python_code
stringlengths
0
4.04M
repo_name
stringlengths
7
58
file_path
stringlengths
5
147
"""Match items in a dictionary using fuzzy matching Implemented for pywinauto. This class uses difflib to match strings. This class uses a linear search to find the items as it HAS to iterate over every item in the dictionary (otherwise it would not be possible to know which is the 'best' match). If the exact item is in the dictionary (no fuzzy matching needed - then it doesn't do the linear search and speed should be similar to standard Python dictionaries. >>> fuzzywuzzy = FuzzyDict({"hello" : "World", "Hiya" : 2, "Here you are" : 3}) >>> fuzzywuzzy['Me again'] = [1,2,3] >>> >>> fuzzywuzzy['Hi'] 2 >>> >>> >>> # next one doesn't match well enough - so a key error is raised ... >>> fuzzywuzzy['There'] Traceback (most recent call last): File "<stdin>", line 1, in ? File "pywinauto\fuzzydict.py", line 125, in __getitem__ raise KeyError( KeyError: "'There'. closest match: 'hello' with ratio 0.400" >>> >>> fuzzywuzzy['you are'] 3 >>> fuzzywuzzy['again'] [1, 2, 3] >>> """ __revision__ = "$Rev$" import difflib class FuzzyDict(dict): "Provides a dictionary that performs fuzzy lookup" def __init__(self, items = None, cutoff = .6): """Construct a new FuzzyDict instance items is an dictionary to copy items from (optional) cutoff is the match ratio below which mathes should not be considered cutoff needs to be a float between 0 and 1 (where zero is no match and 1 is a perfect match)""" super(FuzzyDict, self).__init__() if items: self.update(items) self.cutoff = cutoff # short wrapper around some super (dict) methods self._dict_contains = lambda key: \ super(FuzzyDict,self).__contains__(key) self._dict_getitem = lambda key: \ super(FuzzyDict,self).__getitem__(key) def _search(self, lookfor, stop_on_first = False): """Returns the value whose key best matches lookfor if stop_on_first is True then the method returns as soon as it finds the first item """ # if the item is in the dictionary then just return it if self._dict_contains(lookfor): return True, lookfor, self._dict_getitem(lookfor), 1 # set up the fuzzy matching tool ratio_calc = difflib.SequenceMatcher() ratio_calc.set_seq1(lookfor) # test each key in the dictionary best_ratio = 0 best_match = None best_key = None for key in self: # if the current key is not a string # then we just skip it try: # set up the SequenceMatcher with other text ratio_calc.set_seq2(key) except TypeError: continue # we get an error here if the item to look for is not a # string - if it cannot be fuzzy matched and we are here # this it is defintely not in the dictionary try: # calculate the match value ratio = ratio_calc.ratio() except TypeError: break # if this is the best ratio so far - save it and the value if ratio > best_ratio: best_ratio = ratio best_key = key best_match = self._dict_getitem(key) if stop_on_first and ratio >= self.cutoff: break return ( best_ratio >= self.cutoff, best_key, best_match, best_ratio) def __contains__(self, item): "Overides Dictionary __contains__ to use fuzzy matching" if self._search(item, True)[0]: return True else: return False def __getitem__(self, lookfor): "Overides Dictionary __getitem__ to use fuzzy matching" matched, key, item, ratio = self._search(lookfor) if not matched: raise KeyError( "'%s'. closest match: '%s' with ratio %.3f"% (str(lookfor), str(key), ratio)) return item if __name__ == '__main__': import unittest class FuzzyTestCase(unittest.TestCase): "Perform some tests" test_dict = { 'Hiya' : 1, u'hiy\xe4' : 2, 'test3' : 3, 1: 324} def testCreation_Empty(self): "Verify that not specifying any values creates an empty dictionary" fd = FuzzyDict() self.assertEquals(fd, {}) def testCreation_Dict(self): "Test creating a fuzzy dict" fd = FuzzyDict(self.test_dict) self.assertEquals(fd, self.test_dict) self.assertEquals(self.test_dict['Hiya'], fd['hiya']) fd2 = FuzzyDict(self.test_dict, cutoff = .8) self.assertEquals(fd, self.test_dict) self.assertRaises(KeyError, fd2.__getitem__, 'hiya') def testContains(self): "Test checking if an item is in a FuzzyDict" fd = FuzzyDict(self.test_dict) self.assertEquals(True, fd.__contains__('hiya')) self.assertEquals(True, fd.__contains__(u'test3')) self.assertEquals(True, fd.__contains__(u'hiy\xe4')) self.assertEquals(False, fd.__contains__('FuzzyWuzzy')) self.assertEquals(True, fd.__contains__(1)) self.assertEquals(False, fd.__contains__(23)) def testGetItem(self): "Test getting items from a FuzzyDict" fd = FuzzyDict(self.test_dict) self.assertEquals(self.test_dict["Hiya"], fd['hiya']) self.assertRaises(KeyError, fd.__getitem__, 'FuzzyWuzzy') fd2 = FuzzyDict(self.test_dict, cutoff = .14) self.assertEquals(1, fd2['FuzzyWuzzy']) self.assertEquals(324, fd2[1]) self.assertRaises(KeyError, fd2.__getitem__, 23) unittest.main()
dd-genomics-master
archived/fuzzy_string_dict.py
import ddext from ddext import SD def init(): ddext.input('doc_id', 'text') ddext.input('sent_id', 'int') ddext.input('words', 'text[]') ddext.input('lemmas', 'text[]') ddext.input('poses', 'text[]') ddext.input('ners', 'text[]') ddext.returns('doc_id', 'text') ddext.returns('sent_id', 'int') ddext.returns('wordidxs', 'int[]') ddext.returns('mention_id', 'text') ddext.returns('type', 'text') ddext.returns('entity', 'text') ddext.returns('words', 'text[]') ddext.returns('is_correct', 'boolean') def run(doc_id, sent_id, words, lemmas, poses, ners): if 'diseases' in SD: trie = SD['trie'] diseases = SD['diseases'] diseases_bad = SD['diseases_bad'] genes = SD['genes'] delim_re = SD['delim_re'] else: import os APP_HOME = os.environ['DD_GENOMICS_HOME'] import re diseases = {} all_diseases = [x.strip().split('\t', 1) for x in open('%s/onto/data/all_diseases.tsv' % APP_HOME)] diseases_en = set([x.strip() for x in open('%s/onto/data/all_diseases_en.tsv' % APP_HOME)]) diseases_en_good = set([x.strip() for x in open('%s/onto/manual/disease_en_good.tsv' % APP_HOME)]) diseases_bad = set([x.strip() for x in open('%s/onto/manual/disease_bad.tsv' % APP_HOME)]) SD['diseases_bad'] = diseases_bad diseases_exclude = diseases_bad | diseases_en - diseases_en_good delim_re = re.compile('[^\w-]+') # NOTE: this also removes apostrophe SD['delim_re'] = delim_re diseases_norm = {} trie = {} # special key '$' means terminal nodes for phrase, ids in all_diseases: if phrase in diseases_exclude: continue diseases[phrase] = ids phrase_norm = delim_re.sub(' ', phrase).strip() # print phrase_norm tokens = phrase_norm.split() node = trie for w in tokens: if w not in node: node[w] = {} node = node[w] if '$' not in node: node['$'] = [] node['$'].append((ids, phrase)) if phrase_norm not in diseases_norm: diseases_norm[phrase_norm] = ids else: diseases_norm[phrase_norm] = '|'.join(sorted(set(ids.split('|')) | set(diseases_norm[phrase_norm].split('|')))) SD['diseases'] = diseases SD['trie'] = trie genes = set() for line in open('%s/onto/data/genes.tsv' % APP_HOME): #plpy.info(line) name, synonyms, full_names = line.strip(' \r\n').split('\t') synonyms = set(synonyms.split('|')) genes.add(name.lower()) for s in synonyms: genes.add(s.lower()) SD['genes'] = genes # TODO: currently we do ignore-case exact match for single words; consider stemming. # TODO: currently we do exact phrase matches; consider emitting partial matches. for i in xrange(len(words)): word = words[i] iword = word.lower() # single-token mention if iword in diseases: truth = True mtype = 'ONE' # http://www.ncbi.nlm.nih.gov/pubmed/23271346 # SCs for Stem Cells # HFs for hair follicles if word[-1] == 's' and word[:-1].isupper(): truth = False mtype = 'PLURAL' elif iword in genes: truth = None mtype = 'GSYM' entity = diseases[iword] + ' ' + iword mid = '%s_%s_%d_1' % (doc_id, sent_id, i) yield doc_id, sent_id, [i], mid, mtype, entity, [word], truth # multi-token mentions node = trie depth = 0 for j in xrange(i, len(words)): word = words[j] iword = word.lower() sword = delim_re.sub(' ', iword).strip() if not sword: if j == i: break continue if sword in node: node = node[sword] depth += 1 if '$' in node and depth > 1: for ids, phrase in node['$']: if phrase in diseases_bad: continue entity = ids + ' ' + phrase mid = '%s_%s_%d_%d' % (doc_id, sent_id, i, j - i + 1) wordids = range(i, j + 1) yield doc_id, sent_id, wordids, mid, 'PHRASE', entity, words[i: j + 1], True else: break
dd-genomics-master
archived/v1/code/pheno_mentions.py
import ddext def init(): ddext.input('doc_id', 'text') ddext.input('sent_id', 'int') ddext.input('words', 'text[]') ddext.input('lemmas', 'text[]') ddext.input('poses', 'text[]') ddext.input('ners', 'text[]') ddext.input('dep_paths', 'text[]') ddext.input('dep_parents', 'int[]') ddext.input('wordidxs', 'int[]') ddext.input('relation_id', 'text') ddext.input('wordidxs_1', 'int[]') ddext.input('wordidxs_2', 'int[]') ddext.returns('doc_id', 'text') ddext.returns('relation_id', 'text') ddext.returns('feature', 'text') def run(doc_id, sent_id, words, lemmas, poses, ners, dep_paths, dep_parents, wordidxs, relation_id, wordidxs_1, wordidxs_2): try: import ddlib except: import os DD_HOME = os.environ['DEEPDIVE_HOME'] from sys import path path.append('%s/ddlib' % DD_HOME) import ddlib obj = dict() obj['lemma'] = [] obj['words'] = [] obj['ner'] = [] obj['pos'] = [] obj['dep_graph'] = [] for i in xrange(len(words)): obj['lemma'].append(lemmas[i]) obj['words'].append(words[i]) obj['ner'].append(ners[i]) obj['pos'].append(poses[i]) obj['dep_graph'].append( str(int(dep_parents[i])) + "\t" + dep_paths[i] + "\t" + str(i)) word_obj_list = ddlib.unpack_words( obj, lemma='lemma', pos='pos', ner='ner', words='words', dep_graph='dep_graph') gene_span = ddlib.get_span(wordidxs_1[0], len(wordidxs_1)) pheno_span = ddlib.get_span(wordidxs_2[0], len(wordidxs_2)) features = set() for feature in ddlib.get_generic_features_relation(word_obj_list, gene_span, pheno_span): features.add(feature) for feature in features: yield doc_id, relation_id, feature
dd-genomics-master
archived/v1/code/pair_features.py
import ddext from ddext import SD def init(): ddext.input('doc_id', 'text') ddext.input('sent_id_1', 'int') ddext.input('mention_id_1', 'text') ddext.input('wordidxs_1', 'int[]') ddext.input('words_1', 'text[]') ddext.input('entity_1', 'text') ddext.input('type_1', 'text') ddext.input('correct_1', 'boolean') ddext.input('sent_id_2', 'int') ddext.input('mention_id_2', 'text') ddext.input('wordidxs_2', 'int[]') ddext.input('words_2', 'text[]') ddext.input('entity_2', 'text') ddext.input('type_2', 'text') ddext.input('correct_2', 'boolean') ddext.returns('doc_id', 'text') ddext.returns('sent_id_1', 'int') ddext.returns('sent_id_2', 'int') ddext.returns('relation_id', 'text') ddext.returns('type', 'text') ddext.returns('mention_id_1', 'text') ddext.returns('mention_id_2', 'text') ddext.returns('wordidxs_1', 'int[]') ddext.returns('wordidxs_2', 'int[]') ddext.returns('words_1', 'text[]') ddext.returns('words_2', 'text[]') ddext.returns('entity_1', 'text') ddext.returns('entity_2', 'text') ddext.returns('is_correct', 'boolean') def run(doc_id, sent_id_1, mention_id_1, wordidxs_1, words_1, entity_1, mtype_1, correct_1, sent_id_2, mention_id_2, wordidxs_2, words_2, entity_2, mtype_2, correct_2): if 'pos_pairs' in SD: pos_pairs = SD['pos_pairs'] else: import os APP_HOME = os.environ['DD_GENOMICS_HOME'] pos_pairs = set() gpheno = [x.strip().split('\t') for x in open('%s/onto/data/hpo_phenotype_genes.tsv' % APP_HOME)] gdisease = [x.strip().split('\t') for x in open('%s/onto/data/hpo_disease_genes.tsv' % APP_HOME)] for pheno, gene in gpheno + gdisease: pos_pairs.add((gene, pheno)) SD['pos_pairs'] = pos_pairs rid = '%s_%s_g%s_p%s' % (doc_id, sent_id_1, '%d:%d' % (wordidxs_1[0], wordidxs_1[-1]), '%d:%d' % (wordidxs_2[0], wordidxs_2[-1]), ) truth = None if correct_1 and correct_2: gene = entity_1 for pheno in entity_2.split()[0].split('|'): if (gene, pheno) in pos_pairs: truth = True elif correct_1 is False or correct_2 is False: truth = False yield (doc_id, sent_id_1, sent_id_2, rid, None, mention_id_1, mention_id_2, wordidxs_1, wordidxs_2, words_1, words_2, entity_1, entity_2, truth )
dd-genomics-master
archived/v1/code/gene_pheno_pairs.py
#! /usr/bin/env python3 # # This script takes approved symbols, alternate symbols, and approved long names # from the three dictionaries of genes we currently have, and tries to obtain a # single dictionary that contains the union of the information available. # # The output is a TSV file where the first column is the approved symbols, the # second column is a list of alternate symbols (separated by '|'), and the # third is a list of possible long names (separated by '|'). # import sys from helper.easierlife import BASE_DIR HUGO_alternate_symbolS_FILE = BASE_DIR + "/dicts/hugo_synonyms.tsv" HGNC_APPROVED_NAMES_FILE = BASE_DIR + "/dicts/HGNC_approved_names.txt" GENES_PHARM_FILE = BASE_DIR + "/dicts/genes_pharm.tsv" alternate_symbols = dict() alternate_symbols_inverted = dict() long_names = dict() with open(HUGO_alternate_symbolS_FILE, 'rt') as hugo_file: for line in hugo_file: tokens = line.rstrip().split("\t") symbol = tokens[0] if symbol not in alternate_symbols: alternate_symbols[symbol] = set() alternate_symbols[symbol].add(symbol) alternate_symbols_inverted[symbol] = set([symbol,]) if len(tokens) > 1: for alternate_symbol in tokens[1].split(","): if alternate_symbol not in alternate_symbols: alternate_symbols[alternate_symbol] = set() alternate_symbols[alternate_symbol].add(symbol) alternate_symbols_inverted[symbol].add(alternate_symbol) long_names[symbol] = set() with open(HGNC_APPROVED_NAMES_FILE, 'rt') as hgnc_file: for line in hgnc_file: tokens = line.rstrip().split("\t") symbol = tokens[0] if symbol.endswith("withdrawn"): # TODO XXX (Matteo): or should we take care of withdrawn symbols? continue #sys.stderr.write("symbol:{}\n".format(symbol)) hgnc_alternate_symbols = set([x.strip() for x in tokens[1].split(",")]) if symbol in alternate_symbols and symbol in alternate_symbols[symbol]: # the symbol is a 'main' symbol from hugo, use it as it is. pass elif symbol in alternate_symbols and symbol not in alternate_symbols[symbol]: # the symbol is not a main symbol from hugo, use one of its main # symbols (the first when the set is converted to list) as main symbol. # XXX (Matteo) There's no reason to choose the "first", we could # choose any. new_symbol = list(alternate_symbols[symbol])[0] hgnc_alternate_symbols.discard(new_symbol) hgnc_alternate_symbols.add(symbol) symbol = new_symbol elif symbol not in alternate_symbols: # the symbol did not appear at all in hugo found_new_symbol = False for candidate in hgnc_alternate_symbols: if candidate in alternate_symbols and candidate in alternate_symbols[candidate]: # we found a symbol that is an alternate symbol in hgnc and # a main symbol in hugo. Elect it as main symbol for this entry new_symbol = candidate hgnc_alternate_symbols.discard(new_symbol) hgnc_alternate_symbols.add(symbol) symbol = new_symbol found_new_symbol = True break if not found_new_symbol: for candidate in hgnc_alternate_symbols: if candidate in alternate_symbols and \ candidate not in alternate_symbols[candidate]: # we found a symbol that is an alternate symbol in hgnc # and an alternate symbol in hugo. Elect the 'first' main # symbol for this candidate as main symbol for this # entry new_symbol = list(alternate_symbols[candidate])[0] hgnc_alternate_symbols.discard(new_symbol) hgnc_alternate_symbols.add(symbol) symbol = new_symbol found_new_symbol = True break if not found_new_symbol: # the symbol is not in hugo at all and none of its alternate in # hgnc appears in hugo either. This is a completely new symbol alternate_symbols[symbol] = set([symbol,]) alternate_symbols_inverted[symbol] = set([symbol,]) long_names[symbol] = set() else: sys.stderr.write("WE SHOULDN'T BE HERE\n") for alternate_symbol in hgnc_alternate_symbols: if len(alternate_symbol) == 0: continue if alternate_symbol not in alternate_symbols: alternate_symbols[alternate_symbol] = set([symbol,]) alternate_symbols_inverted[symbol].add(alternate_symbol) # TODO XXX (Matteo) the format of the long names in hgnc is weird long_names[symbol].add(tokens[2]) with open(GENES_PHARM_FILE, 'rt') as pharm_file: ## skip header pharm_file.readline() for line in pharm_file: tokens = line.rstrip().split("\t") symbol = tokens[4] if symbol.endswith("withdrawn"): # TODO XXX (Matteo): or should we take care of withdrawn symbols? continue pharm_alternate_symbols_tokens = tokens[6].split("\"") pharm_alternate_symbols = set() for token in pharm_alternate_symbols_tokens: if token != "," and len(token) > 0: pharm_alternate_symbols.add(token) if symbol in alternate_symbols and symbol in alternate_symbols[symbol]: # the symbol is a 'main' symbol from hugo/hgnc, use it as it is. pass elif symbol in alternate_symbols and symbol not in alternate_symbols[symbol]: # the symbol is not a main symbol from hugo/hgnc, use one of its main # symbols (the first when the set is converted to list) as main symbol. # XXX (Matteo) There's no reason to choose the "first", we could # choose any. new_symbol = list(alternate_symbols[symbol])[0] pharm_alternate_symbols.discard(new_symbol) pharm_alternate_symbols.add(symbol) symbol = new_symbol elif symbol not in alternate_symbols: # the symbol did not appear at all in hugo/hgnc found_new_symbol = False for candidate in hgnc_alternate_symbols: if candidate in alternate_symbols and candidate in alternate_symbols[candidate]: # we found a symbol that is an alternate symbol in pharm and # a main symbol in hugo/hgnc. Elect it as main symbol for this entry new_symbol = candidate hgnc_alternate_symbols.discard(new_symbol) hgnc_alternate_symbols.add(symbol) symbol = new_symbol found_new_symbol = True break if not found_new_symbol: for candidate in pharm_alternate_symbols: if candidate in alternate_symbols and \ candidate not in alternate_symbols[candidate]: # we found a symbol that is an alternate symbol in # pharm and an alternate symbol in hugo/hgnc. Elect the # 'first' main symbol for this candidate as main symbol # for this entry new_symbol = list(alternate_symbols[candidate])[0] pharm_alternate_symbols.discard(new_symbol) pharm_alternate_symbols.add(symbol) symbol = new_symbol found_new_symbol = True break if not found_new_symbol: # the symbol is not in hugo/hgnc at all and none of its alternate in # pharm appears in hugo/hgnc either. This is a completely new symbol alternate_symbols[symbol] = set([symbol,]) alternate_symbols_inverted[symbol] = set([symbol,]) long_names[symbol] = set() else: sys.stderr.write("WE SHOULDN'T BE HERE\n") for alternate_symbol in pharm_alternate_symbols: if len(alternate_symbol) == 0: continue if alternate_symbol not in alternate_symbols: alternate_symbols[alternate_symbol] = set([symbol,]) alternate_symbols_inverted[symbol].add(alternate_symbol) name = tokens[3] long_names[symbol].add(name) pharm_alternate_names_tokens = tokens[5].split("\"") for token in pharm_alternate_names_tokens: if token != "," and len(token) > 0 and token not in long_names[symbol]: long_names[symbol].add(token) for symbol in alternate_symbols: if len(alternate_symbols[symbol]) > 1: sys.stderr.write("WARNING: duplicate symbol {}: present as (alternate) symbol of {}\n".format(symbol, ", ".join(alternate_symbols[symbol]))) for symbol in alternate_symbols_inverted: assert symbol in long_names alternate_symbols_inverted[symbol].discard(symbol) print("{}\t{}\t{}".format(symbol, "|".join(alternate_symbols_inverted[symbol]), "|".join(long_names[symbol])))
dd-genomics-master
archived/v0/dicts/merge_gene_dicts.py
#! /usr/bin/env python3 # # Look for acronyms defined in a document that look like gene symbols import fileinput from dstruct.Sentence import Sentence from helper.dictionaries import load_dict from helper.easierlife import get_dict_from_TSVline, list2TSVarray, no_op, \ TSVstring2list # Return acronyms from sentence def extract(sentence): acronyms = [] # First method: Look for a sentence that starts with "Abbreviations" if len(sentence.words) > 2 and \ sentence.words[0].word.casefold() == "abbreviations" and \ (sentence.words[1].word.casefold() == ":" or sentence.words[1].word.casefold() == "used"): words = [x.word for x in sentence.words] index = 2 while index < len(words): acronym = dict() acronym["acronym"] = words[index] # There are a lot of typos and different separators used in the # text, this is obviously a best effort ... try: comma_index = words.index(",", index + 1) except: comma_index = len(words) try: semicolon_index = words.index(";", index + 1) except: semicolon_index = len(words) try: colon_index = words.index(":", index + 1) except: colon_index = len(words) definition_start = min( [comma_index, semicolon_index, colon_index]) + 1 if definition_start > len(words): definition_start = index + 1 try: definition_end = words.index(";", definition_start + 1) except: if words[-1] == ".": definition_end = len(words) - 1 else: definition_end = len(words) definition = " ".join(words[definition_start:definition_end]) if words[index] not in merged_genes_dict or \ words[index] in inverted_long_names: index = definition_end + 1 continue # If we didn't find a definition, give up if definition.strip() == "": index = definition_end + 1 continue acronym["doc_id"] = sentence.doc_id acronym["sent_id"] = sentence.sent_id acronym["word_idx"] = sentence.words[index].in_sent_idx acronym["definition"] = definition acronyms.append(acronym) index = definition_end + 1 else: # Second method: find 'A Better Example (ABE)' type of definitions. # Skip first and last word of sentence, to allow for "(" and ")". for word in sentence.words[1:-1]: acronym = None # Look for definition only if # - this word is in the genes dictionary AND # - is uppercase AND # - it only contains letters AND # - it has length at least 2 AND # - it comes between "(" and ")" or "(" and ";" # or "(" # and "," if word.word in merged_genes_dict and \ word.word not in inverted_long_names and \ word.word.isupper() and word.word.isalpha() and \ len(word.word) >= 2 and \ ((sentence.words[word.in_sent_idx - 1].word == "(" and sentence.words[word.in_sent_idx + 1].word in [ ")", ";" ",", "]"]) or (sentence.words[word.in_sent_idx - 1].word == "[" and sentence.words[word.in_sent_idx + 1].word == "]")): word_idx = word.in_sent_idx window_size = len(word.word) # Look for a sequence of words coming before this one whose # initials would create this acronym start_idx = 0 while start_idx + window_size - 1 < word_idx: window_words = sentence.words[start_idx:(start_idx + window_size)] is_definition = True for window_index in range(window_size): if window_words[window_index].word[0].lower() != \ word.word[window_index].lower(): is_definition = False break definition = " ".join([w.word for w in window_words]) # Only consider this acronym if the definition is valid if is_definition: acronym = dict() acronym["acronym"] = word.word acronym["definition"] = definition acronyms.append(acronym) break start_idx += 1 return acronyms # Load the genes dictionary merged_genes_dict = load_dict("merged_genes") inverted_long_names = load_dict("inverted_long_names") if __name__ == "__main__": # Process the input with fileinput.input() as input_files: for line in input_files: # Parse the TSV line line_dict = get_dict_from_TSVline( line, ["doc_id", "sent_ids", "wordidxss", "wordss", "posess", "nerss", "lemmass", "dep_pathss", "dep_parentss", "bounding_boxess"], [no_op, lambda x: TSVstring2list(x, int), lambda x: TSVstring2list(x,sep='!~!'), lambda x: TSVstring2list(x,sep='!~!'), lambda x: TSVstring2list(x,sep='!~!'), lambda x: TSVstring2list(x,sep='!~!'), lambda x: TSVstring2list(x,sep='!~!'), lambda x: TSVstring2list(x,sep='!~!'), lambda x: TSVstring2list(x,sep='!~!'), lambda x: TSVstring2list(x,sep='!~!')]) # Acronyms defined in the document acronyms = dict() for idx in range(len(line_dict["sent_ids"])): wordidxs = TSVstring2list(line_dict["wordidxss"][idx], int) words = TSVstring2list(line_dict["wordss"][idx]) poses = TSVstring2list(line_dict["posess"][idx]) ners = TSVstring2list(line_dict["nerss"][idx]) lemmas = TSVstring2list(line_dict["lemmass"][idx]) dep_paths = TSVstring2list(line_dict["dep_pathss"][idx]) dep_parents = TSVstring2list(line_dict["dep_parentss"][idx], int) bounding_boxes = TSVstring2list(line_dict["bounding_boxess"][idx]) # Create the Sentence object sentence = Sentence( line_dict["doc_id"], line_dict["sent_ids"][idx], wordidxs, words, poses, ners, lemmas, dep_paths, dep_parents, bounding_boxes) # Extract the acronyms from the sentence sen_acronyms = extract(sentence) for acronym in sen_acronyms: if acronym["acronym"] not in acronyms: acronyms[acronym["acronym"]] = set() acronyms[acronym["acronym"]].add(acronym["definition"]) # Classify the acronyms for acronym in acronyms: contains_kw = False is_correct = None for definition in acronyms[acronym]: # If the definition is in the gene dictionary, supervise as # correct if definition in merged_genes_dict: is_correct = True break else: # Check if the definition contains some keywords that # make us suspect that it is probably a gene/protein. # This list is incomplete, and it would be good to add # to it. if contains_kw: continue for word in definition.split(): if word.endswith("ase") and len(word) > 5: contains_kw = True break if " gene" in definition or \ "protein" in definition or \ "factor" in definition or \ "ligand" in definition or \ "enzyme" in definition or \ "receptor" in definition or \ "pseudogene" in definition: contains_kw = True # If no significant keyword in any definition, supervise as not # correct if not contains_kw and not is_correct: is_correct = False is_correct_str = "\\N" if is_correct is not None: is_correct_str = is_correct.__repr__() print("\t".join( (line_dict["doc_id"], acronym, list2TSVarray(list(acronyms[acronym]), quote=True), is_correct_str)))
dd-genomics-master
archived/v0/code/ext_gene_find_acronyms.py
#! /usr/bin/env python3 # # Extract, add features to, and supervise mentions extracted from geneRifs. # import fileinput from dstruct.Sentence import Sentence from extract_gene_mentions import extract from helper.easierlife import get_dict_from_TSVline, TSVstring2list, no_op from helper.dictionaries import load_dict if __name__ == "__main__": # Load the merged genes dictionary merged_genes_dict = load_dict("merged_genes") # Process the input with fileinput.input() as input_files: for line in input_files: # Parse the TSV line line_dict = get_dict_from_TSVline( line, ["doc_id", "sent_id", "wordidxs", "words", "gene"], [no_op, int, lambda x: TSVstring2list(x, int), TSVstring2list, no_op]) # Create the Sentence object null_list = [None, ] * len(line_dict["wordidxs"]) sentence = Sentence( line_dict["doc_id"], line_dict["sent_id"], line_dict["wordidxs"], line_dict["words"], null_list, null_list, null_list, null_list, null_list, null_list) # This is the 'labelled' gene that we know is in the sentence gene = line_dict["gene"] # Get the main symbol (or list of symbols) for the labelled gene if gene in merged_genes_dict: gene = merged_genes_dict[gene] else: gene = [gene, ] # Skip sentences that are "( GENE )", as they give no info about # anything. if (sentence.words[0].word == "-LRB-" and sentence.words[-1].word == "-RRB-") or \ (sentence.words[0].word == "-LSB-" and sentence.words[-1].word == "-RSB-"): continue # Extract mentions from sentence. This also adds the features mentions = extract(sentence) # Find the candidate(s) containing the "labelled" gene either in # the words or in the entity, and supervise as True and print. not_main_mentions = [] for mention in mentions: mention.type = "GENERIFS" for g in gene: # If we find the labelled symbol in the words of the # candidate, supervise as true and print if g in mention.words[0].word or \ g in mention.entity.split("|"): mention.is_correct = True print(mention.tsv_dump()) break
dd-genomics-master
archived/v0/code/ext_geneRifs_candidates.py
#! /usr/bin/env python3 # # Map phenotype abnormalities entities to mentions import sys from nltk.stem.snowball import SnowballStemmer from helper.dictionaries import load_dict ORDINALS = frozenset( ["1st", "2nd", "3rd", "4th" "5th", "6th" "7th", "8th", "9th", "first", "second", "third", "fourth", "fifth", "sixth", "seventh", "eighth" "ninth"]) def main(): # Load the dictionaries we need stopwords_dict = load_dict("stopwords") hpoterm_phenotype_abnormalities = load_dict( "hpoterm_phenotype_abnormalities") # Load the stemmer from NLTK stemmer = SnowballStemmer("english") if len(sys.argv) != 2: sys.stderr.write("USAGE: {} DICT\n".format(sys.argv[0])) sys.exit(1) with open(sys.argv[1], 'rt') as dict_file: for line in dict_file: # Skip empty lines if line.strip() == "": continue hpo_id, name, definition = line.strip().split("\t") # Skip if this is not a phenotypic abnormality if hpo_id not in hpoterm_phenotype_abnormalities: continue tokens = name.split() if len(tokens) == 1: name_stems = [tokens[0].casefold(), ] else: # Compute the stems of the name name_stems = set() for word in tokens: # Remove parenthesis and commas and colons if word[0] == "(": word = word[1:] if word[-1] == ")": word = word[:-1] if word[-1] == ",": word = word[:-1] if word[-1] == ":": word = word[:-1] # Only process non stop-words AND single letters if (word.casefold() not in stopwords_dict and word not in ORDINALS) or len(word) == 1: # split words that contain a "/" if word.find("/") != - 1: for part in word.split("/"): name_stems.add(stemmer.stem(part)) else: name_stems.add(stemmer.stem(word)) print("\t".join([hpo_id, name, "|".join(name_stems)])) if __name__ == "__main__": sys.exit(main())
dd-genomics-master
archived/v0/code/hpoterms2mentions.py
#! /usr/bin/env python3 # # Extract gene mention candidates and perform distant supervision # import fileinput from dstruct.Mention import Mention from dstruct.Sentence import Sentence from helper.dictionaries import load_dict from helper.easierlife import get_all_phrases_in_sentence, \ get_dict_from_TSVline, TSVstring2list, no_op DOC_ELEMENTS = frozenset( ["figure", "table", "figures", "tables", "fig", "fig.", "figs", "figs.", "file", "movie"]) INDIVIDUALS = frozenset(["individual", "individuals", "patient"]) TYPES = frozenset(["group", "type", "class", "method"]) # Load the dictionaries that we need merged_genes_dict = load_dict("merged_genes") inverted_long_names = load_dict("inverted_long_names") hpoterms_with_gene = load_dict("hpoterms_with_gene") english_dict = load_dict("english") # Max mention length. We won't look at subsentences longer than this. max_mention_length = 0 for key in merged_genes_dict: length = len(key.split()) if length > max_mention_length: max_mention_length = length # doubling to take into account commas and who knows what max_mention_length *= 2 # Supervise the candidates. def supervise(mentions, sentence): phrase = " ".join([x.word for x in sentence.words]) new_mentions = [] for mention in mentions: new_mentions.append(mention) if mention.is_correct is not None: continue # The candidate is a long name. if " ".join([word.word for word in mention.words]) in \ inverted_long_names: mention.is_correct = True mention.type = "GENE_SUP_long" continue # The candidate is a MIM entry if mention.words[0].word == "MIM": mention_word_idx = mention.words[0].in_sent_idx if mention_word_idx < len(sentence.words) - 1: next_word = sentence.words[mention_word_idx + 1].word if next_word.casefold() in ["no", "no.", "#", ":"] and \ mention_word_idx + 2 < len(sentence.words): next_word = sentence.words[mention_word_idx + 2].word try: int(next_word) mention.is_correct = False mention.type = "GENE_SUP_MIM" continue except ValueError: pass # The candidate is an entry in Gene Ontology if len(mention.words) == 1 and mention.words[0].word == "GO": try: if sentence.words[mention.words[0].in_sent_idx + 1][0] == ":": mention.is_correct = False mention.type = "GENE_SUP_go" except: pass continue # The phrase starts with words that are indicative of the candidate not # being a mention of a gene # We add a feature for this, as it is a context property if phrase.startswith("Performed the experiments :") or \ phrase.startswith("Wrote the paper :") or \ phrase.startswith("W'rote the paper :") or \ phrase.startswith("Wlrote the paper") or \ phrase.startswith("Contributed reagents") or \ phrase.startswith("Analyzed the data :") or \ phrase.casefold().startswith("address"): # An unsupervised copy with the special feature # unsuper_enriched = Mention( # "GENE_dontsup", mention.entity, mention.words) # unsuper_enriched.features = mention.features.copy() # unsuper_enriched.add_feature("IN_CONTRIB_PHRASE") # new_mentions.append(unsuper_enriched) # This candidate contain only the 'special' feature. # super_spec = Mention( # "GENE_SUP_contr_2", mention.entity, mention.words) # super_spec.is_correct = False # super_spec.add_feature("IN_CONTRIB_PHRASE") # new_mentions.append(super_spec) # Set is_correct and type. mention.is_correct = False mention.type = "GENE_SUP_contr_1" continue # Index of the word on the left idx = mention.wordidxs[0] - 1 if idx >= 0: # The candidate is preceded by a "%" (it's probably a quantity) if sentence.words[idx].word == "%": mention.is_correct = False mention.type = "GENE_SUP_%" continue # The candidate comes after a "document element" (e.g., table, or # figure) if sentence.words[idx].word.casefold() in DOC_ELEMENTS: mention.is_correct = False mention.type = "GENE_SUP_doc" continue # The candidate comes after an "individual" word (e.g., # "individual") if sentence.words[idx].word.casefold() in INDIVIDUALS and \ not mention.words[0].word.isalpha() and \ not len(mention.words[0].word) > 4: mention.is_correct = False mention.type = "GENE_SUP_indiv" continue # The candidate comes after a "type" word, and it is made only of # the letters "I" and "V" if sentence.words[idx].lemma.casefold() in TYPES and \ set(mention.words[0].word).issubset(set(["I", "V"])): mention.is_correct = False mention.type = "GENE_SUP_type" continue # Index of the word on the right idx = mention.wordidxs[-1] + 1 if idx < len(sentence.words): # The candidate is followed by a "=" (it's probably a quantity) if sentence.words[idx].word == "=": mention.is_correct = False mention.type = "GENE_SUP_=" continue # The candidate is followed by a ":" and the word after it is a # number (it's probably a quantity) if sentence.words[idx].word == ":": try: float(sentence.words[idx + 1].word) mention.is_correct = False mention.type = "GENE_SUP_:" except: # both ValueError and IndexError pass continue # The candidate comes before "et" if sentence.words[idx].word == "et": mention.is_correct = False mention.type = "GENE_SUP_et" continue # The candidate is a DNA triplet # We check this by looking at whether the word before or after is also # a DNA triplet. if len(mention.words) == 1 and len(mention.words[0].word) == 3 and \ set(mention.words[0].word) <= set("ACGT"): done = False idx = mention.wordidxs[0] - 1 if idx > 0: if set(sentence.words[idx].word) <= set("ACGT"): mention.is_correct = False mention.type = "GENE_SUP_dna" continue idx = mention.wordidxs[-1] + 1 if not done and idx < len(sentence.words): if set(sentence.words[idx].word) <= set("ACGT"): mention.is_correct = False mention.type = "GENE_SUP_dna" continue # If it's "II", it's most probably wrong. if mention.words[0].word == "II": mention.is_correct = False mention.type = "GENE_SUP_ii" continue # The candidate comes after an organization, or a location, or a # person. We skip commas as they may trick us. comes_after = None loc_idx = mention.wordidxs[0] - 1 while loc_idx >= 0 and sentence.words[loc_idx].lemma == ",": loc_idx -= 1 if loc_idx >= 0 and \ sentence.words[loc_idx].ner in \ ["ORGANIZATION", "LOCATION", "PERSON"] and \ sentence.words[loc_idx].word not in merged_genes_dict: comes_after = sentence.words[loc_idx].ner # The candidate comes before an organization, or a location, or a # person. We skip commas, as they may trick us. comes_before = None loc_idx = mention.wordidxs[-1] + 1 while loc_idx < len(sentence.words) and \ sentence.words[loc_idx].lemma == ",": loc_idx += 1 if loc_idx < len(sentence.words) and sentence.words[loc_idx].ner in \ ["ORGANIZATION", "LOCATION", "PERSON"] and \ sentence.words[loc_idx].word not in merged_genes_dict: comes_before = sentence.words[loc_idx].ner # Not correct if it's most probably a person name. if comes_before and comes_after: mention.is_correct = False mention.type = "GENE_SUP_name" continue # Comes after person and before "," or ":", so it's probably a person # name if comes_after == "PERSON" and \ mention.words[-1].in_sent_idx + 1 < len(sentence.words) and \ sentence.words[mention.words[-1].in_sent_idx + 1].word \ in [",", ":"]: mention.is_correct = False mention.type = "GENE_SUP_name2" continue if comes_after == "PERSON" and mention.words[0].ner == "PERSON": mention.is_correct = False mention.type = "GENE_SUP_name3" continue # Is a location and comes before a location so it's probably wrong if comes_before == "LOCATION" and mention.words[0].ner == "LOCATION": mention.is_correct = False mention.type = "GENE_SUP_loc" continue return new_mentions # Return a list of mention candidates extracted from the sentence def extract(sentence): mentions = [] # Skip the sentence if there are no English words in the sentence no_english_words = True for word in sentence.words: if len(word.word) > 2 and \ (word.word in english_dict or word.word.casefold() in english_dict): no_english_words = False break if no_english_words: return [] # Stop iteration sentence_is_upper = False if " ".join([x.word for x in sentence.words]).isupper(): sentence_is_upper = True # The following set keeps a list of indexes we already looked at and which # contained a mention history = set() words = sentence.words # Scan all subsequences of the sentence of length up to max_mention_length for start, end in get_all_phrases_in_sentence(sentence, max_mention_length): if start in history or end in history: continue phrase = " ".join([word.word for word in words[start:end]]) if sentence_is_upper: # XXX This may not be a great idea... phrase = phrase.casefold() mention = None # If the phrase is a hpoterm name containing a gene, then it is a # mention candidate to supervise as negative if phrase in hpoterms_with_gene: mention = Mention("GENE_SUP_HPO", phrase, words[start:end]) mention.is_correct = False mentions.append(mention) for i in range(start, end): history.add(i) # If the phrase is in the gene dictionary, then is a mention candidate if len(phrase) > 1 and phrase in merged_genes_dict: # The entity is a list of all the main symbols that could have the # phrase as symbol. They're separated by "|". mention = Mention("GENE", "|".join(merged_genes_dict[phrase]), words[start:end]) # Add mention to the list mentions.append(mention) # Add indexes to history so that they are not used for another # mention for i in range(start, end): history.add(i) return mentions if __name__ == "__main__": # Process the input with fileinput.input() as input_files: for line in input_files: # Parse the TSV line line_dict = get_dict_from_TSVline( line, ["doc_id", "sent_id", "wordidxs", "words", "poses", "ners", "lemmas"], [no_op, int, lambda x: TSVstring2list(x, int), TSVstring2list, TSVstring2list, TSVstring2list, TSVstring2list]) # Create the sentence object null_list = [None, ] * len(line_dict["wordidxs"]) sentence = Sentence( line_dict["doc_id"], line_dict["sent_id"], line_dict["wordidxs"], line_dict["words"], line_dict["poses"], line_dict["ners"], line_dict["lemmas"], null_list, null_list, null_list) # Skip weird sentences if sentence.is_weird(): continue # Get list of mentions candidates in this sentence mentions = extract(sentence) # Supervise them new_mentions = supervise(mentions, sentence) # Print! for mention in new_mentions: print(mention.tsv_dump())
