iters=npower_iters, nsubspaces=nsubspaces - 1) # nsubspaces=nsubspaces - 1, col_stds=col_stds) # convert indices from recursive call (which are in a different subspace # since we excluded some indices) back to the original space rest_of_perm = all_idxs[mask][rest_of_perm] # child call using subspace # perm = np.array(list(idxs) + list(rest_of_perm)) perm = np.r_[idxs, rest_of_perm] # if orig_D > D: # we removed some zero cols at the beginning # perm = orig_all_idxs[keep_cols][perm] if len(set(perm)) != len(perm): # TODO rm after debug print("nsubspaces, subspace_len: ", nsubspaces, subspace_len) print("size of set(all_idxs)", len(set(all_idxs))) print("size of set(perm)", len(set(perm))) assert len(set(perm)) == len(perm) # import sys; sys.exit() return perm # v = 'ones' # in subseqent iters, will init with prev eigenva # zero_cols = # TODO ideally actually pull rows/cols out of cov to create a smaller # matrix, so that later subspaces have less work to do; issue here is # that it makes keeping track of what the indices mean pretty ugly # if nsubspaces == 1: # return all_idxs # mask = np.zeros(D, dtype=np.bool) # perm = [] # for m in range(nsubspaces - 1): # v = power_iteration(cov, niters=npower_iters) # if sample_how == 'deterministic': # idxs = top_k_idxs(np.abs(v), subspace_len, smaller_better=False) # elif sample_how == 'importance': # probs = np.abs(v) # probs /= np.sum(probs) + 1e-14 # # # TODO rm after debug # # nnz = np.sum(probs > 0) # # # if nnz < subspace_len: # # print("m: {}/{}".format(m + 1, nsubspaces)) # # print("D:", D) # # print("subspace_len:", subspace_len) # # print("nnz:", nnz) # try: # idxs = np.random.choice(all_idxs, size=subspace_len, # p=probs, replace=False) # except ValueError: # missing_idxs = set(all_idxs) - set(perm) # perm += list(missing_idxs) # break # perm += list(idxs) # # print("adding {} idxs".format(len(idxs))) # # print("new len(perm)", len(perm)) # # rm selected indices from future consideration # mask[:] = True # mask[idxs] = False # cov = cov[mask, mask] # # # rm the selected indices from future consideration # # mask[:] = False # # mask[idxs] = True # # # print("cov.shape: ", cov.shape) # # # # print("mask.shape: ", mask.shape) # # # print("idxs: ", idxs) # # # print("mask: ", mask) # # # print("cov[mask]\n", cov[mask]) # # # print("cov[:, mask]\n", cov[:, mask]) # # # cov[mask, mask] = 0 # # # print("nnz in mask: ", np.sum(mask != 0)) # # cov[mask] = 0 # # cov[:, mask] = 0 # # # print("cov[mask]\n", cov[mask]) # # # print("cov[:, mask]\n", cov[:, mask]) # # # print("idxs: ", idxs) # # # print("cov[idxs].sum(axis=1)", cov[idxs].sum(axis=1)) # # # print("cov[:, idxs].sum(axis=0)", cov[:, idxs].sum(axis=0)) # # # print("nnz cols in cov: ", np.sum(cov.sum(axis=0) != 0)) # # # assert np.all(cov[mask] == 0) # # # assert np.all(cov[:, mask] == 0) # # add whatever indices are left over to last subspace; doing it this way # # both saves us work and avoids breaking things when some columns are 0 # # as a result of earlier padding to multiple of subspace_len # missing_idxs = set(all_idxs) - set(perm) # if len(set(perm)) != len(perm): # TODO rm after debug # print("nsubspaces, subspace_len: ", nsubspaces, subspace_len) # print("size of set(all_idxs)", len(set(all_idxs))) # print("size of set(perm)", len(set(perm))) # print("number of missing_idxs", len(missing_idxs)) # # assert len(set(perm)) == len(perm) # import sys; sys.exit() # perm += list(missing_idxs) # return np.array(perm) # return all_idxs[::-1] # TODO rm after debug # return np.roll(all_idxs, 1) # TODO rm after debug # return all_idxs # TODO rm after debug # def ksparse_pca(X, ncomponents, k, algo='anydims'): # def ksparse_pca(X, ncomponents, k, algo='noreuse'): def ksparse_pca_v1(X, ncomponents, k, algo='1uniq'): N, D = X.shape k = int(k) assert k < D # TODO run dense randomized PCA to handle this case if algo == 'noreuse': assert ncomponents * k <= D # TODO allow dims to be included >1 time from sklearn.linear_model import OrthogonalMatchingPursuit omp = OrthogonalMatchingPursuit(n_nonzero_coefs=k, fit_intercept=False) if algo == '1uniq': assert k > 1 omp_initial = OrthogonalMatchingPursuit( n_nonzero_coefs=k - 1, fit_intercept=False) omp_final = OrthogonalMatchingPursuit( n_nonzero_coefs=1, fit_intercept=False) X = np.asfarray(X) # we'll be taking subsets of columns a lot X_res = np.copy(X) # allowed_idxs = set(np.arange(D)) allowed_idxs = np.arange(D) # all_used_idxs = set() V = None for i in range(ncomponents): # compute ideal projection, and resulting latent values v = top_principal_component(X_res).reshape(D, 1) if i > 0: # gram-schmidt to orthogonalize; we don't get to use this exact # vector anyway, so we don't care too much about numerical issues; # also, principal component of residuals should be in a subspace # that's orthogonal to V already, so might be able to prove this # step isn't even necessary prods = (V.T @ v).ravel() # (D x i+1).T @ (D x 1) = i+1 x 1 # print("prods shape: ", prods.shape) # print("V shape: ", V.shape) # print("v shape: ", v.shape) # print("projections shape: ", (V * prods).shape) v -= (V * prods).sum(axis=1, keepdims=True) # V = np.hstack((V, v)) # V, R = np.linalg.qr(V) # v = V[-1] h = X_res @ v # N x 1 # compute sparse version of this ideal projection # if False: if algo == 'anydims': v = omp.fit(X, h).coef_ elif algo == '1uniq': # 1 new idx -> possible to make orthogonal assert k > 1 if i == 0: v = omp.fit(X, h).coef_ # used_idxs = np.where(v != 0)[0] # all_used_idxs += set(used_idxs) else: # compute k-1 sparse v v = omp_initial.fit(X, h).coef_.ravel() initial_nonzero_idxs = np.where(v != 0)[0] # now find last zero to add, from set that have never been used h_res = h - (X @ v) use_allowed_idxs = set(allowed_idxs) - set(initial_nonzero_idxs) use_allowed_idxs = np.array(sorted(list(use_allowed_idxs))) X_subs = X[:, use_allowed_idxs] soln = omp_final.fit(X_subs, h_res).coef_.ravel() new_nonzero_idx = use_allowed_idxs[np.where(soln != 0)[0][0]] # now take union of all these idxs to get nonzero idxs to use use_idxs = list(initial_nonzero_idxs) + [new_nonzero_idx] use_idxs = np.array(use_idxs) # print("use_idxs", use_idxs) # given nonzero idxs, least squares to get v X_subs = X[:, use_idxs] soln, _, _, _ = np.linalg.lstsq(X_subs, h, rcond=None) v = np.zeros(D) v[use_idxs] = soln.ravel() else: # dims outright can't be reused assert algo == 'noreuse' X_subs = X[:, allowed_idxs] assert len(allowed_idxs) >= k soln = omp.fit(X_subs, h).coef_ v = np.zeros(D) v[allowed_idxs] = soln v = v.reshape(-1, 1) v /= np.linalg.norm(v) assert np.sum(v != 0) == k # update V, ensuring that it remains orthonormal # TODO the issue with this is that there doesn't necessarily *exist* # a k-sparse vector that's orthogonal to all others picked so far; we # could solve this by requiring dk <= D and making it impossible to # select the same input dimension twice; that's more restrictive than # is strictly needed though; what would be really nice is just writing # our own OMP that you can tell to not select certain idxs, because # that would create a combination that can't be made orthogonal; # probably adapt https://github.com/scikit-learn/scikit-learn/blob/1495f69242646d239d89a5713982946b8ffcf9d9/sklearn/linear_model/omp.py#L407 if i > 0: # if dims_can_be_reused: if algo != 'noreuse': nnz_idxs = np.where(v != 0)[0] assert len(nnz_idxs) <= k V_subs = V[nnz_idxs] v_subs = v[nnz_idxs] # niters_ortho = 1000 niters_ortho = 100 for it in range(niters_ortho): if False: prods = (V.T @ v).ravel() # print("prods shape: ", prods.shape) # print("V shape: ", V.shape) # print("v shape: ", v.shape) # print("projections shape: ", (V * prods).shape) v -= (V * prods).sum(axis=1, keepdims=True) v = v.ravel() zero_out_idxs = np.argsort(np.abs(v))[:-k] # keep_idxs = np.argsort(np.abs(v))[-k:] # print("i, it: ", i, it) # print(f"zeroing out {len(zero_out_idxs)} / {D} indices") # print("nnz before zeroing: ", np.sum(v != 0)) # old_v = v # v = np.zeros(D) # v[keep_idxs] = old_v[keep_idxs] v[zero_out_idxs] = 0 nnz = np.sum(v != 0) # print("nnz: ", nnz) # print("len v:", len(v)) # print("v", v) assert nnz <= k v /= np.linalg.norm(v) v = v.reshape(-1, 1) else: prods = (V_subs.T @ v_subs).ravel() v_subs -= (V_subs * prods).sum(axis=1, keepdims=True) # v_subs = v_subs.ravel() if np.max(np.abs(prods)) < 1e-5: # TODO add tol param # print("breaking at iter: ", it) break # pretty converged v = v.ravel() v[:] = 0 v[nnz_idxs] = v_subs.ravel() v /= np.linalg.norm(v) v = v.reshape(-1, 1) if algo in ('noreuse', '1uniq'): used_idxs = np.where(v != 0)[0] # used_idxs = [np.argmax(np.abs(v))] # only eliminate 1 idx allowed_idxs = set(allowed_idxs) - set(used_idxs) allowed_idxs = np.array(sorted(list(allowed_idxs))) if i > 0: V = np.hstack((V, v)) else: V = v # now update X_res; residuals from best linear approx of input given H H = X_res @ V W, _, _, _ = np.linalg.lstsq(H, X, rcond=None) X_res = X - (H @ W) return V # these are just for debugging def _to_sparse(x): x = x.ravel() idxs = np.where(x != 0)[0] vals = x[idxs] idxs = idxs.reshape(-1, 1) vals = vals.reshape(-1, 1) # print("idxs: ", idxs) # print("vals: ", vals) return np.hstack((idxs, vals)) def _to_sparse_cols(A): ars = [_to_sparse(A[:, j])[np.newaxis, ...] for j in range(A.shape[1])] return "\n".join([str(ar) for ar in ars]) # return np.concatenate(vecs, axis=0) def ksparse_pca(X, ncomponents, k): N, D = X.shape k = int(k) assert k < D # TODO run dense randomized PCA to handle this cases X = np.asfarray(X) # we'll be taking subsets of columns a lot X_res = np.copy(X) from sklearn.linear_model import OrthogonalMatchingPursuit omp = OrthogonalMatchingPursuit(n_nonzero_coefs=k, fit_intercept=False) idx_counts = np.zeros(D, dtype=np.int) V = None for i in range(ncomponents): v = top_principal_component(X_res).reshape(D, 1) if i > 0: # gram-schmidt to orthogonalize; we don't get to use this exact # vector anyway, so we don't care too much about numerical issues; # also, principal component of residuals should be in a subspace # that's orthogonal to V already, so might be able to prove this # step isn't even necessary prods = (V.T @ v).ravel() # (D x i+1).T @ (D x 1) = i+1 x 1 v -= (V * prods).sum(axis=1, keepdims=True) h = X_res @ v # compute sparse version of this ideal projection allowed_idxs = idx_counts < k X_subs = X[:, allowed_idxs] assert allowed_idxs.sum() >= k soln = omp.fit(X_subs, h).coef_ v = np.zeros(D) v[allowed_idxs] = soln nnz_idxs = v != 0 v = v.reshape(-1, 1) v /= np.linalg.norm(v) assert np.sum(v != 0) == k # TODO this is broken because having no dim used more than k times # isn't actually a sufficient condition to ensure that cols of V # can be made orthogonal; need to write our own OMP that can take # in existing nnz pattern of V and not include dims that would result # in too many linearly indep cols in that subspace # update idx_counts idx_counts[nnz_idxs] += 1 # make v orthogonal to existing cols in V if V is None: V = v continue V_subs = V[nnz_idxs].copy() nonzero_cols = V_subs.sum(axis=0) != 0 if np.sum(nonzero_cols) < 1: # already orthogonal to existing V V = np.hstack((V, v)) continue V_subs_orig = V_subs.copy() V_subs = V_subs[:, nonzero_cols] # V_subs, _ = np.linalg.qr(V_subs) debug = i == 7 v_subs = v[nnz_idxs].copy() niters_ortho = 100 if not debug else 1 v_orig = v.copy() v_subs_orig = v_subs.copy() for it in range(niters_ortho): prods = (V_subs.T @ v_subs).ravel() projections = (V_subs * prods).sum(axis=1, keepdims=True) # v_subs -= .999 * projections v_subs -= projections V_subs = V_subs[:, prods != 0] # if debug: # print("V_subs:\n", V_subs) # print("projections: ", projections) # # print("v_subs: ", projections) # SELF: issue here is that cols of V_subs are not necessarily # orthogonal, so projections can actually overcorrect and have # exactly the wrong component come to dominate v_subs /= np.linalg.norm(v_subs) if np.max(np.abs(prods)) < 1e-5: # TODO add tol param # print("breaking at iter: ", it) break # pretty converged if it == niters_ortho - 1: print(f"k={k}, it={it}") print(f"FAILED to get component {i} orthogonal") print("prods:\n", prods) # print("v before gram-schmidt:") # print(_to_sparse(v_orig)) # print("V with nonzeros in subspace: ") # V_subset = V[:, prods != 0] # print("V_subset shape:", V_subset.shape) # print(_to_sparse_cols(V_subset)) # # print(V[:, prods != 0]) # print("v:") # print(_to_sparse(v)) print("projections:", projections) print("V_subs_orig\n", V_subs_orig) print("v_subs_orig\n", v_subs_orig) print("V_subs:\n", V_subs[:, prods != 0]) print("v_subs:", v_subs) import sys; sys.exit() # print("got to ortho iteration: ", it) # nonzero_count_idxs = np.where(idx_counts)[0] # print("idx counts:\n", np.array(list(zip(nonzero_count_idxs, idx_counts[nonzero_count_idxs]))).T) # print("picked idxs: ", np.where(nnz_idxs)[0]) v = v.ravel() v[:] = 0 v[nnz_idxs] = v_subs.ravel() v /= np.linalg.norm(v) v = v.reshape(-1, 1) V = np.hstack((V, v)) # now update X_res; residuals from best linear approx of input given H H = X_res @ V W, _, _, _ = np.linalg.lstsq(H, X, rcond=None) X_res = X - (H @ W) return V def debug_orthogonalize(): # V = np.array([[0.0, 0.0, 0.0], # [-0.72, -0.367, 0.55], # [-0.463, 0.482, 0.0], # [-0.391, -0.457, -0.797]]) # v = np.array([[-0.243], # [-0.705], # [-0.427], # [-0.511]]) V = np.array([[0.759, 0.506, 0.41], [-0.58, 0.811, 0.0733], [0.0, 0.0, 0.0], [-0.296, -0.294, 0.909]]) v = np.array([[0.729], [-0.547], [0.261], [-0.318]]) print("V:\n", V) print("v:\n", v) V /= np.linalg.norm(V, axis=0) print("V norms: ", np.linalg.norm(V, axis=0)) for it in range(1): prods = (V.T @ v).ravel() print("prods: ", prods) projections = (V * prods).sum(axis=1, keepdims=True) print("projections:\n", projections) v -= projections v /= np.linalg.norm(v) # print("V:\n", V) print("new v:\n", v) # print("new prods: ", prods) # prods = (V.T @ v).ravel() # ================================================================ main def main(): # debug_orthogonalize(); return # TODO rm np.random.seed(12) # np.random.seed(6) # N, D = 20, 10 # N, D = 10000, 128 # N, D = 1000, 128 # N, D = 1000, 512 N, D = 10000, 64 # N, D = 10000, 32 # N, D = 10000, 16 # N, D = 10000, 8 # N, D = 10000, 10 d = int(D / 4) # create X with low-rank structure # np.random.seed(123) X0 = np.random.randn(N, d).astype(np.float32) X1 = np.random.randn(d, D).astype(np.float32) X = X0 @ X1 X += np.random.randn(N, D).astype(np.float32) * .1 # X = np.random.randn(N, D).astype(np.float32) # greedy_eigenvector_threshold(X, 3) # greedy_eigenvector_threshold(X, 3, sample_how='deterministic') # greedy_eigenvector_threshold(X, 3, sample_how='importance') # greedy_eigenvector_threshold(X, 3, use_corr=True) # k = 1 # k = 1 is really interesting; corresponds to just subsampling cols # k = 2 # k = 4 # k = 6 k = 8 k = min(k, int(D / d)) V = ksparse_pca(X, d, k) H = X @ V W, _, _, _ = np.linalg.lstsq(H, X, rcond=None) X_res = X - (H @ W) print("X sq frob norm: ", np.sum(X * X)) print("X res sq frob norm: ", np.sum(X_res * X_res)) # print("nnz in V cols: ", (V != 0).sum(axis=0)) from sklearn.decomposition import PCA pca = PCA(n_components=d).fit(X) # print("pca explained variance: ", pca.explained_variance_) V2 = pca.components_.T H = X @ V2 W, _, _, _ = np.linalg.lstsq(H, X, rcond=None) X_res = X - (H @ W) print("pca X res sq frob norm: ", np.sum(X_res * X_res)) VtV = V.T @ V VtV2 = V2.T @ V2 our_abs_offdiags = np.abs(VtV) - np.diag(np.diag(VtV)) pca_abs_offdiags = np.abs(VtV2) - np.diag(np.diag(VtV2)) print("our max abs off-diagonal, pca max abs off-diagonal:") print(np.max(our_abs_offdiags)) print(np.max(pca_abs_offdiags)) print("our mean abs off-diagonal, pca mean abs off-diagonal:") print(np.mean(our_abs_offdiags)) print(np.mean(pca_abs_offdiags)) # import matplotlib.pyplot as plt # import seaborn as sb # _, axes = plt.subplots(2) # # sb.heatmap(V.T @ V, ax=axes[0], cmap='RdBu') # # sb.heatmap(V2.T @ V2, ax=axes[1], cmap='RdBu') # sb.heatmap(V.T @ V, ax=axes[0]) # sb.heatmap(V2.T @ V2, ax=axes[1]) # # axes[0].imshow(V.T @ V, interpolation='nearest', cmap='RdBu') # # plt.colorbar(ax=axes[0]) # # axes[0].imshow(V2.T @ V2, interpolation='nearest', cmap='RdBu') # # plt.colorbar(ax=axes[1]) # axes[0].set_title("our V.T @ V") # axes[1].set_title("pca V.T @ V") # plt.tight_layout() # plt.show() # print("our V.T @ V: ", V.T @ V) # print("pca V.T @ V: ", V2.T @ V2) # # # Z = X - X.mean(axis=0) # # # pca = PCA(n_components=D).fit(X.T @ X) # # pca = PCA(n_components=D).fit(X) # # eigenvecs = pca.components_ # # print("PCA components:", eigenvecs) # # print("PCA singular vals:", pca.singular_values_) # # v, lamda = top_principal_component(X, return_eigenval=True, init='gauss') # # print("v: ", v) # # print("v * eigenvecs: ", (eigenvecs * v).sum(axis=1)) # from sklearn.decomposition import PCA # import time # # pca = PCA(n_components=D) # # pca = PCA(n_components=D, svd_solver='full') # TODO rm # pca = PCA(n_components=1, svd_solver='full') # TODO rm # # pca = PCA(n_components=1, svd_solver='randomized') # t = time.perf_counter() # pca.fit(X) # nsecs = time.perf_counter() - t # print("pca time (s): ", nsecs) # t = time.perf_counter() # v = top_principal_component(X) # nsecs = time.perf_counter() - t # print("our time (s): ", nsecs) # print("v * eigenvecs: ", (pca.components_ * v).sum(axis=1)[:5]) # # print("cossim between vecs: ", pca.components_ @ v) if __name__ == '__main__': np.set_printoptions(formatter={'float': lambda f: "{:.3}".format(f)}, linewidth=100) main()
bolt-master
experiments/python/subspaces.py
# first 3 functions taken from: # http://www.johnvinyard.com/blog/?p=268 import numpy as np from numpy.lib.stride_tricks import as_strided as ast # from .arrays import normalizeMat def norm_shape(shape): ''' Normalize numpy array shapes so they're always expressed as a tuple, even for one-dimensional shapes. Parameters shape - an int, or a tuple of ints Returns a shape tuple ''' try: i = int(shape) return (i,) except TypeError: # shape was not a number pass try: t = tuple(shape) return t except TypeError: # shape was not iterable pass raise TypeError('shape must be an int, or a tuple of ints') def sliding_window(a, ws, ss=None, flatten=True): ''' Return a sliding window over a in any number of dimensions Parameters: a - an n-dimensional numpy array ws - an int (a is 1D) or tuple (a is 2D or greater) representing the size of each dimension of the window ss - an int (a is 1D) or tuple (a is 2D or greater) representing the amount to slide the window in each dimension. If not specified, it defaults to ws. flatten - if True, all slices are flattened, otherwise, there is an extra dimension for each dimension of the input. Returns an array containing each n-dimensional window from a ''' if None is ss: # ss was not provided. the windows will not overlap in any direction. ss = ws ws = norm_shape(ws) ss = norm_shape(ss) # convert ws, ss, and a.shape to numpy arrays so that we can do math in every # dimension at once. ws = np.array(ws) ss = np.array(ss) shape = np.array(a.shape) # ensure that ws, ss, and a.shape all have the same number of dimensions ls = [len(shape), len(ws), len(ss)] if 1 != len(set(ls)): raise ValueError( 'a.shape, ws and ss must all have the same length. They were %s' % str(ls)) # ensure that ws is smaller than a in every dimension if np.any(ws > shape): raise ValueError( 'ws cannot be larger than a in any dimension.' 'a.shape was %s and ws was %s' % (str(a.shape), str(ws))) # how many slices will there be in each dimension? newshape = norm_shape(((shape - ws) // ss) + 1) # the shape of the strided array will be the number of slices in each dimension # plus the shape of the window (tuple addition) newshape += norm_shape(ws) # the strides tuple will be the array's strides multiplied by step size, plus # the array's strides (tuple addition) newstrides = norm_shape(np.array(a.strides) * ss) + a.strides strided = ast(a, shape=newshape, strides=newstrides) if not flatten: return strided # Collapse strided so that it has one more dimension than the window. I.e., # the new array is a flat list of slices. meat = len(ws) if ws.shape else 0 firstdim = (np.product(newshape[:-meat]),) if ws.shape else () dim = firstdim + (newshape[-meat:]) return strided.reshape(dim) def sliding_windows_of_elements(a, ss, ws=None, flatten=False): return [sliding_window(row, ss, ws, flatten) for row in a] def sliding_windows_of_rows(a, ss, ws=None, flatten=True): windowsForRows = sliding_windows_of_elements(a, ss, ws, flatten) return np.vstack(windowsForRows) def _compute_from_seq(allSubseqs, n): seqLens = np.array(map(lambda subseqs: subseqs.shape[0], allSubseqs)) startIdxs = np.r_[0, np.cumsum(seqLens)[:-1]] endIdxs = np.r_[startIdxs[1:], n] fromSeq = np.zeros(n) for i in range(len(startIdxs)): startIdx, endIdx = startIdxs[i], endIdxs[i] fromSeq[startIdx:endIdx] = i return fromSeq # def flattened_subseqs_of_length(seqs, m, norm=None, return_from_seq=False): # # TODO should have flags for returning X and allSubseqs, not just fromSeq # # each element of seqs is assumed to be a 1D or 2D array # origM = m # step = 1 # origDims = len(seqs[0].shape) # if origDims > 1: # sampleDimensions = np.prod(seqs[0].shape[1:]) # num cols in mat # m *= sampleDimensions # TODO don't enforce stepping in only one direction # step *= sampleDimensions # for i, seq in enumerate(seqs): # seqs[i] = seq.flatten() # allSubseqs = sliding_windows_of_elements(seqs, m, step) # X = np.asarray(allSubseqs, dtype=np.float).reshape((-1, m)) # -1 = compute it # Xnorm = normalizeMat(X, origM, how=norm) # if not return_from_seq: # return Xnorm, X, allSubseqs # fromSeq = _compute_from_seq(allSubseqs, Xnorm.shape[0]) # return Xnorm, X, allSubseqs, fromSeq # simple function for common case def sliding_window_1D(x, windowLen, step=1): return sliding_window(x, windowLen, step) class InputTooSmallException(Exception): pass def extract_conv2d_windows( X, filt_shape, strides=(1, 1), flatten_spatial_dims=False, flatten_examples_dim=False, padding='valid'): # TODO support NCHW format orig_X_ndim = X.ndim if X.ndim == 3: X = X[np.newaxis, ...] assert X.ndim == 4 assert len(filt_shape) == 2 assert len(strides) in (2, 4) filt_shape = int(filt_shape[0]), int(filt_shape[1]) if filt_shape[0] > X.shape[1]: # TODO rm after debug raise InputTooSmallException( "filt_shape[0] ({}) > X.shape[1] ({})".format( filt_shape[0], X.shape[1])) if filt_shape[1] > X.shape[2]: raise InputTooSmallException( "filt_shape[1] ({}) > X.shape[2] ({})".format( filt_shape[0], X.shape[2])) padding = padding.lower() assert padding in ('same', 'valid') pad_nrows = filt_shape[0] - 1 pad_ncols = filt_shape[1] - 1 if padding == 'same' and (pad_nrows > 0 or pad_ncols > 0): padded = np.zeros((X.shape[0], X.shape[1] + pad_nrows, X.shape[1] + pad_ncols, X.shape[3])) # NOTE: this should mirror the padding used by scipy and tensorflow; # however, since their exact behavior is only vaguely documented, it # may diverge from their behavior at any time. See the source code for # scipy.signal.convolve2d or https://stackoverflow.com/a/38111069 row_start = int(pad_nrows) // 2 row_end = row_start + X.shape[1] col_start = int(pad_ncols) // 2 col_end = col_start + X.shape[2] # print("padding to shape:", padded.shape) # print("padding: data row start, end:", row_start, row_end) # print("padding: data col start, end:", col_start, col_end) padded[:, row_start:row_end, col_start:col_end, :] = X X = padded filt_shape = (1, filt_shape[0], filt_shape[1], X.shape[3]) if len(strides) == 2: strides = (1, strides[0], strides[1], X.shape[3]) windows = sliding_window(X, filt_shape, strides, flatten=False) # strip out dims 3 and 4, since these are always 1; dim 3 is filter # position across channels (only one position, since doing 2D conv), # and dim 4 is all filter data across examples (not actually # convolving across examples); e.g., for first 200 examples from # MNIST with a 5x5 filter, goes from shape: # (200, 24, 24, 1, 1, 5, 5, 1) # to shape: # (200, 24, 24, 5, 5, 1) windows = windows.reshape(windows.shape[:3] + windows.shape[5:]) if flatten_spatial_dims: # nexamples x npositions x filt_size windows = windows.reshape(X.shape[0], -1, np.prod(filt_shape)) if flatten_examples_dim: windows = windows.reshape(-1, *windows.shape[2:]) if orig_X_ndim == 3: windows = windows.reshape(windows.shape[1:]) return windows if __name__ == '__main__': A = np.arange(24).reshape((6, 4)) print(A) ws = 3 ss = 1 print(sliding_windows_of_rows(A, ws, ss))
bolt-master
experiments/python/window.py
#!#!/bin/env/python from __future__ import print_function import numpy as np import torch import torch.nn.functional as F import torch.optim as optim from .utils import kmeans from joblib import Memory _memory = Memory('.', verbose=0) def _to_np(A): return A.cpu().detach().numpy() def _class_balanced_sampling(X, labels, k): np.random.seed(123) N, D = X.shape # intialize centroids by sampling from each class in proportion to its # relative frequency uniq_lbls, counts = np.unique(labels, return_counts=True) sort_idxs = np.argsort(counts) uniq_lbls = uniq_lbls[sort_idxs] counts = counts[sort_idxs] remaining_counts = np.cumsum(counts[::-1])[::-1] nremaining_samples = k # C = np.empty((k, D), dtype=np.float32) C = [] C_labels = [] # affinities = np.zeros((k, nclasses), dtype=np.float32) for i, lbl in enumerate(uniq_lbls): count = counts[i] target_frac = count / remaining_counts[i] target_nsamples = int(nremaining_samples * target_frac + .999) target_nsamples = max(1, target_nsamples) target_nsamples = min(target_nsamples, count) nremaining_samples -= target_nsamples lbl_idxs = np.where(labels == lbl)[0] # print("lbl, count, num lbl idxs: ", lbl, count, len(lbl_idxs)) assert len(lbl_idxs) == count use_idxs = np.random.choice(count, size=target_nsamples, replace=False) keep_idxs = lbl_idxs[use_idxs] C.append(X[keep_idxs]) C_labels.append(np.full(target_nsamples, lbl, dtype=np.int32)) # if len(C).shape[0] < k: C = np.vstack(C).astype(np.float32) # print("k, C shape", k, C.shape) assert C.shape == (k, D) C_labels = np.hstack(C_labels) assert C_labels.shape == (k,) return C, C_labels def neighbor_compression(X, labels, k, niters=1000, rel_tol=.0001, verbose=1): N, D = X.shape # one-hot encode labels nclasses = len(np.unique(labels)) # Y = np.zeros((N, nclasses), dtype=np.float32) # for i in range(N): # Y[i, labels[i]] = 1 # intialize centroids # C, _ = kmeans(X, k) C, C_labels = _class_balanced_sampling(X, labels, k) # convert to torch tensors for optimization # Y = torch.from_numpy(Y) C = torch.tensor(C.T, requires_grad=True) # not from_numpy to allow grad X = torch.from_numpy(X) # having trained class affinities doesn't really seem to help # Z = torch.randn(k, nclasses, requires_grad=True) # print("uniq labels: ", np.unique(labels)) # print("uniq C_labels: ", np.unique(C_labels)) # one-hot encode labels affinities = torch.zeros((k, nclasses), dtype=torch.float32, requires_grad=True) for kk in range(k): affinities[kk, C_labels[kk]] = 1 Z = affinities.clone().detach().requires_grad_(True) labels = torch.from_numpy(labels) loss_fn = torch.nn.CrossEntropyLoss() # opt = optim.SGD([C], lr=.1, momentum=.9) # opt = optim.SGD([C, affinities], lr=.1, momentum=.9) opt = optim.SGD([C, Z], lr=.1, momentum=.9) # X_norms_sq = (X * X).sum(dim=1).view(-1, 1) prev_loss = np.inf for t in range(niters): temperature = np.log2(t + 2) # +2 so that it starts at 1 at t=0 # # compute distances to all centroids # # prods = torch.mm(X, C) # prods = X @ C # # norms_sq = torch.sqrt(torch.sum(C * C)) # # dists_sq = prods - norms_sq # # C_norms_sq = torch.sqrt(torch.sum(C * C, dim=0)) # # C_norms_sq = torch.sum(C * C, dim=0) # # dists_sq = -2 * prods # # dists_sq += X_norms_sq # # dists_sq += C_norms_sq # # neg_dists_sq = -dists_sq # neg_dists_sq = prods # # # update soft labels for each centroid # # similarities = F.softmax(neg_dists_sq, dim=0) # N x C; sim to each sample # # class_affinities = similarities.transpose(0, 1) @ Y # C x nclasses # # class_affinities = F.softmax(class_affinities * temperature, dim=1) # # update class assignments for inputs # # centroid_similarities = F.softmax(neg_dists_sq * temperature, dim=1) # N x C # centroid_similarities = F.softmax(neg_dists_sq, dim=1) # N x C # # centroid_similarities = torch.exp(neg_dists_sq / np.sqrt(D)) # # logits = centroid_similarities @ class_affinities # logits = centroid_similarities @ Z # way simpler version similarities = F.softmax(X @ C, dim=1) # N x C # logits = similarities @ Z affinities = F.softmax(Z * temperature, dim=1) # affinities = F.softmax(affinities * temperature, dim=1) logits = similarities @ affinities # update params and print how we're doing loss = loss_fn(logits, labels) loss.backward() opt.step() opt.zero_grad() loss_pyfloat = loss.item() change = prev_loss - loss_pyfloat thresh = rel_tol * min(loss_pyfloat, prev_loss) if np.abs(change) < thresh: if verbose > 0: _, labels_hat = torch.max(logits, dim=1) acc = torch.mean((labels == labels_hat).type(torch.float)) print("converged after {} iters with acc {:.3f}, loss: {:.4f}" "".format(t + 1, acc.item(), loss_pyfloat)) break # converged prev_loss = loss_pyfloat if (verbose > 1) and ((t + 1) % 10 == 0): _, labels_hat = torch.max(logits, dim=1) acc = torch.mean((labels == labels_hat).type(torch.float)).item() print("acc: ", acc) print("{:.3f}".format(loss.item())) # convert to python float # return _to_np(C).T, _to_np(class_affinities) centroid_labels = np.argmax(_to_np(Z), axis=1) return _to_np(C).T, centroid_labels # or at least, ProtoNN without the L0 constraints; also with simultaneous # updates to all param tensors instead of alternating # def protonn(X, labels, k, niters=10000, verbose=1, gamma=1): def protonn(X, labels, k, d=-1, niters=1000, verbose=1, gamma=-1): N, D = X.shape if gamma < 1: gamma = 1. / np.sqrt(D) # makes it struggle less / not make NaNs # gamma = 1. / D if d < 1: d = D labels = torch.from_numpy(labels) # # one-hot encode labels nclasses = len(np.unique(labels)) # Y = np.zeros((N, nclasses), dtype=np.float32) # for i in range(N): # Y[i, labels[i]] = 1 # intialize centroids C, _ = kmeans(X, k) W = np.random.randn(D, d).astype(np.float32) # C = C @ W # W = np.eye(D).astype(np.float32)[:, :d] # better than randn init # convert to torch tensors for optimization # Y = torch.from_numpy(Y) C = torch.tensor(C.T, requires_grad=True) # not from_numpy to allow grad X = torch.from_numpy(X) W = torch.tensor(W, requires_grad=True) # not from_numpy to allow grad # gamma = torch.tensor(np.array(gamma, dtype=np.float32), requires_grad=True) # labels = torch.from_numpy(labels) # print("W", W[:10]) # return None, None, None Z = torch.randn(k, nclasses, requires_grad=True) loss_fn = torch.nn.CrossEntropyLoss() # opt = optim.SGD([C, Z], lr=.1, momentum=.9) opt = optim.SGD([C, W, Z], lr=.1, momentum=.9) # opt = optim.SGD([C, W, Z, gamma], lr=.1, momentum=.9) nbatches = 1 batch_sz = int(np.ceil(N / nbatches)) # batch_sz = 1024 # nbatches = int(np.ceil(N / batch_sz)) # for t in range(1): for t in range(niters): perm = np.random.permutation(N) for b in range(nbatches): start_idx = b * batch_sz end_idx = min(start_idx + batch_sz, N) perm_idxs = perm[start_idx:end_idx] X_batch = X[perm_idxs] labels_batch = labels[perm_idxs] # temperature = np.log2(t + 2) # +2 so that it starts at 1 at t=0 # compute distances to all centroids # embeddings = X @ W # embeddings = X_batch @ W embeddings = X_batch embed_norms_sq = (embeddings * embeddings).sum(dim=1, keepdim=True) # prods = torch.mm(embeddings, C) prods = embeddings @ C C_norms_sq = torch.sum(C * C, dim=0) dists_sq = -2 * prods dists_sq += embed_norms_sq dists_sq += C_norms_sq neg_dists_sq = -dists_sq # print("gamma: ", gamma) # use_gamma = torch.clamp(gamma, max=1.) # use_gamma = torch.clamp(gamma, 0, 1) # use_gamma = F.sigmoid(gamma) # gamma = torch.min((1, gamma)) # gamma = torch.max((0, gamma)) assert np.min(_to_np(dists_sq)) >= 0 assert np.max(_to_np(neg_dists_sq)) <= 0 similarities = torch.exp(gamma * neg_dists_sq) # N x C # similarities = torch.exp(use_gamma * neg_dists_sq) # N x C logits = similarities @ Z # print("logits shape: ", logits.shape) # print("logits shape: ", logits.shape) # logits_np = _to_np(logits) # print("dists_sq shape", dists_sq.shape) # print("dists_sq", dists_sq[:10]) # print("C_norms_sq", C_norms_sq) # print("embed_norms_sq", embed_norms_sq[:10]) # print("similarities", similarities[:10]) # print("logits", logits[:10]) # update soft labels for each centroid # similarities = F.softmax(neg_dists_sq, dim=0) # N x C; sim to each sample # class_affinities = similarities.transpose(0, 1) @ Y # C x nclasses # class_affinities = F.softmax(class_affinities * temperature, dim=1) # # update class assignments for inputs # centroid_similarities = F.softmax(neg_dists_sq * temperature, dim=1) # N x C # logits = centroid_similarities @ affinities # update params and print how we're doing # loss = loss_fn(logits, labels) loss = loss_fn(logits, labels_batch) # loss += .01 * (gamma * gamma).sum() loss.backward() opt.step() opt.zero_grad() # if (verbose > 0) and (t % 10 == 0): # if (verbose > 0) and ((t + 1) % 10 == 0): if (verbose > 0) and ((t + 1) % 10 == 0) and b == 0: _, labels_hat = torch.max(logits, dim=1) acc = torch.mean((labels[perm_idxs] == labels_hat).type(torch.float)) print("acc: ", acc) print("{:.3f}".format(loss.item())) # convert to python float # print("gamma: ", gamma.item()) return _to_np(C).T, _to_np(W), _to_np(Z) @_memory.cache def stochastic_neighbor_compression(X, labels, k, niters=1000, gamma=-1, rel_tol=.0001, verbose=1): N, D = X.shape nclasses = len(np.unique(labels)) if gamma < 1: gamma = 1 # gamma = 1. / np.sqrt(D) # makes it struggle less / not make NaNs # gamma = 1. / D # labels = torch.from_numpy(labels) # C = np.random.randn(k, D).astype(np.float32) C, C_labels = _class_balanced_sampling(X, labels, k) # one-hot encode labels affinities = torch.zeros((k, nclasses), dtype=torch.float32) for kk in range(k): affinities[kk, C_labels[kk]] = 1 # so that there's actual gradient flow affinities += torch.randn(k, nclasses) * .1 # W = np.random.randn(D, D).astype(np.float32) # C = C @ W # W = np.eye(D).astype(np.float32) # better than randn init # convert to torch tensors for optimization # Y = torch.from_numpy(Y) C = torch.tensor(C.T, requires_grad=True) # not from_numpy to allow grad X = torch.from_numpy(X) labels = torch.from_numpy(labels) gamma = torch.tensor(np.array(gamma, dtype=np.float32)) # affinities = torch.from_numpy(affinities) # print("labels shape: ", labels.shape) # print("uniq labels: ", uniq_lbls) # print("uniq label counts: ", counts) # labels = labels.reshape(-1, 1) # print("labels shape: ", labels.shape) # W = torch.tensor(W, requires_grad=True) # not from_numpy to allow grad # print("W", W[:10]) # return None, None, None # Z = torch.randn(k, nclasses, requires_grad=True) loss_fn = torch.nn.CrossEntropyLoss() opt = optim.SGD([C], lr=.1, momentum=.9) # opt = optim.SGD([C, Z], lr=.1, momentum=.9) # opt = optim.SGD([C, gamma], lr=.1, momentum=.9) nbatches = 1 batch_sz = int(np.ceil(N / nbatches)) # batch_sz = 1024 # nbatches = int(np.ceil(N / batch_sz)) # for t in range(50): prev_loss = np.inf converged = False t = 0 while t < niters and not converged: perm = np.random.permutation(N) for b in range(nbatches): if nbatches > 1: start_idx = b * batch_sz end_idx = min(start_idx + batch_sz, N) perm_idxs = perm[start_idx:end_idx] X_batch = X[perm_idxs] labels_batch = labels[perm_idxs] else: X_batch = X labels_batch = labels # temperature = np.log2(t + 2) # +2 so that it starts at 1 at t=0 # compute distances to all centroids # embeddings = X @ W # embeddings = X_batch @ W embeddings = X_batch embed_norms_sq = (embeddings * embeddings).sum(dim=1, keepdim=True) # prods = torch.mm(embeddings, C) prods = embeddings @ C C_norms_sq = torch.sum(C * C, dim=0) dists_sq = -2 * prods dists_sq += embed_norms_sq dists_sq += C_norms_sq neg_dists_sq = -dists_sq # print("min dist sq: ", torch.min(dists_sq).item()) minval_dist_sq = torch.min(dists_sq).item() if minval_dist_sq < -.01: print("min dist sq: ", minval_dist_sq) print("min C_norms_sq", torch.min(C_norms_sq).item()) print("min X_norms_sq", torch.min(embed_norms_sq).item()) print("dists_sq: ", dists_sq[:10]) assert minval_dist_sq >= -.01 # assert np.min(_to_np(dists_sq)) >= -1e-3 # assert np.max(_to_np(neg_dists_sq)) <= 1e-3 similarities = torch.exp(gamma * neg_dists_sq) # N x C logits = similarities @ affinities # logits = similarities @ Z # print("logits shape: ", logits.shape) # print("logits shape: ", logits.shape) # print("dists_sq shape", dists_sq.shape) # print("dists_sq", dists_sq[:10]) # print("C_norms_sq", C_norms_sq) # print("embed_norms_sq", embed_norms_sq[:10]) # print("similarities", similarities[:10]) # print("logits", logits[:10]) # update params and print how we're doing loss = loss_fn(logits, labels_batch) # loss += gamma * gamma loss.backward() opt.step() opt.zero_grad() loss_pyfloat = loss.item() change = prev_loss - loss_pyfloat thresh = rel_tol * min(loss_pyfloat, prev_loss) if np.abs(change) < thresh: if verbose > 0: _, labels_hat = torch.max(logits, dim=1) labels_true = labels[perm_idxs] if nbatches > 1 else labels acc = torch.mean( (labels_true == labels_hat).type(torch.float)) print("converged after {} iters with acc {:.3f}, loss: {:.4f}" # noqa "".format(t + 1, acc.item(), loss_pyfloat)) converged = True # converged break prev_loss = loss_pyfloat # if (verbose > 0) and ((t + 1) % 10 == 0): # if (verbose > 0) and ((t + 1) % 10 == 0) and b == 0: if (verbose > 1) and (t % 10 == 0) and b == 0: _, labels_hat = torch.max(logits, dim=1) labels_true = labels[perm_idxs] if nbatches > 1 else labels acc = torch.mean( (labels_true == labels_hat).type(torch.float)) print("acc: {:.3f}".format(acc.item())) print("{:.3f}".format(loss.item())) # convert to python float # print("gamma: ", gamma.item()) t += 1 return _to_np(C).T, C_labels def linear_regression_log_loss( X, Y, lamda=1, max_niters=1000, rel_tol=.0001, verbose=2): N, D = X.shape N, M = Y.shape X = X.astype(np.float32) Y = Y.astype(np.float32) # initialize W to OLS solution XtX = X.T @ X XtX += np.eye(D) * np.std(X) XtY = X.T @ Y W = np.linalg.solve(XtX, XtY).astype(np.float32) # W += np.random.randn(*W.shape) X = torch.from_numpy(X) Y = torch.from_numpy(Y) W = torch.tensor(W, requires_grad=True) # W = torch.randn(D, M, requires_grad=True) # W += torch.randn(D, M, requires_grad=False) opt = optim.SGD([W], lr=.1, momentum=.9) # now optimize using pytorch prev_loss = np.inf for t in range(max_niters): Y_hat = X @ W diffs = Y - Y_hat # errs = torch.floor(torch.abs(diffs)) # loss = torch.abs(diffs) # TODO rm # loss = diffs * diffs loss = torch.log2(1 + torch.abs(diffs)) # loss = torch.log2(1e-10 + torch.abs(diffs)) # loss *= (loss > 0).type(torch.float32) loss = torch.mean(loss) # loss = torch.max(loss, 0) loss.backward() opt.step() opt.zero_grad() loss_pyfloat = loss.item() change = prev_loss - loss_pyfloat thresh = rel_tol * min(loss_pyfloat, prev_loss) if np.abs(change) < thresh: if verbose > 0: print("converged after {} iters with loss: {:.4f}".format( t + 1, loss_pyfloat)) break # converged prev_loss = loss_pyfloat if (verbose > 1) and ((t + 1) % 10 == 0): print("loss: {:.4f}".format(loss_pyfloat)) return _to_np(W) def main(): # N, D = 10000, 20 N, D = 1000, 20 # niters = 1000 niters = 10000 X = np.random.randn(N, D).astype(np.float32) # ------------------------ linear regression with weird loss # M = 20 # Y = np.random.randn(N, M).astype(np.float32) # linear_regression_log_loss(X, Y) # ------------------------ neighbor compression K = 16 nclasses = 5 # labels = torch.randint(nclasses, size=(N,)) # labels = _to_np(torch.randint(nclasses, size=(N,))) labels = np.random.randint(nclasses, size=(N,)) # C, W, Z = protonn(X, labels, K, niters=niters) # significantly worse C, centroid_labels = stochastic_neighbor_compression(X, labels, K, niters=niters) # C, centroid_labels = neighbor_compression(X, labels, K, niters=niters) print("centroid_labels:", centroid_labels) print("C type, shape", type(C), C.shape) print("done") if __name__ == '__main__': main()
bolt-master
experiments/python/misc_algorithms.py
#!/usr/bin/env python import os import numpy as np import pandas as pd # TODO this file is hideous (but necessarily so for deadline purposes...) # # Also, this file is tightly coupled to figs.py; it basically has a func # for each figure func that spits out data in exactly the required form MCQ_RESULTS_DIR = '../results/timing/' MATMUL_RESULTS_DIR = '../results/matmul/' def get_mcq_path(D, nbytes): fname = 'mcq_D={}_M={}.txt'.format(D, nbytes) return os.path.join(MCQ_RESULTS_DIR, fname) class McqResults(object): def __init__(self, path=None, D=None, nbytes=None): if path is None: path = get_mcq_path(D=D, nbytes=nbytes) self.path = path with open(self.path, 'r') as f: self.lines = f.readlines() self.stats = {line.split(':')[0].strip(): line.split(':')[1].strip() for line in self.lines if ':' in line} self.bolt_nbytes = int(self.stats['bolt M']) self.pq_nbytes = int(self.stats['pq M']) self.bolt_D = int(self.stats['bolt subvect_len']) * self.bolt_nbytes * 2 self.pq_D = int(self.stats['pq subvect_len']) * self.pq_nbytes assert self.bolt_nbytes == self.pq_nbytes assert self.bolt_D == self.pq_D self.nbytes = self.bolt_nbytes self.D = self.bolt_D # check that file was named properly expected_path = get_mcq_path(D=self.D, nbytes=self.nbytes) if expected_path != path: print("expected path, path = ", expected_path, path) assert expected_path == path def __str__(self): # for debugging s = "" sorted_keys = sorted(self.stats.keys()) for k in sorted_keys: v = self.stats[k] s += "'{}': '{}'\n".format(k, v) return s def _extract_thruput(profile_str): result_strs = profile_str.split(':')[-1] rep_strs = result_strs.strip(' ,').split(',') thruput_parens = [s.strip(' ').split(' ')[1] for s in rep_strs] return np.array([int(s.strip('()s/')) for s in thruput_parens]) def _extract_times(profile_str): result_strs = profile_str.split(':')[-1] rep_strs = result_strs.strip(' ,').split(',') time_strs = [s.strip(' ').split(' ')[0] for s in rep_strs] return np.array([float(s) for s in time_strs]) def popcount_results_256(): LENGTH = 256 popcnt_times = {} popcnt_times[8] = '2.456 (1302931596/s), 2.344 (1365187713/s), 2.125 (1505882352/s), 2.829 (1131141746/s), 2.148 (1489757914/s), 2.167 (1476695892/s), 2.327 (1375161151/s), 2.145 (1491841491/s), 2.12 (1509433962/s), 2.112 (1515151515/s)' popcnt_times[16] = '4.368 (732600732/s), 4.121 (776510555/s), 3.926 (815078960/s), 4.105 (779537149/s), 4.176 (766283524/s), 4.119 (776887594/s), 4.464 (716845878/s), 4.153 (770527329/s), 4.364 (733272227/s), 4.198 (762267746/s)' popcnt_times[32] = '7.612 (420388859/s), 7.347 (435551925/s), 7.694 (415908500/s), 9.122 (350800263/s), 7.343 (435789186/s), 9.344 (342465753/s), 8.148 (392734413/s), 9.046 (353747512/s), 8.455 (378474275/s), 7.685 (416395575/s)' bolt_times = {} bolt_times[8] = '0.461 (2169197396/s), 0.456 (2192982456/s), 0.539 (1855287569/s), 0.53 (1886792452/s), 0.456 (2192982456/s), 0.452 (2212389380/s), 0.442 (2262443438/s), 0.438 (2283105022/s), 0.434 (2304147465/s), 0.547 (1828153564/s)' bolt_times[16] = '0.894 (1118568232/s), 1.08 (925925925/s), 0.88 (1136363636/s), 0.877 (1140250855/s), 0.881 (1135073779/s), 0.847 (1180637544/s), 1.011 (989119683/s), 0.866 (1154734411/s), 0.984 (1016260162/s), 0.838 (1193317422/s)' bolt_times[32] = '2.047 (488519785/s), 1.726 (579374275/s), 1.924 (519750519/s), 2.085 (479616306/s), 2.076 (481695568/s), 1.748 (572082379/s), 1.757 (569151963/s), 2.064 (484496124/s), 1.742 (574052812/s), 1.725 (579710144/s)' out_dicts = [] algos = ['Bolt', 'Binary Embedding'] dicts = [bolt_times, popcnt_times] for algo, d in zip(algos, dicts): for nbytes, s in list(d.items()): thruputs = _extract_thruput(s) out_dicts += [{'algo': algo, 'nbytes': nbytes, 'length': LENGTH, 'trial': i, 'y': t} for i, t in enumerate(thruputs)] return pd.DataFrame.from_records(out_dicts) def encode_results(): dicts = [] for D in [64, 128, 256, 512, 1024]: for nbytes in [8, 16, 32]: res = McqResults(D=D, nbytes=nbytes) abbrevs = ['bolt', 'pq', 'opq'] names = ['Bolt', 'PQ', 'OPQ'] for abbrev, name in zip(abbrevs, names): # results for encoding data key = abbrev + ' encode (10x5)' thruputs = _extract_thruput(res.stats[key]) dicts += [{'task': 'encode_x', 'D': D, 'nbytes': nbytes, 'algo': name, 'trial': i, 'y': t} for i, t in enumerate(thruputs)] # results for encoding query if abbrev == 'bolt': key = abbrev + ' encode lut (10x5)' else: key = abbrev + ' encode lut float dist (10x5)' thruputs = _extract_thruput(res.stats[key]) dicts += [{'task': 'encode_q', 'D': D, 'nbytes': nbytes, 'algo': name, 'trial': i, 'y': t} for i, t in enumerate(thruputs)] return pd.DataFrame.from_records(dicts) def matmul_results(which='square'): if which == 'square': SIZES = [64, 128, 256, 512, 1024, 4096, 8192] data_fname = 'square_matmul_results.txt' elif which == 'tall': SIZES = [32, 64, 128, 256, 512, 1024] data_fname = 'tall_matmul_results.txt' with open(MATMUL_RESULTS_DIR + data_fname) as f: lines = f.readlines() stats = {line.split(':')[0].strip(): line.split(':')[1].strip() for line in lines if ':' in line} dicts = [] # add in results from bolt for nbytes in [8, 16, 32]: prefix = 'bolt<{}>'.format(nbytes) algo = 'Bolt {}B'.format(nbytes) for sz in SIZES: for enc in (0, 1): # don't vs do encode X at start key = '{} encode={} matmul {} (10x5)'.format(prefix, enc, sz) times = _extract_times(stats[key]) dicts += [{'algo': algo, 'size': sz, 'enc': enc, 'nbytes': nbytes, 'trial': i, 'y': t} for i, t in enumerate(times)] # also add in "encode" version of bolt if enc: enc_algo_name = algo + ' + Encode' dicts += [{'algo': enc_algo_name, 'size': sz, 'enc': enc, 'nbytes': nbytes, 'trial': i, 'y': t} for i, t in enumerate(times)] # add in matmul results for sz in SIZES: key = 'matmul {} (10x5)'.format(sz) times = _extract_times(stats[key]) dicts += [{'algo': 'Floats', 'size': sz, 'enc': -1, 'trial': i, 'y': t} for i, t in enumerate(times)] return pd.DataFrame.from_records(dicts) def encode_data_results_256(): LENGTH = 256 pq_times = {} pq_times[8] = 'pq encode (10x5): 6.696 (149342/s), 6.688 (149521/s), 6.639 (150625/s), 6.648 (150421/s), 6.711 (149009/s), 6.67 (149925/s), 6.634 (150738/s), 6.684 (149611/s), 6.663 (150082/s), 6.67 (149925/s),' pq_times[16] = 'pq encode (10x5): 7.181 (139256/s), 7.194 (139004/s), 7.179 (139295/s), 7.146 (139938/s), 7.123 (140390/s), 7.123 (140390/s), 7.162 (139625/s), 7.148 (139899/s), 7.116 (140528/s), 7.193 (139024/s),' pq_times[32] = 'pq encode (10x5): 8.089 (123624/s), 8.175 (122324/s), 8.117 (123198/s), 8.096 (123517/s), 8.48 (117924/s), 8.071 (123900/s), 8.126 (123061/s), 8.123 (123107/s), 8.069 (123931/s), 8.21 (121802/s),' opq_times = {} opq_times[8] = 'opq encode (10x5): 8.441 (118469/s), 8.385 (119260/s), 8.368 (119502/s), 8.39 (119189/s), 8.355 (119688/s), 8.388 (119217/s), 8.383 (119289/s), 8.412 (118877/s), 8.401 (119033/s), 8.391 (119175/s),' opq_times[16] = 'opq encode (10x5): 8.88 (112612/s), 8.786 (113817/s), 8.874 (112688/s), 8.834 (113199/s), 8.874 (112688/s), 8.902 (112334/s), 8.899 (112372/s), 8.925 (112044/s), 8.867 (112777/s), 8.907 (112271/s),' opq_times[32] = 'opq encode (10x5): 9.761 (102448/s), 9.718 (102901/s), 9.717 (102912/s), 9.726 (102817/s), 9.908 (100928/s), 9.796 (102082/s), 10.164 (98386/s), 9.792 (102124/s), 9.735 (102722/s), 9.729 (102785/s),' bolt_times = {} bolt_times[8] = 'bolt encode (10x5): 3.43 (2915451/s), 3.586 (2788622/s), 3.421 (2923121/s), 3.408 (2934272/s), 3.409 (2933411/s), 3.406 (2935995/s), 3.407 (2935133/s), 3.412 (2930832/s), 3.411 (2931691/s), 3.409 (2933411/s),' bolt_times[16] = 'bolt encode (10x5): 3.93 (2544529/s), 3.687 (2712232/s), 3.826 (2613695/s), 4.007 (2495632/s), 3.705 (2699055/s), 3.976 (2515090/s), 3.709 (2696144/s), 3.681 (2716653/s), 3.693 (2707825/s), 3.802 (2630194/s),' bolt_times[32] = 'bolt encode (10x5): 5.039 (1984520/s), 4.591 (2178174/s), 5.081 (1968116/s), 4.697 (2129018/s), 4.591 (2178174/s), 4.763 (2099517/s), 4.832 (2069536/s), 4.805 (2081165/s), 4.961 (2015722/s), 4.665 (2143622/s),' out_dicts = [] algos = ['Bolt', 'PQ', 'OPQ'] dicts = [bolt_times, pq_times, opq_times] for algo, d in zip(algos, dicts): for nbytes, s in list(d.items()): thruputs = _extract_thruput(s) out_dicts += [{'algo': algo, 'nbytes': nbytes, 'length': LENGTH, 'trial': i, 'y': t} for i, t in enumerate(thruputs)] return pd.DataFrame.from_records(out_dicts) def encode_lut_results(): pq_times = {} pq_times[8] = 'pq encode lut float dist (10x5): 64.986 (153879/s), 65.014 (153813/s), 65.155 (153480/s), 64.808 (154301/s), 66.593 (150165/s), 67.68 (147754/s), 69.399 (144094/s), 66.702 (149920/s), 66.234 (150979/s), 66.286 (150861/s),' pq_times[16] = 'pq encode lut float dist (10x5): 67.893 (147290/s), 67.484 (148183/s), 69.608 (143661/s), 68.083 (146879/s), 70.958 (140928/s), 69.423 (144044/s), 72.129 (138640/s), 74.984 (133361/s), 70.837 (141169/s), 74.967 (133392/s),' pq_times[32] = 'pq encode lut float dist (10x5): 78.809 (126889/s), 79.34 (126039/s), 78.565 (127283/s), 79.171 (126308/s), 78.372 (127596/s), 78.689 (127082/s), 78.094 (128050/s), 80.031 (124951/s), 93.367 (107104/s), 81.896 (122106/s),' opq_times = {} opq_times[8] = 'opq encode lut float dist (10x5): 155.68 (64234/s), 159.49 (62698/s), 160.64 (62249/s), 158.21 (63205/s), 159.37 (62747/s), 159.29 (62778/s), 160.81 (62186/s), 158.5 (63090/s), 155.22 (64423/s), 158.98 (62901/s),' opq_times[16] = 'opq encode lut float dist (10x5): 170.42 (58677/s), 168.41 (59380/s), 169.12 (59129/s), 171.53 (58298/s), 167.32 (59766/s), 168.96 (59185/s), 170.43 (58676/s), 170.7 (58581/s), 169.86 (58870/s), 160.43 (62333/s),' opq_times[32] = 'opq encode lut float dist (10x5): 170.86 (58527/s), 175.79 (56885/s), 169.86 (58870/s), 180.3 (55464/s), 172.46 (57983/s), 171.66 (58254/s), 167.23 (59799/s), 168.19 (59457/s), 164.47 (60801/s), 168.31 (59413/s),' bolt_times = {} bolt_times[8] = 'bolt encode lut (10x5): 2.907 (3439972/s), 2.911 (3435245/s), 2.902 (3445899/s), 2.899 (3449465/s), 2.907 (3439972/s), 2.908 (3438789/s), 2.908 (3438789/s), 2.906 (3441156/s), 2.906 (3441156/s), 2.908 (3438789/s),' bolt_times[16] = 'bolt encode lut (10x5): 2.957 (3381805/s), 2.953 (3386386/s), 2.957 (3381805/s), 2.943 (3397893/s), 2.949 (3390979/s), 2.95 (3389830/s), 2.946 (3394433/s), 3.103 (3222687/s), 2.944 (3396739/s), 3.029 (3301419/s),' bolt_times[32] = 'bolt encode lut (10x5): 2.511 (3982477/s), 2.51 (3984063/s), 2.587 (3865481/s), 2.508 (3987240/s), 2.847 (3512469/s), 2.508 (3987240/s), 2.508 (3987240/s), 2.769 (3611412/s), 2.729 (3664345/s), 2.556 (3912363/s),' out_dicts = [] algos = ['Bolt', 'PQ', 'OPQ'] dicts = [bolt_times, pq_times, opq_times] for algo, d in zip(algos, dicts): for nbytes, s in list(d.items()): thruputs = _extract_thruput(s) out_dicts += [{'algo': algo, 'nbytes': nbytes, 'y': t} for t in thruputs] return pd.DataFrame.from_records(out_dicts) def query_speed_results(): # NOTE: all thruputs in this function (except matmul ones) need be # multiplied by 100,000 because we're reporting distances/sec, not time # to query 100k points bolt_times = {} bolt_times[8] = '4.385 (22805/s), 4.385 (22805/s), 4.408 (22686/s), 4.385 (22805/s), 5.117 (19542/s), 4.378 (22841/s), 4.392 (22768/s), 4.393 (22763/s), 4.381 (22825/s), 4.383 (22815/s)' bolt_times[16] = '8.268 (12094/s), 9.807 (10196/s), 8.389 (11920/s), 8.681 (11519/s), 8.711 (11479/s), 8.293 (12058/s), 9.797 (10207/s), 8.32 (12019/s), 9.767 (10238/s), 9.499 (10527/s)' bolt_times[32] = '19.385 (5158/s), 17.215 (5808/s), 18.612 (5372/s), 18.117 (5519/s), 17.323 (5772/s), 18.436 (5424/s), 18.979 (5268/s), 16.274 (6144/s), 19.696 (5077/s), 17.026 (5873/s)' popcnt_times = {} popcnt_times[8] = '2.456 (1302931596/s), 2.344 (1365187713/s), 2.125 (1505882352/s), 2.829 (1131141746/s), 2.148 (1489757914/s), 2.167 (1476695892/s), 2.327 (1375161151/s), 2.145 (1491841491/s), 2.12 (1509433962/s), 2.112 (1515151515/s)' popcnt_times[16] = '4.368 (732600732/s), 4.121 (776510555/s), 3.926 (815078960/s), 4.105 (779537149/s), 4.176 (766283524/s), 4.119 (776887594/s), 4.464 (716845878/s), 4.153 (770527329/s), 4.364 (733272227/s), 4.198 (762267746/s)' popcnt_times[32] = '7.612 (420388859/s), 7.347 (435551925/s), 7.694 (415908500/s), 9.122 (350800263/s), 7.343 (435789186/s), 9.344 (342465753/s), 8.148 (392734413/s), 9.046 (353747512/s), 8.455 (378474275/s), 7.685 (416395575/s)' pq_times = {} pq_times[8] = '36.499 (2739/s), 35.729 (2798/s), 36.521 (2738/s), 37.924 (2636/s), 37.079 (2696/s), 36.444 (2743/s), 36.115 (2768/s), 36.955 (2705/s), 35.913 (2784/s), 40.354 (2478/s)' pq_times[16] = '79.482 (1258/s), 82.546 (1211/s), 84.992 (1176/s), 84.996 (1176/s), 86.218 (1159/s), 84.495 (1183/s), 90.637 (1103/s), 82.164 (1217/s), 85.954 (1163/s), 82.255 (1215/s)' pq_times[32] = '214.85 (465/s), 217.41 (459/s), 212.49 (470/s), 210.75 (474/s), 211.12 (473/s), 212.54 (470/s), 209.91 (476/s), 219.95 (454/s), 212.97 (469/s), 213.44 (468/s)' opq_times = {} opq_times[8] = '38.653 (2587/s), 36.958 (2705/s), 37.684 (2653/s), 35.902 (2785/s), 38.032 (2629/s), 39.511 (2530/s), 42.321 (2362/s), 38.94 (2568/s), 39.224 (2549/s), 39.06 (2560/s)' opq_times[16] = '82.636 (1210/s), 82.401 (1213/s), 88.424 (1130/s), 86.649 (1154/s), 83.329 (1200/s), 82.719 (1208/s), 82.281 (1215/s), 80.581 (1240/s), 80.777 (1237/s), 81.107 (1232/s)' opq_times[32] = '221.61 (451/s), 230.01 (434/s), 241.68 (413/s), 222.39 (449/s), 215.13 (464/s), 215.49 (464/s), 212.27 (471/s), 213.95 (467/s), 213.96 (467/s), 217.79 (459/s)' # 1, 16 -> rowmajor times; 64, 256, 1024 -> colmajor times; (ie, use times from best layout) matmul1_times = '12.063 (8289811/s), 11.231 (8903926/s), 10.283 (9724788/s), 10.864 (9204712/s), 10.492 (9531071/s), 10.877 (9193711/s), 10.79 (9267840/s), 10.85 (9216589/s), 11.041 (9057150/s), 10.647 (9392317/s)' matmul16_times = '21.707 (73708941/s), 21.38 (74836295/s), 21.71 (73698756/s), 21.54 (74280408/s), 21.454 (74578167/s), 21.989 (72763654/s), 22.486 (71155385/s), 22.048 (72568940/s), 23.18 (69025021/s), 21.771 (73492260/s)' matmul64_times = '56.496 (113282356/s), 55.488 (115340253/s), 54.853 (116675478/s), 56.689 (112896681/s), 56.482 (113310435/s), 55.644 (115016893/s), 54.623 (117166761/s), 55.773 (114750865/s), 54.726 (116946241/s), 54.918 (116537383/s)' matmul256_times = '164.72 (155414306/s), 168.41 (152014488/s), 169.93 (150652927/s), 164.99 (155157157/s), 166.66 (153609831/s), 163.04 (157012830/s), 167.45 (152880544/s), 161.06 (158949936/s), 171.13 (149594750/s), 168.49 (151940505/s)' matmul1024_times = '653.63 (156664035/s), 677.26 (151197248/s), 692.88 (147788938/s), 664.79 (154032909/s), 702.61 (145742096/s), 651.74 (157116904/s), 656.4 (156003388/s), 664.69 (154056314/s), 665.34 (153906736/s), 651.88 (157083643/s)' out_dicts = [] algos = ['Bolt', 'PQ', 'OPQ', 'Binary Embedding'] dicts = [bolt_times, pq_times, opq_times, popcnt_times] for algo, d in zip(algos, dicts): for nbytes, s in list(d.items()): thruputs = _extract_thruput(s) * 1e5 if algo == 'Binary Embedding': thruputs /= 1e5 # these are already dists/sec, not qps out_dicts += [{'algo': algo, 'nbytes': nbytes, 'y': t} for t in thruputs] matmul_strs = [matmul1_times, matmul16_times, matmul64_times, matmul256_times, matmul1024_times] batch_sizes = [1, 16, 64, 256, 1024] nbytes_list = [8, 16, 32] # replicate results in each plot for s, sz in zip(matmul_strs, batch_sizes): algo = 'Matmul {}'.format(sz) for nbytes in nbytes_list: thruputs = _extract_thruput(s) out_dicts += [{'algo': algo, 'nbytes': nbytes, 'y': t} for t in thruputs] return pd.DataFrame.from_records(out_dicts) def main(): pass # print _extract_thruput('foo (10x5): 2.456 (1302931596/s), 2.344 (1365187713/s), 2.125 (1505882352/s), 2.829 (1131141746/s), 2.148 (1489757914/s), 2.167 (1476695892/s), 2.327 (1375161151/s), 2.145 (1491841491/s), 2.12 (1509433962/s), 2.112 (1515151515/s)') # print McqResults('../results/tmp.txt') # print McqResults('../results/mcq/mcq_D=256_M=8.txt') # res = query_speed_results() # print res.loc[res['algo'] == 'Matmul 1'] # print res.loc[res['algo'] == 'Matmul 256'] if __name__ == '__main__': main()
bolt-master
experiments/python/results.py
#!/bin/env/python import functools import numpy as np import pprint import scipy import time from . import amm from . import matmul_datasets as md from . import pyience as pyn from . import compress from . import amm_methods as methods from joblib import Memory _memory = Memory('.', verbose=0) # NUM_TRIALS = 1 NUM_TRIALS = 10 # @_memory.cache def _estimator_for_method_id(method_id, **method_hparams): return methods.METHOD_TO_ESTIMATOR[method_id](**method_hparams) def _hparams_for_method(method_id): if method_id in methods.SKETCH_METHODS: # dvals = [2, 4, 6, 8, 12, 16, 24, 32, 48, 64] # d=1 undef on fd methods # dvals = [1, 2, 4, 8, 16, 32, 64, 128] dvals = [1, 2, 4, 8, 16, 32, 64] # dvals = [1, 2, 4, 8, 16, 32] # dvals = [1, 2, 4, 8] # dvals = [32] # TODO rm after debug # dvals = [16] # TODO rm after debug # dvals = [8] # TODO rm after debug # dvals = [4] # TODO rm after debug # dvals = [3] # TODO rm after debug # dvals = [2] # TODO rm after debug # dvals = [1] # TODO rm after debug if method_id == methods.METHOD_SPARSE_PCA: # first one gets it to not return all zeros on caltech alpha_vals = (1. / 16384, .03125, .0625, .125, .25, .5, 1, 2, 4, 8) # alpha_vals = (.0625, .125, .25, .5, 1, 2, 4, 8) # alpha_vals = (.0625, .125) # alpha_vals = [.0625] # TODO rm # alpha_vals = [.03125] # TODO rm # alpha_vals = [1./1024] # TODO rm # alpha_vals = [1./16384] # TODO rm # alpha_vals = [0] # TODO rm # alpha_vals = (2, 4, 5) # alpha_vals = [.1] # alpha_vals = [1.] # alpha_vals = [10.] # alpha_vals = [20.] # alpha_vals = [50.] return [{'d': d, 'alpha': alpha} for d in dvals for alpha in alpha_vals] return [{'d': dval} for dval in dvals] if method_id in methods.VQ_METHODS: # mvals = [1, 2, 4, 8, 16, 32, 64] mvals = [2, 4, 8, 16, 32, 64] # mvals = [64] # mvals = [1, 2, 4, 8, 16] # mvals = [1, 2, 4, 8] # mvals = [8, 16] # TODO rm after debug # mvals = [8, 16, 64] # TODO rm after debug # mvals = [128] # TODO rm after debug # mvals = [64] # TODO rm after debug # mvals = [32] # TODO rm after debug # mvals = [16] # TODO rm after debug # mvals = [8] # TODO rm after debug # mvals = [4] # TODO rm after debug # mvals = [1] # TODO rm after debug if method_id == methods.METHOD_MITHRAL: lut_work_consts = (2, 4, -1) # lut_work_consts = [-1] # TODO rm params = [] for m in mvals: for const in lut_work_consts: params.append({'ncodebooks': m, 'lut_work_const': const}) return params return [{'ncodebooks': m} for m in mvals] if method_id in [methods.METHOD_EXACT, methods.METHOD_SCALAR_QUANTIZE]: return [{}] raise ValueError(f"Unrecognized method: '{method_id}'") def _ntrials_for_method(method_id, ntasks): # return 1 # TODO rm if ntasks > 1: # no need to avg over trials if avging over multiple tasks return 1 # return NUM_TRIALS if method_id in methods.NONDETERMINISTIC_METHODS else 1 return NUM_TRIALS if method_id in methods.RANDOM_SKETCHING_METHODS else 1 # ================================================================ metrics def _compute_compression_metrics(ar): # if quantize_to_type is not None: # ar = ar.astype(quantize_to_type) # ar -= np.min(ar) # ar /= (np.max(ar) / 65535) # 16 bits # ar -= 32768 # center at 0 # ar = ar.astype(np.int16) # elem_sz = ar.dtype.itemsize # return {'nbytes_raw': ar.nbytes, # 'nbytes_blosc_noshuf': len(_blosc_compress( # ar, elem_sz=elem_sz, shuffle=blosc.NOSHUFFLE)), # 'nbytes_blosc_byteshuf': len(_blosc_compress( # ar, elem_sz=elem_sz, shuffle=blosc.SHUFFLE)), # 'nbytes_blosc_bitshuf': len(_blosc_compress( # ar, elem_sz=elem_sz, shuffle=blosc.BITSHUFFLE)), # 'nbytes_zstd': len(_zstd_compress(ar)), # 'nbits_cost': nbits_cost(ar).sum() // 8, # 'nbits_cost_zigzag': # nbits_cost(zigzag_encode(ar), signed=False).sum() // 8, # 'nbytes_sprintz': compress.sprintz_packed_size(ar) # } return {'nbytes_raw': ar.nbytes, 'nbytes_sprintz': compress.sprintz_packed_size(ar)} def _cossim(Y, Y_hat): ynorm = np.linalg.norm(Y) + 1e-20 yhat_norm = np.linalg.norm(Y_hat) + 1e-20 return ((Y / ynorm) * (Y_hat / yhat_norm)).sum() def _compute_metrics(task, Y_hat, compression_metrics=True, **sink): Y = task.Y_test diffs = Y - Y_hat raw_mse = np.mean(diffs * diffs) normalized_mse = raw_mse / np.var(Y) # Y_meannorm = Y - Y.mean() # Y_hat_meannorm = Y_hat - Y_hat.mean() # ynorm = np.linalg.norm(Y_meannorm) + 1e-20 # yhat_norm = np.linalg.norm(Y_hat_meannorm) + 1e-20 # r = ((Y_meannorm / ynorm) * (Y_hat_meannorm / yhat_norm)).sum() metrics = {'raw_mse': raw_mse, 'normalized_mse': normalized_mse, 'corr': _cossim(Y - Y.mean(), Y_hat - Y_hat.mean()), 'cossim': _cossim(Y, Y_hat), # 'bias': diffs.mean(), 'y_mean': Y.mean(), 'y_std': Y.std(), 'yhat_std': Y_hat.std(), 'yhat_mean': Y_hat.mean()} if compression_metrics: # Y_q = compress.quantize(Y, nbits=8) # Y_hat_q = compress.quantize(Y_hat, nbits=8) # diffs_q = Y_q - Y_hat_q # # diffs_q = compress.zigzag_encode(diffs_q).astype(np.uint8) # assert Y_q.dtype == np.int8 # assert diffs_q.dtype == np.int8 Y_q = compress.quantize(Y, nbits=12) Y_hat_q = compress.quantize(Y_hat, nbits=12) diffs_q = Y_q - Y_hat_q assert Y_q.dtype == np.int16 assert diffs_q.dtype == np.int16 # Y_q = quantize_i16(Y) # # quantize to 16 bits # Y = Y - np.min(Y) # Y /= (np.max(Y) / 65535) # 16 bits # Y -= 32768 # center at 0 # Y = Y.astype(np.int16) # diffs = metrics_raw = _compute_compression_metrics(Y_q) metrics.update({k + '_orig': v for k, v in metrics_raw.items()}) metrics_raw = _compute_compression_metrics(diffs_q) metrics.update({k + '_diffs': v for k, v in metrics_raw.items()}) if task.info: problem = task.info['problem'] metrics['problem'] = problem if problem == 'softmax': lbls = task.info['lbls_test'].astype(np.int32) b = task.info['biases'] logits_amm = Y_hat + b logits_orig = Y + b lbls_amm = np.argmax(logits_amm, axis=1).astype(np.int32) lbls_orig = np.argmax(logits_orig, axis=1).astype(np.int32) # print("Y_hat shape : ", Y_hat.shape) # print("lbls hat shape: ", lbls_amm.shape) # print("lbls amm : ", lbls_amm[:20]) metrics['acc_amm'] = np.mean(lbls_amm == lbls) metrics['acc_orig'] = np.mean(lbls_orig == lbls) elif problem in ('1nn', 'rbf'): lbls = task.info['lbls_test'].astype(np.int32) lbls_centroids = task.info['lbls_centroids'] lbls_hat_1nn = [] rbf_lbls_hat = [] W = task.W_test centroid_norms_sq = (W * W).sum(axis=0) sample_norms_sq = (task.X_test * task.X_test).sum( axis=1, keepdims=True) k = W.shape[1] nclasses = np.max(lbls_centroids) + 1 affinities = np.zeros((k, nclasses), dtype=np.float32) for kk in range(k): affinities[kk, lbls_centroids[kk]] = 1 for prods in [Y_hat, Y]: dists_sq_hat = (-2 * prods) + centroid_norms_sq + sample_norms_sq # 1nn classification centroid_idx = np.argmin(dists_sq_hat, axis=1) lbls_hat_1nn.append(lbls_centroids[centroid_idx]) # rbf kernel classification (bandwidth=1) # gamma = 1. / np.sqrt(W.shape[0]) # gamma = 1. / W.shape[0] gamma = 1 similarities = scipy.special.softmax(-dists_sq_hat * gamma, axis=1) class_probs = similarities @ affinities rbf_lbls_hat.append(np.argmax(class_probs, axis=1)) lbls_amm_1nn, lbls_orig_1nn = lbls_hat_1nn rbf_lbls_amm, rbf_lbls_orig = rbf_lbls_hat metrics['acc_amm_1nn'] = np.mean(lbls_amm_1nn == lbls) metrics['acc_orig_1nn'] = np.mean(lbls_orig_1nn == lbls) metrics['acc_amm_rbf'] = np.mean(rbf_lbls_amm == lbls) metrics['acc_orig_rbf'] = np.mean(rbf_lbls_orig == lbls) if problem == '1nn': lbls_amm, lbls_orig = rbf_lbls_amm, rbf_lbls_orig elif problem == 'rbf': lbls_amm, lbls_orig = rbf_lbls_amm, rbf_lbls_orig orig_acc_key = 'acc-1nn-raw' if orig_acc_key in task.info: metrics[orig_acc_key] = task.info[orig_acc_key] metrics['acc_amm'] = np.mean(lbls_amm == lbls) metrics['acc_orig'] = np.mean(lbls_orig == lbls) elif problem == 'sobel': assert Y.shape[1] == 2 grad_mags_true = np.sqrt((Y * Y).sum(axis=1)) grad_mags_hat = np.sqrt((Y_hat * Y_hat).sum(axis=1)) diffs = grad_mags_true - grad_mags_hat metrics['grad_mags_nmse'] = ( (diffs * diffs).mean() / grad_mags_true.var()) elif problem.lower().startswith('dog'): # difference of gaussians assert Y.shape[1] == 2 Z = Y[:, 0] - Y[:, 1] Z_hat = Y_hat[:, 0] - Y_hat[:, 1] diffs = Z - Z_hat metrics['dog_nmse'] = (diffs * diffs).mean() / Z.var() return metrics # ================================================================ driver funcs def _eval_amm(task, est, fixedB=True, **metrics_kwargs): est.reset_for_new_task() if fixedB: est.set_B(task.W_test) # print("eval_amm validating task: ", task.name) # task.validate(train=False, test=True) # print(f"task {task.name} matrix hashes:") # pprint.pprint(task._hashes()) # print("task: ", task.name) # print("X_test shape: ", task.X_test.shape) # print("W_test shape: ", task.W_test.shape) t = time.perf_counter() # Y_hat = est.predict(task.X_test.copy(), task.W_test.copy()) Y_hat = est.predict(task.X_test, task.W_test) # Y_hat = task.X_test @ task.W_test # yep, zero error duration_secs = time.perf_counter() - t metrics = _compute_metrics(task, Y_hat, **metrics_kwargs) metrics['secs'] = duration_secs # metrics['nmultiplies'] = est.get_nmuls(task.X_test, task.W_test) metrics.update(est.get_speed_metrics( task.X_test, task.W_test, fixedB=fixedB)) # print("eval_amm re-validating task: ", task.name) # task.validate(train=False, test=True) # print(f"task {task.name} matrix hashes:") # pprint.pprint(task.hashes()) return metrics def _get_all_independent_vars(): independent_vars = set(['task_id', 'method', 'trial']) for method_id in methods.ALL_METHODS: hparams = _hparams_for_method(method_id)[0] est = _estimator_for_method_id(method_id, **hparams) independent_vars = (independent_vars | set(est.get_params().keys())) return independent_vars # @functools.lru_cache(maxsize=None) # @_memory.cache def _fitted_est_for_hparams(method_id, hparams_dict, X_train, W_train, Y_train, **kwargs): est = _estimator_for_method_id(method_id, **hparams_dict) est.fit(X_train, W_train, Y=Y_train, **kwargs) return est # def _main(tasks, methods=['SVD'], saveas=None, ntasks=None, def _main(tasks_func, methods=None, saveas=None, ntasks=None, verbose=1, limit_ntasks=-1, compression_metrics=False, # TODO uncomment below # verbose=3, limit_ntasks=-1, compression_metrics=False, tasks_all_same_shape=False): methods = methods.DEFAULT_METHODS if methods is None else methods if isinstance(methods, str): methods = [methods] if limit_ntasks is None or limit_ntasks < 1: limit_ntasks = np.inf independent_vars = _get_all_independent_vars() for method_id in methods: if verbose > 0: print("running method: ", method_id) ntrials = _ntrials_for_method(method_id=method_id, ntasks=ntasks) # for hparams_dict in _hparams_for_method(method_id)[2:]: # TODO rm for hparams_dict in _hparams_for_method(method_id): if verbose > 3: print("got hparams: ") pprint.pprint(hparams_dict) metrics_dicts = [] try: prev_X_shape, prev_Y_shape = None, None prev_X_std, prev_Y_std = None, None est = None for i, task in enumerate(tasks_func()): if i + 1 > limit_ntasks: raise StopIteration() if verbose > 1: print("-------- running task: {} ({}/{})".format( task.name, i + 1, ntasks)) task.validate_shapes() # fail fast if task is ill-formed can_reuse_est = ( (i != 0) and (est is not None) and (prev_X_shape is not None) and (prev_Y_shape is not None) and (prev_X_std is not None) and (prev_Y_std is not None) and (task.X_train.shape == prev_X_shape) and (task.Y_train.shape == prev_Y_shape) and (task.X_train.std() == prev_X_std) and (task.Y_train.std() == prev_Y_std)) if not can_reuse_est: try: est = _fitted_est_for_hparams( method_id, hparams_dict, task.X_train, task.W_train, task.Y_train) except amm.InvalidParametersException as e: # hparams don't make sense for task (eg, D < d) if verbose > 2: print(f"hparams apparently invalid: {e}") est = None if tasks_all_same_shape: raise StopIteration() else: continue prev_X_shape = task.X_train.shape prev_Y_shape = task.Y_train.shape prev_X_std = task.X_train.std() prev_Y_std = task.Y_train.std() try: # print(f"task {task.name} matrix hashes:") # pprint.pprint(task.hashes()) for trial in range(ntrials): metrics = _eval_amm( task, est, compression_metrics=compression_metrics) metrics['N'] = task.X_test.shape[0] metrics['D'] = task.X_test.shape[1] metrics['M'] = task.W_test.shape[1] metrics['trial'] = trial metrics['method'] = method_id metrics['task_id'] = task.name # metrics.update(hparams_dict) metrics.update(est.get_params()) print("got metrics: ") pprint.pprint(metrics) # pprint.pprint({k: metrics[k] for k in 'method task_id normalized_mse'.split()}) # print("{:.5f}".format(metrics['normalized_mse'])) # TODO uncomment above metrics_dicts.append(metrics) except amm.InvalidParametersException as e: if verbose > 2: print(f"hparams apparently invalid: {e}") if tasks_all_same_shape: raise StopIteration() else: continue except StopIteration: # no more tasks for these hparams pass if len(metrics_dicts): pyn.save_dicts_as_data_frame( metrics_dicts, save_dir='results/amm', name=saveas, dedup_cols=independent_vars) # def main_ecg(methods=None, saveas='ecg', limit_nhours=1): # tasks = md.load_ecg_tasks(limit_nhours=limit_nhours) # return _main(tasks=tasks, methods=methods, saveas=saveas, ntasks=139, # # limit_ntasks=10, compression_metrics=False) # limit_ntasks=5, compression_metrics=True) def main_caltech(methods=methods.USE_METHODS, saveas='caltech', limit_ntasks=-1, limit_ntrain=-1, filt='sobel'): # tasks = md.load_caltech_tasks() # tasks = md.load_caltech_tasks(limit_ntrain=100e3, limit_ntest=10e3) # TODO rm after debug # tasks = md.load_caltech_tasks(limit_ntrain=-1, limit_ntest=10e3) # TODO rm after debug # tasks = md.load_caltech_tasks(limit_ntrain=100e3) # tasks = md.load_caltech_tasks(limit_ntrain=500e3) # tasks = md.load_caltech_tasks(limit_ntrain=1e6) # does great # tasks = md.load_caltech_tasks(limit_ntrain=15e5) # tasks = md.load_caltech_tasks(limit_ntrain=17.5e5) # bad # tasks = md.load_caltech_tasks(limit_ntrain=2e6) # tasks = md.load_caltech_tasks(limit_ntrain=2.5e6) # return _main(tasks=tasks, methods=methods, saveas=saveas, # limit_ntasks = -1 # limit_ntasks = 10 # filt = 'sharpen5x5' # filt = 'gauss5x5' # filt = 'sobel' saveas = '{}_{}'.format(saveas, filt) # saveas = '{}_{}'.format(saveas, filt) # limit_ntrain = -1 # limit_ntrain = 500e3 task_func = functools.partial( md.load_caltech_tasks, filt=filt, limit_ntrain=limit_ntrain) return _main(tasks_func=task_func, methods=methods, saveas=saveas, ntasks=510, limit_ntasks=limit_ntasks, tasks_all_same_shape=True) def main_ucr(methods=methods.USE_METHODS, saveas='ucr', k=128, limit_ntasks=None, problem='rbf'): # limit_ntasks = 10 # limit_ntasks = 13 # tasks = md.load_ucr_tasks(limit_ntasks=limit_ntasks) # k = 128 tasks_func = functools.partial( md.load_ucr_tasks, limit_ntasks=limit_ntasks, k=k, problem=problem) saveas = '{}_k={}_problem={}'.format(saveas, k, problem) return _main(tasks_func=tasks_func, methods=methods, saveas=saveas, ntasks=76, limit_ntasks=limit_ntasks, tasks_all_same_shape=False) def main_cifar10(methods=methods.USE_METHODS, saveas='cifar10'): # tasks = md.load_cifar10_tasks() return _main(tasks_func=md.load_cifar10_tasks, methods=methods, saveas=saveas, ntasks=1) def main_cifar100(methods=methods.USE_METHODS, saveas='cifar100'): # tasks = md.load_cifar100_tasks() return _main(tasks_func=md.load_cifar100_tasks, methods=methods, saveas=saveas, ntasks=1) def main_all(methods=methods.USE_METHODS): main_cifar10(methods=methods) main_cifar100(methods=methods) # main_ecg(methods=methods) main_caltech(methods=methods) def main(): # main_cifar10(methods='ScalarQuantize') # main_cifar100(methods='ScalarQuantize') # main_ucr(methods='ScalarQuantize') main_caltech(methods='ScalarQuantize', filt='sobel') main_caltech(methods='ScalarQuantize', filt='dog5x5') # main_cifar10(methods='MithralPQ') # main_cifar100(methods='Mithral') # main_caltech(methods='Hadamard') # main_cifar10(methods='MithralPQ') # main_cifar100(methods='MithralPQ') # main_ucr(methods='MithralPQ', k=64, limit_ntasks=5, problem='rbf') # main_ucr(methods='Bolt', k=64, limit_ntasks=5, problem='softmax') # rerun mithral stuff with fixed numerical issues # main_cifar10(methods=['Mithral', 'MithralPQ']) # main_cifar100(methods=['Mithral', 'MithralPQ']) # main_ucr(methods=['Mithral', 'MithralPQ'], k=128, problem='rbf') # main_caltech(methods=['Mithral', 'MithralPQ'], filt='sobel') # main_caltech(methods=['Mithral', 'MithralPQ'], filt='dog5x5') # # # # TODO ideally run this too to put in appendix # # # use_methods = list(methods.USE_METHODS) # use_methods.remove(methods.METHOD_SPARSE_PCA) # main_ucr(methods=use_methods, k=128, problem='softmax') # main_caltech('Mithral', filt='sobel', limit_ntrain=1e6, limit_ntasks=10) # lim = 500e3 # lim = 2e6 # lim = -1 # lim = 4e6 # lim = 5e6 # main_caltech('Mithral', filt='sobel', limit_ntrain=lim, limit_ntasks=10) # main_caltech('MithralPQ', filt='sobel', limit_ntrain=lim, limit_ntasks=10) # main_caltech('Mithral', filt='dog5x5', limit_ntrain=lim, limit_ntasks=10) # main_caltech('MithralPQ', filt='dog5x5', limit_ntrain=lim, limit_ntasks=10) # main_caltech('OldMithralPQ', filt='sobel', limit_ntrain=lim, limit_ntasks=10) # main_ucr(methods='MithralPQ', limit_ntasks=5) # main_caltech(methods='Bolt', limit_ntasks=10, limit_ntrain=500e3, filt='dog5x5') # main_caltech(methods='Bolt', limit_ntasks=10, limit_ntrain=500e3, filt='sobel') # main_caltech(methods='SparsePCA') if __name__ == '__main__': np.set_printoptions(formatter={'float': lambda f: "{:.2f}".format(f)}, linewidth=100) main()
bolt-master
experiments/python/amm_main.py
#!/bin/env/python import abc import numpy as np # from sklearn.decomposition import PCA, SparsePCA from sklearn import decomposition from sklearn.decomposition import PCA, SparsePCA, MiniBatchSparsePCA from sklearn.utils.extmath import randomized_svd import numba # conda install numba # import ffht # https://github.com/FALCONN-LIB/FFHT; python setup.py install import scipy from joblib import Memory _memory = Memory('.', verbose=1, compress=9) KEY_NMULTIPLIES = 'muls' OSNAP_DEFAULT_S = 4 # OSNAP_DEFAULT_S = 2 # ================================================================ utils def _nmultiplies_matmul(A, B): return A.shape[0] * A.shape[1] * B.shape[1] def _nmultiplies_matmul_with_sizes(N, D, M): return N * D * M def _nmultiplies_svd(N, D): return min(N * N * D, N * D * D) def _nmultiplies_qr(N, D): return min(N * N * D, N * D * D) # ================================================================ types class InvalidParametersException(Exception): pass class ApproxMatmul(abc.ABC): def __init__(*args_unused, **kwargs_unused): pass def fit(self, A, B, Y=None): # Y = A @ B if not specified pass def set_A(self, A): pass def set_B(self, B): pass def reset_for_new_task(self): pass @abc.abstractmethod def __call__(self, A, B): pass def predict(self, A, B): return self(A, B) def get_params(self): return {} # def get_nmuls(self, A, B, fixedA=False, fixedB=False): @abc.abstractmethod def get_speed_metrics(self, A, B, fixedA=False, fixedB=False): pass class ExactMatMul(ApproxMatmul): def __call__(self, A, B): return A @ B def get_speed_metrics(self, A, B, **sink): return {KEY_NMULTIPLIES: _nmultiplies_matmul(A, B)} def _scalar_quantize(A, axis=1, signed=False, nbits=8): unsigned_maxval = float(1 << int(nbits)) - 1 # # TODO rm # # return np.zeros((A.shape[0], 1)), np.ones((A.shape[0], 1)), A # # offsets = np.zeros((A.shape[0], 1)) # offsets = A.min(axis=1, keepdims=True) # # scales = maxval / np.ones((A.shape[0], 1)) # scales = maxval / A.max(axis=1, keepdims=True) # Aq = (A - offsets) * scales # return offsets, scales, Aq # maxval = float(1 << int(nbits)) - 1 mins = A.min(axis=axis, keepdims=True) # A_offset = A - offsets ranges = (A - mins).max(axis=axis, keepdims=True) + 1e-20 scales = unsigned_maxval / ranges # Aq = (A_offset * (maxval / scales)).astype(np.int) # Aq = (A_offset * scales).astype(np.int) if signed: # sign_offset = 1 << (nbits - 1) # 8 bits -> 128 # A_offset -= sign_offset offsets = mins + (ranges * (128. / 255)) minval = -(1 << (nbits - 1)) maxval = -minval - 1 else: offsets = mins minval = 0 maxval = (1 << nbits) - 1 Aq = (A - offsets) * scales # print("min, max A:", Aq.min(), Aq.max()) # looks good Aq = np.clip(Aq, minval, maxval).astype(np.int) return offsets, scales, Aq class QuantizedMatmul(ApproxMatmul): __slots__ = 'nbits a_offsets a_scales b_offsets b_scales A B'.split() def __init__(self, nbits=8): self.nbits = nbits def __call__(self, A, B): assert A.shape[1] == B.shape[0] # dims need to match N, D = A.shape D, M = B.shape if self.A is None: self.set_A(A) if self.B is None: self.set_B(B) # print("QuantizedMatmul") # print("min, max A:", self.A.min(), self.A.max()) # print("min, max A offsets:", self.a_offsets.min(), self.a_offsets.max()) # print("min, max A scales :", self.a_scales.min(), self.a_scales.max()) # print("min, max B:", self.B.min(), self.B.max()) # print("min, max B offsets:", self.b_offsets.min(), self.b_offsets.max()) # print("min, max B scales :", self.b_scales.min(), self.b_scales.max()) # ((A - a_offsets) / a_scales) @ ((B - b_offsets) / b_scales) # noqa # ignoring scales, we have: # (A - a_off) @ (B - b_off) # = A @ B - (a_off @ B) - (A @ b_off) + a_off @ b_off # maxval = (1 << int(self.nbits)) - 1 ret = (self.A @ self.B).astype(np.float32) ret *= 1. / self.a_scales ret *= 1. / self.b_scales A_off = np.tile(self.a_offsets, (1, D)) B_off = np.tile(self.b_offsets, (D, 1)) return ret + (A_off @ B) + (A @ B_off) - (A_off @ B_off) def set_A(self, A): # unsigned quantization; we *could* learn the offsets and scales # on the training set, but since this is a baseline, we're giving it # the advantage of using the "true" offsets/scales self.a_offsets, self.a_scales, self.A = _scalar_quantize( A, axis=1, signed=False, nbits=self.nbits) # mins = A.min(axis=1, keepdims=True) # A_offset = A - mins # scales = A_offset.max(axis=1, keepdims=True) + 1e-20 # self.A = (A_offset * (255. / scales)).astype(np.int) def set_B(self, B): # signed quantization (for maddubs instruction) self.b_offsets, self.b_scales, self.B = _scalar_quantize( B, axis=0, signed=True, nbits=self.nbits) # self.b_offsets, self.b_scales, self.B = _scalar_quantize( # B.T, nbits=self.nbits, signed=True) # # quantize each col, not each row # self.b_offsets = self.b_offsets.ravel() # self.b_scales = self.b_scales.ravel() # self.B = self.B.T def reset_for_new_task(self): self.A = None self.B = None def get_speed_metrics(self, A, B, **sink): # neglect packing, postprocessing, etc return {KEY_NMULTIPLIES: _nmultiplies_matmul(A, B)} class SketchedMatmul(ApproxMatmul, abc.ABC): __slots__ = 'd' def __init__(self, d): self.d = int(d) def get_params(self): return {'d': self.d} def sketch(self, A, B): pass def call(self, A, B): A_hat, B_hat = self.sketch(A, B) assert A_hat.shape[0] == A.shape[0] assert B_hat.shape[1] == B.shape[1] assert A_hat.shape[1] <= self.d # verify sketch size not cheating return A_hat @ B_hat def __call__(self, A, B): assert A.shape[1] == B.shape[0] # dims need to match D = A.shape[1] if D <= self.d: raise InvalidParametersException( 'D <= d: {} < {}'.format(D, self.d)) if B.shape[1] <= self.d: raise InvalidParametersException( 'M <= d: {} < {}'.format(B.shape[1], self.d)) return self.call(np.copy(A), np.copy(B)) # guarantee A, B unchanged def get_speed_metrics(self, A, B, fixedA=False, fixedB=False): assert not (fixedA and fixedB) # this would be stupid, so fail fast sketch_nmuls = self._get_nmuls(A.shape[0], A.shape[1], B.shape[1], self.d, fixedA=fixedA, fixedB=fixedB) N, D = A.shape D, M = B.shape sketched_matmul_nmuls = N * self.d * M return {KEY_NMULTIPLIES: sketch_nmuls + sketched_matmul_nmuls} def _get_nmuls(self, N, D, M, d, fixedA=False, fixedB=False): # default nmuls = sketching with dense matrix nmuls = 0 if not fixedA: nmuls += N * D * d if not fixedB: nmuls += M * D * d return nmuls class RandGaussSketch(SketchedMatmul): def sketch(self, A, B): D = A.shape[1] V = np.random.randn(D, self.d).astype(np.float32) # dividing by expected norm is more similar to theory papers, # but no reason this should actually be better AFAIK # V /= np.sqrt(D) V /= np.linalg.norm(V, axis=0) A = A @ V B = V.T @ B return A, B class RandOrthoGaussSketch(SketchedMatmul): def sketch(self, A, B): D = A.shape[1] V = np.random.randn(D, self.d).astype(np.float32) V, _ = np.linalg.qr(V) A = A @ V B = V.T @ B return A, B class RandRademacherSketch(SketchedMatmul): def sketch(self, A, B): D = A.shape[1] V = np.random.randint(2, size=(D, self.d)).astype(np.float32) * 2 - 1 V /= np.sqrt(D) A = A @ V B = V.T @ B return A, B class HadamardSketch(SketchedMatmul): def sketch(self, A, B): D = A.shape[1] use_D = 1 << int(np.ceil(np.log2(D))) V = scipy.linalg.hadamard(use_D)[:D, :self.d].astype(np.float32) V /= np.linalg.norm(V, axis=0) # V /= np.sqrt(2) # V *= np.sqrt(2) # V *= np.sqrt(D / self.d) # V *= (D / self.d) ** .25 A = A @ V B = V.T @ B return A, B class SketchSqSample(SketchedMatmul): def sketch(self, A, B): return sketch_sq_sample(A, B, self.d) def _get_nmuls(self, N, D, M, d, **sink): return _nmultiplies_sketch_sq_sample(N, D, M, d) class FdAmm(SketchedMatmul): def sketch(self, A, B): return fd_amm_sketches(A, B, self.d) def _get_nmuls(self, N, D, M, d, **sink): return _nmultiplies_fd_amm_sketches(N, D, M, d) class CooccurSketch(SketchedMatmul): def sketch(self, A, B): return cooccur_sketches(A, B, self.d) def _get_nmuls(self, N, D, M, d, **sink): return _nmultiplies_cooccur_sketches(N, D, M, d) class FastJlSketch(SketchedMatmul): def sketch(self, A, B): return fastjl_sketches(A, B, self.d) def _get_nmuls(self, N, D, M, d, **sink): return _nmultiplies_fastjl_sketches(N, D, M, d) class HashJlSketch(SketchedMatmul): def sketch(self, A, B): return hash_sketches(A, B, self.d) def _get_nmuls(self, N, D, M, d, **sink): return _nmultiplies_hash_sketches(N, D, M, d) class OsnapSketch(SketchedMatmul): def sketch(self, A, B): return osnap_sketches(A, B, self.d, s=OSNAP_DEFAULT_S) # def get_params(self): # return {'d': self.d, 's': OSNAP_DEFAULT_S} def _get_nmuls(self, N, D, M, d, **sink): return _nmultiplies_osnap_sketches(N, D, M, d) class SvdSketch(SketchedMatmul): __slots__ = 'd niters Ua SVTa Ub SVTb'.split() def __init__(self, d, niters=5): self.d = d self.niters = niters self.reset_for_new_task() def get_params(self): return {'d': self.d, 'niters': self.niters} def _check_mat_shape(self, M): if M is None: return False # if np.min(M.shape) < self.d: if np.max(M.shape) < self.d: raise InvalidParametersException( 'shape has entry < d: {} < {}'.format(M.shape, self.d)) return True def set_A(self, A): # if A is None: # return if self._check_mat_shape(A): self.Ua, self. SVTa = svd_sketch(A, self.d) def set_B(self, B): if self._check_mat_shape(B): self.Ub, self.SVTb = svd_sketch(B, self.d) def reset_for_new_task(self): self.Ua = None self.SVTa = None self.Ub = None self.SVTb = None # def __call__(self, A=None, B=None): # assert A.shape[1] == B.shape[0] # dims need to match # if A.shape[1] < self.d: # raise InvalidParametersException('D < d') def call(self, A=None, B=None): if self.Ua is None: self.set_A(A) if self.Ub is None: self.set_B(B) D = self.Ua.shape[1] if D < self.d: raise InvalidParametersException( 'D < d: {} < {}'.format(D, self.d)) # verify sketch size isn't cheating # print("A.shape", A.shape) # print("B.shape", B.shape) # print("self.Ua.shape: ", self.Ua.shape) # print("self.SVTa.shape: ", self.SVTa.shape) # print("self.Ub.shape: ", self.Ub.shape) # print("self.SVTb.shape: ", self.SVTb.shape) # print("self.d: ", self.d) assert self.Ua.shape[1] <= self.d assert self.SVTa.shape[0] <= self.d assert self.SVTb.shape[0] <= self.d assert self.Ub.shape[1] <= self.d # innermost parens important so that matmuls actually use low rank # outer parens help if B ncols < A nrows (which is true for us) return self.Ua @ ((self.SVTa @ self.Ub) @ self.SVTb) def get_speed_metrics(self, A, B, fixedA=False, fixedB=False): # XXX this will break if not called right after self.call() total = 0 d = self.d N, D = A.shape _, M = B.shape if not fixedA: total += _nmultiplies_svd_sketch(N, D, d, niters=self.niters) if not fixedB: total += _nmultiplies_svd_sketch(D, M, d, niters=self.niters) total += d * D * d # SVTa @ UB, d x D @ D x d total += d * d * M # (above) @ SVTb, d x d @ d x M total += N * d * M # Ua @ (above), N x d @ d x M return {KEY_NMULTIPLIES: total} @_memory.cache def _fitted_pca(X, n_components): pca = PCA(n_components=n_components) return pca.fit(X) class TrainedPcaSketch(ApproxMatmul): __slots__ = 'pca d A B V'.split() def __init__(self, d): # self.pca = PCA(n_components=d) self.d = d self.reset_for_new_task() def reset_for_new_task(self): self.A = None self.B = None def fit(self, A, B, Y=None): # Y = A @ B if not specified D, M = B.shape print("called fit on TrainedPcaSketch!") if D < self.d: raise InvalidParametersException( 'D < d: {} < {}'.format(D, self.d)) if M < self.d: raise InvalidParametersException( 'M < d: {} < {}'.format(M, self.d)) self.pca = _fitted_pca(A, n_components=self.d) self.V = self.pca.components_.T # print("components V.T @ V =\n", self.V.T @ self.V) # yep, orthonormal def set_A(self, A): self.A = A @ self.V def set_B(self, B): self.B = self.V.T @ B def __call__(self, A, B): assert A.shape[1] == B.shape[0] # dims need to match if B.shape[1] < self.d: raise InvalidParametersException( 'M < d: {} < {}'.format(B.shape[1], self.d)) if (self.A is None): self.set_A(A) if (self.B is None): self.set_B(B) return self.A @ self.B def get_params(self): return {'d': self.d} def get_speed_metrics(self, A, B, fixedA=False, fixedB=False): N, D = A.shape D, M = B.shape d = self.d nmuls = N * d * M # assuming matrices already sketched if not fixedA: nmuls += N * D * d if not fixedB: nmuls += D * M * d return {KEY_NMULTIPLIES: nmuls} @_memory.cache def _fitted_sparse_pca(X, d, unscaled_alpha, **kwargs): # this seems to work better than initializing with MiniBatchSparsePCA, # svd of cov mat, or basically anything else I tried U, _, Vt = randomized_svd(X, n_components=d, random_state=123) U = U[:, :d] V = Vt.T[:d] # SparsePCA (and all the sklearn dictionary learning stuff) # internally uses sum of squared errs for each sample, and L1 norm # of parameter matrix; to make alpha meaningful across datasets, # want to scale by number of examples (so it's effectively using MSE) # and divide by L1 norm (which grows linearly with size of parameter # matrix / vector); also scale by variance of data for similar reasons N, D = X.shape alpha = unscaled_alpha * np.var(X - X.mean(axis=0)) * N / D verbose = 1 pca = SparsePCA(n_components=d, alpha=alpha, normalize_components=True, method='lars', U_init=U, V_init=V, max_iter=10, ridge_alpha=max(1, len(X) * X.std() * 10), # ridge_alpha=1e8, verbose=verbose, random_state=123) if verbose > 0: print("fitting sparse pca...") return pca.fit(X) class TrainedSparsePcaSketch(ApproxMatmul): __slots__ = 'pca d alpha nnz can_optimize_transform A B'.split() # def __init__(self, d, alpha, can_optimize_transform=True): def __init__(self, d, alpha, can_optimize_transform=False): self.d = d self.alpha = alpha self.can_optimize_transform = can_optimize_transform self.reset_for_new_task() def reset_for_new_task(self): self.A = None self.B = None def fit(self, A, B, Y=None): # Y = A @ B if not specified D, M = B.shape # if M <= self.d: # raise InvalidParametersException( # 'M <= d: {} < {}'.format(M, self.d)) if D <= self.d: raise InvalidParametersException( 'D < d: {} < {}'.format(D, self.d)) self.pca = _fitted_sparse_pca(A, d=self.d, unscaled_alpha=self.alpha) self.nnz = np.sum(self.pca.components_ != 0) sparsity = np.mean(self.pca.components_ == 0) if self.nnz < self.d: raise InvalidParametersException( "ignoring SparsePCA with nnz < d: " "{} < {}".format(self.nnz, self.d)) if sparsity == 0.: raise InvalidParametersException( "ignoring SparsePCA with no zeros") def set_A(self, A): if self.can_optimize_transform: # uses ridge regression to get coeffs, instead of linear projection # disabled by default because it produces garbage on caltech and # is more expensive than just doing the matmul self.A = self.pca.transform(A) self.A += self.pca.mean_ @ self.pca.components_.T else: self.A = A @ self.pca.components_.T def set_B(self, B): if self.can_optimize_transform: self.B = self.pca.transform(B.T).T self.B += (self.pca.mean_ @ self.pca.components_.T).reshape(-1, 1) else: self.B = (B.T @ self.pca.components_.T).T def __call__(self, A, B): assert A.shape[1] == B.shape[0] # dims need to match N, D = A.shape D, M = B.shape if D <= self.d: raise InvalidParametersException( 'D < d: {} < {}'.format(D, self.d)) fixedA = self.A is not None fixedB = self.B is not None nmuls_naive = N * D * M nmuls_ours = self.get_speed_metrics( A, B, fixedA=fixedA, fixedB=fixedB)[KEY_NMULTIPLIES] if nmuls_naive <= nmuls_ours: raise InvalidParametersException( "naive # of multiplies < sparse sketch # of multiplies: " "{} < {}".format(nmuls_naive, nmuls_ours)) if not fixedA: self.set_A(A) if not fixedB: self.set_B(B) # if N == 700: # if False: print("got to weird dset!") # print("pca means: ", self.pca.mean_[::20]) # print("A means:", A.mean(axis=0)[::20]) # print("B means:", B.mean(axis=1)[::20]) print("pca means sum: ", self.pca.mean_.sum()) print("A means sum: ", A.mean(axis=0).sum()) print("B means sum: ", B.mean(axis=1).sum()) offsets = (self.pca.mean_ @ self.pca.components_.T) print("offsets: ", offsets) print("offsets sum: ", offsets.sum()) # C = (A @ B) # print("true mean of output: ", C.mean()) # print("true std of output: ", C.std()) return self.A @ self.B def get_params(self): return {'d': self.d, 'alpha': self.alpha, 'canCheat': self.can_optimize_transform} def get_speed_metrics(self, A, B, fixedA=False, fixedB=False): N, D = A.shape D, M = B.shape nmuls_sketch_X = N * self.nnz nmuls_sketch_W = M * self.nnz nmuls_make_output = N * self.d * M total_nmuls = nmuls_make_output if not fixedA: total_nmuls += nmuls_sketch_X if not fixedB: total_nmuls += nmuls_sketch_W try: # compute degree of sparsity nnz = self.nnz sparsity = (self.pca.components_ == 0).mean() except AttributeError: # model not fitted yet nnz = -1 sparsity = -1 return {KEY_NMULTIPLIES: total_nmuls, 'nnz': nnz, 'sparsity': sparsity} # ================================================================ drineas06 def _compute_dim_scores(A, B, A_col_norms=None, B_row_norms=None): if A_col_norms is None: A_col_norms = np.linalg.norm(A, axis=0) if B_row_norms is None: B_row_norms = np.linalg.norm(B, axis=1) return A_col_norms * B_row_norms def sketch_sq_sample(A, B, d): scores = _compute_dim_scores(A, B) idxs, weights = importance_sample(scores, d) # idxs, weights = sample_varopt_1d(scores, d) # doesn't help return A[:, idxs] / weights, B[idxs] # weights = np.sqrt(weights) # return A[:, idxs] / weights, B[idxs] / weights.reshape(-1, 1) # probs = scores / np.sum(scores) # D = A.shape[1] # keep_idxs = np.random.choice(D, size=d, p=probs) # # keep_idxs = np.random.choice(D, size=d, p=probs, replace=False) # # keep_idxs = np.random.choice(D, size=d, replace=False) # # keep_idxs = np.arange(D-1) # # keep_idxs = np.arange(1, D) # # keep_idxs = np.arange(D) # weights = np.sqrt(d * probs) # what the paper says; huge errors # # weights = np.sqrt(D * probs) # slightly less bad # # weights = np.sqrt(np.sqrt(d * probs)) # # weights = np.ones(D) # A = np.copy(A) / weights # B = np.copy(B) / weights.reshape(-1, 1) # return np.copy(A[:, keep_idxs]), np.copy(B[keep_idxs]) # return A[:, keep_idxs], B[keep_idxs] # return A, B def _nmultiplies_sketch_sq_sample(N, D, M, d): scores_nmuls = N * D + M * D # sum of sizes of each mat reweight_nmuls = N * d + M * d # sum of sizes of each sampled mat return scores_nmuls + reweight_nmuls # neglect normalization of probs, etc def sketch_sq_deterministic(A, B, d): scores = _compute_dim_scores(A, B) D = A.shape[1] keep_idxs = np.argsort(scores)[::-d] weights = np.sqrt(d * (1. / D)) # uniform prob return A[:, keep_idxs] / weights, B[keep_idxs] / weights.reshape(-1, 1) def test_sketch_sq_sample(): print("test_sketch_sq_sample") N, M, D = 100, 50, 200 np.random.seed(1234) # A = np.random.randint(5, size=(N, D)).astype(np.float32) # B = np.random.randint(5, size=(D, M)).astype(np.float32) # A -= np.mean(A) # B -= np.mean(B) A = np.random.randn(N, D).astype(np.float32) B = np.random.randn(D, M).astype(np.float32) AB = A @ B orig_frob_sq = np.mean(AB * AB) print("true mss: ", orig_frob_sq) prev_normed_err = np.inf for d in (10, 20, 30, 40, 50): A_hat, B_hat = sketch_sq_sample(A, B, d) # A_hat, B_hat = sketch_sq_deterministic(A, B, d) AB_hat = A_hat @ B_hat # print("AB_hat mss: ", (AB_hat * AB_hat).mean()) diffs = AB - AB_hat err_frob_sq = np.mean(diffs * diffs) normed_err_sq = err_frob_sq / orig_frob_sq # print("orig mss: ", orig_frob_sq) print('d = {}, err = {:.3f}'.format(d, normed_err_sq)) assert normed_err_sq < 2. assert normed_err_sq < (prev_normed_err + .05) # should usually hold prev_normed_err = normed_err_sq # ================================================================ sampling # wait, this just returns points summing to the true sample sum # deterministically... def importance_sample(sample_weights, m, replace=False): probs = sample_weights / sample_weights.sum() idxs = np.random.choice( np.arange(len(sample_weights)), p=probs, replace=replace, size=m) weights = 1. / (probs[idxs] * m) return idxs, weights def _invert_permutation(permutation): return np.arange(len(permutation))[np.argsort(permutation)] def _sum_for_tau(x, tau): above_tau = x > tau return x[above_tau].sum() + (x[~above_tau] / tau).sum() def _compute_new_tau(x_sorted_desc, m, tau=0): x = x_sorted_desc current_sum = _sum_for_tau(x, tau) assert current_sum >= m while current_sum > m: x = x[:-1] current_sum = _sum_for_tau(x, tau) def sample_varopt_1d(x, m): # varopt sampling; original paper (see Algorithm 1 on p16): # https://arxiv.org/pdf/0803.0473.pdf # better intuition: # https://datasketches.github.io/docs/Sampling/VarOptSampling.html # # unlike paper, we're just going to do it all at once since that will # be simpler and vectorize way better; basically just recursively # take largest point w_i if w_i > (m / sum_i w_i), with m decremented # by 1 each time; if this doesn't take all the points, importance sample # from the remaining points (with probs proportional to their weights) # # EDIT: this sucks unless really heavy tailed, so probably not a # correct impl? x = np.asarray(x, dtype=np.float32) n = len(x) if m >= n: return np.arange(n) maxval = np.max(x) minval = np.min(x) assert minval >= 0 # needs nonnegative entries if minval == maxval or m == 1: return np.random.choice(np.arange(n), size=m) sort_idxs = np.argsort(x)[::-1] # in descending order x_sorted = x[sort_idxs] unsort_idxs = _invert_permutation(sort_idxs) q = x_sorted * (m / np.sum(x_sorted)) # sums to m # q_tailsums = np.cumsum(q[::-1])[::-1] # next_val = x_sorted[0] head_sz = 0 for i in range(m): if q[0] >= 1.: head_sz += 1 q = q[1:] * ((m - 1) / q[1:].sum()) # TODO just compute tail sums once for renormalization (below) # q_mass_eliminated = q[i] # next_val = q[i + 1] * (m - head_sz) / m * () # renormalize such that tail sums to m - 1 else: break tail_sz = m - head_sz # print("m, head_sz, tail_sz:", m, head_sz, tail_sz) # print("len(q)", len(q)) # probs = q / np.sum(q) probs = x_sorted[head_sz:] / np.sum(x_sorted[head_sz:]) tail_idxs = np.random.choice( np.arange(head_sz, n), p=probs, replace=False, size=tail_sz) idxs = list(tail_idxs) # idxs = tail_idxs # tau = tail_sz / np.sum(x_sorted[head_sz:]) # print("tau: ", tau) # print("x_sorted[:head_sz + 1]: ", x_sorted[:head_sz + 1]) # tau = x_sorted[head_sz] true_probs = probs[tail_idxs - head_sz] * (tail_sz / m) weights = list(1. / (m * true_probs)) # small err; definitely right # weights = [tau] * tail_sz if head_sz > 0: head_idxs = list(np.arange(head_sz)) head_weights = list(np.ones(head_sz)) idxs = head_idxs + idxs weights = head_weights + weights return unsort_idxs[idxs], np.array(weights) # ============================================================ random sketches # sketch both A and B jointly using the same matrix to amortize overhead and # because it seems like this should help accuracy # @numba.jit(nopython=True) def fastjl_sketches(A, B, d, P=None): N, D = A.shape M = B.shape[1] # pad A and B for FHT log2_D = int(np.ceil(np.log2(D))) D_pad = 2 ** log2_D A_pad = np.zeros((N, D_pad), dtype=np.float32) A_pad[:, :D] = A B_pad = np.zeros((D_pad, M), dtype=np.float32) B_pad[:D] = B # construct and apply random signs for each dim randsigns = np.random.randint(0, 2, size=D_pad) * 2 - 1 # scale now instead of scaling FHT mat, so only O(D) multiplies randsigns = randsigns.astype(np.float32) * (1. / np.sqrt(D_pad)) A_pad *= randsigns B_pad *= randsigns.reshape(-1, 1) # # apply fast hadamard transform H = scipy.linalg.hadamard(D_pad, dtype=np.float32) # H = scipy.linalg.hadamard(D_pad, dtype=np.float32) / np.sqrt(D_pad) A_pad = A_pad @ H B_pad = H @ B_pad # dimensionalty reduction if P is None: # logd = np.log2(D_pad) keep_prob = log2_D * log2_D / D_pad # if (keep_prob) >= 1: # print("WARNING: FastJL returning all zeros mat...") P = (np.random.uniform(size=(D_pad, d)) > keep_prob).astype(np.float32) # P *= np.random.randn(*P.shape) * (d / keep_prob) # scaling sigma totally fails; need norm to actually be 1, not just # have expected value of 1 P *= np.random.randn(*P.shape) P *= (1. / np.linalg.norm(P, axis=0)) # print("P shape, Apad shape, Bpad shape: ", P.shape, A_pad.shape, B_pad.shape) return A_pad @ P, P.T @ B_pad def _nmultiplies_fastjl_sketches(N, D, M, d): # avg, not exact, since P sparse # technically adds or subs, but you'd do fma ops regardless for floats log2_D = int(np.ceil(np.log2(D))) D_pad = 2 ** log2_D fht_nmuls = D_pad * np.log2(D_pad) sign_nmuls = D_pad # trickier part; expected number of madds (or similar ops) to mul by P construct_P_nmuls = D_pad * d # assuming only 1 mul for rng + threshold keep_prob = log2_D * log2_D / D_pad nnz_p = min(1, keep_prob) * D_pad # expected nnz per row of P p_nmuls = N * nnz_p * d + d * nnz_p * M return fht_nmuls + sign_nmuls + construct_P_nmuls + p_nmuls @numba.jit(nopython=True) def hash_sketches(A, B, d, scale=1., share_projections=True): N, D = A.shape D, M = B.shape A_hat = np.zeros((N, d), dtype=A.dtype) B_hat = np.zeros((d, M), dtype=B.dtype) for j in range(D): idx = np.random.randint(d) sign = (np.random.randint(0, 2) * 2) - 1 # coeff = sign * scale # worse than predicting mean, esp for small d coeff = sign * scale / np.sqrt(2) # actually pretty decent # coeff = sign * scale * ((d / D) ** .25) # coeff = sign * scale * np.sqrt(d / D) # best for small d / D # coeff = sign * scale * d / D # best for larger d / D A_hat[:, idx] += A[:, j] * coeff if share_projections: B_hat[idx] += B[j] * coeff continue # use a different projection for B idx = np.random.randint(d) sign = (np.random.randint(0, 2) * 2) - 1 B_hat[idx] += B[j] * sign # using unscaled signs preserves norms really well, at least for # random matrices # print("A norm, A_hat norm:", np.linalg.norm(A), np.linalg.norm(A_hat)) # print("B norm, B_hat norm:", np.linalg.norm(B), np.linalg.norm(B_hat)) # A_norm = np.linalg.norm(A) # B_norm = np.linalg.norm(B) # A_hat *= np.linalg.norm(A) / np.linalg.norm(A_hat) # B_hat *= np.linalg.norm(B) / np.linalg.norm(B_hat) return A_hat, B_hat def osnap_sketches(A, B, d, s=OSNAP_DEFAULT_S): N, D = A.shape D, M = B.shape s = max(1, min(d // 2, s)) # handle s too large relative to d A_hat = np.zeros((N, d), dtype=A.dtype) B_hat = np.zeros((d, M), dtype=B.dtype) scale = 1. / np.sqrt(s) # scale = 1. / s # scale = 1 # seems to often work better than dividing by 1/sqrt(s)? # scale = np.sqrt(s) # scale = s subspace_len = (d + s - 1) // s # round up for ss in range(s): start_idx = ss * subspace_len end_idx = min(D, start_idx + subspace_len) A_hat[:, start_idx:end_idx], B_hat[start_idx:end_idx] = \ hash_sketches(A, B, subspace_len, scale=scale) # A_hat /= np.linalg.norm(A_hat, axis=) return A_hat, B_hat def _nmultiplies_hash_sketches(N, D, M, d): # technically adds or subs, but you'd do fma ops regardless for floats return N * D + D * M def _nmultiplies_osnap_sketches(N, D, M, d, s=4): return 4 * _nmultiplies_hash_sketches(N, D, M, d) def test_rand_sketches(): print("test_svd_sketches") N, M, D = 100, 80, 50 np.random.seed(1234) A = np.random.randint(5, size=(N, D)).astype(np.float32) B = np.random.randint(5, size=(D, M)).astype(np.float32) A -= np.mean(A) B -= np.mean(B) AB = A @ B orig_frob_sq = np.sum(AB * AB) prev_normed_err = np.inf # for d in [10]: for d in (1, 2, 4, 8, 16, 32): # (Ua, SVTa), (Ub, SVTb) = svd_sketches(A, B, d) # AB_hat = Ua @ (SVTa @ Ub) @ SVTb A_hat, B_hat = fastjl_sketches(A, B, d) # A_hat, B_hat = hash_sketches(A, B, d) # sharing projections helps # A_hat, B_hat = hash_sketches(A, B, d, share_projections=False) # A_hat, B_hat = osnap_sketches(A, B, d) AB_hat = A_hat @ B_hat # print("fused mats shapes: ") # print(Ua.shape, SVTa.shape, Ub.shape, SVTb.shape) diffs = AB - AB_hat err_frob_sq = np.sum(diffs * diffs) normed_err_sq = err_frob_sq / orig_frob_sq print('d = {}, err = {:.5f}'.format(d, normed_err_sq)) # assert normed_err_sq < 1. # assert normed_err_sq < prev_normed_err + .001 prev_normed_err = normed_err_sq # ================================================================ Rand SVD def svd_sketch(A, d, niters=5, **kwargs): # assert A.shape[0] >= d # assert A.shape[1] >= d assert np.max(A.shape) >= d # can't truncate to larger size U, S, Vt = randomized_svd(A, n_components=d, n_iter=niters, **kwargs) # print("Vt shape: ", Vt.shape) # print("S: ", S) return (U, np.diag(S) @ Vt) def _nmultiplies_svd_sketch(N, D, d, niters): # # "In contrast, randomized schemes can produce an approximate SVD using # # only O(mn log(k) + (m + n)k2) flops" -Halko et al. 2010 # # https://arxiv.org/pdf/0909.4061.pdf # iter_cost = N * D * int(np.ceil(np.log2(d))) # iter_cost += (N + D) * d * d # return iter_cost * niters # # assumes algorithm 4.4 in above; sklearn randomized_svd source # # code says it implements algorithm 4.3, but paper says 4.3 should actually # # be implemented as 4.4 in practice. Also 4x4's complexity is much easier # # to understand and counting multiplies is at best a rough estimate # # regardless. # # # # shapes: # # A: N x D # # A*: D x N # # Omega: D x d # # Y0 = A @ Omega: N x d # # Q0: N x d # # R0: d x d # # Y_tilde_j: # # gauss_mat_cost = D * d # # Y0_cost = N * D * d # Y0_cost = N * D * int(np.ceil(np.log2(d))) # subsampled FFT; see text # Y0_cost += _nmultiplies_qr(N, d) # Yj_tilde_cost = D * N * d + _nmultiplies_qr(N, d) # Yj_cost = # okay, sklearn says it uses algorithm 4.3 in Halko et al. 2010 [1], # so we're going to go with that # [1] https://arxiv.org/pdf/0909.4061.pdf # shapes: # A: N x D # A.T: D x N # G (Omega): D x d # A @ G: N x d # A.T @ (AG) D x d # A @ (A.T@A@G) N x d # Q0: N x d # R0: d x d Omega_cost = D * d A_Omega_cost = N * D * d # each iter: premul by A.T, then A; assumes no LU or QR for stability iter_cost = D * N * d + N * D * d return Omega_cost + A_Omega_cost + iter_cost * niters def svd_sketches(A, B, d, **kwargs): return svd_sketch(A, d, **kwargs), svd_sketch(B, d, **kwargs) # Ua, Sa, VTa = randomized_svd(A, n_components=d, **kwargs) # Ub, Sb, VTb = randomized_svd(B, n_components=d, **kwargs) # print("truncated svd mat shapes:") # print(Ua.shape, Sa.shape, VTa.shape) # print(Ub.shape, Sb.shape, VTb.shape) # return (Ua, np.diag(Sa) @ VTa), (Ub, np.diag(Sb) @ VTb) def test_svd_sketches(): print("test_svd_sketches") N, M, D = 100, 80, 50 np.random.seed(1234) A = np.random.randint(5, size=(N, D)).astype(np.float32) B = np.random.randint(5, size=(D, M)).astype(np.float32) A -= np.mean(A) B -= np.mean(B) AB = A @ B orig_frob_sq = np.sum(AB * AB) prev_normed_err = np.inf # for d in [10]: for d in (1, 2, 4, 8, 16, 32): (Ua, SVTa), (Ub, SVTb) = svd_sketches(A, B, d) AB_hat = Ua @ (SVTa @ Ub) @ SVTb # print("fused mats shapes: ") # print(Ua.shape, SVTa.shape, Ub.shape, SVTb.shape) diffs = AB - AB_hat err_frob_sq = np.sum(diffs * diffs) normed_err_sq = err_frob_sq / orig_frob_sq print('d = {}, err = {:.5f}'.format(d, normed_err_sq)) assert normed_err_sq < 1. assert normed_err_sq < prev_normed_err prev_normed_err = normed_err_sq # ================================================================ FD methods # TODO impl fast-FD, which zeros out half the entries def frequent_directions(A, d, variant=None): N, D = A.shape H = np.zeros((d, D)) assert N >= d assert D >= d # for i in range(N): H[:d - 1] = A[:d - 1] for i in range(d - 1, N): H[-1] = A[i] try: U, S, Vt = np.linalg.svd(H, full_matrices=False) # d x d, d, d x D except np.linalg.LinAlgError as e: print("SVD failed at iter ", i - (d - 1)) print("H shape: ", H.shape) print("A shape: ", A.shape) print("d: ", d) # print("svd mat shape: ", U.shape, S.shape, Vt.shape) raise e # cutoff = S[d - 1] # S is returned as a vector, not a diagonal mat if variant == 'robust': raise NotImplementedError() else: S = np.sqrt((S - S[-1]) ** 2) # note that last entry is dth entry # print("new S shape: ", S.shape) # H = np.diag(S) @ Vt # d x D H = Vt * S.reshape(-1, 1) # d x D; equivalent to np.diag(S) @ Vt return H def fast_frequent_directions(A, d, variant=None, alpha=.5): N, D = A.shape # H = np.zeros((d, D)) H = np.copy(A[:d]) assert N >= d assert D >= d cutoff_idx = int(d * (1 - alpha)) cutoff_idx = min(d - 1, cutoff_idx) # always zero at least last element ntrailing_zeros = d - cutoff_idx i = d while i < N: try: U, S, Vt = np.linalg.svd(H, full_matrices=False) # d x d, d, d x D except np.linalg.LinAlgError as e: print("SVD failed at iter ", i - (d - 1)) print("H shape: ", H.shape) print("A shape: ", A.shape) print("d: ", d) # print("svd mat shape: ", U.shape, S.shape, Vt.shape) raise e cutoff = S[cutoff_idx] if variant == 'parametrized': raise NotImplementedError() else: S = np.sqrt(np.maximum(S - cutoff, 0) ** 2) S = np.sqrt((S - S[-1]) ** 2) # note that last entry is dth entry # print("new S shape: ", S.shape) # H = np.diag(S) @ Vt # d x D H = Vt * S.reshape(-1, 1) # d x D; equivalent to np.diag(S) @ Vt # replace zeroed-out rows of H with next rows of A end_dim = min(N, i + ntrailing_zeros) nrows_to_copy = end_dim - i end_row = cutoff_idx + nrows_to_copy assert nrows_to_copy <= ntrailing_zeros assert end_row <= d H[-nrows_to_copy:] = A[i:end_dim] i = end_dim return H def parametrized_fd_sketches(A, B, d): # from "Improved Practical Matrix Sketching with Guarantees" A_hat = fast_frequent_directions(A.T, d, variant='parametrized', alpha=.2) B_hat = fast_frequent_directions(B.T, d, variant='parametrized', alpha=.2) return A_hat.T, B_hat.T def fd_amm_sketches(A, B, d): # print("A shape: ", A.shape) # print("B shape: ", B.shape) G = np.hstack((A.T, B)) # D x (N + M) H = frequent_directions(G, d) assert H.shape == (d, A.shape[0] + B.shape[1]) C = H[:, :A.shape[0]] # d x N D = H[:, A.shape[0]:] # d x M return C.T, D def fast_fd_amm_sketches(A, B, d): # print("A shape: ", A.shape) # print("B shape: ", B.shape) G = np.hstack((A.T, B)) # D x (N + M) H = fast_frequent_directions(G, d) assert H.shape == (d, A.shape[0] + B.shape[1]) C = H[:, :A.shape[0]] # d x N D = H[:, A.shape[0]:] # d x M return C.T, D def _nmultiplies_frequent_directions(N, D, d): niters = N - d + 1 iter_svd_cost = _nmultiplies_svd(d, D) iter_reweight_cost = d * D iter_cost = iter_svd_cost + iter_reweight_cost return niters * iter_cost def _nmultiplies_fast_frequent_directions(N, D, d): niters = int(np.ceil(N / d)) iter_svd_cost = _nmultiplies_svd(d, D) iter_reweight_cost = d * D iter_cost = iter_svd_cost + iter_reweight_cost return niters * iter_cost def _nmultiplies_fd_amm_sketches(N, D, M, d): N, D = D, N + M # matrices get concatenated return _nmultiplies_frequent_directions(N, D, d) def test_fd_amm_sketches(): print("test_fd_amm_sketches") N, M, D = 100, 80, 50 np.random.seed(1234) A = np.random.randint(5, size=(N, D)).astype(np.float32) B = np.random.randint(5, size=(D, M)).astype(np.float32) # A -= np.mean(A) # B -= np.mean(B) AB = A @ B orig_frob_sq = np.sum(AB * AB) prev_normed_err = np.inf for d in (1, 2, 4, 8, 16, 32): A_hat, B_hat = fd_amm_sketches(A, B, d) AB_hat = A_hat @ B_hat diffs = AB - AB_hat err_frob_sq = np.sum(diffs * diffs) normed_err_sq = err_frob_sq / orig_frob_sq print('d = {}, err = {:.5f}'.format(d, normed_err_sq)) assert normed_err_sq < 1.05 assert normed_err_sq < prev_normed_err prev_normed_err = normed_err_sq # ================================================================ Co-occurring def cooccur_sketches(A, B, d): N, D = A.shape B = B.T M, _ = B.shape assert B.shape[1] == D # assert N >= d # not enough rows in specified A matrix # assert M >= d # not enough cols in specified B matrix # add new rows to A or B so that R from QR factorization is at least d x d if N < d: A_new = np.zeros((d, D), dtype=A.dtype) A_new[:N] = A A = A_new if M < d: B_new = np.zeros((d, D), dtype=B.dtype) B_new[:M] = B B = B_new X = np.copy(A[:, :d]) # N x d Y = np.copy(B[:, :d]) # M x d # mid_idx = d - 2 # does this make it work better for large d? EDIT: nope mid_idx = d // 2 ntrailing_zeros = d - mid_idx i = d while i < D: Qx, Rx = np.linalg.qr(X) # N x d, d x d Qy, Ry = np.linalg.qr(Y) # M x d, d x d prod = Rx @ Ry.T # d x d U, S, Vt = np.linalg.svd(prod, full_matrices=False) # d x d, d, d x d cutoff = S[mid_idx] S = np.sqrt(np.maximum(S - cutoff, 0)) # print("prod.shape", prod.shape) # print("orig X.shape", X.shape) # print("orig Y.shape", Y.shape) X = Qx @ (U * S) # equivalent to U @ np.diag(S) Y = Qy @ (Vt.T * S) # equivalent to Vt.T @ np.diag(S) # print("X.shape", X.shape) # print("Qx.shape", Qx.shape) # print("U.shape", U.shape) # replace zeroed-out cols of X and Y with new cols of A and B end_dim = min(D, i + ntrailing_zeros) ncols_to_copy = end_dim - i end_col = mid_idx + ncols_to_copy assert ncols_to_copy <= ntrailing_zeros assert end_col <= d X[:, mid_idx:end_col] = A[:, i:end_dim] Y[:, mid_idx:end_col] = B[:, i:end_dim] i = end_dim return X[:N], Y[:M].T # slicing is because we may have zero-padded def _nmultiplies_cooccur_sketches(N, D, M, d): niters = int(np.ceil(D / d)) iter_qr_cost = _nmultiplies_qr(N, d) + _nmultiplies_qr(M, d) iter_RRt_cost = d * d * d iter_svd_cost = _nmultiplies_svd(d, d) iter_reweight_cost = N * d + M * d iter_update_x_y_cost = (N * d * d) + (M * d * d) iter_cost = (iter_qr_cost + iter_RRt_cost + iter_svd_cost + iter_reweight_cost + iter_update_x_y_cost) return niters * iter_cost def test_cooccur_sketches(): print("test_cooccur_sketches") # so this doesn't have monotonically better acc as d increases; seems to # run into issues with d being a large fraction of D, possibly because # then it doesn't have many iterations and it's just zeroing out a ton of # the singular vectors N, M, D = 100, 80, 50 # N, M, D = 100, 80, 160 np.random.seed(1234) A = np.random.randint(5, size=(N, D)).astype(np.float32) B = np.random.randint(5, size=(D, M)).astype(np.float32) A -= np.mean(A) B -= np.mean(B) AB = A @ B orig_frob_sq = np.sum(AB * AB) # prev_normed_err = np.inf # for d in [4]: for d in (2, 4, 8, 16, 32): # A_hat, B_hat = fd_amm_sketches(A, B, d) A_hat, B_hat = cooccur_sketches(A, B, d) AB_hat = A_hat @ B_hat # print("fused mats shapes: ") # print(Ua.shape, SVTa.shape, Ub.shape, SVTb.shape) diffs = AB - AB_hat err_frob_sq = np.sum(diffs * diffs) normed_err_sq = err_frob_sq / orig_frob_sq print('d = {}, err = {:.5f}'.format(d, normed_err_sq)) assert normed_err_sq < 1. # assert normed_err_sq < prev_normed_err # prev_normed_err = normed_err_sq # ================================================================ main # def main(): # pass if __name__ == '__main__': np.set_printoptions(formatter={'float': lambda f: "{:.3}".format(f)}) # test_sketch_sq_sample() # test_svd_sketches() # test_fd_amm_sketches() # test_cooccur_sketches() test_rand_sketches() # # N = 1000 # # N = 100 # N = 20 # # N = 10 # M = 10 # # M = 5 # x = np.arange(N) # # x *= x # # x *= x # # x = np.sqrt(x) # # x = 1.1 ** x # # x = 1.15 ** x # x = 2 ** x # # print("x = ", x) # # idxs, weights = sample_varopt_1d(x, M) # idxs, weights = importance_sample(x, M) # y = x[idxs] * weights # xsum, ysum = x.sum(), y.sum() # # print("idxs = ", idxs) # print("vals = ", x[idxs]) # print("weights = ", weights) # print("vals * weights", y) # # print("true sum, sample sum: ", xsum, ysum) # print("sum rel err: ", (xsum - ysum) / xsum)