dd-genomics-master
archived/v0/code/ext_gene_candidates.py
dd-genomics-master
archived/v0/code/__init__.py
#! /usr/bin/env python3 # # Takes one directory containing parser output files and, for each file in that # directory, emits TSV lines that can be loaded # in the 'sentences' table # using the PostgreSQL COPY FROM command. # # Parser output files contain "blocks" which are separated by blank lines. Each # "block" is a sentence. Each sentence spans over one or more lines. Each line # represents a # "word" in the sentence (it can be punctuation, a symbol or # anything). Each word line has *nine* fields: # 1: index of the word in the sentence, starting from 1. # 2: the text of the word as it appears in the document # 3: Part of Speech (POS) tag of the word (see # http://www.computing.dcu.ie/~acahill/tagset.html for a list) # 4: Named Entity Recognition (NER) tag of the word # 5: the lemmatized word # 6: the label on the edge in dependency path between the parent of this word # and the word # 7: the word index of the *parent* of this word in the dependency path. 0 # means root # 8: the sentence ID, unique in the document # 9: the bounding box containing this word in the PDF document. The format is # "[pXXXlXXXtXXXrXXXbXXX]," for page, left, top, right, bottom. # Alternatively, the bounding box may have format # "[pXXXlXXXtXXXrXXXbXXX, pYYYlYYYtYYYrYYYbYYY]" when the word is split # between two lines # An example line is: # 1 Genome NNP O Genome nn 3 SENT_1 [p1l1669t172r1943b234], # # This script outputs TSV lines or JSON objects, one per sentence. # # Each TSV line has nine columns. The text in the columns is formatted so that # the output can be given in input to the PostgreSQL 'COPY FROM' command. The # columns are the following (between parentheses is the PostgreSQL type for the column): # 1: document ID (text) # 2: sentence ID (int) # 3: word indexes (int[]). They now start from 0, like an array. # 4: words, (text[]) # 5: POSes (text[]) # 6: NERs (text[]) # 7: dependency paths (text[]) # 8: dependency parent (int[]) -1 means root, so that each of them is an array index # 9: bounding boxes (text[]) # # This script can be spawn subprocesses to increase parallelism, which can be # useful when having to convert a lot of files. # import json import os import os.path import sys from multiprocessing import Process from helper.easierlife import list2TSVarray def process_files(proc_id, input_files, input_dir, output_dir, mode): with open(os.path.realpath("{}/sentences-{}.{}".format(output_dir, proc_id, mode)), 'wt') as out_file: for filename in input_files: # Docid assumed to be the filename. docid = filename with open(os.path.realpath(input_dir + "/" + filename), 'rt') as curr_file: atEOF = False # Check if the file is empty (we are at End of File) curr_pos = curr_file.tell() curr_file.read(1) new_pos = curr_file.tell() if new_pos == curr_pos: atEOF = True else: curr_file.seek(curr_pos) # One iteration of the following loop corresponds to one sentence while not atEOF: sent_id = -1 wordidxs = [] words = [] poses = [] ners = [] lemmas = [] dep_paths = [] dep_parents = [] bounding_boxes = [] curr_line = curr_file.readline().strip() # Sentences are separated by empty lines in the parser output file while curr_line != "": tokens = curr_line.split("\t") if len(tokens) != 9: sys.stderr.write("ERROR: malformed line (wrong number of fields): {}\n".format(curr_line)) return 1 word_idx, word, pos, ner, lemma, dep_path, dep_parent, word_sent_id, bounding_box = tokens # Normalize sentence id word_sent_id = int(word_sent_id.replace("SENT_", "")) # assign sentence id if this is the first word of the sentence if sent_id == -1: sent_id = word_sent_id # sanity check for word_sent_id elif sent_id != word_sent_id: sys.stderr.write("ERROR: found word with mismatching sent_id w.r.t. sentence: {} != {}\n".format(word_sent_id, sent_id)) return 1 # Normalize bounding box, stripping initial '[' and # final '],' and concatenating components bounding_box = bounding_box[1:-2] bounding_box = bounding_box.replace(", ", "-") # Append contents of this line to the sentence arrays wordidxs.append(int(word_idx) - 1) # Start from 0 words.append(word) poses.append(pos) ners.append(ner) lemmas.append(lemma) dep_paths.append(dep_path) # Now "-1" means root and the rest correspond to array indices dep_parents.append(int(dep_parent) - 1) bounding_boxes.append(bounding_box) # Read the next line curr_line = curr_file.readline().strip() # Write sentence to output if mode == "tsv": out_file.write("{}\n".format("\t".join([docid, str(sent_id), list2TSVarray(wordidxs), list2TSVarray(words, quote=True), list2TSVarray(poses, quote=True), list2TSVarray(ners), list2TSVarray(lemmas, quote=True), list2TSVarray(dep_paths, quote=True), list2TSVarray(dep_parents), list2TSVarray(bounding_boxes)]))) elif mode == "json": out_file.write("{}\n".format(json.dumps({ "doc_id": docid, "sent_id": sent_id, "wordidxs": wordidxs, "words": words, "poses": poses, "ners": ners, "lemmas": lemmas, "dep_paths": dep_paths, "dep_parents": dep_parents, "bounding_boxes": bounding_boxes}))) # Check if we are at End of File curr_pos = curr_file.tell() curr_file.read(1) new_pos = curr_file.tell() if new_pos == curr_pos: atEOF = True else: curr_file.seek(curr_pos) # Process the input files. Output can be either tsv or json def main(): script_name = os.path.basename(__file__) # Check if len(sys.argv) != 5: sys.stderr.write("USAGE: {} MODE PARALLELISM INPUTDIR OUTPUTDIR\n".format(script_name)) return 1 parser_files = os.listdir(os.path.abspath(os.path.realpath(sys.argv[3]))) parallelism = int(sys.argv[2]) mode = sys.argv[1] for i in range(parallelism): files = [] for j in range(len(parser_files)): if j % parallelism == i: files.append(parser_files[j]) p = Process(target = process_files, args = (i, files, os.path.abspath(os.path.realpath(sys.argv[3])), os.path.abspath(os.path.realpath(sys.argv[4])), mode)) p.start() return 0 if __name__ == "__main__": sys.exit(main())
dd-genomics-master
archived/v0/code/parser2sentences.py
#! /usr/bin/env python3 # # Takes as first and only argument a dump obtained using get_dump.sql and # remove the entries where the gene symbol can be used to express multiple # genes. import sys if len(sys.argv) != 2: sys.stderr.write("USAGE: {} dump.tsv\n".format(sys.argv[0])) sys.exit(1) with open(sys.argv[1], 'rt') as dump: skipped = 0 for line in dump: tokens = line.strip().split("\t") gene_entity = tokens[1] if "|" not in gene_entity and "\\N" not in gene_entity: print(line.strip()) else: skipped += 1 sys.stderr.write("skipped: {}\n".format(skipped))
dd-genomics-master
archived/v0/code/filter_out_uncertain_genes.py
#! /usr/bin/env python3 # # Extract gene mention candidates and perform distant supervision # import fileinput import re from dstruct.Sentence import Sentence from helper.dictionaries import load_dict from helper.easierlife import get_dict_from_TSVline, TSVstring2list, no_op, \ print_feature, BASE_DIR import ddlib def add_features_generic(mention_id, gene_words, sentence): # Use the generic feature library (ONLY!) # Load dictionaries for keywords ddlib.load_dictionary(BASE_DIR + "/dicts/features/gene_var.tsv", "VARKW") ddlib.load_dictionary( BASE_DIR + "/dicts/features/gene_knock.tsv", "KNOCKKW") ddlib.load_dictionary( BASE_DIR + "/dicts/features/gene_amino.tsv", "AMINOKW") ddlib.load_dictionary( BASE_DIR + "/dicts/features/gene_antigene.tsv", "ANTIGENEKW") ddlib.load_dictionary(BASE_DIR + "/dicts/features/gene_dna.tsv", "DNAKW") ddlib.load_dictionary( BASE_DIR + "/dicts/features/gene_downregulation.tsv", "DOWNREGKW") ddlib.load_dictionary( BASE_DIR + "/dicts/features/gene_upregulation.tsv", "UPREGKW") ddlib.load_dictionary( BASE_DIR + "/dicts/features/gene_tumor.tsv", "TUMORKW") ddlib.load_dictionary( BASE_DIR + "/dicts/features/gene_gene.tsv", "GENEKW") ddlib.load_dictionary( BASE_DIR + "/dicts/features/gene_expression.tsv", "EXPRESSKW") # Create the objects used by ddlib. ddlib interface is so ugly. obj = dict() obj['lemma'] = [] obj['words'] = [] obj['ner'] = [] obj['pos'] = [] obj['dep_graph'] = [] for word in sentence.words: obj['lemma'].append(word.lemma) obj['words'].append(word.word) obj['ner'].append(word.ner) obj['pos'].append(word.pos) obj['dep_graph'].append( str(word.dep_parent + 1) + "\t" + word.dep_path + "\t" + str(word.in_sent_idx + 1)) word_obj_list = ddlib.unpack_words( obj, lemma='lemma', pos='pos', ner='ner', words='words', dep_graph='dep_graph', dep_graph_parser=ddlib.dep_graph_parser_triplet) gene_span = ddlib.get_span(gene_words[0].in_sent_idx, len(gene_words)) features = set() for feature in ddlib.get_generic_features_mention( word_obj_list, gene_span): features.add(feature) for feature in features: print_feature(sentence.doc_id, mention_id, feature) # Keywords that are often associated with genes VAR_KWS = frozenset([ "acetylation", "activate", "activation", "adaptor", "agonist", "alignment", "allele", "antagonist", "antibody", "asynonymous", "backbone", "binding", "biomarker", "breakdown", "cell", "cleavage", "cluster", "cnv", "coactivator", "co-activator", "complex", "dd-genotype", "DD-genotype", "deletion", "determinant", "domain", "duplication", "dysfunction", "effector", "enhancer", "enrichment", "enzyme", "excision", "factor", "family", "function", "functionality", "genotype", "growth", "haplotype", "haplotypes", "heterozygous", "hexons", "hexon", "histone", "homologue", "homology", "homozygous" "human", "hypermetylation", "hybridization", "induce", "inducer", "induction", "inhibitor", "inhibition", "intron", "interaction", "isoform", "isoforms", "kinase", "kinesin", "level", "ligand", "location", "locus", "mammalian", "marker", "methilation", "modification", "moiety", "molecule", "molecules", "morpheein", "motif", "mutant", "mutation", "mutations", "nonsynonymous", "non-synonymous", "nucleotide", "oligomerization", "oncoprotein", "pathway", "peptide", "pharmacokinetic", "pharmacodynamic", "pharmacogenetic" "phosphorylation", "polymorphism", "proliferation", "promoter", "protein", "receptor", "receptors", "recruitment", "region", "regulator", "release", "repressor", "resistance", "retention", "ribonuclease", "role", "sequence", "sequences", "sequestration", "serum", "signaling", "SNP", "SNPs", "staining", "sumoylation", "synonymous", "target", "T-cell", "transducer", "translocation", "transcribe", "transcript", "transcription", "transporter", "variant", "variation", "vivo", "vitro" ]) KNOCK_KWS = frozenset([ "knockdown", "knock-down", "knock-out", "knockout", "KO"]) AMINO_ACID_KWS = frozenset(["amino-acid", "aminoacid"]) ANTIGENE_KWS = frozenset(["antigen", "antigene", "anti-gen", "anti-gene"]) DNA_KWS = frozenset([ "cdna", "cDNA", "dna", "mrna", "mRNA", "rna", "rrna", "sirnas", "sirna", "siRNA", "siRNAs"]) DOWNREGULATION_KWS = frozenset(["down-regulation", "downregulation"]) UPREGULATION_KWS = frozenset(["up-regulation", "upregulation"]) TUMOR_KWS = frozenset([ "tumor", "tumours", "tumour", "cancer", "carcinoma", "fibrosarcoma", "sarcoma", "lymphoma"]) GENE_KWS = frozenset([ "gene", "oncogene", "protooncogene", "proto-oncogene", "pseudogene", "transgene"]) COEXPRESSION_KWS = frozenset([ "expression", "overexpression", "over-expression", "co-expression", "coexpression"]) KEYWORDS = VAR_KWS | KNOCK_KWS | AMINO_ACID_KWS | ANTIGENE_KWS | DNA_KWS | \ DOWNREGULATION_KWS | DOWNREGULATION_KWS | TUMOR_KWS | GENE_KWS | \ COEXPRESSION_KWS # Load the dictionaries that we need merged_genes_dict = load_dict("merged_genes") long_names_dict = load_dict("long_names") inverted_long_names = load_dict("inverted_long_names") hpoterms_with_gene = load_dict("hpoterms_with_gene") stopwords_dict = load_dict("stopwords") # Add features to a gene mention candidate def add_features(mention_id, mention_words, sentence): # The verb closest to the candidate, with the path to it. minl = 100 minp = None minw = None for word in mention_words: for word2 in sentence.words: if word2.lemma.isalpha() and re.search('^VB[A-Z]*$', word2.pos) \ and word2.lemma != 'be': # Ignoring "be" comes from pharm (Emily) (p, l) = sentence.get_word_dep_path( word.in_sent_idx, word2.in_sent_idx) if l < minl: minl = l minp = p minw = word2.lemma if minw: print_feature( sentence.doc_id, mention_id, 'VERB_[' + minw + ']' + minp) # The keywords that appear in the sentence with the mention minl = 100 minp = None minw = None for word in mention_words: for word2 in sentence.words: if word2.lemma in KEYWORDS: (p, l) = sentence.get_word_dep_path( word.in_sent_idx, word2.in_sent_idx) kw = word2.lemma if word2.lemma in KNOCK_KWS: kw = "_KNOCKOUT" elif word2.lemma in ANTIGENE_KWS: kw = "_ANTIGENE" elif word2.lemma in AMINO_ACID_KWS: kw = "_AMINOACID" # elif word2.lemma in DNA_KWS: # kw = "_DNA" elif word2.lemma in DOWNREGULATION_KWS: kw = "_DOWNREGULATION" elif word2.lemma in UPREGULATION_KWS: kw = "_UPREGULATION" # elif word2.lemma in TUMOR_KWS: # kw = "_TUMOR" # elif word2.lemma in GENE_KWS: # kw = "_GENE" # elif word2.lemma in COEXPRESSION_KWS: # ke = "_COEXPRESSION" if l < minl: minl = l minp = p minw = kw if len(p) < 100: print_feature( sentence.doc_id, mention_id, "KEYWORD_[" + kw + "]" + p) # Special features for the keyword on the shortest dependency path if minw: print_feature( sentence.doc_id, mention_id, 'EXT_KEYWORD_MIN_[' + minw + ']' + minp) print_feature( sentence.doc_id, mention_id, 'KEYWORD_MIN_[' + minw + ']') # If another gene is present in the sentence, add a feature with that gene # and the path to it. This comes from pharm. minl = 100 minp = None minw = None mention_wordidxs = [] for word in mention_words: mention_wordidxs.append(word.in_sent_idx) for word in mention_words: for word2 in sentence.words: if word2.in_sent_idx not in mention_wordidxs and \ word2.word in merged_genes_dict: (p, l) = sentence.get_word_dep_path( word.in_sent_idx, word2.in_sent_idx) if l < minl: minl = l minp = p minw = word2.lemma if minw: print_feature( sentence.doc_id, mention_id, 'OTHER_GENE_['+minw+']' + minp) # print_feature(sentence.doc_id, mention_id, 'OTHER_GENE_['+minw+']') # The lemma on the left of the candidate, whatever it is try: left = sentence.words[mention_words[0].in_sent_idx-1].lemma try: float(left) left = "_NUMBER" except ValueError: pass print_feature( sentence.doc_id, mention_id, "NGRAM_LEFT_1_[" + left + "]") except IndexError: pass # The lemma on the right of the candidate, whatever it is try: right = sentence.words[mention_words[-1].in_sent_idx+1].lemma try: float(right) right = "_NUMBER" except ValueError: pass print_feature( sentence.doc_id, mention_id, "NGRAM_RIGHT_1_[" + right + "]") except IndexError: pass # We know check whether the lemma on the left and on the right are # "special", for example a year or a gene. # The concept of left or right is a little tricky here, as we are actually # looking at the first word that contains only letters and is not a # stopword. idx = mention_words[0].in_sent_idx - 1 gene_on_left = None gene_on_right = None while idx >= 0 and \ ((((not sentence.words[idx].lemma.isalnum() and not sentence.words[idx] in merged_genes_dict) or (not sentence.words[idx].word.isupper() and sentence.words[idx].lemma in stopwords_dict)) and not re.match("^[0-9]+(.[0-9]+)?$", sentence.words[idx].word) and not sentence.words[idx] in merged_genes_dict) or len(sentence.words[idx].lemma) == 1): idx -= 1 if idx >= 0: if sentence.words[idx].word in merged_genes_dict and \ len(sentence.words[idx].word) > 3: gene_on_left = sentence.words[idx].word try: year = float(sentence.words[idx].word) if round(year) == year and year > 1950 and year <= 2014: print_feature(sentence.doc_id, mention_id, "IS_YEAR_LEFT") except: pass # The word on the right of the mention, if present, provided it's # alphanumeric but not a number idx = mention_words[-1].in_sent_idx + 1 while idx < len(sentence.words) and \ ((((not sentence.words[idx].lemma.isalnum() and not sentence.words[idx] in merged_genes_dict) or (not sentence.words[idx].word.isupper() and sentence.words[idx].lemma in stopwords_dict)) and not re.match("^[0-9]+(.[0-9]+)?$", sentence.words[idx].word) and not sentence.words[idx] in merged_genes_dict) or len(sentence.words[idx].lemma) == 1): idx += 1 if idx < len(sentence.words): if sentence.words[idx].word in merged_genes_dict and \ len(sentence.words[idx].word) > 3: gene_on_right = sentence.words[idx].word try: year = float(sentence.words[idx].word) if round(year) == year and year > 1950 and year <= 2014: print_feature(sentence.doc_id, mention_id, "IS_YEAR_RIGHT") except: pass if gene_on_left and gene_on_right: print_feature(sentence.doc_id, mention_id, "IS_BETWEEN_GENES") elif gene_on_left: print_feature(sentence.doc_id, mention_id, "GENE_ON_LEFT") elif gene_on_right: print_feature(sentence.doc_id, mention_id, "GENE_ON_RIGHT") # The candidate is a single word that appears many times (more than 4) in # the sentence if len(mention_words) == 1 and \ [w.word for w in sentence.words].count(mention_words[0].word) > 4: print_feature( sentence.doc_id, mention_id, "APPEARS_MANY_TIMES_IN_SENTENCE") # There are many PERSONs/ORGANIZATIONs/LOCATIONs in the sentence # for ner in ["PERSON", "ORGANIZATION", "LOCATION"]: # if [x.ner for x in sentence.words].count(ner) > 4: # print_feature( # sentence.doc_id, mention_id, "MANY_{}_IN_SENTENCE".format(ner)) if __name__ == "__main__": # Process the input with fileinput.input() as input_files: for line in input_files: # Parse the TSV line line_dict = get_dict_from_TSVline( line, ["doc_id", "sent_id", "wordidxs", "words", "poses", "ners", "lemmas", "dep_paths", "dep_parents", "mention_id", "mention_wordidxs"], [no_op, int, lambda x: TSVstring2list(x, int), TSVstring2list, TSVstring2list, TSVstring2list, TSVstring2list, TSVstring2list, lambda x: TSVstring2list(x, int), no_op, lambda x: TSVstring2list(x, int)]) # Create the sentence object null_list = [None, ] * len(line_dict["wordidxs"]) sentence = Sentence( line_dict["doc_id"], line_dict["sent_id"], line_dict["wordidxs"], line_dict["words"], line_dict["poses"], line_dict["ners"], line_dict["lemmas"], line_dict["dep_paths"], line_dict["dep_parents"], null_list) if sentence.is_weird(): continue mention_words = [] for mention_wordidx in line_dict["mention_wordidxs"]: mention_words.append(sentence.words[mention_wordidx]) add_features(line_dict["mention_id"], mention_words, sentence) # add_features_generic( line_dict["mention_id"], mention_words, # sentence)
dd-genomics-master
archived/v0/code/ext_gene_features.py
#! /usr/bin/env python3 # # Canonicalize a dump using the HPO dag # # Use the output of filter_out_uncertain_genes.py import sys from helper.dictionaries import load_dict if len(sys.argv) != 2: sys.stderr.write("USAGE: {} dump.tsv\n".format(sys.argv[0])) sys.exit(1) hpoancestors = load_dict("hpoancestors") with open(sys.argv[1], 'rt') as dump: for line in dump: tokens = line.strip().split("\t") relation_id = tokens[0] gene_entity = tokens[1] hpo_entity = tokens[3] if "|" not in hpo_entity: continue hpo_id = hpo_entity.split("|")[0] if hpo_id not in hpoancestors: continue print("{}\t{}\t{}".format(relation_id, gene_entity, hpo_entity)) for ancestor in hpoancestors[hpo_id]: print("{}\t{}\t{}".format(relation_id, gene_entity, ancestor))
dd-genomics-master
archived/v0/code/canonicalize.py
#! /usr/bin/env python3 from helper.dictionaries import load_dict if __name__ == "__main__": merged_genes_dict = load_dict("merged_genes") inverted_long_names = load_dict("inverted_long_names") hpoterms_orig = load_dict("hpoterms_orig") for hpoterm_name in hpoterms_orig: for long_name in inverted_long_names: if hpoterm_name in long_name.split() and \ hpoterm_name.casefold() != long_name.casefold: print("\t".join((hpoterm_name, long_name)))
dd-genomics-master
archived/v0/code/find_hpoterms_in_genes.py
#! /usr/bin/env python3 import fileinput import random import re from nltk.stem.snowball import SnowballStemmer from dstruct.Mention import Mention from dstruct.Sentence import Sentence from helper.easierlife import get_all_phrases_in_sentence, \ get_dict_from_TSVline, TSVstring2list, no_op from helper.dictionaries import load_dict max_mention_length = 8 # This is somewhat arbitrary NEG_PROB = 0.005 # Probability of generating a random negative mention # Load the dictionaries that we need english_dict = load_dict("english") stopwords_dict = load_dict("stopwords") inverted_hpoterms = load_dict("hpoterms_inverted") hponames_to_ids = load_dict("hponames_to_ids") genes_with_hpoterm = load_dict("genes_with_hpoterm") # hpodag = load_dict("hpoparents") stems = set() for hpo_name in inverted_hpoterms: stem_set = inverted_hpoterms[hpo_name] stems |= stem_set stems = frozenset(stems) # The keys of the following dictionary are sets of stems, and the values are # sets of hpoterms whose name, without stopwords, gives origin to the # corresponding set of stems (as key) hpoterms_dict = load_dict("hpoterms") # Initialize the stemmer stemmer = SnowballStemmer("english") # Perform the supervision def supervise(mentions, sentence): for mention in mentions: # Skip if we already supervised it (e.g., random mentions or # gene long names) if mention.is_correct is not None: continue # The next word is 'gene' or 'protein', so it's actually a gene if mention.words[-1].in_sent_idx < len(sentence.words) - 1: next_word = sentence.words[mention.words[-1].in_sent_idx + 1].word if next_word.casefold() in ["gene", "protein"]: mention.is_correct = False mention.type = "PHENO_SUP_GENE" continue mention_lemmas = set([x.lemma.casefold() for x in mention.words]) name_words = set([x.casefold() for x in mention.entity.split("|")[1].split()]) # The mention is exactly the HPO name if mention_lemmas == name_words and \ mention.words[0].lemma != "pneunomiae": mention.is_correct = True mention.type = "PHENO_SUP_FULL" return mentions # Return a list of mention candidates extracted from the sentence def extract(sentence): mentions = [] mention_ids = set() # If there are no English words in the sentence, we skip it. no_english_words = True for word in sentence.words: word.stem = stemmer.stem(word.word) # Here so all words have stem if len(word.word) > 2 and \ (word.word in english_dict or word.word.casefold() in english_dict): no_english_words = False if no_english_words: return mentions history = set() # Iterate over each phrase of length at most max_mention_length for start, end in get_all_phrases_in_sentence(sentence, max_mention_length): if start in history or end - 1 in history: continue phrase = " ".join([word.word for word in sentence.words[start:end]]) # If the phrase is a gene long name containing a phenotype name, create # a candidate that we supervise as negative if len(phrase) > 1 and phrase in genes_with_hpoterm: mention = Mention("HPOTERM_SUP_GENEL", phrase, sentence.words[start:end]) mention.is_correct = False mentions.append(mention) for word in sentence.words[start:end]: history.add(word.in_sent_idx) continue # Iterate over each phrase of length at most max_mention_length for start, end in get_all_phrases_in_sentence(sentence, max_mention_length): should_continue = False for i in range(start, end): if i in history: should_continue = True break if should_continue: continue phrase = " ".join([word.word for word in sentence.words[start:end]]) # The list of stems in the phrase (not from stopwords or symbols, and # not already used for a mention) phrase_stems = [] for word in sentence.words[start:end]: if not re.match("^(_|\W)+$", word.word) and \ (len(word.word) == 1 or word.lemma.casefold() not in stopwords_dict): phrase_stems.append(word.stem) phrase_stems_set = frozenset(phrase_stems) if phrase_stems_set in hpoterms_dict: # Find the word objects of that match mention_words = [] mention_lemmas = [] mention_stems = [] for word in sentence.words[start:end]: if word.stem in phrase_stems_set and \ word.lemma.casefold() not in mention_lemmas and \ word.stem not in mention_stems: mention_lemmas.append(word.lemma.casefold()) mention_words.append(word) mention_stems.append(word.stem) if len(mention_words) == len(phrase_stems_set): break entity = list(hpoterms_dict[phrase_stems_set])[0] mention = Mention( "PHENO", hponames_to_ids[entity] + "|" + entity, mention_words) # The following is a way to avoid duplicates. # It's ugly and not perfect if mention.id() in mention_ids: continue mention_ids.add(mention.id()) mentions.append(mention) for word in mention_words: history.add(word.in_sent_idx) # Generate some negative candidates at random, if this sentences didn't # contain any other candidate. We want the candidates to be nouns. if len(mentions) == 0 and random.random() <= NEG_PROB: index = random.randint(0, len(sentence.words) - 1) # We may not get a noun at random, so we try again if we don't. tries = 10 while not sentence.words[index].pos.startswith("NN") and tries > 0: index = random.randint(0, len(sentence.words) - 1) tries -= 1 if sentence.words[index].pos.startswith("NN"): mention = Mention( "PHENO_SUP_rand", sentence.words[index].lemma.casefold(), sentence.words[index:index+1]) mention.is_correct = False mentions.append(mention) return mentions if __name__ == "__main__": # Process the input with fileinput.input() as input_files: for line in input_files: # Parse the TSV line line_dict = get_dict_from_TSVline( line, ["doc_id", "sent_id", "wordidxs", "words", "poses", "lemmas"], [no_op, int, lambda x: TSVstring2list(x, int), TSVstring2list, TSVstring2list, TSVstring2list]) # Create the sentence object null_list = [None, ] * len(line_dict["wordidxs"]) sentence = Sentence( line_dict["doc_id"], line_dict["sent_id"], line_dict["wordidxs"], line_dict["words"], line_dict["poses"], null_list, line_dict["lemmas"], null_list, null_list, null_list) # Skip weird sentences if sentence.is_weird(): continue # Get list of mentions candidates in this sentence mentions = extract(sentence) # Supervise them new_mentions = supervise(mentions, sentence) # Print! for mention in new_mentions: print(mention.tsv_dump())
dd-genomics-master
archived/v0/code/ext_pheno_candidates.py
#! /usr/bin/env python3 # # Convert geneRifs file to a file that can be given in input to the NLPparser # extractor. import fileinput import json import sys if len(sys.argv) < 2: sys.stderr.write("USAGE: {} FILE [FILE [FILE [...]]]\n".format(sys.argv[0])) sys.exit(1) DOCUMENT_ID = "geneRifs-" i = 0 with fileinput.input() as input_files: for line in input_files: tokens = line.split("\t") line_dict = {"id": DOCUMENT_ID + str(i), "text": tokens[2]} print(json.dumps(line_dict)) i += 1
dd-genomics-master
archived/v0/code/geneRifs2NLPparser.py
#! /usr/bin/env python3 import fileinput import re from dstruct.Sentence import Sentence from helper.easierlife import get_dict_from_TSVline, TSVstring2list, no_op, \ print_feature import ddlib def add_features_generic(relation_id, gene_words, pheno_words, sentence): # Use the generic feature library (ONLY!) obj = dict() obj['lemma'] = [] obj['words'] = [] obj['ner'] = [] obj['pos'] = [] obj['dep_graph'] = [] for word in sentence.words: obj['lemma'].append(word.lemma) obj['words'].append(word.word) obj['ner'].append(word.ner) obj['pos'].append(word.pos) obj['dep_graph'].append( str(word.dep_parent + 1) + "\t" + word.dep_path + "\t" + str(word.in_sent_idx + 1)) word_obj_list = ddlib.unpack_words( obj, lemma='lemma', pos='pos', ner='ner', words='words', dep_graph='dep_graph', dep_graph_parser=ddlib.dep_graph_parser_triplet) gene_span = ddlib.get_span(gene_words[0].in_sent_idx, len(gene_words)) pheno_span = ddlib.get_span(pheno_words[0].ins_sent_idx, len(pheno_words)) features = set() for feature in ddlib.get_generic_feature_relation( word_obj_list, gene_span, pheno_span): features.add(feature) for feature in features: print_feature(sentence.doc_id, relation_id, feature) # Add features (few) def add_features_few(relation, gene_mention, hpoterm_mention, sentence): # Find the start/end indices of the mentions composing the relation gene_start = gene_mention.wordidxs[0] hpoterm_start = hpoterm_mention.wordidxs[0] gene_end = gene_mention.wordidxs[-1] hpoterm_end = hpoterm_mention.wordidxs[-1] limits = sorted((gene_start, hpoterm_start, gene_end, hpoterm_end)) start = limits[0] betw_start = limits[1] betw_end = limits[2] # If the gene comes first, we do not prefix, otherwise we do. if start == gene_start: inv = "" else: inv = "INV_" # The following features are only added if the two mentions are "close # enough" to avoid overfitting. The concept of "close enough" is somewhat # arbitrary. if betw_end - betw_start - 1 < 15: # The sequence of lemmas between the two mentions and the sequence of # lemmas between the two mentions but using the NERs, if present, and # the sequence of POSes between the mentions seq_list_ners = [] seq_list_lemmas = [] seq_list_poses = [] for word in sentence.words[betw_start+1:betw_end]: if word.ner != "O": seq_list_ners.append(word.ner) else: seq_list_ners.append(word.lemma) seq_list_lemmas.append(word.lemma) seq_list_poses.append(word.pos) seq_ners = " ".join(seq_list_ners) seq_lemmas = " ".join(seq_list_lemmas) seq_poses = "_".join(seq_list_poses) relation.add_feature(inv + "WORD_SEQ_[" + seq_lemmas + "]") if seq_ners != seq_lemmas: relation.add_feature(inv + "WORD_SEQ_NER_[" + seq_ners + "]") relation.add_feature(inv + "POS_SEQ_[" + seq_poses + "]") else: relation.add_feature(inv + "WORD_SEQ_[TOO_FAR_AWAY]") # relation.add_feature(inv + "WORD_SEQ_NER_[TOO_FAR_AWAY]") # relation.add_feature(inv + "POS_SEQ_[TOO_FAR_AWAY]") # Shortest dependency path between the two mentions (dep_path, dep_path_len) = sentence.dep_path(gene_mention, hpoterm_mention) if dep_path_len < 10: # XXX 10 is arbitrary relation.add_feature(inv + "DEP_PATH_[" + dep_path + "]") (dep_path_pos, dep_path_pos_len) = sentence.dep_path( gene_mention, hpoterm_mention, use_pos=True) relation.add_feature(inv + "DEP_PATH_POS_[" + dep_path_pos + "]") else: relation.add_feature(inv + "DEP_PATH_[TOO_FAR_AWAY]") # relation.add_feature(inv + "DEP_PATH_POS_[TOO_FAR_AWAY]") # For each verb in the sentence compute the dependency path from the # mentions to the verb for i in range(len(sentence.words)): # The filtering of the brackets and commas is from Emily's code. if re.search('^VB[A-Z]*$', sentence.words[i].pos) and \ sentence.words[i].word.isalpha(): # sentence.words[i].word not in ["{", "}", "(", ")", "[", "]"] # and "," not in sentence.words[i].word: min_len_g = 10000 min_path_g = None min_path_pos_g = None for wordidx in gene_mention.wordidxs: (path, length) = sentence.get_word_dep_path( wordidx, sentence.words[i].in_sent_idx) if length < min_len_g: min_path_g = path min_len_g = length (min_path_pos_g, l) = sentence.get_word_dep_path( wordidx, sentence.words[i].in_sent_idx, use_pos=True) min_len_h = 10000 min_path_h = None min_path_pos_h = None for wordidx in hpoterm_mention.wordidxs: (path, length) = sentence.get_word_dep_path( wordidx, sentence.words[i].in_sent_idx) if length < min_len_h: min_path_h = path min_len_h = length (min_path_pos_h, l) = sentence.get_word_dep_path( wordidx, sentence.words[i].in_sent_idx, use_pos=True) if min_len_g < 5 and min_len_h < 5: relation.add_feature( inv + "VERB_DEP_PATH_[" + sentence.words[i].lemma + "]_[" + min_path_g + "]_[" + min_path_h + "]") relation.add_feature( inv + "VERB_DEP_PATH_POS_[" + sentence.words[i].lemma + "]_[" + min_path_pos_g + "]_[" + min_path_pos_h + "]") # Add features def add_features(relation_id, gene_words, pheno_words, sentence): # Find the start/end indices of the mentions composing the relation gene_start = gene_words[0].in_sent_idx pheno_start = pheno_words[0].in_sent_idx gene_end = gene_words[-1].in_sent_idx pheno_end = pheno_words[-1].in_sent_idx limits = sorted((gene_start, pheno_start, gene_end, pheno_end)) start = limits[0] betw_start = limits[1] betw_end = limits[2] end = limits[3] # If the gene comes first, we do not prefix, otherwise we do. if start == gene_start: inv = "" else: inv = "INV_" # Verbs between the mentions verbs_between = [] minl_gene = 100 minp_gene = None minw_gene = None mini_gene = None minl_pheno = 100 # minp_pheno = None minw_pheno = None mini_pheno = None neg_found = False # Look all the words, as in the dependency path there could be words that # are close to both mentions but not between them for i in range(len(sentence.words)): # The filtering of the brackets and commas is from Emily's code. if re.search('^VB[A-Z]*$', sentence.words[i].pos) and \ sentence.words[i].word not in ["{", "}", "(", ")", "[", "]"] \ and "," not in sentence.words[i].word: (p_gene, l_gene) = sentence.get_word_dep_path( betw_start, sentence.words[i].in_sent_idx) (p_pheno, l_pheno) = sentence.get_word_dep_path( sentence.words[i].in_sent_idx, betw_end) if l_gene < minl_gene: minl_gene = l_gene minp_gene = p_gene minw_gene = sentence.words[i].lemma mini_gene = sentence.words[i].in_sent_idx if l_pheno < minl_pheno: minl_pheno = l_pheno # minp_pheno = p_pheno minw_pheno = sentence.words[i].lemma mini_pheno = sentence.words[i].in_sent_idx # Look for negation. if i > 0 and sentence.words[i-1].lemma in \ ["no", "not", "neither", "nor"]: if i < betw_end - 2: neg_found = True print_feature( relation_id, inv + "NEG_VERB_[" + sentence.words[i-1].word + "]-" + sentence.words[i].lemma) else: verbs_between.append(sentence.words[i]) if len(verbs_between) == 1 and not neg_found: print_feature( sentence.doc_id, relation_id, inv + "SINGLE_VERB_[%s]" % verbs_between[0].lemma) else: for verb in verbs_between: if verb.in_sent_idx > betw_start and \ verb.in_sent_idx < betw_end: print_feature( sentence.doc_id, relation_id, inv + "VERB_[%s]" % verb.lemma) if mini_pheno == mini_gene and mini_gene is not None and \ len(minp_gene) < 50: # and "," not in minw_gene: # feature = inv + 'MIN_VERB_[' + minw_gene + ']' + minp_gene # features.append(feature) feature = inv + 'MIN_VERB_[' + minw_gene + ']' print_feature(sentence.doc_id, relation_id, feature) else: feature = inv if mini_gene is not None: # feature = 'MIN_VERB_GENE_[' + minw_gene + ']' + minp_gene # print_feature(sentence.doc_id, relation_id, feature) feature += 'MIN_VERB_GENE_[' + minw_gene + ']' else: feature += 'MIN_VERB_GENE_[NULL]' if mini_pheno is not None: # feature = 'MIN_VERB_pheno_[' + minw_pheno + ']' + minp_pheno) # print_feature(sentence.doc_id, relation_id, feature) feature += '_pheno_[' + minw_pheno + ']' else: feature += '_pheno_[NULL]' print_feature(sentence.doc_id, relation_id, feature) # The following features are only added if the two mentions are "close # enough" to avoid overfitting. The concept of "close enough" is somewhat # arbitrary. neg_word_index = -1 if betw_end - betw_start - 1 < 8: for i in range(betw_start+1, betw_end): # Feature for separation between entities. # TODO Think about merging these? # I think these should be some kind of supervision rule instead? if "while" == sentence.words[i].lemma: print_feature(sentence.doc_id, relation_id, "SEP_BY_[while]") if "whereas" == sentence.words[i].lemma: print_feature(sentence.doc_id, relation_id, "SEP_BY_[whereas]") if sentence.words[i].lemma in ["no", "not", "neither", "nor"]: neg_word_index = i # Features for the negative words # TODO: We would probably need distant supervision for these if neg_word_index > -1: gene_p = None gene_l = 100 for word in sentence.words[gene_start:gene_end+1]: (p, l) = sentence.get_word_dep_path( word.in_sent_idx, neg_word_index) if l < gene_l: gene_p = p gene_l = l if gene_p: print_feature( sentence.doc_id, relation_id, inv + "NEG_[" + gene_p + "]") # pheno_p = None # pheno_l = 100 # for word in sentence.words[pheno_start:pheno_end+1]: # p = sentence.get_word_dep_path( # word.in_sent_idx, neg_word_index) # if len(p) < pheno_l: # pheno_p = p # pheno_l = len(p) # if pheno_p: # print_feature( # relation_id, inv + "pheno_TO_NEG_[" + pheno_p + "]") # The sequence of lemmas between the two mentions and the sequence of # lemmas between the two mentions but using the NERs, if present, and # the sequence of POSes between the mentions seq_list_ners = [] seq_list_lemmas = [] seq_list_poses = [] for word in sentence.words[betw_start+1:betw_end]: if word.ner != "O": seq_list_ners.append(word.ner) else: seq_list_ners.append(word.lemma) seq_list_lemmas.append(word.lemma) seq_list_poses.append(word.pos) seq_ners = " ".join(seq_list_ners) seq_lemmas = " ".join(seq_list_lemmas) seq_poses = "_".join(seq_list_poses) print_feature( sentence.doc_id, relation_id, inv + "WORD_SEQ_[" + seq_lemmas + "]") print_feature( sentence.doc_id, relation_id, inv + "WORD_SEQ_NER_[" + seq_ners + "]") print_feature( sentence.doc_id, relation_id, inv + "POS_SEQ_[" + seq_poses + "]") # Shortest dependency path between the two mentions (path, length) = sentence.dep_path(gene_words, pheno_words) print_feature( sentence.doc_id, relation_id, inv + "DEP_PATH_[" + path + "]") # Number of words between the mentions # TODO I think this should be some kind of supervision rule instead? # print_feature(sentence.doc_id, relation_id, # inv + "WORD_SEQ_LEN_[" + str(betw_end - betw_start - 1) + "]") # 2-gram between the mentions if betw_end - betw_start - 1 > 4 and betw_start - betw_end - 1 < 15: for i in range(betw_start + 1, betw_end - 1): print_feature( sentence.doc_id, relation_id, "BETW_2_GRAM_[" + sentence.words[i].lemma + "_" + sentence.words[i+1].lemma + "]") # Lemmas on the exterior of the mentions and on the interior feature = inv if start > 0: feature += "EXT_NGRAM_[" + sentence.words[start - 1].lemma + "]" else: feature += "EXT_NGRAM_[NULL]" if end < len(sentence.words) - 1: feature += "_[" + sentence.words[end + 1].lemma + "]" else: feature += "_[NULL]" print_feature(sentence.doc_id, relation_id, feature) feature = inv + "INT_NGRAM_[" + sentence.words[betw_start + 1].lemma + \ "]" + "_[" + sentence.words[betw_end - 1].lemma + "]" print_feature(sentence.doc_id, relation_id, feature) if __name__ == "__main__": # Process the input with fileinput.input() as input_files: for line in input_files: # Parse the TSV line line_dict = get_dict_from_TSVline( line, ["doc_id", "sent_id", "wordidxs", "words", "poses", "ners", "lemmas", "dep_paths", "dep_parents", "relation_id", "gene_wordidxs", "pheno_wordidxs"], [no_op, int, lambda x: TSVstring2list(x, int), TSVstring2list, TSVstring2list, TSVstring2list, TSVstring2list, TSVstring2list, lambda x: TSVstring2list(x, int), no_op, lambda x: TSVstring2list(x, int), lambda x: TSVstring2list(x, int)]) # Create the sentence object null_list = [None, ] * len(line_dict["wordidxs"]) sentence = Sentence( line_dict["doc_id"], line_dict["sent_id"], line_dict["wordidxs"], line_dict["words"], line_dict["poses"], line_dict["ners"], line_dict["lemmas"], line_dict["dep_paths"], line_dict["dep_parents"], null_list) if sentence.is_weird(): continue gene_words = [] for gene_wordidx in line_dict["gene_wordidxs"]: gene_words.append(sentence.words[gene_wordidx]) pheno_words = [] for pheno_wordidx in line_dict["pheno_wordidxs"]: pheno_words.append(sentence.words[pheno_wordidx]) add_features( line_dict["relation_id"], gene_words, pheno_words, sentence)