bolt-master
experiments/python/amm.py
bolt-master
experiments/python/vq.py
#!/bin/env/python import numpy as np def energy(A): if A.ndim < 2 or len(A) < 2: return 0 diffs = A - A.mean(axis=0) return np.sum(diffs * diffs) def run_trial(N=100, D=3, seed=None): if seed is not None: np.random.seed(seed) w0, w = np.random.randn(2, D) X = np.random.randn(N, D) X1 = X[(X @ w) > 0] X2 = X[(X @ w) <= 0] U = X[(X @ w0) > 0] V = X[(X @ w0) <= 0] U1 = U[(U @ w) > 0] U2 = U[(U @ w) <= 0] V1 = V[(V @ w) > 0] V2 = V[(V @ w) <= 0] energy_0 = energy(X) energy_w = energy(X1) + energy(X2) energy_w0 = energy(U) + energy(V) energy_w0_w = energy(U1) + energy(U2) + energy(V1) + energy(V2) gain1 = energy_0 - energy_w gain2 = energy_w0 - energy_w0_w if gain1 < gain2: print("N, D, seed = ", N, D, seed) print("energy_0:", energy_0) print("energy_w:", energy_w) print("energy_w0:", energy_w0) print("energy_w0_w:", energy_w0_w) print("gain1:", gain1) print("gain2:", gain2) print("w0:\n", w0) print("w: \n", w) # print("X\t({:.3f}):\n{}".format(energy(X), X)) # print("X1\t({:.3f}):\n{}".format(energy(X1), X1)) # print("X2\t({:.3f}):\n{}".format(energy(X2), X2)) # print("U\t({:.3f}):\n{}".format(energy(U), U)) # print("U1\t({:.3f}):\n{}".format(energy(U1), U1)) # print("U2\t({:.3f}):\n{}".format(energy(U2), U2)) # print("V\t({:.3f}):\n{}".format(energy(V), V)) # print("V1\t({:.3f}):\n{}".format(energy(V1), V1)) # print("V2\t({:.3f}):\n{}".format(energy(V2), V2)) print("X energy: \t{:.3f}".format(energy(X))) print("X1 energy: \t{:.3f}".format(energy(X1))) print("X2 energy: \t{:.3f}".format(energy(X2))) print("U energy: \t{:.3f}".format(energy(U))) print("U1 energy: \t{:.3f}".format(energy(U1))) print("U2 energy: \t{:.3f}".format(energy(U2))) print("V energy: \t{:.3f}".format(energy(V))) print("V1 energy: \t{:.3f}".format(energy(V1))) print("V2 energy: \t{:.3f}".format(energy(V2))) if D == 2: import matplotlib.pyplot as plt _, axes = plt.subplots(2, 2, figsize=(7.5, 7)) # plt.scatter(X[:, 0], X[:, 1]) for ax in axes.ravel(): ax.set_xlim([-2.5, 2.5]) ax.set_ylim([-2.5, 2.5]) # ax.plot([0, w0[0]], [0, w0[1]]) # ax.plot([0, w[0]], [0, w[1]]) axes[0, 0].set_title("X") axes[0, 0].scatter(X[:, 0], X[:, 1]) axes[0, 1].set_title("U and V (split on w0)") axes[0, 1].plot([0, w0[0]], [0, w0[1]]) axes[0, 1].scatter(U[:, 0], U[:, 1]) axes[0, 1].scatter(V[:, 0], V[:, 1]) axes[1, 0].set_title("X1 and X2 (split on w)") axes[1, 0].plot([0, w[0]], [0, w[1]]) axes[1, 0].scatter(X1[:, 0], X1[:, 1]) axes[1, 0].scatter(X2[:, 0], X2[:, 1]) axes[1, 1].set_title("U1, U2, V1, V2 (split on w0 and w)") axes[1, 1].plot([0, w0[0]], [0, w0[1]]) axes[1, 1].plot([0, w[0]], [0, w[1]]) axes[1, 1].scatter(U1[:, 0], U1[:, 1]) axes[1, 1].scatter(U2[:, 0], U2[:, 1]) axes[1, 1].scatter(V1[:, 0], V1[:, 1]) axes[1, 1].scatter(V2[:, 0], V2[:, 1]) plt.tight_layout() plt.show() assert gain1 >= gain2 def main(): ntrials = 100 # for N in [4, 8, 16, 32, 64, 128, 256]: for N in [64, 128, 256]: # for D in [1, 2, 3, 5, 10, 100]: for D in [100, 200]: for trial in range(ntrials): run_trial(N=N, D=D, seed=trial) if __name__ == '__main__': np.set_printoptions(precision=3) main()
bolt-master
experiments/python/submodular_scratch.py
#!/bin/env/python import collections import os import numpy as np import matplotlib as mpl import matplotlib.pyplot as plt import seaborn as sb import pandas as pd import pathlib as pl # from . import files from . import amm_results2 as res # from . import amm_methods as ameth # sb.set_context('poster') # sb.set_context('talk') # sb.set_cmap('tab10') FIGS_SAVE_DIR = pl.Path('../figs/amm') USE_FONT = 'DejaVu Sans' mpl.rcParams['font.family'] = 'sans-serif' mpl.rcParams['font.sans-serif'] = [USE_FONT] # to avoid type3 fonts; 42 = truetype, which is more flexible than type1 mpl.rcParams['pdf.fonttype'] = 42 mpl.rcParams['ps.fonttype'] = 42 def fix_ticks(): # recover from seaborn white style messing this up plt.rcParams['xtick.bottom'] = True plt.rcParams['ytick.left'] = True if not os.path.exists(FIGS_SAVE_DIR): FIGS_SAVE_DIR.mkdir(parents=True) def set_seaborn_style(stylename): sb.set_style(stylename) fix_ticks() def save_fig(name): # plt.savefig(os.path.join(FIGS_SAVE_DIR, name + '.png'), # dpi=300, bbox_inches='tight') plt.savefig(os.path.join(FIGS_SAVE_DIR, name + '.pdf'), bbox_inches='tight') def _xlabel_for_xmetric(x_metric): return {'d': 'Sketch Size', 'secs': 'Time (s)', 'muls': 'Number of Multiplies', 'nlookups': 'Number of Lookups', 'ops': 'Number of Operations', 'Latency': 'Latency (ms)', 'Speedup': 'Speedup Over Exact Matrix Multiply', 'NormalizedTime': 'Normalized Latency', 'Throughput': 'Throughput (elements/s)'}[x_metric] def _ylabel_for_xmetric(y_metric): if y_metric == 'Relative Accuracy': return 'Normalized\nAccuracy' if y_metric == 'Accuracy': return 'Classification\nAccuracy' return y_metric def add_ylabels_on_right(axes, fmt, vals): for i, ax in enumerate(axes): lbl = fmt.format(vals[i]) ax2 = ax.twinx() ax2.get_xaxis().set_visible(False) ax2.yaxis.set_label_position('right') ax2.set_ylabel(lbl, fontsize=14, family=USE_FONT, labelpad=5) sb.despine(ax=ax2, top=True, left=True, bottom=True, right=True) plt.setp(ax2.get_xticklabels(), visible=False) plt.setp(ax2.get_yticklabels(), visible=False) ax2.set_yticks([]) ax2.tick_params(axis='y', which='y', length=0) def scan_speed_fig(save=True): # ================================ data cleaning df = res.scan_timings() name_map = collections.OrderedDict() # name_map['mithral scan'] = 'Mithral' name_map['mithral scan'] = 'MADDNESS' # name_map['mithral scan'] = 'Maddness' # name_map['bolt scan uint8'] = 'Bolt\nCheating' name_map['bolt scan safe uint16'] = 'Bolt' name_map['popcount scan'] = 'Popcount' name_map['pq scan'] = 'PQ / OPQ' df = res.rename_values_in_col(df, 'algo', name_map) df = res.melt_times(df) # alright, can't get stds to show without really screwing with stuff # times = np.array(df['time']) # times += np.random.randn(len(df['time'])) * .1 # get 1px for stds # # mask = df['algo'] == 'PQ / OPQ' # mask = df['B'] == 64 # df['time'].loc[mask] = times[mask] df['thruput'] = df['N'] * df['M'] / df['time'] df['thruput'] /= 1e6 # just use units of billions; times are in ms # df['thruput'] *= 1e3 # times are in ms # ================================ fig creation sb.set_context("talk") # fig, ax = plt.subplots(1, 1, figsize=(8, 5)) fig, ax = plt.subplots(1, 1, figsize=(8, 4)) axes = [ax] sb.barplot(data=df, x='algo', y='thruput', units='timing_trial', hue='B', hue_order=[8, 16, 32, 64], order=name_map.values(), ax=ax, ci='sd') # ------------------------ clean up / format axes for ax in axes[:-1]: # remove x labels except for bottom axis plt.setp(ax.get_xticklabels(), visible=False) ax.get_xaxis().set_visible(False) handles, labels = axes[0].get_legend_handles_labels() labels = ['8B Codes', '16B Codes', '32B Codes', '64B Codes'] # labels = ['8 Bytes', '16 Bytes', '32 Bytes', '64 Bytes'] # labels = ['8B', '16B', '32B', '64B'] plt.figlegend(handles, labels, loc='lower center', ncol=4, fontsize=14) for ax in axes: ax.set_ylabel('Billion Dot Products/s', family=USE_FONT) ax.get_legend().remove() # ------------------------ have bottom / top axes print title, x info axes[0].set_title('Speed of f() Functions for Different Encoding Sizes', y=1.04, family=USE_FONT, fontsize=20) # # get and set them again so we can make the first one bold; can't make # # it bold beforehand because need a tick lbl object, not a string # xlabels = list(axes[-1].get_xticklabels()) # xlabels[0].set_weight('bold') # # axes[-1].set_xticklabels(xlabels, rotation=60, ha='right') # axes[-1].set_xticklabels(xlabels) axes[-1].tick_params(axis='x', which='major', pad=4) axes[-1].set_xlabel("", labelpad=-30) ax.xaxis.set_ticks_position('none') # ------------------------ save / show plot plt.tight_layout() # plt.subplots_adjust(bottom=.21) plt.subplots_adjust(bottom=.23) if save: save_fig('scan_speed') else: plt.show() def encode_speed_fig(save=True): # ================================ data cleaning df = res.encode_timings() df = df.loc[df['algo'] != 'mithral encode i16'] # print("df ours f32: ", df.loc[df['algo'].str.lower().str.strip() == 'mithral encode f32']) # print("df ours f32: ", df.loc[df['algo'].str.lower().str.strip() == 'mithral encode i8']) # print(df) # # # print(df['B']) # # # print(df['C']) # import sys; sys.exit() name_map = collections.OrderedDict() # name_map['mithral encode i8'] = r'$\bf{Mithral}$ $\bf{i8}$') # name_map['mithral encode i8'] = r'$\bf{Mithral}$ $\bf{i8}$') # name_map['mithral encode i8'] = 'Mithral i8' # name_map['mithral encode i16'] = 'Mithral i16' # no i16 in plot # name_map['mithral encode f32'] = 'Mithral f32' # name_map['mithral encode i8'] = 'MADDNESS i8' # name_map['mithral encode f32'] = 'MADDNESS f32' name_map['mithral encode f32'] = 'MADDNESS' name_map['bolt encode'] = 'Bolt' name_map['pq encode'] = 'PQ' name_map['opq encode'] = 'OPQ' df = res.rename_values_in_col(df, 'algo', name_map) df = res.melt_times(df, ntimes=5) order = 'MADDNESS Bolt PQ OPQ'.split() # df['thruput'] = df['N'] * df['D'] / df['time'] # df['thruput'] = df['N'] / (df['time'] * .001) # rows/sec time_secs = (df['time'] * .001) df['elemsz'] = 4 df['elemsz'].loc[df['algo'].str.endswith('i8')] = 1 df['elemsz'].loc[df['algo'].str.endswith('i16')] = 2 df['thruput'] = df['N'] * df['D'] * df['elemsz'] / time_secs # GB/sec df['thruput'] /= 1e9 # convert to GB # df['thruput'] /= 1e6 # just use units of billions; times are in ms # full_byte_per_codebook = df['algo'].isin(['PQ', 'OPQ']) # df['B'] = df['C'].values / 2 # # cvals = df['C'].loc[full_byte_per_codebook] # df['B'].loc[full_byte_per_codebook] = df['C'].loc[full_byte_per_codebook] # df['B'] = df['B'].astype(np.int) # # print("df.cols: ", df.columns) # print(df) # # # print(df['B']) # # # print(df['C']) # import sys; sys.exit() # ================================ fig creation sb.set_context('talk') # sb.set_style('darkgrid') # sb.set_style('white') set_seaborn_style('white') # use_nbytes = [8, 16, 32, 64] use_nbytes = [8, 16, 32] # fig, axes = plt.subplots(len(use_nbytes), 1, figsize=(6, 8), sharey=True) # fig, axes = plt.subplots(len(use_nbytes), 1, figsize=(6, 6.5), sharey=True) # fig, axes = plt.subplots(len(use_nbytes), 1, figsize=(6, 7), sharey=True) fig, axes = plt.subplots(len(use_nbytes), 1, figsize=(6, 6.5), sharey=True) for i, nbytes in enumerate(use_nbytes): data = df.loc[df['B'] == nbytes] # print("df.cols: ", df.columns) # print(data) # # # print(df['B']) # # # print(df['C']) # import sys; sys.exit() order = name_map.values() dashes = {name: ([] if name.lower().startswith('maddness') else mpl.rcParams['lines.dashed_pattern']) for name in order} # dashes = None # sb.lineplot(data=data, x='D', y='thruput', hue='algo', # sb.lineplot(data=data, x='D', y='thruput', hue='algo', units='timing_trial', sb.lineplot(data=data, x='D', y='thruput', hue='algo', # ax=axes[i], ci='sd', estimator=None, hue_order=order, ax=axes[i], ci='sd', estimator='mean', hue_order=order, # ax=axes[i], ci=None, estimator='mean', hue_order=order, style='algo', style_order=order, dashes=dashes, palette=my_colors_list) # import sys; sys.exit() # ------------------------ axis cleanup axes[0].set_title('Speed of g() Functions\nfor Different Encoding Sizes', y=1.04, family=USE_FONT, fontsize=16) handles, labels = axes[0].get_legend_handles_labels() handles, labels = handles[1:], labels[1:] # rm df column name # plt.figlegend(handles, labels, loc='lower center', ncol=3, fontsize=13) plt.figlegend(handles, labels, loc='lower center', ncol=4, fontsize=13) for ax in axes: # ax.semilogx() ax.semilogy() ax.set_ylim([.02, 1000]) # ax.set_yticks([.1, 1, 10, 100, 1000]) ax.set_yticks([.1, 10, 1000]) ax.get_legend().remove() # ax.set_ylabel('Billions of\nScalars Encoded/s', # ax.set_ylabel('Scalars Encoded/s\n(Billions)', # ax.set_ylabel('Scalars Encoded\nper Second (Billions)', # ax.set_ylabel('Scalars Encoded\nper Second', # ax.set_ylabel('Scalars Encoded/s', # ax.set_ylabel('Rows Encoded/s', ax.set_ylabel('Encoding\nSpeed (GB/s)', family=USE_FONT, fontsize=14) for ax in axes[:-1]: # remove x labels except for bottom axis ax.tick_params(axis='x', which='x', length=0) plt.setp(ax.get_xticklabels(), visible=False) ax.set_xlabel("", visible=False) # ax.get_xaxis().set_visible(False) # ax.get_xticklabels().set_visible(False) axes[-1].set_xlabel('Number of Columns in Matrix A', family=USE_FONT, fontsize=14) # add byte counts on the right add_ylabels_on_right(axes, "{}B Encodings", use_nbytes) plt.tight_layout() # plt.subplots_adjust(bottom=.18, hspace=.15) # plt.subplots_adjust(bottom=.19, hspace=.15) plt.subplots_adjust(bottom=.17, hspace=.15) # plt.subplots_adjust(bottom=.21, hspace=.15) if save: save_fig('encode_speed') else: plt.show() def lut_speed_fig(save=True): # ================================ data cleaning df = res.lut_timings() name_map = collections.OrderedDict() # name_map['mithral lut dense'] = '$\bf{Mithral}$' # name_map['mithral lut sparse'] = '$\bf{Mithral}$' name_map['mithral lut dense'] = 'MADDNESS' name_map['mithral lut sparse'] = 'MADDNESS' name_map['bolt lut'] = 'Bolt' name_map['pq lut'] = 'PQ' name_map['opq lut'] = 'OPQ' df = res.rename_values_in_col(df, 'algo', name_map) # print(df[:20]) # df['lutconst'] = df['lutconst'].str.strip().astype(np.float).astype(np.int) # print("df.dtypes", df.dtypes) # import sys; sys.exit() names = list(df['algo']) consts = np.array(df['lutconst']) # print("len(names)", len(names)) # print("len(consts)", len(consts)) mithral_const_to_name = collections.OrderedDict() mithral_const_to_name[-1] = 'MADDNESS, L = ∞' mithral_const_to_name[4] = 'MADDNESS, L = 4' mithral_const_to_name[2] = 'MADDNESS, L = 2' mithral_names = list(mithral_const_to_name.values()) # add lut constant into the name for mithral variations new_names = [] ismithral = [] for i, name in enumerate(names): if not name.startswith('Mithral'): new_names.append(name) ismithral.append(False) continue # const = consts[i] # const = "{:d}".format(int(const)) if const > 0 else "∞" # new_names.append(f"{name}, L = {const}") new_names.append(mithral_const_to_name[int(consts[i])]) ismithral.append(True) # print("len(new_names)", len(new_names)) df['algo'] = new_names df['ismithral'] = ismithral df = res.melt_times(df, ntimes=5) # df = res.melt_times(df, ntimes=3) # TODO rerun with ntrials=5 # print(df) df['thruput'] = df['N'] * df['D'] / df['time'] # df['thruput'] /= 1e6 # just use units of billions; times are in ms # # TODO rm once we have updated results # mask = df['algo'].isin(('PQ', 'OPQ')) # df['B'] = -1 # create placeholder col # df['B'].loc[mask] = df['C'].loc[mask] # df['B'].loc[~mask] = df['C'].loc[~mask] / 2 # ================================ fig creation sb.set_context('talk') # sb.set_style('darkgrid') # sb.set_style('white') set_seaborn_style('white') # use_nbytes = [8, 16, 32, 64] use_nbytes = [8, 16, 32] fig, axes = plt.subplots(len(use_nbytes), 1, figsize=(6, 8), sharey=True) order = [mithral_names[2], 'Bolt', mithral_names[1], 'PQ', mithral_names[0], 'OPQ'] dashes = {k: ('-' if k in mithral_names else '--') for k in order} # dashes = {k: ('solid' if k in mithral_names else 'dashed') for k in order} # dashes = {k: (None if k in mithral_names else [3, 3]) for k in order} # dashes = True # print(dashes) # import sys; sys.exit() for i, nbytes in enumerate(use_nbytes): data = df.loc[df['B'] == nbytes] ax = axes[i] # print(f"------------------------ {nbytes}B") # manual version # for algo in order: # subdf = data.loc[df['algo'] == algo] # print("plotting algo: ", algo) # x = subdf['D'].as_matrix() # y = subdf['thruput'].as_matrix() # sort_idxs = np.argsort(x) # x, y = x[sort_idxs], y[sort_idxs] # ax.plot(x, y, dashes[algo], label=algo) dashes = {name: ([] if name.lower().startswith('mithral') else mpl.rcParams['lines.dashed_pattern']) for name in order} sb.lineplot(data=data, x='D', y='thruput', hue='algo', units='timing_trial', ax=axes[i], ci='sd', estimator=None, hue_order=order, style='algo', style_order=order, dashes=dashes) # sb.lineplot(data=data, x='D', y='thruput', hue='algo', units='timing_trial', # hue_order=order, # # hue_order=order, style='algo', style_order=order, # # dashes=True, # style='ismithral', style_order=[True, False], dashes=True, # ax=axes[i], ci='sd', estimator=None) # ------------------------ axis cleanup axes[0].set_title('Speed of h() Functions\nfor Different Encoding Sizes', y=1.04, family=USE_FONT, fontsize=18) # for ax in axes: # print("ax handles, labels: ") # print(ax.get_legend_handles_labels()) handles, labels = axes[-1].get_legend_handles_labels() handles, labels = handles[1:], labels[1:] # rm df column name # handles, labels = handles[:-3], labels[:-3] # rm ismithral plt.figlegend(handles, labels, loc='lower center', ncol=3, fontsize=13) for ax in axes: # ax.semilogx() ax.semilogy() ax.get_legend().remove() ax.set_ylabel('Scalars Encoded/s', family=USE_FONT, fontsize=14) for ax in axes[:-1]: # remove x labels except for bottom axis ax.tick_params(axis='x', which='x', length=0) plt.setp(ax.get_xticklabels(), visible=False) ax.set_xlabel("", visible=False) axes[-1].set_xlabel('Number of Rows in Matrix B', family=USE_FONT, fontsize=14) # add byte counts on the right add_ylabels_on_right(axes, "{}B Encodings", use_nbytes) plt.tight_layout() plt.subplots_adjust(bottom=.18, hspace=.15) if save: save_fig('lut_speed') else: plt.show() def lotsa_colors_cmap(value): assert 0 <= value <= 1 # if this throws, I don't understand cmaps if value < .3333: return plt.get_cmap('tab20')(3 * value) elif value < .6666: return plt.get_cmap('tab20b')((3 * value) - 1) else: return plt.get_cmap('tab20c')((3 * value) - 2) # def my_tab10(value): # assert 0 <= value <= 1 # value = int(value * 10) # perm = [3, 1, 2, 4, 5, 6, 7, 8, 9] # make red first, then orange # value = perm[value] # return plt.get_cmap('tab10')((value / 10.) + .01) # def my_cmap(value): my_colors_list = (plt.get_cmap('Set1').colors + plt.get_cmap('Set3').colors[:1] # skip light yellow + plt.get_cmap('Set3').colors[2:] + plt.get_cmap('Dark2').colors[:6]) # my_colors_list = my_colors_list[:5] + () my_colors_list[6:] # rm bright yellow # new_yellow = (240./255, 230./255, 140./255) new_yellow = (204. / 255, 204. / 255, 0. / 255) # print(type(my_colors_list)) # print(my_colors_list) my_colors_list = my_colors_list[:5] + (new_yellow,) + my_colors_list[6:] # print(type(my_colors_list)) # print(my_colors_list) # import sys; sys.exit() # DEFAULT_PLOT_METHODS = ('Mithral', 'MithralPQ', 'Brute Force', 'Bolt', # DEFAULT_PLOT_METHODS = ('MADDNESS', 'MADDNESS-PQ', 'Exact', 'Bolt', # 'FastJL', 'HashJL', 'OSNAP', 'PCA', 'SparsePCA', # 'Rademacher', 'RandGauss', 'OrthoGauss') DEFAULT_PLOT_METHODS = ( 'MADDNESS', 'MADDNESS-PQ', 'Exact', 'ScalarQuantize', 'Bolt', # 'MADDNESS', 'Exact', 'ScalarQuantize', 'Bolt', # 'FastJL', 'HashJL', 'PCA', 'RandGauss', 'SparsePCA') 'FastJL', 'HashJL', 'PCA', 'SparsePCA') # 'FastJL', 'HashJL', 'PCA', 'SparsePCA') # 'MADDNESS', 'MADDNESS-PQ', 'Exact', 'Bolt', # 'FastJL', 'HashJL', 'PCA', 'RandGauss', 'SparsePCA') def lineplot(data, ax, x_metric, y_metric, units=None, scatter=False, # plot_methods=None): plot_methods=DEFAULT_PLOT_METHODS, first_two_same_marker=True, **kwargs): estimator = 'mean' if units is None else None if plot_methods is not None: data = data.loc[data['method'].isin(set(plot_methods))] order = plot_methods else: # order = 'Ours Bolt Exact PQ SVD FD-AMM CD'.split() # order = [m for m in order if m in data['Method'].unique()] order = list(data['method'].unique()) # move_methods_to_front = ['Ours', 'OursPQ', 'Brute Force'] # move_methods_to_front = ['Mithral', 'MithralPQ', 'Brute Force'] mithral_methods = [method for method in order # if method.lower().startswith('mithral')][::-1] if method.lower().startswith('maddness')][::-1] move_methods_to_front = mithral_methods[:] # move_methods_to_front.append('Brute Force') move_methods_to_front.append('Exact') for elem in move_methods_to_front[:]: if elem in order: order.remove(elem) else: move_methods_to_front.remove(elem) order = move_methods_to_front + sorted(order) order = [method for method in order if method in data['method'].unique()] # order = plot_methods # order = list(data['method'].unique()) # have to specify markers or seaborn freaks out because it doesn't # have enough of them # filled_markers = ('o', 'v', '^', '<', '>', '8', 's', 'p', '*', 'h', # 'H', 'D', 'd', 'P', 'X') # use_markers = ('*', '*', 's') + ( initial_markers = ('D', 'D', 's') if first_two_same_marker else ('D', 's') use_markers = initial_markers + ( 'o', 'v', '^', '<', '>', '8', 'p', 'h', 'd', 'P', 'X', '*', 'D') if scatter: # sb.violinplot(cut=0, saturation=1, linewidth=.001, scale='width', inner='box', # data['Speedup'] *= 1 + (np.random.randn(len(data['Speedup'])) / 100) sb.scatterplot(alpha=.25, # seems to suck the least data=data, x=x_metric, y=y_metric, hue='method', style='method', style_order=order, hue_order=order, markers=use_markers, estimator=estimator, # units=units, estimator=estimator, markers=use_markers, palette=my_colors_list, ax=ax) # sb.boxplot(linewidth=.1, width=2, whis=999, # sb.stripplot(alpha=.25, orient='v', jitter=False, # data=data, x=x_metric, y=y_metric, hue='method', hue_order=order, # palette=my_colors_list, ax=ax) return kwargs.setdefault('ci', 'sd') sb.lineplot(data=data, x=x_metric, y=y_metric, hue='method', # style='method', style_order=order[::-1], hue_order=order[::-1], style='method', style_order=order, hue_order=order, markers=use_markers, estimator=estimator, # units=units, estimator=estimator, markers=use_markers, dashes=False, palette=my_colors_list, ax=ax, **kwargs) lines = ax.get_lines() for i, line in enumerate(lines): line.set_zorder(10 - i) # def cifar_fig(save=False, x_metric='Throughput', y_metric='Accuracy'): def cifar_fig(save=False, x_metric='Speedup', y_metric='Accuracy'): df10 = res.cifar10_amm() df100 = res.cifar100_amm() sb.set_context('poster') # fig, axes = plt.subplots(2, 1, figsize=(11, 13.5), sharex=True) # fig, axes = plt.subplots(2, 1, figsize=(11, 10), sharex=True) fig, axes = plt.subplots(2, 1, figsize=(11, 8.5), sharex=True) # plot_methods = ['Mithral', 'MithralPQ', 'Brute Force', 'Bolt', # plot_methods = ['MADDNESS', 'MADDNESS-PQ', 'Exact', 'Bolt', # 'FastJL', 'HashJL', 'OSNAP', 'PCA', 'SparsePCA', # 'Rademacher', 'RandGauss', 'OrthoGauss'] # # df10 = df10.loc[df10['method'].isin(set(plot_methods))] # df100 = df100.loc[df100['method'].isin(set(plot_methods))] # df10 = df10.loc[df10['method'] != 'OrthoGauss'] # df100 = df100.loc[df100['method'] != 'OrthoGauss'] lineplot(df10, axes[0], x_metric=x_metric, y_metric=y_metric) lineplot(df100, axes[1], x_metric=x_metric, y_metric=y_metric) # plt.suptitle('Sketch size vs Classification Accuracy') xlbl = _xlabel_for_xmetric(x_metric) # plt.suptitle('{} vs {}'.format(xlbl, y_metric)) plt.suptitle('Approximating Softmax Classifiers', family=USE_FONT) axes[0].set_title('CIFAR-10', family=USE_FONT) for ax in axes: ax.set_ylabel(_ylabel_for_xmetric(y_metric), family=USE_FONT) axes[0].set_xlabel(None) axes[1].set_xlabel(xlbl, family=USE_FONT) axes[1].set_title('CIFAR-100', family=USE_FONT) handles, labels = axes[0].get_legend_handles_labels() handles, labels = handles[1:], labels[1:] # rm 'Method' title # axes[0].legend(handles, labels, fontsize='small') # axes[1].legend(handles, labels, fontsize='small') # plt.figlegend(handles, labels, loc='lower center', ncol=1) # plt.figlegend(handles, labels, loc='center right', ncol=1) for ax in axes.ravel(): ax.get_legend().remove() if y_metric == 'Accuracy': axes[0].set_ylim([.09, .96]) axes[1].set_ylim([.009, .73]) elif y_metric == '1 - NMSE': axes[0].set_ylim([0, 1.02]) axes[1].set_ylim([0, 1.02]) # axes[1].get_legend().remove() # axes[1].get_legend().remove() plt.figlegend(handles, labels, loc='lower center', ncol=3) # if x_metric in ('muls', 'ops', 'nlookups', 'Latency', 'Throughput'): axes[0].semilogx() for ax in axes: if x_metric == 'Speedup': ax.set_xlim([.94, ax.get_xlim()[1]]) elif x_metric == 'NormalizedTime': ax.set_xlim([ax.get_xlim()[0], 1.06]) plt.tight_layout() # plt.subplots_adjust(top=.91, bottom=.24) plt.subplots_adjust(top=.89, bottom=.32) # plt.subplots_adjust(top=.95, bottom=.1) save_fig('cifar_{}_{}'.format(x_metric, y_metric)) # save_fig('cifar_{}_{}_no_maddnesspq'.format(x_metric, y_metric)) def fig1(save=False, x_metric='Speedup', y_metric='Accuracy'): df10 = res.cifar10_amm() df100 = res.cifar100_amm() sb.set_context('poster') fig, axes = plt.subplots(2, 1, figsize=(11, 10), sharex=True) # df10['method'] = df10['method'].str.replace('Mithral', 'HashMul') # replace_names_dict = {'Mithral': 'Ours', replace_names_dict = {'MADDNESS': 'Ours', # 'SparsePCA': '2nd best (Mairal et al.)', # 'HashJL': '3rd best (Dasgupta et al.)', 'SparsePCA': 'Mairal et al.', 'HashJL': 'Dasgupta et al.', 'Exact': 'Exact Matrix Multiply' } # print("--- about to run the rename we care about") df10 = res.rename_values_in_col(df10, 'method', replace_names_dict) df100 = res.rename_values_in_col(df100, 'method', replace_names_dict) # df10['method'] = df10['method'].str.replace(replace_names_dict) # df100['method'] = df100['method'].str.replace(replace_names_dict) # print('df10 methods: ', df10['method'].unique()) # import sys; sys.exit() # plot_methods = ['Ours', '2nd best', '3rd best', 'Exact Matrix Multiply'] # plot_methods = ['Ours', 'Mairal et al.', 'Dasgupta et al.', 'Exact Matrix Multiply'] plot_methods = ['Ours', 'Exact Matrix Multiply', 'Mairal et al.', 'Dasgupta et al.'] # plot_methods = ['Ours', '3rd best', '2nd best', 'Exact Matrix Multiply'] # plot_methods = ['Mithral', 'SparsePCA', 'HashJL', 'Brute Force'] # df10 = df10.loc[df10['method'].isin(set(plot_methods))] # df100 = df100.loc[df100['method'].isin(set(plot_methods))] # df10 = df10.loc[df10['method'] != 'OrthoGauss'] # df100 = df100.loc[df100['method'] != 'OrthoGauss'] lineplot(df10, axes[0], x_metric=x_metric, y_metric=y_metric, plot_methods=plot_methods, ci=None, first_two_same_marker=False) lineplot(df100, axes[1], x_metric=x_metric, y_metric=y_metric, plot_methods=plot_methods, ci=None, first_two_same_marker=False) # plt.suptitle('Sketch size vs Classification Accuracy') xlbl = _xlabel_for_xmetric(x_metric) # plt.suptitle('{} vs {}'.format(xlbl, y_metric)) plt.suptitle('Approximating Softmax Classifiers', family=USE_FONT) axes[0].set_title('CIFAR-10', family=USE_FONT) for ax in axes: ax.set_ylabel(_ylabel_for_xmetric(y_metric), family=USE_FONT) axes[0].set_xlabel(None) axes[1].set_xlabel(xlbl, family=USE_FONT) axes[1].set_title('CIFAR-100', family=USE_FONT) handles, labels = axes[0].get_legend_handles_labels() handles, labels = handles[1:], labels[1:] # rm 'Method' title # axes[0].legend(handles, labels, fontsize='small') # axes[1].legend(handles, labels, fontsize='small') # plt.figlegend(handles, labels, loc='lower center', ncol=1) # plt.figlegend(handles, labels, loc='center right', ncol=1) for ax in axes.ravel(): ax.get_legend().remove() if y_metric == 'Accuracy': axes[0].set_ylim([.09, .96]) axes[1].set_ylim([.009, .73]) elif y_metric == '1 - NMSE': axes[0].set_ylim([0, 1.02]) axes[1].set_ylim([0, 1.02]) # axes[1].get_legend().remove() # axes[1].get_legend().remove() plt.figlegend(handles, labels, loc='lower center', ncol=2) # if x_metric in ('muls', 'ops', 'nlookups', 'Latency', 'Throughput'): axes[0].semilogx() for ax in axes: if x_metric == 'Speedup': ax.set_xlim([.94, ax.get_xlim()[1]]) elif x_metric == 'NormalizedTime': ax.set_xlim([ax.get_xlim()[0], 1.06]) plt.tight_layout() plt.subplots_adjust(top=.89, bottom=.23) save_fig('fig1') def caltech_fig(x_metric='Speedup', y_metric='1 - NMSE'): # df = res.caltech_amm() # df = res.caltech_amm() df0 = res.caltech_amm(filt='sobel') df1 = res.caltech_amm(filt='dog5x5') # print("df cols: ", df.columns) sb.set_context('poster') # fig, ax = plt.subplots(1, 1, figsize=(11, 6)) fig, axes = plt.subplots(2, 1, figsize=(12, 8)) # axes = [ax] # is_mithral = df['method'].str.startswith('Mithral') # is_exact = df['method'] == 'Brute Force' # others_to_keep = df['method'].isin(['Brute Force', 'PCA', 'SparsePCA']) # others_to_keep = df['method'].isin(['PCA', 'SparsePCA']) # df = df.loc[is_mithral | others_to_keep] # others suck too hard # df = df.loc[~(df['method'].isin(['Mithral, L = 2', 'Mithral, L = 4']))] # df['method'].loc[df['method'] == 'Mithral, L = ∞'] = 'Mithral' # print("df0 uniq methods: ", df0['method'].unique()) # print("df1 uniq methods: ", df1['method'].unique()) # import sys; sys.exit() # keep_methods = ['Mithral', 'MithralPQ', 'SparsePCA', 'PCA', 'OSNAP'] # keep_methods = ['Mithral', 'MithralPQ', 'SparsePCA', 'PCA', 'HashJL', 'OSNAP', 'FastJL'] # keep_methods = ['Mithral', 'MithralPQ', 'SparsePCA', 'PCA'] # keep_methods = ['MADDNESS', 'MADDNESS-PQ', 'SparsePCA', 'PCA'] # even scalar quantize is slower than custom exact matmul; note that # in the 5x5 plot, it's occluded by maddness (near perfect mse, but # slightly to the left of 1x speedup) # keep_methods = ['MADDNESS', 'MADDNESS-PQ', 'ScalarQuantize', 'SparsePCA'] keep_methods = ['MADDNESS', 'MADDNESS-PQ', 'SparsePCA'] df0 = df0.loc[df0['method'].isin(keep_methods)] df1 = df1.loc[df1['method'].isin(keep_methods)] # print("df0 kept methods: ", df0['method'].unique()) # print("df1 kept methods: ", df1['method'].unique()) # print("df1 scalar quantize numbers: ", df1.loc[df1['method'] == 'ScalarQuantize']) # import sys; sys.exit() # print("df1:\n", df1.loc[(df1['method'] == 'MithralPQ') & df1['task_id'].str.contains('509')]) # import sys; sys.exit() # lineplot(df, ax, x_metric=x_metric, y_metric=y_metric, units=None) lineplot(df0, axes[0], x_metric=x_metric, y_metric=y_metric, plot_methods=keep_methods) lineplot(df1, axes[1], x_metric=x_metric, y_metric=y_metric, plot_methods=keep_methods) handles, labels = axes[-1].get_legend_handles_labels() handles, labels = handles[1:], labels[1:] # rm 'Method' title # plt.figlegend(handles, labels, loc='lower center', ncol=2) # plt.figlegend(handles, labels, loc='lower center', ncol=4) plt.figlegend(handles, labels, loc='lower center', ncol=len(keep_methods)) # plt.suptitle('Approximating an Image Filter') for ax in axes: ax.set_xlabel(_xlabel_for_xmetric(x_metric), fontsize=20) ax.set_ylabel(y_metric) ax.get_legend().remove() ax.set_ylim([-.01, 1.01]) ax.plot([1, 1], ax.get_ylim(), 'k--') # for ax in axes[:-1]: # # remove x labels except for bottom axis # plt.setp(ax.get_xticklabels(), visible=False) # ax.get_xaxis().set_visible(False) axes[0].set_title('Approximating a Sobel Filter', y=1.02, fontsize=28) axes[1].set_title('Approximating a Gaussian Filter', y=1.02, fontsize=28) # plt.subplots_adjust(top=.91, bottom=.37) plt.tight_layout() # plt.subplots_adjust(bottom=.26, hspace=.72) # with ncol=2 plt.subplots_adjust(bottom=.22, hspace=.7) # with ncol=2 # plt.subplots_adjust(top=.95, bottom=.1) save_fig('caltech_{}_{}'.format(x_metric, '1 - NMSE')) # save_fig('caltech_sobel_{}_{}'.format(x_metric, '1 - NMSE')) # save_fig('caltech_dog_{}_{}'.format(x_metric, '1 - NMSE')) # def ucr_fig(x_metric='Speedup', y_metric='Accuracy'): # def ucr_fig(x_metric='Speedup', y_metric='Change in Accuracy'): def ucr_fig(x_metric='Speedup', y_metric='Relative Accuracy'): # df = res.ucr_amm() # df = res.ucr_amm(k=64) # df = res.ucr_amm(k=128) # df = res.ucr_amm(k=256) df0 = res.ucr_amm(k=64) df1 = res.ucr_amm(k=128) df2 = res.ucr_amm(k=256) sb.set_context('poster') # fig, ax = plt.subplots(1, 1, figsize=(11, 8)) fig, axes = plt.subplots(3, 1, figsize=(12, 13), sharex=True) # axes = [ax] # df = df.loc[df['task_id'].str.lower().str.contains('starlight')] # df = df.loc[df['method'] == 'Mithral'] # # df = df.loc[df['method'] == 'MithralPQ'] # # df = df.loc[df['ncodebooks'] == 4] # df = df['Accuracy acc_orig acc_orig_1nn ncodebooks method task_id'.split() + ['Relative Accuracy']] # df.reset_index(inplace=True, drop=True) # print(df) # import sys; sys.exit() # df['Change in Accuracy'] = df['Accuracy'] - df['acc-1nn-raw'] # print("uniq N, D, M: ") # print(df['N'].unique()) # print(df['D'].unique()) # print(df['M'].unique()) # df_brute = df.loc[df['method'] == 'Brute Force'] # print("uniq times from brute force: ", df_brute['time'].unique()) # print("df Brute:\n", df_brute['N D M method normalized_mse Accuracy time'.split()]) # import sys; sys.exit() # df['acc'] # # TODO put in results cleaning after debug # if 'Accuracy' in df.columns: # # df['Relative Accuracy'] = df['Accuracy'] / (df['acc_orig'] + 1e-20) # # # note that relative accuracy can actually be higher if errors # # # happen to compensate for incorrect classification sometimes # # print("max relative acc: ", df['Relative Accuracy'].values.max()) # # # assert df['Relative Accuracy'].values.max() <= 1.000001 # # acc_orig field is supposed to capture this, but I messed it up for # # 1nn so this will also work # tid2acc = {} # exactdf = df.loc[df['method'] == 'Brute Force'] # for tid in df['task_id'].unique(): # subdf = exactdf.loc[exactdf['task_id'] == tid] # if subdf.shape[0] != 1: # print(f"tid = {tid} gives bad subdf:\n", subdf) # tid2acc[tid] = subdf['Accuracy'].values[0] # df['BaseAccuracy'] = [tid2acc[tid] for tid in df['task_id']] # df['Relative Accuracy'] = df['Accuracy'] / df['BaseAccuracy'] # df = df.loc[~(df['method'].isin(['Mithral, L = 2', 'Mithral, L = 4']))] # # df['method'].loc[df['method'] == 'Mithral, L = ∞'] = 'Mithral' # df0 = df0.loc[df0['method'] != 'Brute Force'] # df1 = df1.loc[df1['method'] != 'Brute Force'] # df2 = df2.loc[df2['method'] != 'Brute Force'] # print(df.columns) # import sys; sys.exit() def clean_df(df): df['Change in Accuracy'] = df['Accuracy'] - df['acc-1nn-raw'] # is_mithral = df['method'].str.startswith('Mithral') # is_mithral = df['method'] == 'Mithral' is_mithral = df['method'] == 'MADDNESS' # # is_exact = df['method'] == 'Brute Force' others_to_keep = df['method'].isin([ 'PCA', 'SparsePCA', 'Bolt', 'HashJL', 'OSNAP']) # others_to_keep = df['method'].isin(['PCA', 'SparsePCA']) return df.loc[is_mithral | others_to_keep] df0 = clean_df(df0) df1 = clean_df(df1) df2 = clean_df(df2) # df = df.loc[df['method'] == 'Brute Force'] # df['not_mse'] = 1. - df['normalized_mse'] # df = df.loc[df['not_mse'] < 2] lineplot(df0, axes[0], x_metric=x_metric, y_metric=y_metric, scatter=True) lineplot(df1, axes[1], x_metric=x_metric, y_metric=y_metric, scatter=True) lineplot(df2, axes[2], x_metric=x_metric, y_metric=y_metric, scatter=True) plt.suptitle('Approximating an RBF Kernel Classifier') axes[-1].set_xlabel(_xlabel_for_xmetric(x_metric)) # ax.set_ylabel('1. - NMSE') handles, labels = axes[-1].get_legend_handles_labels() handles, labels = handles[1:], labels[1:] # rm 'Method' title plt.figlegend(handles, labels, loc='lower center', ncol=3) for ax in axes: ax.set_ylabel(_ylabel_for_xmetric(y_metric)) ax.get_legend().remove() ax.semilogx() ax.set_xlim([.9, ax.get_xlim()[1]]) # ax.set_ylim([.2, 1.1]) # plt.plot([1, 1], ax.get_ylim(), 'k--') plt.tight_layout() plt.subplots_adjust(top=.94, bottom=.25) # plt.subplots_adjust(top=.95, bottom=.1) save_fig('ucr_{}_{}'.format(x_metric, y_metric)) def ucr_fig2(x_metric='Speedup', y_metric='Relative Accuracy', # problem='softmax'): problem='rbf'): # df0 = res.ucr_amm(k=64) # df1 = res.ucr_amm(k=128) # df2 = res.ucr_amm(k=256) df = res.ucr_amm(k=128, problem=problem) sb.set_context('poster') # fig, axes = plt.subplots(3, 1, figsize=(12, 13), sharex=True) fig, axes = plt.subplots(3, 1, figsize=(12, 12), sharex=True) # df = res.ucr_amm(k=128, problem='rbf') # df_bolt = df.loc[df['method'] == 'Bolt'] # print("number of uniq bolt speedups:") # print(df_bolt['Speedup'].unique().size) # import sys; sys.exit() def clean_df(df): df['Change in Accuracy'] = df['Accuracy'] - df['acc-1nn-raw'] return df # # is_mithral = df['method'].str.startswith('Mithral') # is_mithral = df['method'] == 'Mithral' # # # is_exact = df['method'] == 'Brute Force' # others_to_keep = df['method'].isin([ # 'PCA', 'SparsePCA', 'Bolt', 'HashJL', 'OSNAP']) # # others_to_keep = df['method'].isin(['PCA', 'SparsePCA']) # return df.loc[is_mithral | others_to_keep] def frac_above_thresh(df, thresh): return res.frac_above_thresh( df, x_metric, y_metric, 'method', 'task_id', thresh) df = clean_df(df) # df0['frac_above_thresh'] = frac_above_thresh(df, .5) # df_bolt = df.loc[df['method'] == 'Bolt'] # print("number of uniq bolt speedups:") # print(df_bolt['Speedup'].unique().size) # import sys; sys.exit() # df = df.loc[df['method'] == 'SparsePCA'] # print(df.groupby('task_id')['Speedup'].count()) # import sys; sys.exit() y_frac_thresholds = [.5, .75, .95] df0 = frac_above_thresh(df, y_frac_thresholds[0]) df1 = frac_above_thresh(df, y_frac_thresholds[1]) df2 = frac_above_thresh(df, y_frac_thresholds[2]) # # print(df0['frac_above_thresh']) # print(df0) # # for row in df0.iterrows(): # # print(row) # # print(df0.unstack(0)) # print("df cols: ", df.columns) # print("df0 cols: ", df0.columns) # print("uniq methods: ", df['method'].unique()) # df = df.loc[df['method'] == 'Brute Force'] # df['not_mse'] = 1. - df['normalized_mse'] # df = df.loc[df['not_mse'] < 2] ycol = 'frac_above_thresh' lineplot(df0, axes[0], x_metric=x_metric, y_metric=ycol, scatter=False) lineplot(df1, axes[1], x_metric=x_metric, y_metric=ycol, scatter=False) lineplot(df2, axes[2], x_metric=x_metric, y_metric=ycol, scatter=False) kind = 'a Softmax' if problem == 'softmax' else 'an RBF Kernel' plt.suptitle(f'Approximating {kind} Classifier') axes[-1].set_xlabel(_xlabel_for_xmetric(x_metric)) # ax.set_ylabel('1. - NMSE') handles, labels = axes[-1].get_legend_handles_labels() handles, labels = handles[1:], labels[1:] # rm 'Method' title plt.figlegend(handles, labels, loc='lower center', ncol=3) for i, ax in enumerate(axes): # ax.set_ylabel(_ylabel_for_xmetric(y_metric)) # ax.set_ylabel("Fraction of Datasets\nWith Relative Acc > " # f"{y_frac_thresholds[i]}") # ax.set_ylabel(f"Fraction with Relative\nAccuracy> {y_frac_thresholds[i]}") ax.set_ylabel(f"Fraction > {y_frac_thresholds[i]}") ax.get_legend().remove() ax.semilogx() ax.set_xlim([.9, ax.get_xlim()[1]]) ax.set_ylim([0, 1.03]) # ax.set_ylim([.2, 1.1]) # plt.plot([1, 1], ax.get_ylim(), 'k--') plt.tight_layout() # plt.subplots_adjust(top=.94, bottom=.25) plt.subplots_adjust(top=.94, bottom=.22) # plt.subplots_adjust(top=.95, bottom=.1) save_fig('ucr2_{}_{}_{}'.format(x_metric, y_metric, problem)) def main(): scan_speed_fig() encode_speed_fig() lut_speed_fig() fig1() ucr_fig2() caltech_fig() # caltech_fig(y_metric='1 - NMSE') # caltech_fig(x_metric='ops', y_metric='1 - NMSE') cifar_fig() # cifar_fig(y_metric='1 - NMSE') # cifar_fig(x_metric='ops') # cifar_fig(x_metric='ops', y_metric='1 - NMSE') # ucr_fig2(x_metric='ops', y_metric='1 - NMSE') # ucr_fig2(x_metric='ops') # cifar_fig(y_metric='1 - NMSE') # ucr_fig2() # ucr_fig2(y_metric='1 - NMSE') if __name__ == '__main__': main()
bolt-master
experiments/python/amm_figs2.py
bolt-master
experiments/python/__init__.py
#!/bin/env/python from . import amm, vq_amm METHOD_EXACT = 'Exact' METHOD_SCALAR_QUANTIZE = 'ScalarQuantize' METHOD_SKETCH_SQ_SAMPLE = 'SketchSqSample' METHOD_SVD = 'SVD' # truncated SVD run on the matrix at test time METHOD_FD_AMM = 'FD-AMM' METHOD_COOCCUR = 'CooccurSketch' METHOD_PCA = 'PCA' # PCA projection, with PCA basis learned at train time METHOD_SPARSE_PCA = 'SparsePCA' # like above, using sklearn SparsePCA METHOD_RANDGAUSS = 'RandGauss' METHOD_ORTHOGAUSS = 'OrthoGauss' METHOD_HADAMARD = 'Hadamard' METHOD_RADEMACHER = 'Rademacher' METHOD_FASTJL = 'FastJL' METHOD_HASHJL = 'HashJL' METHOD_OSNAP = 'OSNAP' METHOD_OPQ = 'OPQ' METHOD_BOLT = 'Bolt' METHOD_BOLT_PERM = 'Bolt+Perm' METHOD_BOLT_CORRPERM = 'Bolt+CorrPerm' METHOD_BOLT_SPLITS = 'BoltSplits' METHOD_BOLT_MULTISPLITS = 'Bolt+MultiSplits' METHOD_BOLT_PERM_MULTISPLITS = 'Bolt+Perm+MultiSplits' METHOD_PQ = 'PQ' METHOD_PQ_PERM = 'PQ+Perm' METHOD_PQ_MULTISPLITS = 'PQ+MultiSplits' METHOD_PQ_PERM_MULTISPLITS = 'PQ+Perm+MultiSplits' METHOD_MITHRALPQ = 'MithralPQ' METHOD_OLD_MITHRALPQ = 'OldMithralPQ' METHOD_MITHRAL = 'Mithral' # these are for trying out different perm options METHOD_BOLT_GEHT_COV_TOPK = 'Bolt_CovTopk' METHOD_BOLT_GEHT_COV_SAMP = 'Bolt_CovSamp' METHOD_BOLT_GEHT_COR_TOPK = 'Bolt_CorTopk' METHOD_BOLT_GEHT_COR_SAMP = 'Bolt_CorSamp' # DEFAULT_METHODS = (METHOD_EXACT, METHOD_SVD, METHOD_FD_AMM, # METHOD_COOCCUR, METHOD_PCA, METHOD_PQ, # METHOD_BOLT, METHOD_MITHRALPQ) METHOD_TO_ESTIMATOR = { METHOD_EXACT: amm.ExactMatMul, METHOD_SCALAR_QUANTIZE: amm.QuantizedMatmul, METHOD_SKETCH_SQ_SAMPLE: amm.SketchSqSample, METHOD_SVD: amm.SvdSketch, METHOD_FD_AMM: amm.FdAmm, METHOD_COOCCUR: amm.CooccurSketch, METHOD_PCA: amm.TrainedPcaSketch, METHOD_SPARSE_PCA: amm.TrainedSparsePcaSketch, METHOD_RANDGAUSS: amm.RandGaussSketch, METHOD_ORTHOGAUSS: amm.RandOrthoGaussSketch, METHOD_HADAMARD: amm.HadamardSketch, METHOD_RADEMACHER: amm.RandRademacherSketch, METHOD_FASTJL: amm.FastJlSketch, METHOD_HASHJL: amm.HashJlSketch, METHOD_OSNAP: amm.OsnapSketch, METHOD_PQ: vq_amm.PQMatmul, METHOD_BOLT: vq_amm.BoltMatmul, METHOD_OPQ: vq_amm.OPQMatmul, METHOD_BOLT_CORRPERM: vq_amm.GEHTBoltMatmul_CorrTopk, METHOD_BOLT_GEHT_COV_TOPK: vq_amm.GEHTBoltMatmul_CovTopk, METHOD_BOLT_GEHT_COV_SAMP: vq_amm.GEHTBoltMatmul_CovSamp, METHOD_BOLT_GEHT_COR_TOPK: vq_amm.GEHTBoltMatmul_CorrTopk, METHOD_BOLT_GEHT_COR_SAMP: vq_amm.GEHTBoltMatmul_CorrSamp, METHOD_BOLT_PERM: vq_amm.GEHTBoltMatmul_CovTopk, METHOD_BOLT_SPLITS: vq_amm.BoltSplits, METHOD_BOLT_MULTISPLITS: vq_amm.BoltMultiSplits, METHOD_BOLT_PERM_MULTISPLITS: vq_amm.BoltPermMultiSplits, METHOD_PQ_PERM: vq_amm.PQPerm, METHOD_PQ_MULTISPLITS: vq_amm.PQMultiSplits, METHOD_PQ_PERM_MULTISPLITS: vq_amm.PQPermMultiSplits, METHOD_OLD_MITHRALPQ: vq_amm.OldMithralPQ, METHOD_MITHRALPQ: vq_amm.MithralPQ, METHOD_MITHRAL: vq_amm.MithralMatmul } ALL_METHODS = sorted(list(METHOD_TO_ESTIMATOR.keys())) ALL_METHODS.remove(METHOD_SKETCH_SQ_SAMPLE), # always terrible results ALL_METHODS.remove(METHOD_OPQ) # takes forever to train, more muls than exact # these were just for playing with different permuation options ALL_METHODS.remove(METHOD_BOLT_GEHT_COV_TOPK) ALL_METHODS.remove(METHOD_BOLT_GEHT_COV_SAMP) ALL_METHODS.remove(METHOD_BOLT_GEHT_COR_TOPK) ALL_METHODS.remove(METHOD_BOLT_GEHT_COR_SAMP) RANDOM_SKETCHING_METHODS = ( METHOD_FASTJL, METHOD_HASHJL, METHOD_OSNAP, METHOD_RANDGAUSS, METHOD_ORTHOGAUSS, METHOD_RADEMACHER) DENSE_SKETCH_METHODS = (METHOD_PCA, METHOD_FASTJL, METHOD_RANDGAUSS, METHOD_HADAMARD, METHOD_ORTHOGAUSS, METHOD_RADEMACHER) FAST_SKETCH_METHODS = RANDOM_SKETCHING_METHODS + ( METHOD_HADAMARD, METHOD_PCA, METHOD_SPARSE_PCA) # SLOW_SKETCH_METHODS = (METHOD_SVD, METHOD_FD_AMM, METHOD_COOCCUR) SLOW_SKETCH_METHODS = (METHOD_FD_AMM, METHOD_COOCCUR, METHOD_SVD) SKETCH_METHODS = FAST_SKETCH_METHODS + SLOW_SKETCH_METHODS # VQ_METHODS = (METHOD_PQ, METHOD_BOLT, METHOD_OPQ) # VQ_METHODS = (METHOD_PQ, METHOD_BOLT) BOLT_METHODS = (METHOD_BOLT, METHOD_BOLT_PERM, METHOD_BOLT_CORRPERM, METHOD_BOLT_SPLITS, METHOD_BOLT_MULTISPLITS, METHOD_BOLT_PERM_MULTISPLITS) PQ_METHODS = (METHOD_PQ, METHOD_PQ_PERM, METHOD_PQ_MULTISPLITS, METHOD_PQ_PERM_MULTISPLITS) MITHRAL_METHODS = (METHOD_MITHRALPQ, METHOD_MITHRAL, METHOD_OLD_MITHRALPQ) VQ_METHODS = PQ_METHODS + BOLT_METHODS + MITHRAL_METHODS NONDETERMINISTIC_METHODS = (METHOD_SKETCH_SQ_SAMPLE, METHOD_SVD) + VQ_METHODS # USE_METHODS = (FAST_SKETCH_METHODS + # (METHOD_EXACT, METHOD_BOLT, METHOD_MITHRALPQ, METHOD_MITHRAL)) USE_METHODS = ((METHOD_EXACT, METHOD_BOLT, METHOD_MITHRALPQ, METHOD_MITHRAL) + FAST_SKETCH_METHODS) USE_CALTECH_METHODS = list(USE_METHODS) USE_CALTECH_METHODS.remove(METHOD_BOLT) # Bolt *can't* be faster
bolt-master
experiments/python/amm_methods.py
#!/usr/bin/env python from __future__ import print_function import numpy as np import pprint microbench_output = \ """ ncodebooks = 4 amm bolt N, D, M, ncodebooks: 10000, 512, 10, 4 (5x20): 7.574 (4.225e+07/s), 7.582 (4.221e+07/s), 7.584 (4.219e+07/s), 7.587 (4.218e+07/s), 7.579 (4.222e+07/s), amm bolt N, D, M, ncodebooks: 10000, 512, 100, 4 (5x20): 7.747 (1.652e+08/s), 7.743 (1.653e+08/s), 7.757 (1.650e+08/s), 7.758 (1.650e+08/s), 7.743 (1.653e+08/s), amm bolt N, D, M, ncodebooks: 223590, 96, 12, 4 (5x20): 26.029 (2.749e+08/s), 26.028 (2.749e+08/s), 26.013 (2.751e+08/s), 26.010 (2.751e+08/s), 26.063 (2.745e+08/s), amm bolt N, D, M, ncodebooks: 49284, 27, 2, 4 (5x20): 1.931 (8.167e+08/s), 1.924 (8.197e+08/s), 1.925 (8.193e+08/s), 1.925 (8.193e+08/s), 1.929 (8.176e+08/s), ncodebooks = 8 amm bolt N, D, M, ncodebooks: 10000, 512, 10, 8 (5x20): 6.912 (4.630e+07/s), 6.919 (4.625e+07/s), 6.912 (4.630e+07/s), 6.909 (4.632e+07/s), 6.911 (4.630e+07/s), amm bolt N, D, M, ncodebooks: 10000, 512, 100, 8 (5x20): 7.169 (1.785e+08/s), 7.207 (1.776e+08/s), 7.200 (1.778e+08/s), 7.205 (1.777e+08/s), 7.205 (1.777e+08/s), amm bolt N, D, M, ncodebooks: 223590, 96, 12, 8 (5x20): 24.550 (2.914e+08/s), 24.514 (2.919e+08/s), 24.485 (2.922e+08/s), 24.470 (2.924e+08/s), 24.474 (2.923e+08/s), amm bolt N, D, M, ncodebooks: 49284, 27, 2, 8 (5x20): 2.445 (6.450e+08/s), 2.454 (6.427e+08/s), 2.436 (6.474e+08/s), 2.448 (6.442e+08/s), 2.446 (6.448e+08/s), ncodebooks = 16 amm bolt N, D, M, ncodebooks: 10000, 512, 10, 16 (5x20): 6.350 (5.039e+07/s), 6.350 (5.039e+07/s), 6.347 (5.042e+07/s), 6.356 (5.035e+07/s), 6.438 (4.970e+07/s), amm bolt N, D, M, ncodebooks: 10000, 512, 100, 16 (5x20): 7.340 (1.744e+08/s), 7.270 (1.761e+08/s), 7.302 (1.753e+08/s), 7.277 (1.759e+08/s), 7.299 (1.754e+08/s), amm bolt N, D, M, ncodebooks: 223590, 96, 12, 16 (5x20): 28.217 (2.536e+08/s), 28.063 (2.550e+08/s), 28.082 (2.548e+08/s), 28.086 (2.547e+08/s), 28.070 (2.549e+08/s), amm bolt N, D, M, ncodebooks: 49284, 27, 2, 16 (5x20): 3.525 (4.474e+08/s), 3.529 (4.469e+08/s), 3.525 (4.474e+08/s), 3.530 (4.468e+08/s), 3.527 (4.471e+08/s), ncodebooks = 32 amm bolt N, D, M, ncodebooks: 10000, 512, 10, 32 (5x20): 6.036 (5.302e+07/s), 6.070 (5.272e+07/s), 6.085 (5.259e+07/s), 6.158 (5.196e+07/s), 6.176 (5.181e+07/s), amm bolt N, D, M, ncodebooks: 10000, 512, 100, 32 (5x20): 7.473 (1.713e+08/s), 7.478 (1.712e+08/s), 7.571 (1.691e+08/s), 7.567 (1.692e+08/s), 7.571 (1.691e+08/s), amm bolt N, D, M, ncodebooks: 223590, 96, 12, 32 (5x20): 36.693 (1.950e+08/s), 36.721 (1.948e+08/s), 36.753 (1.947e+08/s), 36.805 (1.944e+08/s), 37.216 (1.923e+08/s), ncodebooks = 64 amm bolt N, D, M, ncodebooks: 10000, 512, 10, 64 (5x20): 6.962 (4.596e+07/s), 6.959 (4.598e+07/s), 6.954 (4.602e+07/s), 6.959 (4.598e+07/s), 6.964 (4.595e+07/s), amm bolt N, D, M, ncodebooks: 10000, 512, 100, 64 (5x20): 8.539 (1.499e+08/s), 8.598 (1.489e+08/s), 8.484 (1.509e+08/s), 8.572 (1.493e+08/s), 8.527 (1.501e+08/s), amm bolt N, D, M, ncodebooks: 223590, 96, 12, 64 (5x20): 64.087 (1.116e+08/s), 64.096 (1.116e+08/s), 64.638 (1.107e+08/s), 64.099 (1.116e+08/s), 64.079 (1.117e+08/s), ncodebooks = 4 ---- f32 amm mithral N, D, M, ncodebooks: 10000, 512, 10, 4 (5x20): 0.021 (4.770e+09/s), 0.021 (4.770e+09/s), 0.021 (4.770e+09/s), 0.021 (4.770e+09/s), 0.021 (4.770e+09/s), f32 amm mithral enc N, D, M, ncodebooks: 10000, 512, 10, 4 (5x20): 0.016 (1.252e+09/s), 0.016 (1.252e+09/s), 0.016 (1.252e+09/s), 0.016 (1.252e+09/s), 0.016 (1.252e+09/s), f32 amm mithral zipb N, D, M, ncodebooks: 10000, 512, 10, 4 (5x20): 0.000 (inf/s), 0.000 (inf/s), 0.000 (inf/s), 0.000 (inf/s), 0.000 (inf/s), ---- f32 amm mithral N, D, M, ncodebooks: 10000, 512, 100, 4 (5x20): 0.077 (1.301e+10/s), 0.077 (1.301e+10/s), 0.076 (1.318e+10/s), 0.080 (1.252e+10/s), 0.077 (1.301e+10/s), f32 amm mithral enc N, D, M, ncodebooks: 10000, 512, 100, 4 (5x20): 0.016 (1.252e+09/s), 0.016 (1.252e+09/s), 0.016 (1.252e+09/s), 0.016 (1.252e+09/s), 0.017 (1.178e+09/s), f32 amm mithral zipb N, D, M, ncodebooks: 10000, 512, 100, 4 (5x20): 0.000 (inf/s), 0.000 (inf/s), 0.000 (inf/s), 0.000 (inf/s), 0.000 (inf/s), ---- f32 amm mithral N, D, M, ncodebooks: 223590, 96, 12, 4 (5x20): 0.999 (2.686e+09/s), 0.974 (2.755e+09/s), 1.001 (2.681e+09/s), 1.000 (2.683e+09/s), 0.999 (2.686e+09/s), f32 amm mithral enc N, D, M, ncodebooks: 223590, 96, 12, 4 (5x20): 0.614 (7.284e+08/s), 0.611 (7.320e+08/s), 0.598 (7.479e+08/s), 0.613 (7.296e+08/s), 0.601 (7.441e+08/s), f32 amm mithral zipb N, D, M, ncodebooks: 223590, 96, 12, 4 (5x20): 0.024 (1.863e+10/s), 0.024 (1.863e+10/s), 0.024 (1.863e+10/s), 0.024 (1.863e+10/s), 0.024 (1.863e+10/s), ---- i16 amm mithral N, D, M, ncodebooks: 223590, 96, 12, 4 (5x20): 0.604 (4.443e+09/s), 0.603 (4.450e+09/s), 0.579 (4.635e+09/s), 0.604 (4.443e+09/s), 0.605 (4.435e+09/s), i16 amm mithral enc N, D, M, ncodebooks: 223590, 96, 12, 4 (5x20): 0.257 (1.740e+09/s), 0.280 (1.597e+09/s), 0.265 (1.688e+09/s), 0.254 (1.761e+09/s), 0.254 (1.761e+09/s), i16 amm mithral zipb N, D, M, ncodebooks: 223590, 96, 12, 4 (5x20): 0.024 (1.863e+10/s), 0.024 (1.863e+10/s), 0.024 (1.863e+10/s), 0.024 (1.863e+10/s), 0.024 (1.863e+10/s), ---- f32 amm mithral N, D, M, ncodebooks: 49284, 27, 2, 4 (5x20): 0.083 (1.188e+09/s), 0.083 (1.188e+09/s), 0.085 (1.160e+09/s), 0.084 (1.174e+09/s), 0.084 (1.174e+09/s), f32 amm mithral enc N, D, M, ncodebooks: 49284, 27, 2, 4 (5x20): 0.077 (1.281e+09/s), 0.077 (1.281e+09/s), 0.076 (1.298e+09/s), 0.076 (1.298e+09/s), 0.076 (1.298e+09/s), f32 amm mithral zipb N, D, M, ncodebooks: 49284, 27, 2, 4 (5x20): 0.004 (2.466e+10/s), 0.004 (2.466e+10/s), 0.004 (2.466e+10/s), 0.004 (2.466e+10/s), 0.004 (2.466e+10/s), ---- i8 amm mithral N, D, M, ncodebooks: 49284, 27, 2, 4 (5x20): 0.034 (2.901e+09/s), 0.029 (3.401e+09/s), 0.029 (3.401e+09/s), 0.030 (3.287e+09/s), 0.030 (3.287e+09/s), i8 amm mithral enc N, D, M, ncodebooks: 49284, 27, 2, 4 (5x20): 0.023 (4.288e+09/s), 0.023 (4.288e+09/s), 0.023 (4.288e+09/s), 0.023 (4.288e+09/s), 0.023 (4.288e+09/s), i8 amm mithral zipb N, D, M, ncodebooks: 49284, 27, 2, 4 (5x20): 0.004 (2.466e+10/s), 0.004 (2.466e+10/s), 0.004 (2.466e+10/s), 0.004 (2.466e+10/s), 0.004 (2.466e+10/s), ncodebooks = 8 ---- f32 amm mithral N, D, M, ncodebooks: 10000, 512, 10, 8 (5x20): 0.043 (2.329e+09/s), 0.043 (2.329e+09/s), 0.043 (2.329e+09/s), 0.043 (2.329e+09/s), 0.043 (2.329e+09/s), f32 amm mithral enc N, D, M, ncodebooks: 10000, 512, 10, 8 (5x20): 0.031 (1.292e+09/s), 0.032 (1.252e+09/s), 0.033 (1.214e+09/s), 0.034 (1.178e+09/s), 0.034 (1.178e+09/s), f32 amm mithral zipb N, D, M, ncodebooks: 10000, 512, 10, 8 (5x20): 0.001 (4.006e+10/s), 0.001 (4.006e+10/s), 0.001 (4.006e+10/s), 0.001 (4.006e+10/s), 0.001 (4.006e+10/s), ---- f32 amm mithral N, D, M, ncodebooks: 10000, 512, 100, 8 (5x20): 0.154 (6.504e+09/s), 0.162 (6.183e+09/s), 0.155 (6.462e+09/s), 0.155 (6.462e+09/s), 0.162 (6.183e+09/s), f32 amm mithral enc N, D, M, ncodebooks: 10000, 512, 100, 8 (5x20): 0.035 (1.145e+09/s), 0.033 (1.214e+09/s), 0.032 (1.252e+09/s), 0.034 (1.178e+09/s), 0.034 (1.178e+09/s), f32 amm mithral zipb N, D, M, ncodebooks: 10000, 512, 100, 8 (5x20): 0.001 (4.006e+10/s), 0.001 (4.006e+10/s), 0.001 (4.006e+10/s), 0.001 (4.006e+10/s), 0.001 (4.006e+10/s), ---- f32 amm mithral N, D, M, ncodebooks: 223590, 96, 12, 8 (5x20): 1.810 (1.483e+09/s), 1.790 (1.499e+09/s), 1.797 (1.493e+09/s), 1.809 (1.483e+09/s), 1.810 (1.483e+09/s), f32 amm mithral enc N, D, M, ncodebooks: 223590, 96, 12, 8 (5x20): 1.395 (6.412e+08/s), 1.371 (6.524e+08/s), 1.394 (6.417e+08/s), 1.394 (6.417e+08/s), 1.393 (6.421e+08/s), f32 amm mithral zipb N, D, M, ncodebooks: 223590, 96, 12, 8 (5x20): 0.041 (2.182e+10/s), 0.041 (2.182e+10/s), 0.041 (2.182e+10/s), 0.041 (2.182e+10/s), 0.041 (2.182e+10/s), ---- i16 amm mithral N, D, M, ncodebooks: 223590, 96, 12, 8 (5x20): 1.102 (2.435e+09/s), 1.106 (2.426e+09/s), 1.091 (2.460e+09/s), 1.101 (2.437e+09/s), 1.129 (2.377e+09/s), i16 amm mithral enc N, D, M, ncodebooks: 223590, 96, 12, 8 (5x20): 0.681 (1.313e+09/s), 0.653 (1.370e+09/s), 0.654 (1.368e+09/s), 0.653 (1.370e+09/s), 0.653 (1.370e+09/s), i16 amm mithral zipb N, D, M, ncodebooks: 223590, 96, 12, 8 (5x20): 0.041 (2.182e+10/s), 0.041 (2.182e+10/s), 0.041 (2.182e+10/s), 0.043 (2.080e+10/s), 0.043 (2.080e+10/s), ---- f32 amm mithral N, D, M, ncodebooks: 49284, 27, 2, 8 (5x20): 0.173 (5.701e+08/s), 0.172 (5.734e+08/s), 0.173 (5.701e+08/s), 0.185 (5.331e+08/s), 0.173 (5.701e+08/s), f32 amm mithral enc N, D, M, ncodebooks: 49284, 27, 2, 8 (5x20): 0.160 (1.233e+09/s), 0.176 (1.121e+09/s), 0.185 (1.066e+09/s), 0.165 (1.195e+09/s), 0.161 (1.225e+09/s), f32 amm mithral zipb N, D, M, ncodebooks: 49284, 27, 2, 8 (5x20): 0.008 (2.466e+10/s), 0.008 (2.466e+10/s), 0.008 (2.466e+10/s), 0.008 (2.466e+10/s), 0.008 (2.466e+10/s), ---- i8 amm mithral N, D, M, ncodebooks: 49284, 27, 2, 8 (5x20): 0.059 (1.672e+09/s), 0.059 (1.672e+09/s), 0.059 (1.672e+09/s), 0.059 (1.672e+09/s), 0.059 (1.672e+09/s), i8 amm mithral enc N, D, M, ncodebooks: 49284, 27, 2, 8 (5x20): 0.049 (4.025e+09/s), 0.050 (3.945e+09/s), 0.049 (4.025e+09/s), 0.048 (4.109e+09/s), 0.048 (4.109e+09/s), i8 amm mithral zipb N, D, M, ncodebooks: 49284, 27, 2, 8 (5x20): 0.008 (2.466e+10/s), 0.008 (2.466e+10/s), 0.008 (2.466e+10/s), 0.008 (2.466e+10/s), 0.008 (2.466e+10/s), ncodebooks = 16 ---- f32 amm mithral N, D, M, ncodebooks: 10000, 512, 10, 16 (5x20): 0.094 (1.066e+09/s), 0.093 (1.077e+09/s), 0.100 (1.002e+09/s), 0.100 (1.002e+09/s), 0.097 (1.033e+09/s), f32 amm mithral enc N, D, M, ncodebooks: 10000, 512, 10, 16 (5x20): 0.065 (1.233e+09/s), 0.066 (1.214e+09/s), 0.066 (1.214e+09/s), 0.065 (1.233e+09/s), 0.066 (1.214e+09/s), f32 amm mithral zipb N, D, M, ncodebooks: 10000, 512, 10, 16 (5x20): 0.003 (2.671e+10/s), 0.003 (2.671e+10/s), 0.003 (2.671e+10/s), 0.003 (2.671e+10/s), 0.003 (2.671e+10/s), ---- f32 amm mithral N, D, M, ncodebooks: 10000, 512, 100, 16 (5x20): 0.367 (2.729e+09/s), 0.372 (2.692e+09/s), 0.374 (2.678e+09/s), 0.377 (2.657e+09/s), 0.374 (2.678e+09/s), f32 amm mithral enc N, D, M, ncodebooks: 10000, 512, 100, 16 (5x20): 0.067 (1.196e+09/s), 0.064 (1.252e+09/s), 0.064 (1.252e+09/s), 0.064 (1.252e+09/s), 0.064 (1.252e+09/s), f32 amm mithral zipb N, D, M, ncodebooks: 10000, 512, 100, 16 (5x20): 0.003 (2.671e+10/s), 0.003 (2.671e+10/s), 0.003 (2.671e+10/s), 0.003 (2.671e+10/s), 0.003 (2.671e+10/s), ---- f32 amm mithral N, D, M, ncodebooks: 223590, 96, 12, 16 (5x20): 3.597 (7.460e+08/s), 3.607 (7.439e+08/s), 3.599 (7.456e+08/s), 3.610 (7.433e+08/s), 3.614 (7.425e+08/s), f32 amm mithral enc N, D, M, ncodebooks: 223590, 96, 12, 16 (5x20): 2.761 (6.479e+08/s), 2.761 (6.479e+08/s), 2.760 (6.482e+08/s), 2.751 (6.503e+08/s), 2.763 (6.475e+08/s), f32 amm mithral zipb N, D, M, ncodebooks: 223590, 96, 12, 16 (5x20): 0.103 (1.737e+10/s), 0.105 (1.704e+10/s), 0.123 (1.454e+10/s), 0.128 (1.398e+10/s), 0.123 (1.454e+10/s), ---- i16 amm mithral N, D, M, ncodebooks: 223590, 96, 12, 16 (5x20): 2.233 (1.202e+09/s), 2.261 (1.187e+09/s), 2.207 (1.216e+09/s), 2.207 (1.216e+09/s), 2.261 (1.187e+09/s), i16 amm mithral enc N, D, M, ncodebooks: 223590, 96, 12, 16 (5x20): 1.417 (1.262e+09/s), 1.563 (1.145e+09/s), 1.514 (1.182e+09/s), 1.464 (1.222e+09/s), 1.483 (1.206e+09/s), i16 amm mithral zipb N, D, M, ncodebooks: 223590, 96, 12, 16 (5x20): 0.136 (1.315e+10/s), 0.130 (1.376e+10/s), 0.147 (1.217e+10/s), 0.133 (1.345e+10/s), 0.134 (1.335e+10/s), ---- f32 amm mithral N, D, M, ncodebooks: 49284, 27, 2, 16 (5x20): 0.397 (2.484e+08/s), 0.407 (2.423e+08/s), 0.395 (2.497e+08/s), 0.388 (2.542e+08/s), 0.385 (2.562e+08/s), f32 amm mithral enc N, D, M, ncodebooks: 49284, 27, 2, 16 (5x20): 0.369 (1.069e+09/s), 0.368 (1.072e+09/s), 0.377 (1.046e+09/s), 0.375 (1.052e+09/s), 0.408 (9.669e+08/s), f32 amm mithral zipb N, D, M, ncodebooks: 49284, 27, 2, 16 (5x20): 0.019 (2.076e+10/s), 0.019 (2.076e+10/s), 0.019 (2.076e+10/s), 0.019 (2.076e+10/s), 0.019 (2.076e+10/s), ---- i8 amm mithral N, D, M, ncodebooks: 49284, 27, 2, 16 (5x20): 0.131 (7.529e+08/s), 0.131 (7.529e+08/s), 0.131 (7.529e+08/s), 0.131 (7.529e+08/s), 0.131 (7.529e+08/s), i8 amm mithral enc N, D, M, ncodebooks: 49284, 27, 2, 16 (5x20): 0.103 (3.830e+09/s), 0.103 (3.830e+09/s), 0.103 (3.830e+09/s), 0.103 (3.830e+09/s), 0.104 (3.793e+09/s), i8 amm mithral zipb N, D, M, ncodebooks: 49284, 27, 2, 16 (5x20): 0.019 (2.076e+10/s), 0.019 (2.076e+10/s), 0.019 (2.076e+10/s), 0.019 (2.076e+10/s), 0.019 (2.076e+10/s), ncodebooks = 32 ---- f32 amm mithral N, D, M, ncodebooks: 10000, 512, 10, 32 (5x20): 0.201 (4.983e+08/s), 0.194 (5.163e+08/s), 0.205 (4.886e+08/s), 0.201 (4.983e+08/s), 0.200 (5.008e+08/s), f32 amm mithral enc N, D, M, ncodebooks: 10000, 512, 10, 32 (5x20): 0.142 (1.129e+09/s), 0.143 (1.121e+09/s), 0.144 (1.113e+09/s), 0.142 (1.129e+09/s), 0.161 (9.954e+08/s), f32 amm mithral zipb N, D, M, ncodebooks: 10000, 512, 10, 32 (5x20): 0.007 (2.289e+10/s), 0.007 (2.289e+10/s), 0.007 (2.289e+10/s), 0.007 (2.289e+10/s), 0.007 (2.289e+10/s), ---- f32 amm mithral N, D, M, ncodebooks: 10000, 512, 100, 32 (5x20): 0.762 (1.314e+09/s), 0.781 (1.282e+09/s), 0.756 (1.325e+09/s), 0.753 (1.330e+09/s), 0.798 (1.255e+09/s), f32 amm mithral enc N, D, M, ncodebooks: 10000, 512, 100, 32 (5x20): 0.183 (8.757e+08/s), 0.149 (1.076e+09/s), 0.154 (1.041e+09/s), 0.150 (1.068e+09/s), 0.147 (1.090e+09/s), f32 amm mithral zipb N, D, M, ncodebooks: 10000, 512, 100, 32 (5x20): 0.007 (2.289e+10/s), 0.007 (2.289e+10/s), 0.007 (2.289e+10/s), 0.007 (2.289e+10/s), 0.007 (2.289e+10/s), ---- f32 amm mithral N, D, M, ncodebooks: 223590, 96, 12, 32 (5x20): 7.958 (3.372e+08/s), 7.142 (3.757e+08/s), 7.148 (3.754e+08/s), 7.114 (3.772e+08/s), 7.135 (3.761e+08/s), f32 amm mithral enc N, D, M, ncodebooks: 223590, 96, 12, 32 (5x20): 5.589 (6.402e+08/s), 5.642 (6.341e+08/s), 5.563 (6.432e+08/s), 5.592 (6.398e+08/s), 5.579 (6.413e+08/s), f32 amm mithral zipb N, D, M, ncodebooks: 223590, 96, 12, 32 (5x20): 0.341 (1.049e+10/s), 0.330 (1.084e+10/s), 0.327 (1.094e+10/s), 0.327 (1.094e+10/s), 0.328 (1.091e+10/s), ---- i16 amm mithral N, D, M, ncodebooks: 223590, 96, 12, 32 (5x20): 4.369 (6.142e+08/s), 4.357 (6.159e+08/s), 4.537 (5.914e+08/s), 4.361 (6.153e+08/s), 4.406 (6.090e+08/s), i16 amm mithral enc N, D, M, ncodebooks: 223590, 96, 12, 32 (5x20): 2.888 (1.239e+09/s), 2.889 (1.238e+09/s), 2.898 (1.235e+09/s), 2.898 (1.235e+09/s), 2.909 (1.230e+09/s), i16 amm mithral zipb N, D, M, ncodebooks: 223590, 96, 12, 32 (5x20): 0.329 (1.087e+10/s), 0.326 (1.098e+10/s), 0.331 (1.081e+10/s), 0.328 (1.091e+10/s), 0.345 (1.037e+10/s), ---- f32 amm mithral N, D, M, ncodebooks: 49284, 27, 2, 32 (5x20): 0.781 (1.263e+08/s), 0.785 (1.256e+08/s), 0.793 (1.244e+08/s), 0.788 (1.252e+08/s), 0.787 (1.253e+08/s), f32 amm mithral enc N, D, M, ncodebooks: 49284, 27, 2, 32 (5x20): 0.814 (9.693e+08/s), 0.828 (9.529e+08/s), 0.755 (1.045e+09/s), 0.766 (1.030e+09/s), 0.768 (1.027e+09/s), f32 amm mithral zipb N, D, M, ncodebooks: 49284, 27, 2, 32 (5x20): 0.045 (1.753e+10/s), 0.041 (1.924e+10/s), 0.041 (1.924e+10/s), 0.046 (1.715e+10/s), 0.041 (1.924e+10/s), ---- i8 amm mithral N, D, M, ncodebooks: 49284, 27, 2, 32 (5x20): 0.320 (3.082e+08/s), 0.303 (3.255e+08/s), 0.301 (3.277e+08/s), 0.321 (3.072e+08/s), 0.301 (3.277e+08/s), i8 amm mithral enc N, D, M, ncodebooks: 49284, 27, 2, 32 (5x20): 0.279 (2.828e+09/s), 0.260 (3.035e+09/s), 0.263 (3.000e+09/s), 0.221 (3.570e+09/s), 0.242 (3.260e+09/s), i8 amm mithral zipb N, D, M, ncodebooks: 49284, 27, 2, 32 (5x20): 0.061 (1.293e+10/s), 0.044 (1.793e+10/s), 0.041 (1.924e+10/s), 0.041 (1.924e+10/s), 0.040 (1.972e+10/s), ncodebooks = 64 ---- f32 amm mithral N, D, M, ncodebooks: 10000, 512, 10, 64 (5x20): 0.454 (2.206e+08/s), 0.497 (2.015e+08/s), 0.489 (2.048e+08/s), 0.486 (2.061e+08/s), 0.457 (2.192e+08/s), f32 amm mithral enc N, D, M, ncodebooks: 10000, 512, 10, 64 (5x20): 0.349 (9.184e+08/s), 0.344 (9.317e+08/s), 0.385 (8.325e+08/s), 0.377 (8.502e+08/s), 0.344 (9.317e+08/s), f32 amm mithral zipb N, D, M, ncodebooks: 10000, 512, 10, 64 (5x20): 0.019 (1.687e+10/s), 0.019 (1.687e+10/s), 0.019 (1.687e+10/s), 0.019 (1.687e+10/s), 0.020 (1.603e+10/s), ---- f32 amm mithral N, D, M, ncodebooks: 10000, 512, 100, 64 (5x20): 1.586 (6.315e+08/s), 1.530 (6.546e+08/s), 1.531 (6.542e+08/s), 1.529 (6.551e+08/s), 1.539 (6.508e+08/s), f32 amm mithral enc N, D, M, ncodebooks: 10000, 512, 100, 64 (5x20): 0.405 (7.914e+08/s), 0.408 (7.856e+08/s), 0.449 (7.138e+08/s), 0.403 (7.953e+08/s), 0.411 (7.798e+08/s), f32 amm mithral zipb N, D, M, ncodebooks: 10000, 512, 100, 64 (5x20): 0.020 (1.603e+10/s), 0.020 (1.603e+10/s), 0.019 (1.687e+10/s), 0.019 (1.687e+10/s), 0.019 (1.687e+10/s), ---- f32 amm mithral N, D, M, ncodebooks: 223590, 96, 12, 64 (5x20): 14.943 (1.796e+08/s), 15.205 (1.765e+08/s), 14.912 (1.799e+08/s), 14.951 (1.795e+08/s), 14.981 (1.791e+08/s), f32 amm mithral enc N, D, M, ncodebooks: 223590, 96, 12, 64 (5x20): 11.376 (6.290e+08/s), 11.305 (6.330e+08/s), 11.313 (6.325e+08/s), 11.315 (6.324e+08/s), 11.312 (6.326e+08/s), f32 amm mithral zipb N, D, M, ncodebooks: 223590, 96, 12, 64 (5x20): 0.877 (8.159e+09/s), 0.822 (8.705e+09/s), 0.845 (8.468e+09/s), 0.849 (8.428e+09/s), 0.836 (8.559e+09/s), ---- i16 amm mithral N, D, M, ncodebooks: 223590, 96, 12, 64 (5x20): 9.459 (2.837e+08/s), 9.458 (2.837e+08/s), 9.420 (2.849e+08/s), 9.457 (2.837e+08/s), 9.452 (2.839e+08/s), i16 amm mithral enc N, D, M, ncodebooks: 223590, 96, 12, 64 (5x20): 5.819 (1.230e+09/s), 5.820 (1.230e+09/s), 5.824 (1.229e+09/s), 5.845 (1.224e+09/s), 5.901 (1.213e+09/s), i16 amm mithral zipb N, D, M, ncodebooks: 223590, 96, 12, 64 (5x20): 0.818 (8.748e+09/s), 0.823 (8.695e+09/s), 0.803 (8.911e+09/s), 0.818 (8.748e+09/s), 0.851 (8.409e+09/s), ---- f32 amm mithral N, D, M, ncodebooks: 49284, 27, 2, 64 (5x20): 1.571 (6.278e+07/s), 1.571 (6.278e+07/s), 1.573 (6.270e+07/s), 1.574 (6.266e+07/s), 1.571 (6.278e+07/s), f32 amm mithral enc N, D, M, ncodebooks: 49284, 27, 2, 64 (5x20): 1.479 (1.067e+09/s), 1.473 (1.071e+09/s), 1.475 (1.070e+09/s), 1.476 (1.069e+09/s), 1.473 (1.071e+09/s), f32 amm mithral zipb N, D, M, ncodebooks: 49284, 27, 2, 64 (5x20): 0.114 (1.384e+10/s), 0.115 (1.372e+10/s), 0.115 (1.372e+10/s), 0.110 (1.435e+10/s), 0.115 (1.372e+10/s), ---- i8 amm mithral N, D, M, ncodebooks: 49284, 27, 2, 64 (5x20): 0.561 (1.758e+08/s), 0.560 (1.761e+08/s), 0.561 (1.758e+08/s), 0.560 (1.761e+08/s), 0.560 (1.761e+08/s), i8 amm mithral enc N, D, M, ncodebooks: 49284, 27, 2, 64 (5x20): 0.453 (3.483e+09/s), 0.492 (3.207e+09/s), 0.470 (3.357e+09/s), 0.464 (3.401e+09/s), 0.494 (3.194e+09/s), i8 amm mithral zipb N, D, M, ncodebooks: 49284, 27, 2, 64 (5x20): 0.114 (1.384e+10/s), 0.120 (1.315e+10/s), 0.116 (1.360e+10/s), 0.114 (1.384e+10/s), 0.114 (1.384e+10/s), blas sketch matmul N, D, M, d: 10000, 512, 10, 2 (5x20): 3.827 (2.613e+07/s), 3.815 (2.621e+07/s), 3.830 (2.611e+07/s), 3.858 (2.592e+07/s), 3.832 (2.610e+07/s), our sketch matmul N, D, M, d: 10000, 512, 10, 2 (5x20): 1.080 (9.259e+07/s), 1.041 (9.606e+07/s), 1.049 (9.533e+07/s), 1.049 (9.533e+07/s), 1.045 (9.569e+07/s), blas sketch matmul N, D, M, d: 10000, 512, 10, 4 (5x20): 3.505 (2.853e+07/s), 3.568 (2.803e+07/s), 3.541 (2.824e+07/s), 3.431 (2.915e+07/s), 3.234 (3.092e+07/s), our sketch matmul N, D, M, d: 10000, 512, 10, 4 (5x20): 2.081 (4.805e+07/s), 2.135 (4.684e+07/s), 2.083 (4.801e+07/s), 2.077 (4.815e+07/s), 2.079 (4.810e+07/s), blas sketch matmul N, D, M, d: 10000, 512, 10, 8 (5x20): 3.772 (2.651e+07/s), 3.641 (2.746e+07/s), 3.617 (2.765e+07/s), 3.616 (2.765e+07/s), 4.002 (2.499e+07/s), our sketch matmul N, D, M, d: 10000, 512, 10, 8 (5x20): 2.864 (3.492e+07/s), 2.861 (3.495e+07/s), 2.901 (3.447e+07/s), 3.017 (3.315e+07/s), 2.880 (3.472e+07/s), blas sketch matmul N, D, M, d: 10000, 512, 10, 16 (5x20): 4.535 (2.205e+07/s), 4.565 (2.191e+07/s), 4.475 (2.235e+07/s), 4.476 (2.234e+07/s), 4.480 (2.232e+07/s), our sketch matmul N, D, M, d: 10000, 512, 10, 16 (5x20): 5.217 (1.917e+07/s), 5.185 (1.929e+07/s), 5.243 (1.907e+07/s), 5.256 (1.903e+07/s), 5.184 (1.929e+07/s), blas sketch matmul N, D, M, d: 10000, 512, 10, 32 (5x20): 6.537 (1.530e+07/s), 6.527 (1.532e+07/s), 6.517 (1.534e+07/s), 6.507 (1.537e+07/s), 6.512 (1.536e+07/s), our sketch matmul N, D, M, d: 10000, 512, 10, 32 (5x20): 9.143 (1.094e+07/s), 9.119 (1.097e+07/s), 9.137 (1.094e+07/s), 9.110 (1.098e+07/s), 9.128 (1.096e+07/s), blas sketch matmul N, D, M, d: 10000, 512, 10, 64 (5x20): 10.156 (9.846e+06/s), 10.136 (9.866e+06/s), 10.143 (9.859e+06/s), 10.146 (9.856e+06/s), 10.147 (9.855e+06/s), our sketch matmul N, D, M, d: 10000, 512, 10, 64 (5x20): 17.739 (5.637e+06/s), 17.767 (5.628e+06/s), 17.641 (5.669e+06/s), 17.647 (5.667e+06/s), 17.640 (5.669e+06/s), blas sketch matmul N, D, M, d: 10000, 512, 10, 128 (5x20): 17.149 (5.831e+06/s), 17.183 (5.820e+06/s), 17.144 (5.833e+06/s), 17.109 (5.845e+06/s), 17.182 (5.820e+06/s), our sketch matmul N, D, M, d: 10000, 512, 10, 128 (5x20): 35.289 (2.834e+06/s), 35.025 (2.855e+06/s), 35.294 (2.833e+06/s), 35.022 (2.855e+06/s), 35.071 (2.851e+06/s), blas matmul N, D, M: 10000, 512, 10 (5x20): 4.174 (2.396e+07/s), 4.136 (2.418e+07/s), 4.164 (2.402e+07/s), 4.198 (2.382e+07/s), 4.188 (2.388e+07/s), our matmul N, D, M: 10000, 512, 10 (5x20): 3.546 (2.820e+07/s), 3.546 (2.820e+07/s), 3.553 (2.815e+07/s), 3.555 (2.813e+07/s), 3.560 (2.809e+07/s), blas sketch matmul N, D, M, d: 10000, 512, 100, 2 (5x20): 4.085 (2.448e+08/s), 4.091 (2.444e+08/s), 4.055 (2.466e+08/s), 4.045 (2.472e+08/s), 4.057 (2.465e+08/s), our sketch matmul N, D, M, d: 10000, 512, 100, 2 (5x20): 1.322 (7.564e+08/s), 1.337 (7.479e+08/s), 1.336 (7.485e+08/s), 1.323 (7.559e+08/s), 1.322 (7.564e+08/s), blas sketch matmul N, D, M, d: 10000, 512, 100, 4 (5x20): 3.631 (2.754e+08/s), 3.843 (2.602e+08/s), 3.798 (2.633e+08/s), 3.848 (2.599e+08/s), 3.847 (2.599e+08/s), our sketch matmul N, D, M, d: 10000, 512, 100, 4 (5x20): 2.626 (3.808e+08/s), 2.491 (4.014e+08/s), 2.510 (3.984e+08/s), 2.589 (3.862e+08/s), 2.480 (4.032e+08/s), blas sketch matmul N, D, M, d: 10000, 512, 100, 8 (5x20): 4.275 (2.339e+08/s), 4.313 (2.319e+08/s), 4.333 (2.308e+08/s), 4.289 (2.332e+08/s), 4.130 (2.421e+08/s), our sketch matmul N, D, M, d: 10000, 512, 100, 8 (5x20): 3.405 (2.937e+08/s), 3.571 (2.800e+08/s), 3.405 (2.937e+08/s), 3.423 (2.921e+08/s), 3.405 (2.937e+08/s), blas sketch matmul N, D, M, d: 10000, 512, 100, 16 (5x20): 5.392 (1.855e+08/s), 5.316 (1.881e+08/s), 5.283 (1.893e+08/s), 5.281 (1.894e+08/s), 5.184 (1.929e+08/s), our sketch matmul N, D, M, d: 10000, 512, 100, 16 (5x20): 6.046 (1.654e+08/s), 6.047 (1.654e+08/s), 6.076 (1.646e+08/s), 6.071 (1.647e+08/s), 6.044 (1.655e+08/s), blas sketch matmul N, D, M, d: 10000, 512, 100, 32 (5x20): 7.291 (1.372e+08/s), 7.293 (1.371e+08/s), 7.308 (1.368e+08/s), 7.296 (1.371e+08/s), 7.294 (1.371e+08/s), our sketch matmul N, D, M, d: 10000, 512, 100, 32 (5x20): 10.697 (9.348e+07/s), 10.584 (9.448e+07/s), 10.599 (9.435e+07/s), 10.611 (9.424e+07/s), 10.594 (9.439e+07/s), blas sketch matmul N, D, M, d: 10000, 512, 100, 64 (5x20): 11.586 (8.631e+07/s), 11.528 (8.675e+07/s), 11.528 (8.675e+07/s), 11.535 (8.669e+07/s), 11.530 (8.673e+07/s), our sketch matmul N, D, M, d: 10000, 512, 100, 64 (5x20): 20.459 (4.888e+07/s), 20.514 (4.875e+07/s), 20.542 (4.868e+07/s), 20.429 (4.895e+07/s), 20.532 (4.870e+07/s), blas matmul N, D, M: 10000, 512, 100 (5x20): 13.506 (7.404e+07/s), 13.432 (7.445e+07/s), 13.467 (7.426e+07/s), 13.464 (7.427e+07/s), 13.484 (7.416e+07/s), our matmul N, D, M: 10000, 512, 100 (5x20): 27.160 (3.682e+07/s), 27.135 (3.685e+07/s), 27.260 (3.668e+07/s), 27.213 (3.675e+07/s), 27.268 (3.667e+07/s), blas sketch matmul N, D, M, d: 223590, 96, 12, 2 (5x20): 17.987 (1.492e+08/s), 17.601 (1.524e+08/s), 18.118 (1.481e+08/s), 17.847 (1.503e+08/s), 17.977 (1.493e+08/s), our sketch matmul N, D, M, d: 223590, 96, 12, 2 (5x20): 5.117 (5.243e+08/s), 5.115 (5.246e+08/s), 5.102 (5.259e+08/s), 5.088 (5.273e+08/s), 5.111 (5.250e+08/s), blas sketch matmul N, D, M, d: 223590, 96, 12, 4 (5x20): 11.524 (2.328e+08/s), 12.362 (2.170e+08/s), 11.828 (2.268e+08/s), 11.793 (2.275e+08/s), 11.785 (2.277e+08/s), our sketch matmul N, D, M, d: 223590, 96, 12, 4 (5x20): 9.979 (2.689e+08/s), 10.007 (2.681e+08/s), 10.010 (2.680e+08/s), 10.010 (2.680e+08/s), 9.973 (2.690e+08/s), blas sketch matmul N, D, M, d: 223590, 96, 12, 8 (5x20): 19.261 (1.393e+08/s), 19.116 (1.404e+08/s), 19.205 (1.397e+08/s), 19.342 (1.387e+08/s), 19.189 (1.398e+08/s), our sketch matmul N, D, M, d: 223590, 96, 12, 8 (5x20): 14.543 (1.845e+08/s), 14.510 (1.849e+08/s), 14.570 (1.842e+08/s), 14.556 (1.843e+08/s), 14.509 (1.849e+08/s), blas matmul N, D, M: 223590, 96, 12 (5x20): 19.189 (1.398e+08/s), 19.231 (1.395e+08/s), 19.378 (1.385e+08/s), 19.348 (1.387e+08/s), 19.390 (1.384e+08/s), our matmul N, D, M: 223590, 96, 12 (5x20): 16.242 (1.652e+08/s), 16.194 (1.657e+08/s), 16.197 (1.657e+08/s), 16.230 (1.653e+08/s), 16.238 (1.652e+08/s), blas sketch matmul N, D, M, d: 49284, 27, 2, 2 (5x20): 0.375 (2.628e+08/s), 0.373 (2.643e+08/s), 0.380 (2.594e+08/s), 0.380 (2.594e+08/s), 0.378 (2.608e+08/s), our sketch matmul N, D, M, d: 49284, 27, 2, 2 (5x20): 0.219 (4.501e+08/s), 0.220 (4.480e+08/s), 0.219 (4.501e+08/s), 0.216 (4.563e+08/s), 0.203 (4.856e+08/s), blas matmul N, D, M: 49284, 27, 2 (5x20): 0.327 (3.014e+08/s), 0.318 (3.100e+08/s), 0.319 (3.090e+08/s), 0.328 (3.005e+08/s), 0.328 (3.005e+08/s), our matmul N, D, M: 49284, 27, 2 (5x20): 0.186 (5.299e+08/s), 0.181 (5.446e+08/s), 0.183 (5.386e+08/s), 0.174 (5.665e+08/s), 0.173 (5.698e+08/s), """ def _load_matmul_times_for_n_d_m(startswith): lines = microbench_output.split('\n') matmul_lines = [line for line in lines if line.startswith(startswith)] matmul_shape_to_times = {} matmul_shape_to_thruputs = {} for line in matmul_lines: start_idx = line.find(':') + 1 end_idx = line.find('(') nmd_str = line[start_idx:end_idx] N, D, M = [int(substr) for substr in nmd_str.split(',')[:3]] speeds_str = line[line.find('):') + 2:] speed_pairs = speeds_str.split(',')[:5] # print("N, D, M: ", N, D, M) # print("speed pairs: ", speed_pairs) times = [] thruputs = [] for pair in speed_pairs: pair = pair.strip() if not len(pair): continue # handle trailing comma on line # print("pair: ", pair) pair = pair.strip() time_str, thruput_str = pair.split() times.append(float(time_str)) thruput_str = thruput_str.strip('()s/') thruputs.append(float(thruput_str)) key = (N, D, M) matmul_shape_to_times[key] = times matmul_shape_to_thruputs[key] = thruputs # print("what we're getting from func:") # pprint.pprint(matmul_shape_to_times) # pprint.pprint(matmul_shape_to_thruputs) return matmul_shape_to_times, matmul_shape_to_thruputs def _load_sketch_times_for_n_d_m(startswith): # print("loading sketch times for ", startswith) lines = microbench_output.split('\n') matmul_lines = [line for line in lines if line.startswith(startswith)] matmul_shape_to_times = {} matmul_shape_to_thruputs = {} for line in matmul_lines: start_idx = line.find(':') + 1 end_idx = line.find('(') nmd_str = line[start_idx:end_idx] N, D, M, d = [int(substr) for substr in nmd_str.split(',')[:4]] speeds_str = line[line.find('):') + 2:] speed_pairs = speeds_str.split(',')[:5] # print("N, D, M: ", N, D, M) # print("speed pairs: ", speed_pairs) times = [] thruputs = [] for pair in speed_pairs: pair = pair.strip() if not len(pair): continue # handle trailing comma on line # print("pair: ", pair) pair = pair.strip() time_str, thruput_str = pair.split() times.append(float(time_str)) thruput_str = thruput_str.strip('()s/') thruputs.append(float(thruput_str)) key = (N, D, M, d) matmul_shape_to_times[key] = times matmul_shape_to_thruputs[key] = thruputs # pprint.pprint(matmul_shape_to_times) # pprint.pprint(matmul_shape_to_thruputs) return matmul_shape_to_times, matmul_shape_to_thruputs def load_matmul_times_for_n_d_m(key1='blas matmul', key2='our matmul', sketches=False): if sketches: # print("results from blas:") shape2lat0, shape2thruput0 = _load_sketch_times_for_n_d_m(key1) # print("results from ours:") shape2lat1, shape2thruput1 = _load_sketch_times_for_n_d_m(key2) else: # print("results from blas:") shape2lat0, shape2thruput0 = _load_matmul_times_for_n_d_m(key1) # print("results from ours:") shape2lat1, shape2thruput1 = _load_matmul_times_for_n_d_m(key2) # take minimum of time from eigen blas and our sgemm shape2lat = {} for k in shape2lat0: vals0 = shape2lat0.get(k, [1e20]) vals1 = shape2lat1.get(k, [1e20]) mean0, mean1 = np.mean(vals0), np.mean(vals1) if mean0 < mean1: shape2lat[k] = shape2lat0[k] else: shape2lat[k] = shape2lat1[k] shape2thruput = {} for k in shape2thruput0: vals0 = shape2thruput0.get(k, [-1e20]) vals1 = shape2thruput1.get(k, [-1e20]) # print("k, vals0, vals1: ", k) # print(vals0) # print(vals1) mean0, mean1 = np.mean(vals0), np.mean(vals1) if mean0 > mean1: shape2thruput[k] = shape2thruput0[k] else: shape2thruput[k] = shape2thruput1[k] # print("what we're returning:") # pprint.pprint(shape2lat) # pprint.pprint(shape2thruput) return shape2lat, shape2thruput def _load_vq_times_for_n_d_m(startswith): lines = microbench_output.split('\n') lines = [line for line in lines if line.startswith(startswith)] shape_ncodebooks_to_times = {} shape_ncodebooks_to_thruputs = {} for line in lines: start_idx = line.find(':') + 1 end_idx = line.find('(') nmd_str = line[start_idx:end_idx] N, D, M, C = [int(substr) for substr in nmd_str.split(',')[:4]] speeds_str = line[line.find('):') + 2:] speed_pairs = speeds_str.split(',')[:5] times = [] thruputs = [] for pair in speed_pairs: pair = pair.strip() if not len(pair): continue # handle trailing comma on line time_str, thruput_str = pair.split() times.append(float(time_str)) thruput_str = thruput_str.strip('()s/') thruputs.append(float(thruput_str)) key = (N, D, M, C) shape_ncodebooks_to_times[key] = times shape_ncodebooks_to_thruputs[key] = thruputs # print("startswith: ", startswith) # if 'bolt' in startswith: # print("bolt speed dicts:") # pprint.pprint(shape_ncodebooks_to_times) # pprint.pprint(shape_ncodebooks_to_thruputs) return shape_ncodebooks_to_times, shape_ncodebooks_to_thruputs # def load_multisplit_times_for_n_d_m(): # return _load_vq_times_for_n_d_m('famm mithral') def load_bolt_times_for_n_d_m(): return _load_vq_times_for_n_d_m('amm bolt') def load_mithral_f32_times_for_n_d_m(): # two spaces so it doesn't try to read enc and zip times return _load_vq_times_for_n_d_m('f32 amm mithral ') def load_mithral_i16_times_for_n_d_m(): return _load_vq_times_for_n_d_m('i16 amm mithral ') def load_mithral_i8_times_for_n_d_m(): return _load_vq_times_for_n_d_m('i8 amm mithral ') def load_mithral_times_for_n_d_m(): return _load_vq_times_for_n_d_m('f32 amm mithral ') def load_sketch_times_for_n_d_m(): return load_matmul_times_for_n_d_m( 'blas sketch matmul', 'our sketch matmul', sketches=True) def main(): # load_matmul_times_for_n_d_m() # load_multisplit_times_for_n_d_m() # load_bolt_times_for_n_d_m() # pprint.pprint(load_sketch_times_for_n_d_m()) # pprint.pprint(load_multisplit_times_for_n_d_m()) # pprint.pprint(load_mithral_times_for_n_d_m()) ret = load_matmul_times_for_n_d_m() print("matmul latencies, thruputs") pprint.pprint(ret) # pprint.pprint(load_bolt_times_for_n_d_m()) if __name__ == '__main__': main()
bolt-master
experiments/python/amm_results.py
#!/usr/bin/env python import itertools import numpy as np from sklearn import cluster from scipy import signal # import types import kmc2 # state-of-the-art kmeans initialization (as of NIPS 2016) from joblib import Memory _memory = Memory('.', verbose=0) # ================================================================ misc def is_dict(x): return isinstance(x, dict) def is_list_or_tuple(x): return isinstance(x, (list, tuple)) def as_list_or_tuple(x): return x if is_list_or_tuple(x) else [x] def is_scalar_seq(x): try: [float(element) for element in x] return True except TypeError: return False def as_scalar_seq(x): if is_scalar_seq(x): return x try: _ = float(x) return [x] except TypeError: raise TypeError("Couldn't convert value '{}' to sequence " "of scalars".format(x)) def is_string(x): return isinstance(x, (str,)) def flatten_list_of_lists(l): return list(itertools.chain.from_iterable(l)) def element_size_bytes(x): return np.dtype(x.dtype).itemsize def invert_permutation(permutation): return np.arange(len(permutation))[np.argsort(permutation)] # ================================================================ image def conv2d(img, filt, pad='same'): # assert pad in ('same',) # TODO support valid # mode = 'constant' if len(img.shape) == 2: return signal.correlate2d(img, filt, mode=pad) # img is more than 2d; do a 2d conv for each channel and sum results assert len(img.shape) == 3 out = np.zeros(img.shape[:2], dtype=np.float32) for c in range(img.shape[2]): f = filt[:, :, c] if len(filt.shape) == 3 else filt out += signal.correlate2d(img[:, :, c], f, mode=pad) return out # def filter_img(img, filt): # out = conv2d(img, filt) # return out / np.max(out) # ================================================================ distance def dists_sq(X, q): diffs = X - q return np.sum(diffs * diffs, axis=-1) def dists_l1(X, q): diffs = np.abs(X - q) return np.sum(diffs, axis=-1) def sq_dists_to_vectors(X, queries, rowNorms=None, queryNorms=None): Q = queries.shape[0] mat_size = X.shape[0] * Q mat_size_bytes = element_size_bytes(X[0] + queries[0]) if mat_size_bytes > int(1e9): print("WARNING: sq_dists_to_vectors: attempting to create a matrix" \ "of size {} ({}B)".format(mat_size, mat_size_bytes)) if rowNorms is None: rowNorms = np.sum(X * X, axis=1, keepdims=True) if queryNorms is None: queryNorms = np.sum(queries * queries, axis=1) dotProds = np.dot(X, queries.T) return (-2 * dotProds) + rowNorms + queryNorms # len(X) x len(queries) def all_eq(x, y): if len(x) != len(y): return False if len(x) == 0: return True return np.max(np.abs(x - y)) < .001 def top_k_idxs(elements, k, smaller_better=True, axis=-1): if smaller_better: # return indices of lowest elements which_nn = np.arange(k) return np.argpartition(elements, kth=which_nn, axis=axis)[:k] else: # return indices of highest elements which_nn = len(elements) - 1 - np.arange(k) return np.argpartition(elements, kth=which_nn, axis=axis)[-k:][::-1] def compute_true_knn(X, Q, k=1000, print_every=5, block_sz=128): nqueries = Q.shape[0] nblocks = int(np.ceil(nqueries / float(block_sz))) truth = np.full((nqueries, k), -999, dtype=np.int32) if nqueries <= block_sz: dists = sq_dists_to_vectors(Q, X) assert dists.shape == (Q.shape[0], X.shape[0]) for i in range(nqueries): truth[i, :] = top_k_idxs(dists[i, :], k) # truth[i, :] = top_k_idxs(dists[:, i], k) return truth for b in range(nblocks): # recurse to fill in knn for each block start = b * block_sz end = min(start + block_sz, nqueries) rows = Q[start:end, :] truth[start:end, :] = compute_true_knn(X, rows, k=k, block_sz=block_sz) if b % print_every == 0: print("computing top k for query block " "{} (queries {}-{})...".format(b, start, end)) # for i in range(nqueries): # if i % print_every == 0: # print "computing top k for query {}...".format(i) # truth[i, :] = top_k_idxs(dists[i, :], k) print("done") assert np.all(truth != -999) return truth def knn(X, q, k, dist_func=dists_sq): dists = dist_func(X, q) idxs = top_k_idxs(dists, k) return idxs, dists[idxs] @_memory.cache def kmeans(X, k, max_iter=16, init='kmc2', return_sse=False): X = X.astype(np.float32) # handle fewer nonzero rows than centroids (mostly just don't choke # if X all zeros, which happens when run in PQ with tiny subspaces) rowsums = X.sum(axis=1) nonzero_mask = rowsums != 0 nnz_rows = np.sum(nonzero_mask) if nnz_rows < k: print("X.shape: ", X.shape) print("k: ", k) print("nnz_rows: ", nnz_rows) centroids = np.zeros((k, X.shape[1]), dtype=X.dtype) labels = np.full(X.shape[0], nnz_rows, dtype=np.int) if nnz_rows > 0: # special case, because can't have slice of size 0 # make a centroid out of each nonzero row, and assign only those # rows to that centroid; all other rows get assigned to next # centroid after those, which is all zeros centroids[nnz_rows] = X[nonzero_mask] labels[nonzero_mask] = np.arange(nnz_rows) if return_sse: return centroids, labels, 0 return centroids, labels # if k is huge, initialize centers with cartesian product of centroids # in two subspaces sqrt_k = int(np.ceil(np.sqrt(k))) if k >= 16 and init == 'subspaces': print("kmeans: clustering in subspaces first; k, sqrt(k) =" " {}, {}".format(k, sqrt_k)) _, D = X.shape centroids0, _ = kmeans(X[:, :D/2], sqrt_k, max_iter=1) centroids1, _ = kmeans(X[:, D/2:], sqrt_k, max_iter=1) seeds = np.empty((sqrt_k * sqrt_k, D), dtype=np.float32) for i in range(sqrt_k): for j in range(sqrt_k): row = i * sqrt_k + j seeds[row, :D/2] = centroids0[i] seeds[row, D/2:] = centroids1[j] seeds = seeds[:k] # rounded up sqrt(k), so probably has extra rows elif init == 'kmc2': try: seeds = kmc2.kmc2(X, k).astype(np.float32) except ValueError: # can happen if dist of 0 to centroid print("WARNING: couldn't use kmc2 initialization") seeds = 'k-means++' if k < max_iter else 'random' else: raise ValueError("init parameter must be one of {'kmc2', 'subspaces'}") est = cluster.MiniBatchKMeans( k, init=seeds, max_iter=max_iter, n_init=1).fit(X) if return_sse: return est.cluster_centers_, est.labels_, est.inertia_ return est.cluster_centers_, est.labels_ def orthonormalize_rows(A): Q, R = np.linalg.qr(A.T) return Q.T def random_rotation(D): rows = np.random.randn(D, D) return orthonormalize_rows(rows) def hamming_dist(v1, v2): return np.count_nonzero(v1 != v2) def hamming_dists(X, q): return np.array([hamming_dist(row, q) for row in X]) if __name__ == '__main__': a = np.random.randn(10) sort_idxs = np.argsort(a)[::-1] print(a) print(top_k_idxs(a, 3, smaller_better=False)) print(sort_idxs[:3])
bolt-master
experiments/python/utils.py
#!/usr/bin/env python import numpy as np import numba import zstandard as zstd # pip install zstandard # ================================================================ Funcs def nbits_cost(diffs, signed=True): """ >>> [nbits_cost(i) for i in [0, 1, 2, 3, 4, 5, 7, 8, 9]] [0, 2, 3, 3, 4, 4, 4, 5, 5] >>> [nbits_cost(i) for i in [-1, -2, -3, -4, -5, -7, -8, -9]] [1, 2, 3, 3, 4, 4, 4, 5] >>> nbits_cost([]) array([], dtype=int32) >>> nbits_cost([0, 2, 1, 0]) array([0, 3, 2, 0], dtype=int32) >>> nbits_cost([0, 2, 1, 3, 4, 0], signed=False) array([0, 2, 1, 2, 3, 0], dtype=int32) """ if diffs is None: return None diffs = np.asarray(diffs, dtype=np.int32) if diffs.size == 0: return np.array([], dtype=np.int32) if not signed: assert np.all(diffs >= 0) pos_idxs = diffs > 0 nbits = np.zeros(diffs.shape, dtype=np.int32) nbits[pos_idxs] = np.floor(np.log2(diffs[pos_idxs])) + 1 nbits[~pos_idxs] = 0 return nbits # shape = diffs.shape # diffs = diffs.ravel() # zero_idxs = (diffs == 0) # # nbits[zero_idxs] = 0 # nbits = np.zeros(len(diffs), dtype=np.int32) # diffs = diffs[~zero_idxs] # equiv_diffs = np.abs(diffs) + (diffs >= 0).astype(np.int32) # +1 if < 0 # # assert np.all(np.abs(diffs) > 0) # # assert np.all(equiv_diffs > 0) # nbits[~zero_idxs] = np.ceil(np.log2(equiv_diffs)) + 1 # nbits = np.asarray(nbits, dtype=np.int32) # next line can't handle scalar # assert np.all(nbits >= 0) shape = diffs.shape diffs = diffs.ravel() equiv_diffs = np.abs(diffs) + (diffs >= 0).astype(np.int32) # +1 if < 0 nbits = np.ceil(np.log2(equiv_diffs)) + 1 nbits = np.asarray(nbits, dtype=np.int32) # next line can't handle scalar nbits[diffs == 0] = 0 assert np.all(nbits >= 0) return nbits.reshape(shape) if nbits.size > 1 else nbits[0] # unpack if scalar @numba.njit(fastmath=True) def zigzag_encode(x): """ >>> [zigzag_encode(i) for i in [0,1,-1,2,-2,3,-3]] [0, 1, 2, 3, 4, 5, 6] >>> zigzag_encode([0,1,-1,2,-2,3,-3]) array([0, 1, 2, 3, 4, 5, 6], dtype=int32) """ x = np.asarray(x, dtype=np.int32) return (np.abs(x) << 1) - (x > 0).astype(np.int32) @numba.njit(fastmath=True) def zigzag_decode(x): return np.bitwise_xor(x >> 1, -np.bitwise_and(x, 1)) def quantize(X, nbits=16, minval=None, maxval=None): minval = np.min(X) if minval is None else minval maxval = np.max(X) if maxval is None else maxval unsigned_max = (1 << nbits) - 1 dtype_min = 1 << (nbits - 1) scale = float(unsigned_max) / maxval X = np.maximum(0, X - minval) X = np.minimum(unsigned_max, X * scale) X -= dtype_min # center at 0 dtype = {16: np.int16, 12: np.int16, 8: np.int8}[nbits] return X.astype(dtype) # ================================================================ def zstd_compress(buff, comp=None): comp = zstd.ZstdCompressor() if comp is None else comp if isinstance(buff, str): buff = bytes(buff, encoding='utf8') return comp.compress(buff) def zstd_decompress(buff, decomp=None): decomp = zstd.ZstdDecompressor() if decomp is None else decomp return decomp.decompress(decomp) # ============================================================== sprintz # except without the predictive coding part because we do that manually; # we also omit the run-length encoding because the author says that's a # huge pain to code and won't change the results much for our fast-changing # time series; also we don't do the grouping thing since it only # affects the decoding speed (it could affect the ratio slightly if the # number of variables were really low and not a multiple of 8, but neither # is the case for us) # def bitpack_vec(x, nbits_per_element): # n = len(x) # total_nbits = n * nbits_per_element # bitvec = np.zeros(total_nbits, dtype=np.bool) # for i, val in enumerate(x): # start_idx = i * nbits_per_element # for b in range(nbits_per_element): # bit = (val >> b) & 1 # bitvec[start_idx + b] = bit # return np.packbits(bitvec) # def bitunpack(X, nbits_per_element): # was_1d = X.ndim == 1 # X = np.atleast_2d(X) # N, D = X.shape # ret = np.unpackbits(X, axis=1) # if was_1d: # ret = ret.squeeze() # return ret # @numba.njit(fastmath=True) def bitpack(X, nbits_per_element): was_1d = X.ndim == 1 X = np.atleast_2d(X) N, D = X.shape # orig_elemsz = X.dtype.itemsize orig_elemsz_bits = 8 * X.dtype.itemsize assert X.dtype in (np.uint8, np.uint16) assert X.dtype in (np.uint8, np.uint16) if nbits_per_element == orig_elemsz_bits: ret = X elif X.dtype == np.uint8: # print("N, D, nbits: ", N, D, nbits_per_element) # shape = X.shape X = X.ravel() # unpacked = np.unpackbits(X, count=nbits_per_element, bitorder='little', axis=-1) unpacked = np.unpackbits(X, bitorder='little', axis=-1) # print("unpacked initial shape: ", unpacked.shape) unpacked = unpacked.reshape(N * D, 8)[:, :nbits_per_element] # print("unpacked new shape: ", unpacked.shape) ret = np.packbits(unpacked.reshape(N, -1), axis=1) # ret = ret.reshape(N, -1) # print("ret.shape: ", ret.shape) else: # X_low = (X & 0xff)[:, :, np.newaxis] # X_high = ((X & 0xff00) >> 8)[:, :, np.newaxis] # X_combined = np.concatenate([X_low, X_high], axis=-1) # X = X[:, :, np.newaxis] # X = np.concatenate([X, X], axis=-1) # X[:, :, 0] = X[:, :, 0] & 0xff # X[:, :, 1] = (X[:, :, 1] & 0xff00) >> 8 # X = X.reshape(N, 2 * D).astype(np.uint8) X = np.ascontiguousarray(X).view(np.uint8).reshape(N, 2 * D) # print("X shape: ", X.shape) unpacked = np.unpackbits(X, axis=1, bitorder='little') unpacked = unpacked.reshape(N, orig_elemsz_bits, D) # unpacked = unpacked[:, ::-1, :] # low bits in low idxs unpacked = np.ascontiguousarray(unpacked[:, :nbits_per_element]) ret = np.packbits(unpacked.reshape(N, -1)) # nbits_per_row = D * nbits_per_element # bitmat = np.zeros((N, nbits_per_row), dtype=np.uint8) # for j in range(D): # col = X[:, j] # start_idx = j * nbits_per_element # for b in range(nbits_per_element): # bit = (col >> b) & 1 # bitmat[:, start_idx + b] = bit # ret = np.packbits(bitmat, axis=1) if was_1d: ret = ret.squeeze() return ret @numba.njit(fastmath=True) def _sprintz_header_sz(headers, header_elem_nbits): _, D = headers.shape header_row_sz = int(np.ceil(D * header_elem_nbits / 8)) rows_total_nbits = headers.sum(axis=1) # zero_rows = rows_total_nbits == 0 # header_sz = np.sum(nzero_rows) # one byte for run length # pair_sums = zero_rows + header_sz = 0 prev_was_zero = False for row in rows_total_nbits: is_zero = row == 0 if is_zero: if prev_was_zero: continue else: header_sz += 1 # start of run else: header_sz += header_row_sz prev_was_zero = is_zero return header_sz # def sprintz_packed_size(X, nbits=None, just_return_sz=False, postproc='zstd'): def sprintz_packed_size(X, nbits=None, just_return_sz=True, postproc=None): if nbits is None: nbits = {1: 8, 2: 16}.get(X.dtype.itemsize, 16) unsigned_dtype = {8: np.uint8, 16: np.uint16}[nbits] window_len = 8 pad_nrows = X.shape[0] % window_len if pad_nrows != 0: pad_rows = np.zeros((pad_nrows, X.shape[1]), dtype=X.dtype) X = np.vstack([X, pad_rows]) N, D = X.shape if X.dtype.itemsize > 2: # basically just catching floats # print("sprintz: quantizing X...WTF") X = quantize(X, nbits=nbits) if np.min(X) < 0: # print("sprintz: zigzag_encoding X!") X = zigzag_encode(X).astype(unsigned_dtype) # else: # print("sprintz: not zigzag_encoding X!") header_elem_nbits = {8: 3, 16: 4}[nbits] X_nbits = nbits_cost(X, signed=False) X_nbits = np.asfarray(X_nbits).reshape(N // window_len, window_len, -1) block_nbits = X_nbits.max(axis=1).astype(np.uint8) block_nbits[block_nbits == (nbits - 1)] = nbits headers = block_nbits if just_return_sz: payload_sz = int(block_nbits.sum() * window_len / 8) header_sz = _sprintz_header_sz(headers, header_elem_nbits) # print("header sz: ", header_sz) return header_sz + payload_sz nwindows = N // window_len payloads = [] for i in range(nwindows): start_idx = i * window_len end_idx = start_idx + window_len X_slice = X[start_idx:end_idx] for j in range(D): col = X_slice[:, j] payloads.append(bitpack(col, headers[i, j])) headers = bitpack(headers, header_elem_nbits) payloads = np.hstack(payloads) if postproc is None: return headers.nbytes + payloads.nbytes elif postproc == 'zstd': return len(zstd_compress(headers)) + len(zstd_compress(payloads)) # # nbits_slice = nbits_cost(X_slice, signed=False) # nbits_slice = X_nbits[start_idx:end_idx] # max_nbits = nbits_slice.max(axis=0) # headers[i] = np.minimum(max_nbits, nbits - 1) # 8->7, 16->15 # max_nbits[max_nbits == nbits - 1] = nbits # 7->8, 15->16 # for j in range(D): # col = X_slice[:, j] # payloads.append(bitpack(col, max_nbits[j])) # headers = bitpack(headers, header_elem_nbits) # payloads = np.hstack(payloads) # header_bytes = headers.tobytes() # # payload_bytes = headers.tobytes() # blosc.compress(buff, typesize=elem_sz, # cname=compressor, shuffle=shuffle) # if __name__ == '__main__': import doctest doctest.testmod()
bolt-master
experiments/python/compress.py
#!/usr/bin/env python from __future__ import print_function import os import numpy as np import pandas as pd from io import StringIO from . import amm_methods as methods from joblib import Memory _memory = Memory('.', verbose=1) pd.options.mode.chained_assignment = None # suppress stupid warning RESULTS_DIR = os.path.join('results', 'amm') TIMING_RESULTS_DIR = os.path.join(RESULTS_DIR, 'timing') # we log these, but don't need them for the plots AMM_DROP_COLS = ['__pyience_timestamp__', 'y_mean', 'y_std', 'bias', 'raw_mse', 'r', 'alpha', 'ncentroids'] def _read_csv_with_garbage(path, **kwargs): with open(path, 'r') as f: # print("\n".join(f.readlines())) keep_lines = [line.strip() for line in f.readlines() if (',' in line and not line.startswith('-'))] contents = '\n'.join(keep_lines) # print("contents\n", contents) return pd.read_csv(StringIO(contents), **kwargs) def rename_values_in_col(df, col, name_map, drop_others=True): name_map = {k.strip().lower(): v for k, v in name_map.items()} vals = [name_map.get(name.strip().lower(), "") for name in df[col]] valid_vals = set(name_map.values()) # print("valid_vals: ", valid_vals) valid_mask = np.array([val in valid_vals for val in vals]) # print("valid mask: ", valid_mask) df = df.copy() df[col] = vals if drop_others: df = df.loc[valid_mask] return df # print(df) def melt_observation_cols(df, cols, var_name=None, value_name=None): """like pd.melt, but assumes only 1 observation var instead of 1 id var""" independent_vars = [col for col in df.columns if col not in set(cols)] return pd.melt(df, id_vars=independent_vars, value_vars=cols, var_name=var_name, value_name='time') def melt_times(df, ntimes=5): observation_vars = 't0 t1 t2 t3 t4'.split() observation_vars = observation_vars[:ntimes] return melt_observation_cols( df, observation_vars, var_name='timing_trial', value_name='time') def drop_cols_inplace(df, cols): for col in AMM_DROP_COLS: try: df.drop([col], axis=1, inplace=True) except KeyError: pass return df def frac_above_thresh(df, xvar, yvar, methodvar, unitvar, ythresh): """ (method, xvar) -> [0, 1] Assumes you have a tidy dataframe where method, xvar, yvar, and unit are each a col. """ df = df.copy() # df['frac_above_thresh'] = (df[yvar] > ythresh).astype(np.float) # (method, xvar, [(unit, yvar)]) -> bool df['frac_above_thresh'] = (df[yvar] > ythresh).astype(np.float) # independent_vars = [methodvar, unitvar, xvar] independent_vars = [methodvar, xvar] # return df.groupby(independent_vars)['is_above_thresh'].transform('mean') # last part converts from groupby back to regular df EDIT: no it doesn't # return df.groupby(independent_vars)['frac_above_thresh'].mean().apply(pd.Series) # return df.groupby(independent_vars)['is_above_thresh'].mean() df = df.groupby(independent_vars)['frac_above_thresh'].mean() # this is the magic line; turn multi-index levels into regular cols, with # multi-index value broadcast all the corresponding rows; # WOW this took a long time to figure out... df = df.reset_index(level=independent_vars) return df # tmp = df.groupby(independent_vars)['frac_above_thresh'].mean() # tmp = df.groupby(independent_vars)['frac_above_thresh'].transform('mean') # print("tmp:\n", tmp) # df['frac_above_thresh'] = tmp # return df # return df.groupby(independent_vars)[independent_vars + ['frac_above_thresh']] # ret = df.groupby([methodvar, unitvar, xvar])['__above_thresh__'] # ret.drop(['__above_thresh__'], axis=1, inplace=True) # return ret def encode_timings(): TIMINGS_PATH = os.path.join(TIMING_RESULTS_DIR, 'encode-timing.csv') ORIG_HEADERS = 'algo __ N D C B ___ t0 _0 t1 _1 t2 _2 t3 _3 t4 _4'.split() USE_HEADERS = 'algo N D C B t0 t1 t2 t3 t4'.split() # ORIG_HEADERS = 'algo __ N D C ___ t0 _0 t1 _1 t2 _2'.split() # USE_HEADERS = 'algo N D C t0 t1 t2'.split() df = _read_csv_with_garbage(TIMINGS_PATH, names=ORIG_HEADERS, header=None) df = df[USE_HEADERS] return df # print(df) def lut_timings(): TIMINGS_PATH = os.path.join(TIMING_RESULTS_DIR, 'lut-timing.csv') ORIG_HEADERS = ('algo __ N D C B lutconst ___ ' 't0 _0 t1 _1 t2 _2 t3 _3 t4 _4').split() USE_HEADERS = 'algo N D C B lutconst t0 t1 t2 t3 t4'.split() df = _read_csv_with_garbage(TIMINGS_PATH, names=ORIG_HEADERS, header=None) df = df[USE_HEADERS] return df def scan_timings(): TIMINGS_PATH = os.path.join(TIMING_RESULTS_DIR, 'scan-timing.csv') ORIG_HEADERS = 'algo __ N C B M ___ t0 _0 t1 _1 t2 _2 t3 _3 t4 _4'.split() USE_HEADERS = 'algo N C B M t0 t1 t2 t3 t4'.split() df = _read_csv_with_garbage(TIMINGS_PATH, names=ORIG_HEADERS, header=None, skiprows=1) df = df[USE_HEADERS] return df def mithral_amm_timings(): TIMINGS_PATH = os.path.join(TIMING_RESULTS_DIR, 'amm-mithral-timing.csv') ORIG_HEADERS = ('dset dtype algo __ N D M C lutconst ___ ' 't0 _0 t1 _1 t2 _2 t3 _3 t4 _4').split() USE_HEADERS = 'dset dtype algo N D M C lutconst t0 t1 t2 t3 t4'.split() df = _read_csv_with_garbage(TIMINGS_PATH, names=ORIG_HEADERS, header=None) df = df[USE_HEADERS] return df def bolt_amm_timings(): TIMINGS_PATH = os.path.join(TIMING_RESULTS_DIR, 'amm-bolt-timing.csv') ORIG_HEADERS = ('dset dtype algo __ N D M C ___ ' 't0 _0 t1 _1 t2 _2 t3 _3 t4 _4').split() USE_HEADERS = 'dset dtype algo N D M C t0 t1 t2 t3 t4'.split() df = _read_csv_with_garbage(TIMINGS_PATH, names=ORIG_HEADERS, header=None) df = df[USE_HEADERS] df['fixedB'] = df['algo'].str.strip().str.endswith('noenc') df.drop('algo', axis=1, inplace=True) df = df.loc[df['fixedB']] # print("bolt df:\n", df) # import sys; sys.exit() return df def dense_amm_timings(): TIMINGS_PATH = os.path.join(TIMING_RESULTS_DIR, 'amm-dense-timing.csv') ORIG_HEADERS = ('dset algo __ N D M d ___ ' 't0 _0 t1 _1 t2 _2 t3 _3 t4 _4').split() USE_HEADERS = 'dset algo N D M d t0 t1 t2 t3 t4'.split() df = _read_csv_with_garbage(TIMINGS_PATH, names=ORIG_HEADERS, header=None) df = df[USE_HEADERS] df['algo'] = df['algo'].str.strip() # drop stuff that doesn't have fixedW; we just let the existing methods # use fixedW (same as fixedB in amm.py), instead of having to encode the # smaller matrix # df = df.loc[~df['algo'].isin(['blas sketch matmul', 'our sketch matmul'])] t_sums = (df['t0'] + df['t1'] + df['t2'] + df['t3'] + df['t4']).values / 5 # df['t_avg'] = (df['t0'] + df['t1'] + df['t2'] + df['t3'] + df['t4']) / 5. # # mark whether it's from our gemm or eigen gemm # df['is_ours'] = df['algo'].str.startswith('our') # print("uniq n vals: ", np.unique(df['N'])) sizes = np.empty((len(df), 4), dtype=np.int) sizes[:, 0] = df['N'] sizes[:, 1] = df['D'] sizes[:, 2] = df['M'] sizes[:, 3] = df['d'] as_tuples = [tuple(row) for row in sizes] uniq_tuples = sorted(list(set(as_tuples))) keep_idxs = [] # print("sizes:\n", sizes) # print("uniq_tuples:\n", uniq_tuples) for tup in uniq_tuples: row = np.array(tup) idxs = np.where((sizes == row).sum(axis=1) == sizes.shape[1])[0] best_idx = idxs[np.argmin(t_sums[idxs])] # print(f"{tup} -> {best_idx}") keep_idxs.append(best_idx) df = df.iloc[keep_idxs] rename_dict = {} rename_dict['blas matmul'] = 'Brute Force' rename_dict['our matmul'] = 'Brute Force' rename_dict['blas sketch matmul'] = 'Dense Sketch' rename_dict['our sketch matmul'] = 'Dense Sketch' rename_dict['blas sketch fixedw matmul'] = 'Dense Sketch' rename_dict['our sketch fixedw matmul'] = 'Dense Sketch' df = rename_values_in_col(df, 'algo', rename_dict, drop_others=False) return df def osnap_amm_timings(): TIMINGS_PATH = os.path.join(TIMING_RESULTS_DIR, 'amm-osnap-timing.csv') ORIG_HEADERS = ('dset algo __ N D M d s ___ ' 't0 _0 t1 _1 t2 _2 t3 _3 t4 _4').split() USE_HEADERS = 'dset algo N D M d s t0 t1 t2 t3 t4'.split() df = _read_csv_with_garbage(TIMINGS_PATH, names=ORIG_HEADERS, header=None) df = df[USE_HEADERS] df.drop('algo', axis=1, inplace=True) return df def sparse_amm_timings(): TIMINGS_PATH = os.path.join(TIMING_RESULTS_DIR, 'amm-sparse-timing.csv') ORIG_HEADERS = ('dset algo __ N D M d frac ___ ' 't0 _0 t1 _1 t2 _2 t3 _3 t4 _4').split() USE_HEADERS = 'dset algo N D M d frac t0 t1 t2 t3 t4'.split() df = _read_csv_with_garbage(TIMINGS_PATH, names=ORIG_HEADERS, header=None) df = df[USE_HEADERS] df.drop('algo', axis=1, inplace=True) return df def scalar_quantized_amm_timings(): timings = [] timings.append(['Cifar10', 10000, 512, 10, 2.013]) timings.append(['Cifar100', 10000, 512, 100, 6.472]) timings.append(['Ucr128', 1000, 320, 128, .4808]) timings.append(['Caltech3x3', 49284, 27, 2, .894]) timings.append(['Caltech5x5', 48400, 75, 2, 1.409]) dicts = [{'dset': l[0], 'N': l[1], 'D': l[2], 'M': l[3], 'time': l[4]} for l in timings] # df = pd.DataFrame.from_records(dicts) # print("scalar_quantized_amm_timings: ") # print(df) return pd.DataFrame.from_records(dicts) # import sys; sys.exit() # df = pd.DataFrame.from_records(timings) # output from ./GEMMsBenchmark after defining FBGEMM_MEASURE_TIME_BREAKDOWN # in include/fbgemm/Fbgemm.h; recorded here since not in a results file ''' M, N, K, Type, Packing (us), Kernel (us), Postproc (us), Total (us), GOPs 10000, 10, 512, FBGEMM_i8_acc32, 438.069, 1465.04, 43.5959, 2013.31, 50.6 10000, 10, 512, FBGEMM_i8_acc16, 512.8, 1338.1, 69.9, 2115.1, 48.3 10000, 100, 512, FBGEMM_i8_acc32, 473.7, 9203.9, 85.9, 9923.9, 103.1 10000, 100, 512, FBGEMM_i8_acc16, 569.8, 5558.7, 108.5, 6472.2, 158.1 1000, 128, 320, FBGEMM_i8_acc32, 39.5, 724.6, 5.8, 795.2, 101.8 1000, 128, 320, FBGEMM_i8_acc16, 43.5, 404.1, 3.1, 480.8, 168.4 49284, 2, 27, FBGEMM_i8_acc32, 298.5, 226.2, 139.6, 894.0, 5.9 49284, 2, 27, FBGEMM_i8_acc16, 333.6, 650.1, 162.5, 1608.7, 3.3 48400, 2, 75, FBGEMM_i8_acc32, 482.0, 546.0, 141.5, 1409.3, 10.2 48400, 2, 75, FBGEMM_i8_acc16, 438.3, 1228.7, 159.2, 2278.4, 6.4 ''' # def _extract_cols_into_list_of_tuples(df, cols): def _extract_cols_into_list_of_tuples(df, cols): # return [tuple(row) for row in df[cols].iterrows()] ar = np.vstack([df[col] for col in cols]).T # print("ar: \n", ar) ar = np.atleast_2d(ar).astype(np.int) # return [tuple(row) for row in ar] return [sum([hash(-12435 * i + 1) ^ hash(1234567 * val) for i, val in enumerate(row)]) for row in ar] # return [int(hash(tuple(row))) for row in ar] def _join_on_cols(df_left, left_cols, df_right, right_cols, verbose=0): df_left = df_left.copy() df_right = df_right.copy() df_left['__index__'] = _extract_cols_into_list_of_tuples( df_left, left_cols) df_right['__index__'] = _extract_cols_into_list_of_tuples( df_right, right_cols) # dup_cols = set(left_cols) & set(right_cols) # if verbose > 0: # print("_join_on_cols(); dropping duplicate cols from rhs: ", dup_cols) # df_right = df_right.drop(dup_cols, axis=1) df = df_left.merge( df_right, on='__index__', how='left', suffixes=('', '_rhs')) df.drop(['__index__'], axis=1, inplace=True) # df.sort_values(left_cols, axis=0, inplace=True) return df def _join_with_mithral_times(df, timing_dtype='f32'): time_df = mithral_amm_timings() if timing_dtype is not None: time_df = time_df.loc[time_df['dtype'].str.strip() == timing_dtype] df = df.loc[df['method'].str.lower().str.startswith('mithral')] df['ncodebooks'] = df['ncodebooks'].astype(np.int) # time_df.reset_index(inplace=True, drop=True) # df.reset_index(inplace=True, drop=True) # print("time_df with appropriate dtype:\n", time_df) # import sys; sys.exit() # we also report times for subroutines within mithral; can't let it # use any of these; just use rename_values_in_col to drop them and also # get more intuitive debug output # rename_dict = {'amm mithral sparselut': 'Mithral, L = ??', # 'amm mithral nolut': 'Mithral, L = ∞'} name_mithral_dense = 'mithralDense' # only one we use; others arbitrary rename_dict = {'amm mithral sparselut': 'mithralSparse', 'amm mithral denselut': name_mithral_dense, 'amm mithral nolut': 'mithralOffline'} time_df = rename_values_in_col(time_df, 'algo', rename_dict) # give MithralPQ a valid lut const so the join will work (pq is equivalent # to constant of 1) is_mithral_pq = df['method'].str.lower().str.startswith('mithralpq') df.loc[is_mithral_pq, 'lut_work_const'] = 1 df_mpq = df.loc[is_mithral_pq].copy() # there shouldn't be rows that violated this, but there are (probably # from early runs that haven't been overwritten yet) df = df.loc[df['lut_work_const'].values <= df['ncodebooks'].values] # now add in extra rows for mithral with no lut computation (which is # assumed to use dense luts because no reason not to) vs mithral # with dense lut computation as part of the timing is_any_mithral = df['method'].str.lower().str.startswith('mithral') is_mithral = is_any_mithral & (~is_mithral_pq) is_dense = df['lut_work_const'] == -1 df_mithral_dense = df.loc[is_mithral & is_dense].copy() dummy_lutconst = -2 df_mithral_dense['lut_work_const'] = dummy_lutconst time_df['lutconst'].loc[ time_df['algo'] == name_mithral_dense] = dummy_lutconst # add in version of mithralpq with offline lut computation df_mpq = df.loc[df['method'].str.lower().str.startswith('mithralpq')] df_mpq['lut_work_const'] = -1 df = pd.concat([df, df_mithral_dense, df_mpq], axis=0) cols_df = 'N D M ncodebooks lut_work_const'.split() cols_time_df = 'N D M C lutconst'.split() # print("df cols: ", df.columns) # time_df.reset_index(inplace=True, drop=True) # df.reset_index(inplace=True, drop=True) df.sort_values(['method'] + cols_df, axis=0, inplace=True) time_df.sort_values(cols_time_df, axis=0, inplace=True) ret = _join_on_cols(df, cols_df, time_df, cols_time_df) # ret['lut_work_const'].loc[ret['lut_work_const'] == dummy_lutconst] = -1 # show_keys = 'method N D M C ncodebooks lutconst lut_work_const'.split() # print("mithral df:\n", df['method N D M ncodebooks lut_work_const'.split()]) # # print("mithral time df:\n", time_df.loc[time_df['dset'] == 'Cifar10']) # print("mithral time df:\n", time_df.loc[time_df['dset'] == 'Caltech3x3']) # print("joined df:\n", ret[show_keys]) # # print("joined df:\n", ret) # import sys; sys.exit() # one of these fails if the join failed; check if you have redundant # rows in either df or missing rows in the time df assert np.all(ret['C'] == ret['ncodebooks']) assert np.all(ret['lutconst'] == ret['lut_work_const']) return ret def _join_with_bolt_times(df): time_df = bolt_amm_timings() df = df.loc[df['method'].str.lower().str.startswith('bolt')] return _join_on_cols(df, 'N D M ncodebooks'.split(), time_df, 'N D M C'.split()) def _join_with_osnap_times(df): time_df = osnap_amm_timings() # df = df.loc[df['method'].str.lower().str.startswith('osnap')] df = df.loc[df['method'].isin( [methods.METHOD_OSNAP, methods.METHOD_HASHJL])] df['s'] = 1 df['s'].loc[df['method'] == methods.METHOD_OSNAP] = 4 # print("osnap df shape: ", df.shape) df['d'] = df['d'].astype(np.int) # print("time_df:\n", time_df[time_df['dset'] == 'Cifar10']) # note that d < s isn't present in time_df, which makes sense return _join_on_cols(df, 'N D M d s'.split(), time_df, 'N D M d s'.split()) def _join_with_brute_force_times(df): time_df = dense_amm_timings() df = df.loc[df['method'].str.lower().str.startswith('exact')] time_df = time_df.loc[time_df['algo'].str.lower().str.startswith('brute')] # print("df:\n", df) # print("time_df:\n", time_df) return _join_on_cols(df, 'N D M'.split(), time_df, 'N D M'.split()) def _join_with_dense_sketch_times(df): time_df = dense_amm_timings() # print("found methods in df: ", df['method'].unique()) # print("dense sketch methods: ", methods.DENSE_SKETCH_METHODS) df = df.loc[df['method'].isin(methods.DENSE_SKETCH_METHODS)] time_df = time_df.loc[time_df['algo'].str.lower().str.startswith( 'dense sketch')] # print("df:\n", df) # print("time_df:\n", time_df) return _join_on_cols(df, 'N D M d'.split(), time_df, 'N D M d'.split()) def _join_with_scalar_quantize_times(df): time_df = scalar_quantized_amm_timings() df = df.loc[df['method'] == methods.METHOD_SCALAR_QUANTIZE] # print("scalar quantize time df:\n", time_df) # print("scalar quantize acc df:\n", df.columns) # print(df['N D M'.split()]) # df_joint = _join_on_cols(df, 'N D M'.split(), time_df, 'N D M'.split()) # print("joined df: ") # print(df_joint['N D M time'.split()]) # import sys; sys.exit() return _join_on_cols(df, 'N D M'.split(), time_df, 'N D M'.split()) def extract_pareto_frontier_idxs(xvals, yvals): """assumes lower x is better and higher y is better""" assert len(xvals) == len(yvals) sort_idxs = np.argsort(xvals) xvals = xvals[sort_idxs] yvals = yvals[sort_idxs] # orig_idxs = np.arange(len(xvals)) first_idx = sort_idxs[0] curr_thresh = yvals[first_idx] keep_idxs = [first_idx] for i, y in enumerate(yvals[1:]): if y > curr_thresh: curr_thresh = y keep_idxs.append(sort_idxs[i + 1]) return keep_idxs def _join_with_sparse_sketch_times(df, sparse_pareto=True): time_df = sparse_amm_timings() df = df.loc[df['method'].str.lower().str.startswith('sparse')] df['d'] = df['d'].astype(np.int) new_rows = [] for _, row in df.iterrows(): # pprint.pprint(dict(row)) subdf = time_df for key in 'N D M d'.split(): subdf = subdf.loc[subdf[key] == row[key]] if len(subdf) < 1: continue sparsities = subdf['frac'] # print("subdf for N, D, M, D: ", [row[k] for k in 'N D M d'.split()]) # print(subdf) # N, D, M, d = [row[k] for k in 'N D M d'.split()] target_frac = row['sparsity'] small_enough_sparsities_idxs = np.where(sparsities.values <= target_frac)[0] if len(small_enough_sparsities_idxs): take_idx = small_enough_sparsities_idxs[-1] else: # no nonzeros, or at least uselessly few of them take_idx = np.argmin(sparsities.values) time_keys = 't0 t1 t2 t3 t4'.split() times_row = subdf.iloc[take_idx] # times = subdf.loc[take_idx, time_keys] row = dict(row) for key in time_keys: row[key] = float(times_row[key]) row['time'] = sum([float(times_row[key]) for key in time_keys]) / len(time_keys) new_rows.append(row) # return pd.DataFrame.from_records(new_rows) df = pd.DataFrame.from_records(new_rows) if not sparse_pareto: return df # # for dset in df[''] # subdf = df.loc[df['method'] == 'SparsePCA'] # here we have a bunch of hack stuff # print("df columns: ", df.columns) # yvals = 1. - df['normalized_mse'].values subdfs = [] for tid in df['task_id'].unique(): subdf = df.loc[df['task_id'] == tid] xvals = subdf['time'].values if 'acc_amm' in df.columns: yvals = subdf['acc_amm'].values else: yvals = 1. - subdf['normalized_mse'].values idxs = extract_pareto_frontier_idxs(xvals, yvals) subdfs.append(subdf.iloc[idxs]) df = pd.concat(subdfs, axis=0) return df def _clean_method_names_amm(df): key = 'method' if 'method' in df else 'algo' if 'lutconst' in df: df.loc[df['lutconst'] == -2, key] = 'MADDNESS Dense' is_lutconst_neg1 = df['lutconst'] == -1 is_mithral_pq = df['method'] == 'MithralPQ' df.loc[is_lutconst_neg1 & is_mithral_pq, key] = 'MADDNESS-PQ' df.loc[is_lutconst_neg1 & ~is_mithral_pq, key] = 'MADDNESS' df.loc[df['lutconst'] == 1, key] = 'MADDNESS, L = 1' df.loc[df['lutconst'] == 2, key] = 'MADDNESS, L = 2' df.loc[df['lutconst'] == 4, key] = 'MADDNESS, L = 4' # df.loc[df['lutconst'] == -2, key] = 'Mithral Dense' # is_lutconst_neg1 = df['lutconst'] == -1 # is_mithral_pq = df['method'] == 'MithralPQ' # df.loc[is_lutconst_neg1 & is_mithral_pq, key] = 'MithralPQ' # df.loc[is_lutconst_neg1 & ~is_mithral_pq, key] = 'Mithral' # df.loc[df['lutconst'] == 1, key] = 'Mithral, L = 1' # df.loc[df['lutconst'] == 2, key] = 'Mithral, L = 2' # df.loc[df['lutconst'] == 4, key] = 'Mithral, L = 4' # mask = df['lutconst'] == 1 # is_mithral_pq = df[key].str.lower().str.startswith('mithralpq') # mask &= ~is_mithral_pq # df[key][mask] = 'Mithral, L = ∞' # df[key].loc[df[key] == 'Exact'] = 'Brute Force' df[key].loc[df[key] == 'Exact'] = 'Exact' return df def _clean_metrics_amm(df): df = df.rename({'acc_amm': 'Accuracy'}, axis=1) # if 'time' not in df.columns: mask = df['time'].isna() # df.loc['time', mask] = ((df['t0'] + df['t1'] + df['t2'] + df['t3'] + df['t4']).values / 5.)[mask] times = (df['t0'] + df['t1'] + df['t2'] + df['t3'] + df['t4']) / 5. df.loc[mask, 'time'] = times.values[mask] df['Throughput'] = 1e3 * df['N'] * df['M'] / df['time'] # create ops column that sums number of multiplies + lookups df['muls'] = df['muls'].fillna(0) mask = ~df['nlookups'].isna() df['ops'] = df['muls'] # print("debugging df[ops]: ") # # print(type(df['ops'])) # # print(type(df['ops'])) # print(type(df['nlookups'])) df['ops'].loc[mask] += df['nlookups'].loc[mask] # df['nor'] # df_exact = df.loc[df['method'] == 'Brute Force'] df_exact = df.loc[df['method'] == 'Exact'] # print("df_exact\n", df_exact) if 'task_id' in df.columns: nuniq_tasks = len(df['task_id'].unique()) else: nuniq_tasks = 1 # cifar{10,100} assert df_exact.shape[0] == nuniq_tasks base_time = float(df_exact.loc[0, 'time']) df['NormalizedTime'] = df['time'] / base_time df['Speedup'] = 1. / df['NormalizedTime'] df['1 - NMSE'] = 1. - df['normalized_mse'] if 'Accuracy' in df.columns: df['Relative Accuracy'] = df['Accuracy'] / (df['acc_orig'] + 1e-20) # print("df.columns", df.columns) # df['Change in Accuracy'] = df['Accuracy'] - df['acc-1nn-raw'] # if 'acc-1nn-raw' in df.columns: # # # note that relative accuracy can actually be higher if errors # # # happen to compensate for incorrect classification sometimes # # print("max relative acc: ", df['Relative Accuracy'].values.max()) # # # assert df['Relative Accuracy'].values.max() <= 1.000001 # # acc_orig field is supposed to capture this, but I messed it up for # # 1nn so this will also work # tid2acc = {} # exactdf = df.loc[df['method'] == 'Exact'] # for tid in df['task_id'].unique(): # subdf = exactdf.loc[exactdf['task_id'] == tid] # tid2acc[tid] = subdf['Accuracy'].values[0] # df['BaseAccuracy'] = [tid2acc[tid] for tid in df['task_id']] # df['Relative Accuracy'] = df['Accuracy'] / df['BaseAccuracy'] return df def _join_with_times(df, timing_dtype='f32', sparse_pareto=True): df_quant = _join_with_scalar_quantize_times(df) # print("scalar quantize time df:\n", time_df) # print("scalar quantize acc df:\n", df) # print("df scalar quant:\n", df_quant['dset N D M time'.split()]) # import sys; sys.exit() df_bolt = _join_with_bolt_times(df) # # print("df bolt:\n", df_bolt) # df_tmp = df_bolt['N D M C ncodebooks method normalized_mse t0 t1 t2 t3 t4 task_id'.split()] # df_tmp = df_tmp.loc[df_tmp['task_id'].isin(['ucr Yoga k=128', 'ucr Wafer k=128'])] # df_tmp['time'] = (df_tmp['t0'] + df_tmp['t1'] + df_tmp['t2'] + df_tmp['t3'] + df_tmp['t4']) / 5. # print("df tmp:\n", df_tmp) # print("df tmp times:\n", df_tmp[['C', 'time', 'task_id']]) # # tids = df_tmp['task_id'].unique() # # # yep, exactly 6 results per dset # # counts = df_tmp.groupby('task_id')['task_id'].count() # # print("task counts: ", counts) # import sys; sys.exit() # print("df bolt:\n", df_bolt) # looks good # import sys; sys.exit() # assert np.all(df_mithral['lutconst'] == df_mithral['lut_work_const']) # df_mithral = df.loc[df['method'].str.startswith('Mithral')] # df_mithral.to_csv('mithral-caltech-debug.csv') df_mithral = _join_with_mithral_times(df, timing_dtype=timing_dtype) # df_tmp = df_mithral # df_tmp = df_tmp['N D M C ncodebooks lutconst lut_work_const method algo normalized_mse t0 t1'.split()] # # print("mithral rows:\n", df.loc[df['method'].str.startswith('mithral')]) # print("mithralpq rows after join:\n", df_tmp.loc[df_tmp['method'] == 'MithralPQ']) # print("mithral rows after join:\n", df_tmp[:100]) # mismatch_mask = df_tmp['lutconst'] != df_tmp['lut_work_const'] # print("mithral mismatched rows:\n", df_tmp.loc[mismatch_mask]) # print(df_mithral['lutconst', 'lut_work_const']) # import sys; sys.exit() # if this line fails, it's usually because the join with mithral times # failed assert np.all(df_mithral['lutconst'] == df_mithral['lut_work_const']) df_osnap = _join_with_osnap_times(df) df_brute = _join_with_brute_force_times(df) df_sketch = _join_with_dense_sketch_times(df) df_sparse = _join_with_sparse_sketch_times(df, sparse_pareto=sparse_pareto) # dfs = [df_mithral, df_bolt, df_osnap, df_brute, df_sketch, df_sparse] dfs = [df_quant, df_mithral, df_bolt, df_osnap, df_brute, df_sketch, df_sparse] return pd.concat(dfs, axis=0, join='outer', sort=False) def _clean_amm_results_df(df, timing_dtype='f32', sparse_pareto=True): # print("initial methods: ", df['method'].unique()) df = _join_with_times( df, timing_dtype=timing_dtype, sparse_pareto=sparse_pareto) # df['time'] = df['t_avg'] # df = melt_times(df) # print("uniq methods after joining with times:\n", sorted(df['method'].unique())) # import sys; sys.exit() df = _clean_metrics_amm(df) df = df.loc[~df['time'].isna()] # print("uniq methods after rming nan times:\n", sorted(df['method'].unique())) # import sys; sys.exit() df = _clean_method_names_amm(df) return df @_memory.cache def _read_amm_csv(fname, **kwargs): df = pd.read_csv(os.path.join(RESULTS_DIR, fname), **kwargs) drop_cols_inplace(df, AMM_DROP_COLS) return df def cifar10_amm(): # df = pd.read_csv(os.path.join(RESULTS_DIR, 'cifar10.csv')) # drop_cols_inplace(df, AMM_DROP_COLS) df = _read_amm_csv('cifar10.csv') # print("initial uniq methods:\n", sorted(df['method'].unique())) return _clean_amm_results_df(df) def cifar100_amm(): # df = pd.read_csv(os.path.join(RESULTS_DIR, 'cifar100.csv')) # drop_cols_inplace(df, AMM_DROP_COLS) df = _read_amm_csv('cifar100.csv') return _clean_amm_results_df(df) @_memory.cache def caltech_amm(filt='sobel'): """filt must be one of {'sobel','dog5x5'}""" df = _read_amm_csv('caltech_{}.csv'.format(filt)) return _clean_amm_results_df(df, timing_dtype='i8') @_memory.cache def ucr_amm(k=128, problem='rbf'): """k must be one of {64, 128, 256}""" df = _read_amm_csv('ucr_k={}_problem={}.csv'.format(k, problem)) df['origN'] = df['N'].values df['N'] = 1000 # timing is for a test set size of 1000 if problem == 'softmax': df['M'] = k # to get meaningful timing vs acc comparison return _clean_amm_results_df(df, sparse_pareto=False) def main(): # print(encode_timings()) # print(lut_timings()) # print(scan_timings()) # print(bolt_amm_timings()) # print(mithral_amm_timings()) # print(dense_amm_timings()) # print(osnap_amm_timings()) # print(sparse_amm_timings()) # print(cifar10_amm()) # print(cifar100_amm()) # print(caltech_amm(filt='sobel')) # print(caltech_amm(filt='dog5x5')) # print(ucr_amm(k=64)) # df = ucr_amm(k=128, problem='rbf') # df_bolt = df.loc[df['method'] == 'Bolt'] # print("number of uniq bolt speedups:") # print(df_bolt['Speedup'].unique().size) # import sys; sys.exit() # df = df.loc[df['method'] == 'Bolt'] # print("bolt dset counts") # print(df.groupby('task_id')['task_id'].count()) # # print("bolt speedup per dset counts") # # print(df.groupby('task_id')['Speedup'].unique().count()) # print("number of uniq speedups:") # print(df['Speedup'].unique().size) # df = cifar10_amm() # df = cifar100_amm() df = caltech_amm(filt='dog5x5') # df = caltech_amm(filt='sobel') print(sorted(df['method'].unique())) # # df = df.loc[df['method'].isin(['Brute Force', 'Mithral', 'SparsePCA'])] # df = df.loc[df['method'].isin(['Exact', 'ScalarQuantize', 'MADDNESS', 'SparsePCA'])] # df = df.sort_values(['method', 'Speedup'], axis=0) # print(df['method Speedup Accuracy'.split()]) if __name__ == '__main__': main()