dd-genomics-master
archived/v0/code/ext_genepheno_features.py
#! /usr/bin/env python3 import fileinput import random import re from dstruct.Mention import Mention from dstruct.Sentence import Sentence from dstruct.Relation import Relation from helper.dictionaries import load_dict from helper.easierlife import get_dict_from_TSVline, no_op, TSVstring2list # Load the gene<->hpoterm dictionary genehpoterms_dict = load_dict("genehpoterms") # Supervise the candidates def supervise(relation, gene_mention, hpoterm_mention, sentence): # One of the two mentions is labelled as False if gene_mention.is_correct is False and \ hpoterm_mention.is_correct is not False: relation.is_correct = False relation.type = "GENEPHENO_SUP_F_G" elif hpoterm_mention.is_correct is False and \ gene_mention.is_correct is not False: relation.is_correct = False relation.type = "GENEPHENO_SUP_F_H" elif hpoterm_mention.is_correct is False and \ gene_mention.is_correct is False: relation.is_correct = False relation.type = "GENEPHENO_SUP_F_GH" else: # Present in the existing HPO mapping in_mapping = False hpo_entity_id = hpoterm_mention.entity.split("|")[0] if frozenset([gene_mention.words[0].word, hpo_entity_id]) in \ genehpoterms_dict: in_mapping = True else: for gene in gene_mention.entity.split("|"): if frozenset([gene, hpo_entity_id]) in \ genehpoterms_dict: in_mapping = True break if in_mapping: relation.is_correct = True relation.type = "GENEPHENO_SUP_MAP" if __name__ == "__main__": # Process input with fileinput.input() as input_files: for line in input_files: # Parse the TSV line line_dict = get_dict_from_TSVline( line, ["doc_id", "sent_id", "wordidxs", "words", "poses", "ners", "lemmas", "dep_paths", "dep_parents", "bounding_boxes", "gene_entities", "gene_wordidxss", "gene_is_corrects", "gene_types", "hpoterm_entities", "hpoterm_wordidxss", "hpoterm_is_corrects", "hpoterm_types"], [no_op, int, lambda x: TSVstring2list(x, int), TSVstring2list, TSVstring2list, TSVstring2list, TSVstring2list, TSVstring2list, lambda x: TSVstring2list(x, int), TSVstring2list, # these are for the sentence TSVstring2list, lambda x: TSVstring2list(x, sep="!~!"), TSVstring2list, TSVstring2list, # these are for the genes TSVstring2list, lambda x: TSVstring2list(x, sep="!~!"), TSVstring2list, TSVstring2list, # these are for the HPO ]) # Remove the genes that are unsupervised copies or duplicates supervised_idxs = set() unsupervised_idxs = set() for i in range(len(line_dict["gene_is_corrects"])): if line_dict["gene_is_corrects"][i] == "n": unsupervised_idxs.add(i) else: if line_dict["gene_types"][i] != "GENE_SUP_contr_2": # The above condition is to avoid duplicates supervised_idxs.add(i) survived_unsuperv_idxs = set() for i in unsupervised_idxs: wordidxs = line_dict["gene_wordidxss"][i] found = False for j in supervised_idxs: if line_dict["gene_wordidxss"][j] == wordidxs: found = True break if not found: survived_unsuperv_idxs.add(i) to_keep = sorted(survived_unsuperv_idxs | supervised_idxs) new_gene_entities = [] new_gene_wordidxss = [] new_gene_is_corrects = [] new_gene_types = [] for i in to_keep: new_gene_entities.append(line_dict["gene_entities"][i]) new_gene_wordidxss.append(line_dict["gene_wordidxss"][i]) new_gene_is_corrects.append(line_dict["gene_is_corrects"][i]) new_gene_types.append(line_dict["gene_types"][i]) line_dict["gene_entities"] = new_gene_entities line_dict["gene_wordidxss"] = new_gene_wordidxss line_dict["gene_is_corrects"] = new_gene_is_corrects line_dict["gene_types"] = new_gene_types # Remove the hpoterms that are unsupervised copies supervised_idxs = set() unsupervised_idxs = set() for i in range(len(line_dict["hpoterm_is_corrects"])): if line_dict["hpoterm_is_corrects"][i] == "n": unsupervised_idxs.add(i) else: supervised_idxs.add(i) survived_unsuperv_idxs = set() for i in unsupervised_idxs: wordidxs = line_dict["hpoterm_wordidxss"][i] found = False for j in supervised_idxs: if line_dict["hpoterm_wordidxss"][j] == wordidxs: found = True break if not found: survived_unsuperv_idxs.add(i) to_keep = sorted(survived_unsuperv_idxs | supervised_idxs) new_hpoterm_entities = [] new_hpoterm_wordidxss = [] new_hpoterm_is_corrects = [] new_hpoterm_types = [] for i in to_keep: new_hpoterm_entities.append(line_dict["hpoterm_entities"][i]) new_hpoterm_wordidxss.append(line_dict["hpoterm_wordidxss"][i]) new_hpoterm_is_corrects.append( line_dict["hpoterm_is_corrects"][i]) new_hpoterm_types.append(line_dict["hpoterm_types"][i]) line_dict["hpoterm_entities"] = new_hpoterm_entities line_dict["hpoterm_wordidxss"] = new_hpoterm_wordidxss line_dict["hpoterm_is_corrects"] = new_hpoterm_is_corrects line_dict["hpoterm_types"] = new_hpoterm_types # Create the sentence object where the two mentions appear sentence = Sentence( line_dict["doc_id"], line_dict["sent_id"], line_dict["wordidxs"], line_dict["words"], line_dict["poses"], line_dict["ners"], line_dict["lemmas"], line_dict["dep_paths"], line_dict["dep_parents"], line_dict["bounding_boxes"]) # Skip weird sentences if sentence.is_weird(): continue gene_mentions = [] hpoterm_mentions = [] positive_relations = [] gene_wordidxs = set() hpoterm_wordidxs = set() # Iterate over each pair of (gene,phenotype) mentions for g_idx in range(len(line_dict["gene_is_corrects"])): g_wordidxs = TSVstring2list( line_dict["gene_wordidxss"][g_idx], int) for idx in g_wordidxs: gene_wordidxs.add(idx) gene_mention = Mention( "GENE", line_dict["gene_entities"][g_idx], [sentence.words[j] for j in g_wordidxs]) if line_dict["gene_is_corrects"][g_idx] == "n": gene_mention.is_correct = None elif line_dict["gene_is_corrects"][g_idx] == "f": gene_mention.is_correct = False elif line_dict["gene_is_corrects"][g_idx] == "t": gene_mention.is_correct = True else: assert False gene_mention.type = line_dict["gene_types"][g_idx] assert not gene_mention.type.endswith("_UNSUP") gene_mentions.append(gene_mention) for h_idx in range(len(line_dict["hpoterm_is_corrects"])): h_wordidxs = TSVstring2list( line_dict["hpoterm_wordidxss"][h_idx], int) for idx in h_wordidxs: hpoterm_wordidxs.add(idx) hpoterm_mention = Mention( "hpoterm", line_dict["hpoterm_entities"][h_idx], [sentence.words[j] for j in h_wordidxs]) if line_dict["hpoterm_is_corrects"][h_idx] == "n": hpoterm_mention.is_correct = None elif line_dict["hpoterm_is_corrects"][h_idx] == "f": hpoterm_mention.is_correct = False elif line_dict["hpoterm_is_corrects"][h_idx] == "t": hpoterm_mention.is_correct = True else: assert False hpoterm_mention.type = line_dict["hpoterm_types"][h_idx] assert not hpoterm_mention.type.endswith("_UNSUP") hpoterm_mentions.append(hpoterm_mention) # Skip if the word indexes overlab if set(g_wordidxs) & set(h_wordidxs): continue # Skip if the mentions are too far away gene_start = gene_mention.wordidxs[0] hpoterm_start = hpoterm_mention.wordidxs[0] gene_end = gene_mention.wordidxs[-1] hpoterm_end = hpoterm_mention.wordidxs[-1] limits = sorted( (gene_start, hpoterm_start, gene_end, hpoterm_end)) start = limits[0] betw_start = limits[1] betw_end = limits[2] if betw_end - betw_start > 50: continue relation = Relation( "GENEPHENO", gene_mention, hpoterm_mention) # Supervise supervise(relation, gene_mention, hpoterm_mention, sentence) if relation.is_correct: positive_relations.append( (gene_mention, hpoterm_mention)) # Print! print(relation.tsv_dump()) # Create some artificial negative examples: # for each (gene, phenotype) pair that is labelled as positive # example, select one word w in the same sentence that (1) is not a # gene mention candidate and (2) is not a phenotype mention # candidate, add (gene, w) and (w, phenotype) as negative example avail_wordidxs = ( set(line_dict["wordidxs"]) - set(hpoterm_wordidxs)) - \ set(gene_wordidxs) avail_wordidxs = list(avail_wordidxs) if len(avail_wordidxs) > 0: fake_rels = [] for (gene_mention, hpoterm_mention) in positive_relations: other_word = sentence.words[random.choice(avail_wordidxs)] fake_gene_mention = Mention( "FAKE_GENE", other_word.lemma, [other_word, ]) fake_hpo_mention = Mention( "FAKE_HPOTERM", other_word.lemma, [other_word, ]) fake_rel_1 = Relation( "GENEPHENO_SUP_POSFAKEGENE", fake_gene_mention, hpoterm_mention) fake_rel_2 = Relation( "GENEPHENO_SUP_POSFAKEHPO", gene_mention, fake_hpo_mention) fake_rel_1.is_correct = False fake_rel_2.is_correct = False # Print! print(fake_rel_1.tsv_dump()) print(fake_rel_2.tsv_dump()) # Create more artificial negative examples: # for each gene candidate G in the sentence, if the pattern G # <Verb> X appears in the same sentence and X is not a phenotype # mention candidate, add (gene, X) as negative examples for gene_mention in gene_mentions: try: next_word = sentence.words[gene_mention.wordidxs[-1] + 1] except IndexError: continue if re.search('^VB[A-Z]*$', next_word.pos) and \ next_word.word not in ["{", "}", "(", ")", "[", "]"]: try: after_next_word = sentence.words[ next_word.in_sent_idx + 1] except IndexError: continue if after_next_word.in_sent_idx in hpoterm_wordidxs: continue fake_hpo_mention = Mention( "FAKE_HPOTERM", after_next_word.lemma, [after_next_word, ]) fake_rel = Relation( "GENEPHENO_SUP_FAKEHPO", gene_mention, fake_hpo_mention) fake_rel.is_correct = False print(fake_rel.tsv_dump()) # Create more artificial negative examples: # as before but for phenotypes for hpo_mention in hpoterm_mentions: try: next_word = sentence.words[hpo_mention.wordidxs[-1] + 1] except IndexError: continue if re.search('^VB[A-Z]*$', next_word.pos) and \ next_word.word not in ["{", "}", "(", ")", "[", "]"]: try: after_next_word = sentence.words[ next_word.in_sent_idx + 1] except IndexError: continue if after_next_word.in_sent_idx in gene_wordidxs: continue fake_gene_mention = Mention( "FAKE_GENE", after_next_word.lemma, [after_next_word, ]) fake_rel = Relation( "GENEPHENO_SUP_FAKEGENE", fake_gene_mention, hpo_mention) fake_rel.is_correct = False print(fake_rel.tsv_dump())
dd-genomics-master
archived/v0/code/ext_genepheno_candidates.py
#! /usr/bin/env python3 import fileinput import re from dstruct.Sentence import Sentence from helper.easierlife import get_dict_from_TSVline, TSVstring2list, no_op, \ print_feature, BASE_DIR import ddlib def add_features_generic(mention_id, pheno_words, sentence): # Use the generic feature library (ONLY!) # Load dictionaries for keywords ddlib.load_dictionary(BASE_DIR + "/dicts/features/pheno_var.tsv", "VARKW") ddlib.load_dictionary( BASE_DIR + "/dicts/features/pheno_patient.tsv", "PATIENTKW") # Create the objects used by ddlib. ddlib interface is so ugly. obj = dict() obj['lemma'] = [] obj['words'] = [] obj['ner'] = [] obj['pos'] = [] obj['dep_graph'] = [] for word in sentence.words: obj['lemma'].append(word.lemma) obj['words'].append(word.word) obj['ner'].append(word.ner) obj['pos'].append(word.pos) obj['dep_graph'].append( str(word.dep_parent + 1) + "\t" + word.dep_path + "\t" + str(word.in_sent_idx + 1)) word_obj_list = ddlib.unpack_words( obj, lemma='lemma', pos='pos', ner='ner', words='words', dep_graph='dep_graph', dep_graph_parser=ddlib.dep_graph_parser_triplet) gene_span = ddlib.get_span(pheno_words[0].in_sent_idx, len(pheno_words)) features = set() for feature in ddlib.get_generic_features_mention( word_obj_list, gene_span): features.add(feature) for feature in features: print_feature(sentence.doc_id, mention_id, feature) # Add features def add_features(mention_id, mention_words, sentence): mention_wordidxs = [] for word in mention_words: mention_wordidxs.append(word.in_sent_idx) # The first alphanumeric lemma on the left of the mention, if present, idx = mention_words[0].in_sent_idx - 1 left_lemma_idx = -1 left_lemma = "" while idx >= 0 and not sentence.words[idx].word.isalnum(): idx -= 1 try: left_lemma = sentence.words[idx].lemma try: float(left_lemma) left_lemma = "_NUMBER" except ValueError: pass left_lemma_idx = idx print_feature( sentence.doc_id, mention_id, "NGRAM_LEFT_1_[{}]".format( left_lemma)) except IndexError: pass # The first alphanumeric lemma on the right of the mention, if present, idx = mention_wordidxs[-1] + 1 right_lemma_idx = -1 right_lemma = "" while idx < len(sentence.words) and not sentence.words[idx].word.isalnum(): idx += 1 try: right_lemma = sentence.words[idx].lemma try: float(right_lemma) right_lemma = "_NUMBER" except ValueError: pass right_lemma_idx = idx print_feature( sentence.doc_id, mention_id, "NGRAM_RIGHT_1_[{}]".format( right_lemma)) except IndexError: pass # The lemma "two on the left" of the mention, if present try: print_feature(sentence.doc_id, mention_id, "NGRAM_LEFT_2_[{}]".format( sentence.words[left_lemma_idx - 1].lemma)) print_feature( sentence.doc_id, mention_id, "NGRAM_LEFT_2_C_[{} {}]".format( sentence.words[left_lemma_idx - 1].lemma, left_lemma)) except IndexError: pass # The lemma "two on the right" on the left of the mention, if present try: print_feature( sentence.doc_id, mention_id, "NGRAM_RIGHT_2_[{}]".format( sentence.words[right_lemma_idx + 1].lemma)) print_feature( sentence.doc_id, mention_id, "NGRAM_RIGHT_2_C_[{} {}]".format( right_lemma, sentence.words[right_lemma_idx + 1].lemma)) except IndexError: pass # The keywords that appear in the sentence with the mention minl = 100 minp = None minw = None for word in mention_words: for word2 in sentence.words: if word2.lemma in KEYWORDS: (p, l) = sentence.get_word_dep_path( word.in_sent_idx, word2.in_sent_idx) kw = word2.lemma if word2.lemma in PATIENT_KWS: kw = "_HUMAN" print_feature( sentence.doc_id, mention_id, "KEYWORD_[" + kw + "]" + p) if l < minl: minl = l minp = p minw = kw # Special feature for the keyword on the shortest dependency path if minw: print_feature( sentence.doc_id, mention_id, 'EXT_KEYWORD_MIN_[' + minw + ']' + minp) print_feature( sentence.doc_id, mention_id, 'KEYWORD_MIN_[' + minw + ']') # The verb closest to the candidate minl = 100 minp = None minw = None for word in mention_words: for word2 in sentence.words: if word2.word.isalpha() and re.search('^VB[A-Z]*$', word2.pos) \ and word2.lemma != 'be': (p, l) = sentence.get_word_dep_path( word.in_sent_idx, word2.in_sent_idx) if l < minl: minl = l minp = p minw = word2.lemma if minw: print_feature( sentence.doc_id, mention_id, 'VERB_[' + minw + ']' + minp) # Keyword that seems to appear with phenotypes VAR_KWS = frozenset([ "abnormality", "affect", "apoptosis", "association", "cancer", "carcinoma", "case", "cell", "chemotherapy", "clinic", "clinical", "chromosome", "cronic", "deletion", "detection", "diagnose", "diagnosis", "disease", "drug", "family", "gene", "genome", "genomic", "genotype", "give", "grade", "group", "history", "infection", "inflammatory", "injury", "mutation", "pathway", "phenotype", "polymorphism", "prevalence", "protein", "risk", "severe", "stage", "symptom", "syndrome", "therapy", "therapeutic", "treat", "treatment", "variant" "viruses", "virus"]) PATIENT_KWS = frozenset( ["boy", "girl", "man", "woman", "men", "women", "patient", "patients"]) KEYWORDS = VAR_KWS | PATIENT_KWS if __name__ == "__main__": # Process the input with fileinput.input() as input_files: for line in input_files: # Parse the TSV line line_dict = get_dict_from_TSVline( line, ["doc_id", "sent_id", "wordidxs", "words", "poses", "ners", "lemmas", "dep_paths", "dep_parents", "mention_id", "mention_wordidxs"], [no_op, int, lambda x: TSVstring2list(x, int), TSVstring2list, TSVstring2list, TSVstring2list, TSVstring2list, TSVstring2list, lambda x: TSVstring2list(x, int), no_op, lambda x: TSVstring2list(x, int)]) # Create the sentence object null_list = [None, ] * len(line_dict["wordidxs"]) sentence = Sentence( line_dict["doc_id"], line_dict["sent_id"], line_dict["wordidxs"], line_dict["words"], line_dict["poses"], line_dict["ners"], line_dict["lemmas"], line_dict["dep_paths"], line_dict["dep_parents"], null_list) if sentence.is_weird(): continue mention_words = [] for mention_wordidx in line_dict["mention_wordidxs"]: mention_words.append(sentence.words[mention_wordidx]) add_features(line_dict["mention_id"], mention_words, sentence)
dd-genomics-master
archived/v0/code/ext_pheno_features.py
#! /usr/bin/env python3 from helper.dictionaries import load_dict if __name__ == "__main__": merged_genes_dict = load_dict("merged_genes") inverted_long_names = load_dict("inverted_long_names") hpoterms_orig = load_dict("hpoterms_orig") for long_name in inverted_long_names: for hpoterm_name in hpoterms_orig: if long_name in hpoterm_name.split() and \ long_name.casefold() != hpoterm_name.casefold(): print("\t".join((long_name, hpoterm_name)))
dd-genomics-master
archived/v0/code/find_genes_in_hpoterms.py
#! /usr/bin/env python3 # # Perform comparision between existing HPO mapping and dump from DeepDive # # Take the output from canonicalize.py import sys if len(sys.argv) != 3: sys.stderr.write("USAGE: {} hpo dump\n".format(sys.argv[0])) sys.exit(1) hpo_genes = set() hpo_ids = set() hpo_mappings = set() with open(sys.argv[1], 'rt') as hpo: for line in hpo: tokens = line.strip().split("\t") gene = tokens[0] hpo_id = tokens[1] assert hpo_id.startswith("HP:") hpo_genes.add(gene) hpo_ids.add(hpo_id) hpo_mappings.add("_".join((gene, hpo_id))) dump_genes = set() dump_ids = set() dump_mappings = set() relation_ids = dict() with open(sys.argv[2], 'rt') as dump: for line in dump: tokens = line.strip().split("\t") relation_id = tokens[0] gene = tokens[1] assert "\\N" not in gene hpo_id = tokens[2] assert hpo_id.startswith("HP:") dump_genes.add(gene) dump_ids.add(hpo_id) rel_string = "_".join((gene, hpo_id)) dump_mappings.add(rel_string) if rel_string not in relation_ids: relation_ids[rel_string] = set() relation_ids[rel_string].add(relation_id) print("### HPO (existing mapping) ###") print("Non-zero Entries: {}".format(len(hpo_mappings))) print("\"Covered\" Genes: {}".format(len(hpo_genes))) print("\"Covered\" Phenotypes: {}".format(len(hpo_ids))) print("### DeepDive Dump ###") print("Non-zero Entries: {}".format(len(dump_mappings))) print("\"Covered\" Genes: {}".format(len(dump_genes))) print("\"Covered\" Phenotypes: {}".format(len(dump_ids))) print("### Comparison ###") print("Non-zero Entries in both: {}".format( len(hpo_mappings & dump_mappings))) print("Non-zero Entries only in HPO: {}".format( len(hpo_mappings - dump_mappings))) print("Non-zero Entries only in DD Dump: {}".format( len(dump_mappings - hpo_mappings))) print("\"Covered\" Genes in both: {}".format(len(hpo_genes & dump_genes))) print("\"Covered\" Genes only in HPO: {}".format(len(hpo_genes - dump_genes))) print("\"Covered\" Genes only in DD Dump: {}".format( len(dump_genes - hpo_genes))) print("\"Covered\" Phenotypes in both: {}".format(len(hpo_ids & dump_ids))) print("\"Covered\" Phenotypes only in HPO: {}".format(len(hpo_ids - dump_ids))) print("\"Covered\" Phenotypes only in DD Dump: {}".format( len(dump_ids - hpo_ids))) print("#######") printed_rels = set() for new_rel in dump_mappings - hpo_mappings: for rel_id in set(relation_ids[new_rel]) - printed_rels: print(rel_id) printed_rels.add(rel_id)
dd-genomics-master
archived/v0/code/compare_dump_to_hpo.py
#! /usr/bin/env python3 # # Take the json output of the NLPextractor extractor and convert it to TSV that # we can feed to the database using COPY FROM. The schema of the table is equal # to the 'sentences' table except for an additional column at the end which is # the gene that we know the geneRif contains. import fileinput import json import sys from helper.easierlife import list2TSVarray if len(sys.argv) < 2: sys.stderr.write("USAGE: {} GENE_RIFS_DICT PARSER_OUTPUT [PARSER_OUTPUT [PARSER_OUTPUT [...]]]\n".format(sys.argv[0])) sys.exit(1) genes = [] with open(sys.argv[1], 'rt') as gene_rifs_dict_file: for line in gene_rifs_dict_file: tokens = line.strip().split("\t") genes.append(tokens[1]) with fileinput.input(sys.argv[2:]) as input_files: for line in input_files: line_dict = json.loads(line) doc_id = line_dict["doc_id"] sent_id = line_dict["sent_id"] words = line_dict["words"] wordidxs = [x for x in range(len(words))] poses = line_dict["poses"] ners = line_dict["ners"] lemmas = line_dict["lemmas"] dep_paths_orig = line_dict["dep_paths"] bounding_boxes = ["empty"] * len(words) gene_index = int(doc_id.split("-")[-1]) # Compute dependency path edge labels and node parents dep_paths = ["_"] * len(words) dep_parents = [0] * len(words) for dep_path in dep_paths_orig: tokens = dep_path.split("(") dep_parent = int((tokens[1].split(", ")[0]).split("-")[-1]) - 1 dep_child = int((tokens[1].split(", ")[-1]).split("-")[-1][:-1]) - 1 dep_paths[dep_child] = tokens[0] dep_parents[dep_child] = dep_parent print("{}".format("\t".join([doc_id, str(sent_id), list2TSVarray(wordidxs), list2TSVarray(words, quote=True), list2TSVarray(poses, quote=True), list2TSVarray(ners), list2TSVarray(lemmas, quote=True), list2TSVarray(dep_paths, quote=True), list2TSVarray(dep_parents), list2TSVarray(bounding_boxes), genes[gene_index]])))
dd-genomics-master
archived/v0/code/parser2geneRifs.py
#! /usr/bin/env python3 import fileinput import re from dstruct.Mention import Mention from dstruct.Sentence import Sentence from dstruct.Relation import Relation from helper.dictionaries import load_dict from helper.easierlife import get_dict_from_TSVline, no_op, TSVstring2bool, \ TSVstring2list # Add features # 20141125 As of now, we use the same features from the gene/hpoterm relation # extractor. # TODO Look at Emily's code to understand what features to add def add_features(relation, gene_1_mention, gene_2_mention, sentence): # Find the start/end indices of the mentions composing the relation gene_1_start = gene_1_mention.wordidxs[0] gene_2_start = gene_2_mention.wordidxs[0] gene_1_end = gene_1_mention.wordidxs[-1] gene_2_end = gene_2_mention.wordidxs[-1] limits = sorted((gene_1_start, gene_2_start, gene_1_end, gene_2_end)) start = limits[0] betw_start = limits[1] betw_end = limits[2] end = limits[3] # If the gene comes first, we do not prefix, otherwise we do. # TODO We should think about it because it may not be necessary: the order # shouldn't really matter, but I may be wrong. # TODO We should also be careful when specifying the input query, to avoid # creating first on one order and then on the other. if start == gene_1_start: inv = "" else: inv = "INV_" # Verbs between the mentions # A lot of this comes from Emily's code ws = [] verbs_between = [] minl_gene_1 = 100 minp_gene_1 = None minw_gene_1 = None mini_gene_1 = None minl_gene_2 = 100 minp_gene_2 = None minw_gene_2 = None mini_gene_2 = None neg_found = False # Emily's code was only looking at the words between the mentions, but it # is more correct (in my opinion) to look all the words, as in the # dependency path there could be words that are close to both mentions but # not between them #for i in range(betw_start+1, betw_end): for i in range(len(sentences.words)): if "," not in sentence.words[i].lemma: ws.append(sentence.words[i].lemma) # Feature for separation between entities # TODO Think about merging these? if "while" == sentence.words[i].lemma: relation.add_feature("SEP_BY_[while]") if "whereas" == sentence.words[i].lemma: relation.add_feature("SEP_BY_[whereas]") # The filtering of the brackets and commas is from Emily's code. I'm # not sure it is actually needed, but it won't hurt. if re.search('^VB[A-Z]*', sentence.words[i].pos) and \ sentence.words[i].word != "{" and \ sentence.words[i].word != "}" and \ "," not in sentence.words[i].word: p_gene_1 = sentence.get_word_dep_path(betw_start, sentence.words[i].in_sent_idx) p_gene_2 = sentence.get_word_dep_path( sentence.words[i].in_sent_idx, betw_end) if len(p_gene_1) < minl_gene_1: minl_gene_1 = len(p_gene_1) minp_gene_1 = p_gene_1 minw_gene_1 = sentence.words[i].lemma mini_gene_1 = sentence.words[i].in_sent_idx if len(p_gene_2) < minl_gene_2: minl_gene_2 = len(p_gene_2) minp_gene_2 = p_gene_2 minw_gene_2 = sentence.words[i].lemma mini_gene_2 = sentence.words[i].in_sent_idx # Look for negation. if i > 0: if sentence.words[i-1].lemma in ["no", "not", "neither", "nor"]: if i < betw_end - 2: neg_found = True relation.add_feature(inv + "NEG_VERB_[" + sentence.words[i-1].word + "]-" + sentence.words[i].lemma) elif sentence.words[i] != "{" and sentence.words[i] != "}": verbs_between.append(sentence.words[i].lemma) # TODO This idea of 'high_quality_verb' is taken from Emily's code, but # it's still not clear to me what it implies high_quality_verb = False if len(verbs_between) == 1 and not neg_found: relation.add_feature(inv + "SINGLE_VERB_[%s]" % verbs_between[0]) if verbs_between[0] in ["interact", "associate", "bind", "regulate", "phosporylate", "phosphorylated"]: high_quality_verb = True else: for verb in verbs_between: relation.add_feature(inv + "VERB_[%s]" % verb) if mini_gene_2 == mini_gene_1 and mini_gene_1 != None and len(minp_gene_1) < 50: # and "," not in minw_gene_1: # feature = inv + 'MIN_VERB_[' + minw_gene_1 + ']' + minp_gene_1 # features.append(feature) feature = inv + 'MIN_VERB_[' + minw_gene_1 + ']' relation.add_feature(feature) else: if mini_gene_1 != None: # feature = 'MIN_VERB_gene_1_[' + minw_gene_1 + ']' + minp_gene_1 # relation.add_feature(feature) feature = inv + 'MIN_VERB_GENE_1_[' + minw_gene_1 + ']' relation.add_feature(feature) if mini_gene_2 != None: # feature = 'MIN_VERB_gene_2_[' + minw_gene_2 + ']' + minp_gene_2) # relation.add_feature(feature) feature = inv + 'MIN_VERB_GENE_2_[' + minw_gene_2 + ']' relation.add_feature(feature) # Shortest dependency path between the two mentions relation.add_feature(inv + "DEP_PATH_[" + sentence.dep_path(gene_1_mention, gene_2_mention) + "]") # The sequence of lemmas between the two mentions if len(ws) < 7 and len(ws) > 0 and "{" not in ws and "}" not in ws and \ "\"" not in ws and "/" not in ws and "\\" not in ws and \ "," not in ws and \ " ".join(ws) not in ["_ and _", "and", "or", "_ or _"]: relation.add_feature(inv + "WORD_SEQ_[%s]" % " ".join(ws)) # Number of words between the mentions relation.add_feature(inv + "WORD_SEQ_LEN_[%d]" % len(ws)) # The sequence of lemmas between the two mentions but using the NERs, if # present seq_list = [] for word in sentence.words[betw_start+1:betw_end]: if word.ner != "O": seq_list.append(word.ner) else: seq_list.append(word.lemma) seq = "_".join(seq_list) relation.add_feature(inv + "WORD_SEQ_NER_[" + seq + "]") # Lemmas on the left and on the right if gene_1_start > 0: relation.add_feature("GENE_1_NGRAM_LEFT_1_[" + sentence.words[gene_1_start-1].lemma + "]") if gene_1_end < len(sentence.words) - 1: relation.add_feature("GENE_1_NGRAM_RIGHT_1_[" + sentence.words[gene_1_end+1].lemma + "]") if gene_2_start > 0: relation.add_feature("GENE_2_NGRAM_LEFT_1_[" + sentence.words[gene_2_start-1].lemma + "]") if gene_2_end < len(sentence.words) - 1: relation.add_feature("GENE_2_NGRAM_RIGHT_1_[" + sentence.words[gene_2_end+1].lemma + "]") if __name__ == "__main__": # Process input with fileinput.input() as input_files: for line in input_files: # Parse the TSV line line_dict = get_dict_from_TSVline( line, ["doc_id", "sent_id", "wordidxs", "words", "poses", "ners", "lemmas", "dep_paths", "dep_parents", "bounding_boxes", "gene_1_entity", "gene_1_wordidxs", "gene_1_is_correct", "gene_1_type", "gene_2_entity", "gene_2_wordidxs", "gene_2_is_correct", "gene_2_type"], [no_op, int, lambda x: TSVstring2list(x, int), TSVstring2list, TSVstring2list, TSVstring2list, TSVstring2list, TSVstring2list, lambda x: TSVstring2list(x, int), TSVstring2list, no_op, lambda x: TSVstring2list(x, int), TSVstring2bool, no_op, no_op, lambda x: TSVstring2list(x, int), TSVstring2bool, no_op]) # Create the sentence object where the two mentions appear sentence = Sentence( line_dict["doc_id"], line_dict["sent_id"], line_dict["wordidxs"], line_dict["words"], line_dict["poses"], line_dict["ners"], line_dict["lemmas"], line_dict["dep_paths"], line_dict["dep_parents"], line_dict["bounding_boxes"]) # Create the mentions gene_1_mention = Mention( "GENE", line_dict["gene_1_entity"], [sentence.words[j] for j in line_dict["gene_1_wordidxs"]]) gene_1_mention.is_correct = line_dict["gene_1_is_correct"] gene_1_mention.type = line_dict["gene_1_type"] gene_2_mention = Mention( "GENE", line_dict["gene_2_entity"], [sentence.words[j] for j in line_dict["gene_2_wordidxs"]]) gene_2_mention.is_correct = line_dict["gene_2_is_correct"] gene_2_mention.type = line_dict["gene_2_type"] # If the word indexes do not overlap, create the relation candidate # TODO there may be other cases. Check with Emily. if not set(line_dict["gene_1_wordidxs"]) & \ set(line_dict["gene_2_wordidxs"]): relation = Relation( "GENEGENE", gene_1_mention, gene_2_mention) # Add features add_features(relation, gene_1_mention, gene_2_mention, sentence) # Supervise # One of the two mentions (or both) is labelled as False # We do not create a copy in this case because there will # already be an unsupervised copy built on the unsupervised # copies of the mentions. if gene_1_mention.is_correct is False or \ gene_2_mention.is_correct is False: relation.is_correct = False relation.type = "GENEGENE_SUP_F" # TODO Check in Emily's code how to supervise as True # Print! print(relation.tsv_dump())
dd-genomics-master
archived/v0/code/gene_gene_relations.py
#! /usr/bin/env python3 """ An object representing a relation """ import json from helper.easierlife import list2TSVarray class Relation(object): doc_id = None sent_id_1 = None sent_id_2 = None type = None mention_1_id = None mention_2_id = None mention_1_words = None mention_2_words = None is_correct = None def __init__(self, _type, mention_1, mention_2): self.doc_id = mention_1.words[0].doc_id self.sent_id_1 = mention_1.words[0].sent_id self.sent_id_2 = mention_2.words[0].sent_id self.mention_1_id = mention_1.id() self.mention_2_id = mention_2.id() self.type = _type self.mention_1_words = mention_1.words self.mention_2_words = mention_2.words def id(self): return "RELATION_{}_{}_{}_{}_{}_{}_{}_{}".format( self.type, self.doc_id, self.sent_id_1, self.sent_id_2, self.mention_1_words[0].in_sent_idx, self.mention_1_words[-1].in_sent_idx, self.mention_2_words[0].in_sent_idx, self.mention_2_words[-1].in_sent_idx) def json_dump(self): return json.dumps( {"id": None, "doc_id": self.doc_id, "sent_id_1": self.sent_id_1, "sent_id_2": self.sent_id_2, "relation_id": self.id(), "type": self.type, "mention_id_1": self.mention_1_id, "mention_id_2": self.mention_2_id, "wordidxs_1": [x.in_sent_idx for x in self.mention_1_words], "wordidxs_2": [x.in_sent_idx for x in self.mention_2_words], "words_1": [x.word for x in self.mention_1_words], "words_2": [x.word for x in self.mention_2_words], "is_correct": self.is_correct}) def tsv_dump(self): is_correct_str = "\\N" if self.is_correct is not None: is_correct_str = self.is_correct.__repr__() return "\t".join( ["\\N", self.doc_id, str(self.sent_id_1), str(self.sent_id_2), self.id(), self.type, self.mention_1_id, self.mention_2_id, list2TSVarray([x.in_sent_idx for x in self.mention_1_words]), list2TSVarray([x.in_sent_idx for x in self.mention_2_words]), list2TSVarray([x.word for x in self.mention_1_words], True), list2TSVarray([x.word for x in self.mention_2_words], True), is_correct_str])
dd-genomics-master
archived/v0/code/dstruct/Relation.py
dd-genomics-master
archived/v0/code/dstruct/__init__.py
#! /usr/bin/env python3 """ A Sentence class Basically a container for an array of Word objects, plus doc_id and sent_id. Originally obtained from the 'pharm' repository, but modified. """ from dstruct.Word import Word class Sentence(object): # to avoid bad parse tree that have self-recursion _MAX_DEP_PATH_LEN = 1000 doc_id = None sent_id = None words = [] def __init__(self, _doc_id, _sent_id, _wordidxs, _words, _poses, _ners, _lemmas, _dep_paths, _dep_parents, _bounding_boxes): self.doc_id = _doc_id self.sent_id = _sent_id wordidxs = _wordidxs words = _words poses = _poses ners = _ners lemmas = _lemmas dep_paths = _dep_paths dep_parents = _dep_parents bounding_boxes = _bounding_boxes self.words = [] if _wordidxs: # checking for None for i in range(len(wordidxs)): word = Word(self.doc_id, self.sent_id, wordidxs[i], words[i], poses[i], ners[i], lemmas[i], dep_paths[i], dep_parents[i], bounding_boxes[i]) self.words.append(word) # Return a list of the indexes of all words in the dependency path from # the word at index word_index to the root def get_path_till_root(self, word_index): path = [] c = word_index MAX_DEP_PATH_LEN = self._MAX_DEP_PATH_LEN while MAX_DEP_PATH_LEN > 0: MAX_DEP_PATH_LEN = MAX_DEP_PATH_LEN - 1 try: # c == -1 means we found the root if c == -1: break path.append(c) c = self.words[c].dep_parent except: break return path # Given two paths returned by get_path_till_root, find the least common # ancestor, i.e., the one farthest away from the root. If there is no # common ancestor, return None def get_common_ancestor(self, path1, path2): # The paths are sorted from leaf to root, so reverse them path1_rev = path1[:] path1_rev.reverse() path2_rev = path2[:] path2_rev.reverse() i = 0 while i < min(len(path1_rev), len(path2_rev)) and \ path1_rev[i] == path2_rev[i]: i += 1 if path1_rev[i-1] != path2_rev[i-1]: # No common ancestor found return None else: return path1_rev[i-1] # XXX (Matteo) The following is the function as it was in pharma. # The logic seemed more complicated to understand for me. # parent = None # for i in range(max(len(path1), len(path2))): # tovisit = 0 - i - 1 # if i >= len(path1) or i >= len(path2): # break # if path1[tovisit] != path2[tovisit]: # break # parent = path1[tovisit] # return parent # Given two word idx1 and idx2, where idx2 is an ancestor of idx1, return, # for each word 'w' on the dependency path between idx1 and idx2, the label # on the edge to 'w' and the NER tag of 'w' or its lemma if the NER tag # is 'O' (see Word.get_feature()) # the dependency path labels on the path from idx1 to idx2 def get_direct_dependency_path_between_words( self, idx1, idx2, use_pos=False): words_on_path = [] c = idx1 length = 0 MAX_DEP_PATH_LEN = self._MAX_DEP_PATH_LEN while MAX_DEP_PATH_LEN > 0: MAX_DEP_PATH_LEN -= 1 try: if c == -1: break elif c == idx2: break elif c == idx1: # we do not include the NER tag/lemma for idx1 words_on_path.append(str(self.words[c].dep_path)) else: words_on_path.append(str(self.words[c].dep_path) + "|" + self.words[c].get_feature(use_pos)) c = self.words[c].dep_parent length += 1 except: break return (words_on_path, length) # Given two word idx1 and idx2, return the dependency path feature between # them def get_word_dep_path(self, idx1, idx2, use_pos=False): path1 = self.get_path_till_root(idx1) path2 = self.get_path_till_root(idx2) parent = self.get_common_ancestor(path1, path2) (words_from_idx1_to_parents, length_1) = \ self.get_direct_dependency_path_between_words( idx1, parent, use_pos) (words_from_idx2_to_parents, length_2) = \ self.get_direct_dependency_path_between_words( idx2, parent, use_pos) if parent is None: root_str = "@ROOT@" else: root_str = "@" return ("-".join(words_from_idx1_to_parents) + root_str + "-".join(words_from_idx2_to_parents), length_1 + length_2) # Given a mention, return the word before the first word of the mention, # if present def get_prev_wordobject(self, mention): begin = mention.words[0].in_sent_idx if begin - 1 < 0: return None else: return self.words[begin - 1] # Given a mention, return the word after the last word of the mention, if # present def get_next_wordobject(self, mention): end = mention.words[-1].in_sent_idx if end == len(self.words) - 1: return None else: return self.words[end + 1] def dep_parent(self, mention): begin = mention.words[0].in_sent_idx end = mention.words[-1].in_sent_idx paths = [] for i in range(begin, end+1): for j in range(0, len(self.words)): if j >= begin and j <= end: continue (path, length) = self.get_word_dep_path(i, j) paths.append(path) return sorted(paths, key=len)[0:min(5, len(paths))] # Given two entities, return the feature of the shortest dependency path # between a word from one of to a word of the other. def dep_path(self, entity1_words, entity2_words, use_pos=False): begin1 = entity1_words[0].in_sent_idx end1 = entity1_words[-1].in_sent_idx begin2 = entity2_words[0].in_sent_idx end2 = entity2_words[-1].in_sent_idx min_len = 10000000000 min_p = None for idx1 in range(begin1, end1+1): for idx2 in range(begin2, end2+1): (path, length) = self.get_word_dep_path(idx1, idx2, use_pos) if length < min_len: min_p = path min_len = length return (min_p, min_len) # Return True if the sentence is 'weird', according to the following # criteria: # 1) It contains more than 12 floats # 2) It contains many "no" / "yes" / "na" # 3) It contains many "—" # 4) It contains many ";" # 5) It is longer than 150 words def is_weird(self): if len(self.words) > 150: return True count_floats = 0 count_NA = 0 count_minus = 0 count_semicolon = 0 for word in self.words: try: float(word.word) count_floats += 1 except ValueError: pass if word.word in ["NA", "Yes", "No"]: count_NA += 1 elif word.word == "—": count_minus += 1 elif word.word == ";": count_semicolon += 1 if count_floats > 12 or count_NA > 6 or count_minus > 10 or \ count_semicolon > 6: return True else: return False
dd-genomics-master
archived/v0/code/dstruct/Sentence.py
#! /usr/bin/env python3 """ A generic Mention class Originally obtained from the 'pharm' repository, but modified. """ import json from helper.easierlife import list2TSVarray class Mention(object): doc_id = None sent_id = None wordidxs = None type = None entity = None words = None is_correct = None right_lemma = "" left_lemma = "" def __init__(self, _type, _entity, _words): self.doc_id = _words[0].doc_id self.sent_id = _words[0].sent_id self.wordidxs = sorted([word.in_sent_idx for word in _words]) self.type = _type self.entity = _entity # These are Word objects self.words = _words self.is_correct = None def __repr__(self): return " ".join([w.word for w in self.words]) def id(self): return "MENTION_{}_{}_{}_{}_{}".format( self.type, self.doc_id, self.sent_id, self.wordidxs[0], self.wordidxs[-1]) # Dump self to a json object def json_dump(self): json_obj = {"id": None, "doc_id": self.doc_id, "sent_id": self.sent_id, "wordidxs": self.wordidxs, "mention_id": self.id(), "type": self.type, "entity": self.entity, "words": [w.word for w in self.words], "is_correct": self.is_correct} return json.dumps(json_obj) # Dump self to a TSV line def tsv_dump(self): is_correct_str = "\\N" if self.is_correct is not None: is_correct_str = self.is_correct.__repr__() tsv_line = "\t".join( ["\\N", self.doc_id, str(self.sent_id), list2TSVarray(self.wordidxs), self.id(), self.type, self.entity, list2TSVarray(self.words, quote=True), is_correct_str]) return tsv_line