bolt-master
experiments/python/amm_results2.py
#!/usr/bin/env python import abc import numpy as np from . import vquantizers as vq from . import amm KEY_NLOOKUPS = 'nlookups' class VQMatmul(amm.ApproxMatmul, abc.ABC): def __init__(self, ncodebooks, ncentroids=None): self.ncodebooks = ncodebooks self.ncentroids = (self._get_ncentroids() if ncentroids is None else ncentroids) self.enc = self._create_encoder(ncodebooks) self.reset_for_new_task() @abc.abstractmethod def _create_encoder(self, ncodebooks): # to be overriden by subclasses return vq.PQEncoder(ncodebooks=ncodebooks, ncentroids=self.ncentroids, **self._get_encoder_kwargs()) # @abc.abstractmethod def _get_ncentroids(self): pass @abc.abstractmethod def get_speed_metrics(self, A, B, fixedA=False, fixedB=False): pass def _get_encoder_kwargs(self): # to be overriden by subclasses return {} def reset_for_new_task(self): self.A_enc = None self.luts = None def fit(self, A, B, Y=None): _, D = A.shape if D < self.ncodebooks: raise amm.InvalidParametersException( 'D < C: {} < {}'.format(D, self.ncodebooks)) self.enc.fit(A, B.T) def set_A(self, A): self.A_enc = self.enc.encode_X(A) def set_B(self, B): self.luts = self.enc.encode_Q(B.T) def __call__(self, A, B): if self.A_enc is None: self.set_A(A) if self.luts is None: self.set_B(B) return self.enc.dists_enc(self.A_enc, self.luts) def get_params(self): return {'ncodebooks': self.ncodebooks} # ================================================================ PQ class PQMatmul(VQMatmul): def _create_encoder(self, ncodebooks): # to be overriden by subclasses return vq.PQEncoder(ncodebooks=ncodebooks, ncentroids=self.ncentroids, **self._get_encoder_kwargs()) def _get_ncentroids(self): return 256 def get_speed_metrics(self, A, B, fixedA=False, fixedB=False): # data encoding and LUT costs nmuls = 0 nmuls += 0 if fixedA else A.shape[0] * A.shape[1] * self.ncentroids nmuls += 0 if fixedB else B.shape[0] * B.shape[1] * self.ncentroids nlookups = A.shape[0] * B.shape[1] * self.ncodebooks return {amm.KEY_NMULTIPLIES: nmuls, KEY_NLOOKUPS: nlookups} # ================================================================ OPQ class OPQMatmul(PQMatmul): def _get_encoder_kwargs(self): return dict(preproc='OPQ') def get_speed_metrics(self, A, B, fixedA=False, fixedB=False): metrics = super().get_speed_metrics(A, B, fixedA=fixedA, fixedB=fixedB) rot_nmuls = A.shape[0] * A.shape[1] * A.shape[1] # OPQ rotation cost metrics[amm.KEY_NMULTIPLIES] += rot_nmuls return metrics # ================================================================ Bolt class BoltMatmul(PQMatmul): # def __init__(self, ncodebooks): # self.ncodebooks = ncodebooks # self.ncentroids = 16 # self.enc = self._create_encoder(self.ncodebooks) # self._reset() def _get_ncentroids(self): return 16 def _create_encoder(self, ncodebooks): return vq.PQEncoder(ncodebooks=ncodebooks, ncentroids=self.ncentroids, quantize_lut=True, # quantize_lut=False, # accumulate_how='mean', accumulate_how='sum', upcast_every=-1, # upcast_every=2, # upcast_every=4, # upcast_every=256, # fine as long as using mean # TODO set quantize_lut=True after debug **self._get_encoder_kwargs()) class GEHTBoltMatmul_CovTopk(BoltMatmul): def _get_encoder_kwargs(self): return dict( preproc='GEHT', sample_how='deterministic', stats_mat='cov') class GEHTBoltMatmul_CovSamp(BoltMatmul): def _get_encoder_kwargs(self): return dict( preproc='GEHT', sample_how='importance', stats_mat='cov') class GEHTBoltMatmul_CorrTopk(BoltMatmul): def _get_encoder_kwargs(self): return dict( preproc='GEHT', sample_how='deterministic', stats_mat='corr') class GEHTBoltMatmul_CorrSamp(BoltMatmul): def _get_encoder_kwargs(self): return dict( preproc='GEHT', sample_how='importance', stats_mat='corr') class BoltSplits(BoltMatmul): def _get_encoder_kwargs(self): return dict( preproc='PQ', encode_algo='splits') def get_speed_metrics(self, A, B, fixedA=False, fixedB=False): metrics = super().get_speed_metrics(A, B, fixedA=fixedA, fixedB=fixedB) nmuls = 0 nmuls += 0 if fixedB else B.shape[0] * B.shape[1] * self.ncentroids metrics[amm.KEY_NMULTIPLIES] = nmuls return metrics class BoltMultiSplits(BoltMatmul): def _get_encoder_kwargs(self): return dict(encode_algo='multisplits') def get_speed_metrics(self, A, B, fixedA=False, fixedB=False): metrics = super().get_speed_metrics(A, B, fixedA=fixedA, fixedB=fixedB) nmuls = 0 nmuls += 0 if fixedB else B.shape[0] * B.shape[1] * self.ncentroids metrics[amm.KEY_NMULTIPLIES] = nmuls return metrics class BoltPermMultiSplits(BoltMatmul): def _get_encoder_kwargs(self): return dict(preproc='GEHT', encode_algo='multisplits') def get_speed_metrics(self, A, B, fixedA=False, fixedB=False): metrics = super().get_speed_metrics(A, B, fixedA=fixedA, fixedB=fixedB) nmuls = 0 nmuls += 0 if fixedB else B.shape[0] * B.shape[1] * self.ncentroids metrics[amm.KEY_NMULTIPLIES] = nmuls return metrics class PQPerm(PQMatmul): def _get_encoder_kwargs(self): return dict(preproc='GEHT') def get_speed_metrics(self, A, B, fixedA=False, fixedB=False): metrics = super().get_speed_metrics(A, B, fixedA=fixedA, fixedB=fixedB) nmuls = 0 nmuls += 0 if fixedB else B.shape[0] * B.shape[1] * self.ncentroids metrics[amm.KEY_NMULTIPLIES] = nmuls return metrics class PQMultiSplits(PQMatmul): def __init__(self, ncodebooks, ncentroids=256): super().__init__(ncodebooks=ncodebooks, ncentroids=ncentroids) def _get_encoder_kwargs(self): return dict(encode_algo='multisplits') def get_params(self): return {'ncodebooks': self.ncodebooks, 'ncentroids': self.ncentroids} def get_speed_metrics(self, A, B, fixedA=False, fixedB=False): metrics = super().get_speed_metrics(A, B, fixedA=fixedA, fixedB=fixedB) nmuls = 0 nmuls += 0 if fixedB else B.shape[0] * B.shape[1] * self.ncentroids metrics[amm.KEY_NMULTIPLIES] = nmuls return metrics class PQPermMultiSplits(PQMatmul): def __init__(self, ncodebooks, ncentroids=256): super().__init__(ncodebooks=ncodebooks, ncentroids=ncentroids) def _get_encoder_kwargs(self): return dict(preproc='GEHT', encode_algo='multisplits') def get_params(self): return {'ncodebooks': self.ncodebooks, 'ncentroids': self.ncentroids} def get_speed_metrics(self, A, B, fixedA=False, fixedB=False): metrics = super().get_speed_metrics(A, B, fixedA=fixedA, fixedB=fixedB) nmuls = 0 nmuls += 0 if fixedB else B.shape[0] * B.shape[1] * self.ncentroids metrics[amm.KEY_NMULTIPLIES] = nmuls return metrics # ================================================================ Mithral class OldMithralPQ(PQMatmul): # def _get_ncentroids(self): # return 16 def __init__(self, ncodebooks): super().__init__(ncodebooks=ncodebooks, ncentroids=16) def _create_encoder(self, ncodebooks): return vq.PQEncoder(ncodebooks=ncodebooks, ncentroids=self.ncentroids, encode_algo='multisplits', quantize_lut=True, upcast_every=16, # fine as long as using mean accumulate_how='mean') def get_speed_metrics(self, A, B, fixedA=False, fixedB=False): N, D = A.shape D, M = B.shape # data encoding and LUT costs nmuls = 0 nmuls += 0 if fixedA else N * D # offset + scale before quantize nmuls += 0 if fixedB else M * self.ncentroids * D # lookups given encoded data + luts nlookups = N * M * self.ncodebooks return {amm.KEY_NMULTIPLIES: nmuls, KEY_NLOOKUPS: nlookups} class MithralMatmul(VQMatmul): def __init__(self, ncodebooks, lut_work_const=-1): self.lut_work_const = lut_work_const if (lut_work_const is not None) and (lut_work_const > 0) and ( lut_work_const > ncodebooks): raise amm.InvalidParametersException( "lut_work_const > ncodebooks: {} > {}".format( lut_work_const, ncodebooks)) super().__init__(ncodebooks=ncodebooks, ncentroids=16) # def _get_ncentroids(self): # return 16 # def fit(self, A, B, Y=None): # super().fit(self, A, B, Y=Y) def _create_encoder(self, ncodebooks): return vq.MithralEncoder( ncodebooks=ncodebooks, lut_work_const=self.lut_work_const) def get_params(self): return {'ncodebooks': self.ncodebooks, 'lut_work_const': self.lut_work_const} def get_speed_metrics(self, A, B, fixedA=False, fixedB=False): N, D = A.shape D, M = B.shape # data encoding and LUT costs nmuls = 0 nmuls += 0 if fixedA else N * D # offset + scale before quantize nmuls_per_codebook_per_output = self.ncentroids * D nmuls_per_output = nmuls_per_codebook_per_output * self.ncodebooks nmuls += 0 if fixedB else nmuls_per_output * M # lookups given encoded data + luts nlookups = N * M * self.ncodebooks return {amm.KEY_NMULTIPLIES: nmuls, KEY_NLOOKUPS: nlookups} def set_B(self, B): self.luts, self.offset, self.scale = self.enc.encode_Q(B.T) def __call__(self, A, B): if self.A_enc is None: self.set_A(A) if self.luts is None: self.set_B(B) return self.enc.dists_enc(self.A_enc, self.luts, offset=self.offset, scale=self.scale) class MithralPQ(MithralMatmul): def __init__(self, ncodebooks): super().__init__(ncodebooks=ncodebooks, lut_work_const=1)
bolt-master
experiments/python/vq_amm.py
#!/bin/env/python """utility functions for running experiments""" from __future__ import print_function, absolute_import import datetime import os import itertools import warnings import numpy as np import pandas as pd import sys import sklearn # from sklearn.model_selection import StratifiedKFold from python.files import ensure_dir_exists try: from joblib import Memory memory = Memory('.', verbose=0) cache = memory.cache except Exception: def cache(f): return f # ================================================================ Constants KEY_FINISHED_UPDATING = '__pyn_finished_updating__' KEY_NEW_KEYS = '__pyn_newkeys__' # ================================================================ Types class UsageError(Exception): pass class Options(object): """Wrapper for a collection to signify that each element is one possible parameter value""" def __init__(self, *args): if args is None or len(args) < 1: raise ValueError("No options given!") if len(args) == 1 and hasattr(args, '__len__'): self.values = args[0] # given a list else: self.values = args # given individual objects def __len__(self): return len(self.values) # deliberately don't act like a collection so that we fail fast if # code doesn't know that this is supposed to represent Options, rather # than a collection of values. This is mostly to ensure that Options # are always expanded out when generating sets of parameters. def __getitem__(self, idx): self._raise() def __setitem__(self, idx, item): self._raise() def _raise(self): raise TypeError("Options object is not a collection; use options.values" " to access the collection of individual options") # ================================================================ Funcs # ------------------------------------------------ misc utils def make_immutable(x): """ >>> make_immutable(5) == 5 True >>> make_immutable('a') == 'a' True >>> make_immutable((1, 2)) == (1, 2) True >>> make_immutable([1, 2]) == [1, 2] False >>> make_immutable([1, 2]) == (1, 2) True """ # must either be not a collections or immutable try: {}[x] = 0 # dicts require immutability return x except TypeError: # so it's mutable; either a collection or a # mutable class; if a class, we're hosed, so # assume it's a collection try: # if it's a singleton collection, try returning # first element; this will jump to except # unless x is a collection _ = len(x) # apparently a collection, so make it a tuple return tuple(x) except TypeError: return repr(x) # not a collection; stringify as last resort def as_key(x): return make_immutable(x) # ------------------------------------------------ IO / saving results def now_as_string(): return datetime.datetime.now().strftime("%Y-%m-%dT%H_%M_%S") def save_data_frame(df, save_dir='results', name="", timestamp='copy', cols_in_filename=None, col_kv_fmt="_{}={}", store_index=False, append=True, dedup_cols=None, add_timestamp_col=True, sort_by=None, **sink): if timestamp == 'copy': # save one copy with and without timestamp kwargs = dict(name=name, col_kv_fmt=col_kv_fmt, cols_in_filename=cols_in_filename, dedup_cols=dedup_cols, store_index=store_index, append=append, sort_by=sort_by, add_timestamp_col=add_timestamp_col) backups_dir = os.path.join(save_dir, 'pyience-backups') save_data_frame(df, timestamp=True, save_dir=backups_dir, **kwargs) save_data_frame(df, timestamp=False, save_dir=save_dir, **kwargs) return # construct filename name = name if name else "" if cols_in_filename: cols = list(df.columns.values) # substrs = ["{%s}" % col for col in cols] # name = name_fmt # for ss in substrs: # key = ss[1:-1] for key in cols_in_filename: if key not in cols: warnings.warn("Column '{}' not found in Dataframe." "Excluding it from filename".format(key)) continue # get value associated with this key; ignored if col not constant vals = df[key] nuniq = len(vals.unique()) if nuniq != 1: warnings.warn("Column '{}' has more than one value in Dataframe." "Excluding it from filename".format(key)) continue val = vals[0] fmt = col_kv_fmt if name == "" and not col_kv_fmt.startswith("{"): fmt = col_kv_fmt[1:] name += fmt.format(key, val) ensure_dir_exists(save_dir) raw_timestamp_str = now_as_string() timestamp_str = ("_" + raw_timestamp_str) if timestamp else "" fileName = "{}{}.csv".format(name, timestamp_str).strip("_") save_path = os.path.join(save_dir, fileName) if add_timestamp_col: df['__pyience_timestamp__'] = [raw_timestamp_str] * df.shape[0] if append and os.path.exists(save_path): existing_df = pd.read_csv(save_path) # print("existing_df_cols", existing_df.columns) # print("existing_df_cols", df.columns) # print("dedup_cols", dedup_cols) df = pd.concat([existing_df, df], axis=0, sort=False, ignore_index=True) # print("df secs: ") # print(df['secs']) dedup_cols = set(dedup_cols) & set(list(df.columns)) df.drop_duplicates(subset=dedup_cols, keep='last', inplace=True) df = df.sort_index(axis=1) if sort_by is not None: df.sort_values(sort_by, inplace=True) # also move these cols to the front for legibility, since they're # probably something you care about other_cols = [col for col in df.columns.values if col not in sort_by] df = df[sort_by + other_cols] df.to_csv(save_path, index=store_index) def save_dicts_as_data_frame(d, **kwargs): if not isinstance(d, dict): try: df = pd.DataFrame.from_records(d) except Exception: dfs = [pd.DataFrame.from_records(dd, index=[0]) for dd in d] df = pd.concat(dfs, axis=0, ignore_index=True) else: df = pd.DataFrame.from_records(d, index=[0]) save_data_frame(df, **kwargs) def generate_save_path(params, savedir, subdir_keys=None): subdir = '' # create nested subdirectories with names specified by # the values for the keys in subdir_keys if subdir_keys is not None: subdir_keys = list(subdir_keys) subdir_names = ["{}__{}".format(str(key), str(params[key])) for key in subdir_keys] subdir = os.path.join(*subdir_names) savedir = os.path.join(savedir, subdir) return savedir # ------------------------------------------------ parameter generation def expand_params(params): """dict of kv pairs -> list of dicts with one option selected for each key whose value is an instance of Options.""" # keys with values that are Options; try all combos of these options_keys = [key for key in params if isinstance(params[key], Options)] options_keys = sorted(options_keys) # sort for reproducibility options_vals = [params[key].values for key in options_keys] # keys with values that aren't Options; these are the same every time no_options_keys = [key for key in params if not isinstance(params[key], Options)] no_options_vals = [params[key] for key in no_options_keys] no_options_params = dict(zip(no_options_keys, no_options_vals)) # make a list of all possible combos of values for each key with Options expanded_params_list = [] for v in itertools.product(*options_vals): expanded_params = dict(zip(options_keys, v)) # pick one option for each expanded_params.update(no_options_params) # add in fixed params expanded_params_list.append(expanded_params) return expanded_params_list def update_func_from_dict(d): def f(params, new_keys, d=d): updated = False for k, v in d.items(): if k in new_keys: for kk, vv in v.items(): updated = updated or (kk not in params) params.setdefault(kk, vv) return updated return f def generate_params_combinations(params_list, update_func={}): """Uses update_func to update each dict based on its values (e.g., to add SVM kernel params if it contains "classifier": "SVM")""" if not isinstance(params_list, (list, set, frozenset, tuple)): params_list = [params_list] for params in params_list: params[KEY_NEW_KEYS] = set(params.keys()) if isinstance(update_func, dict): update_func = update_func_from_dict(update_func) while True: new_list = [] for params in params_list: expanded = expand_params(params) new_list += expanded if not update_func: params_list = new_list break allFinished = True for params in new_list: # if these params aren't fully updated, update them; keep # track of which keys are added along the way so we can # pass this set to the update function next time if not params.get(KEY_FINISHED_UPDATING, False): # read which keys were added last time and which keys # are currently present new_keys = params[KEY_NEW_KEYS] existing_keys = frozenset(params.keys()) params.pop(KEY_NEW_KEYS) unfinished = update_func(params, new_keys) # compute and store which keys were added this time new_keys = frozenset(params.keys()) - existing_keys params[KEY_NEW_KEYS] = new_keys if unfinished: allFinished = False params[KEY_FINISHED_UPDATING] = not unfinished params_list = new_list if allFinished: break for p in params_list: p.pop(KEY_FINISHED_UPDATING) p.pop(KEY_NEW_KEYS) return params_list # ------------------------------------------------ cross validation def stratified_split_train_test(X, Y, train_frac=.8, random_state=123): """Returns X_train, X_test, y_train, y_test""" return sklearn.model_selection.train_test_split( X, Y, train_size=train_frac, stratify=Y, random_state=random_state) def split_train_test(X, Y, train_frac=.8, random_state=123): """Returns X_train, X_test, y_train, y_test""" np.random.seed(123) return sklearn.model_selection.train_test_split( X, Y, train_size=train_frac, random_state=random_state) # n_folds = int(train_frac / (2. - train_frac)) # split = StratifiedKFold(Y, n_folds=n_folds, random_state=12345) # train_index, test_index = next(iter(split)) # X, Xtest = X[train_index], X[test_index] # Y, Ytest = Y[train_index], Y[test_index] # return X, Xtest, Y, Ytest # ------------------------------------------------ Command line def _split_kv_arg(arg): key, val = arg.split('=') return key.strip('-'), val def _is_kv_arg(arg): return len(arg.split('=')) == 2 def _clean_flag_arg(arg): return arg.strip('-') def _is_flag_arg(arg): return arg[0] == '-' def _parse_func_call_cmd(s): """ >>> _parse_func_call_cmd("range(5)") array([0, 1, 2, 3, 4]) >>> _parse_func_call_cmd("range(2, -3, -2)") array([ 2, 0, -2]) >>> _parse_func_call_cmd("linspace( -2,-20, 3)") array([ -2., -11., -20.]) >>> _parse_func_call_cmd("logspace(-1, 3, 3)") array([1.e-01, 1.e+01, 1.e+03]) """ fnames = 'randn randint range linspace logspace'.split() nargs = [(1,), (1, 2, 3), (1, 2, 3), (2, 3), (2, 3)] funcs = [np.random.randn, np.random.randint, np.arange, np.linspace, np.logspace] if not isinstance(s, str): return None for fname, argc, func in zip(fnames, nargs, funcs): if not s.startswith(fname + '('): continue if not s.endswith(')'): raise ValueError("You tried to call function '{}', but forgot the" " closing parenthesis".format(fname)) in_parens = s[len(fname) + 1:-1] maybe_args = in_parens.split(',') if len(maybe_args) not in argc: raise ValueError( "You tried to call function '{}', but passed an invalid number" " of arguments: {}. Needed to be one of: {}" .format( fname, len(maybe_args), argc)) try: nums = [int(arg) for arg in maybe_args] return func(*nums) except: # noqa raise ValueError("Command '{}' has arguments that can't be coerced" " into integers".format(s)) return None def _to_appropriate_type(s): """convert string `s` to an int, bool, float, or integer range as appropriate. Returns the original string if it does not appear to be any of these types.""" if s == 'True' or s == 'T': return True elif s == 'False' or s == 'F': return False try: return int(s) except: # noqa pass try: return float(s) except: # noqa pass if len(s.split('..')) in (2, 3): # range vals_as_strs = s.split('..') try: return np.arange(*[int(val) for val in vals_as_strs]) except: # noqa pass as_func_result = _parse_func_call_cmd(s) if as_func_result is not None: return as_func_result return s def parse_cmd_line(argv=None, positional_keys=None, allow_flags=True, infer_types=True): """Parses the list of command line arguments into a dictionary of key-value pairs Parameters ---------- argv : iterable of strings This should be sys.argv if supplied. Otherwise, sys.argv is read. positional_keys : iterable of strings, optional If k strings are specified, the up to the first k arguments will be treated as values to be paired with these keys. Arguments of the form foo=bar will never be treated this way. allow_flags : bool, optional If True, allows arguments of the form --myArg. When passed, this will add {'myArg': True} to the returned dictionary. This is equivalent to myArg=True infer_types : bool, optional If True, attempts to infer the type of each value in the returned dictionary. E.g., instead of returning {'height': '72'}, it will return {'height': 72}. Returns ------- argKV : dict: string -> inferred type or string A dictionary whose keys and values are specified by the command line arguments >>> # ------------------------ positional args only >>> argv = ['pyience.py', 'fooVal', 'barVal'] >>> d = parse_cmd_line(argv, positional_keys=['fooKey', 'barKey']) >>> len(d) 2 >>> d['fooKey'] 'fooVal' >>> d['barKey'] 'barVal' >>> # ------------------------ key-value args >>> argv = ['pyience.py', 'fooVal', 'bletchKey=bletchVal', 'blahKey=blahVal'] >>> d = parse_cmd_line(argv, positional_keys=['fooKey', 'barKey']) >>> len(d) 3 >>> d['fooKey'] 'fooVal' >>> d.get('barKey', 'notHere') 'notHere' >>> d['bletchKey'] 'bletchVal' >>> d['blahKey'] 'blahVal' >>> # ------------------------ flags >>> argv = ['pyience.py', 'fooVal', 'bletchKey=bletchVal', '--myFlag'] >>> d = parse_cmd_line(argv, positional_keys=['fooKey', 'barKey']) >>> d['myFlag'] True >>> # ------------------------ type inference >>> argv = ['pyience.py', '--myFlag', 'foo=1.1', 'bar=7', 'baz=T', 'r=1..5'] >>> d = parse_cmd_line(argv, positional_keys=['fooKey', 'barKey']) >>> len(d) 5 >>> d['myFlag'] True >>> d['foo'] 1.1 >>> d['bar'] 7 >>> d['baz'] True >>> d['r'] array([1, 2, 3, 4]) >>> # ------------------------ no positional args >>> d = parse_cmd_line(argv) >>> len(d) 5 >>> d['myFlag'] True >>> d['foo'] 1.1 """ if argv is None: argv = sys.argv args = argv[1:] # ignore file name num_positional_keys = 0 if positional_keys is not None and len(positional_keys): num_positional_keys = len(positional_keys) # validate input; keyword arguments must come after positional # arguments, and there must be no more positional arguments than # we have keys to associate with them kwargs_started = False flags_started = False for i, arg in enumerate(args): if _is_kv_arg(arg): # it's a keyword argument kwargs_started = True elif _is_flag_arg(arg): flags_started = True else: # it's not a keyword argument or flag arguemnt if kwargs_started: raise UsageError("key=value arguments must come after" "positional arguments!") if flags_started: raise UsageError("flag (e.g., --myFlag) arguments must come" "after positional arguments!") arg_num = i + 1 if arg_num > num_positional_keys: raise UsageError("only expecting " "{} positional arguments!".format( num_positional_keys)) argKV = {} for i, arg in enumerate(args): if _is_kv_arg(arg): key, val = _split_kv_arg(arg) argKV[key] = val elif _is_flag_arg(arg): key = _clean_flag_arg(arg) argKV[key] = 'True' # string so that all vals are strings elif i < num_positional_keys: key = positional_keys[i] argKV[key] = arg else: raise UsageError("couldn't parse argument '{}'".format(arg)) if infer_types: for k, v in argKV.items(): argKV[k] = _to_appropriate_type(v) return argKV # ------------------------------------------------ other stuff def apply_funcs(funcs, data): f = chain(funcs) return f(data) def chain(funcs): if funcs is None or not len(funcs): return lambda x: x def f(*args, **kwargs): res = funcs[0](*args, **kwargs) for func in funcs[1:]: res = func(res) return f def subdict(d, keys): """Returns a new dictionary composed of the (key, value) pairs from d for the keys specified in keys""" return {k: d[k] for k in keys} # ------------------------------------------------ sklearn interop def set_attrs(obj, attrs_dict, require_attrs_exist=False): if require_attrs_exist: keys_and_there = ([(k, k in obj.__dict__) for k in attrs_dict]) missing_keys = [k for (k, there) in keys_and_there if not there] there = zip(*keys_and_there)[1] if not all(there): raise ValueError("Object is missing keys {}".format( missing_keys)) obj.__dict__.update(attrs_dict) # ------------------------------------------------ cross validation def _uniq_element_positions(iterable): """ Returns a mapping of unique elements to positions at which they occur within the iterable """ objs2positions = {} for i, obj in enumerate(iterable): key = as_key(obj) positions = objs2positions.get(key, []) positions.append(i) objs2positions[key] = positions return objs2positions # def _group_start_idxs_eq_split(nelements, ngroups): # group_sz = nelements // ngroups # return np.arange(0, nelements, group_sz, dtype=np.int) def _group_start_end_idxs(nelements, ngroups=-1, fractions=None): hasFracs = fractions is not None and len(fractions) if ngroups <= 1 and not hasFracs: return np.array([0], dtype=np.int), np.array([nelements], dtype=np.int) if not hasFracs: fracs = np.ones(ngroups) fractions = np.asarray(fracs) fractions /= np.max(fracs) cum_fracs = np.cumsum(fractions) end_idxs = (nelements * cum_fracs).astype(np.int) start_idxs = np.r_[0, end_idxs[:-1]] return start_idxs, end_idxs def _split_into_groups(iterable, ngroups=-1, fractions=None, shuffle=True): if shuffle: iterable = np.copy(iterable) np.shuffle(iterable) start_idxs, end_idxs = _group_start_end_idxs(len(iterable), ngroups, fractions) return [iterable[start:end] for start, end in zip(start_idxs, end_idxs)] def cv_partition_idxs(labels, n_folds=5, fractions=None, stratified=True): if fractions is not None and len(fractions): if len(fractions) != n_folds: raise ValueError("Specified fractions of total for {} groups, but " "n_folds is {}; ignoring n_fold".format( len(fractions), n_folds)) if stratified: all_idxs = [[] for i in range(n_folds)] lbl2idxs = _uniq_element_positions(labels) for lbl, idxs in lbl2idxs.items(): if len(idxs) < n_folds: warnings.warn(("Label {} appears only {} times, which is " "less than the number of folds requested, {}" .format(lbl, len(idxs), n_folds)), Warning) idxGroups = _split_into_groups(idxs, n_folds, fractions) for i, group in enumerate(idxGroups): all_idxs[i] += group return all_idxs else: possible_idxs = np.arange(len(labels)) return _split_into_groups(possible_idxs, n_folds, fractions) def cv_split(X, y, n_folds=5, fractions=None, stratified=True): if len(X) != len(y): raise IndexError("len(X) {} != len(y) {}".format(len(X), len(y))) all_idxs = cv_partition_idxs(y, n_folds=n_folds, fractions=fractions, stratified=stratified) X_split = [X[idxs] for idxs in all_idxs] y_split = [y[idxs] for idxs in all_idxs] return X_split, y_split # ================================================================ Main def update(params, new_keys): if 'classifier' in new_keys: params['kernel'] = Options('rbf', 'linear') # we use setdefault here so that we don't overwrite values # passed in at the top level if 'kernel' in new_keys: kernel = params['kernel'] params.setdefault('C', Options(10. ** np.arange(-5, 3))) if kernel == 'rbf': params.setdefault('gamma', Options([1, 10])) return True if new_keys else False def main(): cVals = 10. ** np.arange(-3, 3) d = {"classifier": "SVM", 'C': Options(cVals)} # generate_params_combinations(d, update) combos = generate_params_combinations(d, update) # add a fake outcome variable for combo in combos: combo['runtime'] = np.random.rand() * 10 # print out a dataframe so we can see that this worked import pandas as pd print(pd.DataFrame.from_records(combos)) # woot; it worked if __name__ == '__main__': from doctest import testmod testmod() main()
bolt-master
experiments/python/pyience.py
#!/usr/bin/env python import functools import matplotlib.pyplot as plt import numpy as np import os from scipy.stats.stats import pearsonr import seaborn as sb import time from collections import namedtuple # import datasets import files import product_quantize as pq import pyience as pyn from datasets import neighbors as dsets from utils import kmeans, top_k_idxs from joblib import Memory _memory = Memory('.', verbose=0) np.set_printoptions(precision=3) SAVE_DIR = '../results' # ================================================================ Distances def dists_elemwise_sq(x, q): diffs = x - q return diffs * diffs def dists_elemwise_l1(x, q): return np.abs(x - q) def dists_elemwise_dot(x, q): return x * q # ================================================================ Clustering def load_dataset_object(which_dataset, **load_dataset_kwargs): X_train, Q, X_test, true_nn = dsets.load_dataset( which_dataset, **load_dataset_kwargs) assert Q.shape[-1] == X_train.shape[-1] if isinstance(which_dataset, str): name = files.basename(which_dataset, noext=True) else: name = which_dataset.__name__ # assumes which_dataset is a class return Dataset(Q, X_train, X_test, true_nn, name) Dataset = namedtuple('Dataset', [ 'Q', 'X_train', 'X_test', 'true_nn', 'name']) # ================================================================ Quantizers # ------------------------------------------------ Product Quantization def _learn_centroids(X, ncentroids, nsubvects, subvect_len): ret = np.empty((ncentroids, nsubvects, subvect_len)) for i in range(nsubvects): start_col = i * subvect_len end_col = start_col + subvect_len X_in = X[:, start_col:end_col] centroids, labels = kmeans(X_in, ncentroids) ret[:, i, :] = centroids return ret def _parse_codebook_params(D, code_bits=-1, bits_per_subvect=-1, nsubvects=-1): if nsubvects < 0: nsubvects = code_bits // bits_per_subvect elif code_bits < 1: code_bits = bits_per_subvect * nsubvects elif bits_per_subvect < 1: bits_per_subvect = code_bits // nsubvects ncentroids = int(2 ** bits_per_subvect) subvect_len = D // nsubvects assert code_bits % bits_per_subvect == 0 if D % subvect_len: print("D, nsubvects, subvect_len = ", D, nsubvects, subvect_len) assert D % subvect_len == 0 # TODO rm this constraint return nsubvects, ncentroids, subvect_len def _fit_pq_lut(q, centroids, elemwise_dist_func): _, nsubvects, subvect_len = centroids.shape assert len(q) == nsubvects * subvect_len q = q.reshape((1, nsubvects, subvect_len)) q_dists_ = elemwise_dist_func(centroids, q) q_dists_ = np.sum(q_dists_, axis=-1) return np.asfortranarray(q_dists_) # ncentroids, nsubvects, col-major class PQEncoder(object): def __init__(self, dataset, code_bits=-1, bits_per_subvect=-1, nsubvects=-1, elemwise_dist_func=dists_elemwise_sq): X = dataset.X_train self.elemwise_dist_func = elemwise_dist_func tmp = _parse_codebook_params(X.shape[1], code_bits=code_bits, bits_per_subvect=bits_per_subvect, nsubvects=nsubvects) self.nsubvects, self.ncentroids, self.subvect_len = tmp self.code_bits = int(np.log2(self.ncentroids)) # for fast lookups via indexing into flattened array self.offsets = np.arange(self.nsubvects, dtype=np.int) * self.ncentroids self.centroids = _learn_centroids(X, self.ncentroids, self.nsubvects, self.subvect_len) def name(self): return "PQ_{}x{}b".format(self.nsubvects, self.code_bits) def params(self): return {'_algo': 'PQ', '_ncodebooks': self.nsubvects, '_code_bits': self.code_bits} def encode_X(self, X, **sink): idxs = pq._encode_X_pq(X, codebooks=self.centroids) return idxs + self.offsets # offsets let us index into raveled dists def encode_q(self, q, **sink): return None # we use fit_query() instead, so fail fast def dists_true(self, X, q): return np.sum(self.elemwise_dist_func(X, q), axis=-1) def fit_query(self, q, **sink): self.q_dists_ = _fit_pq_lut(q, centroids=self.centroids, elemwise_dist_func=self.elemwise_dist_func) def dists_enc(self, X_enc, q_unused=None): # this line has each element of X_enc index into the flattened # version of q's distances to the centroids; we had to add # offsets to each col of X_enc above for this to work centroid_dists = self.q_dists_.T.ravel()[X_enc.ravel()] return np.sum(centroid_dists.reshape(X_enc.shape), axis=-1) def _learn_best_quantization(luts): # luts can be a bunch of vstacked luts best_loss = np.inf best_alpha = None best_floors = None best_scale_by = None for alpha in [.001, .002, .005, .01, .02, .05, .1]: alpha_pct = int(100 * alpha) # compute quantized luts this alpha would yield floors = np.percentile(luts, alpha_pct, axis=0) luts_offset = np.maximum(0, luts - floors) ceil = np.percentile(luts_offset, 100 - alpha_pct) scale_by = 255. / ceil luts_quantized = np.floor(luts_offset * scale_by).astype(np.int) luts_quantized = np.minimum(255, luts_quantized) # compute err luts_ideal = (luts - luts_offset) * scale_by diffs = luts_ideal - luts_quantized loss = np.sum(diffs * diffs) if loss <= best_loss: best_loss = loss best_alpha = alpha best_floors = floors best_scale_by = scale_by return best_floors, best_scale_by, best_alpha class OPQEncoder(PQEncoder): def __init__(self, dataset, code_bits=-1, bits_per_subvect=-1, nsubvects=-1, elemwise_dist_func=dists_elemwise_sq, opq_iters=20, quantize_lut=False, algo='OPQ', **opq_kwargs): X = dataset.X_train self.elemwise_dist_func = elemwise_dist_func self.quantize_lut = quantize_lut self.opq_iters = opq_iters self.algo = algo tmp = _parse_codebook_params(X.shape[1], code_bits=code_bits, bits_per_subvect=bits_per_subvect, nsubvects=nsubvects) self.nsubvects, self.ncentroids, self.subvect_len = tmp self.code_bits = int(np.log2(self.ncentroids)) # for fast lookups via indexing into flattened array self.offsets = np.arange(self.nsubvects, dtype=np.int) * self.ncentroids if self.algo == 'Bolt': # Note: we always pass in 0 iters in the reported experiments, # so it never rotates anything self.centroids, _, self.rotations = pq.learn_bopq( X, ncodebooks=nsubvects, codebook_bits=bits_per_subvect, niters=opq_iters, **opq_kwargs) elif self.algo == 'OPQ': self.centroids, _, self.R = pq.learn_opq( X, ncodebooks=nsubvects, codebook_bits=bits_per_subvect, niters=opq_iters, **opq_kwargs) else: raise ValueError("argument algo must be one of {OPQ, Bolt}") # learn appropriate offsets and shared scale factor for quantization self.lut_offsets = np.zeros(self.nsubvects) self.order_idxs = np.arange(self.nsubvects, dtype=np.int) if self.quantize_lut: # TODO put this logic in separate function print("learning quantization...") num_rows = min(10*1000, len(X) // 2) _, queries = dsets.extract_random_rows( X[num_rows:], how_many=1000, remove_from_X=False) X = X[:num_rows] # limit to first 10k rows of X # compute luts for all the queries luts = [self._fit_query(q, quantize=False) for q in queries] luts = np.vstack(luts) assert luts.shape == (self.ncentroids * len(queries), self.nsubvects) self.lut_offsets, self.scale_by, _ = _learn_best_quantization(luts) def name(self): return "{}_{}x{}b_iters={}_quantize={}".format( self.algo, self.nsubvects, self.code_bits, self.opq_iters, int(self.quantize_lut)) def params(self): return {'_algo': self.algo, '_ncodebooks': self.nsubvects, '_code_bits': self.code_bits, 'opq_iters': self.opq_iters, '_quantize': self.quantize_lut} def _fit_query(self, q, quantize=False): if self.algo == 'OPQ': qR = pq.opq_rotate(q, self.R).ravel() elif self.algo == 'Bolt': qR = pq.bopq_rotate(q, self.rotations).ravel() lut = _fit_pq_lut(qR, centroids=self.centroids, elemwise_dist_func=self.elemwise_dist_func) if quantize: if False: # roughly laplace distro, reaching all the way to 0 ax = sb.distplot(lut.ravel(), hist=False, rug=True) ax.set_xlabel('Query dist to centroids (lut dist histogram)') ax.set_ylabel('Fraction of queries') plt.show() lut = np.maximum(0, lut - self.lut_offsets) lut = np.floor(lut * self.scale_by).astype(np.int) return np.minimum(lut, 255) return lut def encode_X(self, X, **sink): if self.algo == 'OPQ': X = pq.opq_rotate(X, self.R) elif self.algo == 'Bolt': X = pq.bopq_rotate(X, self.rotations) idxs = pq._encode_X_pq(X, codebooks=self.centroids) return idxs + self.offsets # offsets let us index into raveled dists def fit_query(self, q, quantize=True, **sink): quantize = quantize and self.quantize_lut self.q_dists_ = self._fit_query(q, quantize=quantize) if quantize: # print "min, max lut values: {}, {}".format(np.min(self.q_dists_), # np.max(self.q_dists_)) assert np.min(self.q_dists_) >= 0 assert np.max(self.q_dists_) <= 255 if False: _, axes = plt.subplots(3, figsize=(9, 11)) sb.violinplot(data=self.q_dists_, inner="box", cut=0, ax=axes[0]) axes[0].set_xlabel('Codebook') axes[0].set_ylabel('Distance to query') axes[0].set_ylim([0, np.max(self.q_dists_)]) sb.heatmap(data=self.q_dists_, ax=axes[1], cbar=False, vmin=0) axes[1].set_xlabel('Codebook') axes[1].set_ylabel('Centroid') sb.distplot(self.q_dists_.ravel(), hist=False, rug=True, vertical=False, ax=axes[2]) axes[2].set_xlabel('Centroid dist to query') axes[2].set_ylabel('Fraction of centroids') axes[2].set_xlim([0, np.max(self.q_dists_) + .5]) # plot where the mean is mean_dist = np.mean(self.q_dists_) ylim = axes[2].get_ylim() axes[2].plot([mean_dist, mean_dist], ylim, 'r--') axes[2].set_ylim(ylim) plt.show() # ================================================================ Main def eval_encoder(dataset, encoder, dist_func_true=None, dist_func_enc=None, eval_dists=True, verbosity=1, plot=False, smaller_better=True): X = dataset.X_test queries = dataset.Q true_nn = dataset.true_nn if true_nn is not None: print("eval encoder(): got true_nn with shape: ", true_nn.shape) queries = queries[:1000] # TODO rm for tables; fine for plots print("queries.shape", queries.shape) need_true_dists = eval_dists or plot or true_nn is None if len(queries.shape) == 1: queries = [queries] if dist_func_true is None: dist_func_true = encoder.dists_true if dist_func_enc is None: dist_func_enc = encoder.dists_enc t0 = time.time() # performance metrics RECALL_Rs = [1, 5, 10, 50, 100, 500, 1000] recall_counts = np.zeros(len(RECALL_Rs)) fracs_below_max = [] if eval_dists: all_corrs = [] all_rel_errs = [] all_errs = [] total_dist = 0. if need_true_dists: X = X[:10000] # limit to 10k points because otherwise it takes forever queries = queries[:256, :] print("encoding X...") X_enc = encoder.encode_X(X) print("trying queries...") for i, q in enumerate(queries): if i % 100 == 0: print("trying query {}...".format(i)) q_enc = encoder.encode_q(q) encoder.fit_query(q) if need_true_dists: all_true_dists = dist_func_true(X, q) all_enc_dists = dist_func_enc(X_enc, q_enc) # ------------------------ begin analysis / reporting code # find true knn if need_true_dists: knn_idxs = top_k_idxs(all_true_dists, 10, smaller_better=smaller_better) else: knn_idxs = true_nn[i, :10] # compute fraction of points with enc dists as close as 10th nn knn_enc_dists = all_enc_dists[knn_idxs] if smaller_better: max_enc_dist = np.max(knn_enc_dists) num_below_max = np.sum(all_enc_dists <= max_enc_dist) else: max_enc_dist = np.min(knn_enc_dists) num_below_max = np.sum(all_enc_dists >= max_enc_dist) frac_below_max = float(num_below_max) / len(all_enc_dists) fracs_below_max.append(frac_below_max) # compute recall@R stats top_1000 = top_k_idxs(all_enc_dists, 1000, smaller_better=smaller_better) nn_idx = knn_idxs[0] for i, r in enumerate(RECALL_Rs): recall_counts[i] += nn_idx in top_1000[:r] # compute distortion in distances, quantified by corr and rel err if eval_dists: total_dist += np.sum(all_true_dists) corr, _ = pearsonr(all_enc_dists, all_true_dists) all_corrs.append(corr) rel_errs = (all_enc_dists - all_true_dists) / all_true_dists all_rel_errs.append(rel_errs) all_errs.append(all_enc_dists - all_true_dists) assert not np.any(np.isinf(all_enc_dists)) assert not np.any(np.isnan(all_enc_dists)) assert not np.any(np.isinf(all_true_dists)) assert not np.any(np.isnan(all_true_dists)) if plot and i < 3: # at most 3 plots num_nn = min(10000, len(all_true_dists) - 1) xlim = [0, np.partition(all_true_dists, num_nn)[num_nn]] ylim = [0, np.partition(all_enc_dists, num_nn)[num_nn]] grid = sb.jointplot(x=all_true_dists, y=all_enc_dists, xlim=xlim, ylim=ylim, joint_kws=dict(s=10)) # hack to bully the sb JointGrid into plotting a vert line cutoff = all_true_dists[knn_idxs[-1]] grid.x = [cutoff, cutoff] grid.y = ylim grid.plot_joint(plt.plot, color='r', linestyle='--') # also make it plot cutoff in terms of quantized dist grid.x = xlim grid.y = [max_enc_dist, max_enc_dist] grid.plot_joint(plt.plot, color='k', linestyle='--') if plot: plt.show() t = time.time() - t0 # log a lot of performance metrics / experimental params detailed_stats = [] # list of dicts stats = {} stats['X_rows'] = X.shape[0] stats['X_cols'] = X.shape[1] stats['nqueries'] = len(queries) stats['eval_time_secs'] = t stats['fracs_below_max_mean'] = np.mean(fracs_below_max) stats['fracs_below_max_std'] = np.std(fracs_below_max) stats['fracs_below_max_50th'] = np.median(fracs_below_max) stats['fracs_below_max_90th'] = np.percentile(fracs_below_max, q=90) for i, r in enumerate(RECALL_Rs): key = 'recall@{}'.format(r) val = float(recall_counts[i]) / len(queries) stats[key] = val if eval_dists: corrs = np.hstack(all_corrs) rel_errs = np.hstack(all_rel_errs) rel_errs = rel_errs[~(np.isnan(rel_errs) + np.isinf(rel_errs))] errs = np.hstack(all_errs) stats['corr_mean'] = np.mean(all_corrs) stats['corr_std'] = np.std(all_corrs) stats['mse_mean'] = np.mean(errs * errs) stats['mse_std'] = np.std(errs * errs) stats['rel_err_mean'] = np.mean(rel_errs) stats['rel_err_std'] = np.std(rel_errs) stats['rel_err_sq_mean'] = np.mean(rel_errs * rel_errs) stats['rel_err_sq_std'] = np.std(rel_errs * rel_errs) # sample some relative errs cuz all we need them for is plotting # confidence intervals np.random.shuffle(rel_errs) np.random.shuffle(errs) detailed_stats = [{'corr': all_corrs[i], 'rel_err': rel_errs[i], 'err': errs[i]} for i in range(len(corrs))] for d in detailed_stats: d.update(encoder_params(encoder)) if verbosity > 0: print("------------------------ {}".format(name_for_encoder(encoder))) keys = sorted(stats.keys()) lines = ["{}: {}".format(k, stats[k]) for k in keys if isinstance(stats[k], str)] lines += ["{}: {:.4g}".format(k, stats[k]) for k in keys if not isinstance(stats[k], str)] print("\n".join(lines)) stats.update(encoder_params(encoder)) return stats, detailed_stats # detailed_stats empty unless `eval_dists` def name_for_encoder(encoder): try: return encoder.name() except AttributeError: return str(type(encoder)) def encoder_params(encoder): try: return encoder.params() except AttributeError: return {'algo': name_for_encoder(encoder)} # @_memory.cache def _experiment_one_dataset(which_dataset, eval_dists=False, dotprods=False, save_dir=None): SAVE_DIR = save_dir if save_dir else '../results/acc/' elemwise_dist_func = dists_elemwise_dot if dotprods else dists_elemwise_sq smaller_better = not dotprods N, D = -1, -1 num_queries = -1 # no effect for "real" datasets if isinstance(which_dataset, str): print("WARNING: sampling queries from data file") num_queries = 128 # if just loading one file, need to sample queries norm_len = False # set to true for cosine similarity norm_mean = True max_ncodebooks = 64 # 32B bolt has 64 codebooks dataset_func = functools.partial(load_dataset_object, N=N, D=D, num_queries=num_queries, norm_len=norm_len, norm_mean=norm_mean, D_multiple_of=max_ncodebooks) dataset = dataset_func(which_dataset) print("=== Using Dataset: {} ({}x{})".format(dataset.name, N, D)) dicts = [] detailed_dicts = [] nbytes_list = [8, 16, 32] # max_opq_iters = 5 # TODO uncomment below max_opq_iters = 20 # ------------------------------------------------ Bolt # Note: we considered having learned rotations like OPQ but constrained # to be block diagonal; this is why you'll see mentions of rotations # in some of the Bolt code. However, it ended up not helping at all # and also slows down Bolt considerably. All the reported results are # without any rotation. # rotation_sizes = [8, 16, 32] rotation_sizes = [32] # rotation_sizes = [16] for nbytes in nbytes_list: for opq_iters in [0]: # 0 opq iters -> no rotations rot_sizes = rotation_sizes if opq_iters > 0 else [16] for rot_sz in rot_sizes: nsubvects = nbytes * 2 encoder = OPQEncoder(dataset, nsubvects=nsubvects, bits_per_subvect=4, opq_iters=opq_iters, R_sz=rot_sz, elemwise_dist_func=elemwise_dist_func, algo='Bolt', quantize_lut=True) stats, detailed_stats = eval_encoder( dataset, encoder, eval_dists=eval_dists, smaller_better=smaller_better) stats['rot_sz'] = rot_sz for d in detailed_dicts: d['rot_sz'] = rot_sz dicts.append(stats) detailed_dicts += detailed_stats # ------------------------------------------------ PQ # for codebook_bits in [4, 8]: for codebook_bits in [8]: for nbytes in nbytes_list: nsubvects = nbytes * (8 // codebook_bits) encoder = PQEncoder(dataset, nsubvects=nsubvects, bits_per_subvect=codebook_bits, elemwise_dist_func=elemwise_dist_func) stats, detailed_stats = eval_encoder( dataset, encoder, eval_dists=eval_dists, smaller_better=smaller_better) dicts.append(stats) detailed_dicts += detailed_stats # ------------------------------------------------ OPQ init = 'identity' opq_iters = max_opq_iters for codebook_bits in [8]: for nbytes in nbytes_list: nsubvects = nbytes * (8 // codebook_bits) encoder = OPQEncoder(dataset, nsubvects=nsubvects, bits_per_subvect=codebook_bits, opq_iters=opq_iters, init=init, elemwise_dist_func=elemwise_dist_func) stats, detailed_stats = eval_encoder( dataset, encoder, eval_dists=eval_dists, smaller_better=smaller_better) dicts.append(stats) detailed_dicts += detailed_stats for d in dicts: d['dataset'] = dataset.name d['norm_mean'] = norm_mean for d in detailed_dicts: d['dataset'] = dataset.name d['norm_mean'] = norm_mean savedir = os.path.join(SAVE_DIR, dataset.name) pyn.save_dicts_as_data_frame(dicts, savedir, name='summary') # also just save versions with timestamps to recover from clobbering pyn.save_dicts_as_data_frame(dicts, savedir, name='summary', timestamp=True) if eval_dists: pyn.save_dicts_as_data_frame(detailed_dicts, savedir, name='all_results') pyn.save_dicts_as_data_frame(detailed_dicts, savedir, name='all_results', timestamp=True) return dicts, detailed_dicts def experiment(eval_dists=False, dotprods=False): # which_datasets = [dsets.Mnist] which_datasets = [dsets.Mnist, dsets.Sift1M, dsets.LabelMe, dsets.Convnet1M] # which_datasets = [dsets.Glove] # which_datasets = [dsets.Deep1M, dsets.Gist] if eval_dists: save_dir = '../results/acc_dotprods/' if dotprods else '../results/acc_l2' else: save_dir = '../results/recall_at_r/' for which_dataset in which_datasets: _dicts, _details = _experiment_one_dataset( which_dataset, eval_dists=eval_dists, dotprods=dotprods, save_dir=save_dir) def main(): import doctest doctest.testmod() np.set_printoptions(precision=3) opts = pyn.parse_cmd_line() opts.setdefault('eval_l2_dists', False) opts.setdefault('eval_dotprods', False) opts.setdefault('eval_recall@R', False) if opts['eval_l2_dists']: print(">>>>>>>> evaluating l2 dists") experiment(eval_dists=True, dotprods=False) if opts['eval_dotprods']: print(">>>>>>>> evaluating dot prods") experiment(eval_dists=True, dotprods=True) if opts['eval_recall@R']: print(">>>>>>>> evaluating recall@R") experiment(eval_dists=False, dotprods=False) return if __name__ == '__main__': main()
bolt-master
experiments/python/main.py
#!/bin/env/python import copy import numpy as np from functools import reduce import numba from sklearn.decomposition import PCA from sklearn import linear_model from . import subspaces as subs from joblib import Memory _memory = Memory('.', verbose=0) # def bucket_id_to_new_bucket_ids(old_id): # i = 2 * old_id # return i, i + 1 class Bucket(object): __slots__ = 'N D id sumX sumX2 point_ids support_add_and_remove'.split() def __init__(self, D=None, N=0, sumX=None, sumX2=None, point_ids=None, bucket_id=0, support_add_and_remove=False): # self.reset(D=D, sumX=sumX, sumX2=sumX2) # assert point_ids is not None if point_ids is None: assert N == 0 point_ids = (set() if support_add_and_remove else np.array([], dtype=np.int)) self.N = len(point_ids) self.id = bucket_id # this is just so that we can store the point ids as array instead of # set, while still retaining option to run our old code that needs # them to be a set for efficient inserts and deletes self.support_add_and_remove = support_add_and_remove if support_add_and_remove: self.point_ids = set(point_ids) else: self.point_ids = np.asarray(point_ids) # figure out D if (D is None or D < 1) and (sumX is not None): D = len(sumX) elif (D is None or D < 1) and (sumX2 is not None): D = len(sumX2) assert D is not None self.D = D # figure out + sanity check stats arrays self.sumX = np.zeros(D, dtype=np.float32) if (sumX is None) else sumX self.sumX2 = np.zeros(D, dtype=np.float32) if (sumX2 is None) else sumX2 # noqa # print("D: ", D) # print("sumX type: ", type(sumX)) assert len(self.sumX) == D assert len(self.sumX2) == D self.sumX = np.asarray(self.sumX).astype(np.float32) self.sumX2 = np.asarray(self.sumX2).astype(np.float32) def add_point(self, point, point_id=None): assert self.support_add_and_remove # TODO replace with more numerically stable updates if necessary self.N += 1 self.sumX += point self.sumX2 += point * point if point_id is not None: self.point_ids.add(point_id) def remove_point(self, point, point_id=None): assert self.support_add_and_remove self.N -= 1 self.sumX -= point self.sumX2 -= point * point if point_id is not None: self.point_ids.remove(point_id) def deepcopy(self, bucket_id=None): # deep copy bucket_id = self.id if bucket_id is None else bucket_id return Bucket( sumX=np.copy(self.sumX), sumX2=np.copy(self.sumX2), point_ids=copy.deepcopy(self.point_ids), bucket_id=bucket_id) def split(self, X=None, dim=None, val=None, X_orig=None): id0 = 2 * self.id id1 = id0 + 1 if X is None or self.N < 2: # copy of this bucket + an empty bucket return (self.deepcopy(bucket_id=id0), Bucket(D=self.D, bucket_id=id1)) assert dim is not None assert val is not None assert self.point_ids is not None my_idxs = np.asarray(self.point_ids) # print("my_idxs shape, dtype", my_idxs.shape, my_idxs.dtype) X = X[my_idxs] X_orig = X if X_orig is None else X_orig[my_idxs] mask = X_orig[:, dim] < val not_mask = ~mask X0 = X[mask] X1 = X[not_mask] ids0 = my_idxs[mask] ids1 = my_idxs[not_mask] def create_bucket(points, ids, bucket_id): sumX = points.sum(axis=0) if len(ids) else None sumX2 = (points * points).sum(axis=0) if len(ids) else None # return Bucket(N=len(ids), D=self.D, point_ids=ids, return Bucket(D=self.D, point_ids=ids, sumX=sumX, sumX2=sumX2, bucket_id=bucket_id) return create_bucket(X0, ids0, id0), create_bucket(X1, ids1, id1) def optimal_split_val(self, X, dim, possible_vals=None, X_orig=None, return_possible_vals_losses=False): if self.N < 2 or self.point_ids is None: if return_possible_vals_losses: return 0, 0, np.zeros(len(possible_vals), dtype=X.dtype) return 0, 0 # my_idxs = np.array(list(self.point_ids)) my_idxs = np.asarray(self.point_ids) if X_orig is not None: X_orig = X_orig[my_idxs] return optimal_split_val( X[my_idxs], dim, possible_vals=possible_vals, X_orig=X_orig, return_possible_vals_losses=return_possible_vals_losses) def col_means(self): return self.sumX.astype(np.float64) / max(1, self.N) def col_variances(self, safe=False): if self.N < 1: return np.zeros(self.D, dtype=np.float32) E_X2 = self.sumX2 / self.N E_X = self.sumX / self.N ret = E_X2 - (E_X * E_X) return np.maximum(0, ret) if safe else ret def col_sum_sqs(self): return self.col_variances() * self.N @property def loss(self): # if self.N < 1: # return 0 # # less stable version with one less divide and mul # return max(0, np.sum(self.sumX2 - (self.sumX * (self.sumX / self.N)))) # more stable version, that also clamps variance at 0 return max(0, np.sum(self.col_sum_sqs())) # expected_X = self.sumX / self.N # expected_X2 = self.sumX2 / self.N # return max(0, np.sum(expected_X2 - (expected_X * expected_X)) * self.N) # @numba.jit(nopython=True) # numpy cumsum in insanely slow # def _cumsum_cols(X): # X = np.copy(X) # for i in range(1, X.shape[0]): # X[i] += X[i - 1] # return X # numpy cumsum in insanely slow; also, having the nested loops is twice # as fast as assigning rows (ie, X[i] += X[i-1]) @numba.njit(fastmath=True) def _cumsum_cols(X): out = np.empty(X.shape, X.dtype) for j in range(X.shape[1]): out[0, j] = X[0, j] for i in range(1, X.shape[0]): for j in range(X.shape[1]): out[i, j] = X[i, j] + out[i - 1, j] return out @numba.njit(fastmath=True, cache=True) # njit = no python, cache binary def _cumsse_cols(X): N, D = X.shape cumsses = np.empty((N, D), X.dtype) cumX_row = np.empty(D, X.dtype) cumX2_row = np.empty(D, X.dtype) for j in range(D): cumX_row[j] = X[0, j] cumX2_row[j] = X[0, j] * X[0, j] cumsses[0, j] = 0 # no err in bucket with 1 element for i in range(1, N): one_over_count = 1. / (i + 1) for j in range(D): cumX_row[j] += X[i, j] cumX2_row[j] += X[i, j] * X[i, j] meanX = cumX_row[j] * one_over_count cumsses[i, j] = cumX2_row[j] - (cumX_row[j] * meanX) return cumsses # def optimal_split_val(X, dim, possible_vals=None, return_val_idx=False): # @_memory.cache def optimal_split_val(X, dim, possible_vals=None, X_orig=None, # return_possible_vals_losses=False, force_val='median'): return_possible_vals_losses=False, force_val=None, # shrink_towards_median=True): shrink_towards_median=False): X_orig = X if X_orig is None else X_orig # X_orig = X # TODO rm if X_orig.shape != X.shape: print("X orig shape: ", X_orig.shape) print("X shape: ", X.shape) assert X_orig.shape == X.shape if force_val in ('mean', 'median'): assert not return_possible_vals_losses x = X_orig[:, dim] val = np.median(x) if force_val == 'median' else np.mean(x) mask = X_orig < val X0 = X[mask] errs0 = X0 - X0.mean(axis=0) loss0 = np.sum(errs0 * errs0) X1 = X[~mask] errs = X1 - X1.mean(axis=0) loss1 = np.sum(errs * errs) return val, loss0 + loss1 N, D = X.shape # sort_idxs = np.argsort(X[:, dim]) sort_idxs = np.argsort(X_orig[:, dim]) X_sort = X[sort_idxs] # use_jit = False use_jit = True if use_jit: # X_sort = X_sort[:100] # TODO rm # X_sort = np.ascontiguousarray(X_sort) # N, D = X_sort.shape # print("about to call jitted func; N, D = ", N, D) sses_head = _cumsse_cols(X_sort) # print("got thru first call...") # X_sort_rev = np.ascontiguousarray(X_sort[::-1]) # sses_tail = _cumsse_cols(X_sort_rev)[::-1] sses_tail = _cumsse_cols(X_sort[::-1])[::-1] # print("returned from jitted func!") else: X_sort_sq = X_sort * X_sort # cumX_head = np.cumsum(X_sort, axis=0) # cumX2_head = np.cumsum(X_sort_sq, axis=0) # cumX_tail = np.cumsum(X_sort[::-1], axis=0)[::-1] # cumX2_tail = np.cumsum(X_sort_sq[::-1], axis=0)[::-1] cumX_head = _cumsum_cols(X_sort) cumX2_head = _cumsum_cols(X_sort_sq) cumX_tail = _cumsum_cols(X_sort[::-1])[::-1] cumX2_tail = _cumsum_cols(X_sort_sq[::-1])[::-1] all_counts = np.arange(1, N + 1).reshape(-1, 1) EX_head = cumX_head / all_counts # E[X], starting from 0 EX_tail = cumX_tail / all_counts[::-1] # E[X], starting from N-1 # EX2_head = cumX2_head / all_counts # E[X^2], starting from 0 # EX2_tail = cumX2_tail / all_counts[::-1] # E[X^2], starting from N-1 # mses_head = EX2_head - (EX_head * EX_head) # mses from 0 # mses_tail = EX2_tail - (EX_tail * EX_tail) # mses from N-1 # sses_head = mses_head * all_counts # # sses_tail = mses_tail * all_counts[::-1] # simpler equivalent of above; mse * N reduces to this sses_head = cumX2_head - (cumX_head * EX_head) sses_tail = cumX2_tail - (cumX_tail * EX_tail) # # TODO rm # mse_head_diffs = sses_head[1:] - sses_head[:-1] # # print("mse_head_diffs[:20]", mse_head_diffs[:20]) # assert np.all(mse_head_diffs > -.1) # should be nondecreasing # mse_tail_diffs = sses_tail[1:] - sses_tail[:-1] # assert np.all(mse_tail_diffs < .1) # should be nonincreasing sses = sses_head sses[:-1] += sses_tail[1:] # sse of X_sort[:i] + sse of X_sort[i:] sses = sses.sum(axis=1) if shrink_towards_median: minsse, maxsse = np.min(sses), np.max(sses) scale = maxsse - minsse # n_over_2 = N // 2 # scale = (maxsse - minsse) / n_over_2 coeffs = np.abs(np.arange(N, dtype=np.float32)) penalties = coeffs * (scale / np.max(coeffs)) sses += penalties # # TODO rm # E_X = X.mean(axis=0) # E_X2 = (X * X).mean(axis=0) # sse_true = np.sum(E_X2 - (E_X * E_X)) * N # print("sses[0], sses[-1], true loss, np.sum(X.var(axis=0)) * N", # sses[0], sses[-1], sse_true, np.sum(X.var(axis=0)) * N) # X_orig_sort = X_orig[sort_idxs] if possible_vals is None or not len(possible_vals): # can split anywhere best_idx = np.argmin(sses) next_idx = min(N - 1, best_idx + 1) # best_val = (X_sort[best_idx, dim] + X_sort[next_idx, dim]) / 2. # X_orig_sort = X_orig[sort_idxs] col = X_orig[:, dim] best_val = (col[sort_idxs[best_idx]] + col[sort_idxs[next_idx]]) / 2 # best_val = (X_orig_sort[best_idx, dim] + X_orig_sort[next_idx, dim]) / 2 else: # have to choose one of the values in possible_vals sorted_col = X_orig[:, dim][sort_idxs] idxs = np.searchsorted(sorted_col, possible_vals) # idxs = np.unique(idxs) idxs = np.maximum(0, idxs - 1) # searchsorted returns first idx larger sses_for_idxs = sses[idxs] which_idx_idx = np.argmin(sses_for_idxs) best_idx = idxs[which_idx_idx] best_val = possible_vals[which_idx_idx] # print("return_possible_vals_losses: ", return_possible_vals_losses) ret = best_val, sses[best_idx] return ret + (sses_for_idxs,) if return_possible_vals_losses else ret def evenly_spaced_quantiles(x, nquantiles, dedup=True): x = np.unique(x) # handle x with fewer unique elements than nquantiles (or same number, or # not that many more; basically just want each returned value to be uniq # and useful for binning the distribution) if len(x) == nquantiles: return x elif len(x) == 1: return np.linspace(-1, 3, num=nquantiles) * x[0] elif len(x) < 2 * nquantiles: return np.linspace(np.min(x), np.max(x), num=nquantiles) n = nquantiles + 1 fracs = np.arange(1, n) / float(n) return np.array([np.quantile(x, frac) for frac in fracs]) class PointInfo(object): __slots__ = 'data bucket_id'.split() def __init__(self, data, bucket_id): self.data = data self.bucket_id = bucket_id class Split(object): __slots__ = 'dim val loss_change'.split() def __init__(self, dim, val, loss_change=None): self.dim = dim self.val = val self.loss_change = loss_change def _sort_and_append_orig_idx(x, ascending=True): sort_idxs = np.argsort(x) if not ascending: sort_idxs = sort_idxs[::-1] x_sort = x[sort_idxs] orig_idxs = np.arange(len(x))[sort_idxs] return list(zip(x_sort, orig_idxs)) def _split_existing_buckets(buckets): return [buck.split() for buck in buckets] # new_buckets = [] # # D = len(buckets[0].sumX) # for buck in buckets: # # buck0 = copy.deepcopy(bucket) # # buck0 = Bucket(N=buck.N, D=D, point_ids=copy.deepcopy(buck.point_ids), # # sumX=np.copy(buck.sumX), sumX2=np.copy(buck.sumX2)) # # buck0 = buck.copy() # # buck1 = Bucket(D=buckets[0].D) # new_buckets.append((buck0, buck1)) # return new_buckets class MultiSplit(object): __slots__ = 'dim vals scaleby offset'.split() def __init__(self, dim, vals, scaleby=None, offset=None): self.dim = dim self.vals = np.asarray(vals) self.scaleby = scaleby self.offset = offset def preprocess_x(self, x): if self.offset is not None: x = x - self.offset if self.scaleby is not None: x = x * self.scaleby return x def learn_multisplits_orig(X, nsplits, log2_max_vals_per_split=4, try_nquantiles=16, return_centroids=True, # learn_quantize_params=False, learn_quantize_params='int16', # learn_quantize_params=True, # verbose=1): verbose=2): # verbose=3): X = X.astype(np.float32) N, D = X.shape max_vals_per_split = 1 << log2_max_vals_per_split X_hat = np.zeros_like(X) # initially, one big bucket with everything buckets = [Bucket(sumX=X.sum(axis=0), sumX2=(X * X).sum(axis=0), point_ids=np.arange(N))] total_loss = sum([bucket.loss for bucket in buckets]) # values to try in each dim, after buckets no longer get to pick optimal # ones; we try values that at evenly spaced quantiles possible_split_vals = np.empty((D, try_nquantiles), dtype=X.dtype) for dim in range(D): # possible_split_vals[dim] = evenly_spaced_quantiles( # X[:, dim], try_nquantiles) # exclude enpoints, so we get appropriate number of points linearly # spaced *between* min and max values minval, maxval = np.min(X[:, dim]), np.max(X[:, dim]) possible_split_vals[dim] = np.linspace( minval, maxval, num=(try_nquantiles + 2))[1:-1] # print("initial possible split vals: ") # print(possible_split_vals[:8]) # print(possible_split_vals[8:16]) # import sys; sys.exit() if verbose > 0: print("================================") print("learn_multisplits(): initial loss: ", total_loss) splits = [] col_losses = np.zeros(D, dtype=np.float32) # TODO rm? for s in range(nsplits): # if s >= 2: # print("exiting after two splits") # import sys; sys.exit() if verbose > 1: print("------------------------ finding split #:", s) for i, buck in enumerate(buckets): # TODO rm sanity check assert buck.id == i nbuckets = len(buckets) # compute number of bucket groups and size of each ngroups = min(nbuckets, max_vals_per_split) nbuckets_per_group = nbuckets // ngroups assert nbuckets_per_group * ngroups == nbuckets # sanity check # try_ndims = 8 # try_ndims = 4 try_ndims = 1 # dim_heuristic = 'eigenvec' # dim_heuristic = 'bucket_eigenvecs' dim_heuristic = 'variance' if dim_heuristic == 'eigenvec': # compute current reconstruction of X, along with errs for buck in buckets: # print("point ids: ", buck.point_ids) if len(buck.point_ids): centroid = buck.col_means() # X_hat[np.array(buck.point_ids)] = centroid X_hat[buck.point_ids] = centroid X_res = X - X_hat # pick dims by looking at top principal component v = subs.top_principal_component(X_res) try_dims = np.argsort(np.abs(v))[-try_ndims:] elif dim_heuristic == 'bucket_eigenvecs': dim_scores = np.zeros(D, dtype=np.float32) for buck in buckets: if buck.N < 2: continue X_buck = X[buck.point_ids] v, lamda = subs.top_principal_component( X_buck, return_eigenval=True) v *= lamda dim_scores += np.abs(v) # X_buck -= X_buck.mean(axis=0) try_dims = np.argsort(dim_scores)[-try_ndims:] elif dim_heuristic == 'variance': # pick out dims to consider splitting on # try_dims = np.arange(D) # TODO restrict to subset? col_losses[:] = 0 for buck in buckets: col_losses += buck.col_sum_sqs() # try_dims = np.argsort(col_losses)[-8:] try_dims = np.argsort(col_losses)[-try_ndims:] # try_dims = np.argsort(col_losses)[-2:] # try_dims = np.arange(2) # try_dims = np.arange(D) # TODO restrict to subset? losses = np.zeros(len(try_dims), dtype=X.dtype) losses_for_vals = np.zeros(try_nquantiles, dtype=X.dtype) all_split_vals = [] # vals chosen by each bucket/group for each dim # determine for this dim what the best split vals are for each # group and what the loss is when using these split vals for d, dim in enumerate(try_dims): if verbose > 2: # print("---------------------- dim = ", dim) print("======== dim = {}, ({:.5f}, {:.5f})".format( dim, np.min(X[:, dim]), np.max(X[:, dim]))) # just let each bucket pick its optimal split val for this dim; # special case of below where each "group" is one bucket, and # instead of having to pick val from fixed set, can be anything if nbuckets_per_group == 1: split_vals = [] # each bucket contributes one split val for buck in buckets: val, loss = buck.optimal_split_val(X, dim) losses[d] += loss split_vals.append(val) all_split_vals.append(split_vals) # buckets have to pick from fixed set of possible values; each # group of buckets (defined by common prefix) have to agree on # one val, so we sum loss for each possible value across all # buckets in the group, and then take val with lowest sum else: split_vals = [] # each group contributes one split val for g in range(ngroups): # print("------------------------ group #", g) start_idx = g * nbuckets_per_group end_idx = start_idx + nbuckets_per_group group_buckets = buckets[start_idx:end_idx] # print("bucket ids, counts: ", # [buck.id for buck in group_buckets], # [buck.N for buck in group_buckets]) # compute loss for each possible split value, summed # across all buckets in this group; then choose best possible_vals = possible_split_vals[dim] # print("possible split vals: ", possible_vals) losses_for_vals[:] = 0 # losses_for_vals = np.zeros_like(losses_for_vals) # print("losses for vals: ", losses_for_vals) for b, buck in enumerate(group_buckets): _, _, val_losses = buck.optimal_split_val( X, dim, possible_vals=possible_vals, return_possible_vals_losses=True) losses_for_vals += val_losses best_val_idx = np.argmin(losses_for_vals) best_val = possible_vals[best_val_idx] best_loss = losses_for_vals[best_val_idx] losses[d] += best_loss # print("best {val idx, val, loss} = ", # best_val_idx, best_val, best_loss) split_vals.append(best_val) all_split_vals.append(split_vals) # determine best dim to split on, and pull out associated split # vals for all buckets best_tried_dim_idx = np.argmin(losses) best_dim = try_dims[best_tried_dim_idx] use_split_vals = all_split_vals[best_tried_dim_idx] split = MultiSplit(dim=best_dim, vals=use_split_vals) if learn_quantize_params: # if len(use_split_vals) > 1: # after 1st split # minsplitval = np.min(use_split_vals) # maxsplitval = np.max(use_split_vals) # gap = maxsplitval - minsplitval # offset = minsplitval - .02 * gap # scale = 250. / gap # slightly below 255. / gap # else: # 1st split; only one bucket, so no intersplit range # assert np.min(use_split_vals) == np.max(use_split_vals) # x = X[:, best_dim] # offset = np.min(x) # scale = 255. / np.max(x - offset) # # x -= offset # # scale = 128. / np.max(split.vals - offset) # # scale = 1 # TODO rm # # x = X[:, best_dim].copy() # x = X[:, best_dim] # offset = np.min(x) # # scale = 255. / np.max(x - offset) # scale = 250. / np.max(use_split_vals) # slightly below 255 # simple version, which also handles 1 bucket: just set min # value to be avg of min splitval and xval, and max value to # be avg of max splitval and xval x = X[:, best_dim] offset = (np.min(x) + np.min(use_split_vals)) / 2 upper_val = (np.max(x) + np.max(use_split_vals)) / 2 - offset scale = 254. / upper_val if learn_quantize_params == 'int16': scale = 2. ** int(np.log2(scale)) split.offset = offset split.scaleby = scale split.vals = (split.vals - split.offset) * split.scaleby split.vals = np.clip(split.vals, 0, 255).astype(np.int32) splits.append(split) # apply this split to get next round of buckets new_buckets = [] for i, buck in enumerate(buckets): group_idx = i // nbuckets_per_group val = use_split_vals[group_idx] new_buckets += list(buck.split(X, dim=best_dim, val=val)) buckets = new_buckets if verbose > 1: print("bucket counts: ", [buck.N for buck in buckets]) print("loss from buckets: ", sum([bucket.loss for bucket in buckets])) print("dim losses: ", losses) if verbose > 2: print("loss from sse computation: ", losses[best_tried_dim_idx]) print("using dim, split_vals:", best_dim, use_split_vals) # maybe return centroids in addition to set of MultiSplits and loss loss = sum([bucket.loss for bucket in buckets]) if verbose > 0: print("learn_multisplits(): returning loss: ", loss) if return_centroids: centroids = np.vstack([buck.col_means() for buck in buckets]) assert centroids.shape == (len(buckets), X.shape[1]) return splits, loss, centroids return splits, loss @_memory.cache def learn_multisplits( X, nsplits=4, return_centroids=True, return_buckets=False, # learn_quantize_params=False, # learn_quantize_params='int16', X_orig=None, try_ndims=1, # learn_quantize_params='int16', X_orig=None, try_ndims=2, learn_quantize_params='int16', X_orig=None, try_ndims=4, # learn_quantize_params='int16', X_orig=None, try_ndims=8, # learn_quantize_params='int16', X_orig=None, try_ndims=16, # learn_quantize_params=True, # verbose=3): # verbose=2): verbose=1): assert nsplits <= 4 # >4 splits means >16 split_vals for this func's impl X = X.astype(np.float32) N, D = X.shape X_orig = X if X_orig is None else X_orig X_hat = np.zeros_like(X) # initially, one big bucket with everything buckets = [Bucket(sumX=X.sum(axis=0), sumX2=(X * X).sum(axis=0), point_ids=np.arange(N))] total_loss = sum([bucket.loss for bucket in buckets]) if verbose > 0: print("================================") # print("learn_multisplits(): initial loss: ", total_loss) print("learn_multisplits(): initial loss: ", total_loss) # print("learn_multisplits(): trying ndims: ", min(D, try_ndims)) splits = [] col_losses = np.zeros(D, dtype=np.float32) # TODO rm? for s in range(nsplits): if verbose > 1: print("------------------------ finding split #:", s) # dim_heuristic = 'eigenvec' # dim_heuristic = 'bucket_eigenvecs' dim_heuristic = 'bucket_sse' # dim_heuristic = 'kurtosis' if dim_heuristic == 'eigenvec': # compute current reconstruction of X, along with errs if s > 0: for buck in buckets: # print("point ids: ", buck.point_ids) if len(buck.point_ids): centroid = buck.col_means() # X_hat[np.array(buck.point_ids)] = centroid X_hat[buck.point_ids] = centroid X_res = X - X_hat else: X_res = X # pick dims by looking at top principal component v = subs.top_principal_component(X_res) try_dims = np.argsort(np.abs(v))[-try_ndims:] elif dim_heuristic == 'bucket_eigenvecs': dim_scores = np.zeros(D, dtype=np.float32) for buck in buckets: if buck.N < 2: continue X_buck = X[buck.point_ids] v, lamda = subs.top_principal_component( X_buck, return_eigenval=True) v *= lamda dim_scores += np.abs(v) # X_buck -= X_buck.mean(axis=0) try_dims = np.argsort(dim_scores)[-try_ndims:] elif dim_heuristic == 'bucket_sse': col_losses[:] = 0 for buck in buckets: col_losses += buck.col_sum_sqs() try_dims = np.argsort(col_losses)[-try_ndims:] elif dim_heuristic == 'kurtosis': # compute X_res if s > 0: for buck in buckets: # print("point ids: ", buck.point_ids) if len(buck.point_ids): centroid = buck.col_means() # X_hat[np.array(buck.point_ids)] = centroid X_hat[buck.point_ids] = centroid X_res = X - X_hat else: X_res = X col_losses[:] = 0 for buck in buckets: col_losses += buck.col_sum_sqs() try_dims = np.argsort(col_losses)[-try_ndims:] from scipy import stats col_losses *= col_losses # just 4th central moment col_losses *= stats.kurtosis(X_res, axis=0) try_dims = np.argsort(col_losses)[-try_ndims:] losses = np.zeros(len(try_dims), dtype=X.dtype) all_split_vals = [] # vals chosen by each bucket/group for each dim # determine for this dim what the best split vals are for each # group and what the loss is when using these split vals # print("try_dims: ", try_dims) for d, dim in enumerate(try_dims): # print("s, d, dim = ", s, d, dim) if verbose > 2: # print("---------------------- dim = ", dim) print("======== dim = {}, ({:.5f}, {:.5f})".format( dim, np.min(X[:, dim]), np.max(X[:, dim]))) split_vals = [] # each bucket contributes one split val for b, buck in enumerate(buckets): val, loss = buck.optimal_split_val(X, dim, X_orig=X_orig) losses[d] += loss if d > 0 and losses[d] >= np.min(losses[:d]): if verbose > 2: print("early abandoning after bucket {}!".format(b)) break # this dim already can't be the best split_vals.append(val) all_split_vals.append(split_vals) # determine best dim to split on, and pull out associated split # vals for all buckets best_tried_dim_idx = np.argmin(losses) best_dim = try_dims[best_tried_dim_idx] use_split_vals = all_split_vals[best_tried_dim_idx] split = MultiSplit(dim=best_dim, vals=use_split_vals) if learn_quantize_params: # simple version, which also handles 1 bucket: just set min # value to be avg of min splitval and xval, and max value to # be avg of max splitval and xval x = X[:, best_dim] offset = (np.min(x) + np.min(use_split_vals)) / 2 upper_val = (np.max(x) + np.max(use_split_vals)) / 2 - offset scale = 254. / upper_val if learn_quantize_params == 'int16': scale = 2. ** int(np.log2(scale)) split.offset = offset split.scaleby = scale split.vals = (split.vals - split.offset) * split.scaleby split.vals = np.clip(split.vals, 0, 255).astype(np.int32) splits.append(split) # apply this split to get next round of buckets new_buckets = [] for i, buck in enumerate(buckets): group_idx = i val = use_split_vals[group_idx] new_buckets += list(buck.split(X, dim=best_dim, val=val, X_orig=X_orig)) buckets = new_buckets if verbose > 1: print("bucket counts: ", [buck.N for buck in buckets]) # print("loss from buckets: ", # sum([bucket.loss for bucket in buckets])) print("dim losses: ", losses) if verbose > 2: print("loss from sse computation: ", losses[best_tried_dim_idx]) print("using dim, split_vals:", best_dim, use_split_vals) # maybe return centroids in addition to set of MultiSplits and loss loss = sum([bucket.loss for bucket in buckets]) if verbose > 0: print("learn_multisplits(): returning loss: ", loss) ret = [splits, loss] if return_centroids: centroids = np.vstack([buck.col_means() for buck in buckets]) assert centroids.shape == (len(buckets), X.shape[1]) ret.append(centroids) # return splits, loss, centroids if return_buckets: # print("returning buckets!") ret.append(buckets) return tuple(ret) @numba.njit(fastmath=True, cache=True) def _XtX_encoded(X_enc, K=16): N, C = X_enc.shape D = C * K # note that this is total number of centroids, not orig D out = np.zeros((D, D), np.int32) # out = np.zeros((D, D), np.float32) # D = int(C * K) # note that this is total number of centroids, not orig D # out = np.zeros((D, D), np.int8) for n in range(N): for c in range(C): code_left = X_enc[n, c] dim_left = (K * c) + code_left out[dim_left, dim_left] += 1 for cc in range(c + 1, C): code_right = X_enc[n, cc] dim_right = (K * cc) + code_right out[dim_left, dim_right] += 1 # populate lower triangle for d in range(D): for dd in range(d + 1, D): out[dd, d] = out[d, dd] return out @numba.njit(fastmath=True, cache=True) def _XtY_encoded(X_enc, Y, K=16): N, C = X_enc.shape N, M = Y.shape D = int(C * K) # note that this is total number of centroids, not orig D out = np.zeros((D, M), Y.dtype) for n in range(N): for c in range(C): code_left = X_enc[n, c] dim_left = (K * c) + code_left for m in range(M): out[dim_left, m] += Y[n, m] return out @numba.njit(fastmath=True, cache=True) def _XW_encoded(X_enc, W, K=16): N, C = X_enc.shape D, M = W.shape out = np.zeros((N, M), W.dtype) for n in range(N): for c in range(C): code_left = X_enc[n, c] dim_left = (K * c) + code_left for m in range(M): out[n, m] += W[dim_left, m] return out @numba.njit(fastmath=True, cache=True) def _densify_X_enc(X_enc, K=16): N, C = X_enc.shape D = C * K out = np.zeros((N, D), np.int8) for n in range(N): for c in range(C): code_left = X_enc[n, c] dim_left = (K * c) + code_left out[n, dim_left] = 1 return out def _fit_ridge_enc(X_enc=None, Y=None, K=16, lamda=1, X_bin=None): if X_bin is None: X_bin = _densify_X_enc(X_enc, K=K) est = linear_model.Ridge(fit_intercept=False, alpha=lamda) est.fit(X_bin, Y) return est.coef_.T def encoded_lstsq(X_enc=None, X_bin=None, Y=None, K=16, XtX=None, XtY=None, precondition=True, stable_ridge=True): if stable_ridge: return _fit_ridge_enc(X_enc=X_enc, Y=Y, X_bin=X_bin, K=K, lamda=1) if XtX is None: XtX = _XtX_encoded(X_enc, K=K).astype(np.float32) lamda = 1 # TODO cross-validate to get lamda # N = X_enc.shape[0] # # lamda = N / (K * K) # Y_bar = Y - Y.mean(axis=0) # lamda = N * np.var(Y - Y.mean(axis=0)) / (K * K) # # lamda = N * np.var(Y - Y.mean(axis=0)) / K # lamda = N * np.var(Y) / K # lamda = N * np.var(Y) / (K * K) # # lamda = N * 1e4 # should shrink coeffs to almost 0 # # alpha = unscaled_alpha * np.var(X - X.mean(axis=0)) * N / D # lamda = N / (1e5) # sorta works # lamda = N / (1e4) # sorta works lamda = max(1, lamda) print("using lamda = ", lamda) # lamda = max(1, len(X_enc) / 1e6) # lamda = max(1, len(X_enc) / 1e5) # lamda = max(1, len(X_enc) / 1e4) # lamda = max(1, len(X_enc) / float(K * K)) # lamda = len(X_enc) / float(K) # print("computing and regularizing XtX using lambda = ", lamda) XtX += np.diag(np.ones(XtX.shape[0]) * lamda).astype(np.float32) # ridge if XtY is None: XtY = _XtY_encoded(X_enc, Y, K=K) XtX = XtX.astype(np.float64) XtY = XtY.astype(np.float64) # preconditioning to avoid numerical issues (seemingly unnecessary, but # might as well do it) # scale = 1. / np.std(XtX) if precondition: # # pretend cols of X were scaled differently # xscales = np.linalg.norm(XtX, axis=0) + 1e-20 # mulby = (1. / xscales) # XtX *= mulby * mulby # XtY *= mulby.reshape(-1, 1) # yscales = np.linalg.norm(XtY, axis=1) + 1e-20 # yscales = np.linalg.norm(XtY, axis=0) + 1e-20 # yscales = yscales.reshape(-1, 1) # xscales = np.mean(np.linalg.norm(XtX, axis=0)) # xscales = 7 # xscales = 1 # XtY *= (1. / yscales) # XtY *= (1. / yscales.reshape(-1, 1)) # scale = 1. / len(X_enc) scale = 1. / np.linalg.norm(XtX, axis=0).max() XtX = XtX * scale XtY = XtY * scale # W = np.linalg.solve(XtX, XtY) W, _, _, _ = np.linalg.lstsq(XtX, XtY, rcond=None) # doesn't fix it # W, _, _, _ = np.linalg.lstsq(X_bin, Y, rcond=None) # import torch # import torch.nn.functional as F # import torch.optim as optim # def _to_np(A): # return A.cpu().detach().numpy() # niters = 10 # for it in range(niters): # if precondition: # pass # # W *= xscales # # W *= xscales.reshape(-1, 1) # # W /= xscales.reshape(-1, 1) # # W *= yscales.ravel() # # W *= yscales # W *= yscales # undo preconditioning # import matplotlib.pyplot as plt # _, axes = plt.subplots(2, 2, figsize=(13, 10)) # axes[0, 0].imshow(_densify_X_enc(X_enc[:1000]), interpolation='nearest') # axes[0, 1].imshow(XtX, interpolation='nearest') # axes[1, 0].imshow(XtY, interpolation='nearest', cmap='RdBu') # axes[1, 1].imshow(W, interpolation='nearest', cmap='RdBu') # # plt.colorbar() # plt.tight_layout() # plt.show() # import sys; sys.exit() return W def _sparse_encoded_lstsq_gomp(X_enc, Y, nnz_blocks, K=16): assert nnz_blocks >= 1 ncodebooks = X_enc.shape[1] M = Y.shape[1] # precompute XtX and XtY and create initial dense W XtX = _XtX_encoded(X_enc, K=K).astype(np.float32) XtX += np.diag(np.ones(XtX.shape[0])).astype(np.float32) # ridge XtY = _XtY_encoded(X_enc, Y, K=K) W = encoded_lstsq(X_enc, Y, XtX=XtX, XtY=XtY) XtX = np.asfarray(XtX) # since we'll be slicing columns keep_codebook_idxs = np.empty((M, nnz_blocks), dtype=np.int) XtX_G = np.empty((ncodebooks, K * ncodebooks, K), dtype=np.float32) for c in range(ncodebooks): start_idx = c * K end_idx = start_idx + K # use_XtX = XtX[start_idx:end_idx][:, start_idx:end_idx] use_XtX = XtX[:, start_idx:end_idx] XtX_G[c], _ = np.linalg.qr(use_XtX) # KC x K codebook_scores = np.zeros(ncodebooks) for m in range(M): # fully solve one output col at a time # xty = np.ascontiguousarray(XtY[:, m]) targets = np.copy(XtY[:, m]) residuals = targets keep_codebooks = set() w = np.copy(W[:, m]) pq_codebook_idx = int(m / float(M) * ncodebooks) # print("---- m = ", m) for b in range(nnz_blocks): # targets_normed = targets # score each codebook to pick new one to add if b > 0: for c in range(ncodebooks): if c in keep_codebooks: codebook_scores[c] = -np.inf continue X_G = XtX_G[c] codebook_scores[c] = np.linalg.norm(X_G.T @ residuals) keep_codebooks.add(np.argmax(codebook_scores)) else: keep_codebooks.add(pq_codebook_idx) # seed with pq idx # refit model using all the groups selected so far keep_idxs = [np.arange(i * K, (i + 1) * K) for i in sorted(list(keep_codebooks))] keep_idxs = np.hstack(keep_idxs) XtX_subs = XtX[keep_idxs][:, keep_idxs] targets_subs = targets[keep_idxs] w_subs = np.linalg.solve(XtX_subs, targets_subs) # XtX_subs = XtX[:, keep_idxs] # targets_subs = targets[keep_idxs] # w_subs = np.linalg.solve(XtX_subs, targets) # w_subs, resid, _, _ = np.linalg.lstsq(XtX_subs, targets) w[:] = 0 w[keep_idxs] = w_subs # resid_norm_sq = np.linalg.norm(residuals)**2 # print("resid norm sq: ", resid_norm_sq) # print("lstsq mse: ", resid / resid_norm_sq) # residuals = targets - (XtX_subs @ w_subs) residuals = targets - (XtX[:, keep_idxs] @ w_subs) # resid_norm_sq = np.linalg.norm(residuals)**2 # print("new resid norm sq: ", resid_norm_sq) # targets = np.copy(XtY[:, m]) - (XtX @ w) # update return arrays keep_codebook_idxs[m] = np.array(list(keep_codebooks)) W[:, m] = w return W, keep_codebook_idxs # each codebook has const number of nonzero idxs def _sparse_encoded_lstsq_elim_v2(X_enc, Y, nnz_per_centroid, K=16, # uniform_sparsity=False): # never better uniform_sparsity=True, pq_perm_algo='start', stable_ridge=True): ncodebooks = X_enc.shape[1] M = Y.shape[1] nnz_per_centroid = min(M, int(nnz_per_centroid)) nnz_per_centroid = max(1, nnz_per_centroid) assert nnz_per_centroid >= int(np.ceil(M / ncodebooks)) assert nnz_per_centroid <= M X_bin = _densify_X_enc(X_enc, K=K) if not stable_ridge: # precompute XtX and XtY and create initial dense W XtX = _XtX_encoded(X_enc, K=K).astype(np.float32) lamda = 1 # # alpha = unscaled_alpha * np.var(X - X.mean(axis=0)) * N / D # # lamda = np.sqrt(ncodebooks) # N = XtX.shape[0] # lamda = N / (K * K) # lamda = max(1, lamda) # print("using lamda = ", lamda) # lamda = max(1, len(X_enc) / 1e4) # lamda = max(1, len(X_enc) / float(K * K)) XtX += np.diag(np.ones(XtX.shape[0]) * lamda).astype(np.float32) # ridge # XtX += np.diag(np.ones(XtX.shape[0])).astype(np.float32) # ridge XtY = _XtY_encoded(X_enc, Y, K=K) # scale = 1. / len(X_enc) scale = 1. / np.linalg.norm(XtX, axis=0).max() XtX = XtX * scale XtY = XtY * scale W = encoded_lstsq(X_bin=X_bin, Y=Y, XtX=XtX, XtY=XtY, precondition=False, stable_ridge=stable_ridge) # KC x M XtX = np.asfarray(XtX) # since we'll be slicing columns else: # stable_ridge is True W = encoded_lstsq(X_bin=X_bin, Y=Y, stable_ridge=stable_ridge) # score all blocks of W all_scores = np.empty((ncodebooks, M), dtype=np.float) # C x M for c in range(ncodebooks): Xc = X_enc[:, c].reshape(-1, 1) start_idx = c * K end_idx = start_idx + K Wc = W[start_idx:end_idx] Yc = _XtY_encoded(Xc, Wc, K=K) # N x M all_scores[c] = np.linalg.norm(Yc, axis=0) # pq_idxs = _pq_codebook_start_end_idxs(M, ncodebooks) pq_idxs = _pq_codebook_start_end_idxs(Y, ncodebooks, algo=pq_perm_algo) # now pick which cols to keep in each codebook keep_mask = np.zeros((ncodebooks, M), dtype=np.bool) # subvec_len = int(np.ceil(M / ncodebooks)) for c in range(ncodebooks): # initialize with PQ start_idx, end_idx = pq_idxs[c] keep_mask[c, start_idx:end_idx] = 1 subvec_len = end_idx - start_idx assert subvec_len >= 1 keep_nidxs_extra = nnz_per_centroid - subvec_len scores = all_scores[c] scores[start_idx:end_idx] = 0 if uniform_sparsity and keep_nidxs_extra > 0: # take as many other (best) nonzero idxs as we we're allowed to assert len(scores) >= keep_nidxs_extra best_idxs = np.argsort(scores)[-keep_nidxs_extra:] if len(best_idxs) != keep_nidxs_extra: print("len(best_idxs)", len(best_idxs)) print("keep_nidxs_extra", keep_nidxs_extra) assert len(best_idxs) == keep_nidxs_extra keep_mask[c, best_idxs] = True if not uniform_sparsity: scores = all_scores.ravel() nkept_idxs = M # number of nonzeros used already keep_nidxs_total = nnz_per_centroid * ncodebooks keep_nidxs_extra = keep_nidxs_total - nkept_idxs keep_idxs = np.argsort(scores)[-keep_nidxs_extra:] flat_mask = keep_mask.ravel() flat_mask[keep_idxs] = 1 keep_mask = flat_mask.reshape(keep_mask.shape) # at this point, we have the mask for which cols of each centroid to keep; # now we just need to go from a mask to a set of indices and a sparse # matrix of centroids W_sparse = np.empty((ncodebooks * K, M), dtype=np.float32) if uniform_sparsity: ret_idxs = np.empty((ncodebooks, nnz_per_centroid), dtype=np.int) else: ret_idxs = [] # else: # ret_idxs = np.zeros((ncodebooks, M), dtype=np.int) - 1 for c in range(ncodebooks): idxs = np.where(keep_mask[c] != 0)[0] if uniform_sparsity: if len(idxs) != nnz_per_centroid: print("c: ", c) print("len(idxs): ", len(idxs)) print("nnz_per_centroid: ", nnz_per_centroid) print("keep_mask counts:", keep_mask.sum(axis=1)) assert len(idxs) == nnz_per_centroid ret_idxs[c] = idxs else: ret_idxs.append(idxs) zero_idxs = np.where(keep_mask[c] == 0)[0] start_idx = c * K end_idx = start_idx + K Wc = W[start_idx:end_idx] Wc[:, zero_idxs] = 0 W_sparse[start_idx:end_idx] = Wc # now refit W_sparse to each output col; right now it's just the original # W with a bunch of entries zeroed for m in range(M): w = W_sparse[:, m] keep_idxs = np.where(w != 0)[0] if stable_ridge: X_bin_subs = X_bin[:, keep_idxs] w_subs = _fit_ridge_enc(X_bin=X_bin_subs, Y=Y[:, m]) else: xty = XtY[:, m] use_XtX = XtX[keep_idxs][:, keep_idxs] use_xty = xty[keep_idxs] w_subs = np.linalg.solve(use_XtX, use_xty) w[:] = 0 w[keep_idxs] = w_subs W_sparse[:, m] = w # nnzs = [len(idxs) for idxs in ret_idxs] # print("nnzs: ", nnzs) # print(f"returning {ret_idxs.shape[1]} nonzeros per centroid...") return W_sparse, ret_idxs def _sparse_encoded_lstsq_backward_elim(X_enc, Y, nnz_blocks, K=16): ncodebooks = X_enc.shape[1] eliminate_nblocks = ncodebooks - nnz_blocks M = Y.shape[1] # precompute XtX and XtY and create initial dense W XtX = _XtX_encoded(X_enc, K=K).astype(np.float32) XtX += np.diag(np.ones(XtX.shape[0])).astype(np.float32) # ridge XtY = _XtY_encoded(X_enc, Y, K=K) W = encoded_lstsq(X_enc, Y, XtX=XtX, XtY=XtY) XtX = np.asfarray(XtX) # since we'll be slicing columns keep_codebook_idxs = np.empty((M, nnz_blocks), dtype=np.int) codebook_scores = np.zeros(ncodebooks) for m in range(M): # fully solve one output col at a time xty = np.ascontiguousarray(XtY[:, m]) rm_codebook_idxs = set() w = np.copy(W[:, m]) for b in range(eliminate_nblocks): # evaluate contribution of each codebook for c in range(ncodebooks): # if c in rm_codebook_idxs or c == pq_codebook_idx: if c in rm_codebook_idxs: codebook_scores[c] = np.inf continue start_idx = c * K end_idx = start_idx + K # XtX_subs = XtX[:, start_idx:end_idx] # CK x K # w_subs = w[start_idx:end_idx] # K # xtyhat_subs = XtX_subs @ w_subs # CK x 1 # codebook_scores[c] = np.linalg.norm(xtyhat_subs) XtX_subs = XtX[start_idx:end_idx][:, start_idx:end_idx] w_subs = w[start_idx:end_idx] # K xtyhat_subs = XtX_subs @ w_subs # K x 1 codebook_scores[c] = np.linalg.norm(xtyhat_subs) # rm least helpful codebook and refit the least squares rm_codebook_idxs.add(np.argmin(codebook_scores)) keep_codebooks = [i for i in range(ncodebooks) if i not in rm_codebook_idxs] keep_idxs = [np.arange(i * K, (i + 1) * K) for i in keep_codebooks] keep_idxs = np.hstack(keep_idxs) use_XtX = XtX[keep_idxs][:, keep_idxs] use_xty = xty[keep_idxs] w_subs = np.linalg.solve(use_XtX, use_xty) # print("w shape: ", w.shape) # print("rm codebooks: ", rm_codebook_idxs) # print("keep codebooks: ", keep_codebooks) # print("keep idxs: ", keep_idxs) # print("type(keep idxs): ", type(keep_idxs)) # print("w[keep idxs]: ", w[keep_idxs]) # print("resid: ", resid) w[:] = 0 w[keep_idxs] = w_subs # update return arrays keep_idxs = [i for i in range(ncodebooks) if i not in rm_codebook_idxs] keep_codebook_idxs[m] = np.array(keep_codebooks) W[:, m] = w return W, keep_codebook_idxs # CK x M, M x nnz def sparse_encoded_lstsq(X_enc, Y, K=16, nnz_blocks=-1, **kwargs): ncodebooks = X_enc.shape[1] if nnz_blocks < 1: # nnz_per_centroid = Y.shape[1] # default to returning dense centroids W = encoded_lstsq(X_enc, Y, K=16) ncodebooks = X_enc.shape[1] M = Y.shape[1] keep_codebook_idxs = np.empty((ncodebooks, M), dtype=np.int) all_idxs = np.arange(M) for c in range(ncodebooks): keep_codebook_idxs[c] = all_idxs return W, keep_codebook_idxs else: nnz_per_centroid = int(nnz_blocks * Y.shape[1] / ncodebooks) # nnz_blocks = int(np.sqrt(ncodebooks) + .5) # return _sparse_encoded_lstsq_backward_elim( # X_enc, Y, nnz_blocks=nnz_blocks, K=K) # return _sparse_encoded_lstsq_gomp(X_enc, Y, nnz_blocks=nnz_blocks, K=K) # print("nnz_per_centroid: ", nnz_per_centroid) return _sparse_encoded_lstsq_elim_v2( X_enc, Y, nnz_per_centroid=nnz_per_centroid, K=K, **kwargs) # def _pq_codebook_start_end_idxs(D, ncodebooks): def _pq_codebook_start_end_idxs(X, ncodebooks, algo='start'): assert algo in ('start', 'end') # TODO do something smarter here # D = int(D) _, D = X.shape ncodebooks = int(ncodebooks) assert D >= ncodebooks idxs = np.empty((ncodebooks, 2), dtype=np.int) full_subvec_len = D // ncodebooks start_idx = 0 for c in range(ncodebooks): subvec_len = full_subvec_len if algo == 'start': # wider codebooks at the start if c < (D % ncodebooks): subvec_len += 1 elif algo == 'end': # wider codebooks at the end if (ncodebooks - c - 1) < (D % ncodebooks): subvec_len += 1 end_idx = min(D, start_idx + subvec_len) # print("c, start_idx, end_idx: ", c, start_idx, end_idx) # print("start_idx, end_idx: ", c, start_idx, end_idx) idxs[c, 0] = start_idx idxs[c, 1] = end_idx start_idx = end_idx assert idxs[0, 0] == 0 assert idxs[-1, -1] == D return idxs @_memory.cache def _learn_mithral_initialization(X, ncodebooks, pq_perm_algo='start', **kwargs): N, D = X.shape ncentroids_per_codebook = 16 X = X.astype(np.float32) X_res = X.copy() X_orig = X all_centroids = np.zeros( (ncodebooks, ncentroids_per_codebook, D), dtype=np.float32) all_splits = [] pq_idxs = _pq_codebook_start_end_idxs(X, ncodebooks, algo=pq_perm_algo) subvec_len = int(np.ceil(D / ncodebooks)) # for non-pq heuristics nonzeros_heuristic = 'pq' # ------------------------ 0th iteration; initialize all codebooks all_splits = [] all_buckets = [] for c in range(ncodebooks): if nonzeros_heuristic == 'pq': start_idx, end_idx = pq_idxs[c] idxs = np.arange(start_idx, end_idx) elif nonzeros_heuristic == 'pca': v = subs.top_principal_component(X_res) idxs = np.argsort(np.abs(v))[:-subvec_len] elif nonzeros_heuristic == 'disjoint_pca': use_X_res = X_res.copy() if c > 0: # not the first codebook use_X_res[:, idxs] = 0 # can't use same subspace v = subs.top_principal_component(use_X_res) idxs = np.argsort(np.abs(v))[:-subvec_len] use_X_res = X_res[:, idxs] use_X_orig = X_orig[:, idxs] # learn codebook to soak current residuals multisplits, _, buckets = learn_multisplits( use_X_res, X_orig=use_X_orig, return_centroids=False, return_buckets=True, **kwargs) for split in multisplits: split.dim = idxs[split.dim] all_splits.append(multisplits) all_buckets.append(buckets) # update residuals and store centroids centroid = np.zeros(D, dtype=np.float32) for b, buck in enumerate(buckets): if len(buck.point_ids): centroid[:] = 0 centroid[idxs] = buck.col_means() X_res[buck.point_ids] -= centroid # update centroid here in case we want to regularize it somehow all_centroids[c, b] = centroid # print("X_res mse / X mse: ", # (X_res * X_res).mean() / (X_orig * X_orig).mean()) return X_res, all_splits, all_centroids, all_buckets @_memory.cache def learn_mithral(X, ncodebooks, return_buckets=False, lut_work_const=-1, **kwargs): N, D = X.shape ncentroids_per_codebook = 16 X_orig = X.astype(np.float32) X_res0, all_splits0, all_centroids0, all_buckets0 = \ _learn_mithral_initialization(X, ncodebooks, pq_perm_algo='start') mse_orig = (X_orig * X_orig).mean() mse0 = (X_res0 * X_res0).mean() print("X_res mse / X mse: ", mse0 / mse_orig) used_perm_algo = 'start' if False: # choose between having wider codebooks at the start vs the end (if # there might be a meaningful difference) X_res1, all_splits1, all_centroids1, all_buckets1 = \ _learn_mithral_initialization(X, ncodebooks, pq_perm_algo='end') mse1 = (X_res1 * X_res1).mean() if mse0 <= mse1: X_res, all_splits, all_centroids, all_buckets = ( X_res0, all_splits0, all_centroids0, all_buckets0) else: X_res, all_splits, all_centroids, all_buckets = ( X_res1, all_splits1, all_centroids1, all_buckets1) used_perm_algo = 'end' print("X_res1 mse / X mse: ", mse1 / mse_orig) else: X_res, all_splits, all_centroids, all_buckets = ( X_res0, all_splits0, all_centroids0, all_buckets0) # optimize centroids discriminatively conditioned on assignments X_enc = mithral_encode(X, all_splits) if lut_work_const != 1: # if it's 1, equivalent to just doing PQ # # shrink W towards 0 # # if lut_work_const < 0: # W = encoded_lstsq(X_enc, X) # else: # W, nonzero_blocks = sparse_encoded_lstsq( # X_enc, X, nnz_blocks=lut_work_const) # # shrink W towards initial centroids # if lut_work_const < 0: print("fitting dense lstsq to X_res") W = encoded_lstsq(X_enc=X_enc, Y=X_res) else: W, _ = sparse_encoded_lstsq( X_enc, X_res, nnz_blocks=lut_work_const, pq_perm_algo=used_perm_algo) all_centroids_delta = W.reshape(ncodebooks, ncentroids_per_codebook, D) all_centroids += all_centroids_delta # check how much improvement we got X_res -= _XW_encoded(X_enc, W) # if we fit to X_res mse_res = (X_res * X_res).mean() print("X_res mse / X mse after lstsq: ", mse_res / mse_orig) # print("min, median, max, std, of all centroids after lstsq:\n", # all_centroids.min(), np.median(all_centroids), # all_centroids.max(), all_centroids.std()) if return_buckets: return all_splits, all_centroids, all_buckets return all_splits, all_centroids def learn_mithral_v1(X, ncodebooks, niters=1, return_buckets=False, **kwargs): # print("called learn_mithral!"); import sys; sys.exit() N, D = X.shape ncentroids_per_codebook = 16 X = X.astype(np.float32) X_res = X.copy() X_orig = X X_hat = np.zeros_like(X) all_centroids = np.zeros( (ncodebooks, ncentroids_per_codebook, D), dtype=np.float32) all_splits = [] subvec_len = int(np.ceil(D / ncodebooks)) # use_X_res = np.zeros_like(X_res) # TODO multiple iters; also store assignments from each codebook, so # that we can undo effect of its X_hat (can't store X_hat directly for # large data, so recompute on the fly using assignments and centroids) nonzeros_heuristic = 'pq' # nonzeros_heuristic = 'pca' # nonzeros_heuristic = 'disjoint_pca' # TODO store assignments (or maybe just buckets directly) # TODO update just centroids (not assignments) at iter end # ------------------------ 0th iteration; initialize all codebooks all_splits = [] all_buckets = [] for c in range(ncodebooks): if nonzeros_heuristic == 'pq': start_idx = c * subvec_len end_idx = min(D, start_idx + subvec_len) idxs = np.arange(start_idx, end_idx) elif nonzeros_heuristic == 'pca': v = subs.top_principal_component(X_res) idxs = np.argsort(np.abs(v))[:-subvec_len] elif nonzeros_heuristic == 'disjoint_pca': use_X_res = X_res.copy() if c > 0: # not the first codebook use_X_res[:, idxs] = 0 # can't use same subspace v = subs.top_principal_component(use_X_res) idxs = np.argsort(np.abs(v))[:-subvec_len] use_X_res = X_res[:, idxs] use_X_orig = X_orig[:, idxs] # learn codebook to soak current residuals multisplits, _, buckets = learn_multisplits( use_X_res, X_orig=use_X_orig, return_centroids=False, return_buckets=True, **kwargs) for split in multisplits: split.dim = idxs[split.dim] all_splits.append(multisplits) all_buckets.append(buckets) # use_X_res[:, start_idx:end_idx] = 0 # use_X_res[:] = 0 # update residuals and store centroids centroid = np.zeros(D, dtype=np.float32) for b, buck in enumerate(buckets): if len(buck.point_ids): centroid[:] = 0 centroid[idxs] = buck.col_means() # centroid /= 2 # TODO rm X_hat[buck.point_ids] = centroid # update centroid here in case we want to regularize it somehow all_centroids[c, b] = centroid X_res -= X_hat print("X res var / X var: ", X_res.var() / X_orig.var()) # ------------------------ remaining iters for t in range(niters): # now update centroids given assignments and all other centroids # for _ in range(5): # for _ in range(20): for _ in range(10): for c in range(ncodebooks): # print("c: ", c) # undo effect of this codebook buckets = all_buckets[c] for b, buck in enumerate(buckets): if len(buck.point_ids): X_hat[buck.point_ids] = all_centroids[c, b] X_res += X_hat # update centroids based on residuals given all other codebooks for b, buck in enumerate(buckets): if len(buck.point_ids): centroid = X_res[buck.point_ids].mean(axis=0) # keep_ndims = D // 2 # zero_idxs = np.argsort(np.abs(centroid))[:-keep_ndims] # centroid[zero_idxs] = 0 # true_centroid = X_res[buck.point_ids].mean(axis=0) # old_centroid = all_centroids[c, b] # centroid = (true_centroid + old_centroid) / 2 X_hat[buck.point_ids] = centroid all_centroids[c, b] = centroid X_res -= X_hat print("X res var / X var after centroid updates: ", X_res.var() / X_orig.var()) # now update assignments if t == niters - 1: break # end after updating centroids, not assignments for c in range(ncodebooks): # print("c: ", c) # undo effect of this codebook buckets = all_buckets[c] # orig_loss = sum([buck.loss for buck in buckets]) orig_loss = np.sum(X_res * X_res) for b, buck in enumerate(buckets): if len(buck.point_ids): X_hat[buck.point_ids] = all_centroids[c, b] X_res += X_hat multisplits, loss, buckets = learn_multisplits( X_res, X_orig=X_orig, return_centroids=False, return_buckets=True, **kwargs) print("orig loss, loss: ", orig_loss, loss) if loss > orig_loss: X_res -= X_hat continue all_splits[c] = multisplits all_buckets[c] = buckets # update residuals and store centroids # centroid = np.zeros(D, dtype=np.float32) for b, buck in enumerate(buckets): if len(buck.point_ids): centroid = buck.col_means() # centroid /= 2 # TODO rm X_hat[buck.point_ids] = centroid # update centroid here in case we want to regularize it somehow all_centroids[c, b] = centroid X_res -= X_hat print("new X res var / X var: ", X_res.var() / X_orig.var()) if return_buckets: return all_splits, all_centroids, all_buckets return all_splits, all_centroids def mithral_encode(X, multisplits_lists): N, D = X.shape ncodebooks = len(multisplits_lists) X_enc = np.empty((N, ncodebooks), dtype=np.int, order='f') for c in range(ncodebooks): X_enc[:, c] = assignments_from_multisplits(X, multisplits_lists[c]) return np.ascontiguousarray(X_enc) def mithral_lut(q, all_centroids): q = q.reshape(1, 1, -1) # all_centroids is shape ncodebooks, ncentroids, D return (q * all_centroids).sum(axis=2) # ncodebooks, ncentroids def learn_splits_greedy(X, nsplits, verbose=2): N, D = X.shape assert nsplits <= D # # improve numerical stability # scale = np.std(X) # X *= (1. / scale) # precompute sorted lists of values within each dimension, # along with which row they originally were so look can look # up the whole vector (and bucket) associated with each value dim2sorted = [] for dim in range(D): sorted_with_idx = _sort_and_append_orig_idx(X[:, dim]) dim2sorted.append(sorted_with_idx) splits = [] # buckets = [Bucket(N=N, sumX=X.sum(axis=0), sumX2=(X * X).sum(axis=0), buckets = [Bucket(sumX=X.sum(axis=0), sumX2=(X * X).sum(axis=0), point_ids=np.arange(N))] # all_point_infos = [PointInfo(data=row, bucket_id=0) for row in X] bucket_assignments = np.zeros(N, dtype=np.int) # Z = X - X.mean(axis=0) # total_loss = np.sum(Z * Z) # print("initial SSE: ", total_loss) total_loss = sum([bucket.loss for bucket in buckets]) if verbose > 0: print("learn_splits(): initial loss: ", total_loss) # unused_dims = set(np.arange(X.shape[1])) # all_dims = np.arange(D) col_losses = np.zeros(D, dtype=np.float32) # TODO rm? for s in range(nsplits): if verbose > 1: print("================================ finding split #:", s) best_split = Split(dim=-1, val=-np.inf, loss_change=0) # for d in unused_dims: # for d in all_dims: # for d in all_dims[:2]: # TODO rm col_losses[:] = 0 for buck in buckets: col_losses += buck.col_sum_sqs() # try_dims = [np.argmax(col_losses)] # try_dims = np.argsort(col_losses)[-nsplits:] try_dims = np.argsort(col_losses)[-4:] # for d in [dim]: # TODO multiple dim options? if verbose > 1: print("trying dims: ", try_dims) print("with losses: ", col_losses[try_dims]) for d in try_dims: vals_and_point_ids = dim2sorted[d] new_buckets = _split_existing_buckets(buckets) new_total_loss = total_loss if verbose > 2: print("---------------------- dim = ", d) # for i, (val, point_id) in enumerate(vals_and_point_ids): # skip last point since that just puts everything in one bucket, # which is the same as what we're starting out with for val, point_id in vals_and_point_ids[:-1]: # if verbose > 1: # print("i: {}/{}".format(i, len(vals_and_point_ids) - 1)) # info = all_point_infos[point_id] # point, bucket_id = info.data, info.bucket_id point = X[point_id] bucket_id = bucket_assignments[point_id] bucket0 = new_buckets[bucket_id][0] bucket1 = new_buckets[bucket_id][1] old_loss = bucket0.loss + bucket1.loss bucket0.remove_point(point, point_id=point_id) bucket1.add_point(point, point_id=point_id) new_loss = bucket0.loss + bucket1.loss new_total_loss -= old_loss # sub old loss from these buckets new_total_loss += new_loss # add new loss from these buckets loss_change = new_total_loss - total_loss # if loss_change > .1: # should be nonincreasing # print("got loss change: ", loss_change) # print("old total loss:", total_loss) # print("new total loss:", new_total_loss) # assert loss_change <= .1 # should be nonincreasing # # loss should be no worse than having new buckets unused # assert loss_change <= .1 # if verbose > 2: # print("-------- split point_id, val = ", point_id, val) # print("bucket0 point ids, loss after update: ", # bucket0.point_ids, bucket0.loss) # print("bucket1 point ids, loss after update: ", # bucket1.point_ids, bucket1.loss) # print("loss change = {:.3f};\tnew_loss = {:.3f} ".format( # loss_change, new_total_loss)) if loss_change < best_split.loss_change: best_split.dim = d best_split.val = val best_split.loss_change = loss_change if verbose > 2: print("---------------------- split on dim={}, val={:.3f} ".format( best_split.dim, best_split.val)) buckets = [buck.split(X, dim=best_split.dim, val=best_split.val) for buck in buckets] buckets = reduce(lambda b1, b2: b1 + b2, buckets) # flatten pairs for i, buck in enumerate(buckets): ids = np.asarray(list(buck.point_ids), dtype=np.int) bucket_assignments[ids] = i total_loss = sum([bucket.loss for bucket in buckets]) # unused_dims.remove(best_split.dim) splits.append(best_split) if verbose > 3: print('learn_splits(): new loss: {:.3f} from split at dim {}, ' 'value {:.3f}'.format( total_loss, best_split.dim, best_split.val)) if verbose > 2: print('bucket losses: ') print([bucket.loss for bucket in buckets]) print('bucket N, sumX, sumX2') print([bucket.N for bucket in buckets]) print([list(bucket.sumX) for bucket in buckets]) print([list(bucket.sumX2) for bucket in buckets]) # for split in splits: # split.val *= scale # undo preconditioning # total_loss *= scale * scale return splits, total_loss def learn_splits_conditional(X, nsplits, dim_algo='greedy_var', split_algo='mean', **sink): N, D = X.shape assert nsplits <= D # unused_dims = set(np.arange(X.shape[1])) col_means = X.mean(axis=0) # dims = np.arange(D) used_mask = np.ones(D, dtype=np.float32) splits = [] buckets = [Bucket(sumX=X.sum(axis=0), sumX2=(X * X).sum(axis=0), point_ids=np.arange(N))] col_losses = np.zeros(D, dtype=np.float32) for s in range(nsplits): print("---- learning split {}/{}...".format(s + 1, nsplits)) print("current number of buckets: ", len(buckets)) # col_vars = X.var(axis=0) col_losses[:] = 0 for buck in buckets: col_losses += buck.col_sum_sqs() col_losses *= used_mask if dim_algo == 'greedy_var': dim = np.argmax(col_losses) used_mask[dim] = 0 if split_algo == 'mean': val = col_means[dim] new_buckets = [] for buck in buckets: new_buckets += list(buck.split(X=X, dim=dim, val=val)) buckets = new_buckets splits.append(Split(dim=dim, val=val)) return splits, -1 # def learn_splits_simple(X, nsplits, dim_algo='randunif', split_algo='mean', # def learn_splits_simple(X, nsplits, dim_algo='greedy_var', split_algo='median', def learn_splits_simple(X, nsplits, dim_algo='greedy_var', split_algo='mean', **sink): # unused_dims = set(np.arange(X.shape[1])) unused_dims = list(np.arange(X.shape[1])) # random.choice can't use set col_means = X.mean(axis=0) col_vars = X.var(axis=0) col_medians = np.median(X, axis=0) # overall_mean = np.mean(col_means) # overall_median = np.median(col_medians) # overall_var = X.var() var_idxs_descending = np.argsort(col_vars)[::-1] splits = [] for s in range(nsplits): if dim_algo == 'randunif': dim = np.random.choice(unused_dims) unused_dims.remove(dim) elif dim_algo == 'greedy_var': dim = var_idxs_descending[s] if split_algo == 'mean': val = col_means[dim] elif split_algo == 'median': val = col_medians[dim] splits.append(Split(dim=dim, val=val)) return splits, -1 def learn_splits(X, nsplits, return_centroids=True, algo='multisplits', **kwargs): # indirect to particular func; will likely need to try something simpler # for debugging and/or as experimental control # return learn_splits_greedy(X, nsplits, **kwargs) # return learn_splits_simple(X, nsplits, **kwargs) # return learn_splits_conditional(X, nsplits, **kwargs) # return learn_splits_greedy(X, nsplits) # TODO fwd kwargs if algo == 'multisplits': return learn_multisplits( X, nsplits, return_centroids=return_centroids) if algo == 'splits': splits, loss = learn_splits_greedy(X, nsplits) if return_centroids: centroids = centroids_from_splits(X, splits) return splits, loss, centroids return splits, loss def