dd-genomics-master
archived/v0/code/dstruct/Mention.py
#! /usr/bin/env python3 """ A Word class Originally obtained from the 'pharm' repository, but modified. """ class Word(object): doc_id = None sent_id = None in_sent_idx = None word = None pos = None ner = None lemma = None dep_path = None dep_parent = None sent_id = None box = None def __init__(self, _doc_id, _sent_id, _in_sent_idx, _word, _pos, _ner, _lemma, _dep_path, _dep_parent, _box): self.doc_id = _doc_id self.sent_id = _sent_id self.in_sent_idx = _in_sent_idx self.word = _word self.pos = _pos self.ner = _ner self.dep_parent = _dep_parent self.dep_path = _dep_path self.box = _box self.lemma = _lemma # If do not do the following, outputting an Array in the language will # crash # XXX (Matteo) This was in the pharm code, not sure what it means # I actually don't think this should go here. # self.lemma = self.lemma.replace('"', "''") # self.lemma = self.lemma.replace('\\', "_") def __repr__(self): return self.word # Return the NER tag if different than 'O', otherwise return the lemma def get_feature(self, use_pos=False): if use_pos: return self.pos elif self.ner == 'O': return self.lemma else: return self.ner
dd-genomics-master
archived/v0/code/dstruct/Word.py
dd-genomics-master
archived/v0/code/helper/__init__.py
#! /usr/bin/env python3 """ Helper functions to make our life easier. Originally obtained from the 'pharm' repository, but modified. """ import fileinput import json import os.path import sys from dstruct.Sentence import Sentence # BASE_DIR denotes the application directory BASE_DIR, throwaway = os.path.split(os.path.realpath(__file__)) BASE_DIR = os.path.realpath(BASE_DIR + "/../..") # Return the start and end indexes of all subsets of words in the sentence # sent, with size at most max_phrase_length def get_all_phrases_in_sentence(sent, max_phrase_length): for start in range(len(sent.words)): for end in reversed(range(start + 1, min( len(sent.words), start + 1 + max_phrase_length))): yield (start, end) # Return Sentence objects from input lines def get_input_sentences(input_files=sys.argv[1:]): with fileinput.input(files=input_files) as f: for line in f: sent_dict = json.loads(line) yield Sentence( sent_dict["doc_id"], sent_dict["sent_id"], sent_dict["wordidxs"], sent_dict["words"], sent_dict["poses"], sent_dict["ners"], sent_dict["lemmas"], sent_dict["dep_paths"], sent_dict["dep_parents"], sent_dict["bounding_boxes"]) # Given a TSV line, a list of keys, and a list of functions, return a dict # like the one returned by json.loads() def get_dict_from_TSVline(line, keys, funcs): assert len(keys) == len(funcs) line_dict = dict() while line[-1] == '\n': line = line[:-1] tokens = line.split("\t") assert len(tokens) == len(keys) for i in range(len(tokens)): token = tokens[i] # skip the token if it's NULL if token != "": try: line_dict[keys[i]] = funcs[i](token) except: pass return line_dict # Return the argument def no_op(x): return x # Transform a TSV string into a boolean def TSVstring2bool(string): if string == "t": return True elif string == "f": return False else: return None # Transform a string obtained by postgresql array_str() into a list. # The parameter func() gets applied to the elements of the list def TSVstring2list(string, func=(lambda x: x), sep="|^|"): tokens = string.split(sep) return [func(x) for x in tokens] # Transform a string obtained by postgresql into a dictionary whose keys are in # the form "TSV_X" where X is an integer from 0. Each value of the dict is a # list obtained using TSVstring2list. def TSVstring2dict(string, func=(lambda x: x), sep="|^^"): tsv_dict = dict() i = 0 tokens = string.split(sep) for token in tokens: tsv_dict["TSV_" + str(i)] = TSVstring2list(token) i += 1 return tsv_dict # Convert a list to a string that can be used in a TSV column and intepreted as # an array by the PostreSQL COPY FROM command. # If 'quote' is True, then double quote the string representation of the # elements of the list, and escape double quotes and backslashes. def list2TSVarray(a_list, quote=False): if quote: for index in range(len(a_list)): if "\\" in str(a_list[index]): # Replace '\' with '\\\\"' to be accepted by COPY FROM a_list[index] = str(a_list[index]).replace("\\", "\\\\\\\\") # This must happen the previous substitution if "\"" in str(a_list[index]): # Replace '"' with '\\"' to be accepted by COPY FROM a_list[index] = str(a_list[index]).replace("\"", "\\\\\"") string = ",".join(list(map(lambda x: "\"" + str(x) + "\"", a_list))) else: string = ",".join(list(map(lambda x: str(x), a_list))) return "{" + string + "}" def print_feature(doc_id, mention_id, feature): if "\\" in feature: # Replace '\' with '\\\\"' to be accepted by COPY FROM feature = feature.replace("\\", "\\\\\\\\") # This must happen the previous substitution if "\"" in feature: # Replace '"' with '\\"' to be accepted by COPY FROM feature = feature.replace("\"", "\\\\\"") print(doc_id + "\t" + mention_id + "\t\"" + feature + "\"")
dd-genomics-master
archived/v0/code/helper/easierlife.py
#! /usr/bin/env python3 from helper.easierlife import BASE_DIR # Load an example dictionary # 1st column is doc id, 2nd is sentence ids (separated by '|'), 3rd is entity def load_examples_dictionary(filename): examples = dict() with open(filename, 'rt') as examples_dict_file: for line in examples_dict_file: tokens = line.rstrip().split("\t") sent_ids = frozenset(tokens[1].split("|")) examples[frozenset([tokens[0], tokens[2]])] = sent_ids if tokens[1] == "": examples[frozenset([tokens[0], tokens[2]])] = None return examples # Load the merged genes dictionary def load_merged_genes_dictionary(filename): merged_genes_dict = dict() with open(filename, 'rt') as merged_genes_dict_file: for line in merged_genes_dict_file: tokens = line[:-1].split("\t") symbol = tokens[0] alternate_symbols = tokens[1].split("|") names = tokens[2].split("|") for sym in [symbol, ] + alternate_symbols + names: if sym not in merged_genes_dict: merged_genes_dict[sym] = [] merged_genes_dict[sym].append(symbol) return merged_genes_dict # Load the genes dictionary def load_genes_dictionary(filename): genes_dict = dict() with open(filename, 'rt') as genes_dict_file: for line in genes_dict_file: tokens = line.strip().split("\t") # first token is symbol, second is csv list of synonyms symbol = tokens[0] genes_dict[symbol] = symbol for synonym in tokens[1].split(","): genes_dict[synonym] = symbol return genes_dict # Load the gene long names dictionary def load_long_names_dictionary(filename): long_names_dict = dict() with open(filename, 'rt') as long_names_dict_file: for line in long_names_dict_file: tokens = line[:-1].split("\t") symbol = tokens[0] alternate_symbols = tokens[1].split("|") names = tokens[2].split("|") for sym in [symbol, ] + alternate_symbols: if sym not in long_names_dict: long_names_dict[sym] = [] long_names_dict[sym] += names return long_names_dict # Load the inverted gene long names dictionary def load_inverted_long_names_dictionary(filename): long_names_dict = dict() with open(filename, 'rt') as long_names_dict_file: for line in long_names_dict_file: tokens = line[:-1].split("\t") symbol = tokens[0] names = tokens[2].split("|") for name in names: if name not in long_names_dict: long_names_dict[name] = [] long_names_dict[name].append(symbol) return long_names_dict def load_genes_in_hpoterms_dictionary(filename): genes_in_hpoterms_dict = dict() with open(filename, 'rt') as dict_file: for line in dict_file: tokens = line.strip().split("\t") if tokens[0] not in genes_in_hpoterms_dict: genes_in_hpoterms_dict[tokens[0]] = set() genes_in_hpoterms_dict[tokens[0]].add(tokens[1]) return genes_in_hpoterms_dict def load_hpoterms_with_gene_dictionary(filename): hpoterms_with_gene_dict = dict() with open(filename, 'rt') as dict_file: for line in dict_file: tokens = line.strip().split("\t") hpoterms_with_gene_dict[tokens[1]] = tokens[0] return hpoterms_with_gene_dict def load_hpoterms_in_genes_dictionary(filename): hpoterms_in_genes_dict = dict() with open(filename, 'rt') as dict_file: for line in dict_file: tokens = line.strip().split("\t") if tokens[0] not in hpoterms_in_genes_dict: hpoterms_in_genes_dict[tokens[0]] = set() hpoterms_in_genes_dict[tokens[0]].add(tokens[1]) return hpoterms_in_genes_dict def load_genes_with_hpoterm_dictionary(filename): genes_with_hpoterm_dict = dict() with open(filename, 'rt') as dict_file: for line in dict_file: tokens = line.strip().split("\t") genes_with_hpoterm_dict[tokens[1]] = tokens[0] return genes_with_hpoterm_dict # Load the HPO term levels def load_hpoterm_levels_dictionary(filename): hpo_level_dict = dict() with open(filename, 'rt') as hpo_level_dict_file: for line in hpo_level_dict_file: hpo_id, name, c, level = line.strip().split("\t") level = int(level) if level not in hpo_level_dict: hpo_level_dict[level] = set() hpo_level_dict[level].add(hpo_id) return hpo_level_dict # Load the HPO parents def load_hpoparents_dictionary(filename): hpoparents_dict = dict() with open(filename, 'rt') as hpoparents_dict_file: for line in hpoparents_dict_file: child, is_a, parent = line.strip().split("\t") if child not in hpoparents_dict: hpoparents_dict[child] = set() hpoparents_dict[child].add(parent) # Add 'All' hpoparents_dict["HP:0000001"] = set(["HP:0000001", ]) return hpoparents_dict # Load the HPO ancestors def load_hpoancestors_dictionary(filename): hpoparents_dict = load_hpoparents_dictionary(filename) def get_ancestors(key): if hpoparents_dict[key] == set([key, ]): return hpoparents_dict[key] else: parents = hpoparents_dict[key] ancestors = set(parents) for parent in parents: ancestors |= get_ancestors(parent) return ancestors hpoancestors_dict = dict() with open(filename, 'rt') as hpoancestors_dict_file: for line in hpoancestors_dict_file: child, is_a, parent = line.strip().split("\t") if child not in hpoancestors_dict: hpoancestors_dict[child] = get_ancestors(child) # Add 'All' hpoancestors_dict["HP:0000001"] = set(["HP:0000001", ]) return hpoancestors_dict # Load the HPO children def load_hpochildren_dictionary(filename): hpochildren_dict = dict() with open(filename, 'rt') as hpochildren_dict_file: for line in hpochildren_dict_file: child, is_a, parent = line.strip().split("\t") if parent not in hpochildren_dict: hpochildren_dict[parent] = set() hpochildren_dict[parent].add(child) return hpochildren_dict # Load the HPOterms original dictionary # Terms are converted to lower case def load_hpoterms_orig_dictionary(filename): hpoterms_dict = dict() with open(filename, 'rt') as hpoterms_dict_file: for line in hpoterms_dict_file: tokens = line.strip().split("\t") # 1st token is name, 2nd is description, 3rd is 'C' and 4th is # (presumably) the distance from the root of the DAG. name = tokens[0] description = tokens[1] # Skip "All" # XXX (Matteo) There may be more generic terms that we want to skip if description == "All": continue description_words = description.split() variants = get_variants(description_words) for variant in variants: hpoterms_dict[variant.casefold()] = name return hpoterms_dict # Load the HPOterms 'mentions' dictionary (output of hpoterms2mentions.py) # Maps stem sets to hpo names def load_hpoterms_dictionary(filename): _hpoterms_dict = dict() with open(filename, 'rt') as _hpoterms_dict_file: for line in _hpoterms_dict_file: hpoterm_id, name, stems = line[:-1].split("\t") stems_set = frozenset(stems.split("|")) if stems_set not in _hpoterms_dict: _hpoterms_dict[stems_set] = set() _hpoterms_dict[stems_set].add(name) return _hpoterms_dict # Load the inverted HPOterms 'mentions' dictionary # Map hpo names to stem sets def load_hpoterms_inverted_dictionary(filename): _hpoterms_dict = dict() with open(filename, 'rt') as _hpoterms_dict_file: for line in _hpoterms_dict_file: hpoterm_id, name, stems = line[:-1].split("\t") stems_set = frozenset(stems.split("|")) _hpoterms_dict[name] = stems_set return _hpoterms_dict # Load the HPO "name" to "id" dictionary def load_hponames_to_ids_dictionary(filename): _hpoterms_dict = dict() with open(filename, 'rt') as _hpoterms_dict_file: for line in _hpoterms_dict_file: hpoterm_id, name, stems = line[:-1].split("\t") _hpoterms_dict[name] = hpoterm_id return _hpoterms_dict # Load the medical acronyms dictionary def load_medacrons_dictionary(filename): medacrons_dict = dict() with open(filename, 'rt') as medacrons_dict_file: for line in medacrons_dict_file: tokens = line.strip().split("\t") # 1st token is acronym, 2nd is definition name = tokens[0] definition = tokens[1].casefold() medacrons_dict[definition] = name return medacrons_dict # Load a dictionary which is a set. def load_set(filename): _set = set() with open(filename, 'rt') as set_file: for line in set_file: line = line.rstrip() _set.add(line) return _set # Load a dictionary which is a set, but convert the entries to lower case def load_set_lower_case(filename): case_set = load_set(filename) lower_case_set = set() for entry in case_set: lower_case_set.add(entry.casefold()) return lower_case_set # Load a dictionary which is a set of pairs, where the pairs are frozensets def load_set_pairs(filename): pair_set = set() with open(filename, 'rt') as set_file: for line in set_file: tokens = line.rstrip().split("\t") pair_set.add(frozenset(tokens[0:2])) return pair_set # Dictionaries GENES_DICT_FILENAME = BASE_DIR + "/dicts/hugo_synonyms.tsv" GENES_IN_HPOTERMS_DICT_FILENAME = BASE_DIR + "/dicts/genes_in_hpoterms.tsv" ENGLISH_DICT_FILENAME = BASE_DIR + "/dicts/english_words.tsv" GENEHPOTERM_DICT_FILENAME = BASE_DIR + \ "/dicts/genes_to_hpo_terms_with_synonyms.tsv" HPOPARENTS_DICT_FILENAME = BASE_DIR + "/dicts/hpo_dag.tsv" HPOTERMS_ORIG_DICT_FILENAME = BASE_DIR + "/dicts/hpo_terms.tsv" # NON PRUNED HPOTERMS_DICT_FILENAME = BASE_DIR + "/dicts/hpoterm_mentions.tsv" HPOTERMS_DICT_FILENAME = BASE_DIR + "/dicts/hpoterm_abnormalities_mentions.tsv" HPOTERM_PHENOTYPE_ABNORMALITIES_DICT_FILENAME = BASE_DIR + \ "/dicts/hpoterm_phenotype_abnormalities.tsv" HPOTERMS_IN_GENES_DICT_FILENAME = BASE_DIR + "/dicts/hpoterms_in_genes.tsv" MED_ACRONS_DICT_FILENAME = BASE_DIR + "/dicts/med_acronyms_pruned.tsv" MERGED_GENES_DICT_FILENAME = BASE_DIR + "/dicts/merged_genes_dict.tsv" NIH_GRANTS_DICT_FILENAME = BASE_DIR + "/dicts/grant_codes_nih.tsv" NSF_GRANTS_DICT_FILENAME = BASE_DIR + "/dicts/grant_codes_nsf.tsv" STOPWORDS_DICT_FILENAME = BASE_DIR + "/dicts/english_stopwords.tsv" POS_GENE_MENTIONS_DICT_FILENAME = BASE_DIR + \ "/dicts/positive_gene_mentions.tsv" NEG_GENE_MENTIONS_DICT_FILENAME = BASE_DIR + \ "/dicts/negative_gene_mentions.tsv" # Dictionary of dictionaries. First argument is the filename, second is the # function to call to load the dictionary. The function must take the filename # as input and return an object like a dictionary, or a set, or a list, ... dictionaries = dict() dictionaries["genes"] = [GENES_DICT_FILENAME, load_genes_dictionary] dictionaries["genes_in_hpoterms"] = [GENES_IN_HPOTERMS_DICT_FILENAME, load_genes_in_hpoterms_dictionary] dictionaries["genes_with_hpoterm"] = [HPOTERMS_IN_GENES_DICT_FILENAME, load_genes_with_hpoterm_dictionary] dictionaries["english"] = [ENGLISH_DICT_FILENAME, load_set_lower_case] dictionaries["genehpoterms"] = [GENEHPOTERM_DICT_FILENAME, load_set_pairs] dictionaries["hpoparents"] = [HPOPARENTS_DICT_FILENAME, load_hpoparents_dictionary] dictionaries["hpoancestors"] = [HPOPARENTS_DICT_FILENAME, load_hpoancestors_dictionary] dictionaries["hpochildren"] = [HPOPARENTS_DICT_FILENAME, load_hpochildren_dictionary] dictionaries["hpolevels"] = [HPOTERMS_ORIG_DICT_FILENAME, load_hpoterm_levels_dictionary] dictionaries["hponames_to_ids"] = [HPOTERMS_DICT_FILENAME, load_hponames_to_ids_dictionary] dictionaries["hpoterms"] = [HPOTERMS_DICT_FILENAME, load_hpoterms_dictionary] dictionaries["hpoterms_inverted"] = [HPOTERMS_DICT_FILENAME, load_hpoterms_inverted_dictionary] dictionaries["hpoterm_phenotype_abnormalities"] = [ HPOTERM_PHENOTYPE_ABNORMALITIES_DICT_FILENAME, load_set] dictionaries["hpoterms_orig"] = [HPOTERMS_ORIG_DICT_FILENAME, load_hpoterms_orig_dictionary] dictionaries["hpoterms_in_genes"] = [HPOTERMS_IN_GENES_DICT_FILENAME, load_hpoterms_in_genes_dictionary] dictionaries["hpoterms_with_gene"] = [GENES_IN_HPOTERMS_DICT_FILENAME, load_hpoterms_with_gene_dictionary] dictionaries["nih_grants"] = [NIH_GRANTS_DICT_FILENAME, load_set] dictionaries["nsf_grants"] = [NSF_GRANTS_DICT_FILENAME, load_set] dictionaries["med_acrons"] = [MED_ACRONS_DICT_FILENAME, load_medacrons_dictionary] dictionaries["merged_genes"] = [MERGED_GENES_DICT_FILENAME, load_merged_genes_dictionary] dictionaries["long_names"] = [MERGED_GENES_DICT_FILENAME, load_long_names_dictionary] dictionaries["inverted_long_names"] = [MERGED_GENES_DICT_FILENAME, load_inverted_long_names_dictionary] dictionaries["stopwords"] = [STOPWORDS_DICT_FILENAME, load_set] dictionaries["pos_gene_mentions"] = [POS_GENE_MENTIONS_DICT_FILENAME, load_examples_dictionary] dictionaries["neg_gene_mentions"] = [NEG_GENE_MENTIONS_DICT_FILENAME, load_examples_dictionary] # Load a dictionary using the appropriate filename and load function def load_dict(dict_name): filename = dictionaries[dict_name][0] load = dictionaries[dict_name][1] return load(filename) # Given a list of words, return a list of variants built by splitting words # that contain the separator. # An example is more valuable: # let words = ["the", "cat/dog", "is", "mine"], the function would return ["the # cat is mine", "the dog is mine"] # XXX (Matteo) Maybe goes in a different module def get_variants(words, separator="/"): if len(words) == 0: return [] variants = [] base = [] i = 0 # Look for a word containing a "/" while words[i].find(separator) == -1: base.append(words[i]) i += 1 if i == len(words): break # If we found a word containing a "/", call recursively if i < len(words): variants_starting_words = words[i].split("/") following_variants = get_variants(words[i+1:]) for variant_starting_word in variants_starting_words: variant_base = base + [variant_starting_word] if len(following_variants) > 0: for following_variant in following_variants: variants.append(" ".join(variant_base + [following_variant])) else: variants.append(" ".join(variant_base)) else: variants = [" ".join(base)] return variants
dd-genomics-master
archived/v0/code/helper/dictionaries.py
#!/usr/bin/env python # A script for seeing basic statistics about the number and type of gene mentions extracted # Author: Alex Ratner <ajratner@stanford.edu> # Created: 2015-01-25 import sys import csv import re # Kinds of statistics tracked automatically by postgres "ANALYZE" command # https://github.com/postgres/postgres/blob/master/src/include/catalog/pg_statistic.h STAT_KINDS = { 1: 'most_common_values', 2: 'histogram', 3: 'correlation_to_row_order', 4: 'most_common_elements', 5: 'distinct_elements_count_histogram', 6: 'range_length_histogram', 7: 'bounds_histogram'} def unnest(row): return re.split(r'\"*,\"*', re.sub(r'^\"*\{\"*|\"*\}\"*$', '', row)) def process_pg_statistics(path_to_data, root_path_out): with open(path_to_data, 'rb') as csvf: csv_reader = csv.reader(csvf) NUM_STATS = 0 STA_START = 0 for i,row in enumerate(csv_reader): # figure out how many different statistics are contained in the table if i == 0: for j,cell in enumerate(row): cell_match = re.match(r'stakind(\d+)', cell) if cell_match is not None: NUM_STATS = int(cell_match.group(1)) if NUM_STATS == 1: STA_START = j continue # get the column this row is referring to col = int(row[1]) # for each row, unpack each seperate statistic and output to file for s in range(NUM_STATS): # for each of the rows, identify which type of statistic stat_kind = int(row[STA_START + s]) if STAT_KINDS.has_key(stat_kind): stat_label = STAT_KINDS[stat_kind] elif stat_kind == 0: continue else: stat_label = "Other_%s" % (stat_kind,) # unpack and zip value / stat lists vals = unnest(row[STA_START+(3*NUM_STATS)+s]) stats = unnest(row[STA_START+(2*NUM_STATS)+s]) data = zip(vals, stats) if len(data) < 2: continue # output as csv file with open("%s_%s_%s.csv" % (root_path_out, col, stat_label), 'wb') as data_out: csv_writer = csv.writer(data_out) for d in data: csv_writer.writerow(d)
dd-genomics-master
archived/analysis/util/dd_analysis_utils.py
#!/usr/bin/env python # Author: Alex Ratner <ajratner@stanford.edu> # Created: 2015-01-25 import sys import os import csv from collections import defaultdict # there is 1 group_by col + 1 total_count + 1 labeled_true + 1 labeled_false + 10 bucket_n N_COLS = 14 if __name__ == '__main__': if len(sys.argv) < 4: print "Process.py: Insufficient arguments" else: # get the correct dict if sys.argv[3] == 'gene_mentions': dict_name = 'merged_genes_dict' elif sys.argv[3] == 'pheno_mentions' or sys.argv[3] == 'hpoterm_mentions': dict_name = 'hpo_terms' else: dict_name = None if dict_name is not None: # load the data & mark seen entities data = [] seen = defaultdict(lambda: None) with open(sys.argv[1], 'rb') as f_in: csv_reader = csv.reader(f_in) for row in csv_reader: data.append(row) seen[row[0]] = True # load the dict & append zero values to data for unseen entities # NOTE: assume entity names in col 0 DICT_PATH = "%s/dicts/%s.tsv" % (os.environ['GDD_HOME'], dict_name) with open(DICT_PATH, 'rb') as f_in: tsv_reader = csv.reader(f_in, delimiter='\t') for row in tsv_reader: if seen[row[0]] is None: data.append([row[0]] + [0]*(N_COLS-1)) # output the appended data with open("%s_appended.csv" % (sys.argv[2],), 'wb') as f_out: csv_writer = csv.writer(f_out) for row in data: csv_writer.writerow(row)
dd-genomics-master
archived/analysis/analyses/mentions-by-entity/process.py
#!/usr/bin/env python # A script for seeing basic statistics about the number and type of gene mentions extracted # Author: Alex Ratner <ajratner@stanford.edu> # Created: 2015-01-25 import sys from dd_analysis_utils import process_pg_statistics if __name__ == '__main__': if len(sys.argv) < 3: print "Process.py: Insufficient arguments" else: process_pg_statistics(sys.argv[1], sys.argv[2])
dd-genomics-master
archived/analysis/analyses/postgres-stats/process.py
#!/usr/bin/env python # Author: Alex Ratner <ajratner@stanford.edu> # Created: 2015-01-25 import sys import os import csv from collections import defaultdict # there is 1 group_by col + 1 total_count + 1 labeled_true + 1 labeled_false + 10 bucket_n N_COLS = 14 if __name__ == '__main__': if len(sys.argv) < 4: print "Process.py: Insufficient arguments" else: # get the correct dict if sys.argv[3] == 'gene_mentions': dict_name = 'merged_genes_dict' elif sys.argv[3] == 'pheno_mentions' or sys.argv[3] == 'hpoterm_mentions': dict_name = 'hpo_terms' else: dict_name = None if dict_name is not None: # load the data & mark seen entities data = [] seen = defaultdict(lambda: None) with open(sys.argv[1], 'rb') as f_in: csv_reader = csv.reader(f_in) for row in csv_reader: data.append(row) seen[row[0]] = True # load the dict & append zero values to data for unseen entities # NOTE: assume entity names in col 0 DICT_PATH = "%s/dicts/%s.tsv" % (os.environ['GDD_HOME'], dict_name) with open(DICT_PATH, 'rb') as f_in: tsv_reader = csv.reader(f_in, delimiter='\t') for row in tsv_reader: if seen[row[0]] is None: data.append([row[0]] + [0]*(N_COLS-1)) # output the appended data with open("%s_appended.csv" % (sys.argv[2],), 'wb') as f_out: csv_writer = csv.writer(f_out) for row in data: csv_writer.writerow(row)
dd-genomics-master
archived/analysis/analyses/docs-by-entity/process.py
#!/bin/python try: from setuptools import setup except ImportError: from distutils.core import setup # # This is the, uh, setup for librarian # setup(name="librarian", version="0.0.dev1", description="The Librarian maintains important datasets", author="Jaeho, Abhinav, Mike", author_email="michael.cafarella@gmail.com", packages=["librarian"], install_requires=["boto", "MySQL-python"], #packages=["boto", "distutils"], entry_points={ 'console_scripts': ['librarian=librarian.librarian:main'] }, )
librarian-master
setup.py
import os def list_files(directory): if os.path.isfile(directory): yield directory raise StopIteration for f in os.listdir(directory): name = directory + '/' + f if os.path.isfile(name): yield name elif os.path.isdir(name): for f in list_files(name): yield f if __name__ == '__main__': for f in list_files(os.getcwd()): print f[len(os.getcwd()):]
librarian-master
librarian/listfiles.py
###################################################################################### # # # A temprorary implementation which uses google sheets as the database for librarian # # # # # # Written by - Abhinav Rastogi, 02/16/2015 # # # ###################################################################################### import os from urllib2 import urlopen from subprocess import call import json import re import string read_key = os.getenv('SHEETSDB_KEY_READ') LIBRARIAN_SCHEMA = { 'Engagements': ['id', 'name', 'date_originated', 'owner', 'comments'], 'IncomingData': ['engagement_id', 'name, version', 'part', 'incoming_id', 'date_ingested', 'checksum', 's3path', 'comments'], 'OutgoingData': ['engagement_id', 'name', 'version', 'outgoing_id', 'date_produced', 'checksum', 's3path', 'published_report_s3path', 'comments'], 'ActivityLog': ['action_id', 'action_type', 'date', 'description', 'engagement_id', 'incoming_id', 'outoging_id'] } def colname(i): if i < 26: return chr(ord('A') + i) else: colname(i / 26) + colname(i % 26) def col_names(num): for c1 in [''] + list(string.ascii_uppercase): for c2 in list(string.ascii_uppercase): if num > 0: yield c1 + c2 num -= 1 else: raise StopIteration # Insert into sheet def insert(table, **kwargs): row = dict(kwargs) if table not in LIBRARIAN_SCHEMA: raise Exception("Table not found.") if not set(row.keys()) <= set(LIBRARIAN_SCHEMA[table]): raise Exception("Schema doesn't match. Insert aborted.") cmd = ['./sheetsdb', 'insert', table] for k, v in row.iteritems(): cmd.append(k + '=' + str(v)) call(cmd) # Query from sheet based on an attribute def query(table, **kwargs): row = dict(kwargs) schema = LIBRARIAN_SCHEMA[table] col_dict = dict(zip(schema, col_names(len(schema)))) params = [] for k, v in row.iteritems(): params.append(col_dict[k] + '%3D' + repr(v)) query = 'select%20*' if len(params) > 0: query += '%20where%20' + '%20and%20'.join(params) url = 'https://docs.google.com/spreadsheets/d/' + read_key + \ '/gviz/tq?tq=' + query + '&sheet=' + table resp = urlopen(url) res = resp.read()[39:-2] # Parse the javascript dates hasDate = re.search(r'new Date\([0-9,]*\)', res) while hasDate: a,b = hasDate.span() y, m, d = map(int, res[a+9:b-1].split(',')) res = res[:a]+'"'+str(m+1)+'-'+str(d)+'-'+str(y)+'"'+res[b:] hasDate = re.search(r'new Date\([0-9,]*\)', res) # load the json object res = json.loads(res) cols = map(lambda x:x[u'label'], res[u'table'][u'cols']) rows = [map(lambda x:x[u'v'] if x else None, r[u'c']) for r in res[u'table'][u'rows']] return cols, rows # id, name, date_originated, owner, comments def add_Engagement(id, name, date, owner, comments): args_dict = {'id':id, 'name':name, 'date_originated':date, 'owner':owner, 'comments':comments} insert('Engagements', **args_dict) # engagement_id, name, version, part, incoming_id, date_ingested, checksum, s3path, comments def add_Incoming(id, name, ver, part, in_id, date, checksum, s3, comments): args_dict = {'engagement_id':id, 'name':name, 'version':ver, 'part':part, 'incoming_id':in_id, 'date_ingested':date, 'checksum':checksum, 's3path':s3, 'comments':comments} insert('IncomingData', **args_dict) # engagement_id, name, version, outgoing_id, date_produced, checksum, s3path, published_report_s3path, comments def add_Outgoing(id, name, ver, out_id, date, checksum, s3, report, comments): args_dict = {'engagement_id':id, 'name':name, 'version':ver, 'outgoing_id':out_id, 'date_produced':date, 'checksum':checksum, 's3path':s3, 'published_report_s3path':report, 'comments':comments} insert('OutgoingData', **args_dict) # action_id, action_type, date, description, engagement_id, incoming_id, outoging_id def add_ActivityLog(act_id, act_type, date, desc, eng_id, inc_id, out_id): args_dict = {'action_id':act_id, 'action_type':act_type, 'date':date, 'description':desc, 'engagement_id':eng_id, 'incoming_id':inc_id, 'outoging_id':out_id} insert('ActivityLog', **args_dict) if __name__=='__main__': # add_Engagement(0, 'memex', 'Sept-1-2014', 'mjc', 'This will be big!') # add_Incoming(0, 'small sample of backpage', 0, 0, 0, 'Sept-5-2014', 'MD5...', 's3:dd-incoming/memex/small_sample_of_backpage/v_0000/data.tsv', 'more data expected later') # add_Outgoing(0, 'Memex ht basic attrs', 0, 0, 'Nov-30-2014', 'MD5:...', 's3:dd-outgoing/memex/memex_ht_basic_attrs/v_0000/data_0000.tsv', 's3:dd-outgoing/memex/memex_ht_basic_attrs/v_0000/report.pdf', 'First shipment! This reflects input backpage data from the large-backpage-crawl up through Nov-1-2014') # add_ActivityLog(0, 'CREATE', 'Jan-20-2015', 'Add new engagement', 3, 'NULL', 'NULL') print query('ActivityLog', action_id=1)
librarian-master
librarian/database.py
#!/usr/bin/env python """Librarian Client Version 0.01 Librarian takes care of all files that leave/enter engagements. When a partner provides a new datafile (as with Memex ads), they get added to Librarian. When we ship extracted data elsewhere, they get added to Librarian. It can also be used to track standard utility files, like Wikipedia or Freebase dumps. It should NOT be used to hold temporary or working files. """ import argparse, boto, json, os.path, dbconn ## # GLOBALS ## configFilename = os.path.abspath(os.path.expanduser("~/.librarian")) configDict = {"credentials":{}} ############################################### class ConfigError(Exception): """ConfigError is a basic Exception wrapper class for this application""" def __init__(self, msg): self.msg = msg ################################################## def loadConfig(): """Grab config info from the ondisk file.""" if not os.path.exists(configFilename): raise ConfigError("Librarian config file does not exist. Invoke librarian --init to create") configFile = open(configFilename) try: global configDict configDict = json.loads(configFile.read()) finally: configFile.close() def saveConfig(): """Save config info to disk file.""" configFile = open(configFilename, "w") try: configFile.write(json.dumps(configDict)) finally: configFile.close() def configInit(): """Create the local .librarian config file, if none previously existed""" if os.path.exists(configFilename): raise ConfigError("Cannot init. Librarian config file already exists at", configFilename) saveConfig() def addCredentials(credentialName, **credential): """Add a new credential to the config file for later use""" loadConfig() global configDict configDict["credentials"][credentialName] = credential saveConfig() def checkS3(): """Ensure we have valid S3 access""" loadConfig() def checkMetadata(): """Ensure we have valid access to the Librarian metadata.""" loadConfig() global dbconn c = configDict["credentials"]["mysql"] dbconn = dbconn.DBConn(c["user"], c["password"], c["host"], c["port"]) def put(fname, project, comment): """Check a file into Librarian""" checkMetadata() print "Put a file called", fname, "into project", project, "with comment", comment def get(fname, project): """Get a file from Librarian""" checkMetadata() print "Get a file called", fname, "from project", project def projectLs(): """List all Librarian projects""" checkMetadata() print "List of all known projects:" for name in dbconn.projectLs(): print name def ls(projectname): """List all Librarian files for a single project""" checkMetadata() print "List of all datasets in a project named", projectname for name, version, urls in dbconn.ls(projectname): print name, version, urls # # main() # def main(): usage = "usage: %prog [options]" # Setup cmdline parsing parser = argparse.ArgumentParser(description="Librarian stores data") parser.add_argument("--put", nargs=3, metavar=("filename", "project", "comment"), help="Puts a <filename> into a <project> with a <comment>") parser.add_argument("--get", nargs=2, metavar=("filename", "project"), help="Gets a <filename> from a <project>") parser.add_argument("--config", nargs=1, metavar=("configfile"), help="Location of the Librarian config file") parser.add_argument("--lscreds", action="store_true", help="List all known credentials") parser.add_argument("--set_aws_cred", nargs=2, metavar=("aws_access_key_id", "aws_secret_access_key"), help="Stores an AWS credential pair in the Librarian config file") parser.add_argument("--set_mysql_cred", nargs=4, metavar=("mysql_host", "mysql_port", "mysql_user", "mysql_password"), help="Stores a MySQL connection info quadruple in the Librarian config file") parser.add_argument("--ls", nargs=1, metavar=("project"), help="List all the files in a <project>") parser.add_argument("--pls", action="store_true", default=False, help="List all projects") parser.add_argument("--init", action="store_true", default=False, help="Create the initial config file") parser.add_argument("--version", action="version", version="%(prog)s 0.1") # Invoke either get() or put() args = parser.parse_args() try: if args.config is not None: configFilename = os.path.abspath(args.config) if args.init: configInit() elif args.set_aws_cred is not None and len(args.set_aws_cred) == 2: addCredentials("aws", access_key_id=args.set_aws_cred[0] , secret_access_key=args.set_aws_cred[1] ) elif args.set_mysql_cred is not None and len(args.set_mysql_cred) == 4: addCredentials("mysql", host=args.set_mysql_cred[0] , port=args.set_mysql_cred[1] , user=args.set_mysql_cred[2] , password=args.set_mysql_cred[3] ) elif args.pls: projectLs() elif args.ls is not None: ls(args.ls[0]) elif args.put is not None and len(args.put) > 0: put(args.put[0], args.put[1], args.put[2]) elif args.get is not None and len(args.get) > 0: get(args.get[0], args.get[1]) elif args.lscreds: loadConfig() print "There are", len(configDict["credentials"]), "credential(s) available" for name, cred in configDict["credentials"].iteritems(): # TODO print prettier print " ", name, cred else: parser.print_help() except ConfigError as e: print e.msg if __name__ == "__main__": main()
librarian-master
librarian/librarian.py
librarian-master
librarian/__init__.py
#!/bin/python """Database connectivity for Librarian. This module contains all the classes and miscellany necessary for Librarian to connect to a shared backend RDBMS for metadata. It is not designed to hold raw content, just the file names, version history, checksums, etc. Schema: 'Engagements': ['id', 'name', 'date_started', 'owner', 'comments'], 'IncomingData': ['id', 'project', 'name', 'version', 'timestamp', 'urls', 'checksums', 'metadata_url', 'comments', 'user', 'hostname'] 'OutgoingData': ['id', 'project', 'name', 'version', 'timestamp', 'urls', 'checksums', 'metadata_url', 'comments', 'user', 'hostname'] """ import MySQLdb, datetime class DBConn: """Represents a live database conn with Librarian-specific operators.""" def __init__(self, username, password, host, port = 3306): self.user = username self.pswd = password self.host = host self.port = int(port) try: self.db = MySQLdb.connect(host=self.host, port=self.port, user=self.user, passwd=self.pswd, db='librarian') except: raise Exception('Invalid credentials for librarian database') def projectLs(self): ''' returns a generator listing all librarian projects ''' c = self.db.cursor() try: for _ in xrange(c.execute( '''select name from Engagements''')): yield c.fetchone()[0] except: raise Exception('Database not available') c.close() def ls(self, project): ''' returns a generator listing all datasets and their versions in a librarian project. The generator yield a (name, version) tuple. ''' c = self.db.cursor() def datasetQueryFor(table): return ''' select ds.name, ds.version, ds.urls from %s ds join Engagements on ds.project = Engagements.id where Engagements.name = %%s ''' % (table) try: for _ in xrange(c.execute(datasetQueryFor('IncomingData') + ' union ' + datasetQueryFor('OutgoingData'), (project, project))): yield c.fetchone() except Exception as e: raise Exception('Database not available', e) c.close() def createProject(self, project, comments=''): ''' Creates a new project in the database. This function should be called after appropriate space has been allocated on the S3 bucket ''' if project in self.ls(): raise Exception('Project already exists!') c = self.db.cursor() date = datetime.date.today() owner = self.user c.execute('''insert into Engagements values (%s, %s, %s, %s)''', (project, date, owner, comments)) c.close()
librarian-master
librarian/dbconn.py
#!/usr/bin/env python # upload-s3.py -- Librarian script that takes care of uploading data to AWS S3 import boto import boto.s3.connection import os import datetime def list_files(directory): ''' Generator to recursively list all the files in a directory. ''' if os.path.isfile(directory): yield directory raise StopIteration for f in os.listdir(directory): name = directory + '/' + f if os.path.isfile(name): yield name elif os.path.isdir(name): for f in list_files(name): yield f def upload(local_paths, project, dataset, timestamp): ''' Upload a file/directory to S3 path maintaining the directory structure ''' # get the s3 access keys access_key = os.getenv('AWS_ACCESS_KEY_ID') secret_key = os.getenv('AWS_SECRET_ACCESS_KEY') conn = boto.s3.connection.S3Connection( aws_access_key_id = access_key, aws_secret_access_key = secret_key, calling_format = boto.s3.connection.OrdinaryCallingFormat(), ) # get the storage bucket bucket = conn.get_bucket('librarian_upload_test') # make a separate directory for the installation store_dir = '/'.join([project, dataset, timestamp]) urls = [] checksums = [] # Upload all the files and directories pointed to by local_path for local_path in local_paths: for f in list_files(local_path): key = bucket.new_key(store_dir + f[len(local_path):]) key.set_contents_from_filename(f) key.set_acl('public-read') url = key.generate_url(expires_in=0, query_auth=False) urls.append(url) checksums.append('') # TODO # return the urls and checksums for uploaded objects return urls, checksums if __name__=='__main__': print upload('/home/abhinav/Dropbox/github/librarian', 'folder_test')
librarian-master
librarian/storage_s3.py
librarian-master
tests/__init__.py
from nose.tools import * import librarian def setup(): print "SETUP!" def teardown(): print "TEAR DOWN!" def test_basic(): print "I RAN!"