assignments_from_splits(X, splits): nsplits = len(splits) indicators = np.empty((nsplits, len(X)), dtype=np.int) for i, split in enumerate(splits): indicators[i] = X[:, split.dim] > split.val # compute assignments by treating indicators in a row as a binary num # scales = (2 ** np.arange(nsplits)).astype(np.int) scales = (1 << np.arange(nsplits)).astype(np.int) return (indicators.T * scales).sum(axis=1).astype(np.int) def assignments_from_multisplits(X, splits): N, _ = X.shape nsplits = len(splits) # indicators = np.zeros((nsplits, len(X)), dtype=np.int) assert len(splits) >= 1 # dim0 = splits[0].dim # assert len(splits[0].vals) == 1 # only 1 initial split # indicators[0] = X > splits[0].vals[0] max_ngroups = len(splits[-1].vals) nsplits_affecting_group_id = int(np.log2(max_ngroups)) assert 1 << nsplits_affecting_group_id == max_ngroups # power of 2 # np.log2(max_nsplits) # determine group ids for each point; this is the one that's annoying # because the number of bits changes after split group_ids = np.zeros(N, dtype=np.int) for i in range(min(nsplits, nsplits_affecting_group_id)): split = splits[i] vals = split.vals[group_ids] # x = X[:, split.dim] # if split.offset is not None: # x = x - split.offset # if split.scaleby is not None: # x = x * split.scaleby # indicators = x > vals indicators = split.preprocess_x(X[:, split.dim]) > vals group_ids = (group_ids * 2) + indicators if nsplits <= nsplits_affecting_group_id: return group_ids # compute remaining bits assignments = np.copy(group_ids) for i in range(nsplits_affecting_group_id, nsplits): split = splits[i] vals = split.vals[group_ids] # x = X[:, split.dim] # if split.offset is not None: # x = x - split.offset # if split.scaleby is not None: # x = x * split.scaleby # indicators = x > vals indicators = split.preprocess_x(X[:, split.dim]) > vals assignments = (assignments * 2) + indicators return assignments def _centroids_from_assignments(X, assignments, ncentroids): centroids = np.empty((ncentroids, X.shape[1]), dtype=X.dtype) for c in range(ncentroids): centroids[c] = X[assignments == c].mean(axis=0) return centroids def centroids_from_splits(X, splits): ncentroids = int(1 << len(splits)) assignments = assignments_from_splits(X, splits) return _centroids_from_assignments(X, assignments, ncentroids=ncentroids) @_memory.cache def learn_splits_in_subspaces(X, subvect_len, nsplits_per_subs, return_centroids=True, algo='multisplits', verbose=2): N, D = X.shape # N /= 100 # TODO rm after debug splits_lists = [] nsubs = int(np.ceil(D) / subvect_len) # stuff for sse stats tot_sse = 0 X_bar = X - np.mean(X, axis=0) col_sses = np.sum(X_bar * X_bar, axis=0) + 1e-14 tot_sse_using_mean = np.sum(col_sses) if verbose > 1: print("original sum of sses within each col: ", tot_sse_using_mean) if return_centroids: ncentroids = int(2 ** nsplits_per_subs) # this order seems weird, but matches _learn_centroids, etc; helps with # eventual vectorized lookups centroids = np.empty((ncentroids, nsubs, subvect_len), dtype=X.dtype) for m in range(nsubs): start_col = m * subvect_len end_col = start_col + subvect_len X_subs = X[:, start_col:end_col] splits, sse, subs_centroids = learn_splits( X_subs, nsplits=nsplits_per_subs, verbose=(verbose - 1), return_centroids=True, algo=algo) centroids[:, m, :] = subs_centroids splits_lists.append(splits) tot_sse += sse if verbose > 1: # print("col sses in subspace: ", col_sses[start_col:end_col]) # print("sum col sses in subspace: ", col_sses[start_col:end_col].sum()) # print("buckets claim sse:", sse) # print("N: ", N) # print("(sse / N)", (sse / N)) # print("np.var(X_subs)", np.var(X_subs)) orig_sse_in_subs = col_sses[start_col:end_col].sum() # print("learning splits: mse / var(X) in subs {}/{} = {:3g}".format( # m + 1, nsubs, (sse / N) / np.var(X_subs))) print("learning splits: sse / orig sse in subs {}/{} = {:3g}".format( m + 1, nsubs, sse / orig_sse_in_subs)) # import sys; sys.exit() # print("exiting after one subspace") # import sys; sys.exit() if verbose > 0: print("-- learn_splits_in_subspaces: new / orig mse: {:.3g}".format( tot_sse / tot_sse_using_mean)) # print("tot_sse_using_mean: ", tot_sse_using_mean) if return_centroids: return splits_lists, centroids return splits_lists def encode_using_splits(X, subvect_len, splits_lists, split_type='single'): N, D = X.shape nsubs = int(np.ceil(D) / subvect_len) X_enc = np.empty((X.shape[0], nsubs), dtype=np.int, order='f') for m in range(nsubs): start_col = m * subvect_len end_col = start_col + subvect_len X_subs = X[:, start_col:end_col] if split_type == 'single': X_enc[:, m] = assignments_from_splits(X_subs, splits_lists[m]) elif split_type == 'multi': X_enc[:, m] = assignments_from_multisplits(X_subs, splits_lists[m]) return np.ascontiguousarray(X_enc) def _plot_stuff_on_trace(): import matplotlib as mpl import matplotlib.pyplot as plt from joblib import Memory _memory = Memory('.', verbose=0) mpl.rcParams['lines.linewidth'] = .5 @_memory.cache def _load_trace(): return np.loadtxt('assets/debug/Trace/Trace_TRAIN.txt') # try_ndims = 128 # try_ndims = 64 try_ndims = 4 # limit_n = 20 # limit_n = 50 # limit_n = 200 limit_n = 500 # X = np.loadtxt('assets/debug/Trace/Trace_TRAIN.txt')[:limit_n] X = _load_trace()[:limit_n] y = (X[:, 0] - 1).astype(np.int) X = X[:, 1:] _, axes = plt.subplots(3, 4, figsize=(13, 9), sharey=True) colors = ('blue', 'red', 'green', 'black') axes[0, 0].set_title('Trace Dataset\n(colored by class)') for lbl in np.unique(y): X_subset = X[y == lbl] axes[0, 0].plot(X_subset.T, color=colors[lbl]) # visualize output with only 1 codebook (no need for updates) ncodebooks = 1 splits, centroids, buckets = learn_mithral( X, ncodebooks, return_buckets=True, try_ndims=try_ndims, niters=1) centroids = centroids[0] # only one codebook axes[0, 1].set_title('centroids') axes[0, 1].plot(centroids.T) X_hat = np.zeros_like(X) for c, splitlist in enumerate(splits): for s, split in enumerate(splitlist): assert len(splitlist) == 4 vals = (split.vals / split.scaleby) + split.offset for val in vals: axes[0, c].scatter(split.dim, val, color=colors[s], marker='o', zorder=5) for b in buckets[0]: # only one codebook, so use first list if b.N > 0: X_hat[b.point_ids] = b.col_means() X_res = X - X_hat axes[0, 2].set_title('reconstructions') axes[0, 2].plot(X_hat.T) # axes[0, 3].set_title('residuals (mean={:.2f})'.format(X_res.mean())) axes[0, 3].set_title('residuals (var={:.2f})'.format(X_res.var())) axes[0, 3].plot(X_res.T) # visualize output with only 2 codebooks, no updates ncodebooks = 2 splits, centroids, buckets = learn_mithral( X, ncodebooks, return_buckets=True, try_ndims=try_ndims, niters=1) # centroids = centroids[0] # only one codebook axes[1, 0].set_title('centroids[0]') axes[1, 0].plot(centroids[0].T) axes[1, 1].set_title('centroids[1]') axes[1, 1].plot(centroids[1].T) X_hat = np.zeros_like(X) # print("splits: ", splits) for c, splitlist in enumerate(splits): for s, split in enumerate(splitlist): assert len(splitlist) == 4 vals = (split.vals / split.scaleby) + split.offset for val in vals: axes[1, c].scatter(split.dim, val, color=colors[s]) for c in range(len(buckets)): # for each codebook for b, buck in enumerate(buckets[c]): if buck.N > 0: X_hat[buck.point_ids] += centroids[c, b] X_res = X - X_hat axes[1, 2].set_title('reconstructions') axes[1, 2].plot(X_hat.T) # axes[1, 3].set_title('residuals (mean={:.2f})'.format(X_res.mean())) axes[1, 3].set_title('residuals (var={:.2f})'.format(X_res.var())) axes[1, 3].plot(X_res.T) # visualize output with only 2 codebooks, with centroid updates ncodebooks = 2 splits, centroids, buckets = learn_mithral( X, ncodebooks, return_buckets=True, try_ndims=try_ndims, niters=1) axes[2, 0].set_title('centroids[0]') axes[2, 0].plot(centroids[0].T) axes[2, 1].set_title('centroids[1]') axes[2, 1].plot(centroids[1].T) X_hat = np.zeros_like(X) for c in range(len(buckets)): # for each codebook for b, buck in enumerate(buckets[c]): if buck.N > 0: X_hat[buck.point_ids] += centroids[c, b] X_res = X - X_hat axes[2, 2].set_title('reconstructions') axes[2, 2].plot(X_hat.T) # axes[2, 3].set_title('residuals (mean={:.2f})'.format(X_res.mean())) axes[2, 3].set_title('residuals (var={:.2f})'.format(X_res.var())) axes[2, 3].plot(X_res.T) plt.tight_layout() plt.show() def test_encoded_ops(): N, C, K = 100, 8, 16 X_enc = np.random.randint(K, size=(N, C)) # print(X_enc) X_bin = _densify_X_enc(X_enc) # print(X_enc_binary) assert np.all(X_bin.sum(axis=1) == C) XtX = _XtX_encoded(X_enc) XtX2 = X_bin.T @ X_bin assert np.all(XtX == XtX2) M = 17 Y = np.random.randn(N, M).astype(np.float32) XtY = _XtY_encoded(X_enc, Y) XtY2 = X_bin.T @ Y # print(XtY[:2]) # print(XtY2[:2]) assert np.all(XtY == XtY2) D = C * K W = np.random.randn(D, M).astype(np.float32) XW = _XW_encoded(X_enc, W) XW2 = X_bin @ W assert np.all(XW == XW2) def main(): test_encoded_ops() # print(_pq_codebook_start_end_idxs(6, 3)) # print(_pq_codebook_start_end_idxs(8, 3)) # print(_pq_codebook_start_end_idxs(9, 3)) # print(_pq_codebook_start_end_idxs(10, 3)) if __name__ == '__main__': main()
bolt-master
experiments/python/clusterize.py
#!/usr/bin/env python from __future__ import division, absolute_import import abc import matplotlib.pyplot as plt import numpy as np import seaborn as sb from . import product_quantize as pq from . import subspaces as subs from . import clusterize from .utils import kmeans # ================================================================ misc funcs def dists_elemwise_sq(x, q): diffs = x - q return diffs * diffs def dists_elemwise_l1(x, q): return np.abs(x - q) def dists_elemwise_dot(x, q): return x * q def extract_random_rows(X, how_many, remove_from_X=True): split_start = np.random.randint(len(X) - how_many - 1) split_end = split_start + how_many rows = np.copy(X[split_start:split_end]) if remove_from_X: return np.vstack((X[:split_start], X[split_end:])), rows return X, rows # XXX: not clear whether this function is correct in general, but # does always pass the asserts (which capture the invariants we want) def _insert_zeros(X, nzeros): N, D = X.shape D_new = D + nzeros X_new = np.zeros((N, D_new), dtype=X.dtype) # print("attempting to insert {} zeros into X of shape {}".format(nzeros, X.shape)) step = int(D / (nzeros + 1)) - 1 step = max(1, step) # print("using step: ", step) for i in range(nzeros): in_start = step * i in_end = in_start + step # out_start = in_start + i + 1 out_start = (step + 1) * i out_end = out_start + step X_new[:, out_start:out_end] = X[:, in_start:in_end] # out_start = out_end # out_end += step out_end += 1 # account for the last 0 remaining_len = D - in_end out_remaining_len = D_new - out_end # print "step", step # print "in_start, in_end", in_start, in_end # print "out_start, out_end", out_start, out_end # print "D, D_new", D, D_new # print "remaining_len, out_remaining_len", remaining_len, out_remaining_len assert remaining_len == out_remaining_len assert remaining_len >= 0 if remaining_len: # X_new[:, out_end:out_end+remaining_len] = X[:, in_end:D] X_new[:, out_end:] = X[:, in_end:] # print("first cols of old and new X:") # print(X[:, 0]) # print(X_new[:, 0]) # print(X_new.shape) # print((X_new.sum(axis=0) != 0).sum()) assert X.shape[0] == X_new.shape[0] cols_nonzero = X_new.sum(axis=0) != 0 orig_cols_nonzero = X.sum(axis=0) != 0 # new_cols_nonzero = cols_nonzero & (~orig_cols_nonzero) # print("zero cols: ", np.where(~cols_nonzero)[0]) assert cols_nonzero.sum() == orig_cols_nonzero.sum() nzeros_added = (~cols_nonzero).sum() - (~orig_cols_nonzero).sum() assert nzeros_added == nzeros # assert np.array_equal(X[:, 0], X_new[:, 0]) # assert np.array_equal(X[:, -1], X_new[:, -1]) return X_new # def ensure_num_cols_multiple_of(X, multiple_of, min_ncols=-1): def ensure_num_cols_multiple_of(X, multiple_of): remainder = X.shape[1] % multiple_of if remainder > 0: return _insert_zeros(X, multiple_of - remainder) # # TODO rm and uncomment above after debug # add_ncols = multiple_of - remainder # new_ncols = X.shape[1] + add_ncols # new_X = np.zeros((X.shape[0], new_ncols), dtype=X.dtype) # new_X[:, :X.shape[1]] = X # return new_X return X def _learn_best_quantization(luts): assert luts.ndim == 2 # luts can be a bunch of vstacked luts, but not 3D best_loss = np.inf best_alpha = None best_floors = None best_scale_by = None for alpha in [.001, .002, .005, .01, .02, .05, .1]: # alpha_pct = int(100 * alpha) alpha_pct = 100 * alpha # compute quantized luts this alpha would yield floors = np.percentile(luts, alpha_pct, axis=0) luts_offset = np.maximum(0, luts - floors) ceil = np.percentile(luts_offset, 100 - alpha_pct) scale_by = 255. / ceil # if only_shift: # scale_by = 1 << int(np.log2(scale_by)) luts_quantized = np.floor(luts_offset * scale_by).astype(np.int) luts_quantized = np.minimum(255, luts_quantized) # compute err luts_ideal = (luts - luts_offset) * scale_by diffs = luts_ideal - luts_quantized loss = np.sum(diffs * diffs) if loss <= best_loss: best_loss = loss best_alpha = alpha best_floors = floors best_scale_by = scale_by return best_floors, best_scale_by, best_alpha # ================================================================ Quantizers # ------------------------------------------------ Abstract Base Class class MultiCodebookEncoder(abc.ABC): def __init__(self, ncodebooks, ncentroids=256, quantize_lut=False, upcast_every=-1, accumulate_how='sum'): self.ncodebooks = ncodebooks self.ncentroids = ncentroids self.quantize_lut = quantize_lut self.upcast_every = upcast_every if upcast_every >= 1 else 1 self.upcast_every = min(self.ncodebooks, self.upcast_every) assert self.upcast_every in (1, 2, 4, 8, 16, 32, 64, 128, 256) self.accumulate_how = accumulate_how self.code_bits = int(np.log2(self.ncentroids)) # for fast lookups via indexing into flattened array self.offsets = (np.arange(self.ncodebooks, dtype=np.int) * self.ncentroids) def name(self): return "{}_{}x{}b_quantize={}".format( self.preproc, self.ncodebooks, self.code_bits, int(self.quantize_lut)) def params(self): return {'ncodebooks': self.ncodebooks, 'code_bits': self.code_bits, 'quantize': self.quantize_lut} def _learn_lut_quantization(self, X, Q=None): if self.quantize_lut: # TODO put this logic in separate function print("learning quantization...") # print("initial Q: ", Q) if Q is None: # num_rows = min(10 * 1000, len(X) // 2) # _, queries = extract_random_rows( # X[num_rows:], how_many=1000, remove_from_X=False) # X = X[:num_rows] # limit to first 10k rows of X _, Q = extract_random_rows( X, how_many=1000, remove_from_X=False) Q = Q.T # want each row to be one query, not each col # Q = self._pad_ncols(Q) # if self.preproc == 'OPQ': # Q = pq.opq_rotate(Q, self.R) # elif self.preproc == 'BOPQ': # Q = pq.bopq_rotate(Q, self.rotations) # elif self.preproc == 'GEHT': # Q = Q[:, self.perm] # print("Q shape: ", Q.shape) # compute luts for all the queries # luts = [self.encode_Q(q, quantize=False) for q in Q] luts = self.encode_Q(Q, quantize=False) # luts = np.vstack(luts) # print("ncodebooks: ", self.ncodebooks) # print("luts shape: ", luts.shape) assert luts.shape == (len(Q), self.ncodebooks, self.ncentroids) luts = np.moveaxis(luts, 2, 1) assert luts.shape == (len(Q), self.ncentroids, self.ncodebooks) luts = luts.reshape(len(Q) * self.ncentroids, self.ncodebooks) self.lut_offsets, self.scale_by, _ = _learn_best_quantization(luts) # print("self.lut_offsets.shape", self.lut_offsets.shape) # print("self.scale_by.shape", self.scale_by.shape) # print("self.scale_by", self.scale_by) assert self.lut_offsets.shape == (self.ncodebooks,) # self.lut_offsets = self.lut_offsets[:, np.newaxis] self.total_lut_offset = np.sum(self.lut_offsets) # print("lut offsets: ", self.lut_offsets) def dists_enc(self, X_enc, Q_luts, unquantize=True, offset=None, scale=None): X_enc = np.ascontiguousarray(X_enc) if unquantize: offset = self.total_lut_offset if offset is None else offset scale = self.scale_by if scale is None else scale all_dists = np.empty((len(Q_luts), len(X_enc)), dtype=np.float32) for i, lut in enumerate(Q_luts): centroid_dists = lut.ravel()[X_enc.ravel()] dists = centroid_dists.reshape(X_enc.shape) if self.upcast_every < 2 or not self.quantize_lut: dists = dists.sum(axis=-1) else: dists = dists.reshape(dists.shape[0], -1, self.upcast_every) if self.accumulate_how == 'sum': # sum upcast_every vals, then clip to mirror saturating # unsigned addition, then sum without saturation (like u16) dists = dists.sum(2) dists = np.clip(dists, 0, 255).sum(axis=-1) elif self.accumulate_how == 'mean': # mirror hierarchical avg_epu8 # print("reducing using mean!") # print("fraction of low bits that are 1: ", # np.mean(dists % 2 == 1)) # ya, ~.5, or maybe ~.495 while dists.shape[-1] > 2: dists = (dists[:, :, ::2] + dists[:, :, 1::2] + 1) // 2 dists = (dists[:, :, 0] + dists[:, :, 1] + 1) // 2 dists = dists.sum(axis=-1) # clipping not needed # undo biasing; if low bits are {0,0} or {1,1}, no bias # from the averaging; but if {0,1}, then rounds up by # .5; happens with prob ~=~ .5, so each avg op adds .25; # the other tricky thing here is that rounding up when # you're averaging averages biases it even farther # base_bias = .5 * .5 # assert self.upcast_every >= 2 # bias_per_upcast = 0 # nlevels = int(np.log2(self.upcast_every)) # for level in range(nlevels): # num_avg_ops = self.upcast_every / (2 << level) # print("num_avg_ops: ", num_avg_ops) # bias_per_op = (1 << level) * base_bias # print("level multiplier: ", 1 << level) # bias_per_upcast += num_avg_ops * bias_per_op # bias = bias_per_upcast * (self.ncodebooks / self.upcast_every) # num_avg_ops = (self.upcast_every - 1) * ( # self.ncodebooks / self.upcast_every) # num_avg_ops = (self.upcast_every - 1) * np.sqrt( # self.ncodebooks / self.upcast_every) # num_avg_ops = (self.upcast_every - 1) # bias = num_avg_ops * base_bias # bias = (self.ncodebooks / 2) * int(np.log2(self.upcast_every)) # bias = (self.ncodebooks / 2) * int(np.log2(self.upcast_every)) # bias = 0 # dists -= int(bias * self.upcast_every) dists *= self.upcast_every # convert mean to sum # I honestly don't know why this is the formula, but wow # does it work well bias = self.ncodebooks / 4 * np.log2(self.upcast_every) dists -= int(bias) else: raise ValueError("accumulate_how must be 'sum' or 'mean'") if self.quantize_lut and unquantize: # dists = (dists / self.scale_by) + self.total_lut_offset dists = (dists / scale) + offset all_dists[i] = dists return all_dists.T # ------------------------------------------------ Product Quantization def _learn_centroids(X, ncentroids, ncodebooks, subvect_len): ret = np.empty((ncentroids, ncodebooks, subvect_len)) # print("_learn_centroids(): running kmeans...") tot_sse = 0 X_bar = X - np.mean(X, axis=0) col_sses = np.sum(X_bar * X_bar, axis=0) + 1e-14 tot_sse_using_mean = np.sum(col_sses) for i in range(ncodebooks): print("running kmeans in subspace {}/{}...".format( i + 1, ncodebooks), end=" ") start_col = i * subvect_len end_col = start_col + subvect_len X_in = X[:, start_col:end_col] # centroids, labels = kmeans(X_in, ncentroids) centroids, labels, sse = kmeans(X_in, ncentroids, return_sse=True) # X_bar = X_in - np.mean(X_in, axis=0) # sse_using_mean = np.sum(X_bar * X_bar) + 1e-14 subspace_sse = np.sum(col_sses[start_col:end_col]) print("mse / {{var(X_subs), var(X)}}: {:.3g}, {:.3g}".format( sse / subspace_sse, sse * ncodebooks / tot_sse_using_mean)) tot_sse += sse # print("centroids shape: ", centroids.shape) # print("ret shape: ", ret.shape) ret[:, i, :] = centroids print("--- total mse / var(X): {:.3g}".format(tot_sse / tot_sse_using_mean)) return ret def _parse_codebook_params(D, code_bits=-1, bits_per_subvect=-1, ncodebooks=-1): if ncodebooks < 0: ncodebooks = code_bits // bits_per_subvect elif code_bits < 1: code_bits = bits_per_subvect * ncodebooks elif bits_per_subvect < 1: bits_per_subvect = code_bits // ncodebooks ncentroids = int(2 ** bits_per_subvect) subvect_len = D // ncodebooks assert code_bits % bits_per_subvect == 0 if D % subvect_len: print("D, ncodebooks, subvect_len = ", D, ncodebooks, subvect_len) assert D % subvect_len == 0 # TODO rm this constraint return ncodebooks, ncentroids, subvect_len def _fit_pq_lut(q, centroids, elemwise_dist_func): _, ncodebooks, subvect_len = centroids.shape q = q.reshape((1, ncodebooks, subvect_len)) q_dists = np.sum(centroids * q, axis=-1) return q_dists # ncentroids, ncodebooks, row-major class PQEncoder(MultiCodebookEncoder): def __init__(self, ncodebooks, ncentroids=256, elemwise_dist_func=dists_elemwise_dot, preproc='PQ', encode_algo=None, quantize_lut=False, upcast_every=-1, accumulate_how='sum', **preproc_kwargs): super().__init__( ncodebooks=ncodebooks, ncentroids=ncentroids, quantize_lut=quantize_lut, upcast_every=upcast_every, accumulate_how=accumulate_how) self.elemwise_dist_func = elemwise_dist_func self.preproc = preproc self.encode_algo = encode_algo self.preproc_kwargs = preproc_kwargs def _pad_ncols(self, X): return ensure_num_cols_multiple_of(X, self.ncodebooks) def fit(self, X, Q=None): self.subvect_len = int(np.ceil(X.shape[1] / self.ncodebooks)) X = self._pad_ncols(X) self.centroids = None if self.preproc == 'BOPQ': self.centroids, _, self.rotations = pq.learn_bopq( X, ncodebooks=self.ncodebooks, codebook_bits=self.code_bits, **self.preproc_kwargs) elif self.preproc == 'OPQ': self.centroids, _, self.R = pq.learn_opq( X, ncodebooks=self.ncodebooks, codebook_bits=self.code_bits, **self.preproc_kwargs) elif self.preproc == 'GEHT': self.perm = subs.greedy_eigenvector_threshold( X, subspace_len=self.subvect_len, **self.preproc_kwargs) assert X.shape[1] == len(set(self.perm)) X = X[:, self.perm] if self.centroids is None: if self.encode_algo in ('splits', 'multisplits'): assert self.encode_algo != 'splits' # TODO rm self.splits_lists, self.centroids = \ clusterize.learn_splits_in_subspaces( X, subvect_len=self.subvect_len, nsplits_per_subs=self.code_bits, algo=self.encode_algo) # print("centroids shape: ", self.centroids.shape) # # TODO rm # # yep, yields identical errs as mithral with pq_perm_algo='end' # self.splits_lists, self.centroids = clusterize.learn_mithral( # X, ncodebooks=self.ncodebooks) # print("centroids shape: ", self.centroids.shape) else: self.centroids = _learn_centroids( X, self.ncentroids, self.ncodebooks, self.subvect_len) self._learn_lut_quantization(X, Q) def name(self): return "{}_{}".format(self.preproc, super().name()) def params(self): d = super().params() d['_preproc'] = self.preproc return d def encode_Q(self, Q, quantize=True): # quantize param enables quantization if set in init; separate since # quantization learning needs to call this func, but vars like # lut_offsets aren't set when this function calls it Q = np.atleast_2d(Q) Q = self._pad_ncols(Q) if self.preproc == 'OPQ': Q = pq.opq_rotate(Q, self.R) elif self.preproc == 'BOPQ': Q = pq.bopq_rotate(Q, self.rotations) elif self.preproc == 'GEHT': Q = Q[:, self.perm] luts = np.zeros((Q.shape[0], self.ncodebooks, self.ncentroids)) # print("Q shape: ", Q.shape) for i, q in enumerate(Q): lut = _fit_pq_lut(q, centroids=self.centroids, elemwise_dist_func=self.elemwise_dist_func) if self.quantize_lut and quantize: lut = np.maximum(0, lut - self.lut_offsets) lut = np.floor(lut * self.scale_by).astype(np.int) lut = np.minimum(lut, 255) luts[i] = lut.T return luts def encode_X(self, X, **sink): X = self._pad_ncols(X) if self.preproc == 'OPQ': X = pq.opq_rotate(X, self.R) elif self.preproc == 'BOPQ': X = pq.bopq_rotate(X, self.rotations) elif self.preproc == 'GEHT': X = X[:, self.perm] if self.encode_algo in ('splits', 'multisplits'): split_type = ('multi' if self.encode_algo == 'multisplits' else 'single') idxs = clusterize.encode_using_splits( X, self.subvect_len, self.splits_lists, split_type=split_type) else: idxs = pq._encode_X_pq(X, codebooks=self.centroids) return idxs + self.offsets # offsets let us index into raveled dists # ------------------------------------------------ Mithral # def _mithral_quantize_luts(luts, lut_work_const, force_power_of_2=False): def _mithral_quantize_luts(luts, lut_work_const, force_power_of_2=True): nqueries, ncodebooks, ncentroids = luts.shape # if lut_work_const < 0: # not time constrained # assert luts.shape == (nqueries, ncodebooks, ncentroids) # luts2d = np.moveaxis(luts, 2, 1) # assert luts2d.shape == (nqueries, ncentroids, ncodebooks) # luts2d = luts2d.reshape(nqueries * ncentroids, ncodebooks) # # if True: # if False: # # ax = sb.distplot(luts.ravel(), hist=False, rug=True) # _, ax = plt.subplots(1, figsize=(13, 5)) # # sb.violinplot(data=luts2d, inner='point', ax=ax) # # sb.boxenplot(data=luts2d, ax=ax) # means = luts2d.mean(axis=0) # # # rm largest and smallest entry in each col # # argmaxs = np.argmax(luts2d, axis=0) # # argmins = np.argmax(luts2d, axis=0) # # for c in range(luts.shape[1]): # # luts2d[argmins[c], c] = means[c] # # luts2d[argmaxs[c], c] = means[c] # maxs = luts2d.max(axis=0) # mins = luts2d.min(axis=0) # gaps = maxs - mins # max_idx = np.argmax(gaps) # print(f"biggest gap = {np.max(gaps)} at idx {max_idx}") # gaps[max_idx] = 0 # max_idx = np.argmax(gaps) # print(f"2nd biggest gap = {np.max(gaps)} at idx {max_idx}") # gaps[max_idx] = 0 # max_idx = np.argmax(gaps) # print(f"3rd biggest gap = {np.max(gaps)} at idx {max_idx}") # gaps[max_idx] = 0 # max_idx = np.argmax(gaps) # print(f"4th biggest gap = {np.max(gaps)} at idx {max_idx}") # gaps[max_idx] = 0 # max_idx = np.argmax(gaps) # print(f"5th biggest gap = {np.max(gaps)} at idx {max_idx}") # # for i in range(len(luts2d)): # # row = luts2d[i] # # luts2d[i, row == mins] = means # # luts2d[i, row == maxs] = means # luts2d -= mins # # luts2d -= means # # luts2d *= 255 / (maxs - mins).max() # luts2d *= 255 / gaps.max() # luts2d = np.minimum(luts2d, 255) # sb.stripplot(data=luts2d, ax=ax, size=4) # ax.set_xlabel('Query dist to centroids (lut dist histogram)') # ax.set_ylabel('Fraction of queries') # plt.show() # import sys; sys.exit() # offsets, scale, _ = _learn_best_quantization(luts2d) # offsets = offsets[np.newaxis, :, np.newaxis] # luts = np.maximum(0, luts - offsets) * scale # luts = np.floor(luts).astype(np.int) # luts = np.minimum(255, luts) # return luts, offsets.sum(), scale # luts = np.zeros((Q.shape[0], self.ncodebooks, self.ncentroids)) mins = luts.min(axis=(0, 2)) maxs = luts.max(axis=(0, 2)) gaps = maxs - mins # gaps[np.argmax(gaps)] = 0 # use 2nd highest gap = np.max(gaps) if force_power_of_2: exponent = np.ceil(np.log2(gap)) scale = 2 ** int(-exponent) # scale is a power of 2, so can just shift scale *= (255.5 - 1e-10) # so max val is at most 255 else: scale = (255.5 - 1e-10) / gap offsets = mins[np.newaxis, :, np.newaxis] luts_quantized = (luts - offsets) * scale luts_quantized = (luts_quantized + .5).astype(np.int) # luts_quantized = np.minimum(luts_quantized, 255) assert np.min(luts_quantized) >= 0 assert np.max(luts_quantized) <= 255. # print("total offset: ", mins.sum()) return luts_quantized, offsets.sum(), scale # # compute offset taking into account stuff getting rounded down # luts_hat = (luts / scale) + offsets # diffs = luts - luts_hat # print("mean of diffs: ", diffs.mean()) # offset = diffs.mean() + offsets.sum() # return luts_quantized, offset, scale class MithralEncoder(MultiCodebookEncoder): def __init__(self, ncodebooks, lut_work_const=-1): super().__init__( ncodebooks=ncodebooks, ncentroids=16, # quantize_lut=True, upcast_every=64, # quantize_lut=True, upcast_every=32, quantize_lut=True, upcast_every=16, # quantize_lut=True, upcast_every=8, # quantize_lut=True, upcast_every=4, # quantize_lut=True, upcast_every=2, # quantize_lut=True, upcast_every=1, accumulate_how='mean') self.lut_work_const = lut_work_const def name(self): return "{}_{}".format('mithral', super().name()) def params(self): return {'ncodebooks': self.ncodebooks, 'lut_work_const': self.lut_work_const} def fit(self, X, Q=None): self.splits_lists, self.centroids = clusterize.learn_mithral( X, self.ncodebooks, lut_work_const=self.lut_work_const) # self._learn_lut_quantization(X, Q) def encode_X(self, X): idxs = clusterize.mithral_encode(X, self.splits_lists) return idxs + self.offsets def encode_Q(self, Q, quantize=True): Q = np.atleast_2d(Q) luts = np.zeros((Q.shape[0], self.ncodebooks, self.ncentroids)) for i, q in enumerate(Q): luts[i] = clusterize.mithral_lut(q, self.centroids) if self.quantize_lut: luts, offset, scale = _mithral_quantize_luts(luts, self.lut_work_const) return luts, offset, scale return luts, 0, 1 def main(): X = np.ones((3, 75), dtype=np.int) _insert_zeros(X, 53) if __name__ == '__main__': main()
bolt-master
experiments/python/vquantizers.py
#!/bin/env/python import os import numpy as np import matplotlib.pyplot as plt import seaborn as sb import pandas as pd import pathlib as pl # from . import files from . import amm_results as res from . import amm_methods as ameth sb.set_context('poster') # sb.set_context('talk') # sb.set_cmap('tab10') RESULTS_DIR = pl.Path('results/amm') FIGS_SAVE_DIR = pl.Path('../figs/amm') if not os.path.exists(FIGS_SAVE_DIR): FIGS_SAVE_DIR.mkdir(parents=True) def save_fig(name): plt.savefig(os.path.join(FIGS_SAVE_DIR, name + '.png'), dpi=300, bbox_inches='tight') def _xlabel_for_xmetric(x_metric): return {'d': 'Sketch Size', 'secs': 'Time (s)', 'muls': 'Number of Multiplies', 'nlookups': 'Number of Lookups', 'ops': 'Number of Operations', 'Latency': 'Latency (ms)', 'Throughput': 'Throughput (elements/s)'}[x_metric] # if x_metric == 'd': # return 'Log2(Sketch Size)' # elif x_metric == 'secs': # return 'Time (s)' # elif x_metric == 'muls': # # return 'Log10(# of Multiplies)' # return 'Number of Multiplies' # elif x_metric == 'nlookups': # # return 'Log10(# of Table Lookups)' # return 'Number of Table Lookups' # elif x_metric == 'ops': # # return 'Log10(# of Operations)' # return 'Number of Operations' # elif x_metric == 'Latency': # return 'Latency (ms)' def _clean_results_df(df, default_D=None): # for Exact, set d = D if default_D is not None and ('d' in df): mask = df['d'].isna() df.loc[mask, 'd'] = default_D # clean up column names + other strings for old, new in [('method', 'Method'), ('acc_amm', 'Accuracy'), ('r_sq', 'R-Squared'), ('nmultiplies', 'muls')]: try: df.rename({old: new}, axis=1, inplace=True) except KeyError: pass # replace_dict = {'Bolt+MultiSplits': 'Ours', # replace_dict = {'Mithral': 'Ours', replace_dict = {'Mithral': 'Ours', 'MithralPQ': 'OursPQ', 'Exact': 'Brute Force', 'CooccurSketch': 'CD'} # def _replace_method_name(name): # return replace_dict.get(name, name) df['Method'] = df['Method'].apply(lambda s: replace_dict.get(s, s)) # create ops column that sums number of multiplies + lookups df['muls'] = df['muls'].fillna(0) mask = ~df['nlookups'].isna() df['ops'] = df['muls'] df['ops'].loc[mask] += df['nlookups'].loc[mask] # df['muls'] = np.log10(df['muls']) # df['ops'] = np.log10(df['ops']) # join with cpp timing results matmul_latencies, matmul_thruputs = res.load_matmul_times_for_n_d_m() sketch_latencies, sketch_thruputs = res.load_sketch_times_for_n_d_m() # multisplit_latencies, multisplit_thruputs = \ # res.load_multisplit_times_for_n_d_m() mithral_latencies, mithral_thruputs = res.load_mithral_times_for_n_d_m() bolt_latencies, bolt_thruputs = res.load_bolt_times_for_n_d_m() # row_dicts = [] all_latencies = [] all_thruputs = [] # for _, row in df.itertuples(): # print("d col: ") # print(df['d']) fast_sketch_methods = set([m.lower() for m in ameth.FAST_SKETCH_METHODS]) slow_sketch_methods = set([m.lower() for m in ameth.SLOW_SKETCH_METHODS]) for _, row in df.iterrows(): # row = dict(*row) N, D, M = [int(row[k]) for k in ('N', 'D', 'M')] method = row['Method'].lower() # if 'split' in method.lower(): # print("using method: ", method) if method in ('bolt', 'ours', 'ourspq'): # TODO check if in vq methods, instead of hardcoding ncodebooks = int(row['ncodebooks']) key = (N, D, M, ncodebooks) if method in ('ours', 'ourspq'): # latencies = multisplit_latencies[key] # thruputs = multisplit_thruputs[key] latencies = mithral_latencies[key] thruputs = mithral_thruputs[key] elif method == 'bolt': latencies = bolt_latencies[key] thruputs = bolt_thruputs[key] # all_latencies.append(np.median(latencies)) # all_thruputs.append(np.median(thruputs)) elif method == 'brute force': key = (N, D, M) latencies = matmul_latencies[key] thruputs = matmul_thruputs[key] elif method in fast_sketch_methods: d = int(row['d']) key = (N, D, M, d) latencies = sketch_latencies[key] thruputs = sketch_thruputs[key] else: # slow sketch-based methods # print("method: ", method) # assert method in slow_sketch_methods # print("method: ", method) # print("fast sketch methods: ", fast_sketch_methods) # assert False # TODO rm secs = row['secs'] lat = secs * 1000 thruput = N * M / secs latencies = [lat] thruputs = [thruput] # print("d: ", d) # print("key:", key) # print("sketch_latencies:") # import pprint # pprint.pprint(sketch_latencies) # secs = row['secs'] # lat = secs * 1000 # thruput = N * M / secs # # # version where we pretend same efficiency as matmul # # nmuls = int(row['muls']) # # exact_nmuls = N * D * M # # scale = nmuls / exact_nmuls # # lat *= scale # # thruput /= scale # all_latencies.append(lat) # all_thruputs.append(thruput) all_latencies.append(np.mean(latencies)) all_thruputs.append(np.mean(thruputs)) # print("len latencies: ", len(all_latencies)) # print("len thruputs: ", len(all_thruputs)) # print("df len: ", df.shape[0]) df['Latency'] = all_latencies df['Throughput'] = all_thruputs print("cleaned df:\n", df) # print(df) # print(df.loc[:11]) # print(df.loc[10:]) # for row in df.iterrows(): # print(row) # import sys; sys.exit() # make stuff log scale # if 'd' in df: # df['d'] = np.log2(df['d']).astype(np.int32) df['Log10(MSE)'] = np.log10(1. - df['R-Squared'] + 1e-10) df = df.sort_values('Method', axis=0) return df def make_cifar_fig(x_metric='d', y_metric='Accuracy'): # fig, axes = plt.subplots(2, 1, figsize=(6, 9), sharex=True) fig, axes = plt.subplots(2, 1, figsize=(11, 13.5), sharex=True) df10 = pd.read_csv(RESULTS_DIR / 'cifar10.csv') df100 = pd.read_csv(RESULTS_DIR / 'cifar100.csv') # dfs = (df10, df100) # for df in dfs: df10 = df10.loc[~(df10['ncodebooks'] < 4)] df100 = df100.loc[~(df100['ncodebooks'] < 4)] # if x_metric in ('Latency', 'Throughput'): # # TODO get results for PQ + Bolt # # df10 = df10.loc[~df10['method'].isin(['PQ', 'Bolt'])] # # include_methods = ('Bolt+MultiSplits', 'Bolt', 'Exact') # include_methods = ['Bolt+MultiSplits', 'Bolt', 'Exact'] # include_methods += 'PQ SVD FD-AMM CooccurSketch'.split() # TODO rm # # print("uniq methods: ", df10['method'].unique()) # # df10 = df10.loc[~df10['method'].isin(['PQ'])] # df10 = df10.loc[df10['method'].isin(include_methods)] # # df100 = df100.loc[~df100['method'].isin(['PQ', 'Bolt'])] # # df100 = df100.loc[~df100['method'].isin(['PQ'])] # df100 = df100.loc[df100['method'].isin(include_methods)] df10 = _clean_results_df(df10, default_D=512) df100 = _clean_results_df(df100, default_D=512) def lineplot(data, ax): # order = 'Ours Bolt Exact PQ SVD FD-AMM CD'.split() # order = [m for m in order if m in data['Method'].unique()] order = list(data['Method'].unique()) move_methods_to_front = ['Ours', 'OursPQ', 'Brute Force'] for elem in move_methods_to_front[:]: if elem in order: order.remove(elem) else: move_methods_to_front.remove(elem) order = move_methods_to_front + order # order = None # print("uniq methods:\n", data['Method'].unique()) # print("using order:\n", order) # cmap = plt.get_cmap('tab10') # palette = {'Ours': 'red', 'Bolt': cmap(0), 'Exact': cmap(1), # 'PQ': cmap(2), 'SVD': cmap(4), 'FD-AMM': cmap(5), # 'CD': cmap(6)} palette = None # have to specify markers or seaborn freaks out because it doesn't # have enough of them filled_markers = ('o', 'v', '^', '<', '>', '8', 's', 'p', '*', 'h', 'H', 'D', 'd', 'P', 'X') sb.lineplot(data=data, x=x_metric, y=y_metric, hue='Method', style='Method', style_order=order, hue_order=order, # markers=True, dashes=False, ax=ax, palette=palette) markers=filled_markers, dashes=False, ax=ax, palette=palette) # palette='tab10') lineplot(df10, axes[0]) lineplot(df100, axes[1]) # plt.suptitle('Sketch size vs Classification Accuracy') xlbl = _xlabel_for_xmetric(x_metric) # plt.suptitle('{} vs {}'.format(xlbl, y_metric)) plt.suptitle('Approximating Softmax Layers') axes[0].set_title('CIFAR-10') for ax in axes: ax.set_ylabel(y_metric) axes[0].set_xlabel(None) axes[1].set_xlabel(xlbl) axes[1].set_title('CIFAR-100') handles, labels = axes[0].get_legend_handles_labels() handles, labels = handles[1:], labels[1:] # rm 'Method' title axes[0].legend(handles, labels, fontsize='small') # axes[1].legend(handles, labels, fontsize='small') # plt.figlegend(handles, labels, loc='lower center', ncol=1) # plt.figlegend(handles, labels, loc='center right', ncol=1) axes[1].get_legend().remove() # axes[1].get_legend().remove() if x_metric in ('muls', 'ops', 'nlookups', 'Latency', 'Throughput'): axes[0].semilogx() plt.tight_layout() # plt.subplots_adjust(top=.92, bottom=.2) plt.subplots_adjust(top=.92, bottom=.22) save_fig('cifar_{}_{}'.format(x_metric, y_metric)) # def make_ecg_fig(y_metric='R-Squared'): def make_ecg_fig(x_metric='d'): fig, axes = plt.subplots(2, 1, figsize=(6, 9)) df = pd.read_csv(RESULTS_DIR / 'ecg.csv') df = _clean_results_df(df, default_D=24) # D = 24 # if 'd' in df: # mask = df['d'].isna() # df.loc[mask, 'd'] = D # df['d'] = np.log2(df['d']) # df.rename({'method': 'Method', 'acc_amm': 'Accuracy', # 'r_sq': 'R-Squared', 'nmultiplies': 'muls'}, # axis=1, inplace=True) # df['Log10(MSE)'] = np.log10(1. - df['R-Squared'] + 1e-10) # avoid log10(0) # df['muls'] = df['muls'].fillna(0) # df['nlookups'] = df['nlookups'].fillna(0) # # mask = ~df['nlookups'].isna() # # print("mask: ", mask) # # print('muls, nlookups') # # print(df[['muls', 'nlookups']]) # # add_to_muls = df['nlookups'].loc[mask] # equivalent_muls = df['muls'].add(df['nlookups']) # # df['muls'] = equivalent_muls # df['muls'] = equivalent_muls # # import sys; sys.exit() # df['muls'] = np.log10(df['muls']) df['Compression Ratio'] = df['nbytes_orig'] / df['nbytes_blosc_byteshuf'] def lineplot(data, ycol, ax): sb.lineplot(data=data, hue='Method', x=x_metric, y=ycol, style='Method', markers=True, dashes=False, ax=ax) lineplot(df, ycol='R-Squared', ax=axes[0]) lineplot(df, ycol='Compression Ratio', ax=axes[1]) xlbl = _xlabel_for_xmetric(x_metric) axes[0].set_title('ECG: {} vs R-Squared'.format(xlbl)) axes[1].set_title('ECG: {} vs Compression Ratio'.format(xlbl)) axes[0].set_ylim([0, 1]) axes[0].set_ylabel('R-Squared') axes[1].set_ylabel('Compression Ratio') axes[1].set_xlabel(xlbl) if x_metric in ('muls', 'ops', 'nlookups'): axes[0].semilogx() # axes[0].semilogx() plt.tight_layout() plt.subplots_adjust(top=.92, bottom=.2) save_fig('ecg_{}'.format(x_metric)) def make_caltech_fig(x_metric='d'): """x_metric should be in {'d', 'secs', 'muls'}""" fig, ax = plt.subplots(1, 1, figsize=(6, 6)) df = pd.read_csv(RESULTS_DIR / 'caltech.csv') df = _clean_results_df(df, default_D=27) sb.lineplot(data=df, hue='Method', x=x_metric, y='Log10(MSE)', style='Method', markers=True, dashes=False, ax=ax) ax.set_ylabel('Log10(MSE + 1e-10)') if x_metric == 'd': ax.set_title('Caltech: Sketch Size vs Log Squared Error') ax.set_xlabel('Log2(Sketch Size)') elif x_metric == 'secs': ax.set_title('Caltech: Computation Time vs Log Squared Error') ax.set_xlabel('Time (s)') elif x_metric == 'muls': ax.set_title('Caltech: # of Multiplies vs Log Squared Error') ax.set_xlabel('Log10(# of Multiplies)') plt.tight_layout() plt.subplots_adjust(top=.92, bottom=.2) save_fig('caltech_{}'.format(x_metric)) def main(): # for x_metric in 'd secs muls'.split(): # for x_metric in ['muls']: # for y_metric in ('Accuracy', 'R-Squared'): # make_cifar_fig(x_metric, y_metric) # make_cifar_fig('d', 'Accuracy') # make_cifar_fig('muls', 'Accuracy') make_cifar_fig('ops', 'Accuracy') make_cifar_fig('Latency', 'Accuracy') make_cifar_fig('Throughput', 'Accuracy') # make_cifar_fig('Accuracy') # make_cifar_fig('Accuracy') # make_cifar_fig('R-Squared') # make_ecg_fig(x_metric='d') # make_ecg_fig(x_metric='secs') # make_ecg_fig(x_metric='muls') # make_caltech_fig(x_metric='d') # make_caltech_fig(x_metric='secs') # make_caltech_fig(x_metric='muls') print("done") if __name__ == '__main__': main()
bolt-master
experiments/python/amm_figs.py
#!/usr/bin/env python import time import numpy as np from .utils import kmeans, orthonormalize_rows, random_rotation from joblib import Memory _memory = Memory('.', verbose=0) # ================================================================ PQ @_memory.cache def learn_pq(X, ncentroids, nsubvects, subvect_len, max_kmeans_iters=16): codebooks = np.empty((ncentroids, nsubvects, subvect_len)) assignments = np.empty((X.shape[0], nsubvects), dtype=np.int) # print "codebooks shape: ", codebooks.shape for i in range(nsubvects): start_col = i * subvect_len end_col = start_col + subvect_len X_in = X[:, start_col:end_col] centroids, labels = kmeans(X_in, ncentroids, max_iter=max_kmeans_iters) codebooks[:, i, :] = centroids assignments[:, i] = labels return codebooks, assignments # [2**nbits x M x D/M], [N x M] def reconstruct_X_pq(assignments, codebooks): """assignments: N x M ints; codebooks: 2**nbits x M x D/M floats""" _, M = assignments.shape subvect_len = codebooks.shape[2] assert assignments.shape[1] == codebooks.shape[1] D = M * subvect_len pointsCount = assignments.shape[0] points = np.zeros((pointsCount, D), dtype=np.float32) for i in range(M): subspace_start = subvect_len * i subspace_end = subspace_start + subvect_len subspace_codes = assignments[:, i] points[:, subspace_start:subspace_end] = codebooks[subspace_codes, i, :] return points def _dists_elemwise_sq(x, q): diffs = x - q return diffs * diffs def _dists_elemwise_l1(x, q): return np.abs(x - q) def _encode_X_pq(X, codebooks, elemwise_dist_func=_dists_elemwise_sq): ncentroids, nsubvects, subvect_len = codebooks.shape assert X.shape[1] == (nsubvects * subvect_len) idxs = np.empty((X.shape[0], nsubvects), dtype=np.int) X = X.reshape((X.shape[0], nsubvects, subvect_len)) for i, row in enumerate(X): row = row.reshape((1, nsubvects, subvect_len)) dists = elemwise_dist_func(codebooks, row) dists = np.sum(dists, axis=2) idxs[i, :] = np.argmin(dists, axis=0) return idxs # [N x nsubvects] def compute_reconstruction_error(X, X_hat, subvect_len=-1): diffs = X - X_hat diffs_sq = diffs * diffs if subvect_len > 0: errs = [] for i in range(0, diffs_sq.shape[1], subvect_len): errs_block = diffs_sq[:, i:i+subvect_len] errs.append(np.mean(errs_block)) print(" errors in each block: {} ({})".format( np.array(errs), np.sum(errs))) X_bar = X - np.mean(X, axis=0) col_sses = np.sum(X_bar * X_bar, axis=0) + 1e-14 tot_sse_using_mean = np.sum(col_sses) errors = np.mean(diffs_sq, axis=1) # variances = np.var(X, axis=1) # return np.mean(errors) / np.mean(variances) return np.mean(errors) / (tot_sse_using_mean / X_bar.size) # ================================================================ Gaussian OPQ # https://github.com/yahoo/lopq/blob/master/python/lopq/model.py; see # https://github.com/yahoo/lopq/blob/master/LICENSE. For this function only: # # Copyright 2015, Yahoo Inc. # Licensed under the terms of the Apache License, Version 2.0. # See the LICENSE file associated with the project for terms. # @_memory.cache def eigenvalue_allocation(num_buckets, eigenvalues, shuffle=False): """ Compute a permutation of eigenvalues to balance variance accross buckets of dimensions. Described in section 3.2.4 in http://research.microsoft.com/pubs/187499/cvpr13opq.pdf Note, the following slides indicate this function will break when fed eigenvalues < 1 without the scaling trick implemented below: https://www.robots.ox.ac.uk/~vgg/rg/slides/ge__cvpr2013__optimizedpq.pdf :param int num_buckets: the number of dimension buckets over which to allocate eigenvalues :param ndarray eigenvalues: a vector of eigenvalues :param bool shuffle: whether to randomly shuffle the order of resulting buckets :returns ndarray: a vector of indices by which to permute the eigenvectors """ D = len(eigenvalues) dims_per_bucket = D // num_buckets eigenvalue_product = np.zeros(num_buckets, dtype=float) bucket_size = np.zeros(num_buckets, dtype=int) permutation = np.zeros((num_buckets, dims_per_bucket), dtype=int) # We first must scale the eigenvalues by dividing by their # smallets non-zero value to avoid problems with the algorithm # when eigenvalues are less than 1. min_non_zero_eigenvalue = np.min(np.abs(eigenvalues[np.nonzero(eigenvalues)])) eigenvalues = eigenvalues / min_non_zero_eigenvalue # this is not actually a requirement, but I'm curious about whether this # condition is ever violated if not np.all(eigenvalues > 0): print("WARNING: some eigenvalues were nonpositive") # Iterate eigenvalues in descending order sorted_inds = np.argsort(eigenvalues)[::-1] log_eigs = np.log2(abs(eigenvalues)) for ind in sorted_inds: # Find eligible (not full) buckets eligible = (bucket_size < dims_per_bucket).nonzero() # Find eligible bucket with least eigenvalue product i = eigenvalue_product[eligible].argmin(0) bucket = eligible[0][i] # Update eigenvalue product for this bucket eigenvalue_product[bucket] = eigenvalue_product[bucket] + log_eigs[ind] # Store bucket assignment and update size permutation[bucket, bucket_size[bucket]] = ind bucket_size[bucket] += 1 if shuffle: shuffle_idxs = np.arange(num_buckets, dtype=np.int) np.random.shuffle(shuffle_idxs) permutation = permutation[shuffle_idxs] # wow, these are within <1% of each other # print "opq eigenvalue log prods: ", eigenvalue_product return np.reshape(permutation, D) def learn_opq_gaussian_rotation(X_train, ncodebooks, shuffle=False): means = np.mean(X_train, axis=0) cov = np.dot(X_train.T, X_train) - np.outer(means, means) eigenvals, eigenvects = np.linalg.eigh(cov) order_idxs = eigenvalue_allocation(ncodebooks, eigenvals, shuffle=shuffle) assert len(order_idxs) == X_train.shape[1] return eigenvects[:, order_idxs].T # rows are projections # ================================================================ OPQ def _update_centroids_opq(X, assignments, ncentroids): # [N x D], [N x M] nsubvects = assignments.shape[1] subvect_len = X.shape[1] // nsubvects assert X.shape[0] == assignments.shape[0] assert X.shape[1] % nsubvects == 0 codebooks = np.zeros((ncentroids, nsubvects, subvect_len), dtype=np.float32) for i, row in enumerate(X): for m in range(nsubvects): start_col = m * subvect_len end_col = start_col + subvect_len codebooks[assignments[i, m], m, :] += row[start_col:end_col] for m in range(nsubvects): code_counts = np.bincount(assignments[:, m], minlength=ncentroids) codebooks[:, m] /= np.maximum(code_counts, 1).reshape((-1, 1)) # no div by 0 return codebooks class NumericalException(Exception): pass def _debug_rotation(R): D = np.max(R.shape) identity = np.identity(D, dtype=np.float32) RtR = np.dot(R.T, R) R_det = np.linalg.det(RtR) print("determinant of R*R: ", R_det) R_trace = np.trace(RtR) print("trace of R*R, trace divided by D: {}, {}".format(R_trace, R_trace / D)) off_diagonal_abs_mean = np.mean(np.abs(RtR - identity)) print("mean(abs(off diagonals of R*R)): ", off_diagonal_abs_mean) if R_det < .999 or R_det > 1.001: raise NumericalException("Bad determinant") if R_trace < .999 * D or R_trace > 1.001 * D: raise NumericalException("Bad trace") if off_diagonal_abs_mean > .001: raise NumericalException("Bad off-diagonals") def opq_rotate(X, R): # so other code need not know what to transpose return np.dot(np.atleast_2d(X), R.T) def opq_undo_rotate(X, R): # so other code need not know what to transpose return np.dot(np.atleast_2d(X), R) # @_memory.cache def opq_initialize(X_train, ncodebooks, init='gauss'): X = X_train _, D = X.shape if init == 'gauss' or init == 'gauss_flat' or init == 'gauss_shuffle': permute = (init == 'gauss_shuffle') R = learn_opq_gaussian_rotation(X_train, ncodebooks, shuffle=permute) R = R.astype(np.float32) if init == 'gauss_flat': # assert R.shape[0] == R.shape[1] D = R.shape[1] d = D // ncodebooks assert d * ncodebooks == D # same # of dims in each subspace local_r = random_rotation(int(d)) tiled = np.zeros((D, D)) for c in range(ncodebooks): start = c * d end = start + d tiled[start:end, start:end] = local_r R = np.dot(R, tiled) X_rotated = opq_rotate(X, R) elif init == 'identity': R = np.identity(D, dtype=np.float32) # D x D X_rotated = X elif init == 'random': R = np.random.randn(D, D).astype(np.float32) R = orthonormalize_rows(R) X_rotated = opq_rotate(X, R) else: raise ValueError("Unrecognized initialization method: ".format(init)) return X_rotated, R # loosely based on: # https://github.com/arbabenko/Quantizations/blob/master/opqCoding.py @_memory.cache def learn_opq(X_train, ncodebooks, codebook_bits=8, niters=10, initial_kmeans_iters=1, init='gauss', debug=False): """init in {'gauss', 'identity', 'random'}""" print("OPQ: Using init '{}'".format(init)) t0 = time.time() X = X_train.astype(np.float32) N, D = X.shape ncentroids = int(2**codebook_bits) subvect_len = D // ncodebooks assert D % subvect_len == 0 # equal number of dims for each codebook X_rotated, R = opq_initialize(X_train, ncodebooks=ncodebooks, init=init) # initialize codebooks by running kmeans on each rotated dim; this way, # setting niters=0 corresponds to normal PQ codebooks, assignments = learn_pq(X_rotated, ncentroids=ncentroids, nsubvects=ncodebooks, subvect_len=subvect_len, max_kmeans_iters=1) for it in np.arange(niters): # compute reconstruction errors X_hat = reconstruct_X_pq(assignments, codebooks) # err = compute_reconstruction_error(X_rotated, X_hat, subvect_len=subvect_len) err = compute_reconstruction_error(X_rotated, X_hat) print("---- OPQ {}x{}b iter {}: mse / variance = {:.5f}".format( ncodebooks, codebook_bits, it, err)) # update rotation matrix based on reconstruction errors U, s, V = np.linalg.svd(np.dot(X_hat.T, X), full_matrices=False) R = np.dot(U, V) # update centroids using new rotation matrix X_rotated = opq_rotate(X, R) assignments = _encode_X_pq(X_rotated, codebooks) codebooks = _update_centroids_opq(X_rotated, assignments, ncentroids) X_hat = reconstruct_X_pq(assignments, codebooks) err = compute_reconstruction_error(X_rotated, X_hat) t = time.time() - t0 print("---- OPQ {}x{}b final mse / variance = {:.5f} ({:.3f}s)".format( ncodebooks, codebook_bits, err, t)) return codebooks, assignments, R # ================================================================ Block OPQ def bopq_rotate(X, rotations): X = np.atleast_2d(X) _, D = X.shape R_sz = len(rotations[0]) nrots = int(D / R_sz) assert nrots == len(rotations) rot_starts = R_sz * np.arange(nrots) rot_ends = rot_starts + R_sz X_out = np.copy(X) for i, R in enumerate(rotations): start, end = rot_starts[i], rot_ends[i] X_out[:, start:end] = np.dot(X[:, start:end], R.T) return X_out @_memory.cache # opq with block diagonal rotations def learn_bopq(X_train, ncodebooks, codebook_bits=4, niters=20, initial_kmeans_iters=1, R_sz=16, **sink): t0 = time.time() X = X_train.astype(np.float32) N, D = X.shape ncentroids = int(2**codebook_bits) subvect_len = D // ncodebooks assert D % subvect_len == 0 # equal number of dims for each codebook # compute number of rotations and subspaces associated with each nrots = int(D / R_sz) rot_starts = R_sz * np.arange(nrots) rot_ends = rot_starts + R_sz # X_rotated, R = opq_initialize(X_train, ncodebooks=ncodebooks, init=init) X_rotated = X # hardcode identity init # TODO allow others rotations = [np.eye(R_sz) for i in range(nrots)] # initialize codebooks by running kmeans on each rotated dim; this way, # setting niters=0 corresponds to normal PQ codebooks, assignments = learn_pq(X_rotated, ncentroids=ncentroids, nsubvects=ncodebooks, subvect_len=subvect_len, max_kmeans_iters=1) for it in np.arange(niters): # compute reconstruction errors X_hat = reconstruct_X_pq(assignments, codebooks) # err = compute_reconstruction_error(X_rotated, X_hat, subvect_len=subvect_len) err = compute_reconstruction_error(X_rotated, X_hat) print("---- BOPQ {} {}x{}b iter {}: mse / variance = {:.5f}".format( R_sz, ncodebooks, codebook_bits, it, err)) rotations = [] for i in range(nrots): start, end = rot_starts[i], rot_ends[i] X_sub = X[:, start:end] X_hat_sub = X_hat[:, start:end] # update rotation matrix based on reconstruction errors U, s, V = np.linalg.svd(np.dot(X_hat_sub.T, X_sub), full_matrices=False) R = np.dot(U, V) rotations.append(R) X_rotated[:, start:end] = np.dot(X_sub, R.T) # update assignments and codebooks based on new rotations assignments = _encode_X_pq(X_rotated, codebooks) codebooks = _update_centroids_opq(X_rotated, assignments, ncentroids) X_hat = reconstruct_X_pq(assignments, codebooks) err = compute_reconstruction_error(X_rotated, X_hat) t = time.time() - t0 print("---- BOPQ {} {}x{}b final mse / variance = {:.5f} ({:.3f}s)".format( R_sz, ncodebooks, codebook_bits, err, t)) return codebooks, assignments, rotations
bolt-master
experiments/python/product_quantize.py
#!/bin/env/python import os import shutil def ls(dir='.'): return os.listdir(dir) def is_hidden(path): return os.path.basename(path).startswith('.') def is_visible(path): return not is_hidden(path) def join_paths(dir, contents): return [os.path.join(dir, f) for f in contents] def files_matching(dir, prefix=None, suffix=None, abs_paths=False, only_files=False, only_dirs=False, recursive=False, only_visible=False, only_hidden=False): files = os.listdir(dir) if recursive: abs_dir = dir paths = join_paths(abs_dir, files) for path in paths: if not os.path.isdir(path): continue matches = files_matching( path, prefix=prefix, suffix=suffix, abs_paths=abs_paths, only_files=only_files, only_dirs=only_dirs, recursive=True) matches = join_paths(path, matches) matches = [os.path.relpath(m, start=dir) for m in matches] files += matches if prefix: files = [f for f in files if f.startswith(prefix)] if suffix: files = [f for f in files if f.endswith(suffix)] if only_files or only_dirs: paths = join_paths(dir, files) if only_files: files = [f for f, p in zip(files, paths) if os.path.isfile(p)] if only_dirs: files = [f for f, p in zip(files, paths) if os.path.isdir(p)] if abs_paths: files = join_paths(os.path.abspath(dir), files) if only_visible: files = [f for f in files if is_visible(f)] if only_hidden: files = [f for f in files if is_hidden(f)] return sorted(files) def list_subdirs(dir, startswith=None, endswith=None, abs_paths=False, recursive=False, only_visible=False): return files_matching(dir, startswith, endswith, abs_paths, only_dirs=True, recursive=recursive, only_visible=only_visible) def list_files(dir, startswith=None, endswith=None, abs_paths=False, recursive=False, only_visible=False): return files_matching(dir, startswith, endswith, abs_paths, only_files=True, recursive=recursive, only_visible=only_visible) def remove(path): if os.path.exists(path): try: os.remove(path) except (OSError): shutil.rmtree(path) def force_create_dir(dir): if os.path.exists(dir): remove(dir) os.makedirs(dir) def ensure_dir_exists(dir_or_file): if '.' in os.path.basename(dir_or_file): # this looks like a file dirname = os.path.dirname(dir_or_file) else: dirname = dir_or_file if not os.path.exists(dirname): os.makedirs(dirname) def basename(f, noext=False): name = os.path.basename(f) if noext: name = name.split('.')[0] return name
bolt-master
experiments/python/datasets/files.py