librarian-master
tests/librarian_tests.py
# Copyright (c) Facebook, Inc. and its affiliates. import cv2 import sys import numpy as np from utils import ( initialize_render, merge_meshes, load_motion ) import torch from PIL import Image from model import JOHMRLite import os import glob import json from pathlib import Path import argparse import re import matplotlib.pyplot as plt global model, index, alpha index = 0 alpha = 0.5 def isfloat(x): try: a = float(x) except (TypeError, ValueError): return False else: return True def isint(x): try: a = float(x) b = int(a) except (TypeError, ValueError): return False else: return a == b def find_files(folder, extension): return sorted([Path(os.path.join(folder, f)) for f in os.listdir(folder) if f.endswith(extension)]) def read_data(): """ Load all annotated data for visualization """ # load gt part motion values (degree or cm) gt_partmotion = [] fp = open(os.path.join(args.data_folder, 'jointstate.txt')) for i, line in enumerate(fp): line = line.strip('\n') if isfloat(line) or isint(line): gt_partmotion.append(float(line)) gt_partmotion = np.asarray(gt_partmotion) with open(os.path.join(args.data_folder, '3d_info.txt')) as myfile: gt_data = [next(myfile).strip('\n') for x in range(14)] # GT global object rotation gt_pitch = float(re.findall(r"[-+]?\d*\.\d+|\d+", gt_data[3])[0]) gt_yaw = float(re.findall(r"[-+]?\d*\.\d+|\d+", gt_data[4])[0]) gt_roll = float(re.findall(r"[-+]?\d*\.\d+|\d+", gt_data[5])[0]) # GT global object translation (cm) gt_x = float(re.findall(r"[-+]?\d*\.\d+|\d+", gt_data[6])[0]) gt_y = float(re.findall(r"[-+]?\d*\.\d+|\d+", gt_data[7])[0]) gt_z = float(re.findall(r"[-+]?\d*\.\d+|\d+", gt_data[8])[0]) # GT object dimension (cm) gt_xdim = float(re.findall(r"[-+]?\d*\.\d+|\d+", gt_data[9])[0]) gt_ydim = float(re.findall(r"[-+]?\d*\.\d+|\d+", gt_data[9])[1]) gt_zdim = float(re.findall(r"[-+]?\d*\.\d+|\d+", gt_data[9])[2]) gt_cad = re.findall(r"[-+]?\d*\.\d+|\d+", gt_data[10])[0] gt_part = int(re.findall(r"[-+]?\d*\.\d+|\d+", gt_data[11])[0]) gt_focalX = int(re.findall(r"[-+]?\d*\.\d+|\d+", gt_data[-2])[0]) gt_focalY = int(re.findall(r"[-+]?\d*\.\d+|\d+", gt_data[-1])[0]) assert gt_focalX == gt_focalY data = {'part_motion': gt_partmotion, 'pitch': gt_pitch, 'yaw': gt_yaw, 'roll': gt_roll, 'x_offset': gt_x, 'y_offset': gt_y, 'z_offset': gt_z, 'obj_size': [gt_xdim, gt_ydim, gt_zdim], 'cad': gt_cad, 'part': gt_part, 'focal': gt_focalX} return data def create_model(gt_data): """ create initial models """ global model, index, alpha x_offset = gt_data['x_offset'] y_offset = gt_data['y_offset'] z_offset = gt_data['z_offset'] yaw = gt_data['yaw'] pitch = gt_data['pitch'] roll = gt_data['roll'] part_motion = gt_data['part_motion'] obj_size = gt_data['obj_size'] # length, height, width (x, y, z), cm focal_x = gt_data['focal'] focal_y = gt_data['focal'] device = torch.device("cuda:0") obj_path = os.path.join(args.cad_folder, gt_data['cad']) verts, faces, vertexSegs, faceSegs = merge_meshes(obj_path, device) verts[:,1:] *= -1 # pytorch3d -> world coordinate obj_verts = verts.to(device) obj_faces = faces.to(device) # load motion json file with open(os.path.join(args.cad_folder, gt_data['cad'], 'motion.json')) as json_file: motions = json.load(json_file) assert len(motions) + 2 == len(vertexSegs) rot_o, rot_axis, rot_type, limit_a, limit_b, contact_list = load_motion(motions, device) frames = find_files(os.path.join(args.data_folder, 'frames'), '.jpg') image_bg = np.array(Image.open(frames[index]))/255.0 img_h = image_bg.shape[0] img_w = image_bg.shape[1] img_square = max(img_h, img_w) img_small = 256 # render _, phong_renderer = initialize_render(device, focal_x, focal_y, img_square, img_small) # Model >_< model = JOHMRLite(x_offset, y_offset, z_offset, yaw, pitch, roll, part_motion, obj_size, \ obj_verts, obj_faces, phong_renderer, gt_data['part'], rot_o, rot_axis, \ vertexSegs, rot_type) return len(frames) def display_img(): global model, index, alpha frames = find_files(os.path.join(args.data_folder, 'frames'), '.jpg') image_bg = np.array(Image.open(frames[index]))/255.0 img_h = image_bg.shape[0] img_w = image_bg.shape[1] img_square = max(img_h, img_w) img_small = 256 with torch.no_grad(): image = model(index) rgb_mask = image_bg.astype(np.float32) #cv2.addWeighted(objmask.astype(np.float32), 0.5, image_bg.astype(np.float32), 0.5, 0.0) frame_img = np.zeros((img_square, img_square,3)) start = int((max(img_h, img_w) - min(img_h, img_w))/2) - 1 end = start + min(img_h, img_w) if img_h > img_w: frame_img[:, start:end, :] = rgb_mask else: frame_img[start:end, :, :] = rgb_mask rgb_mask = frame_img alpha = min(1.0, max(0.0,alpha)) img_blend = cv2.addWeighted(image.astype(np.float32), alpha, rgb_mask.astype(np.float32), 1-alpha, 0.0) img_blend = cv2.resize(img_blend, dsize=(800, 800), interpolation=cv2.INTER_NEAREST) return img_blend parser = argparse.ArgumentParser() parser.add_argument("--data_folder", type=str, help="annotation data folder") parser.add_argument("--cad_folder", type=str, help="cad data folder") args = parser.parse_args() gt_data = read_data() num_frames = create_model(gt_data) for index in range(num_frames): img_blend = display_img() plt.imshow(img_blend) plt.show()
d3d-hoi-main
visualization/visualize_data.py
# Copyright (c) Facebook, Inc. and its affiliates. import torch.nn as nn import torch import numpy as np from pytorch3d.renderer import ( look_at_view_transform, TexturesVertex ) from pytorch3d.structures import Meshes from utils import rotation_matrix from pytorch3d.io import save_obj from pytorch3d.transforms import ( RotateAxisAngle, matrix_to_euler_angles ) from pytorch3d.transforms.rotation_conversions import ( rotation_6d_to_matrix, matrix_to_rotation_6d ) import os from pytorch3d.transforms import ( euler_angles_to_matrix ) from utils import ( rotation_matrix ) class JOHMRLite(nn.Module): def __init__(self, x_offset, y_offset, z_offset, yaw, pitch, roll, part_motion, obj_size, \ obj_verts, obj_faces, vis_render, part_idx, rot_o, axis, vertexSegs, rot_type): super().__init__() self.device = obj_verts.device self.vis_render = vis_render self.obj_verts = obj_verts.detach() self.obj_faces = obj_faces.detach() self.rot_type = rot_type self.x_offset = x_offset self.y_offset = y_offset self.z_offset = z_offset self.part_motion = part_motion # camera is almost at the center (distance can't be zero for diff render) self.R, self.T = look_at_view_transform(0.1, 0.0, 0.0,device=self.device) self.T[0,2] = 0.0 # manually set to zero x_diff = torch.max(obj_verts[:,0]) - torch.min(obj_verts[:,0]) self.x_ratio = float(obj_size[0]) / x_diff y_diff = torch.max(obj_verts[:,1]) - torch.min(obj_verts[:,1]) self.y_ratio = float(obj_size[1]) / y_diff z_diff = torch.max(obj_verts[:,2]) - torch.min(obj_verts[:,2]) self.z_ratio = float(obj_size[2]) / z_diff # predefined object CAD part and axis self.vertexStart = vertexSegs[part_idx] self.vertexEnd = vertexSegs[part_idx+1] self.rot_o = rot_o[part_idx] self.axis = axis[part_idx] # pytorch3d -> world coordinate self.rot_o[1:] *= -1 self.axis[1:] *= -1 # rescale object self.obj_verts[:, 0] *= self.x_ratio self.obj_verts[:, 1] *= self.y_ratio self.obj_verts[:, 2] *= self.z_ratio self.rot_o[0] *= self.x_ratio self.rot_o[1] *= self.y_ratio self.rot_o[2] *= self.z_ratio euler_angle = torch.tensor([pitch, yaw, roll]).reshape(1,3) self.objR = euler_angles_to_matrix(euler_angle, ["X","Y","Z"]).to(self.device)[0] return def forward(self, index): partmotion = self.part_motion[index] obj_verts = self.obj_verts.clone() # part motion if self.rot_type[0] == 'prismatic': part_state = torch.tensor(partmotion).to(self.device) obj_verts_t1 = obj_verts[self.vertexStart:self.vertexEnd, :] - self.rot_o obj_verts_t2 = obj_verts_t1 + self.axis * part_state #/float(annotation['obj_dim'][2]) * z_ratio obj_verts[self.vertexStart:self.vertexEnd, :] = obj_verts_t2 + self.rot_o else: part_state = torch.tensor(partmotion*0.0174533) part_rot_mat = rotation_matrix(self.axis, part_state) obj_verts_t1 = obj_verts[self.vertexStart:self.vertexEnd, :] - self.rot_o obj_verts_t2 = torch.mm(part_rot_mat.to(self.device), obj_verts_t1.permute(1,0)).permute(1,0) obj_verts[self.vertexStart:self.vertexEnd, :] = obj_verts_t2 + self.rot_o # step 3: object orientation obj_verts = torch.mm(self.objR, obj_verts.permute(1,0)).permute(1,0) # step 4: object offset obj_verts[:, 0] += 100.0*self.x_offset obj_verts[:, 1] += 100.0*self.y_offset obj_verts[:, 2] += 100.0*self.z_offset obj_verts[:,1:] *= -1 # create object mesh for diff render and visualization tex = torch.ones_like(obj_verts).unsqueeze(0) tex[:, :, 0] = 0 tex[:, :, 1] = 1 tex[:, :, 2] = 0 textures = TexturesVertex(verts_features=tex).to(self.device) self.obj_mesh = Meshes(verts=[obj_verts],faces=[self.obj_faces],textures=textures) vis_image = self.vis_render(meshes_world=self.obj_mesh, R=self.R, T=self.T) silhouette = vis_image[0,:,:,:3] return silhouette.detach().cpu().numpy()
d3d-hoi-main
visualization/model.py
# Copyright (c) Facebook, Inc. and its affiliates. import numpy as np import torch import natsort import glob import open3d as o3d # rendering components from pytorch3d.renderer import ( FoVPerspectiveCameras,RasterizationSettings, MeshRenderer, MeshRasterizer, BlendParams, SoftSilhouetteShader, HardPhongShader, PointLights, DirectionalLights, PerspectiveCameras ) from pytorch3d.io import save_obj import math import cv2 import matplotlib.pyplot as plt import os import imageio from decimal import Decimal import pdb import json import matplotlib.pyplot as plt from mpl_toolkits import mplot3d from mpl_toolkits.mplot3d import axes3d from scipy.ndimage.filters import gaussian_filter1d from numpy.linalg import svd from multiprocessing import Pool, Manager, cpu_count from pytorch3d.transforms import Rotate, Translate from matplotlib.image import imsave from pathlib import Path def planeFit(points): """ p, n = planeFit(points) Given an array, points, of shape (d,...) representing points in d-dimensional space, fit an d-dimensional plane to the points. Return a point, p, on the plane (the point-cloud centroid), and the normal, n. """ points = np.reshape(points, (np.shape(points)[0], -1)) # Collapse trialing dimensions assert points.shape[0] <= points.shape[1], "There are only {} points in {} dimensions.".format(points.shape[1], points.shape[0]) ctr = points.mean(axis=1) x = points - ctr[:,np.newaxis] M = np.dot(x, x.T) # Could also use np.cov(x) here. return ctr, svd(M)[0][:,-1] def initialize_render(device, focal_x, focal_y, img_square_size, img_small_size): """ initialize camera, rasterizer, and shader. """ # Initialize an OpenGL perspective camera. #cameras = FoVPerspectiveCameras(znear=1.0, zfar=9000.0, fov=20, device=device) #cameras = FoVPerspectiveCameras(device=device) #cam_proj_mat = cameras.get_projection_transform() img_square_center = int(img_square_size/2) shrink_ratio = int(img_square_size/img_small_size) focal_x_small = int(focal_x/shrink_ratio) focal_y_small = int(focal_y/shrink_ratio) img_small_center = int(img_small_size/2) camera_sfm = PerspectiveCameras( focal_length=((focal_x, focal_y),), principal_point=((img_square_center, img_square_center),), image_size = ((img_square_size, img_square_size),), device=device) camera_sfm_small = PerspectiveCameras( focal_length=((focal_x_small, focal_y_small),), principal_point=((img_small_center, img_small_center),), image_size = ((img_small_size, img_small_size),), device=device) # To blend the 100 faces we set a few parameters which control the opacity and the sharpness of # edges. Refer to blending.py for more details. blend_params = BlendParams(sigma=1e-4, gamma=1e-4) # Define the settings for rasterization and shading. Here we set the output image to be of size # 256x256. To form the blended image we use 100 faces for each pixel. We also set bin_size and max_faces_per_bin to None which ensure that # the faster coarse-to-fine rasterization method is used. Refer to rasterize_meshes.py for # explanations of these parameters. Refer to docs/notes/renderer.md for an explanation of # the difference between naive and coarse-to-fine rasterization. raster_settings = RasterizationSettings( image_size=img_small_size, blur_radius=np.log(1. / 1e-4 - 1.) * blend_params.sigma, faces_per_pixel=100, ) # Create a silhouette mesh renderer by composing a rasterizer and a shader. silhouette_renderer = MeshRenderer( rasterizer=MeshRasterizer( cameras=camera_sfm_small, raster_settings=raster_settings ), shader=SoftSilhouetteShader(blend_params=blend_params) ) # We will also create a phong renderer. This is simpler and only needs to render one face per pixel. raster_settings = RasterizationSettings( image_size=img_square_size, blur_radius=0.0, faces_per_pixel=1, ) # We can add a point light in front of the object. lights = PointLights(device=device, location=((2.0, 2.0, -2.0),)) #lights = DirectionalLights(device=device, direction=((0, 0, 1),)) phong_renderer = MeshRenderer( rasterizer=MeshRasterizer( cameras=camera_sfm, raster_settings=raster_settings ), shader=HardPhongShader(device=device, cameras=camera_sfm, lights=lights) ) return silhouette_renderer, phong_renderer def merge_meshes(obj_path, device): """ helper function for loading and merging meshes. """ verts_list = torch.empty(0,3) faces_list = torch.empty(0,3).long() num_vtx = [0] num_faces = [0] # merge meshes, load in ascending order meshes = natsort.natsorted(glob.glob(obj_path+'/final/*_rescaled_sapien.obj')) for part_mesh in meshes: #print('loading %s' %part_mesh) mesh = o3d.io.read_triangle_mesh(part_mesh) verts = torch.from_numpy(np.asarray(mesh.vertices)).float() faces = torch.from_numpy(np.asarray(mesh.triangles)).long() faces = faces + verts_list.shape[0] verts_list = torch.cat([verts_list, verts]) faces_list = torch.cat([faces_list, faces]) num_vtx.append(verts_list.shape[0]) num_faces.append(faces_list.shape[0]) verts_list = verts_list.to(device) faces_list = faces_list.to(device) return verts_list, faces_list, num_vtx, num_faces def load_motion(motions, device): """ load rotation axis, origin, and limit. """ rot_origin = [] rot_axis = [] rot_type = [] limit_a = [] limit_b = [] contact_list = [] # load all meta data for idx, key in enumerate(motions.keys()): jointData = motions[key] # if contains movable parts if jointData is not None: origin = torch.FloatTensor(jointData['axis']['origin']).to(device) axis = torch.FloatTensor(jointData['axis']['direction']).to(device) mobility_type = jointData['type'] if 'contact' in jointData: contact_list.append(jointData['contact']) # convert to radians if necessary if mobility_type == 'revolute': mobility_a = math.pi*jointData['limit']['a'] / 180.0 mobility_b = math.pi*jointData['limit']['b'] / 180.0 else: assert mobility_type == 'prismatic' mobility_a = jointData['limit']['a'] mobility_b = jointData['limit']['b'] rot_origin.append(origin) rot_axis.append(axis) rot_type.append(mobility_type) limit_a.append(mobility_a) limit_b.append(mobility_b) return rot_origin, rot_axis, rot_type, limit_a, limit_b, contact_list def visualize(mask, image, alpha): #mask = np.repeat(mask[:,:,np.newaxis], 3, axis=2) mask_img_blend = cv2.addWeighted(mask, alpha, image.astype(np.float32), 1.0-alpha, 0) mask_img_blend = mask_img_blend*mask + image*(1-mask) return mask_img_blend def visualize_curve(data, output, save_folder, title): mask_model = output['obj_mask'] spin_points = output['spin_points'] # plot curve obj_curve = output['obj_curve'] spin_curve = output['spin_curve'] x_offset = spin_curve[0,0] - obj_curve[0,0] y_offset = spin_curve[0,1] - obj_curve[0,1] z_offset = spin_curve[0,2] - obj_curve[0,2] obj_curve[:,0] += x_offset obj_curve[:,1] += y_offset obj_curve[:,2] += z_offset fig = plt.figure() ax = plt.axes(projection='3d') #obj_curves = obj_curve_norm ax.scatter(spin_curve[0,0], spin_curve[0,1], spin_curve[0,2], color='red') ax.scatter(obj_curve[0,0], obj_curve[0,1], obj_curve[0,2], color='red') ax.plot(obj_curve[:,0], obj_curve[:,1], obj_curve[:,2], label='object curve') ax.plot(spin_curve[:,0], spin_curve[:,1], spin_curve[:,2], label='hand curve') ax.legend() ax.set_xlabel("X") ax.set_ylabel("Y") ax.set_zlabel("Z") plt.show() def save_mesh(id): global obj_verts_dict global obj_faces_dict global human_verts_dict global human_faces_dict global save_path_mesh verts1 = obj_verts_dict[str(id+1)] verts2 = human_verts_dict[str(id+1)] faces1 = obj_faces_dict[str(id+1)] faces2 = human_faces_dict[str(id+1)] verts = np.concatenate((verts1, verts2), axis=0) faces = np.concatenate((faces1, faces2 + verts1.shape[0]), axis=0) path = os.path.join(save_path_mesh, str(id+1)+'_object.obj') save_obj(path, torch.from_numpy(verts1), torch.from_numpy(faces1)) path = os.path.join(save_path_mesh, str(id+1)+'_person.obj') save_obj(path, torch.from_numpy(verts2), torch.from_numpy(faces2)) path = os.path.join(save_path_mesh, str(id+1)+'_joint.obj') save_obj(path, torch.from_numpy(verts), torch.from_numpy(faces)) def save_meshes(meshes, save_folder, video_name, title): global obj_verts_dict global obj_faces_dict global human_verts_dict global human_faces_dict global save_path_mesh save_path_mesh = os.path.join(save_folder, title) if not os.path.exists(save_path_mesh): os.makedirs(save_path_mesh) obj_meshes = meshes['obj_mesh'] spin_meshes = meshes['spin_mesh'] # merge object + SPIN meshes obj_verts = {} obj_faces = {} human_verts = {} human_faces = {} for idx in range(len(obj_meshes)): obj_verts[str(idx+1)] = obj_meshes[idx].verts_list()[0].detach().cpu().numpy() obj_faces[str(idx+1)] = obj_meshes[idx].faces_list()[0].detach().cpu().numpy() human_verts[str(idx+1)] = spin_meshes[idx].verts_list()[0].detach().cpu().numpy() human_faces[str(idx+1)] = spin_meshes[idx].faces_list()[0].detach().cpu().numpy() manager = Manager() obj_verts_dict = manager.dict(obj_verts) obj_faces_dict = manager.dict(obj_faces) human_verts_dict = manager.dict(human_verts) human_faces_dict = manager.dict(human_faces) ids = [item for item in range(len(obj_meshes))] pool = Pool(processes=12) pool.map(save_mesh, ids) ''' eft_cmd = 'python -m demo.demo_bodymocap --render wire --bg rgb --videoname '+video_name+' --vPath '+save_folder os.chdir('/home/xuxiangx/research/eft') os.system(eft_cmd) save_path = os.path.join(save_folder, 'eft', 'front') ffmpeg_cmd = 'ffmpeg -r 3 -i '+save_path+'/scene_%08d.jpg '+save_folder+'/frontview.mp4' os.system(ffmpeg_cmd) save_path = os.path.join(save_folder, 'eft', 'side') ffmpeg_cmd = 'ffmpeg -r 3 -i '+save_path+'/scene_%08d.jpg '+save_folder+'/sideview.mp4' os.system(ffmpeg_cmd) ''' return def save_parameters(model, save_folder, title): save_path = os.path.join(save_folder, title) if not os.path.exists(save_path): os.makedirs(save_path) obj_offset = 1000.0*model.obj_offset.detach().cpu().numpy() #(3,) smpl_offset = 1000.0*model.smpl_offset.detach().cpu().numpy() #(bs,3) obj_scale = 3000.0*model.obj_scale smpl_scale = 3000.0 focal_len = model.focal part_rot_angle = model.part_rot_params.detach().cpu().numpy() #(bs,) obj_rot_mat = model.obj_rot_angle_mat[0].detach().cpu().numpy() #(3,3) part_rot_mat = model.part_rot_mat.detach().cpu().numpy() #(bs,3,3) K_mat = model.K.detach().cpu().numpy() #(3,3) rot_o = model.rot_o.detach().cpu().numpy() #(3,) rot_axis = model.axis.detach().cpu().numpy() #(3,) parameters = {} parameters['obj_offset'] = obj_offset parameters['smpl_offset'] = smpl_offset parameters['obj_scale'] = obj_scale parameters['smpl_scale'] = smpl_scale parameters['focal_length'] = focal_len parameters['part_rot_angle'] = part_rot_angle parameters['obj_rot_matrix'] = obj_rot_mat parameters['part_rot_matrix'] = part_rot_mat parameters['K_matrix'] = K_mat parameters['rot_origin'] = rot_o parameters['rot_axis'] = rot_axis np.save(os.path.join(save_path, 'parameters.npy'), parameters) return def save_img(idx): global shared_dict1 global shared_dict2 global save_path roi_image = shared_dict1['image'].permute(0,2,3,1)[idx].numpy() silhouette = shared_dict1['objmask'].permute(0,2,3,1)[idx] mask_model = shared_dict2['obj_mask'] gt_points = shared_dict1['smplv2d'] spin_points = shared_dict2['spin_points'] silhouette_init = mask_model.detach().cpu().squeeze()[idx].numpy() mask_img_blend = visualize(silhouette_init, roi_image, 0.8) # save image #plt.subplots_adjust(hspace = 0.2, left=0.01, right=0.99, top=0.95, bottom=0.05) imsave(os.path.join(save_path, str(idx)+'.png'), mask_img_blend) return def save_imgs(data, output, save_folder): global shared_dict1 global shared_dict2 global save_path save_path = save_folder manager = Manager() shared_dict1 = manager.dict(data) shared_dict1 = data shared_dict2 = manager.dict(output) shared_dict2 = output ids = [item for item in range(data['image'].shape[0])] pool = Pool(processes=12) pool.map(save_img, ids) #sceneflow = shared_dict2['sceneflow'] #objSurfaceFlow = shared_dict2['objSurfaceFlow'] #synFlow = shared_dict2['synFlow'] #sceneflowMaskSquareShrink = shared_dict2['sceneflowMaskSquareShrink'] #part_diff_images = shared_dict2['part_diff_images'] # save object part suface raft flow visualization #save_path = os.path.join(save_folder, title, 'objSurfaceFlow') #if not os.path.exists(save_path): #os.makedirs(save_path) #for idx in range(objSurfaceFlow.shape[0]): #imsave(os.path.join(save_path, str(idx)+'.png'), objSurfaceFlow[idx]) #ffmpeg_cmd = 'ffmpeg -r 3 -i '+save_path+'/%d.png '+save_folder+'/objSurfaceFlow.mp4' #os.system(ffmpeg_cmd) # save synthetic rendering flow visualization #save_path = os.path.join(save_folder, title, 'synFlow') #if not os.path.exists(save_path): #os.makedirs(save_path) #for idx in range(synFlow.shape[0]): #imsave(os.path.join(save_path, str(idx)+'.png'), synFlow[idx]) #ffmpeg_cmd = 'ffmpeg -r 3 -i '+save_path+'/%d.png '+save_folder+'/synFlow.mp4' #os.system(ffmpeg_cmd) # save visualize images #for idx in range(data['image'].shape[0]): #save_img(idx, shared_dict1, shared_dict2) #save_path = os.path.join(save_folder, title, 'render') #ffmpeg_cmd = 'ffmpeg -r 3 -i '+save_path+'/%d.png '+save_folder+'/render.mp4' #os.system(ffmpeg_cmd) #vid1 = os.path.join(save_folder, 'objSurfaceFlow.mp4') #vid2 = os.path.join(save_folder, 'synFlow.mp4') #vid3 = os.path.join(save_folder, 'visual.mp4') #ffmpeg_cmd = 'ffmpeg -i '+vid1+' -i '+vid2+' -filter_complex hstack=inputs=2 '+vid3 #os.system(ffmpeg_cmd) return def rotation_matrix(axis, theta): """ Return the rotation matrix associated with counterclockwise rotation about the given axis by theta radians. """ axis = axis / torch.sqrt(torch.dot(axis, axis)) a = torch.cos(theta / 2.0) b, c, d = -axis * torch.sin(theta / 2.0) aa, bb, cc, dd = a * a, b * b, c * c, d * d bc, ad, ac, ab, bd, cd = b * c, a * d, a * c, a * b, b * d, c * d rot_mat = torch.empty(3,3) rot_mat[0,0] = aa + bb - cc - dd rot_mat[0,1] = 2 * (bc + ad) rot_mat[0,2] = 2 * (bd - ac) rot_mat[1,0] = 2 * (bc - ad) rot_mat[1,1] = aa + cc - bb - dd rot_mat[1,2] = 2 * (cd + ab) rot_mat[2,0] = 2 * (bd + ac) rot_mat[2,1] = 2 * (cd - ab) rot_mat[2,2] = aa + dd - bb - cc return rot_mat def rotation_matrix_batch(axis, theta): """ Return the rotation matrix associated with counterclockwise rotation about the given axis by theta radians. """ axis = axis / torch.sqrt(torch.dot(axis, axis)) a = torch.cos(theta / 2.0) b = -axis[0] * torch.sin(theta / 2.0) c = -axis[1] * torch.sin(theta / 2.0) d = -axis[2] * torch.sin(theta / 2.0) aa, bb, cc, dd = a * a, b * b, c * c, d * d bc, ad, ac, ab, bd, cd = b * c, a * d, a * c, a * b, b * d, c * d rot_mat = torch.empty(aa.shape[0],3,3) rot_mat[:,0,0] = aa + bb - cc - dd rot_mat[:,0,1] = 2 * (bc + ad) rot_mat[:,0,2] = 2 * (bd - ac) rot_mat[:,1,0] = 2 * (bc - ad) rot_mat[:,1,1] = aa + cc - bb - dd rot_mat[:,1,2] = 2 * (cd + ab) rot_mat[:,2,0] = 2 * (bd + ac) rot_mat[:,2,1] = 2 * (cd - ab) rot_mat[:,2,2] = aa + dd - bb - cc return rot_mat def flow_confidence(threshold, forwardFlow, backwardFlow, img_w, img_h): # I_t -> I_(t+1), wrap with forward flow It1 = forwardFlow.clone() It1[:,:,0] += torch.arange(img_w) It1[:,:,1] += torch.arange(img_h).unsqueeze(1) # (u, v) coordinate It1 = torch.round(It1) withinFrameMask = (It1[:,:,0] < img_w) * (It1[:,:,0] > 0) *\ (It1[:,:,1] < img_h) * (It1[:,:,1] > 0) pdb.set_trace() withinFrameCoord = torch.nonzero(withinFrameMask==1) # (x, y) coordinate of within frame flow nextCoord = It1[withinFrameCoord[:, 0], withinFrameCoord[:,1]].astype(int) # u, v order # I_(t+1) -> I_t, wrap back with backward flow nextCoordBackwardFlow = backwardFlow[nextCoord[:,1], nextCoord[:,0],:] nextbackCoord = nextCoord + nextCoordBackwardFlow # u, v coord nextbackCoord[:,[1,0]] = nextbackCoord[:,[0,1]] # swap to x,y coord # filter out noisy flow stableFlowMask = np.sum(np.abs(nextbackCoord - withinFrameCoord), 1) < threshold stableFlowCoord = withinFrameCoord[stableFlowMask] # (x,y) coord return stableFlowCoord def make_colorwheel(): """ Generates a color wheel for optical flow visualization as presented in: Baker et al. "A Database and Evaluation Methodology for Optical Flow" (ICCV, 2007) URL: http://vision.middlebury.edu/flow/flowEval-iccv07.pdf Code follows the original C++ source code of Daniel Scharstein. Code follows the the Matlab source code of Deqing Sun. Returns: np.ndarray: Color wheel """ RY = 15 YG = 6 GC = 4 CB = 11 BM = 13 MR = 6 ncols = RY + YG + GC + CB + BM + MR colorwheel = np.zeros((ncols, 3)) col = 0 # RY colorwheel[0:RY, 0] = 255 colorwheel[0:RY, 1] = np.floor(255*np.arange(0,RY)/RY) col = col+RY # YG colorwheel[col:col+YG, 0] = 255 - np.floor(255*np.arange(0,YG)/YG) colorwheel[col:col+YG, 1] = 255 col = col+YG # GC colorwheel[col:col+GC, 1] = 255 colorwheel[col:col+GC, 2] = np.floor(255*np.arange(0,GC)/GC) col = col+GC # CB colorwheel[col:col+CB, 1] = 255 - np.floor(255*np.arange(CB)/CB) colorwheel[col:col+CB, 2] = 255 col = col+CB # BM colorwheel[col:col+BM, 2] = 255 colorwheel[col:col+BM, 0] = np.floor(255*np.arange(0,BM)/BM) col = col+BM # MR colorwheel[col:col+MR, 2] = 255 - np.floor(255*np.arange(MR)/MR) colorwheel[col:col+MR, 0] = 255 return colorwheel def flow_uv_to_colors(u, v, convert_to_bgr=False): """ Applies the flow color wheel to (possibly clipped) flow components u and v. According to the C++ source code of Daniel Scharstein According to the Matlab source code of Deqing Sun Args: u (np.ndarray): Input horizontal flow of shape [H,W] v (np.ndarray): Input vertical flow of shape [H,W] convert_to_bgr (bool, optional): Convert output image to BGR. Defaults to False. Returns: np.ndarray: Flow visualization image of shape [H,W,3] """ flow_image = np.zeros((u.shape[0], u.shape[1], 3), np.uint8) colorwheel = make_colorwheel() # shape [55x3] ncols = colorwheel.shape[0] rad = np.sqrt(np.square(u) + np.square(v)) a = np.arctan2(-v, -u)/np.pi fk = (a+1) / 2*(ncols-1) k0 = np.floor(fk).astype(np.int32) k1 = k0 + 1 k1[k1 == ncols] = 0 f = fk - k0 for i in range(colorwheel.shape[1]): tmp = colorwheel[:,i] col0 = tmp[k0] / 255.0 col1 = tmp[k1] / 255.0 col = (1-f)*col0 + f*col1 idx = (rad <= 1) col[idx] = 1 - rad[idx] * (1-col[idx]) col[~idx] = col[~idx] * 0.75 # out of range # Note the 2-i => BGR instead of RGB ch_idx = 2-i if convert_to_bgr else i flow_image[:,:,ch_idx] = np.floor(255 * col) return flow_image def flow_to_image(flow_uv, clip_flow=None, convert_to_bgr=False): """ Expects a two dimensional flow image of shape. Args: flow_uv (np.ndarray): Flow UV image of shape [H,W,2] clip_flow (float, optional): Clip maximum of flow values. Defaults to None. convert_to_bgr (bool, optional): Convert output image to BGR. Defaults to False. Returns: np.ndarray: Flow visualization image of shape [H,W,3] """ assert flow_uv.ndim == 3, 'input flow must have three dimensions' assert flow_uv.shape[2] == 2, 'input flow must have shape [H,W,2]' if clip_flow is not None: flow_uv = np.clip(flow_uv, 0, clip_flow) u = flow_uv[:,:,0] v = flow_uv[:,:,1] rad = np.sqrt(np.square(u) + np.square(v)) rad_max = 40.0#, epsilon = 1e-5 u = u / (rad_max + epsilon) v = v / (rad_max + epsilon) return flow_uv_to_colors(u, v, convert_to_bgr)
d3d-hoi-main
visualization/utils.py
# Copyright (c) Facebook, Inc. and its affiliates. import cv2 import sys from PyQt5 import QtCore, QtGui, QtWidgets import numpy as np from utils import ( initialize_render, merge_meshes, load_motion ) import torch from PIL import Image from natsort import natsorted from model import JOHMRLite import os import json import pdb import scipy.misc import matplotlib.pyplot as plt import open3d as o3d import torch.optim as optim from pytorch3d.io import save_obj # load cad model device = torch.device("cuda:0") obj_path = 'processed_cads/storagefurniture/45132' verts, faces, part_segs, _ = merge_meshes(obj_path, device) verts[:,1:] *= -1 # pytorch3d -> world coordinate obj_verts = verts.to(device) obj_faces = faces.to(device) obj_size = np.asarray([74.0, 77.5, 68.5]) # length, height, width (x, y, z), cm # fridge (home) np.asarray([600, 1450, 620]) # dishwasher (yang) obj_size = np.asarray([600, 800, 600]) # laptop (large) obj_size = np.asarray([415, 15, 280]) # fridge (small) obj_size = np.asarray([450, 825, 472]) # trashcan (outside) obj_size = np.asarray([650, 1050, 635]) # 677 x 1100 x 665 # load image img_path = 'storagefurniture/b008-0109/frames/images-0001.jpg' focal_x = 983#1505 #1680 focal_y = 983#1505 #1680 img_square = 1920 img_small = 256 # render _, phong_renderer = initialize_render(device, focal_x, focal_y, img_square, img_small) global x_offset, y_offset, z_offset, yaw, pitch, roll, rot_alpha, rot_beta, rot_gamma x_offset = 0.0 y_offset = 0.0 z_offset = 2.0 yaw = 0.0 pitch = 0.0 roll = 0.0 valstep = 0.01 # initialize model image_bg = np.array(Image.open(img_path))/255.0 img_h = image_bg.shape[0] img_w = image_bg.shape[1] model = JOHMRLite(obj_verts, obj_faces, phong_renderer, img_h, img_w) def display_img(model, alpha): image_bg = np.array(Image.open(img_path))/255.0 img_h = image_bg.shape[0] img_w = image_bg.shape[1] global x_offset, y_offset, z_offset, yaw, pitch, roll, rot_alpha, rot_beta, rot_gamma vis_image, rot_alpha, rot_beta, rot_gamma = model(obj_size, x_offset, y_offset, z_offset, yaw, pitch, roll) image = vis_image.detach().cpu().numpy().squeeze() #objmask = np.array(Image.open(mask_path))#/255.0 # object mask #objmask = np.repeat(objmask[:,:,np.newaxis], 3, axis=2) #objmask[:,:,0] *= 0 #objmask[:,:,1] *= 0 rgb_mask = image_bg.astype(np.float32) #cv2.addWeighted(objmask.astype(np.float32), 0.5, image_bg.astype(np.float32), 0.5, 0.0) frame_img = np.zeros((img_square, img_square,3)) start = int((max(img_h, img_w) - min(img_h, img_w))/2) - 1 end = start + min(img_h, img_w) if img_h > img_w: frame_img[:, start:end, :] = rgb_mask else: frame_img[start:end, :, :] = rgb_mask rgb_mask = frame_img alpha = min(1.0, max(0.0,alpha)) img_blend = cv2.addWeighted(image.astype(np.float32), alpha, rgb_mask.astype(np.float32), 1-alpha, 0.0) img_blend = cv2.resize(img_blend, dsize=(800, 800), interpolation=cv2.INTER_NEAREST) return img_blend img_blend = display_img(model, 0.5) h,w,_ = img_blend.shape img_blend = np.uint8(img_blend*255) qimage = QtGui.QImage(img_blend.data, h, w, 3*h, QtGui.QImage.Format_RGB888) class Annotate(QtWidgets.QWidget): def __init__(self): super(Annotate, self).__init__() self.initUI() def initUI(self): QtWidgets.QToolTip.setFont(QtGui.QFont('Test', 10)) # Show image self.pic = QtWidgets.QLabel(self) self.pic.setGeometry(10, 10, 800, 800) self.pic.setPixmap(QtGui.QPixmap(qimage)) self.alpha = 0.5 # Show button btn1 = QtWidgets.QPushButton('Offset Z-', self) btn1.resize(btn1.sizeHint()) btn1.clicked.connect(lambda: self.fun('dec_oz')) btn1.move(900, 10) btn2 = QtWidgets.QPushButton('Offset Z+', self) btn2.resize(btn2.sizeHint()) btn2.clicked.connect(lambda: self.fun('inc_oz')) btn2.move(1000, 10) self.textbox1 = QtWidgets.QLineEdit(self) self.textbox1.move(1150, 10) self.textbox1.resize(100,25) self.textbox1.setText(str(z_offset)) btn7 = QtWidgets.QPushButton('Offset X-', self) btn7.resize(btn7.sizeHint()) btn7.clicked.connect(lambda: self.fun('dec_ox')) btn7.move(900, 150) btn8 = QtWidgets.QPushButton('Offset X+', self) btn8.resize(btn8.sizeHint()) btn8.clicked.connect(lambda: self.fun('inc_ox')) btn8.move(1000, 150) self.textbox4 = QtWidgets.QLineEdit(self) self.textbox4.move(1150, 150) self.textbox4.resize(100,25) self.textbox4.setText(str(x_offset)) btn9 = QtWidgets.QPushButton('Offset Y-', self) btn9.resize(btn9.sizeHint()) btn9.clicked.connect(lambda: self.fun('dec_oy')) btn9.move(900, 190) btn10 = QtWidgets.QPushButton('Offset Y+', self) btn10.resize(btn10.sizeHint()) btn10.clicked.connect(lambda: self.fun('inc_oy')) btn10.move(1000, 190) self.textbox5 = QtWidgets.QLineEdit(self) self.textbox5.move(1150, 190) self.textbox5.resize(100,25) self.textbox5.setText(str(y_offset)) btn11 = QtWidgets.QPushButton('Yaw-', self) btn11.resize(btn11.sizeHint()) btn11.clicked.connect(lambda: self.fun('dec_yaw')) btn11.move(900, 250) btn12 = QtWidgets.QPushButton('Yaw+', self) btn12.resize(btn12.sizeHint()) btn12.clicked.connect(lambda: self.fun('inc_yaw')) btn12.move(1000, 250) self.textbox6 = QtWidgets.QLineEdit(self) self.textbox6.move(1150, 250) self.textbox6.resize(100,25) self.textbox6.setText(str(yaw)) btn13 = QtWidgets.QPushButton('Pitch-', self) btn13.resize(btn13.sizeHint()) btn13.clicked.connect(lambda: self.fun('dec_pitch')) btn13.move(900, 290) btn14 = QtWidgets.QPushButton('Pitch+', self) btn14.resize(btn14.sizeHint()) btn14.clicked.connect(lambda: self.fun('inc_pitch')) btn14.move(1000, 290) self.textbox7 = QtWidgets.QLineEdit(self) self.textbox7.move(1150, 290) self.textbox7.resize(100,25) self.textbox7.setText(str(pitch)) btn15 = QtWidgets.QPushButton('Roll-', self) btn15.resize(btn15.sizeHint()) btn15.clicked.connect(lambda: self.fun('dec_roll')) btn15.move(900, 330) btn16 = QtWidgets.QPushButton('Roll+', self) btn16.resize(btn16.sizeHint()) btn16.clicked.connect(lambda: self.fun('inc_roll')) btn16.move(1000, 330) self.textbox8 = QtWidgets.QLineEdit(self) self.textbox8.move(1150, 330) self.textbox8.resize(100,25) self.textbox8.setText(str(roll)) btn22 = QtWidgets.QPushButton('Vis-', self) btn22.resize(btn22.sizeHint()) btn22.clicked.connect(lambda: self.fun('dec_vis')) btn22.move(900, 550) btn23 = QtWidgets.QPushButton('Vis+', self) btn23.resize(btn23.sizeHint()) btn23.clicked.connect(lambda: self.fun('inc_vis')) btn23.move(1000, 550) btn21 = QtWidgets.QPushButton('Save', self) btn21.resize(btn21.sizeHint()) btn21.clicked.connect(lambda: self.fun('save')) btn21.move(1000, 500) self.setGeometry(300, 300, 2000, 1500) self.setWindowTitle('JOHMR Annotation Tool -- Sam Xu') self.show() # Connect button to image updating def fun(self, arguments): global x_offset, y_offset, z_offset, yaw, pitch, roll, rot_alpha, rot_beta, rot_gamma if arguments == 'dec_oz': z_offset -= valstep elif arguments == 'inc_oz': z_offset += valstep elif arguments == 'dec_ox': x_offset -= valstep elif arguments == 'inc_ox': x_offset += valstep elif arguments == 'dec_oy': y_offset -= valstep elif arguments == 'inc_oy': y_offset += valstep elif arguments == 'dec_yaw': yaw -= valstep elif arguments == 'inc_yaw': yaw += valstep elif arguments == 'dec_pitch': pitch -= valstep elif arguments == 'inc_pitch': pitch += valstep elif arguments == 'dec_roll': roll -= valstep elif arguments == 'inc_roll': roll += valstep elif arguments == 'save': # save obj orientation text_file = './3d_info.txt' with open(text_file, "w") as myfile: myfile.write('yaw: '+str(round(yaw,3))+'\n') myfile.write('pitch: '+str(round(pitch,3))+'\n') myfile.write('roll: '+str(round(roll,3))+'\n') myfile.write('rot_alpha: '+str(round(rot_alpha,3))+'\n') myfile.write('rot_beta: '+str(round(rot_beta,3))+'\n') myfile.write('rot_gamma: '+str(round(rot_gamma,3))+'\n') myfile.write('x_offset: '+str(round(x_offset,3))+'\n') myfile.write('y_offset: '+str(round(y_offset,3))+'\n') myfile.write('z_offset: '+str(round(z_offset,3))+'\n') myfile.write('obj_size: '+str(obj_size[0])+','+str(obj_size[1])+','+str(obj_size[2])+'\n') myfile.write('\n') # save human & obj meshes #save_hverts = model.smpl_verts_output.detach().cpu().numpy() #save_hfaces = hfaces.detach().cpu().numpy() save_objverts = model.obj_verts_output.detach().cpu().numpy() save_objfaces = obj_faces.detach().cpu().numpy() #verts = np.concatenate((save_hverts, save_objverts), axis=0) #faces = np.concatenate((save_hfaces, save_objfaces + save_hverts.shape[0]), axis=0) save_obj('./object.obj', torch.from_numpy(save_objverts), torch.from_numpy(save_objfaces)) #save_obj('annotate/person.obj', torch.from_numpy(save_hverts), torch.from_numpy(save_hfaces)) #save_obj('annotate/joint.obj', torch.from_numpy(verts), torch.from_numpy(faces)) elif arguments == 'dec_vis': self.alpha -= 0.1 elif arguments == 'inc_vis': self.alpha += 0.1 else: print('not implemented') self.textbox4.setText(str(round(x_offset,3))) self.textbox5.setText(str(round(y_offset,3))) self.textbox6.setText(str(round(yaw,3))) self.textbox7.setText(str(round(pitch,3))) self.textbox8.setText(str(round(roll,3))) self.textbox1.setText(str(round(z_offset,3))) img = display_img(model, self.alpha) img = np.uint8(img*255) h,w,_ = img.shape qimage = QtGui.QImage(img.data, h, w, 3*h, QtGui.QImage.Format_RGB888) self.pic.setPixmap(QtGui.QPixmap(qimage)) def main(): app = QtWidgets.QApplication(sys.argv) ex = Annotate() sys.exit(app.exec_()) if __name__ == '__main__': main()
d3d-hoi-main
visualization/annotation/qt.py
# Copyright (c) Facebook, Inc. and its affiliates. import torch.nn as nn import torch import pdb import numpy as np from pytorch3d.renderer import ( look_at_view_transform, TexturesVertex ) import math from pytorch3d.structures import Meshes import cv2 import matplotlib.pyplot as plt from utils import rotation_matrix from scipy.ndimage.filters import gaussian_filter1d from pytorch3d.io import save_obj from pytorch3d.transforms import ( RotateAxisAngle, matrix_to_euler_angles ) from pytorch3d.transforms.rotation_conversions import ( rotation_6d_to_matrix, matrix_to_rotation_6d ) from utils import ( flow_to_image, flow_confidence ) import time from matplotlib.image import imsave import os from torch.autograd import Variable from pytorch3d.transforms import ( euler_angles_to_matrix ) from utils import ( rotation_matrix ) class JOHMRLite(nn.Module): def __init__(self, obj_verts, obj_faces, vis_render, img_h, img_w): super().__init__() self.device = obj_verts.device self.vis_render = vis_render self.obj_verts = obj_verts.detach() self.obj_faces = obj_faces.detach() self.img_h = img_h self.img_w = img_w # camera is almost at the center (distance can't be zero for diff render) self.R, self.T = look_at_view_transform(0.1, 0.0, 0.0,device=self.device) self.T[0,2] = 0.0 # manually set to zero return def forward(self, obj_size, x_offset, y_offset, z_offset, yaw, pitch, roll): obj_verts = self.obj_verts.clone() # step 1: rescale object x_diff = torch.max(obj_verts[:,0]) - torch.min(obj_verts[:,0]) x_ratio = float(obj_size[0]) / x_diff y_diff = torch.max(obj_verts[:,1]) - torch.min(obj_verts[:,1]) y_ratio = float(obj_size[1]) / y_diff z_diff = torch.max(obj_verts[:,2]) - torch.min(obj_verts[:,2]) z_ratio = float(obj_size[2]) / z_diff obj_verts[:, 0] *= x_ratio obj_verts[:, 1] *= y_ratio obj_verts[:, 2] *= z_ratio # step 2: part motion #part_state = torch.tensor(90 * (math.pi/180)).cuda() #axis = torch.tensor([0, -0.9999999999999999, -0]).cuda().float() #rot_o = torch.tensor([0.37487859368179954*x_ratio, -0.859491*y_ratio, -0.24141621508844158*z_ratio]).cuda() #assert(part_state>=0) # non negative value #start = 380 #end = 380+198 #partrot_mat = rotation_matrix(axis, part_state).cuda() # part rotation matrix #obj_verts_part = obj_verts[start:end, :] - rot_o #obj_verts_part2 = torch.mm(partrot_mat, obj_verts_part.permute(1,0)).permute(1,0) #obj_verts[start:end, :] = obj_verts_part2 + rot_o # step 3: object orientation euler_angle = torch.tensor([pitch, yaw, roll]).reshape(1,3) objrot_mat = euler_angles_to_matrix(euler_angle, ["X","Y","Z"]).to(self.device) rot_alpha, rot_beta, rot_gamma = matrix_to_euler_angles(objrot_mat, ["X","Y","Z"])[0] rot_alpha = float(rot_alpha) rot_beta = float(rot_beta) rot_gamma = float(rot_gamma) objrot_mat = objrot_mat[0] obj_verts = torch.mm(objrot_mat, obj_verts.permute(1,0)).permute(1,0) # step 4: object offset obj_verts[:, 0] += 100.0*x_offset obj_verts[:, 1] += 100.0*y_offset obj_verts[:, 2] += 100.0*z_offset self.obj_verts_output = obj_verts.clone() obj_verts[:,1:] *= -1 # create object mesh for diff render and visualization tex = torch.ones_like(obj_verts).unsqueeze(0) textures = TexturesVertex(verts_features=tex).to(self.device) self.obj_mesh = Meshes(verts=[obj_verts],faces=[self.obj_faces],textures=textures) vis_image = self.vis_render(meshes_world=self.obj_mesh, R=self.R, T=self.T) return vis_image[...,:3], rot_alpha, rot_beta, rot_gamma
d3d-hoi-main
visualization/annotation/model.py
# Copyright (c) Facebook, Inc. and its affiliates. import numpy as np import torch import natsort import glob import open3d as o3d # rendering components from pytorch3d.renderer import ( FoVPerspectiveCameras,RasterizationSettings, MeshRenderer, MeshRasterizer, BlendParams, SoftSilhouetteShader, HardPhongShader, PointLights, DirectionalLights, PerspectiveCameras ) from pytorch3d.io import save_obj import math import cv2 import matplotlib.pyplot as plt import os import imageio from decimal import Decimal import pdb import json import matplotlib.pyplot as plt from mpl_toolkits import mplot3d from mpl_toolkits.mplot3d import axes3d from scipy.ndimage.filters import gaussian_filter1d from numpy.linalg import svd from multiprocessing import Pool, Manager, cpu_count from pytorch3d.transforms import Rotate, Translate from matplotlib.image import imsave from pathlib import Path def planeFit(points): """ p, n = planeFit(points) Given an array, points, of shape (d,...) representing points in d-dimensional space, fit an d-dimensional plane to the points. Return a point, p, on the plane (the point-cloud centroid), and the normal, n. """ points = np.reshape(points, (np.shape(points)[0], -1)) # Collapse trialing dimensions assert points.shape[0] <= points.shape[1], "There are only {} points in {} dimensions.".format(points.shape[1], points.shape[0]) ctr = points.mean(axis=1) x = points - ctr[:,np.newaxis] M = np.dot(x, x.T) # Could also use np.cov(x) here. return ctr, svd(M)[0][:,-1] def initialize_render(device, focal_x, focal_y, img_square_size, img_small_size): """ initialize camera, rasterizer, and shader. """ # Initialize an OpenGL perspective camera. #cameras = FoVPerspectiveCameras(znear=1.0, zfar=9000.0, fov=20, device=device) #cameras = FoVPerspectiveCameras(device=device) #cam_proj_mat = cameras.get_projection_transform() img_square_center = int(img_square_size/2) shrink_ratio = int(img_square_size/img_small_size) focal_x_small = int(focal_x/shrink_ratio) focal_y_small = int(focal_y/shrink_ratio) img_small_center = int(img_small_size/2) camera_sfm = PerspectiveCameras( focal_length=((focal_x, focal_y),), principal_point=((img_square_center, img_square_center),), image_size = ((img_square_size, img_square_size),), device=device) camera_sfm_small = PerspectiveCameras( focal_length=((focal_x_small, focal_y_small),), principal_point=((img_small_center, img_small_center),), image_size = ((img_small_size, img_small_size),), device=device) # To blend the 100 faces we set a few parameters which control the opacity and the sharpness of # edges. Refer to blending.py for more details. blend_params = BlendParams(sigma=1e-4, gamma=1e-4) # Define the settings for rasterization and shading. Here we set the output image to be of size # 256x256. To form the blended image we use 100 faces for each pixel. We also set bin_size and max_faces_per_bin to None which ensure that # the faster coarse-to-fine rasterization method is used. Refer to rasterize_meshes.py for # explanations of these parameters. Refer to docs/notes/renderer.md for an explanation of # the difference between naive and coarse-to-fine rasterization. raster_settings = RasterizationSettings( image_size=img_small_size, blur_radius=np.log(1. / 1e-4 - 1.) * blend_params.sigma, faces_per_pixel=100, ) # Create a silhouette mesh renderer by composing a rasterizer and a shader. silhouette_renderer = MeshRenderer( rasterizer=MeshRasterizer( cameras=camera_sfm_small, raster_settings=raster_settings ), shader=SoftSilhouetteShader(blend_params=blend_params) ) # We will also create a phong renderer. This is simpler and only needs to render one face per pixel. raster_settings = RasterizationSettings( image_size=img_square_size, blur_radius=0.0, faces_per_pixel=1, ) # We can add a point light in front of the object. lights = PointLights(device=device, location=((2.0, 2.0, -2.0),)) #lights = DirectionalLights(device=device, direction=((0, 0, 1),)) phong_renderer = MeshRenderer( rasterizer=MeshRasterizer( cameras=camera_sfm, raster_settings=raster_settings ), shader=HardPhongShader(device=device, cameras=camera_sfm, lights=lights) ) return silhouette_renderer, phong_renderer def merge_meshes(obj_path, device): """ helper function for loading and merging meshes. """ verts_list = torch.empty(0,3) faces_list = torch.empty(0,3).long() num_vtx = [0] num_faces = [0] # merge meshes, load in ascending order meshes = natsort.natsorted(glob.glob(obj_path+'/final/*_rescaled_sapien.obj')) for part_mesh in meshes: #print('loading %s' %part_mesh) mesh = o3d.io.read_triangle_mesh(part_mesh) verts = torch.from_numpy(np.asarray(mesh.vertices)).float() faces = torch.from_numpy(np.asarray(mesh.triangles)).long() faces = faces + verts_list.shape[0] verts_list = torch.cat([verts_list, verts]) faces_list = torch.cat([faces_list, faces]) num_vtx.append(verts_list.shape[0]) num_faces.append(faces_list.shape[0]) verts_list = verts_list.to(device) faces_list = faces_list.to(device) return verts_list, faces_list, num_vtx, num_faces def load_motion(motions, device): """ load rotation axis, origin, and limit. """ rot_origin = [] rot_axis = [] rot_type = [] limit_a = [] limit_b = [] contact_list = [] # load all meta data for idx, key in enumerate(motions.keys()): jointData = motions[key] # if contains movable parts if jointData is not None: origin = torch.FloatTensor(jointData['axis']['origin']).to(device) axis = torch.FloatTensor(jointData['axis']['direction']).to(device) mobility_type = jointData['type'] if 'contact' in jointData: contact_list.append(jointData['contact']) # convert to radians if necessary if mobility_type == 'revolute': mobility_a = math.pi*jointData['limit']['a'] / 180.0 mobility_b = math.pi*jointData['limit']['b'] / 180.0 else: assert mobility_type == 'prismatic' mobility_a = jointData['limit']['a'] mobility_b = jointData['limit']['b'] rot_origin.append(origin) rot_axis.append(axis) rot_type.append(mobility_type) limit_a.append(mobility_a) limit_b.append(mobility_b) return rot_origin, rot_axis, rot_type, limit_a, limit_b, contact_list def visualize(mask, image, alpha): #mask = np.repeat(mask[:,:,np.newaxis], 3, axis=2) mask_img_blend = cv2.addWeighted(mask, alpha, image.astype(np.float32), 1.0-alpha, 0) mask_img_blend = mask_img_blend*mask + image*(1-mask) return mask_img_blend def visualize_curve(data, output, save_folder, title): mask_model = output['obj_mask'] spin_points = output['spin_points'] # plot curve obj_curve = output['obj_curve'] spin_curve = output['spin_curve'] x_offset = spin_curve[0,0] - obj_curve[0,0] y_offset = spin_curve[0,1] - obj_curve[0,1] z_offset = spin_curve[0,2] - obj_curve[0,2] obj_curve[:,0] += x_offset obj_curve[:,1] += y_offset obj_curve[:,2] += z_offset fig = plt.figure() ax = plt.axes(projection='3d') #obj_curves = obj_curve_norm ax.scatter(spin_curve[0,0], spin_curve[0,1], spin_curve[0,2], color='red') ax.scatter(obj_curve[0,0], obj_curve[0,1], obj_curve[0,2], color='red') ax.plot(obj_curve[:,0], obj_curve[:,1], obj_curve[:,2], label='object curve') ax.plot(spin_curve[:,0], spin_curve[:,1], spin_curve[:,2], label='hand curve') ax.legend() ax.set_xlabel("X") ax.set_ylabel("Y") ax.set_zlabel("Z") plt.show() def save_mesh(id): global obj_verts_dict global obj_faces_dict global human_verts_dict global human_faces_dict global save_path_mesh verts1 = obj_verts_dict[str(id+1)] verts2 = human_verts_dict[str(id+1)] faces1 = obj_faces_dict[str(id+1)] faces2 = human_faces_dict[str(id+1)] verts = np.concatenate((verts1, verts2), axis=0) faces = np.concatenate((faces1, faces2 + verts1.shape[0]), axis=0) path = os.path.join(save_path_mesh, str(id+1)+'_object.obj') save_obj(path, torch.from_numpy(verts1), torch.from_numpy(faces1)) path = os.path.join(save_path_mesh, str(id+1)+'_person.obj') save_obj(path, torch.from_numpy(verts2), torch.from_numpy(faces2)) path = os.path.join(save_path_mesh, str(id+1)+'_joint.obj') save_obj(path, torch.from_numpy(verts), torch.from_numpy(faces)) def save_meshes(meshes, save_folder, video_name, title): global obj_verts_dict global obj_faces_dict global human_verts_dict global human_faces_dict global save_path_mesh save_path_mesh = os.path.join(save_folder, title) if not os.path.exists(save_path_mesh): os.makedirs(save_path_mesh) obj_meshes = meshes['obj_mesh'] spin_meshes = meshes['spin_mesh'] # merge object + SPIN meshes obj_verts = {} obj_faces = {} human_verts = {} human_faces = {} for idx in range(len(obj_meshes)): obj_verts[str(idx+1)] = obj_meshes[idx].verts_list()[0].detach().cpu().numpy() obj_faces[str(idx+1)] = obj_meshes[idx].faces_list()[0].detach().cpu().numpy() human_verts[str(idx+1)] = spin_meshes[idx].verts_list()[0].detach().cpu().numpy() human_faces[str(idx+1)] = spin_meshes[idx].faces_list()[0].detach().cpu().numpy() manager = Manager() obj_verts_dict = manager.dict(obj_verts) obj_faces_dict = manager.dict(obj_faces) human_verts_dict = manager.dict(human_verts) human_faces_dict = manager.dict(human_faces) ids = [item for item in range(len(obj_meshes))] pool = Pool(processes=12) pool.map(save_mesh, ids) ''' eft_cmd = 'python -m demo.demo_bodymocap --render wire --bg rgb --videoname '+video_name+' --vPath '+save_folder os.chdir('/home/xuxiangx/research/eft') os.system(eft_cmd) save_path = os.path.join(save_folder, 'eft', 'front') ffmpeg_cmd = 'ffmpeg -r 3 -i '+save_path+'/scene_%08d.jpg '+save_folder+'/frontview.mp4' os.system(ffmpeg_cmd) save_path = os.path.join(save_folder, 'eft', 'side') ffmpeg_cmd = 'ffmpeg -r 3 -i '+save_path+'/scene_%08d.jpg '+save_folder+'/sideview.mp4' os.system(ffmpeg_cmd) ''' return def save_parameters(model, save_folder, title): save_path = os.path.join(save_folder, title) if not os.path.exists(save_path): os.makedirs(save_path) obj_offset = 1000.0*model.obj_offset.detach().cpu().numpy() #(3,) smpl_offset = 1000.0*model.smpl_offset.detach().cpu().numpy() #(bs,3) obj_scale = 3000.0*model.obj_scale smpl_scale = 3000.0 focal_len = model.focal part_rot_angle = model.part_rot_params.detach().cpu().numpy() #(bs,) obj_rot_mat = model.obj_rot_angle_mat[0].detach().cpu().numpy() #(3,3) part_rot_mat = model.part_rot_mat.detach().cpu().numpy() #(bs,3,3) K_mat = model.K.detach().cpu().numpy() #(3,3) rot_o = model.rot_o.detach().cpu().numpy() #(3,) rot_axis = model.axis.detach().cpu().numpy() #(3,) parameters = {} parameters['obj_offset'] = obj_offset parameters['smpl_offset'] = smpl_offset parameters['obj_scale'] = obj_scale parameters['smpl_scale'] = smpl_scale parameters['focal_length'] = focal_len parameters['part_rot_angle'] = part_rot_angle parameters['obj_rot_matrix'] = obj_rot_mat parameters['part_rot_matrix'] = part_rot_mat parameters['K_matrix'] = K_mat parameters['rot_origin'] = rot_o parameters['rot_axis'] = rot_axis np.save(os.path.join(save_path, 'parameters.npy'), parameters) return def save_img(idx): global shared_dict1 global shared_dict2 global save_path roi_image = shared_dict1['image'].permute(0,2,3,1)[idx].numpy() silhouette = shared_dict1['objmask'].permute(0,2,3,1)[idx] mask_model = shared_dict2['obj_mask'] gt_points = shared_dict1['smplv2d'] spin_points = shared_dict2['spin_points'] silhouette_init = mask_model.detach().cpu().squeeze()[idx].numpy() mask_img_blend = visualize(silhouette_init, roi_image, 0.8) # save image #plt.subplots_adjust(hspace = 0.2, left=0.01, right=0.99, top=0.95, bottom=0.05) imsave(os.path.join(save_path, str(idx)+'.png'), mask_img_blend) return def save_imgs(data, output, save_folder): global shared_dict1 global shared_dict2 global save_path save_path = save_folder manager = Manager() shared_dict1 = manager.dict(data) shared_dict1 = data shared_dict2 = manager.dict(output) shared_dict2 = output ids = [item for item in range(data['image'].shape[0])] pool = Pool(processes=12) pool.map(save_img, ids) #sceneflow = shared_dict2['sceneflow'] #objSurfaceFlow = shared_dict2['objSurfaceFlow'] #synFlow = shared_dict2['synFlow'] #sceneflowMaskSquareShrink = shared_dict2['sceneflowMaskSquareShrink'] #part_diff_images = shared_dict2['part_diff_images'] # save object part suface raft flow visualization #save_path = os.path.join(save_folder, title, 'objSurfaceFlow') #if not os.path.exists(save_path): #os.makedirs(save_path) #for idx in range(objSurfaceFlow.shape[0]): #imsave(os.path.join(save_path, str(idx)+'.png'), objSurfaceFlow[idx]) #ffmpeg_cmd = 'ffmpeg -r 3 -i '+save_path+'/%d.png '+save_folder+'/objSurfaceFlow.mp4' #os.system(ffmpeg_cmd) # save synthetic rendering flow visualization #save_path = os.path.join(save_folder, title, 'synFlow') #if not os.path.exists(save_path): #os.makedirs(save_path) #for idx in range(synFlow.shape[0]): #imsave(os.path.join(save_path, str(idx)+'.png'), synFlow[idx]) #ffmpeg_cmd = 'ffmpeg -r 3 -i '+save_path+'/%d.png '+save_folder+'/synFlow.mp4' #os.system(ffmpeg_cmd) # save visualize images #for idx in range(data['image'].shape[0]): #save_img(idx, shared_dict1, shared_dict2) #save_path = os.path.join(save_folder, title, 'render') #ffmpeg_cmd = 'ffmpeg -r 3 -i '+save_path+'/%d.png '+save_folder+'/render.mp4' #os.system(ffmpeg_cmd) #vid1 = os.path.join(save_folder, 'objSurfaceFlow.mp4') #vid2 = os.path.join(save_folder, 'synFlow.mp4') #vid3 = os.path.join(save_folder, 'visual.mp4') #ffmpeg_cmd = 'ffmpeg -i '+vid1+' -i '+vid2+' -filter_complex hstack=inputs=2 '+vid3 #os.system(ffmpeg_cmd) return def rotation_matrix(axis, theta): """ Return the rotation matrix associated with counterclockwise rotation about the given axis by theta radians. """ axis = axis / torch.sqrt(torch.dot(axis, axis)) a = torch.cos(theta / 2.0) b, c, d = -axis * torch.sin(theta / 2.0) aa, bb, cc, dd = a * a, b * b, c * c, d * d bc, ad, ac, ab, bd, cd = b * c, a * d, a * c, a * b, b * d, c * d rot_mat = torch.empty(3,3) rot_mat[0,0] = aa + bb - cc - dd rot_mat[0,1] = 2 * (bc + ad) rot_mat[0,2] = 2 * (bd - ac) rot_mat[1,0] = 2 * (bc - ad) rot_mat[1,1] = aa + cc - bb - dd rot_mat[1,2] = 2 * (cd + ab) rot_mat[2,0] = 2 * (bd + ac) rot_mat[2,1] = 2 * (cd - ab) rot_mat[2,2] = aa + dd - bb - cc return rot_mat def rotation_matrix_batch(axis, theta): """ Return the rotation matrix associated with counterclockwise rotation about the given axis by theta radians. """ axis = axis / torch.sqrt(torch.dot(axis, axis)) a = torch.cos(theta / 2.0) b = -axis[0] * torch.sin(theta / 2.0) c = -axis[1] * torch.sin(theta / 2.0) d = -axis[2] * torch.sin(theta / 2.0) aa, bb, cc, dd = a * a, b * b, c * c, d * d bc, ad, ac, ab, bd, cd = b * c, a * d, a * c, a * b, b * d, c * d rot_mat = torch.empty(aa.shape[0],3,3) rot_mat[:,0,0] = aa + bb - cc - dd rot_mat[:,0,1] = 2 * (bc + ad) rot_mat[:,0,2] = 2 * (bd - ac) rot_mat[:,1,0] = 2 * (bc - ad) rot_mat[:,1,1] = aa + cc - bb - dd rot_mat[:,1,2] = 2 * (cd + ab) rot_mat[:,2,0] = 2 * (bd + ac) rot_mat[:,2,1] = 2 * (cd - ab) rot_mat[:,2,2] = aa + dd - bb - cc return rot_mat def flow_confidence(threshold, forwardFlow, backwardFlow, img_w, img_h): # I_t -> I_(t+1), wrap with forward flow It1 = forwardFlow.clone() It1[:,:,0] += torch.arange(img_w) It1[:,:,1] += torch.arange(img_h).unsqueeze(1) # (u, v) coordinate It1 = torch.round(It1) withinFrameMask = (It1[:,:,0] < img_w) * (It1[:,:,0] > 0) *\ (It1[:,:,1] < img_h) * (It1[:,:,1] > 0) pdb.set_trace() withinFrameCoord = torch.nonzero(withinFrameMask==1) # (x, y) coordinate of within frame flow nextCoord = It1[withinFrameCoord[:, 0], withinFrameCoord[:,1]].astype(int) # u, v order # I_(t+1) -> I_t, wrap back with backward flow nextCoordBackwardFlow = backwardFlow[nextCoord[:,1], nextCoord[:,0],:] nextbackCoord = nextCoord + nextCoordBackwardFlow # u, v coord nextbackCoord[:,[1,0]] = nextbackCoord[:,[0,1]] # swap to x,y coord # filter out noisy flow stableFlowMask = np.sum(np.abs(nextbackCoord - withinFrameCoord), 1) < threshold stableFlowCoord = withinFrameCoord[stableFlowMask] # (x,y) coord return stableFlowCoord def make_colorwheel(): """ Generates a color wheel for optical flow visualization as presented in: Baker et al. "A Database and Evaluation Methodology for Optical Flow" (ICCV, 2007) URL: http://vision.middlebury.edu/flow/flowEval-iccv07.pdf Code follows the original C++ source code of Daniel Scharstein. Code follows the the Matlab source code of Deqing Sun. Returns: np.ndarray: Color wheel """ RY = 15 YG = 6 GC = 4 CB = 11 BM = 13 MR = 6 ncols = RY + YG + GC + CB + BM + MR colorwheel = np.zeros((ncols, 3)) col = 0 # RY colorwheel[0:RY, 0] = 255 colorwheel[0:RY, 1] = np.floor(255*np.arange(0,RY)/RY) col = col+RY # YG colorwheel[col:col+YG, 0] = 255 - np.floor(255*np.arange(0,YG)/YG) colorwheel[col:col+YG, 1] = 255 col = col+YG # GC colorwheel[col:col+GC, 1] = 255 colorwheel[col:col+GC, 2] = np.floor(255*np.arange(0,GC)/GC) col = col+GC # CB colorwheel[col:col+CB, 1] = 255 - np.floor(255*np.arange(CB)/CB) colorwheel[col:col+CB, 2] = 255 col = col+CB # BM colorwheel[col:col+BM, 2] = 255 colorwheel[col:col+BM, 0] = np.floor(255*np.arange(0,BM)/BM) col = col+BM # MR colorwheel[col:col+MR, 2] = 255 - np.floor(255*np.arange(MR)/MR) colorwheel[col:col+MR, 0] = 255 return colorwheel def flow_uv_to_colors(u, v, convert_to_bgr=False): """ Applies the flow color wheel to (possibly clipped) flow components u and v. According to the C++ source code of Daniel Scharstein According to the Matlab source code of Deqing Sun Args: u (np.ndarray): Input horizontal flow of shape [H,W] v (np.ndarray): Input vertical flow of shape [H,W] convert_to_bgr (bool, optional): Convert output image to BGR. Defaults to False. Returns: np.ndarray: Flow visualization image of shape [H,W,3] """ flow_image = np.zeros((u.shape[0], u.shape[1], 3), np.uint8) colorwheel = make_colorwheel() # shape [55x3] ncols = colorwheel.shape[0] rad = np.sqrt(np.square(u) + np.square(v)) a = np.arctan2(-v, -u)/np.pi fk = (a+1) / 2*(ncols-1) k0 = np.floor(fk).astype(np.int32) k1 = k0 + 1 k1[k1 == ncols] = 0 f = fk - k0 for i in range(colorwheel.shape[1]): tmp = colorwheel[:,i] col0 = tmp[k0] / 255.0 col1 = tmp[k1] / 255.0 col = (1-f)*col0 + f*col1 idx = (rad <= 1) col[idx] = 1 - rad[idx] * (1-col[idx]) col[~idx] = col[~idx] * 0.75 # out of range # Note the 2-i => BGR instead of RGB ch_idx = 2-i if convert_to_bgr else i flow_image[:,:,ch_idx] = np.floor(255 * col) return flow_image def flow_to_image(flow_uv, clip_flow=None, convert_to_bgr=False): """ Expects a two dimensional flow image of shape. Args: flow_uv (np.ndarray): Flow UV image of shape [H,W,2] clip_flow (float, optional): Clip maximum of flow values. Defaults to None. convert_to_bgr (bool, optional): Convert output image to BGR. Defaults to False. Returns: np.ndarray: Flow visualization image of shape [H,W,3] """ assert flow_uv.ndim == 3, 'input flow must have three dimensions' assert flow_uv.shape[2] == 2, 'input flow must have shape [H,W,2]' if clip_flow is not None: flow_uv = np.clip(flow_uv, 0, clip_flow) u = flow_uv[:,:,0] v = flow_uv[:,:,1] rad = np.sqrt(np.square(u) + np.square(v)) rad_max = 40.0#, epsilon = 1e-5 u = u / (rad_max + epsilon) v = v / (rad_max + epsilon) return flow_uv_to_colors(u, v, convert_to_bgr)
d3d-hoi-main
visualization/annotation/utils.py
# Copyright (c) Facebook, Inc. and its affiliates. import torch import os from model import JOHMRModel from utils import ( initialize_render, merge_meshes, load_motion, save_meshes, save_parameters ) import json import tqdm from matplotlib.image import imsave import matplotlib.pyplot as plt import cv2 import re import numpy as np from PIL import Image import glob from dataloader import MyOwnDataset import torch.nn as nn import torch.optim as optim import argparse import itertools def isfloat(x): try: a = float(x) except (TypeError, ValueError): return False else: return True def isint(x): try: a = float(x) b = int(a) except (TypeError, ValueError): return False else: return a == b ################# # training code # ################# def run_exp(inputvideo): # Initialize gpu device assert torch.cuda.is_available() device = torch.device("cuda:"+str(args.device)) global available_category vidpath = inputvideo[1] video_name = inputvideo[0] if(video_name[:4]=='b001'): video_category = 'dishwasher' elif(video_name[:4]=='b003'): video_category = 'laptop' elif(video_name[:4]=='b004'): video_category = 'microwave' elif(video_name[:4]=='b005'): video_category = 'refrigerator' elif(video_name[:4]=='b006'): video_category = 'trashcan' elif(video_name[:4]=='b007'): video_category = 'washingmachine' elif(video_name[:4]=='b008'): video_category = 'storage_revolute' elif(video_name[:4]=='b108'): video_category = 'storage_prismatic' elif(video_name[:4]=='b009'): video_category = 'oven' else: print('not available category...') print('processing '+video_name+' for category '+video_category) # load gt annotation, find the correct object size, cad model, part id, and focal len with open(os.path.join(vidpath, '3d_info.txt')) as myfile: gt_data = [next(myfile).strip('\n') for x in range(14)] # Initialize object scale (x, y, z) obj_sizeX = float(re.findall(r"[-+]?\d*\.\d+|\d+", gt_data[9])[0]) obj_sizeY = float(re.findall(r"[-+]?\d*\.\d+|\d+", gt_data[9])[1]) obj_sizeZ = float(re.findall(r"[-+]?\d*\.\d+|\d+", gt_data[9])[2]) obj_dimension = [obj_sizeX, obj_sizeY, obj_sizeZ] # in cm # initialize object cad model and part id if args.use_gt_objmodel: if args.use_gt_objpart: cad_object = os.path.join(args.cadpath, video_category, re.findall(r"[-+]?\d*\.\d+|\d+", gt_data[10])[0]) cad_part = int(re.findall(r"[-+]?\d*\.\d+|\d+", gt_data[11])[0]) cad_models = [(cad_object, cad_part)] else: cad_models = [] cad_object = os.path.join(args.cadpath, video_category, re.findall(r"[-+]?\d*\.\d+|\d+", gt_data[10])[0]) with open(os.path.join(cad_object, 'motion.json')) as json_file: cad_parts = len(json.load(json_file)) for cad_part in range(cad_parts): cad_models.append((cad_object,cad_part)) else: # iter through all cad models in that category cad_models = [] cad_objects = [f.path for f in os.scandir(os.path.join(args.cadpath, video_category))] for cad_object in cad_objects: with open(os.path.join(cad_object, 'motion.json')) as json_file: cad_parts = len(json.load(json_file)) for cad_part in range(cad_parts): cad_models.append((cad_object,cad_part)) # initialize focal len focal_len = float(re.findall(r"[-+]?\d*\.\d+|\d+", gt_data[12])[0]) assert(focal_len == float(re.findall(r"[-+]?\d*\.\d+|\d+", gt_data[13])[0])) # in pixel (for 1280x720 only) # initalize data loader (use all frames at once) dataset = MyOwnDataset(inputvideo[1]) img_square, img_small = dataset.correct_image_size(200,300) if img_small <= 0: print('can not find small image size') return False trainloader = torch.utils.data.DataLoader(dataset, batch_size=len(dataset), pin_memory=True, shuffle=False, num_workers=4) # initialize render silhouette_renderer, phong_renderer = initialize_render(device, focal_len, focal_len, img_square, img_small) # load all data per video for idx, data in enumerate(trainloader): imgs = data['image'].permute(0,2,3,1).to(device) batch_size = imgs.shape[0] img_h = imgs.shape[1] img_w = imgs.shape[2] points = data['smplv2d'].to(device).float() smpl_verts = data['ver'].to(device).float() smpl_faces = data['f'].to(device).float() joints = data['joint3d'].to(device).float() normal = data['normal'].to(device).float() normal2 = data['normal2'].to(device).float() objmask = data['objmask'].permute(0,2,3,1).to(device).float() print('data loaded...') # load gt part motion gt_partmotion = [] fp = open(os.path.join(vidpath, 'jointstate.txt')) for i, line in enumerate(fp): line = line.strip('\n') if isfloat(line) or isint(line): gt_partmotion.append(float(line)) gt_partmotion = np.asarray(gt_partmotion) # Infer HOI snippet from GT part motions diff = gt_partmotion[:-1] - gt_partmotion[1:] # (i - i+1) if video_category == 'storage_prismatic': large_diff = np.where(abs(diff)>0.5)[0] else: large_diff = np.where(abs(diff)>2)[0] care_idx = np.union1d(large_diff, large_diff+1) care_idx = np.clip(care_idx, 0, len(gt_partmotion)-1) # compute object mask center obj_x_center = 0 obj_y_center = 0 count = 1e-5 for mask in objmask: if torch.sum(mask) > 0: count += 1 small_img = mask.squeeze().detach().cpu().numpy() large_img = cv2.resize(small_img, dsize=(img_square, img_square), interpolation=cv2.INTER_NEAREST) x, y, w, h = cv2.boundingRect(np.uint8(large_img)) obj_x_center += int(x+0.5*w) obj_y_center += int(y+0.5*h) obj_x_center /= count obj_y_center /= count ############################################### # optimize different cad model configurations # ############################################### final_losses = [] folders = [] for (obj_path, part_idx) in cad_models: cad_name = re.findall(r'\d+', obj_path)[-1] # load object mesh verts, faces, vertexSegs, faceSegs = merge_meshes(obj_path) verts[:,1:] *= -1 # pytorch3d -> world coordinate if args.use_gt_objscale: # compute object rescale value if using gt dimension (cm) x_diff = torch.max(verts[:,0]) - torch.min(verts[:,0]) x_ratio = obj_dimension[0] / x_diff y_diff = torch.max(verts[:,1]) - torch.min(verts[:,1]) y_ratio = obj_dimension[1] / y_diff z_diff = torch.max(verts[:,2]) - torch.min(verts[:,2]) z_ratio = obj_dimension[2] / z_diff else: if video_category == 'laptop': initial_dim = 5.0 elif cad_name == '10797': initial_dim = 20.0 # small fridge elif video_category == 'refrigerator': initial_dim = 100.0 # large fridge else: initial_dim = 50.0 x_diff = torch.max(verts[:,0]) - torch.min(verts[:,0]) x_ratio = x_diff * initial_dim y_diff = torch.max(verts[:,1]) - torch.min(verts[:,1]) y_ratio = y_diff * initial_dim z_diff = torch.max(verts[:,2]) - torch.min(verts[:,2]) z_ratio = z_diff * initial_dim obj_verts = verts.to(device) obj_faces = faces.to(device) # load motion json file with open(os.path.join(obj_path, 'motion.json')) as json_file: motions = json.load(json_file) assert len(motions) + 2 == len(vertexSegs) rot_origin, rot_axis, rot_type, limit_a, limit_b, contact_list = load_motion(motions, device) # Hand, object contact vertex id handcontact = [2005, 5466] # left, right hand from SMPL objcontact = contact_list[part_idx] # Optimize for all possible settings for handcontact_v in handcontact: for objcontact_v in objcontact: meta_info = str(part_idx)+'_'+str(objcontact_v)+'_'+str(handcontact_v) # initalize model model = JOHMRModel(imgs.detach(), obj_verts.detach(), obj_faces.detach(), smpl_verts.detach(), smpl_faces.detach(), points.detach(), silhouette_renderer, phong_renderer, normal.detach(), normal2.detach(), objmask.detach(), rot_origin, rot_axis, rot_type, vertexSegs, faceSegs, limit_a, limit_b, img_small ,focal_len, joints.detach()) # initialize optimizer optimizer = optim.Adam(model.parameters(), lr=0.05) # 0.05 scheduler = optim.lr_scheduler.StepLR(optimizer, step_size=int(0.75*args.iter), gamma=0.1) # Start optimizing for iteration in range(args.iter): loss, loss_meta = model(iteration, args, cad_name, care_idx, part_idx, handcontact_v, objcontact_v, obj_x_center, obj_y_center, x_ratio, y_ratio, z_ratio) if loss_meta is not None: print('Iteration %d lr %.4f, total loss %.4f, smpl %.4f, mask %.4f, hfacing %.4f, depth %.4f, gamma %.4f, alpha %.4f, size %.3f, contact %.4f' % (iteration, optimizer.param_groups[0]['lr'], loss.data, loss_meta['l_points'], loss_meta['l_mask'], loss_meta['l_direction'], loss_meta['l_depth'],loss_meta['l_gamma'],loss_meta['l_alpha'], loss_meta['l_prior'],loss_meta['l_contact'])) optimizer.zero_grad() loss.backward() optimizer.step() scheduler.step() # save results param_path = os.path.join(args.exp_name, 'params', video_name,cad_name, meta_info) save_parameters(model, param_path) final_losses.append(loss_meta['final_loss']) folders.append(param_path) # Only keep best result best_run = final_losses.index(min(final_losses)) folders.remove(folders[best_run]) for folder in folders: os.system('rm -r '+folder) if __name__ == "__main__": global available_category parser = argparse.ArgumentParser() parser.add_argument('--iter', type=int) parser.add_argument('--use_gt_objscale', action='store_true') parser.add_argument('--use_gt_objmodel', action='store_true') parser.add_argument('--use_gt_objpart', action='store_true') parser.add_argument('--objmask', type=float) parser.add_argument('--hfacing', type=float) parser.add_argument('--depth', type=float) parser.add_argument('--gamma', type=float) parser.add_argument('--alpha', type=float) parser.add_argument('--range', type=float) parser.add_argument('--smpl', type=float) parser.add_argument('--contact', type=float) parser.add_argument('--size', type=float) parser.add_argument('--center', type=float) parser.add_argument('--smooth', type=float) parser.add_argument('--scale', type=float) parser.add_argument('--category', type=str, help="which category to run") parser.add_argument('--exp_name', type=str, help="experiment main folder") parser.add_argument('--datapath', type=str, help="experiment data folder") parser.add_argument('--cadpath', type=str, help="experiment data folder") parser.add_argument("--device", type=int, help="CUDA Device Index") args = parser.parse_args() available_category = ['dishwasher', 'laptop', 'microwave', 'refrigerator', 'trashcan', 'washingmachine', 'oven', 'storage_revolute', 'storage_prismatic'] if args.category not in available_category and args.category!='all': print('please choose a vaild category') # create main exp folder args.exp_path = os.path.join(os.getcwd(), args.exp_name) if not os.path.exists(args.exp_path): os.makedirs(args.exp_path) videopath = [] # run on single object category if args.category != 'all': videopath = sorted([(f.name,f.path) for f in os.scandir(os.path.join(args.datapath, args.category))]) # run on all object categories else: videopath = [] for obj_class in available_category: videopath.append(sorted([(f.name, f.path) for f in os.scandir(os.path.join(args.datapath, obj_class))])) videopath = sorted(list(itertools.chain.from_iterable(videopath))) print('total of '+str(len(videopath))+' experiments...') # run locally for i in range(len(videopath)): run_exp(videopath[i])
d3d-hoi-main
optimization/optimize.py
# Copyright (c) Facebook, Inc. and its affiliates. import torch.nn as nn import torch import numpy as np from pytorch3d.renderer import ( look_at_view_transform, TexturesVertex ) import math from pytorch3d.structures import Meshes import cv2 import matplotlib.pyplot as plt from utils import rotation_matrix_batch from scipy.ndimage.filters import gaussian_filter1d from pytorch3d.io import save_obj from pytorch3d.transforms import ( RotateAxisAngle, matrix_to_euler_angles, euler_angles_to_matrix ) from pytorch3d.transforms.rotation_conversions import ( rotation_6d_to_matrix, matrix_to_rotation_6d ) import time from matplotlib.image import imsave import os from torch.autograd import Variable import open3d as o3d class JOHMRModel(nn.Module): """ Differentiable render for fitting CAD model based on silhouette and human. """ def __init__(self, imgs, obj_verts, obj_faces, smpl_verts, smpl_faces, points, diff_render, vis_render, normal, normal2, objmask, rot_o, axis, rot_type, vertexSegs, faceSegs, limit_a, limit_b, img_size_small ,focal_len, joints): super(JOHMRModel, self).__init__() self.imgs = imgs self.objmask = objmask[..., 0] self.objmask.requires_grad = False self.device = smpl_verts.device self.diff_render = diff_render self.vis_render = vis_render self.obj_verts_orig = obj_verts self.obj_faces = obj_faces self.smpl_verts_orig = smpl_verts self.smpl_faces = smpl_faces self.points = points self.rot_origs = rot_o self.rot_axises = axis self.vertexSegs = vertexSegs self.faceSegs = faceSegs self.limit_as = limit_a self.limit_bs = limit_b self.rot_type = rot_type self.bs = self.imgs.shape[0] self.normal = normal self.normal2 = normal2 self.img_h = self.imgs.shape[1] self.img_w = self.imgs.shape[2] self.new_s = int((max(self.img_h, self.img_w) - min(self.img_h, self.img_w))/2)-1 self.img_small = img_size_small self.focal = focal_len self.joints = joints self.normalize = 1.0/(0.5*(self.img_h+self.img_w)) K = torch.from_numpy(np.array([[self.focal, 0, self.img_w/2], [0, self.focal, self.img_h/2], [0,0,1]])) self.K = K.float().to(self.device) # camera is at the center self.R, self.T = look_at_view_transform(0.1, 0.0, 0.0, device=self.device) self.T[0,2] = 0.0 # manually set to zero # object CAD x, y, z offset in 3D obj_offset = np.array([0.0, 0.0, 2.5], dtype=np.float32) self.obj_offset = nn.Parameter(torch.from_numpy(obj_offset).to(self.device)) # object CAD scale in 3D obj_scale = np.array([1.0, 1.0, 1.0], dtype=np.float32) self.obj_scale = nn.Parameter(torch.from_numpy(obj_scale).to(self.device)) # SPIN mesh x, y, z offset in 3D smpl_offset = np.zeros((self.bs,3), dtype=np.float32) smpl_offset[:,0] = 0.0 smpl_offset[:,1] = 0.0 smpl_offset[:,2] = 2.5 self.smpl_offset = nn.Parameter(torch.from_numpy(smpl_offset).to(self.device)) # local rotation angle or translation offset for the parts part_motion = 0.0*np.ones(self.bs, dtype=np.float32) self.part_motion = nn.Parameter(torch.from_numpy(part_motion).to(self.device)) # global rotation angle for the object CAD yaw_degree = 0.0 * 180/np.pi #-20.0# * 180/np.pi #0.0* 180/np.pi rot_mat = RotateAxisAngle(yaw_degree, axis='X').get_matrix() rot_mat = rot_mat[0,:3,:3].unsqueeze(0) ortho6d = matrix_to_rotation_6d(rot_mat) self.obj_rot_angle = nn.Parameter(ortho6d.to(self.device)) # curve rotation in 3D yaw_degree2 = 0.0 * 180/np.pi #0.0* 180/np.pi rot_mat2 = RotateAxisAngle(yaw_degree2, axis='Y').get_matrix() rot_mat2 = rot_mat2[0,:3,:3].unsqueeze(0) ortho6d2 = matrix_to_rotation_6d(rot_mat2) self.curve_rot_angle = nn.Parameter(ortho6d2.to(self.device)) curve_offset = np.array([0.0, 0.0, 0.0], dtype=np.float32) self.curve_offset = nn.Parameter(torch.from_numpy(curve_offset).to(self.device)) self.cos = nn.CosineSimilarity(dim=1, eps=1e-6) self.relu = nn.ReLU() return def forward(self, iteration, args, cad_name, care_idx, part_idx, handcontact_v, objcontact_v, obj_x_center, obj_y_center, x_ratio, y_ratio, z_ratio): # Predefined CAD segmentation and motion axis from SAPIEN self.vertexStart = self.vertexSegs[part_idx] self.vertexEnd = self.vertexSegs[part_idx+1] faceStart = self.faceSegs[part_idx] faceEnd = self.faceSegs[part_idx+1] self.rot_o = self.rot_origs[part_idx].clone().to(self.device).detach() self.axis = self.rot_axises[part_idx].clone().to(self.device).detach() limit_a = self.limit_as[part_idx] limit_b = self.limit_bs[part_idx] self.rot_o.requires_grad = False self.axis.requires_grad = False # Transform pytorch3d -> world coordinate self.rot_o[1:] *= -1 self.axis[1:] *= -1 #################### ## fit human mesh ## #################### self.smpl_verts = self.smpl_verts_orig.clone() # Resize human mesh smplmesh_calibrate_path = 'smplmesh-calibrate.obj' smplmesh_calibrate = o3d.io.read_triangle_mesh(smplmesh_calibrate_path) # load smpl mesh hverts_cal = torch.from_numpy(np.asarray(smplmesh_calibrate.vertices)).float() human_height = 175 #cm h_diff = torch.max(hverts_cal[:,1]) - torch.min(hverts_cal[:,1]) h_ratio = (human_height / h_diff).detach() self.smpl_verts *= h_ratio # Add x y z offsets to SMPL mesh (camera looking at positive depth z) smpl_offset = self.smpl_offset.reshape(-1,1,3).repeat(1,self.smpl_verts_orig.shape[1],1) # (bs, 6890, 3) self.smpl_verts[:,:,0] += args.scale*smpl_offset[:,:,0] self.smpl_verts[:,:,1] += args.scale*smpl_offset[:,:,1] self.smpl_verts[:,:,2] += args.scale*smpl_offset[:,:,2] #smpl_offset[:,:,2] #smpl_offset[0,:,2] # Compute projection matrix K K_batch = self.K.expand(self.smpl_verts.shape[0],-1,-1) # Prespective projection points_out_v = torch.bmm(self.smpl_verts, K_batch.permute(0,2,1)) self.smpl_2d = points_out_v[...,:2] / points_out_v[...,2:] # Human fitting error l_points = torch.mean(self.normalize*(self.points - self.smpl_2d)**2) ##################### ## optimize object ## ##################### self.obj_rot_mat = rotation_6d_to_matrix(self.obj_rot_angle)[0].to(self.device) # pitch, yaw, roll alpha,beta,gamma = matrix_to_euler_angles(rotation_6d_to_matrix(self.obj_rot_angle), ["X","Y","Z"])[0] obj_verts_batch = self.obj_verts_orig.reshape(1,-1,3).repeat(self.bs,1,1) # (bs, ver, 3) # Step 1: rescale object and rotation orig if not args.use_gt_objscale: sx = self.obj_scale[0] * x_ratio sy = self.obj_scale[1] * y_ratio sz = self.obj_scale[2] * z_ratio else: sx = x_ratio sy = y_ratio sz = z_ratio obj_verts_batch[:,:,0] *= sx obj_verts_batch[:,:,1] *= sy obj_verts_batch[:,:,2] *= sz self.rot_o[0] *= sx self.rot_o[1] *= sy self.rot_o[2] *= sz # Oject real-world dimension after scaling self.x_dim = torch.max(obj_verts_batch[0,:,0]) - torch.min(obj_verts_batch[0,:,0]) self.y_dim = torch.max(obj_verts_batch[0,:,1]) - torch.min(obj_verts_batch[0,:,1]) self.z_dim = torch.max(obj_verts_batch[0,:,2]) - torch.min(obj_verts_batch[0,:,2]) # Step 2: add part motion (prismatic or revolute) if cad_name == '45261' or cad_name == '45132': obj_verts_batch_t1 = obj_verts_batch[:, self.vertexStart:self.vertexEnd, :] - self.rot_o self.part_motion_scaled = self.part_motion * args.scale batch_offset = self.axis.unsqueeze(0).repeat(self.bs,1) * self.part_motion_scaled.unsqueeze(-1).repeat(1,3) obj_verts_batch_t2 = obj_verts_batch_t1 + batch_offset.unsqueeze(1).repeat(1,obj_verts_batch_t1.shape[1], 1) obj_verts_batch[:, self.vertexStart:self.vertexEnd, :] = obj_verts_batch_t2 + self.rot_o else: self.part_rot_mat = rotation_matrix_batch(self.axis, self.part_motion, self.device) obj_verts_batch_t1 = obj_verts_batch[:, self.vertexStart:self.vertexEnd, :] - self.rot_o obj_verts_batch_t2 = torch.bmm(self.part_rot_mat, obj_verts_batch_t1.permute(0,2,1)).permute(0,2,1) obj_verts_batch[:, self.vertexStart:self.vertexEnd, :] = obj_verts_batch_t2 + self.rot_o # Step 3: add global object rotation obj_verts_batch = torch.bmm(self.obj_rot_mat.reshape(1,3,3).repeat(self.bs,1,1), obj_verts_batch.permute(0,2,1)).permute(0,2,1) # Step 4: add global object translation self.obj_verts_batch = obj_verts_batch + args.scale*self.obj_offset # Object center error obj_2d = torch.bmm(self.obj_verts_batch, K_batch.permute(0,2,1)) self.obj_2d = (obj_2d[...,:2] / (obj_2d[...,2:])) # (bs, objV, 2) obj_2d_x_center = torch.mean(self.obj_2d[:,:,0]) obj_2d_y_center = torch.mean(self.obj_2d[:,:,1]) if self.img_w > self.img_h: obj_2d_y_center += self.new_s else: obj_2d_x_center += self.new_s l_mask_center = self.normalize*(obj_y_center - obj_2d_y_center)**2 + self.normalize*(obj_x_center - obj_2d_x_center)**2 # Object & human orientation error if '10213' in cad_name or '9968' in cad_name: # Difficult to predefine orientation for laptop # Use CAD base part front_vertex = self.obj_verts_orig[645+581].detach() top_vertex = self.obj_verts_orig[645+285].detach() base_center = self.obj_verts_orig[self.vertexSegs[-2]:self.vertexSegs[-1]].detach() obj_norm = torch.mean(base_center, 0) - front_vertex obj_norm_rot = torch.mm(self.obj_rot_mat, obj_norm.float().reshape(-1,1)).permute(1,0) output = self.cos(self.normal, obj_norm_rot.repeat(self.bs, 1)) l_direction = torch.mean((1.0 - output)[care_idx]) obj_norm2 = top_vertex - torch.mean(base_center, 0) obj_norm_rot2 = torch.mm(self.obj_rot_mat, obj_norm2.float().reshape(-1,1)).permute(1,0) output2 = self.cos(self.normal2, obj_norm_rot2.repeat(self.bs, 1)) l_direction2 = torch.mean((1.0 - output2)) else: obj_norm = torch.from_numpy(np.asarray([0,0,1])).to(self.device) obj_norm2 = torch.from_numpy(np.asarray([0,-1,0])).to(self.device) obj_norm_rot = torch.mm(self.obj_rot_mat, obj_norm.float().reshape(-1,1)).permute(1,0) obj_norm_rot2 = torch.mm(self.obj_rot_mat, obj_norm2.float().reshape(-1,1)).permute(1,0) output = self.cos(self.normal, obj_norm_rot.repeat(self.bs, 1)) output2 = self.cos(self.normal2, obj_norm_rot2.repeat(self.bs, 1)) l_direction = torch.mean((1.0 - output)[care_idx]) l_direction2 = torch.mean((1.0 - output2)) # Differentiable mask error diff_images = [] for index in range(self.bs): # convert object mesh for diff render, opengl -> pytorch3d p3d_obj_verts = self.obj_verts_batch[index].clone() p3d_obj_verts[:,1] *= -1 p3d_obj_verts[:,2] *= -1 # pass through diff render tex = torch.ones_like(p3d_obj_verts).unsqueeze(0) textures = TexturesVertex(verts_features=tex).to(self.device) obj_mesh = Meshes(verts=[p3d_obj_verts],faces=[self.obj_faces],textures=textures) diff_img = self.diff_render(meshes_world=obj_mesh, R=self.R, T=self.T) diff_img = diff_img[..., 3:] diff_img = diff_img.permute(0,3,1,2)[0,0,:,:] #(h,w) diff_images.append(diff_img) diff_images = torch.stack(diff_images) #(bs,h,w) mask2 = (diff_images>0).detach() l_gtMask = torch.mean(self.objmask*(diff_images-self.objmask)**2) l_rendMask = torch.mean(mask2*((diff_images-self.objmask)**2)) mask_diff = torch.mean((diff_images-self.objmask)**2) l_mask = 0.3*l_rendMask + 0.6*l_gtMask + 0.1*mask_diff # Hand & object 3D contact error self.curve_rot_angle_mat = rotation_6d_to_matrix(self.curve_rot_angle)[0].to(self.device) l_contact = torch.zeros(1).to(self.device) if '102156' not in cad_name and '103635' not in cad_name: obj_contact_curve = self.obj_verts_batch[care_idx, objcontact_v, :].clone() smpl_contact_curve = self.smpl_verts[care_idx, handcontact_v, :].clone().detach() obj_contact_curve_after = torch.t(torch.mm(self.curve_rot_angle_mat, torch.t(obj_contact_curve))) + 5.0*self.curve_offset l_contact = self.normalize * torch.mean((obj_contact_curve_after- smpl_contact_curve)**2) # Smoothing error nomotion_idx = list(set(list(range(0, len(self.part_motion)-1))) - set(care_idx.tolist())) partrot_first = self.part_motion[:-1] partrot_second = self.part_motion[1:] l_smooth = torch.mean((partrot_first - partrot_second)[np.array(nomotion_idx)]**2) # Motion range error l_range = torch.mean(self.relu(limit_a - self.part_motion) + self.relu(self.part_motion-limit_b)) # Roll, pitch constraint (except for laptop) if '10213' in cad_name or '9968' in cad_name: l_gamma = torch.zeros(1).to(self.device) l_alpha = torch.zeros(1).to(self.device) else: l_alpha = self.relu(-alpha-0.2)**2 l_gamma = self.relu(torch.abs(gamma)-0.2)**2 # Depth constraint l_depth = torch.mean((self.smpl_offset[care_idx,2].detach() - self.obj_offset[2])**2) # Object size constraint #l_size = torch.sum(self.relu(0.1 - self.obj_scale)) l_size = torch.mean(self.relu(self.obj_scale-0.1)**2) # Overall error overall_loss = args.smpl*l_points + args.objmask*l_mask +\ args.depth*l_depth + args.smooth*l_smooth + args.range*l_range +\ args.gamma*l_gamma + args.alpha*l_alpha +\ args.hfacing*(l_direction+l_direction2) + args.contact*l_contact if iteration <= int(0.5*args.iter): overall_loss += args.center*l_mask_center if iteration > int(0.5*args.iter): overall_loss += (args.size*l_size ) loss_meta = {} loss_meta['l_mask'] = args.objmask*l_mask.data.detach().cpu().numpy() loss_meta['l_center'] = args.center*l_mask_center.data.detach().cpu().numpy() loss_meta['l_contact'] = args.contact*l_contact.data.detach().cpu().numpy() loss_meta['l_depth'] = args.depth*l_depth.data.detach().cpu().numpy() loss_meta['l_gamma'] = args.gamma*l_gamma.data.detach().cpu().numpy() loss_meta['l_alpha'] = args.alpha*l_alpha.data.detach().cpu().numpy() loss_meta['l_range'] = args.alpha*l_range.data.detach().cpu().numpy() loss_meta['l_smooth'] = args.alpha*l_smooth.data.detach().cpu().numpy() loss_meta['l_prior'] = args.size*l_size.data.detach().cpu().numpy() loss_meta['l_direction'] = args.hfacing*(l_direction.data.detach().cpu().numpy() + l_direction2.data.detach().cpu().numpy() ) loss_meta['l_points'] = args.smpl*l_points.data.detach().cpu().numpy() loss_meta['overall_loss'] = overall_loss.data.detach().cpu().item() loss_meta['final_loss'] = loss_meta['l_mask'] + 0.3*loss_meta['l_contact'] + loss_meta['l_depth'] + loss_meta['l_range'] + loss_meta['l_smooth'] +\ loss_meta['l_gamma'] + loss_meta['l_alpha'] + loss_meta['l_prior'] + 0.3*loss_meta['l_direction'] return overall_loss, loss_meta def render(self, save_folder=None): obj_meshes = [] smpl_meshes = [] for index in range(self.bs): smpl_verts = self.smpl_verts[index] obj_verts = self.obj_verts_batch[index] # create SPIN mesh (opengl) tex = torch.ones_like(smpl_verts).unsqueeze(0) textures = TexturesVertex(verts_features=tex).to(self.device) smpl_mesh = Meshes(verts=[smpl_verts],faces=[self.smpl_faces[index]],textures=textures).detach() smpl_meshes.append(smpl_mesh) # create object mesh for diff render and visualization tex = torch.ones_like(obj_verts).unsqueeze(0) textures = TexturesVertex(verts_features=tex).to(self.device) obj_mesh = Meshes(verts=[obj_verts],faces=[self.obj_faces],textures=textures).detach() obj_meshes.append(obj_mesh) meshes = {'obj_mesh':obj_meshes, 'spin_mesh':smpl_meshes} return meshes
d3d-hoi-main