#!/bin/env python from __future__ import absolute_import, division, print_function import numpy as np import os import PIL from PIL import Image from PIL import ImageOps # can't just do PIL.ImageOps for some reason from . import files # ================================ TODO rm duplicate code from imagenet.py # adapted from https://github.com/keras-team/keras-preprocessing/blob/master/ # keras_preprocessing/image/utils.py under MIT license def img_to_array(img, layout='nhwc', dtype='float32', mode='RGB'): """Converts a PIL Image instance to a Numpy array. # Arguments img: PIL Image instance. layout: Image data format, either "nchw" or "nhwc". dtype: Dtype to use for the returned array. # Returns A 3D Numpy array. # Raises ValueError: if invalid `img` or `layout` is passed. """ # print("img info:", img.format, img.size, img.mode) # if img.mode == 'L': if img.mode != mode: img = img.convert(mode=mode) if layout not in ('nchw', 'nhwc'): raise ValueError('Unknown layout: %s' % layout) # Numpy array x has format (height, width, channel) # or (channel, height, width) # but original PIL image has format (width, height, channel) x = np.asarray(img, dtype=dtype) if len(x.shape) == 3: if layout == 'nchw': x = x.transpose(2, 0, 1) elif len(x.shape) == 2: # print("x is only rank 2...WTF!?") if layout == 'nchw': x = x.reshape((1, x.shape[0], x.shape[1])) else: x = x.reshape((x.shape[0], x.shape[1], 1)) else: raise ValueError('Unsupported image shape: %s' % (x.shape,)) return x def resize_img(img, ratio_or_size): if ratio_or_size is None or np.max(ratio_or_size) < 0: return img try: nrows = ratio_or_size[0] ncols = ratio_or_size[1] nrows = img.height if nrows < 0 else nrows ncols = img.width if ncols < 0 else ncols except AttributeError: nrows = img.height * ratio_or_size ncols = img.width * ratio_or_size new_size = (nrows, ncols) is_downsampling = (nrows < img.height) or (ncols < img.width) interp = PIL.Image.LANCZOS if is_downsampling else PIL.Image.BICUBIC return img.resize(new_size, resample=interp) def crop_img(img, crop_how=None, new_size=(224, 224), resize_shorter_to=256): if crop_how is None: return img assert crop_how in ('center', 'square') height, width = img.height, img.width if (height == width) and (new_size is None): return img if crop_how == 'center': return center_crop(img, new_size=new_size, resize_shorter_to=resize_shorter_to) if new_size is None: new_width = min(width, height) new_height = new_width else: new_height, new_width = new_size assert new_width <= width assert new_height <= height left = (width - new_width) // 2 top = (height - new_height) // 2 # right = (width + new_width) // 2 # bottom = (height + new_height) // 2 right = left + new_width bottom = top + new_height return img.crop((left, top, right, bottom)) def center_crop(img, new_size=(224, 224), resize_shorter_to=256): height, width = img.height, img.width minsize = min(height, width) new_height = (height * resize_shorter_to) // minsize new_width = (width * resize_shorter_to) // minsize img = img.resize( (new_width, new_height), resample=Image.BICUBIC) assert min(new_width, new_height) == resize_shorter_to return crop_img(img, crop_how='square', new_size=new_size) def pad_img(img, pad_how='square', fill_value=0): if pad_how is None: return img assert pad_how == 'square' # no other kinds of cropping supported height, width = img.height, img.width if height == width: return img new_size = max(height, width) delta_w = new_size - width pad_left = delta_w // 2 pad_right = delta_w - pad_left delta_h = new_size - height pad_top = delta_h // 2 pad_bottom = delta_h - pad_top padding = pad_left, pad_top, pad_right, pad_bottom return ImageOps.expand(img, border=padding, fill=fill_value) def load_jpg(path, layout='nhwc', dtype=None, resample=None, crop=None, pad=None): img = PIL.Image.open(path) img = pad_img(img, pad) img = crop_img(img, crop) img = resize_img(img, ratio_or_size=resample) return img_to_array(img, layout=layout, dtype=dtype) # assumes one subdir for each class, with class name equal to subdir name # @_memory.cache def load_jpegs_from_dir(dirpath, remove_classes=None, require_suffix=None, layout='nhwc', dtype=None, resample=(224, 224), crop='center', pad=None, verbose=1, limit_per_class=None, only_return_path=False): subdirs = sorted(files.list_subdirs(dirpath, only_visible=True)) if remove_classes is not None: if isinstance(remove_classes, str): remove_classes = [remove_classes] for classname in remove_classes: subdirs.remove(classname) if verbose > 0: print("found {} classes in directory: {}".format(len(subdirs), dirpath)) classname_to_label = {name: i for i, name in enumerate(subdirs)} # noqa label_to_classname = {i: name for name, i in classname_to_label.items()} all_imgs = [] all_labels = [] for subdir in subdirs: subdir_path = os.path.join(dirpath, subdir) img_paths = files.list_files( subdir_path, endswith=require_suffix, abs_paths=True, only_visible=True) if limit_per_class is not None and limit_per_class > 0: img_paths = img_paths[:limit_per_class] if verbose > 1: print("loading {:4d} images for class '{}'".format( len(img_paths), subdir)) # not certain += [...] version was working label = classname_to_label[subdir] for i in range(len(img_paths)): all_labels.append(label) # all_labels += [] * len(img_paths) if only_return_path: imgs = img_paths else: imgs = [load_jpg(f, layout=layout, dtype=dtype, resample=resample, crop=crop, pad=pad)[np.newaxis, :, :, :] for f in img_paths] all_imgs += imgs if only_return_path: X = all_imgs else: try: # this works iff resampled/padded/cropped to same size X = np.concatenate(all_imgs, axis=0) except ValueError: # otherwise strip batch dim (so each image is 3D) X = [img.reshape(img.shape[1:]) for img in all_imgs] y = np.array(all_labels, dtype=np.int32) return (X, y), label_to_classname
bolt-master
experiments/python/datasets/image_utils.py
#!/bin/env python from __future__ import print_function import numpy as np import os import warnings import h5py from sklearn.datasets import load_digits import keras from keras.preprocessing import image # from python import imagenet, svhn, caltech # from python.datasets import caltech from . import imagenet from . import svhn from .data_utils import stratified_split_train_test from joblib import Memory _memory = Memory('.', verbose=1) # DATA_DIR = os.path.expanduser('~/Desktop/datasets/nn-search') DATA_DIR = os.path.expanduser('data') join = os.path.join DEFAULT_AUG_KWARGS = { 'shear_range': 0.2, 'zoom_range': 0.2, 'horizontal_flip': True } class LabeledDataset(object): __slots__ = 'name X_train y_train X_test y_test _collection'.split() def __init__(self, name, X_train, y_train, X_test=None, y_test=None): self.name = name self.X_train = X_train self.y_train = y_train self.X_test = X_test self.y_test = y_test def generators(self, batch_size, augment=True, preprocessing_function=None, aug_kwargs=None): _aug_kwargs = DEFAULT_AUG_KWARGS if aug_kwargs is not None: _aug_kwargs.update(aug_kwargs) if not augment: _aug_kwargs = {} nclasses = len(np.unique(self.y_train)) y_train = keras.utils.to_categorical(self.y_train, num_classes=nclasses) y_test = keras.utils.to_categorical(self.y_test, num_classes=nclasses) train_datagen = image.ImageDataGenerator( preprocessing_function=preprocessing_function, **_aug_kwargs) train_generator = train_datagen.flow( self.X_train, y_train, batch_size=batch_size) test_datagen = image.ImageDataGenerator( preprocessing_function=preprocessing_function) test_generator = test_datagen.flow( self.X_test, y_test, batch_size=batch_size) return train_generator, test_generator class HugeLabeledDataset(object): def __init__(self, name, train_dir, test_dir, train_nsamples=None, test_nsamples=None): self.name = name # self.train_dir = os.path.abspath(train_dir) # self.test_dir = os.path.abspath(test_dir) self.train_dir = train_dir self.test_dir = test_dir self.train_nsamples = int(train_nsamples or -1) self.test_nsamples = int(test_nsamples or -1) def generators(self, batch_size=None, augment=True, preprocessing_function=None, aug_kwargs=None, train_batch_size=None, test_batch_size=None, **flow_kwargs): _aug_kwargs = DEFAULT_AUG_KWARGS if aug_kwargs is not None: _aug_kwargs.update(aug_kwargs) if not augment: _aug_kwargs = {} flow_kwargs = flow_kwargs or {} flow_kwargs.setdefault('target_size', (224, 224)) flow_kwargs.setdefault('class_mode', 'categorical') train_generator = None test_generator = None if self.train_dir: train_batch_size = int(train_batch_size or batch_size) flow_kwargs['batch_size'] = train_batch_size print("HugeLabeledDataset: creating flow from train dir: ", self.train_dir) train_datagen = image.ImageDataGenerator( preprocessing_function=preprocessing_function, **_aug_kwargs) train_generator = train_datagen.flow_from_directory( self.train_dir, **flow_kwargs) if self.test_dir: test_batch_size = int(test_batch_size or batch_size) flow_kwargs['batch_size'] = test_batch_size print("HugeLabeledDataset: creating flow from test dir: ", self.test_dir) test_datagen = image.ImageDataGenerator( preprocessing_function=preprocessing_function) test_generator = test_datagen.flow_from_directory( self.test_dir, **flow_kwargs) return train_generator, test_generator class Random: UNIFORM = 'uniform' GAUSS = 'gauss' WALK = 'walk' BLOBS = 'blobs' DIGITS = 'Digits' MNIST = 'MNIST' FASHION_MNIST = 'FashionMNIST' CIFAR10 = 'Cifar10' CIFAR100 = 'Cifar100' SVHN = 'SVHN' CALTECH101 = 'Caltech101' CALTECH256 = 'Caltech256' CUB200 = 'CUB200' FLOWERS102 = 'Flowers102' INDOOR67 = 'Indoor67' IMAGENET_TINY = 'TinyImagenet' # 64x64, 200? classes IMAGENET_10_CLASSES = 'ImageNet-10-Classes' # full res, 10cls, 1k/cls IMAGENET_100_CLASSES = 'ImageNet-100-Classes' # full res, 100cls, 1k/cls IMAGENET_1_EXAMPLE = 'ImageNet-1-Example' # full res, 1k cls, 1/cls IMAGENET_10_EXAMPLES = 'ImageNet-10-Examples' # full res, 1k cls, 10/cls IMAGENET_25_EXAMPLES = 'ImageNet-25-Examples' # full res, 1k cls, 25/cls IMAGENET_50_EXAMPLES = 'ImageNet-50-Examples' # full res, 1k cls, 50/cls IMAGENET_100_EXAMPLES = 'ImageNet-100-Examples' # full res, 1k cls, 100/cls IMAGENET_64PX = 'ImageNet64' # 64x64, all examples IMAGENET = 'ImageNet' IMAGENET_ONE_OF_EACH = 'ImagenetOneOfEach' MINIPLACES = 'Miniplaces' ALL_IMAGENET_DATASETS = [ IMAGENET, IMAGENET_64PX, IMAGENET_TINY, IMAGENET_ONE_OF_EACH, IMAGENET_10_CLASSES, IMAGENET_100_CLASSES, IMAGENET_1_EXAMPLE, IMAGENET_10_EXAMPLES, IMAGENET_100_EXAMPLES] ALL_KERAS_DATASETS = [MNIST, CIFAR10, CIFAR100, FASHION_MNIST] def _load_file(fname, *args, **kwargs): fname = os.path.join(DATA_DIR, fname) print("trying to load file at path: {}".format(fname)) if fname.split('.')[-1] == 'txt': return np.loadtxt(fname, *args, **kwargs) return np.load(fname, *args, **kwargs) def _load_digits_X_y(ntrain=1000): X, y = load_digits(return_X_y=True) X_train, X_test = X[:ntrain], X[ntrain:] y_train, y_test = y[:ntrain], y[ntrain:] return LabeledDataset('Digits', X_train, y_train, X_test, y_test) # return X[:-nqueries], X[-nqueries:] # X, Q def _load_keras_dset(which_dataset): from keras import datasets as kd dataClass = {CIFAR10: kd.cifar10, CIFAR100: kd.cifar100, MNIST: kd.mnist, FASHION_MNIST: kd.fashion_mnist}[which_dataset] (X_train, y_train), (X_test, y_test) = dataClass.load_data() pretty_name = str(which_dataset).split('.')[-1].split("'")[0] return LabeledDataset(pretty_name, X_train, y_train, X_test, y_test) def load_imagenet_64(limit_ntrain=-1): # if we're not going to use the whole training set, don't even load in all # the files it's split into (necessary unless you have >18GB of free RAM) which_file_idxs = None if limit_ntrain > 0: nchunks = int(np.ceil( limit_ntrain / imagenet.IMAGENET_64_TRAIN_CHUNK_NSAMPLES)) which_file_idxs = np.arange(1, nchunks + 1) X_train, y_train = imagenet.load_train_data_64x64( which_file_idxs=which_file_idxs) X_test, y_test = imagenet.load_test_data_64x64() return LabeledDataset(IMAGENET_64PX, X_train, y_train, X_test, y_test, train_nsamples=1e6) def load_imagenet_tiny(): X_train, y_train = imagenet.load_train_data_tiny() X_test, y_test = imagenet.load_test_data_tiny() return LabeledDataset(IMAGENET_TINY, X_train, y_train, X_test, y_test) def load_imagenet_one_of_each(): X, y = imagenet.load_data_one_of_each() return LabeledDataset(IMAGENET_ONE_OF_EACH, X, y, X, y, train_nsamples=1e3) def load_imagenet(load_train=True, load_val=True): train_path = imagenet.IMAGENET_TRAIN_PATH if load_train else None test_path = imagenet.IMAGENET_TEST_PATH if load_val else None return HugeLabeledDataset( IMAGENET, train_path, test_path, train_nsamples=1281167, test_nsamples=50e3) def load_imagenet_10_classes(load_train=True, load_val=True): train_path = imagenet.IMAGENET_10_CLASSES_TRAIN_PATH if load_train else None test_path = imagenet.IMAGENET_10_CLASSES_TEST_PATH if load_val else None return HugeLabeledDataset( IMAGENET_10_CLASSES, train_path, test_path, train_nsamples=13000, test_nsamples=500) def load_imagenet_100_classes(load_train=True, load_val=True): train_path = imagenet.IMAGENET_100_CLASSES_TRAIN_PATH \ if load_train else None test_path = imagenet.IMAGENET_100_CLASSES_TEST_PATH if load_val else None return HugeLabeledDataset(IMAGENET_100_CLASSES, train_path, test_path, train_nsamples=129395, test_nsamples=5000) def load_imagenet_1_example(load_train=True, load_val=True): train_path = imagenet.IMAGENET_1_EXAMPLE_TRAIN_PATH \ if load_train else None test_path = imagenet.IMAGENET_TEST_PATH if load_val else None return HugeLabeledDataset(IMAGENET_10_EXAMPLES, train_path, test_path, train_nsamples=1e3, test_nsamples=50e3) def load_imagenet_10_examples(load_train=True, load_val=True): train_path = imagenet.IMAGENET_10_EXAMPLES_TRAIN_PATH \ if load_train else None test_path = imagenet.IMAGENET_TEST_PATH if load_val else None return HugeLabeledDataset(IMAGENET_10_EXAMPLES, train_path, test_path, train_nsamples=10e3, test_nsamples=50e3) def load_imagenet_25_examples(load_train=True, load_val=True): train_path = imagenet.IMAGENET_25_EXAMPLES_TRAIN_PATH \ if load_train else None test_path = imagenet.IMAGENET_TEST_PATH if load_val else None return HugeLabeledDataset(IMAGENET_25_EXAMPLES, train_path, test_path, train_nsamples=25e3, test_nsamples=50e3) def load_imagenet_50_examples(load_train=True, load_val=True): train_path = imagenet.IMAGENET_50_EXAMPLES_TRAIN_PATH \ if load_train else None test_path = imagenet.IMAGENET_TEST_PATH if load_val else None return HugeLabeledDataset(IMAGENET_50_EXAMPLES, train_path, test_path, train_nsamples=50e3, test_nsamples=50e3) def load_imagenet_100_examples(load_train=True, load_val=True): train_path = imagenet.IMAGENET_100_EXAMPLES_TRAIN_PATH \ if load_train else None test_path = imagenet.IMAGENET_TEST_PATH if load_val else None return HugeLabeledDataset(IMAGENET_10_EXAMPLES, train_path, test_path, train_nsamples=100e3, test_nsamples=50e3) def _load_miniplaces(): path = '/data/ddmg/neuro/datasets/Miniplaces/miniplaces.h5' with h5py.File(path, 'r') as hf: X_train = hf['X_train'][()] Y_train = hf['Y_train'][()] X_val = hf['X_val'][()] Y_val = hf['Y_val'][()] return LabeledDataset(MINIPLACES, X_train, Y_train, X_val, Y_val) def _load_svhn(): (X_train, y_train), (X_test, y_test) = svhn.load_data() return LabeledDataset(SVHN, X_train, y_train, X_test, y_test) def load_caltech101(): data_dir = '../datasets/caltech/101_ObjectCategories' return HugeLabeledDataset(CALTECH101, data_dir, None) # (X, y), _ = caltech.load_caltech101() # return LabeledDataset(IMAGENET_ONE_OF_EACH, X, y, X, y) def load_caltech256(): data_dir = '../datasets/caltech/256_ObjectCategories' return HugeLabeledDataset(CALTECH256, data_dir, None) # (X, y), _ = caltech.load_caltech256() # return LabeledDataset(IMAGENET_ONE_OF_EACH, X, y, X, y) def load_flowers102(): data_dir = '../datasets/flowers102' train_dir = os.path.join(data_dir, 'train') test_dir = os.path.join(data_dir, 'test') return HugeLabeledDataset(FLOWERS102, train_dir, test_dir, train_nsamples=1020, test_nsamples=6149) def load_cub200(): # note that this is 2011 version of CUB200 data_dir = '../datasets/cub200' train_dir = os.path.join(data_dir, 'train') test_dir = os.path.join(data_dir, 'test') return HugeLabeledDataset(CUB200, train_dir, test_dir, train_nsamples=5994, test_nsamples=5794) def load_indoor67(): # this is the subset with predefined train vs test split data_dir = '../datasets/indoor67' train_dir = os.path.join(data_dir, 'train') test_dir = os.path.join(data_dir, 'test') return HugeLabeledDataset(INDOOR67, train_dir, test_dir, train_nsamples=(67 * 80), test_nsamples=(67 * 20)) # @_memory.cache def load_dataset(which_dataset, norm_mean=False, norm_len=False, flatten=False, Ntrain=-1, Ntest=-1, ensure_channels=False, test_frac=None, scale_to_0_1=False): if which_dataset == DIGITS: dset = _load_digits_X_y() elif which_dataset in ALL_KERAS_DATASETS: dset = _load_keras_dset(which_dataset) elif which_dataset == IMAGENET_64PX: dset = load_imagenet_64(limit_ntrain=Ntrain) elif which_dataset == IMAGENET_TINY: dset = load_imagenet_tiny() elif which_dataset == IMAGENET_ONE_OF_EACH: dset = load_imagenet_one_of_each() elif which_dataset == MINIPLACES: dset = _load_miniplaces() elif which_dataset == SVHN: dset = _load_svhn() elif which_dataset == CALTECH101: return load_caltech101() elif which_dataset == CALTECH256: return load_caltech256() elif which_dataset == CUB200: return load_cub200() elif which_dataset == FLOWERS102: return load_flowers102() elif which_dataset == IMAGENET: return load_imagenet() elif which_dataset == IMAGENET_10_CLASSES: return load_imagenet_10_classes() elif which_dataset == IMAGENET_100_CLASSES: return load_imagenet_100_classes() elif which_dataset == IMAGENET_1_EXAMPLE: return load_imagenet_1_example() elif which_dataset == IMAGENET_10_EXAMPLES: return load_imagenet_10_examples() elif which_dataset == IMAGENET_25_EXAMPLES: return load_imagenet_25_examples() elif which_dataset == IMAGENET_50_EXAMPLES: return load_imagenet_50_examples() elif which_dataset == IMAGENET_100_EXAMPLES: return load_imagenet_100_examples() else: raise ValueError("unrecognized dataset {}".format(which_dataset)) if isinstance(dset, HugeLabeledDataset): # only has flow_from_directory() generators; no postprocessing # possible, so go ahead and return immediately return dset train_is_test = (dset.X_train.base is dset.X_test) or \ (dset.X_test.base is dset.X_train) train_test_equal = np.array_equal(dset.X_train[:10], dset.X_test[:10]) train_test_same = train_is_test or train_test_equal if train_test_same: if test_frac is None: warnings.warn("WARNING: Training data is also the test data! " "Reversing order of test data. Consider passing " "test_frac > 0 to automatically perform a " "stratified train-test split.") dset.X_test = dset.X_test[::-1] else: X_train, X_test, y_train, y_test = stratified_split_train_test( dset.X_train, dset.y_train, train_frac=(1. - test_frac)) dset = LabeledDataset(dset.name, X_train, y_train, X_test, y_test) train_is_test = False train_test_equal = False train_test_same = False if train_is_test: dset.X_test = np.copy(dset.X_test) dset.y_test = np.copy(dset.y_test) train_is_test = False if flatten: dset.X_train = dset.X_train.reshape(dset.X_train.shape[0], -1) dset.X_test = dset.X_test.reshape(dset.X_test.shape[0], -1) dset.X_train = dset.X_train.astype(np.float32) dset.X_test = dset.X_test.astype(np.float32) X_train = dset.X_train X_test = dset.X_test if Ntrain > 0: dset.X_train = X_train[:Ntrain] dset.y_train = dset.y_train[:Ntrain] if Ntest > 0: dset.X_test = np.copy(X_test[:Ntest]) dset.y_test = np.copy(dset.y_test[:Ntest]) if scale_to_0_1: min_X = min(np.min(dset.X_train), np.min(dset.X_test)) max_X = max(np.max(dset.X_train), np.max(dset.X_test)) dset.X_train = (dset.X_train - min_X) / max_X # if not train_is_test: dset.X_test = (dset.X_test - min_X) / max_X if norm_mean: means = np.mean(dset.X_train, axis=0) dset.X_train -= means # if not train_is_test: # don't subtract means twice from same array dset.X_test -= means if norm_len: dset.X_train /= np.linalg.norm(dset.X_train, axis=1, keepdims=True) # if not train_is_test: # don't divide by norms twice on same array dset.X_test /= np.linalg.norm(dset.X_test, axis=1, keepdims=True) if ensure_channels: import keras.backend as K # don't import keras unless we need it if len(X_train.shape) == 3: # no channels; e.g., MNIST img_rows, img_cols = X_train.shape[-2], X_train.shape[-1] # K.set_image_data_format('channels_last') # for argmax layer if K.image_data_format() == 'channels_first': dset.X_train = dset.X_train.reshape( X_train.shape[0], 1, img_rows, img_cols) dset.X_test = dset.X_test.reshape( X_test.shape[0], 1, img_rows, img_cols) else: dset.X_train = dset.X_train.reshape( X_train.shape[0], img_rows, img_cols, 1) dset.X_test = dset.X_test.reshape( X_test.shape[0], img_rows, img_cols, 1) return dset # if D_multiple_of > 1: # X_train = ensure_num_cols_multiple_of(X_train, D_multiple_of) # X_test = ensure_num_cols_multiple_of(X_test, D_multiple_of) # Q = ensure_num_cols_multiple_of(Q, D_multiple_of) # return X_train, Q, X_test, true_nn
bolt-master
experiments/python/datasets/image_classify.py
#!/bin/env python from __future__ import division, print_function import numpy as np # import pyedflib as edf # pip install pyedflib # import mne from . import paths from . import files ECG_DIR = paths.UCD_ECG NUM_RECORDINGS = 25 def main(): pass print("ecg dir: ", ECG_DIR) fpaths = files.list_files(ECG_DIR, abs_paths=True) # fpaths = files.list_files(ECG_DIR) assert len(fpaths) == NUM_RECORDINGS # print("fpaths: ", "\n".join(fpaths)) # print("number of fpaths: ", len(fpaths)) for path in fpaths: print("------------------------ ", path) # f = edf.EdfReader(path) # print(f.signals_in_file) magical_start_offset = 1025 # from looking at raw binary # raw = bytes(open(path, 'rb').read())[magical_start_offset:] with open(path, 'rb') as f: raw = f.read() # raw = open(path, 'rb').read() print("length of raw: ", len(raw)) print("type(raw)", type(raw)) a = np.frombuffer(raw, offset=magical_start_offset, dtype=np.uint16) # a = np.frombuffer(raw, dtype=np.uint16) print(len(a)) print(len(a) / 3) # print("number of bytes: ", len(raw)) # with open(path, 'rb') as f: # # f.seek(magical_start_offset) # f.read(magical_start_offset) # a = np.fromfile(f, dtype=np.int16) # print(len(a)) # print(len(a) / 3) if __name__ == '__main__': main()
bolt-master
experiments/python/datasets/ucddb.py
#!/usr/env/python import os DATASETS_DIR = os.path.expanduser("~/Desktop/datasets/") def to_path(*args): return os.path.join(DATASETS_DIR, *args) # straightforward datasets MSRC_12 = to_path('MSRC-12', 'origData') UCR = to_path('ucr/UCRArchive_2018') UCR_INFO = to_path('ucr/DataSummary.csv') UWAVE = to_path('uWave', 'extracted') PAMAP = to_path('PAMAP_Dataset') PAMAP2 = to_path('PAMAP2_Dataset') WARD = to_path('WARD1.0') UCI_GAS = to_path('uci-gas-sensor') # ampds2 AMPD2_POWER = to_path('ampds2', 'electric') AMPD2_GAS = to_path('ampds2', 'gas') AMPD2_WEATHER = to_path('ampds2', 'weather') AMPD2_WATER = to_path('ampds2', 'water') # caltech-{101,256} CALTECH_101 = to_path('caltech', '101_ObjectCategories') CALTECH_256 = to_path('caltech', '256_ObjectCategories') # ECG data SHAREE_ECG = to_path('sharee-ecg-database') INCART_ECG = to_path('incart-12-lead-ecg')
bolt-master
experiments/python/datasets/paths.py
#!/bin/env python import os import numpy as np from sklearn.datasets.samples_generator import make_blobs from joblib import Memory _memory = Memory('.', verbose=1) DATA_DIR = os.path.expanduser('~/Desktop/datasets/nn-search') join = os.path.join class Random: UNIFORM = 'uniform' GAUSS = 'gauss' WALK = 'walk' BLOBS = 'blobs' class Gist: DIR = join(DATA_DIR, 'gist') TRAIN = join(DIR, 'gist_train.npy') # noqa TEST = join(DIR, 'gist.npy') # noqa TEST_100 = join(DIR, 'gist_100k.npy') # noqa TEST_200 = join(DIR, 'gist_200k.npy') # noqa QUERIES = join(DIR, 'gist_queries.npy') # noqa TRUTH = join(DIR, 'gist_truth.npy') # noqa class Sift1M: DIR = join(DATA_DIR, 'sift1m') TRAIN = join(DIR, 'sift_learn.npy') # noqa TEST = join(DIR, 'sift_base.npy') # noqa TEST_100 = join(DIR, 'sift_100k.txt') # noqa TEST_200 = join(DIR, 'sift_200k.txt') # noqa QUERIES = join(DIR, 'sift_queries.npy') # noqa TRUTH = join(DIR, 'sift_groundtruth.npy') # noqa class Sift10M: DIR = join(DATA_DIR, 'sift1b') # TRAIN = join(DIR, 'big_ann_learn_10M.npy') # noqa TRAIN = join(DIR, 'big_ann_learn_1M.npy') # noqa # TODO use 10M? TRAIN_1M = join(DIR, 'big_ann_learn_1M.npy') # noqa TEST = join(DIR, 'sift_10M.npy') # noqa QUERIES = join(DIR, 'sift_queries.npy') # noqa TRUTH = join(DIR, 'true_nn_idxs_10M.npy') # noqa class Deep1M: """256D PCA of convnet activations; see OTQ paper supporting webiste, http://sites.skoltech.ru/compvision/projects/aqtq/""" DIR = join(DATA_DIR, 'deep1m') # noqa TRAIN = join(DIR, 'deep1M_learn.npy') # noqa TEST = join(DIR, 'deep1M_base.npy') # noqa TEST_100 = join(DIR, 'deep1M_test_100k.npy') # noqa QUERIES = join(DIR, 'deep1M_queries.npy') # noqa TRUTH_TRAIN = join(DIR, 'deep1M_truth_train.npy') # noqa TRUTH = join(DIR, 'deep1M_groundtruth.npy') # noqa class Convnet1M: DIR = join(DATA_DIR, 'convnet1m') # noqa TRAIN = join(DIR, 'convnet_train.npy') # noqa TEST = join(DIR, 'convnet_test.npy') # noqa TEST_100 = join(DIR, 'convnet_test_100k.npy') # noqa QUERIES = join(DIR, 'convnet_queries.npy') # noqa TRUTH_TRAIN = join(DIR, 'truth_train.npy') # noqa TRUTH = join(DIR, 'truth_test.npy') # noqa class Mnist: # following other papers (eg, "revisiting additive quantization"), # use mnist test set as queries and training set as database DIR = join(DATA_DIR, 'mnist') # noqa TEST = join(DIR, 'X_train.npy') # noqa QUERIES = join(DIR, 'X_test.npy') # noqa TRUTH = join(DIR, 'truth_Q=test_X=train.npy') # noqa class LabelMe: DIR = join(DATA_DIR, 'labelme') # noqa TRAIN = join(DIR, 'labelme_train.npy') # noqa TEST = join(DIR, 'labelme_train.npy') # noqa QUERIES = join(DIR, 'labelme_test.npy') # noqa TRUTH = join(DIR, 'labelme_truth.npy') # noqa class Glove: DIR = join(DATA_DIR, 'glove') # noqa TEST = join(DIR, 'glove_test.npy') # noqa TEST_100 = join(DIR, 'glove_100k.txt') # noqa TEST_200 = join(DIR, 'glove_200k.txt') # noqa QUERIES = join(DIR, 'glove_queries.npy') # noqa TRUTH = join(DIR, 'glove_truth.npy') # noqa # note that we've only run the real experiments on the ones reported # in the paper (i.e., no cherrypicking) ALL_REAL_DATASETS = [ Gist, Sift1M, Sift10M, Deep1M, Convnet1M, Mnist, LabelMe, Glove] def load_file(fname, *args, **kwargs): if fname.split('.')[-1] == 'txt': return np.loadtxt(fname, *args, **kwargs) return np.load(fname, *args, **kwargs) def extract_random_rows(X, how_many, remove_from_X=True): split_start = np.random.randint(len(X) - how_many - 1) split_end = split_start + how_many rows = np.copy(X[split_start:split_end]) if remove_from_X: return np.vstack((X[:split_start], X[split_end:])), rows return X, rows def _load_complete_dataset(which_dataset, num_queries=10): X_test = np.load(which_dataset.TEST) try: X_train = np.load(which_dataset.TRAIN) print("using separate test set!") except AttributeError: print("No training set found for dataset {}".format(str(which_dataset))) X_train = np.copy(X_test) try: Q = np.load(which_dataset.QUERIES) except AttributeError: assert num_queries > 1 X_train, Q = extract_random_rows(X_train, how_many=num_queries) try: true_nn = np.load(which_dataset.TRUTH).astype(np.int) except AttributeError: true_nn = None return X_train, Q, X_test, true_nn def _ground_truth_for_dataset(which_dataset): return None # TODO # XXX: not clear whether this function is correct in general, but works for # 784D with the nzeros we get for 32 and 64 codebooks def _insert_zeros(X, nzeros): N, D = X.shape D_new = D + nzeros X_new = np.zeros((N, D_new), dtype=X.dtype) step = int(D / (nzeros + 1)) - 1 for i in range(nzeros): in_start = step * i in_end = in_start + step # out_start = in_start + i + 1 out_start = (step + 1) * i out_end = out_start + step X_new[:, out_start:out_end] = X[:, in_start:in_end] # out_start = out_end # out_end += step out_end += 1 # account for the last 0 remaining_len = D - in_end out_remaining_len = D_new - out_end # print "step", step # print "in_start, in_end", in_start, in_end # print "out_start, out_end", out_start, out_end # print "D, D_new", D, D_new # print "remaining_len, out_remaining_len", remaining_len, out_remaining_len assert remaining_len == out_remaining_len assert remaining_len >= 0 if remaining_len: # X_new[:, out_end:out_end+remaining_len] = X[:, in_end:D] X_new[:, out_end:] = X[:, in_end:] assert np.array_equal(X[:, 0], X_new[:, 0]) assert np.array_equal(X[:, -1], X_new[:, -1]) return X_new def ensure_num_cols_multiple_of(X, multiple_of): remainder = X.shape[1] % multiple_of if remainder > 0: return _insert_zeros(X, multiple_of - remainder) return X # @_memory.cache # uncomment to get same randomness each time def load_dataset(which_dataset, N=-1, D=-1, norm_mean=False, norm_len=False, num_queries=10, Ntrain=-1, D_multiple_of=-1): true_nn = None # randomly generated datasets if which_dataset == Random.UNIFORM: X_test = np.random.rand(N, D) X_train = np.random.rand(Ntrain, D) if Ntrain > 0 else X_test Q = np.random.rand(num_queries, D) elif which_dataset == Random.GAUSS: X_test = np.random.randn(N, D) X_train = np.random.randn(Ntrain, D) if Ntrain > 0 else X_test Q = np.random.randn(num_queries, D) elif which_dataset == Random.WALK: X_test = np.random.randn(N, D) X_test = np.cumsum(X_test, axis=1) X_train = np.copy(X_test) if Ntrain > 0: X_train = np.random.randn(Ntrain, D) X_train = np.cumsum(X_train) Q = np.random.randn(num_queries, D) Q = np.cumsum(Q, axis=-1) elif which_dataset == Random.BLOBS: # centers is D x D, and centers[i, j] = (i + j) centers = np.arange(D) centers = np.sum(np.meshgrid(centers, centers), axis=0) X_test, _ = make_blobs(n_samples=N, centers=centers) X_train = np.copy(X_test) if Ntrain > 0: X_train, _ = make_blobs(n_samples=Ntrain, centers=centers) Q, true_nn = make_blobs(n_samples=num_queries, centers=centers) # datasets that are just one block of a "real" dataset elif isinstance(which_dataset, str): # assert False # TODO rm after real experiments X_test = load_file(which_dataset) X_test, Q = extract_random_rows(X_test, how_many=num_queries) X_train = np.copy(X_test) true_nn = _ground_truth_for_dataset(which_dataset) # "real" datasets with predefined train, test, queries, truth elif which_dataset in ALL_REAL_DATASETS: X_train, Q, X_test, true_nn = _load_complete_dataset( which_dataset, num_queries=num_queries) else: raise ValueError("unrecognized dataset {}".format(which_dataset)) N = X_test.shape[0] if N < 1 else N D = X_test.shape[1] if D < 1 else D X_test, X_train = np.copy(X_test)[:N, :D], X_train[:N, :D] Q = Q[:, :D] if len(Q.shape) > 1 else Q[:D] train_is_test = X_train.base is X_test or X_test.base is X_train train_test_equal = np.array_equal(X_train[:100], X_test[:100]) train_test_same = train_is_test or train_test_equal if train_test_same: print("WARNING: Training data is also the test data!") if train_is_test: X_test = np.copy(X_test) if norm_mean: means = np.mean(X_train, axis=0) X_train -= means X_test -= means Q -= means if norm_len: X_test /= np.linalg.norm(X_test, axis=1, keepdims=True) X_train /= np.linalg.norm(X_train, axis=1, keepdims=True) Q /= np.linalg.norm(Q, axis=-1, keepdims=True) # np.set_printoptions(precision=6) # print "start of Q:", Q[:5, :5] # print "start of X_test:", X_test[:5, :5] # TODO don't convert datasets that are originally uint8s to floats X_train = X_train.astype(np.float32) X_test = X_test.astype(np.float32) # Q = np.squeeze(Q.astype(np.float32)) Q = Q.astype(np.float32) if D_multiple_of > 1: X_train = ensure_num_cols_multiple_of(X_train, D_multiple_of) X_test = ensure_num_cols_multiple_of(X_test, D_multiple_of) Q = ensure_num_cols_multiple_of(Q, D_multiple_of) return X_train, Q, X_test, true_nn def read_yael_vecs(path, c_contiguous=True, limit_rows=-1, dtype=None): dim = np.fromfile(path, dtype=np.int32, count=2)[0] print("vector length = {}".format(dim)) if dtype is None: if 'fvecs' in path: dtype = np.float32 elif 'ivecs' in path: dtype = np.int32 elif 'bvecs' in path: dtype = np.uint8 else: raise ValueError("couldn't infer dtype from path {}".format(path)) itemsize = np.dtype(dtype).itemsize assert dim > 0 assert itemsize in (1, 2, 4) cols_for_dim = 4 // itemsize row_size_bytes = 4 + dim * itemsize row_size_elems = row_size_bytes // itemsize limit = int(limit_rows) * row_size_elems if limit_rows > 0 else -1 fv = np.fromfile(path, dtype=dtype, count=limit) fv = fv.reshape((-1, row_size_elems)) if not all(fv.view(np.int32)[:, 0] == dim): raise IOError("Non-uniform vector sizes in " + path) fv = fv[:, cols_for_dim:] if c_contiguous: fv = fv.copy() return fv
bolt-master
experiments/python/datasets/neighbors.py
#!/usr/bin/env python import os # import matplotlib as mpl import matplotlib.pyplot as plt import numpy as np import pandas as pd import seaborn as sb from joblib import Memory from . import paths from . import files _memory = Memory('./') def _list_csvs(directory): return files.list_files(directory, endswith='.csv', abs_paths=True) ELECTRIC_PATHS = _list_csvs(paths.AMPD2_POWER) GAS_PATHS = _list_csvs(paths.AMPD2_GAS) WATER_PATHS = _list_csvs(paths.AMPD2_WATER) WEATHER_PATHS = _list_csvs(paths.AMPD2_WEATHER) ELECTRIC_COLS = 'UNIX_TS,WHE,RSE,GRE,MHE,B1E,BME,CWE,DWE,EQE,FRE,HPE,OFE,' \ 'UTE,WOE,B2E,CDE,DNE,EBE,FGE,HTE,OUE,TVE,UNE'.split(',') ELECTRIC_DATA_COLS = ELECTRIC_COLS[1:] # ELECTRIC_DATA_COLS.remove('MHE') # linear combo of other cols # ELECTRIC_DATA_COLS.remove('UNE') # linear combo of other cols GAS_DATA_COLS = ['counter', 'avg_rate', 'inst_rate'] WATER_DATA_COLS = ['counter', 'avg_rate'] WEATHER_TIME_COL = 'Date/Time' WEATHER_DATA_COLS = ['Temp (C)', 'Dew Point Temp (C)', 'Rel Hum (%)', 'Wind Dir (10s deg)', 'Wind Spd (km/h)', 'Visibility (km)', 'Stn Press (kPa)'] WEATHER_ALL_COLS = [WEATHER_TIME_COL] + WEATHER_DATA_COLS FIG_SAVE_DIR = os.path.join('figs', 'ampds') # ================================================================ public class HouseRecording(object): def __init__(self, path, cols=None): data = _read_file(path) self.path = path self.name = os.path.basename(path).split('.')[0] self.col_names = cols self.sampleTimes = data[:, 0] self.data = data[:, 1:] # XXX have to use all cols after the first # if 'power' in self.name: # print "initial sample times: ", self.sampleTimes[:50] # print # hack to deal with DWW water not having inst_rate # self.col_names = self.col_names[:self.data.shape[1]] self.data = self.data[:, :len(self.col_names)] class WeatherRecording(object): def __init__(self): df = _load_weather_data() self.name = 'weather' self.col_names = WEATHER_DATA_COLS self.sampleTimes = _datetime_strs_to_unix_timestamps(df[WEATHER_TIME_COL]) self.data = df[WEATHER_DATA_COLS].values.astype(np.float32) # ------------------------ top-level data loading functions def all_power_recordings(): return [HouseRecording(path, cols=ELECTRIC_DATA_COLS) for path in ELECTRIC_PATHS] def all_gas_recordings(): return [HouseRecording(path, cols=GAS_DATA_COLS) for path in GAS_PATHS] def all_water_recordings(): return [HouseRecording(path, cols=WATER_DATA_COLS) for path in WATER_PATHS] def all_weather_recordings(): return [WeatherRecording()] # just one data file, so just one recording def all_timestamp_recordings(): all_recordings = all_power_recordings() + all_gas_recordings() + \ all_water_recordings() + all_weather_recordings() # all_recordings = all_weather_recordings() # TODO rm for r in all_recordings: r.data = r.sampleTimes.astype(np.float64) r.name += '_timestamps' return all_recordings # ================================================================ private # def _read_file(path, cols=None): @_memory.cache def _read_file(path): df = pd.read_csv(path).fillna(method='backfill') # hold prev val # if cols is not None and len(cols) > 0: # timestamps = df[df.columns[0]] # return df.values.astype(np.int32) return df.values.astype(np.float64) # need f64 to not lose timestamps @_memory.cache def _load_weather_data(): path = WEATHER_PATHS[0] df = pd.read_csv(path, sep=',').fillna(method='backfill') # hold prev val return df[WEATHER_ALL_COLS] def _datetimes_to_unix_timestamps(datetimes): # https://stackoverflow.com/q/34038273 return (datetimes.astype(np.int64) / 1e6).astype(np.uint64) def _datetime_strs_to_unix_timestamps(strs): return _datetimes_to_unix_timestamps(pd.to_datetime(strs)) # ================================================================ main def save_fig_png(path): plt.savefig(path, dpi=300, bbox_inches='tight') def _prev_corrs_stats(corr): assert corr.shape[0] == corr.shape[1] # needs to be a correlation mat abs_corr = np.abs(corr) prev_corrs = np.zeros(len(corr) - 1) best_corrs = np.zeros(len(corr) - 1) for i, row in enumerate(abs_corr[1:]): # each row after the first prev_corrs[i] = row[i] # note that i is row index - 1 try: best_corr_idx = np.nanargmax(row[:i+1]) best_corrs[i] = row[best_corr_idx] except ValueError: # if row all nans best_corrs[i] = prev_corrs[i] assert not (best_corrs[i] < prev_corrs[i]) # double neg for nans # avg corr with prev variable, avg highest corr with any preceding variable return np.nanmean(prev_corrs), np.nanmean(best_corrs) def _plot_corr(data, fig, ax, add_title=True): """assumes data is row-major; ie, each col is one variable over time""" # cov = np.cov(data.T) corr = np.corrcoef(data.T) # im = ax.imshow(corr, interpolation='nearest', # cmap=plt.cm.RdBu, # norm=mpl.colors.Normalize(vmin=-1., vmax=1.)) # fig.colorbar(im, ax=ax) # sb.heatmap(corr, center=0, ax=ax, square=True) sb.heatmap(corr, vmin=-1, vmax=1, center=0, ax=ax, square=True) if add_title: mean_prev_corr, mean_best_corr = _prev_corrs_stats(corr) ax.set_title("|rho| prev, best prev =\n{:.2f}, {:.2f}".format( mean_prev_corr, mean_best_corr)) def plot_recordings(recordings, interval_len=1000, norm_means=False, mins_zero=False, savedir=None): for r in recordings: print(("recording {} has data of shape {}".format(r.name, r.data.shape))) fig, axes = plt.subplots(2, 4, figsize=(13, 7)) start_idxs = [0, len(r.data) - interval_len] end_idxs = [interval_len, len(r.data)] # any_nans_in_row = np.isnan(r.data).sum(axis=1) # print np.where(any_nans_in_row)[0] # continue for i, (start, end) in enumerate(zip(start_idxs, end_idxs)): timestamps = r.sampleTimes[start:end] data = r.data[start:end] if norm_means: data -= np.mean(data, axis=0).astype(data.dtype) elif mins_zero: data -= np.min(data, axis=0).astype(data.dtype) # print "data shape", data.shape # print "data final vals", data[-20:] # continue col = i + 1 axes[0, col].plot(timestamps, data, lw=1) axes[1, col].plot(timestamps[1:], np.diff(data, axis=0), lw=1) axes[0, col].set_title('data') axes[1, col].set_title('first derivs') # plot correlation matrices for orig data and first derivs cor_sample_length = max(10000, len(r.data) // 5) data = r.data[:cor_sample_length] _plot_corr(data, fig, axes[0, 0]) _plot_corr(np.diff(data, axis=0), fig, axes[1, 0]) data = r.data[-cor_sample_length:] _plot_corr(data, fig, axes[0, -1]) _plot_corr(np.diff(data, axis=0), fig, axes[1, -1]) # _plot_corr(r.data[:cor_sample_length], fig, axes[0, 0]) # data = r.data[-cor_sample_length:] # _plot_corr(data, fig, axes[2, 1]) plt.tight_layout() # plt.show() if savedir is not None: files.ensure_dir_exists(savedir) # plt.savefig(os.path.join(savedir, r.name)) save_fig_png(os.path.join(savedir, r.name)) def main(): recordings = [] recordings += all_gas_recordings() recordings += all_water_recordings() recordings += all_power_recordings() recordings += all_weather_recordings() norm_means = False # norm_means = True mins_zero = True plot_recordings(recordings, norm_means=norm_means, mins_zero=mins_zero, savedir=FIG_SAVE_DIR) # plt.show() if __name__ == '__main__': main()
bolt-master
experiments/python/datasets/ampds.py
#!/bin/env python from __future__ import absolute_import, division, print_function import numpy as np import os import PIL import pickle import psutil # pip install psutil import shutil import sys # just for stderr for warnings # import warnings from PIL import Image from python import files from python import image_utils from joblib import Memory _memory = Memory('.', verbose=1) IMAGENET_ONE_OF_EACH_PATH = '../datasets/one-of-each-imagenet' IMAGENET_ONE_OF_EACH_FLOW_PATH = '../datasets/one-of-each-imagenet-as-folders' # IMAGENET_64_PATH = os.path.expanduser("~/Desktop/datasets/imagenet64") # IMAGENET_TINY_PATH = os.path.expanduser("~/Desktop/datasets/tiny-imagenet-200") IMAGENET_64_PATH = '../datasets/imagenet64' IMAGENET_TINY_PATH = '../datasets/tiny-imagenet-200' IMAGENET_64_TRAIN_CHUNK_NSAMPLES = 128116 IMAGENET_TRAIN_PATH = '../datasets/ILSVRC2012/ILSVRC2012_img_train' IMAGENET_TEST_PATH = '/home/dblalock/datasets/ILSVRC2012/ILSVRC2012_img_val' if not os.path.exists(IMAGENET_TEST_PATH): # try to load local version IMAGENET_TEST_PATH = '../datasets/ILSVRC2012/ILSVRC2012_img_val' IMAGENET_10_CLASSES_TRAIN_PATH = '../datasets/ILSVRC2012_10/ILSVRC2012_img_train' IMAGENET_10_CLASSES_TEST_PATH = '../datasets/ILSVRC2012_10/ILSVRC2012_img_val' IMAGENET_100_CLASSES_TRAIN_PATH = '../datasets/ILSVRC2012_100/ILSVRC2012_img_train' IMAGENET_100_CLASSES_TEST_PATH = '../datasets/ILSVRC2012_100/ILSVRC2012_img_val' IMAGENET_1_EXAMPLE_TRAIN_PATH = '../datasets/imagenet-001-of-each' IMAGENET_10_EXAMPLES_TRAIN_PATH = '../datasets/imagenet-010-of-each' IMAGENET_25_EXAMPLES_TRAIN_PATH = '../datasets/imagenet-025-of-each' IMAGENET_50_EXAMPLES_TRAIN_PATH = '../datasets/imagenet-050-of-each' IMAGENET_100_EXAMPLES_TRAIN_PATH = '../datasets/imagenet-100-of-each' # ================================================================ Downsampled def _unpickle_file(path): with open(path, 'rb') as f: pydict = pickle.load(f) return pydict # @_memory.cache def _load_downsampled_data_file(path, layout='nhwc', dtype=None, X_out=None, y_out=None, start_row=None): d = _unpickle_file(path) X = d['data'] # NOTE: subtracting 1 so min idx is 0; this breaks synset lookup y = np.array(d['labels'], dtype=np.int32) - 1 y = y.ravel() # shouldn't be necessary, but might as well assert X.shape[0] == y.shape[0] assert len(X.shape) == 2 nchan = 3 npixels = X.shape[1] / nchan assert npixels * nchan == X.shape[1] # each row not one img? side_len = int(np.sqrt(npixels)) assert side_len * side_len == npixels X = X.reshape(X.shape[0], nchan, side_len, side_len) layout = 'nhwc' if layout is None else layout assert layout in ('nhwc', 'nchw') if layout == 'nhwc': X = np.moveaxis(X, 1, -1) # make channels last axis X = np.ascontiguousarray(X) if X_out is not None: assert dtype in (None, X_out.dtype) dtype = X_out.dtype if dtype is not None: X = X.astype(dtype) # print("X shape: ", X.shape) # print("y shape: ", y.shape) if start_row is not None: end_row = start_row + X.shape[0] if X_out is not None: assert start_row is not None X_out[start_row:end_row] = X if y_out is not None: assert start_row is not None y_out[start_row:end_row] = y return X, y def load_train_file_64x64(idx, verbose=0, **kwargs): assert idx in np.arange(1, 11) # valid indices are 1 thru 10 path = os.path.join(IMAGENET_64_PATH, "train_data_batch_{}".format(idx)) if verbose > 1: print("loading train file: ", path) return _load_downsampled_data_file(path, **kwargs) def _clean_which_file_idxs(which_file_idxs=None, dtype=None): if which_file_idxs is None: which_file_idxs = np.arange(1, 11) which_file_idxs = np.asarray(which_file_idxs, dtype=np.int32) # don't try to load more training data then we can actually fit in RAM mem_available = psutil.virtual_memory().available itemsize = dtype.itemsize if dtype is not None else 1 one_img_nbytes = 64 * 64 * 3 * itemsize one_file_nbytes = IMAGENET_64_TRAIN_CHUNK_NSAMPLES * one_img_nbytes max_nfiles = (mem_available // one_file_nbytes) - 1 # print("one_img_nbytes", one_img_nbytes) # print("one_file_nbytes", one_file_nbytes) # print("available mem", mem_available) # print("max_nfiles", max_nfiles) if max_nfiles < 1: raise MemoryError( "Minimum amount of RAM needed to load one chunk of ImageNet64x64 " "is {}B, but only {}B are available".format( one_file_nbytes, mem_available)) requested_nfiles = len(which_file_idxs) if max_nfiles < requested_nfiles: requested_nbytes = (requested_nfiles + 1) * one_file_nbytes requested_MB = requested_nbytes // int(1e6) available_MB = mem_available // int(1e6) print("imagenet.load_train_data_64x64: MemoryWarning: " "Only loading {}/10 chunks of ImageNet64 instead of requested " "{}/10 since not enough memory; would need {:}MB, but only {:}MB " "are available".format( max_nfiles, requested_nfiles, requested_MB, available_MB), file=sys.stderr) # warnings.warn(msg, UserWarning) which_file_idxs = which_file_idxs[:max_nfiles] assert np.min(which_file_idxs) >= 1 assert np.max(which_file_idxs) <= 10 return which_file_idxs # NOTE: total size of training data is around 16GB def load_train_data_64x64(which_file_idxs=None, layout='nhwc', dtype=None, verbose=1): which_file_idxs = _clean_which_file_idxs(which_file_idxs, dtype=dtype) if verbose > 0: print("load_train_data_64x64: loading file numbers: ", which_file_idxs) # import sys; sys.exit() if dtype is None: dtype = np.uint8 # default dtype # preallocate output matrix of appropriate size so that we can just # keep one copy of the data in memory (as opposed to loading all the # data matrices and then concatenating them) assert layout in ('nhwc', 'nchw') nrows_per_file = IMAGENET_64_TRAIN_CHUNK_NSAMPLES img_shape = (64, 64, 3) if layout == 'nhwc' else (3, 64, 64) combined_nrows = nrows_per_file * len(which_file_idxs) combined_shape = (combined_nrows,) + img_shape X_combined = np.zeros(combined_shape, dtype=dtype) y_combined = np.zeros(combined_nrows, dtype=np.int32) for i, idx in enumerate(which_file_idxs): start_row = nrows_per_file * i load_train_file_64x64( idx, layout=layout, X_out=X_combined, y_out=y_combined, start_row=start_row, verbose=verbose) return X_combined, y_combined def load_test_data_64x64(layout='nhwc', dtype=None): path = os.path.join(IMAGENET_64_PATH, "val_data") return _load_downsampled_data_file(path, layout=layout, dtype=dtype) # ================================================================ Tiny # # adapted from https://github.com/keras-team/keras-preprocessing/blob/master/ # # keras_preprocessing/image/utils.py under MIT license # def img_to_array(img, layout='nhwc', dtype='float32', mode='RGB'): # """Converts a PIL Image instance to a Numpy array. # # Arguments # img: PIL Image instance. # layout: Image data format, either "nchw" or "nhwc". # dtype: Dtype to use for the returned array. # # Returns # A 3D Numpy array. # # Raises # ValueError: if invalid `img` or `layout` is passed. # """ # # print("img info:", img.format, img.size, img.mode) # # if img.mode == 'L': # if img.mode != mode: # img = img.convert(mode=mode) # if layout not in ('nchw', 'nhwc'): # raise ValueError('Unknown layout: %s' % layout) # # Numpy array x has format (height, width, channel) # # or (channel, height, width) # # but original PIL image has format (width, height, channel) # x = np.asarray(img, dtype=dtype) # if len(x.shape) == 3: # if layout == 'nchw': # x = x.transpose(2, 0, 1) # elif len(x.shape) == 2: # # print("x is only rank 2...WTF!?") # if layout == 'nchw': # x = x.reshape((1, x.shape[0], x.shape[1])) # else: # x = x.reshape((x.shape[0], x.shape[1], 1)) # else: # raise ValueError('Unsupported image shape: %s' % (x.shape,)) # return x # def _resize_img(img, ratio_or_size): # if ratio_or_size is None or np.min(ratio_or_size) < 0: # return img # try: # nrows = ratio_or_size[0] # ncols = ratio_or_size[1] # except AttributeError: # nrows = img.height * ratio_or_size # ncols = img.width * ratio_or_size # new_size = (nrows, ncols) # is_downsampling = (nrows < img.height) or (ncols < img.width) # interp = PIL.Image.LANCZOS if is_downsampling else PIL.Image.BICUBIC # return img.resize(new_size, resample=interp) # def image_utils.load_jpg(path, layout='nhwc', dtype='float32', resample=None): # img = Image.open(path) # img = _resize_img(img, ratio_or_size=resamp) # return img_to_array(img, layout=layout, dtype=dtype) @_memory.cache def _load_tiny_clsids_to_nums(): wnids_path = os.path.join(IMAGENET_TINY_PATH, 'wnids.txt') with open(wnids_path) as f: lines = f.readlines() lines = [line.strip() for line in lines] return {s: i for i, s in enumerate(lines)} def _imagenet_tiny_cls_to_number(classnames): if isinstance(classnames, str): return _load_tiny_clsids_to_nums()[classnames] return [_load_tiny_clsids_to_nums()[name] for name in classnames] @_memory.cache def load_train_data_tiny(layout='nhwc', dtype=None, verbose=1): train_dir = os.path.join(IMAGENET_TINY_PATH, 'train') subdirs = files.list_subdirs(train_dir) all_classes = subdirs assert len(all_classes) == 200 # wrong number of classes?? subdir_paths = files.list_subdirs(train_dir, abs_paths=True) all_imgs = [] all_labels = [] for i, pth in enumerate(np.sort(subdir_paths)): classname = os.path.basename(pth) if verbose > 0: print("loading images for class {}...".format(classname)) imgs_subdir = os.path.join(pth, 'images') img_paths = files.list_files( imgs_subdir, endswith='.JPEG', abs_paths=True) assert len(img_paths) == 500 # supposed to be 500 examples per class... imgs = [image_utils.load_jpg(f, layout=layout, dtype=dtype)[np.newaxis, :, :, :] for f in img_paths] all_imgs += imgs lbl = _imagenet_tiny_cls_to_number(classname) all_labels += [lbl] * len(img_paths) X = np.concatenate(all_imgs, axis=0) y = np.array(all_labels, dtype=np.int32) return X, y @_memory.cache def load_test_data_tiny(layout='nhwc', dtype=None): # no labels given for "true" test set, so use the "val" subset as the # test set test_dir = os.path.join(IMAGENET_TINY_PATH, 'val') imgs_subdir = os.path.join(test_dir, 'images') img_paths = files.list_files( imgs_subdir, endswith='.JPEG', abs_paths=True) assert len(img_paths) == 10000 # wrong number of val images? # load images imgs = [image_utils.load_jpg(f, layout=layout, dtype=dtype)[np.newaxis, :, :, :] for f in img_paths] X = np.concatenate(imgs, axis=0) # load labels # TODO make sure this computation is correct lbls_path = os.path.join(test_dir, 'val_annotations.txt') with open(lbls_path, 'r') as f: lines = f.readlines() fnames = [line.split()[0] for line in lines] class_ids = [line.split()[1] for line in lines] # complicated way that doesn't rely on annotations being sorted fname_to_class_id = dict(zip(fnames, class_ids)) img_fnames = [os.path.basename(pth) for pth in img_paths] img_class_ids = [fname_to_class_id[fname] for fname in img_fnames] labels = _imagenet_tiny_cls_to_number(img_class_ids) y = np.array(labels, dtype=np.int32) return X, y # ================================================================ K-of-each # def load_data_one_of_each(layout='nhwc', dtype=None, size=None): def load_data_one_of_each(layout='nhwc', dtype=None, size=(224, 224)): # np_save_file = os.path.join(IMAGENET_ONE_OF_EACH_PATH, 'oneOfEach.npy') # cached_exists = os.path.exists(np_save_file) # if cached_exists: # return np.load(np_save_file) img_paths = files.list_files(IMAGENET_ONE_OF_EACH_PATH, endswith='.JPEG', abs_paths=True) assert len(img_paths) == 1000 # should be 1000 images... imgs = [image_utils.load_jpg(f, layout=layout, dtype=dtype, resample=size) for f in img_paths] if size is not None: # can only concat if same size imgs = [img[np.newaxis, :, :, :] for img in imgs] X = np.concatenate(imgs, axis=0) else: X = imgs # XXX this is a total hack that will break if we get >1 img per class, and # already (probably) doesn't match up with the synsets # lbls = [os.path.basename(path).split('_')[0] for path in img_paths] y = np.arange(len(X)) return X, y # ================================================================ example def load_flow_example(**kwargs): IMAGENET_EXAMPLE_PATH = os.path.abspath('../datasets/imagenet-example') # print("files in data dir:") # print(files.list_subdirs(IMAGENET_EXAMPLE_PATH)) # import sys; sys.exit() j = os.path.join kwargs.setdefault('target_size', (224, 224)) kwargs.setdefault('batch_size', 16) kwargs.setdefault('class_mode', 'categorical') import keras from keras.preprocessing import image train_datagen = image.ImageDataGenerator() val_datagen = image.ImageDataGenerator() test_datagen = image.ImageDataGenerator() # print("contents of train dir: ", files.list_subdirs(j(IMAGENET_EXAMPLE_PATH, 'train'))) train_generator = train_datagen.flow_from_directory( j(IMAGENET_EXAMPLE_PATH, 'train'), **kwargs) val_generator = val_datagen.flow_from_directory( j(IMAGENET_EXAMPLE_PATH, 'val'), **kwargs) test_generator = val_datagen.flow_from_directory( j(IMAGENET_EXAMPLE_PATH, 'val'), **kwargs) return train_generator, val_generator, test_generator def example_imagenet_train(): import tensorflow as tf import keras from python import models from python import approx_conv_v2 as aconv # both are necessary to actually get consistent output np.random.seed(123) tf.random.set_random_seed(123) model = models.get_model(models.VGG16, weights=None, input_shape=(224, 224, 3)) # swap out normal conv layer with our custom layer model = models.replace_layer_classes( model, {keras.layers.Conv2D: aconv.MyConv2D}) model.compile(loss='categorical_crossentropy', optimizer='adam', metrics=['accuracy']) model.summary() train_generator, val_generator, test_generator = load_flow_example() model.fit_generator(train_generator, steps_per_epoch=10, epochs=1, validation_steps=1, validation_data=val_generator) model.evaluate_generator(test_generator, steps=2) def main(): # X, y = load_train_file_64x64(1) # X, y = load_train_data_64x64([1, 2, 3]) # X, y = load_train_data_64x64([1, 2, 3, 4, 5]) # works # X, y = load_train_data_64x64() # correctly yields mem warning # X, y = load_train_data_64x64([1]) # X, y = load_test_data_64x64() # X, y = load_data_one_of_each(size=None) # no resampling # X, y = load_data_one_of_each(size=(224, 224)) # wow, imagenet-tiny looks like crap; lots of aliasing X, y = load_train_data_tiny() # X, y = load_test_data_tiny() print("X, y dtypes and shapes:") print(X.dtype) print(y.dtype) print(X.shape) print(y.shape) import matplotlib.pyplot as plt inp = 'y' count = 0 while inp == 'y': _, axes = plt.subplots(3, 3, figsize=(9, 9)) idxs = np.random.choice(np.arange(len(X)), size=axes.size) # offset = 0 # offset = 10000 # idxs = np.arange(offset + 9*count, offset + 9 + 9*count) for i, ax in enumerate(axes.ravel()): idx = idxs[i] img, classId = X[idx], y[idx] ax.imshow(img, interpolation='nearest') ax.set_title("Idx = {}, class = {}".format(idx, classId)) # plt.imshow(X[100*1000], interpolation='nearest') # plt.imshow(X[300*1000], interpolation='nearest') plt.tight_layout() plt.show() count += 1 inp = input("enter y to plot more random imgs; anything else to stop: ") def _folderize_imagenet_one_of_each(): # one-off script olddir = IMAGENET_ONE_OF_EACH_PATH newdir = IMAGENET_ONE_OF_EACH_FLOW_PATH files.ensure_dir_exists(newdir) old_files = files.list_files(olddir, endswith='.JPEG', abs_paths=True) for f in files.list_files(olddir, endswith='.JPEG', abs_paths=True): basename = os.path.basename(f) label = basename.split('_')[0] subdir = os.path.join(newdir, label) files.ensure_dir_exists(subdir) newpath = os.path.join(subdir, basename) # newpath = os.path.join(newdir, ) # print("oldpath: ", f, os.path.exists(f)) # print("newpath: ", newpath) shutil.copy(f, newpath) def _make_imagenet_k_of_each(k=10): out_path = '../datasets/imagenet-{:03d}-of-each'.format(k) print("writing to path: ", out_path) src_dir = IMAGENET_TRAIN_PATH for synset in files.list_subdirs(src_dir): subdir_path = os.path.join(src_dir, synset) img_paths = sorted(files.list_files(subdir_path, abs_paths=True)) img_paths = img_paths[:k] new_subdir = os.path.join(out_path, synset) files.ensure_dir_exists(new_subdir) for path in img_paths: fname = os.path.basename(path) new_path = os.path.join(new_subdir, fname) shutil.copy(path, new_path) if __name__ == '__main__': # example_imagenet_train() main() # _folderize_imagenet_one_of_each() # _make_imagenet_k_of_each(10) # _make_imagenet_k_of_each(25) # _make_imagenet_k_of_each(50) # _make_imagenet_k_of_each(100)
bolt-master
experiments/python/datasets/imagenet.py