optimization/model.py
# Copyright (c) Facebook, Inc. and its affiliates. import numpy as np import torch import natsort import glob import open3d as o3d # rendering components from pytorch3d.renderer import ( FoVPerspectiveCameras,RasterizationSettings, MeshRenderer, MeshRasterizer, BlendParams, SoftSilhouetteShader, HardPhongShader, PointLights, DirectionalLights, PerspectiveCameras ) from pytorch3d.io import save_obj, load_obj import math import cv2 import matplotlib.pyplot as plt import os import imageio from decimal import Decimal import json import matplotlib.pyplot as plt from mpl_toolkits import mplot3d from mpl_toolkits.mplot3d import axes3d from scipy.ndimage.filters import gaussian_filter1d from numpy.linalg import svd from multiprocessing import Pool, Manager, cpu_count from pytorch3d.transforms import Rotate, Translate from matplotlib.image import imsave from pathlib import Path def planeFit(points): """ p, n = planeFit(points) Given an array, points, of shape (d,...) representing points in d-dimensional space, fit an d-dimensional plane to the points. Return a point, p, on the plane (the point-cloud centroid), and the normal, n. """ points = np.reshape(points, (np.shape(points)[0], -1)) # Collapse trialing dimensions assert points.shape[0] <= points.shape[1], "There are only {} points in {} dimensions.".format(points.shape[1], points.shape[0]) ctr = points.mean(axis=1) x = points - ctr[:,np.newaxis] M = np.dot(x, x.T) # Could also use np.cov(x) here. return ctr, svd(M)[0][:,-1] def initialize_render(device, focal_x, focal_y, img_square_size, img_small_size): """ initialize camera, rasterizer, and shader. """ # Initialize an OpenGL perspective camera. #cameras = FoVPerspectiveCameras(znear=1.0, zfar=9000.0, fov=20, device=device) #cameras = FoVPerspectiveCameras(device=device) #cam_proj_mat = cameras.get_projection_transform() img_square_center = int(img_square_size/2) shrink_ratio = int(img_square_size/img_small_size) focal_x_small = int(focal_x/shrink_ratio) focal_y_small = int(focal_y/shrink_ratio) img_small_center = int(img_small_size/2) camera_sfm = PerspectiveCameras( focal_length=((focal_x, focal_y),), principal_point=((img_square_center, img_square_center),), image_size = ((img_square_size, img_square_size),), device=device) camera_sfm_small = PerspectiveCameras( focal_length=((focal_x_small, focal_y_small),), principal_point=((img_small_center, img_small_center),), image_size = ((img_small_size, img_small_size),), device=device) # To blend the 100 faces we set a few parameters which control the opacity and the sharpness of # edges. Refer to blending.py for more details. blend_params = BlendParams(sigma=1e-4, gamma=1e-4) # Define the settings for rasterization and shading. Here we set the output image to be of size # 256x256. To form the blended image we use 100 faces for each pixel. We also set bin_size and max_faces_per_bin to None which ensure that # the faster coarse-to-fine rasterization method is used. Refer to rasterize_meshes.py for # explanations of these parameters. Refer to docs/notes/renderer.md for an explanation of # the difference between naive and coarse-to-fine rasterization. raster_settings = RasterizationSettings( image_size=img_small_size, blur_radius=np.log(1. / 1e-4 - 1.) * blend_params.sigma, faces_per_pixel=50, ) # Create a silhouette mesh renderer by composing a rasterizer and a shader. silhouette_renderer = MeshRenderer( rasterizer=MeshRasterizer( cameras=camera_sfm_small, raster_settings=raster_settings ), shader=SoftSilhouetteShader(blend_params=blend_params) ) # We will also create a phong renderer. This is simpler and only needs to render one face per pixel. raster_settings = RasterizationSettings( image_size=img_square_size, blur_radius=0.0, faces_per_pixel=1, ) # We can add a point light in front of the object. lights = PointLights(device=device, location=((2.0, 2.0, -2.0),)) #lights = DirectionalLights(device=device, direction=((0, 0, 1),)) phong_renderer = MeshRenderer( rasterizer=MeshRasterizer( cameras=camera_sfm, raster_settings=raster_settings ), shader=HardPhongShader(device=device, cameras=camera_sfm, lights=lights) ) return silhouette_renderer, phong_renderer def merge_meshes(obj_path): """ helper function for loading and merging meshes. """ verts_list = torch.empty(0,3) faces_list = torch.empty(0,3).long() num_vtx = [0] num_faces = [0] # merge meshes, load in ascending order meshes = natsort.natsorted(glob.glob(obj_path+'/final/*_rescaled_sapien.obj')) for part_mesh in meshes: verts, faces, aux = load_obj(part_mesh) faces = faces.verts_idx faces = faces + verts_list.shape[0] verts_list = torch.cat([verts_list, verts]) faces_list = torch.cat([faces_list, faces]) num_vtx.append(verts_list.shape[0]) num_faces.append(faces_list.shape[0]) return verts_list, faces_list, num_vtx, num_faces def load_motion(motions, device): """ load rotation axis, origin, and limit. """ rot_origin = [] rot_axis = [] rot_type = [] limit_a = [] limit_b = [] contact_list = [] # load all meta data for idx, key in enumerate(motions.keys()): jointData = motions[key] # if contains movable parts if jointData is not None: origin = torch.FloatTensor(jointData['axis']['origin']).to(device) axis = torch.FloatTensor(jointData['axis']['direction']).to(device) mobility_type = jointData['type'] contact_list.append(jointData['contact']) # convert to radians if necessary if mobility_type == 'revolute': mobility_a = math.pi*jointData['limit']['a'] / 180.0 mobility_b = math.pi*jointData['limit']['b'] / 180.0 else: assert mobility_type == 'prismatic' mobility_a = jointData['limit']['a'] mobility_b = jointData['limit']['b'] rot_origin.append(origin) rot_axis.append(axis) rot_type.append(mobility_type) limit_a.append(mobility_a) limit_b.append(mobility_b) return rot_origin, rot_axis, rot_type, limit_a, limit_b, contact_list def save_object(id): global obj_verts_dict global obj_faces_dict global save_path_mesh verts = obj_verts_dict[str(id+1)] faces = obj_faces_dict[str(id+1)] path = os.path.join(save_path_mesh, str(id+1)+'_object.obj') save_obj(path, torch.from_numpy(verts), torch.from_numpy(faces)) def save_human(id): global human_verts_dict global human_faces_dict global save_path_mesh verts = human_verts_dict[str(id+1)] faces = human_faces_dict[str(id+1)] path = os.path.join(save_path_mesh, str(id+1)+'_person.obj') save_obj(path, torch.from_numpy(verts), torch.from_numpy(faces)) def save_meshes(meshes, save_folder, video_name, title): global obj_verts_dict global obj_faces_dict global human_verts_dict global human_faces_dict global save_path_mesh save_path_mesh = os.path.join(save_folder, title) if not os.path.exists(save_path_mesh): os.makedirs(save_path_mesh) obj_meshes = meshes['obj_mesh'] spin_meshes = meshes['spin_mesh'] # merge object + SPIN meshes obj_verts = {} obj_faces = {} human_verts = {} human_faces = {} for idx in range(len(obj_meshes)): path = os.path.join(save_path_mesh, str(idx+1)+'_person.obj') save_obj(path, spin_meshes[idx].verts_list()[0], spin_meshes[idx].faces_list()[0]) path = os.path.join(save_path_mesh, str(idx+1)+'_object.obj') save_obj(path, obj_meshes[idx].verts_list()[0], obj_meshes[idx].faces_list()[0]) eft_cmd = 'python -m demo.demo_bodymocapnewnew --render solid --videoname '+video_name+' --vPath '+save_folder os.chdir('/local-scratch/projects/d3dhoi/eft') os.system(eft_cmd) os.chdir('/local-scratch/projects/d3dhoi') ''' save_path = os.path.join(save_folder, 'eft', 'front') ffmpeg_cmd = 'ffmpeg -r 3 -i '+save_path+'/scene_%08d.jpg '+save_folder+'/frontview.mp4' os.system(ffmpeg_cmd) ''' return def save_parameters(model, save_path): if not os.path.exists(save_path): os.makedirs(save_path) obj_offset = model.obj_offset.detach().cpu().numpy() x_dim = model.x_dim.item() y_dim = model.y_dim.item() z_dim = model.z_dim.item() obj_rot_angle = model.obj_rot_angle.detach().cpu().numpy() #(3,3) part_motion = model.part_motion.detach().cpu().numpy() parameters = {} parameters['obj_offset'] = obj_offset parameters['obj_dim'] = [x_dim, y_dim, z_dim] parameters['obj_rot_angle'] = obj_rot_angle parameters['part_motion'] = part_motion np.save(os.path.join(save_path, 'params.npy'), parameters) return def rotation_matrix(axis, theta): """ Return the rotation matrix associated with counterclockwise rotation about the given axis by theta radians. """ axis = axis / torch.sqrt(torch.dot(axis, axis)) a = torch.cos(theta / 2.0) b, c, d = -axis * torch.sin(theta / 2.0) aa, bb, cc, dd = a * a, b * b, c * c, d * d bc, ad, ac, ab, bd, cd = b * c, a * d, a * c, a * b, b * d, c * d rot_mat = torch.empty(3,3) rot_mat[0,0] = aa + bb - cc - dd rot_mat[0,1] = 2 * (bc + ad) rot_mat[0,2] = 2 * (bd - ac) rot_mat[1,0] = 2 * (bc - ad) rot_mat[1,1] = aa + cc - bb - dd rot_mat[1,2] = 2 * (cd + ab) rot_mat[2,0] = 2 * (bd + ac) rot_mat[2,1] = 2 * (cd - ab) rot_mat[2,2] = aa + dd - bb - cc return rot_mat def rotation_matrix_batch(axis, theta, device): """ Return the rotation matrix associated with counterclockwise rotation about the given axis by theta radians. """ axis = axis / torch.sqrt(torch.dot(axis, axis)) a = torch.cos(theta / 2.0) b = -axis[0] * torch.sin(theta / 2.0) c = -axis[1] * torch.sin(theta / 2.0) d = -axis[2] * torch.sin(theta / 2.0) aa, bb, cc, dd = a * a, b * b, c * c, d * d bc, ad, ac, ab, bd, cd = b * c, a * d, a * c, a * b, b * d, c * d rot_mat = torch.empty(aa.shape[0],3,3).to(device) rot_mat[:,0,0] = aa + bb - cc - dd rot_mat[:,0,1] = 2 * (bc + ad) rot_mat[:,0,2] = 2 * (bd - ac) rot_mat[:,1,0] = 2 * (bc - ad) rot_mat[:,1,1] = aa + cc - bb - dd rot_mat[:,1,2] = 2 * (cd + ab) rot_mat[:,2,0] = 2 * (bd + ac) rot_mat[:,2,1] = 2 * (cd - ab) rot_mat[:,2,2] = aa + dd - bb - cc return rot_mat
d3d-hoi-main
optimization/utils.py
# Copyright (c) Facebook, Inc. and its affiliates. import os import numpy as np import cv2 import matplotlib.pyplot as plt import torch from pytorch3d.transforms import ( so3_relative_angle, euler_angles_to_matrix ) from scipy.spatial.distance import cdist import json from utils import ( load_motion, ) import re import argparse from pytorch3d.transforms.rotation_conversions import ( rotation_6d_to_matrix ) def isfloat(x): try: a = float(x) except (TypeError, ValueError): return False else: return True def isint(x): try: a = float(x) b = int(a) except (TypeError, ValueError): return False else: return a == b parser = argparse.ArgumentParser() parser.add_argument('--cad_path', type=str, help="experiment cad folder") parser.add_argument('--result_folder', type=str, help="experiment result folder") parser.add_argument('--data_path', type=str, help="experiment data folder") parser.add_argument('--scale', type=float) args = parser.parse_args() cad_path = args.cad_path result_folder = args.result_folder anno_path = args.data_path videos = sorted([(f.name, f.path) for f in os.scandir(result_folder)]) results = {} # loop through all videos for idx, video in enumerate(videos): vidname = video[0] vidpath = video[1] cads = sorted([(f.name, f.path) for f in os.scandir(vidpath)]) if(vidname[:4]=='b001'): category = 'dishwasher' elif(vidname[:4]=='b003'): category = 'laptop' elif(vidname[:4]=='b004'): category = 'microwave' elif(vidname[:4]=='b005'): category = 'refrigerator' elif(vidname[:4]=='b006'): category = 'trashcan' elif(vidname[:4]=='b007'): category = 'washingmachine' elif(vidname[:4]=='b008'): category = 'storage_revolute' elif(vidname[:4]=='b108'): category = 'storage_prismatic' elif(vidname[:4]=='b009'): category = 'oven' # loop through all cad models for cad in cads: cadname = cad[0] cadpath = cad[1] settings = sorted([(f.name, f.path) for f in os.scandir(cadpath)]) # loop through all settings for setting in settings: expname = setting[0] exppath = setting[1] partid = int(setting[0][0]) # load experiment meta if not os.path.exists(os.path.join(exppath, 'params.npy')): print('missing '+vidname +' for setting '+expname) continue expmeta = np.load(os.path.join(exppath, 'params.npy'), allow_pickle=True) expmeta = expmeta.item() # load estimated global object rotation exp_rot_angle = torch.from_numpy(expmeta['obj_rot_angle']) exp_rot_mat = rotation_6d_to_matrix(exp_rot_angle) # load estimated global object translation (cm) exp_t = expmeta['obj_offset'] * args.scale # load estimated object dimension (cm) exp_dim = expmeta['obj_dim'] # load estimated part motion (degree or cm) if cadname == '45132' or cadname == '45261': exp_partmotion = expmeta['part_motion'] * args.scale else: exp_partmotion = expmeta['part_motion'] * 57.296 # load gt part motion values (degree or cm) gt_partmotion = [] fp = open(os.path.join(anno_path, category, vidname, 'jointstate.txt')) for i, line in enumerate(fp): line = line.strip('\n') if isfloat(line) or isint(line): gt_partmotion.append(float(line)) gt_partmotion = np.asarray(gt_partmotion) with open(os.path.join(anno_path, category, vidname, '3d_info.txt')) as myfile: gt_data = [next(myfile).strip('\n') for x in range(14)] # GT global object rotation gt_alpha = float(re.findall(r"[-+]?\d*\.\d+|\d+", gt_data[3])[0]) gt_beta = float(re.findall(r"[-+]?\d*\.\d+|\d+", gt_data[4])[0]) gt_gamma = float(re.findall(r"[-+]?\d*\.\d+|\d+", gt_data[5])[0]) gt_alpha_tensor = torch.tensor(gt_alpha).reshape(-1) gt_beta_tensor = torch.tensor(gt_beta).reshape(-1) gt_gamma_tensor = torch.tensor(gt_gamma).reshape(-1) euler_angle = torch.cat((gt_alpha_tensor,gt_beta_tensor,gt_gamma_tensor),0).reshape(1,3) rot_mat_gt = euler_angles_to_matrix(euler_angle, ["X","Y","Z"]) # GT global object translation (cm) gt_x = float(re.findall(r"[-+]?\d*\.\d+|\d+", gt_data[6])[0])*100.0 gt_y = float(re.findall(r"[-+]?\d*\.\d+|\d+", gt_data[7])[0])*100.0 gt_z = float(re.findall(r"[-+]?\d*\.\d+|\d+", gt_data[8])[0])*100.0 # GT object dimension (cm) gt_xdim = float(re.findall(r"[-+]?\d*\.\d+|\d+", gt_data[9])[0]) gt_ydim = float(re.findall(r"[-+]?\d*\.\d+|\d+", gt_data[9])[1]) gt_zdim = float(re.findall(r"[-+]?\d*\.\d+|\d+", gt_data[9])[2]) gt_cad = re.findall(r"[-+]?\d*\.\d+|\d+", gt_data[10])[0] gt_part = int(re.findall(r"[-+]?\d*\.\d+|\d+", gt_data[11])[0]) # CAD model correctness correctness = gt_cad==cadname #and gt_part == partid # Avg part motion abs error (degree or cm) motion_error = np.mean(np.abs(gt_partmotion - exp_partmotion)) # Global object rotation error [relative angle (in degree) between the rotation matrixs in so3 space] R_dist = (so3_relative_angle(rot_mat_gt, exp_rot_mat, cos_angle=False).numpy()*57.296)[0] # Global object translation error (in cm) x_error = np.square(gt_x - exp_t[0]) y_error = np.square(gt_y - exp_t[1]) z_error = np.square(gt_z - exp_t[2]) T_dist = np.sqrt(x_error+y_error+z_error) # Avg object dimension abs error (in cm) xdim_error = np.abs(gt_xdim - exp_dim[0]) ydim_error = np.abs(gt_ydim - exp_dim[1]) zdim_error = np.abs(gt_zdim - exp_dim[2]) dim_error = (xdim_error + ydim_error + zdim_error)/3.0 # print per video result with open(os.path.join(os.path.dirname(result_folder),"result.txt"), 'a') as f: print(vidname+': ', file=f) print('model: '+str(cadname)+', part: '+str(partid), file=f) print('correctness: '+str(correctness), file=f) print('orientation (degree): '+str(round(R_dist,4)), file=f) print('location (cm): '+str(round(T_dist,4)), file=f) if cadname == '45132' or cadname == '45261': print('motion (cm): '+str(round(motion_error,4)), file=f) else: print('motion (degree): '+str(round(motion_error,4)), file=f) print('dimension (cm): '+str(round(dim_error,4)), file=f) print('--------------------------', file=f) if not category in results: results[category] = {} results[category]['correctness'] = [] results[category]['orientation'] = [] results[category]['location'] = [] results[category]['motion'] = [] results[category]['dimension'] = [] results[category]['correctness'].append(int(correctness)) if not correctness: continue results[category]['orientation'].append(R_dist) results[category]['location'].append(T_dist) results[category]['motion'].append(motion_error) results[category]['dimension'].append(dim_error) # per-category results: for key, value in results.items(): correct_percent = sum(value['correctness'])/len(value['correctness'])*100.0 motion_mean = sum(value['motion'])/len(value['motion']) oriens_mean = sum(value['orientation'])/len(value['orientation']) locs_mean = sum(value['location'])/len(value['location']) dims_mean = sum(value['dimension'])/len(value['dimension']) with open(os.path.join(os.path.dirname(result_folder),"result.txt"), 'a') as f: print('--------------------------', file=f) print(key+' model correctness: '+str(correct_percent)+'%', file=f) print('motion_mean: '+str(motion_mean), file=f) print('orientation_mean: '+str(oriens_mean), file=f) print('location_mean: '+str(locs_mean), file=f) print('dimension_mean: '+str(dims_mean), file=f) print('--------------------------', file=f)
d3d-hoi-main
optimization/evaluate.py
# Copyright (c) Facebook, Inc. and its affiliates. from skimage import io from torch.utils.data import Dataset import json import os import numpy as np import torch import matplotlib.pyplot as plt import torchvision.transforms as transforms from PIL import Image import cv2 from natsort import natsorted from utils import planeFit from numpy.linalg import norm import glob from pytorch3d.io import load_obj class MyOwnDataset(Dataset): """ My Own data loader. """ def __init__(self, root_dir): """ Args: root_dir (string): Directory with all the images, masks and meta file. category (string): Category class. """ self.img_paths = sorted(glob.glob(os.path.join(root_dir, 'frames', '*.jpg'))) self.smplv2d_paths = sorted(glob.glob(os.path.join(root_dir, 'smplv2d', '*.npy'))) self.smplmesh_paths = sorted(glob.glob(os.path.join(root_dir, 'smplmesh', '*.obj'))) self.joint3d_paths = sorted(glob.glob(os.path.join(root_dir, 'joints3d', '*.npy'))) self.objmask_paths = sorted(glob.glob(os.path.join(root_dir, 'gt_mask', '*object_mask.npy'))) # transformations transform_list = [transforms.ToTensor()] self.transforms = transforms.Compose(transform_list) def correct_image_size(self,low,high): # automatically finds a good ratio in the given range image = np.array(Image.open(self.img_paths[0])) img_h = image.shape[0] img_w = image.shape[1] img_square = max(img_h,img_w) img_small = -1 for i in range(low, high): if img_square % i == 0: img_small = i break return img_square, img_small def __len__(self): return len(self.img_paths) def getImgPath(self): return self.img_paths def __getitem__(self, idx): if torch.is_tensor(idx): idx = idx.tolist() image = np.array(Image.open(self.img_paths[idx])) # load image img_h = image.shape[0] img_w = image.shape[1] square_len = max(img_h, img_w) # compute add in region for square new_s = int((max(img_h, img_w) - min(img_h, img_w))/2)-1 add_l = min(img_h, img_w) objmask = np.load(self.objmask_paths[idx]).astype(np.uint8) smplv2d = np.load(self.smplv2d_paths[idx]) # load 2D points joint3d = np.load(self.joint3d_paths[idx]) if (joint3d.shape[0] == 147): pdb.set_trace() # no avaiable frame normal = np.zeros((3)) normal2 = np.zeros((3)) else: # estimate the body fitting plane and its normal vector joints_np = np.transpose(joint3d) # (3xN) lhip_to_rShoulder = joint3d[33] - joint3d[28] rhip_to_lShoulder = joint3d[34] - joint3d[27] normal = np.cross(lhip_to_rShoulder, rhip_to_lShoulder) normal = normal / np.sqrt(np.sum(normal**2)) arm = joint3d[31,:] - joint3d[33,:] cos_sim = np.inner(normal, arm)/(norm(normal)*norm(arm)) if cos_sim < 0: normal *= -1 lankle_to_rtoe = joint3d[22] - joint3d[30] rankle_to_ltoe = joint3d[19] - joint3d[25] normal2 = np.cross(lankle_to_rtoe, rankle_to_ltoe) normal2 = normal2 / np.sqrt(np.sum(normal2**2)) leg = joint3d[29,:] - joint3d[30,:] cos_sim2 = np.inner(normal2, leg)/(norm(normal2)*norm(leg)) if cos_sim2 < 0: normal2 *= -1 # SMPL mesh verts, faces, aux = load_obj(self.smplmesh_paths[idx]) faces = faces.verts_idx verts = verts.float() faces = faces.long() joints = torch.from_numpy(joint3d).float() normal = torch.from_numpy(normal).float() normal2 = torch.from_numpy(normal2).float() # apply transformations image = self.transforms(np.uint8(image)) objmask = self.transforms(np.uint8(objmask)) objmask[objmask>0.0] = 1.0 data = {'image': image, 'objmask': objmask, 'smplv2d': smplv2d, 'ver': verts, 'f': faces, 'normal': normal, 'normal2': normal2, 'joint3d': joints} return data
d3d-hoi-main
optimization/dataloader.py
import os import argparse import ntpath import common import pdb import open3d as o3d import numpy as np class Simplification: """ Perform simplification of watertight meshes. """ def __init__(self): """ Constructor. """ parser = self.get_parser() self.options = parser.parse_args() self.simplification_script = os.path.join(os.path.dirname(os.path.realpath(__file__)), 'simplification.mlx') def get_parser(self): """ Get parser of tool. :return: parser """ parser = argparse.ArgumentParser(description='Scale a set of meshes stored as OFF files.') parser.add_argument('--in_dir', type=str, help='Path to input directory.') parser.add_argument('--out_dir', type=str, help='Path to output directory; files within are overwritten!') return parser def read_directory(self, directory): """ Read directory. :param directory: path to directory :return: list of files """ files = [] for filename in os.listdir(directory): files.append(os.path.normpath(os.path.join(directory, filename))) return files def run(self): """ Run simplification. """ if not os.path.exists(self.options.in_dir): return common.makedir(self.options.out_dir) files = self.read_directory(self.options.in_dir) # count number of faces num_faces = [] for filepath in files: mesh = o3d.io.read_triangle_mesh(filepath) faces = np.asarray(mesh.triangles).shape[0] num_faces.append(faces) num_faces = np.array(num_faces) total_faces = np.sum(num_faces) num_faces = np.around(2500 * (num_faces / (total_faces+0.0))).astype(int) # total 2500 faces for idx, filepath in enumerate(files): # write new simply mlx file with open(os.path.join(self.options.out_dir,'tmp.mlx'), 'w') as out_file: with open(self.simplification_script, 'r') as in_file: Lines = in_file.readlines() for count, line in enumerate(Lines): # modify target face number according to ratio if count == 3: front = line[:51] back = line[57:] line = front+"\""+str(num_faces[idx])+"\""+back out_file.write(line) os.system('meshlabserver -i %s -o %s -s %s' % ( filepath, os.path.join(self.options.out_dir, ntpath.basename(filepath)), os.path.join(self.options.out_dir,'tmp.mlx') )) if __name__ == '__main__': app = Simplification() app.run()
d3d-hoi-main
preprocess/3_simplify.py
# Copyright (c) Facebook, Inc. and its affiliates.import math import os import torch import numpy as np from tqdm import tqdm_notebook import imageio import torch.nn as nn import torch.nn.functional as F import matplotlib.pyplot as plt from skimage import img_as_ubyte import pdb import glob import natsort from torch.autograd import Variable import trimesh import copy import re # io utils from pytorch3d.io import load_obj, save_obj, save_ply, load_ply # datastructures from pytorch3d.structures import Meshes # 3D transformations functions from pytorch3d.transforms import Rotate, Translate # rendering components from pytorch3d.renderer import ( OpenGLPerspectiveCameras, look_at_view_transform, look_at_rotation, RasterizationSettings, MeshRenderer, MeshRasterizer, BlendParams, SoftSilhouetteShader, HardPhongShader, PointLights, HardFlatShader, DirectionalLights, cameras ) import json import csv import open3d as o3d device = torch.device("cuda:0") torch.cuda.set_device(device) # helper function for computing roation matrix in 3D def rotation_matrix(axis, theta): """ Return the rotation matrix associated with counterclockwise rotation about the given axis by theta radians. """ axis = axis / torch.sqrt(torch.dot(axis, axis)) a = torch.cos(theta / 2.0) b, c, d = -axis * torch.sin(theta / 2.0) aa, bb, cc, dd = a * a, b * b, c * c, d * d bc, ad, ac, ab, bd, cd = b * c, a * d, a * c, a * b, b * d, c * d rot_mat = torch.empty(3,3) rot_mat[0,0] = aa + bb - cc - dd rot_mat[0,1] = 2 * (bc + ad) rot_mat[0,2] = 2 * (bd - ac) rot_mat[1,0] = 2 * (bc - ad) rot_mat[1,1] = aa + cc - bb - dd rot_mat[1,2] = 2 * (cd + ab) rot_mat[2,0] = 2 * (bd + ac) rot_mat[2,1] = 2 * (cd - ab) rot_mat[2,2] = aa + dd - bb - cc return rot_mat # helper function for loading and merging meshes def merge_meshes(obj_path): verts_list = torch.empty(0,3) faces_list = torch.empty(0,3).long() num_vtx = [0] # merge meshes, load in ascending order meshes = natsort.natsorted(glob.glob(obj_path+'/final/*_rescaled_sapien.obj')) for part_mesh in meshes: print('loading %s' %part_mesh) mesh = o3d.io.read_triangle_mesh(part_mesh) verts = torch.from_numpy(np.asarray(mesh.vertices)).float() faces = torch.from_numpy(np.asarray(mesh.triangles)).long() faces = faces + verts_list.shape[0] verts_list = torch.cat([verts_list, verts]) faces_list = torch.cat([faces_list, faces]) num_vtx.append(verts_list.shape[0]) verts_list = verts_list.to(device) faces_list = faces_list.to(device) return verts_list, faces_list, num_vtx cad_folder = 'test' # cad data folder (after mesh fusion) cad_classes = [f.name for f in os.scandir(cad_folder)] for cad_category in cad_classes: folder_path = os.path.join(cad_folder, cad_category) object_paths = [f.path for f in os.scandir(folder_path)] for obj_path in object_paths: print('processing %s' % obj_path) # load merged mesh and number of vtx for each part verts_list, faces_list, num_vtx = merge_meshes(obj_path) # load motion json file with open(os.path.join(obj_path, 'motion.json')) as json_file: motion = json.load(json_file) # create gif writer filename_output = os.path.join(obj_path, 'motion.gif') writer = imageio.get_writer(filename_output, mode='I', duration=0.3) vis = o3d.visualization.Visualizer() vis.create_window(height=500, width=500) distance = 2.4 # distance from camera to the object elevation = 25 # angle of elevation in degrees azimuth = 20 # No rotation so the camera is positioned on the +Z axis. # at least render one frame if len(motion) == 0: motion['placeholder'] = {} # rotate or translate individual part for idx, key in enumerate(motion.keys()): jointData = motion[key] # rotation part if jointData and jointData['type'] == 'revolute': start = num_vtx[idx] end = num_vtx[idx+1] rot_orig = torch.FloatTensor(jointData['axis']['origin']).to(device) rot_axis = torch.FloatTensor(jointData['axis']['direction']).to(device) aa = math.pi*jointData['limit']['a'] / 180.0 bb = math.pi*jointData['limit']['b'] / 180.0 print(aa) print(bb) rot_angles = np.linspace(aa, bb, num=5) rot_angles_rev = np.linspace(bb, aa, num=5) angles = np.concatenate((rot_angles, rot_angles_rev),0) for angle in angles: verts = verts_list.clone() faces = faces_list.clone() # world coordinate to local coordinate (rotation origin) verts[start:end, 0] -= rot_orig[0] verts[start:end, 1] -= rot_orig[1] verts[start:end, 2] -= rot_orig[2] # rotate around local axis [-1 0 0] init_value = torch.tensor([angle]) theta = Variable(init_value.cuda()) rot_mat = rotation_matrix(rot_axis, theta).float() # 3x3 verts[start:end,:] = torch.t(torch.mm(rot_mat.to(device), torch.t(verts[start:end,:]))) # local coordinate to world coordinate verts[start:end, 0] += rot_orig[0] verts[start:end, 1] += rot_orig[1] verts[start:end, 2] += rot_orig[2] R, T = look_at_view_transform(distance, elevation, azimuth, device=device) T = Translate(T, device=T.device) R = Rotate(R, device=R.device) MM = R.compose(T) opt_mesh = o3d.geometry.TriangleMesh() # transform tmp = MM.transform_points(verts).detach().cpu().numpy() tmp[:,0] *= -1 tmp[:,2] *= -1 # visualize opt_mesh.vertices = o3d.utility.Vector3dVector(tmp) opt_mesh.triangles = o3d.utility.Vector3iVector(faces_list.cpu().numpy()) opt_mesh.compute_vertex_normals() vis.clear_geometries() vis.add_geometry(opt_mesh) vis.poll_events() img = np.asarray(vis.capture_screen_float_buffer(True)) image = img_as_ubyte(img) writer.append_data(image) # translation part elif jointData and jointData['type'] == 'prismatic': start = num_vtx[idx] end = num_vtx[idx+1] trans_orig = torch.FloatTensor(jointData['axis']['origin']).to(device) trans_axis = torch.FloatTensor(jointData['axis']['direction']).to(device) aa = jointData['limit']['a'] bb = jointData['limit']['b'] trans_len = np.linspace(aa, bb, num=5) trans_len_rev = np.linspace(bb, aa, num=5) trans_lens = np.concatenate((trans_len, trans_len_rev),0) for tran_len in trans_lens: verts = verts_list.clone() faces = faces_list.clone() # world coordinate to local coordinate (rotation origin) verts[start:end, 0] -= trans_orig[0] verts[start:end, 1] -= trans_orig[1] verts[start:end, 2] -= trans_orig[2] # add value in translation direction verts[start:end, 0] += (trans_axis[0] * tran_len) verts[start:end, 1] += (trans_axis[1] * tran_len) verts[start:end, 2] += (trans_axis[2] * tran_len) # local coordinate to world coordinate verts[start:end, 0] += trans_orig[0] verts[start:end, 1] += trans_orig[1] verts[start:end, 2] += trans_orig[2] R, T = look_at_view_transform(distance, elevation, azimuth, device=device) T = Translate(T, device=T.device) R = Rotate(R, device=R.device) MM = R.compose(T) opt_mesh = o3d.geometry.TriangleMesh() # transform tmp = MM.transform_points(verts).detach().cpu().numpy() tmp[:,0] *= -1 tmp[:,2] *= -1 # visualize opt_mesh.vertices = o3d.utility.Vector3dVector(tmp) opt_mesh.triangles = o3d.utility.Vector3iVector(faces_list.cpu().numpy()) opt_mesh.compute_vertex_normals() vis.clear_geometries() vis.add_geometry(opt_mesh) vis.poll_events() img = np.asarray(vis.capture_screen_float_buffer(True)) image = img_as_ubyte(img) writer.append_data(image) # no motion else: assert not jointData # world --> view coordinate R, T = look_at_view_transform(distance, elevation, azimuth, device=device) T = Translate(T, device=T.device) R = Rotate(R, device=R.device) MM = R.compose(T) opt_mesh = o3d.geometry.TriangleMesh() # transform tmp = MM.transform_points(verts_list).detach().cpu().numpy() tmp[:,0] *= -1 tmp[:,2] *= -1 # visualize opt_mesh.vertices = o3d.utility.Vector3dVector(tmp) opt_mesh.triangles = o3d.utility.Vector3iVector(faces_list.cpu().numpy()) opt_mesh.compute_vertex_normals() vis.clear_geometries() vis.add_geometry(opt_mesh) vis.poll_events() img = np.asarray(vis.capture_screen_float_buffer(True)) image = img_as_ubyte(img) writer.append_data(image) vis.destroy_window() writer.close()
d3d-hoi-main
preprocess/visualize_data.py
import math import numpy as np import os from scipy import ndimage import common import argparse import ntpath # Import shipped libraries. import librender import libmcubes use_gpu = True if use_gpu: import libfusiongpu as libfusion from libfusiongpu import tsdf_gpu as compute_tsdf else: import libfusioncpu as libfusion from libfusioncpu import tsdf_cpu as compute_tsdf class Fusion: """ Performs TSDF fusion. """ def __init__(self): """ Constructor. """ parser = self.get_parser() self.options = parser.parse_args() self.render_intrinsics = np.array([ self.options.focal_length_x, self.options.focal_length_y, self.options.principal_point_x, self.options.principal_point_x ], dtype=float) # Essentially the same as above, just a slightly different format. self.fusion_intrisics = np.array([ [self.options.focal_length_x, 0, self.options.principal_point_x], [0, self.options.focal_length_y, self.options.principal_point_y], [0, 0, 1] ]) self.image_size = np.array([ self.options.image_height, self.options.image_width, ], dtype=np.int32) # Mesh will be centered at (0, 0, 1)! self.znf = np.array([ 1 - 0.75, 1 + 0.75 ], dtype=float) # Derive voxel size from resolution. self.voxel_size = 1./self.options.resolution self.truncation = self.options.truncation_factor*self.voxel_size def get_parser(self): """ Get parser of tool. :return: parser """ parser = argparse.ArgumentParser(description='Scale a set of meshes stored as OFF files.') parser.add_argument('--mode', type=str, default='render', help='Operation mode: render or fuse.') parser.add_argument('--in_dir', type=str, help='Path to input directory.') parser.add_argument('--depth_dir', type=str, help='Path to depth directory; files are overwritten!') parser.add_argument('--out_dir', type=str, help='Path to output directory; files within are overwritten!') parser.add_argument('--n_views', type=int, default=100, help='Number of views per model.') parser.add_argument('--image_height', type=int, default=640, help='Depth image height.') parser.add_argument('--image_width', type=int, default=640, help='Depth image width.') parser.add_argument('--focal_length_x', type=float, default=640, help='Focal length in x direction.') parser.add_argument('--focal_length_y', type=float, default=640, help='Focal length in y direction.') parser.add_argument('--principal_point_x', type=float, default=320, help='Principal point location in x direction.') parser.add_argument('--principal_point_y', type=float, default=320, help='Principal point location in y direction.') parser.add_argument('--depth_offset_factor', type=float, default=1.5, help='The depth maps are offsetted using depth_offset_factor*voxel_size.') parser.add_argument('--resolution', type=float, default=256, help='Resolution for fusion.') parser.add_argument('--truncation_factor', type=float, default=10, help='Truncation for fusion is derived as truncation_factor*voxel_size.') return parser def read_directory(self, directory): """ Read directory. :param directory: path to directory :return: list of files """ files = [] for filename in os.listdir(directory): files.append(os.path.normpath(os.path.join(directory, filename))) return files def get_points(self): """ See https://stackoverflow.com/questions/9600801/evenly-distributing-n-points-on-a-sphere. :param n_points: number of points :type n_points: int :return: list of points :rtype: numpy.ndarray """ rnd = 1. points = [] offset = 2. / self.options.n_views increment = math.pi * (3. - math.sqrt(5.)); for i in range(self.options.n_views): y = ((i * offset) - 1) + (offset / 2); r = math.sqrt(1 - pow(y, 2)) phi = ((i + rnd) % self.options.n_views) * increment x = math.cos(phi) * r z = math.sin(phi) * r points.append([x, y, z]) # visualization.plot_point_cloud(np.array(points)) return np.array(points) def get_views(self): """ Generate a set of views to generate depth maps from. :param n_views: number of views per axis :type n_views: int :return: rotation matrices :rtype: [numpy.ndarray] """ Rs = [] points = self.get_points() for i in range(points.shape[0]): # https://math.stackexchange.com/questions/1465611/given-a-point-on-a-sphere-how-do-i-find-the-angles-needed-to-point-at-its-ce longitude = - math.atan2(points[i, 0], points[i, 1]) latitude = math.atan2(points[i, 2], math.sqrt(points[i, 0] ** 2 + points[i, 1] ** 2)) R_x = np.array([[1, 0, 0], [0, math.cos(latitude), -math.sin(latitude)], [0, math.sin(latitude), math.cos(latitude)]]) R_y = np.array([[math.cos(longitude), 0, math.sin(longitude)], [0, 1, 0], [-math.sin(longitude), 0, math.cos(longitude)]]) R = R_y.dot(R_x) Rs.append(R) return Rs def render(self, mesh, Rs): """ Render the given mesh using the generated views. :param base_mesh: mesh to render :type base_mesh: mesh.Mesh :param Rs: rotation matrices :type Rs: [numpy.ndarray] :return: depth maps :rtype: numpy.ndarray """ depthmaps = [] for i in range(len(Rs)): np_vertices = Rs[i].dot(mesh.vertices.astype(np.float64).T) np_vertices[2, :] += 1 np_faces = mesh.faces.astype(np.float64) np_faces += 1 depthmap, mask, img = librender.render(np_vertices.copy(), np_faces.T.copy(), self.render_intrinsics, self.znf, self.image_size) # This is mainly result of experimenting. # The core idea is that the volume of the object is enlarged slightly # (by subtracting a constant from the depth map). # Dilation additionally enlarges thin structures (e.g. for chairs). depthmap -= self.options.depth_offset_factor * self.voxel_size depthmap = ndimage.morphology.grey_erosion(depthmap, size=(3, 3)) depthmaps.append(depthmap) return depthmaps def fusion(self, depthmaps, Rs): """ Fuse the rendered depth maps. :param depthmaps: depth maps :type depthmaps: numpy.ndarray :param Rs: rotation matrices corresponding to views :type Rs: [numpy.ndarray] :return: (T)SDF :rtype: numpy.ndarray """ Ks = self.fusion_intrisics.reshape((1, 3, 3)) Ks = np.repeat(Ks, len(depthmaps), axis=0).astype(np.float32) Ts = [] for i in range(len(Rs)): Rs[i] = Rs[i] Ts.append(np.array([0, 0, 1])) Ts = np.array(Ts).astype(np.float32) Rs = np.array(Rs).astype(np.float32) depthmaps = np.array(depthmaps).astype(np.float32) views = libfusion.PyViews(depthmaps, Ks, Rs, Ts) # Note that this is an alias defined as libfusiongpu.tsdf_gpu or libfusioncpu.tsdf_cpu! return compute_tsdf(views, self.options.resolution, self.options.resolution, self.options.resolution, self.voxel_size, self.truncation, False) def run(self): """ Run the tool. """ if self.options.mode == 'render': self.run_render() elif self.options.mode == 'fuse': self.run_fuse() else: print('Invalid model, choose render or fuse.') exit() def run_render(self): """ Run rendering. """ assert os.path.exists(self.options.in_dir) common.makedir(self.options.depth_dir) files = self.read_directory(self.options.in_dir) timer = common.Timer() Rs = self.get_views() for filepath in files: timer.reset() mesh = common.Mesh.from_off(filepath) depths = self.render(mesh, Rs) depth_file = os.path.join(self.options.depth_dir, os.path.basename(filepath) + '.h5') common.write_hdf5(depth_file, np.array(depths)) print('[Data] wrote %s (%f seconds)' % (depth_file, timer.elapsed())) def run_fuse(self): """ Run fusion. """ assert os.path.exists(self.options.depth_dir) common.makedir(self.options.out_dir) files = self.read_directory(self.options.depth_dir) timer = common.Timer() Rs = self.get_views() for filepath in files: # As rendering might be slower, we wait for rendering to finish. # This allows to run rendering and fusing in parallel (more or less). depths = common.read_hdf5(filepath) timer.reset() tsdf = self.fusion(depths, Rs) tsdf = tsdf[0] vertices, triangles = libmcubes.marching_cubes(-tsdf, 0) vertices /= self.options.resolution vertices -= 0.5 off_file = os.path.join(self.options.out_dir, ntpath.basename(filepath)[:-3]) libmcubes.export_off(vertices, triangles, off_file) print('[Data] wrote %s (%f seconds)' % (off_file, timer.elapsed())) if __name__ == '__main__': app = Fusion() app.run()
d3d-hoi-main
preprocess/2_fusion.py
import os import subprocess from tqdm import tqdm from multiprocessing import Pool def convert(obj_path): try: load_folder = os.path.join(obj_path, 'parts_ply') save_folder = os.path.join(obj_path, 'parts_off') part_paths = [f.path for f in os.scandir(load_folder)] if not os.path.exists(save_folder): os.makedirs(save_folder) for part in part_paths: target_mesh = save_folder+'/'+part[-5:-3]+'off' subprocess.run(["meshlabserver", "-i", part, "-o", target_mesh]) except Exception as ex: return cad_folder = './cad_sapien' cad_classes = [f.name for f in os.scandir(cad_folder)] for cad_category in cad_classes: folder_path = os.path.join(cad_folder, cad_category) object_paths = [f.path for f in os.scandir(folder_path)] # Parallel threads = 16 # number of threads in your computer convert_iter = Pool(threads).imap(convert, object_paths) for _ in tqdm(convert_iter, total=len(object_paths)): pass
d3d-hoi-main
preprocess/convert_off.py
import pdb import subprocess import scandir from multiprocessing import Pool import json import common def remesh(obj_path): in_dir = os.path.join(obj_path, 'parts_off/') scaled_dir = os.path.join(obj_path, 'parts_scaled_off/') depth_dir = os.path.join(obj_path, 'parts_depth_off/') fused_dir = os.path.join(obj_path, 'parts_watertight_off/') out_dir = os.path.join(obj_path, 'parts_out_off/') final_dir = os.path.join(obj_path, 'final/') rescale_dir = os.path.join(obj_path, 'rescale/') # scale to .5 cube subprocess.call(["python", "1_scale.py", "--in_dir", in_dir, "--out_dir", scaled_dir]) # re-mesh using tsdf subprocess.call(["python", "2_fusion.py", "--mode", "render", "--in_dir", scaled_dir, "--depth_dir", depth_dir, "--out_dir", fused_dir]) subprocess.call(["python", "2_fusion.py", "--mode", "fuse", "--in_dir", scaled_dir, "--depth_dir", depth_dir, "--out_dir", fused_dir]) # simplify mesh subprocess.call(["python", "3_simplify.py", "--in_dir", fused_dir, "--out_dir", out_dir]) if not os.path.exists(final_dir): os.makedirs(final_dir) for file in os.listdir(rescale_dir): if file.endswith("rescale.json"): with open(os.path.join(rescale_dir, file)) as json_file: # load rescale value rescale_dict = json.load(json_file) scales = (1.0/rescale_dict['scales'][0], 1.0/rescale_dict['scales'][1], 1.0/rescale_dict['scales'][2]) translation = (-rescale_dict['translation'][2], -rescale_dict['translation'][1], -rescale_dict['translation'][0]) # load mesh mesh = common.Mesh.from_off(os.path.join(out_dir, file[0]+'.off')) # apply rescaling mesh.scale(scales) mesh.translate(translation) mesh.to_off(os.path.join(final_dir, file[0]+'_rescaled.off')) # change axis apply_script = "change_axis.mlx" source_mesh = os.path.join(final_dir, file[0]+'_rescaled.off') target_mesh = os.path.join(final_dir, file[0]+'_rescaled_sapien.off') subprocess.call(["meshlabserver", "-i", source_mesh, "-o", target_mesh, "-s", apply_script]) # convert to obj source_mesh = os.path.join(final_dir, file[0]+'_rescaled_sapien.off') target_mesh = os.path.join(final_dir, file[0]+'_rescaled_sapien.obj') subprocess.call(["meshlabserver", "-i", source_mesh, "-o", target_mesh]) return cad_folder = 'test' # cad data path (after convert_off) cad_classes = [f.name for f in scandir.scandir(cad_folder)] Processors = 10 # n of processors you want to use for cad_category in cad_classes: folder_path = os.path.join(cad_folder, cad_category) object_paths = [f.path for f in scandir.scandir(folder_path)] pool = Pool(processes=Processors) pool.map(remesh, object_paths) print('All jobs finished...')
d3d-hoi-main
preprocess/re-meshing.py
""" Some I/O utilities. """ import os import time import h5py import math import numpy as np def write_hdf5(file, tensor, key = 'tensor'): """ Write a simple tensor, i.e. numpy array ,to HDF5. :param file: path to file to write :type file: str :param tensor: tensor to write :type tensor: numpy.ndarray :param key: key to use for tensor :type key: str """ assert type(tensor) == np.ndarray, 'expects numpy.ndarray' h5f = h5py.File(file, 'w') chunks = list(tensor.shape) if len(chunks) > 2: chunks[2] = 1 if len(chunks) > 3: chunks[3] = 1 if len(chunks) > 4: chunks[4] = 1 h5f.create_dataset(key, data = tensor, chunks = tuple(chunks), compression = 'gzip') h5f.close() def read_hdf5(file, key = 'tensor'): """ Read a tensor, i.e. numpy array, from HDF5. :param file: path to file to read :type file: str :param key: key to read :type key: str :return: tensor :rtype: numpy.ndarray """ assert os.path.exists(file), 'file %s not found' % file h5f = h5py.File(file, 'r') assert key in h5f.keys(), 'key %s not found in file %s' % (key, file) tensor = h5f[key][()] h5f.close() return tensor def write_off(file, vertices, faces): """ Writes the given vertices and faces to OFF. :param vertices: vertices as tuples of (x, y, z) coordinates :type vertices: [(float)] :param faces: faces as tuples of (num_vertices, vertex_id_1, vertex_id_2, ...) :type faces: [(int)] """ num_vertices = len(vertices) num_faces = len(faces) assert num_vertices > 0 assert num_faces > 0 with open(file, 'w') as fp: fp.write('OFF\n') fp.write(str(num_vertices) + ' ' + str(num_faces) + ' 0\n') for vertex in vertices: assert len(vertex) == 3, 'invalid vertex with %d dimensions found (%s)' % (len(vertex), file) fp.write(str(vertex[0]) + ' ' + str(vertex[1]) + ' ' + str(vertex[2]) + '\n') for face in faces: assert face[0] == 3, 'only triangular faces supported (%s)' % file assert len(face) == 4, 'faces need to have 3 vertices, but found %d (%s)' % (len(face), file) for i in range(len(face)): assert face[i] >= 0 and face[i] < num_vertices, 'invalid vertex index %d (of %d vertices) (%s)' % (face[i], num_vertices, file) fp.write(str(face[i])) if i < len(face) - 1: fp.write(' ') fp.write('\n') # add empty line to be sure fp.write('\n') def read_off(file): """ Reads vertices and faces from an off file. :param file: path to file to read :type file: str :return: vertices and faces as lists of tuples :rtype: [(float)], [(int)] """ assert os.path.exists(file), 'file %s not found' % file with open(file, 'r') as fp: lines = fp.readlines() lines = [line.strip() for line in lines] # Fix for ModelNet bug were 'OFF' and the number of vertices and faces are # all in the first line. if len(lines[0]) > 3: assert lines[0][:3] == 'OFF' or lines[0][:3] == 'off', 'invalid OFF file %s' % file parts = lines[0][3:].split(' ') assert len(parts) == 3 num_vertices = int(parts[0]) assert num_vertices > 0 num_faces = int(parts[1]) assert num_faces > 0 start_index = 1 # This is the regular case! else: assert lines[0] == 'OFF' or lines[0] == 'off', 'invalid OFF file %s' % file parts = lines[1].split(' ') assert len(parts) == 3 num_vertices = int(parts[0]) assert num_vertices > 0 num_faces = int(parts[1]) assert num_faces > 0 start_index = 2 vertices = [] for i in range(num_vertices): vertex = lines[start_index + i].split(' ') vertex = [float(point.strip()) for point in vertex if point != ''] assert len(vertex) == 3 vertices.append(vertex) faces = [] for i in range(num_faces): face = lines[start_index + num_vertices + i].split(' ') face = [index.strip() for index in face if index != ''] # check to be sure for index in face: assert index != '', 'found empty vertex index: %s (%s)' % (lines[start_index + num_vertices + i], file) face = [int(index) for index in face] assert face[0] == len(face) - 1, 'face should have %d vertices but as %d (%s)' % (face[0], len(face) - 1, file) assert face[0] == 3, 'only triangular meshes supported (%s)' % file for index in face: assert index >= 0 and index < num_vertices, 'vertex %d (of %d vertices) does not exist (%s)' % (index, num_vertices, file) assert len(face) > 1 faces.append(face) return vertices, faces assert False, 'could not open %s' % file def write_obj(file, vertices, faces): """ Writes the given vertices and faces to OBJ. :param vertices: vertices as tuples of (x, y, z) coordinates :type vertices: [(float)] :param faces: faces as tuples of (num_vertices, vertex_id_1, vertex_id_2, ...) :type faces: [(int)] """ num_vertices = len(vertices) num_faces = len(faces) assert num_vertices > 0 assert num_faces > 0 with open(file, 'w') as fp: for vertex in vertices: assert len(vertex) == 3, 'invalid vertex with %d dimensions found (%s)' % (len(vertex), file) fp.write('v' + ' ' + str(vertex[0]) + ' ' + str(vertex[1]) + ' ' + str(vertex[2]) + '\n') for face in faces: assert len(face) == 3, 'only triangular faces supported (%s)' % file fp.write('f ') for i in range(len(face)): assert face[i] >= 0 and face[i] < num_vertices, 'invalid vertex index %d (of %d vertices) (%s)' % (face[i], num_vertices, file) # face indices are 1-based fp.write(str(face[i] + 1)) if i < len(face) - 1: fp.write(' ') fp.write('\n') # add empty line to be sure fp.write('\n') def read_obj(file): """ Reads vertices and faces from an obj file. :param file: path to file to read :type file: str :return: vertices and faces as lists of tuples :rtype: [(float)], [(int)] """ assert os.path.exists(file), 'file %s not found' % file with open(file, 'r') as fp: lines = fp.readlines() lines = [line.strip() for line in lines if line.strip()] vertices = [] faces = [] for line in lines: parts = line.split(' ') parts = [part.strip() for part in parts if part] if parts[0] == 'v': assert len(parts) == 4, \ 'vertex should be of the form v x y z, but found %d parts instead (%s)' % (len(parts), file) assert parts[1] != '', 'vertex x coordinate is empty (%s)' % file assert parts[2] != '', 'vertex y coordinate is empty (%s)' % file assert parts[3] != '', 'vertex z coordinate is empty (%s)' % file vertices.append([float(parts[1]), float(parts[2]), float(parts[3])]) elif parts[0] == 'f': assert len(parts) == 4, \ 'face should be of the form f v1/vt1/vn1 v2/vt2/vn2 v2/vt2/vn2, but found %d parts (%s) instead (%s)' % (len(parts), line, file) components = parts[1].split('/') assert len(components) >= 1 and len(components) <= 3, \ 'face component should have the forms v, v/vt or v/vt/vn, but found %d components instead (%s)' % (len(components), file) assert components[0].strip() != '', \ 'face component is empty (%s)' % file v1 = int(components[0]) components = parts[2].split('/') assert len(components) >= 1 and len(components) <= 3, \ 'face component should have the forms v, v/vt or v/vt/vn, but found %d components instead (%s)' % (len(components), file) assert components[0].strip() != '', \ 'face component is empty (%s)' % file v2 = int(components[0]) components = parts[3].split('/') assert len(components) >= 1 and len(components) <= 3, \ 'face component should have the forms v, v/vt or v/vt/vn, but found %d components instead (%s)' % (len(components), file) assert components[0].strip() != '', \ 'face component is empty (%s)' % file v3 = int(components[0]) #assert v1 != v2 and v2 != v3 and v3 != v2, 'degenerate face detected: %d %d %d (%s)' % (v1, v2, v3, file) if v1 == v2 or v2 == v3 or v1 == v3: print('[Info] skipping degenerate face in %s' % file) else: faces.append([v1 - 1, v2 - 1, v3 - 1]) # indices are 1-based! else: assert False, 'expected either vertex or face but got line: %s (%s)' % (line, file) return vertices, faces assert False, 'could not open %s' % file def makedir(dir): """ Creates directory if it does not exist. :param dir: directory path :type dir: str """ if not os.path.exists(dir): os.makedirs(dir) class Mesh: """ Represents a mesh. """ def __init__(self, vertices = [[]], faces = [[]]): """ Construct a mesh from vertices and faces. :param vertices: list of vertices, or numpy array :type vertices: [[float]] or numpy.ndarray :param faces: list of faces or numpy array, i.e. the indices of the corresponding vertices per triangular face :type faces: [[int]] fo rnumpy.ndarray """ self.vertices = np.array(vertices, dtype = float) """ (numpy.ndarray) Vertices. """ self.faces = np.array(faces, dtype = int) """ (numpy.ndarray) Faces. """ assert self.vertices.shape[1] == 3 assert self.faces.shape[1] == 3 def extents(self): """ Get the extents. :return: (min_x, min_y, min_z), (max_x, max_y, max_z) :rtype: (float, float, float), (float, float, float) """ min = [0]*3 max = [0]*3 for i in range(3): min[i] = np.min(self.vertices[:, i]) max[i] = np.max(self.vertices[:, i]) return tuple(min), tuple(max) def switch_axes(self, axis_1, axis_2): """ Switch the two axes, this is usually useful for switching y and z axes. :param axis_1: index of first axis :type axis_1: int :param axis_2: index of second axis :type axis_2: int """ temp = np.copy(self.vertices[:, axis_1]) self.vertices[:, axis_1] = self.vertices[:, axis_2] self.vertices[:, axis_2] = temp def mirror(self, axis): """ Mirror given axis. :param axis: axis to mirror :type axis: int """ self.vertices[:, axis] *= -1 def scale(self, scales): """ Scale the mesh in all dimensions. :param scales: tuple of length 3 with scale for (x, y, z) :type scales: (float, float, float) """ assert len(scales) == 3 for i in range(3): self.vertices[:, i] *= scales[i] def translate(self, translation): """ Translate the mesh. :param translation: translation as (x, y, z) :type translation: (float, float, float) """ assert len(translation) == 3 for i in range(3): self.vertices[:, i] += translation[i] def _rotate(self, R): self.vertices = np.dot(R, self.vertices.T) self.vertices = self.vertices.T def rotate(self, rotation): """ Rotate the mesh. :param rotation: rotation in (angle_x, angle_y, angle_z); angles in radians :type rotation: (float, float, float :return: """ assert len(rotation) == 3 x = rotation[0] y = rotation[1] z = rotation[2] # rotation around the x axis R = np.array([[1, 0, 0], [0, math.cos(x), -math.sin(x)], [0, math.sin(x), math.cos(x)]]) self._rotate(R) # rotation around the y axis R = np.array([[math.cos(y), 0, math.sin(y)], [0, 1, 0], [-math.sin(y), 0, math.cos(y)]]) self._rotate(R) # rotation around the z axis R = np.array([[math.cos(z), -math.sin(z), 0], [math.sin(z), math.cos(z), 0], [0, 0, 1]]) self._rotate(R) def inv_rotate(self, rotation): """ Rotate the mesh. :param rotation: rotation in (angle_x, angle_y, angle_z); angles in radians :type rotation: (float, float, float :return: """ assert len(rotation) == 3 x = rotation[0] y = rotation[1] z = rotation[2] # rotation around the x axis R = np.array([[1, 0, 0], [0, math.cos(x), -math.sin(x)], [0, math.sin(x), math.cos(x)]]) R = R.T self._rotate(R) # rotation around the y axis R = np.array([[math.cos(y), 0, math.sin(y)], [0, 1, 0], [-math.sin(y), 0, math.cos(y)]]) R = R.T self._rotate(R) # rotation around the z axis R = np.array([[math.cos(z), -math.sin(z), 0], [math.sin(z), math.cos(z), 0], [0, 0, 1]]) R = R.T self._rotate(R) def copy(self): """ Copy the mesh. :return: copy of the mesh :rtype: Mesh """ mesh = Mesh(self.vertices.copy(), self.faces.copy()) return mesh @staticmethod def from_off(filepath): """ Read a mesh from OFF. :param filepath: path to OFF file :type filepath: str :return: mesh :rtype: Mesh """ vertices, faces = read_off(filepath) real_faces = [] for face in faces: assert len(face) == 4 real_faces.append([face[1], face[2], face[3]]) return Mesh(vertices, real_faces) def to_off(self, filepath): """ Write mesh to OFF. :param filepath: path to write file to :type filepath: str """ faces = np.ones((self.faces.shape[0], 4), dtype = int)*3 faces[:, 1:4] = self.faces[:, :] write_off(filepath, self.vertices.tolist(), faces.tolist()) @staticmethod def from_obj(filepath): """ Read a mesh from OBJ. :param filepath: path to OFF file :type filepath: str :return: mesh :rtype: Mesh """ vertices, faces = read_obj(filepath) return Mesh(vertices, faces) def to_obj(self, filepath): """ Write mesh to OBJ file. :param filepath: path to OBJ file :type filepath: str """ write_obj(filepath, self.vertices.tolist(), self.faces.tolist()) class Timer: """ Simple wrapper for time.clock(). """ def __init__(self): """ Initialize and start timer. """ self.start = time.clock() """ (float) Seconds. """ def reset(self): """ Reset timer. """ self.start = time.clock() def elapsed(self): """ Get elapsed time in seconds :return: elapsed time in seconds :rtype: float """ return (time.clock() - self.start)
d3d-hoi-main
preprocess/common.py
# Copyright (c) Facebook, Inc. and its affiliates. import math import os import torch import numpy as np from tqdm import tqdm_notebook import imageio import torch.nn as nn import torch.nn.functional as F import matplotlib.pyplot as plt from skimage import img_as_ubyte from tqdm import tqdm import re import open3d as o3d import itertools # io utils from pytorch3d.io import load_obj, save_obj # datastructures from pytorch3d.structures import Meshes # 3D transformations functions from pytorch3d.transforms import Rotate, Translate # rendering components from pytorch3d.renderer import ( OpenGLPerspectiveCameras, look_at_view_transform, look_at_rotation, RasterizationSettings, MeshRenderer, MeshRasterizer, BlendParams, SoftSilhouetteShader, HardPhongShader, PointLights ) import json import csv SAPIEN_FOLDER = './partnet-mobility-v0' OUT_FOLDER = './cad_sapien' # helper function for computing roation matrix in 3D def rotation_matrix(axis, theta): """ Return the rotation matrix associated with counterclockwise rotation about the given axis by theta radians. """ axis = np.asarray(axis) axis = axis / math.sqrt(np.dot(axis, axis)) a = math.cos(theta / 2.0) b, c, d = -axis * math.sin(theta / 2.0) aa, bb, cc, dd = a * a, b * b, c * c, d * d bc, ad, ac, ab, bd, cd = b * c, a * d, a * c, a * b, b * d, c * d return np.array([[aa + bb - cc - dd, 2 * (bc + ad), 2 * (bd - ac)], [2 * (bc - ad), aa + cc - bb - dd, 2 * (cd + ab)], [2 * (bd + ac), 2 * (cd - ab), aa + dd - bb - cc]]) # helper function for traversing a tree def traverse_tree(current_node, mesh_dict): # further traverse the tree if not at leaf node yet if 'children' in current_node.keys(): for idx in range(len(current_node['children'])): traverse_tree(current_node['children'][idx], mesh_dict) else: # insert meshes associated with an unique part id assert current_node['id'] not in mesh_dict.keys() mesh_dict[current_node['id']] = current_node['objs'] return # helper function for loading and merging meshes def merge_meshes(save_folder, ids, mesh_dict): for count, part_ids in enumerate(ids): part_meshes = [mesh_dict[x] for x in part_ids] part_meshes = list(itertools.chain(*part_meshes)) verts_list = np.empty((0,3)) faces_list = np.empty((0,3))#.long() for part_mesh in part_meshes: obj_path = os.path.join(part_folder, 'textured_objs', part_mesh,)+'.obj' # check if mesh exist if not os.path.exists(obj_path): print(obj_path) continue mesh = o3d.io.read_triangle_mesh(obj_path) verts = np.asarray(mesh.vertices) faces = np.asarray(mesh.triangles) faces = faces + verts_list.shape[0] verts_list = np.concatenate([verts_list, verts]) faces_list = np.concatenate([faces_list, faces]) mesh = o3d.geometry.TriangleMesh(vertices=o3d.utility.Vector3dVector(verts_list), triangles=o3d.utility.Vector3iVector(faces_list)) mesh.compute_vertex_normals() save_path = os.path.join(save_folder, 'parts_ply') if not os.path.exists(save_path): os.makedirs(save_path) o3d.io.write_triangle_mesh(save_path+'/'+str(count)+'.ply', mesh) return part_home = SAPIEN_FOLDER save_home = OUT_FOLDER classes = ['StorageFurniture','Microwave','Laptop','WashingMachine','TrashCan','Oven', 'Dishwasher','Refrigerator'] # 8 categories # Manually verify the part category careParts = {} careParts['Refrigerator'] = ['door', 'other_leaf', 'display_panel', 'door_frame', 'control_panel', 'glass'] careParts['Microwave'] = ['door'] careParts['Laptop'] = ['shaft', 'other_leaf', 'screen_side', 'screen', 'screen_frame'] careParts['WashingMachine'] = ['door'] careParts['TrashCan'] = ['opener', 'lid', 'drawer', 'cover', 'cover_lid', 'frame_vertical_bar', 'container', 'other_leaf'] careParts['Oven'] = ['door', 'door_frame'] careParts['Dishwasher'] = ['door', 'shelf', 'display_panel', 'door_frame'] careParts['StorageFurniture'] = ['cabinet_door', 'mirror', 'drawer', 'drawer_box', 'door', 'shelf', 'handle', 'glass', 'cabinet_door_surface', 'other_leaf', 'countertop'] careParts['Toilet'] = ['lid', 'seat'] #careParts['Table'] = ['drawer', 'cabinet_door_surface', 'drawer_box', 'handle', #'drawer_front', 'board', 'cabinet_door', 'shelf', 'keyboard_tray_surface'] #careParts['Box'] = ['rotation_lid', 'drawer', 'countertop', 'lid_surface'] # font on top #careParts['FoldingChair'] = ['seat'] #careParts['Suitcase'] = ['lid', 'pull-out_handle'] count = 0 # all dirIDs within this class with open('partnetsim.models.csv', 'r') as file: reader = csv.DictReader(file) for row in reader: if row['category'] in classes: part_dir = row['category'] part_id = row['dirId'] part_folder = os.path.join(part_home, str(part_id)) save_folder = os.path.join(save_home, part_dir, str(part_id)) if not os.path.exists(save_folder): os.makedirs(save_folder) count+=1 # load meshes referenced json file if not os.path.isfile(os.path.join(part_folder, 'result.json')): continue with open(os.path.join(part_folder, 'result.json')) as json_file: part_meshes = json.load(json_file) # traverse through a tree mesh_dict = {} root = part_meshes[0] traverse_tree(root, mesh_dict) types = [] with open(os.path.join(part_folder, 'mobility.urdf')) as f: our_lines = f.readlines() for line in our_lines: myString = re.sub('\s+',' ',line) if '<joint name=' in myString: m_type = myString.split("type=",1)[1][1:-3] types.append(m_type) type_idx = 0 details = {} details_saved = {} # load mobility_v2 json file with open(os.path.join(part_folder, 'mobility_v2.json')) as json_file: mobility_parts = json.load(json_file) print('processing %s' % part_folder) part_div = [] for idx, joint_part in enumerate(mobility_parts): # visual names belonging to one joint part joint_part_names = joint_part['parts'] assert(joint_part_names) # make sure not empty # parse ids for each part ids = [x['id'] for x in joint_part_names] part_div.append(ids) # save motion information details[str(idx)] = joint_part['jointData'].copy() details_saved[str(idx)] = joint_part['jointData'].copy() # set type for care part if type_idx<len(types): if joint_part['name'] in careParts[part_dir]: details[str(idx)]['type'] = types[type_idx] details_saved[str(idx)]['type'] = types[type_idx] type_idx += 1 else: if details[str(idx)]: assert type_idx>=len(types) assert joint_part['name'] not in careParts[part_dir] # remove non-care part if not joint_part['jointData'] or joint_part['name'] not in careParts[part_dir]: details[str(idx)] = {} details_saved.pop(str(idx), None) with open(os.path.join(save_folder, 'motion.json'), 'w') as outfile: json.dump(details_saved, outfile) assert len(details) == len(part_div) part_idx = 0 fix_part = [] parts = [] for key, value in details.items(): if value == {}: fix_part.append(part_div[part_idx]) else: parts.append(part_div[part_idx]) part_idx += 1 fix_part = list(itertools.chain(*fix_part)) parts.append(fix_part) # load, merge, and save part mesh file merge_meshes(save_folder, parts, mesh_dict) print(count) print('all done...')
d3d-hoi-main
preprocess/process_data.py
import os import common import argparse import numpy as np import json class Scale: """ Scales a bunch of meshes. """ def __init__(self): """ Constructor. """ parser = self.get_parser() self.options = parser.parse_args() def get_parser(self): """ Get parser of tool. :return: parser """ parser = argparse.ArgumentParser(description='Scale a set of meshes stored as OFF files.') parser.add_argument('--in_dir', type=str, help='Path to input directory.') parser.add_argument('--out_dir', type=str, help='Path to output directory; files within are overwritten!') parser.add_argument('--padding', type=float, default=0.1, help='Relative padding applied on each side.') return parser def read_directory(self, directory): """ Read directory. :param directory: path to directory :return: list of files """ files = [] for filename in os.listdir(directory): files.append(os.path.normpath(os.path.join(directory, filename))) return files def run(self): """ Run the tool, i.e. scale all found OFF files. """ assert os.path.exists(self.options.in_dir) common.makedir(self.options.out_dir) files = self.read_directory(self.options.in_dir) for filepath in files: mesh = common.Mesh.from_off(filepath) # Get extents of model. min, max = mesh.extents() total_min = np.min(np.array(min)) total_max = np.max(np.array(max)) # Set the center (although this should usually be the origin already). centers = ( (min[0] + max[0]) / 2, (min[1] + max[1]) / 2, (min[2] + max[2]) / 2 ) # Scales all dimensions equally. sizes = ( total_max - total_min, total_max - total_min, total_max - total_min ) translation = ( -centers[0], -centers[1], -centers[2] ) scales = ( 1 / (sizes[0] + 2 * self.options.padding * sizes[0]), 1 / (sizes[1] + 2 * self.options.padding * sizes[1]), 1 / (sizes[2] + 2 * self.options.padding * sizes[2]) ) mesh.translate(translation) mesh.scale(scales) print('[Data] %s extents before %f - %f, %f - %f, %f - %f' % (os.path.basename(filepath), min[0], max[0], min[1], max[1], min[2], max[2])) min, max = mesh.extents() print('[Data] %s extents after %f - %f, %f - %f, %f - %f' % (os.path.basename(filepath), min[0], max[0], min[1], max[1], min[2], max[2])) # May also switch axes if necessary. #mesh.switch_axes(1, 2) mesh.to_off(os.path.join(self.options.out_dir, os.path.basename(filepath))) # save parameters rescale = {} rescale['scales'] = scales rescale['translation'] = translation if not os.path.exists(self.options.out_dir[:-18]+'/rescale'): os.makedirs(self.options.out_dir[:-18]+'/rescale') path = self.options.out_dir[:-18]+'/rescale/'+os.path.basename(filepath)[0]+'_rescale.json' with open(path, 'w') as outfile: json.dump(rescale, outfile) if __name__ == '__main__': app = Scale() app.run()
d3d-hoi-main
preprocess/1_scale.py
import re # Defining labels ABSTAIN = 0 ABNORMAL = 1 NORMAL= 2 def LF_report_is_short(report): """ Checks if report is short. """ return NORMAL if len(report) < 280 else ABSTAIN negative_inflection_words = ["but", "however", "otherwise"] def LF_negative_inflection_words_in_report(report): return ABNORMAL if any(word in report.lower() \ for word in negative_inflection_words) else ABSTAIN def LF_is_seen_or_noted_in_report(report): return ABNORMAL if any(word in report.lower() \ for word in ["is seen", "noted"]) else ABSTAIN def LF_disease_in_report(report): return ABNORMAL if "disease" in report.lower() else ABSTAIN def LF_recommend_in_report(report): return ABNORMAL if "recommend" in report.lower() else ABSTAIN def LF_mm_in_report(report): return ABNORMAL if any(word in report.lower() \ for word in ["mm", "cm"]) else ABSTAIN abnormal_mesh_terms = ["opacity", "cardiomegaly", "calcinosis", "hypoinflation", "calcified granuloma", "thoracic vertebrae", "degenerative", "hyperdistention", "catheters", "granulomatous", "nodule", "fracture" "surgical", "instruments", "emphysema"] def LF_abnormal_mesh_terms_in_report(report): if any(mesh in report.lower() for mesh in abnormal_mesh_terms): return ABNORMAL else: return ABSTAIN words_indicating_normalcy = ['clear', 'no', 'normal', 'unremarkable', 'free', 'midline'] def LF_consistency_in_report(report): ''' The words 'clear', 'no', 'normal', 'free', 'midline' in findings section of the report ''' report = report findings = report[report.find('FINDINGS:'):] findings = findings[:findings.find('IMPRESSION:')] sents = findings.split('.') num_sents_without_normal = ABSTAIN for sent in sents: sent = sent.lower() if not any(word in sent for word in words_indicating_normalcy): num_sents_without_normal += 1 elif 'not' in sent: num_sents_without_normal += 1 return NORMAL if num_sents_without_normal < 2 else ABNORMAL categories = ['normal','opacity','cardiomegaly','calcinosis', 'lung/hypoinflation','calcified granuloma', 'thoracic vertebrae/degenerative','lung/hyperdistention', 'spine/degenerative','catheters, indwelling', 'granulomatous disease','nodule','surgical instruments', 'scoliosis', 'osteophyte', 'spondylosis','fractures, bone'] def LF_normal(report): r = re.compile('No acute cardiopulmonary abnormality',re.IGNORECASE) for s in report.split("."): if r.search(s): return NORMAL return ABSTAIN reg_equivocation = re.compile('unlikely|likely|suggests|questionable|concerning|possibly|potentially|could represent|may represent|may relate|cannot exclude|can\'t exclude|may be',re.IGNORECASE) def LF_positive_MeshTerm(report): for idx in range(1,len(categories)): reg_pos = re.compile(categories[idx],re.IGNORECASE) reg_neg = re.compile('(No|without|resolution)\\s([a-zA-Z0-9\-,_]*\\s){0,10}'+categories[idx],re.IGNORECASE) for s in report.split("."): if reg_pos.search(s) and (not reg_neg.search(s)) and (not reg_equivocation.search(s)): return ABNORMAL return ABSTAIN def LF_fracture(report): reg_pos = re.compile('fracture',re.IGNORECASE) reg_neg = re.compile('(No|without|resolution)\\s([a-zA-Z0-9\-,_]*\\s){0,10}fracture',re.IGNORECASE) for s in report.split("."): if reg_pos.search(s) and (not reg_neg.search(s)) and (not reg_equivocation.search(s)): return ABNORMAL return ABSTAIN def LF_calcinosis(report): reg_01 = re.compile('calc',re.IGNORECASE) reg_02 = re.compile('arter|aorta|muscle|tissue',re.IGNORECASE) for s in report.split("."): if reg_01.search(s) and reg_02.search(s): return ABNORMAL return ABSTAIN def LF_degen_spine(report): reg_01 = re.compile('degen',re.IGNORECASE) reg_02 = re.compile('spine',re.IGNORECASE) for s in report.split("."): if reg_01.search(s) and reg_02.search(s): return ABNORMAL return ABSTAIN def LF_lung_hypoinflation(report): #reg_01 = re.compile('lung|pulmonary',re.IGNORECASE) reg_01 = re.compile('hypoinflation|collapse|(low|decrease|diminish)\\s([a-zA-Z0-9\-,_]*\\s){0,4}volume',re.IGNORECASE) for s in report.split("."): if reg_01.search(s): return ABNORMAL return ABSTAIN def LF_lung_hyperdistention(report): #reg_01 = re.compile('lung|pulmonary',re.IGNORECASE) reg_01 = re.compile('increased volume|hyperexpan|inflated',re.IGNORECASE) for s in report.split("."): if reg_01.search(s): return ABNORMAL return ABSTAIN def LF_catheters(report): reg_01 = re.compile(' line|catheter|PICC',re.IGNORECASE) for s in report.split("."): if reg_01.search(s): return ABNORMAL return ABSTAIN def LF_surgical(report): reg_01 = re.compile('clip',re.IGNORECASE) for s in report.split("."): if reg_01.search(s): return ABNORMAL return ABSTAIN def LF_granuloma(report): reg_01 = re.compile('granuloma',re.IGNORECASE) for s in report.split("."): if reg_01.search(s): return ABNORMAL return ABSTAIN
cross-modal-ws-demo-master
openi_demo/labeling_functions.py
import os import numpy as np import torch import torchvision.transforms as transforms try: from PIL import Image as pil_image except ImportError: pil_image = None def load_ids(filename): fin = open(filename, "r") return [_.strip() for _ in fin] class StdNormalize(object): """ Normalize torch tensor to have zero mean and unit std deviation """ def __call__(self, *inputs): outputs = [] for idx, _input in enumerate(inputs): _input = _input.sub(_input.mean()).div(_input.std()) outputs.append(_input) return outputs if idx > 1 else outputs[0] def transform(input_size): return transforms.Compose( [transforms.Resize(input_size), transforms.ToTensor(), StdNormalize()] ) # default xray loader from png def default_xray_loader(xray_path, img_rows=224, img_cols=224): xray = load_img( xray_path, color_mode="grayscale", target_size=(img_rows, img_cols, 1) ) xray = img_to_array(xray) xray = np.dstack([xray, xray, xray]) xray = array_to_img(xray, "channels_last") return xray class CXRFileList(torch.utils.data.Dataset): def __init__(self, paths, label=None, transform=None, loader=default_xray_loader, ref=None, lfs=None, slice_mode=None, get_slice_labels=False): self.paths = paths self.label = label self.transform = transform self.loader = loader self.ref = ref # Note: slice_labels and labels in same order! if lfs is not None: self.lfs = torch.from_numpy(np.array(lfs).astype(np.float32)) def __getitem__(self, index): idx = 0 if self.ref is not None and isinstance(self.paths[index],list): for i in range(len(self.paths[index])): impath = self.paths[index][i] if impath in self.ref: idx=i break else: impath = self.paths[index] y = self.label[index] img = self.loader(impath) if self.transform is not None: img = self.transform(img) return img, y def __len__(self): return len(self.paths) def get_data_loader( paths, labels, batch_size=32, input_size=224, shuffle=False, ): # Load front image index fin=open('./data/front_view_ids.txt', "r") front_view_ids = [_.strip() for _ in fin] fin.close() dataset = CXRFileList( paths=paths, label=labels, transform=transform(input_size), ref=front_view_ids, ) # Build data loader data_loader = torch.utils.data.DataLoader( dataset, sampler=None, batch_size=batch_size, shuffle=shuffle, ) return data_loader def img_to_array(img, data_format="channels_last", dtype="float32"): """Converts a PIL Image instance to a Numpy array. # Arguments img: PIL Image instance. data_format: Image data format, either "channels_first" or "channels_last". dtype: Dtype to use for the returned array. # Returns A 3D Numpy array. # Raises ValueError: if invalid `img` or `data_format` is passed. """ if data_format not in {"channels_first", "channels_last"}: raise ValueError("Unknown data_format: %s" % data_format) # Numpy array x has format (height, width, channel) # or (channel, height, width) # but original PIL image has format (width, height, channel) x = np.asarray(img, dtype=dtype) if len(x.shape) == 3: if data_format == "channels_first": x = x.transpose(2, 0, 1) elif len(x.shape) == 2: if data_format == "channels_first": x = x.reshape((1, x.shape[0], x.shape[1])) else: x = x.reshape((x.shape[0], x.shape[1], 1)) else: raise ValueError("Unsupported image shape: %s" % (x.shape,)) return x def array_to_img(x, data_format="channels_last", scale=True, dtype="float32"): """Converts a 3D Numpy array to a PIL Image instance. # Arguments x: Input Numpy array. data_format: Image data format. either "channels_first" or "channels_last". scale: Whether to rescale image values to be within `[0, 255]`. dtype: Dtype to use. # Returns A PIL Image instance. # Raises ImportError: if PIL is not available. ValueError: if invalid `x` or `data_format` is passed. """ if pil_image is None: raise ImportError( "Could not import PIL.Image. " "The use of `array_to_img` requires PIL." ) x = np.asarray(x, dtype=dtype) if x.ndim != 3: raise ValueError( "Expected image array to have rank 3 (single image). " "Got array with shape: %s" % (x.shape,) ) if data_format not in {"channels_first", "channels_last"}: raise ValueError("Invalid data_format: %s" % data_format) # Original Numpy array x has format (height, width, channel) # or (channel, height, width) # but target PIL image has format (width, height, channel) if data_format == "channels_first": x = x.transpose(1, 2, 0) if scale: x = x + max(-np.min(x), 0) x_max = np.max(x) if x_max != 0: x /= x_max x *= 255 if x.shape[2] == 4: # RGBA return pil_image.fromarray(x.astype("uint8"), "RGBA") elif x.shape[2] == 3: # RGB return pil_image.fromarray(x.astype("uint8"), "RGB") elif x.shape[2] == 1: # grayscale return pil_image.fromarray(x[:, :, 0].astype("uint8"), "L") else: raise ValueError("Unsupported channel number: %s" % (x.shape[2],)) if pil_image is not None: _PIL_INTERPOLATION_METHODS = { "nearest": pil_image.NEAREST, "bilinear": pil_image.BILINEAR, "bicubic": pil_image.BICUBIC, } # These methods were only introduced in version 3.4.0 (2016). if hasattr(pil_image, "HAMMING"): _PIL_INTERPOLATION_METHODS["hamming"] = pil_image.HAMMING if hasattr(pil_image, "BOX"): _PIL_INTERPOLATION_METHODS["box"] = pil_image.BOX # This method is new in version 1.1.3 (2013). if hasattr(pil_image, "LANCZOS"): _PIL_INTERPOLATION_METHODS["lanczos"] = pil_image.LANCZOS def load_img( path, grayscale=False, color_mode="rgb", target_size=None, interpolation="nearest" ): """Loads an image into PIL format. # Arguments path: Path to image file. color_mode: One of "grayscale", "rgb", "rgba". Default: "rgb". The desired image format. target_size: Either `None` (default to original size) or tuple of ints `(img_height, img_width)`. interpolation: Interpolation method used to resample the image if the target size is different from that of the loaded image. Supported methods are "nearest", "bilinear", and "bicubic". If PIL version 1.1.3 or newer is installed, "lanczos" is also supported. If PIL version 3.4.0 or newer is installed, "box" and "hamming" are also supported. By default, "nearest" is used. # Returns A PIL Image instance. # Raises ImportError: if PIL is not available. ValueError: if interpolation method is not supported. """ if grayscale is True: warnings.warn("grayscale is deprecated. Please use " 'color_mode = "grayscale"') color_mode = "grayscale" if pil_image is None: raise ImportError( "Could not import PIL.Image. " "The use of `array_to_img` requires PIL." ) img = pil_image.open(path) if color_mode == "grayscale": if img.mode != "L": img = img.convert("L") elif color_mode == "rgba": if img.mode != "RGBA": img = img.convert("RGBA") elif color_mode == "rgb": if img.mode != "RGB": img = img.convert("RGB") else: raise ValueError('color_mode must be "grayscale", "rgb", or "rgba"') if target_size is not None: width_height_tuple = (target_size[1], target_size[0]) if img.size != width_height_tuple: if interpolation not in _PIL_INTERPOLATION_METHODS: raise ValueError( "Invalid interpolation method {} specified. Supported " "methods are {}".format( interpolation, ", ".join(_PIL_INTERPOLATION_METHODS.keys()) ) ) resample = _PIL_INTERPOLATION_METHODS[interpolation] img = img.resize(width_height_tuple, resample) return img
cross-modal-ws-demo-master
openi_demo/utils.py
import re import spacy spacy_en = spacy.load('en_core_web_sm') # Setting LF output values ABSTAIN_VAL = 0 SEIZURE_VAL = 1 NO_SEIZURE_VAL = -1 ###################################################################################################### ##### HELPFUL REGEXES AND ONTOLOGIES ###################################################################################################### # Defining useful regular expressions. SIMPLE_NORMAL_RE = re.compile('\snormal\s', re.IGNORECASE) # Nouns indicating an EEG EEGSYN = r'(EEG|study|record|electroencephalogram|ambulatory\s+EEG|video.EEG\sstudy)' # Phrases indicating a normal study NORMAL_STUDY_PHRASES = re.compile(rf'\snormal\s+{EEGSYN}' rf'|\snormal\s+awake\s+and\s+asleep\s+{EEGSYN}' rf'|\snormal\s+awake\s+{EEGSYN}' rf'|\snormal\s+awake\s+and\s+drowsy\s+{EEGSYN}' rf'|\snormal\s+asleep\s+{EEGSYN}' rf'|\s{EEGSYN}\s+(is|was)\s+normal' rf'|\srange\s+of\s+normal' # generous rf'|\s(is|was)\s+normal\s+for\s+age' #rf'|(EEG|study|record)\s+(is|was)\s+normal\s+for\s+age' #rf'|(EEG|study|record)\s+(is|was)\s+normal\s+for\s+age' rf'|{EEGSYN}\s+(is|was)\s+within\s+normal\s+' rf'|{EEGSYN}\s+(is|was)\s+borderline\+snormal' rf'|{EEGSYN}\s+(is|was)\s+at\s+the\s+borderline\s+of\s+being\s+normal' rf'|{EEGSYN}\s+capturing\s+wakefulness\s+and\s+sleep\s+(is|was)\s+normal' rf'|{EEGSYN}\s+capturing\s+wakefulness\s+(is|was)\s+normal', re.IGNORECASE) # Regex for abnormal ABNORMAL_RE = re.compile(r'abnormal', re.IGNORECASE) # Regex for seizure synonyms SEIZURE_SYNONYMS = r'seizure|seizures|spasm|spasms|status\sepilepticus|epilepsia\spartialis\scontinua|drop\sattack' SEIZURE_SYNONYMS_RE = re.compile(SEIZURE_SYNONYMS, re.IGNORECASE|re.UNICODE) # Regex for negation NEG_DET = ['no', 'not', 'without'] # Regex for no seizure in study NEG_SEIZURE = r'no seizures|no epileptiform activity or seizures'.replace(' ','\s') NEG_SEIZURE_RE = re.compile(NEG_SEIZURE, re.IGNORECASE) # Alternate section keys for INTERPRATION section of report candidate_interps = ['INTERPRETATION', 'Interpretation', 'Summary', 'impression', 'IMPRESSION', 'conclusion', 'conclusions'] CANDIDATE_INTERPS_LOWER = list({ss.lower() for ss in candidate_interps}) # Alternate regex for no seizures NOSEIZURE_PHRASE_RE = re.compile(r'\bno seizures\b|\bno\sepileptiform\sactivity\sor\sseizures\b' r'|\bno findings to indicate seizures\b' r'|no findings to indicate' r'|no new seizures' r'|with no seizures' r'|no evidence to support seizures' r'|nonepileptic' r'|non-epileptic' , re.IGNORECASE|re.UNICODE) # Defining negexes NEG_DET= r'(\bno\b|\bnot\b|\bwithout\sfurther\b|\bno\sfurther\b|without|neither)' BASIC_NEGEX_RE = re.compile(NEG_DET + '.*('+ SEIZURE_SYNONYMS + ')', re.IGNORECASE|re.UNICODE) REVERSED_NEGEX_RE = re.compile('('+ SEIZURE_SYNONYMS + ').*' + NEG_DET, re.IGNORECASE|re.UNICODE) ###################################################################################################### ##### HELPER FUNCTIONS ###################################################################################################### def is_not_abnormal_interp(interp): """ Check text of interpretation for abnormal mentions """ m = ABNORMAL_RE.search(interp) if not m: return True else: return False def abnormal_interp_with_seizure(interp_text): """ Tests for abnormal interpretation with seizure synonym """ if ABNORMAL_RE.search(interp_text): if SEIZURE_SYNONYMS_RE.search(interp_text): return SEIZURE_VAL else: return NO_SEIZURE_VAL else: return NO_SEIZURE_VAL def abnormal_interp_test(interp_text): """ Tests for abnormal text """ return ABNORMAL_RE.search(interp_text) def eval_interp_with_negex(interp): """ Looks at each sentence, if a sentence says there is a seizure, then that overrides all the negative sentences """ if is_not_abnormal_interp(interp): return NO_SEIZURE_VAL parsed_interp = spacy_en(interp) neg_found = 0 seizure_found_and_no_neg = 0 for sent in parsed_interp.sents: s = str(sent) m1 = BASIC_NEGEX_RE.search(s) if m1: neg_found=1 m2 = REVERSED_NEGEX_RE.search(s) if m2: neg_found =2 if not neg_found: m3 = SEIZURE_SYNONYMS_RE.search(s) if m3: seizure_found_and_no_neg = 1 if neg_found and not seizure_found_and_no_neg: return NO_SEIZURE_VAL elif seizure_found_and_no_neg: return SEIZURE_VAL return NO_SEIZURE_VAL def get_section_with_name(section_names, doc): """ Check exact matches for keys in section_names; this presumes a certain structure in EEGNote doc object """ text = '' for section in section_names: try: text = ' '.join([text, doc.sections[section]['text']]) except: pass try: text = ' '.join([text, doc.sections['narrative'][section]]) except: pass try: text = ' '.join([text, doc.sections['findings'][section]]) except: pass return ' '.join(text.split()) ###################################################################################################### ##### LABELING FUNCTIONS (LFs) ###################################################################################################### def lf_normal_interp_not_seizure(report): """ This LF looks for a top level interpretation section -- if none, no seizure """ for keyinterp in CANDIDATE_INTERPS_LOWER: if keyinterp in report.sections.keys(): interpretation = report.sections[keyinterp] interp_text = interpretation['text'] if SIMPLE_NORMAL_RE.search(interp_text): if NORMAL_STUDY_PHRASES.search(interp_text): return NO_SEIZURE_VAL else: return ABSTAIN_VAL else: return ABSTAIN_VAL return ABSTAIN_VAL def lf_abnormal_interp_with_seizure(report): """ Searching for abnormal interpretation section with seizure synonym """ if 'interpretation' in report.sections.keys(): interpretation = report.sections['interpretation'] interp_text = interpretation['text'] return abnormal_interp_with_seizure(interp_text) elif 'summary' in report.sections: return abnormal_interp_with_seizure(report.sections['summary']['text']) elif 'findings' in report.sections: # fall back to look in the findings if 'summary' in report.sections['findings']: # fall back to look for a summary instead return abnormal_interp_with_seizure(report.sections['findings']['summary']) if 'impression' in report.sections['findings']: return abnormal_interp_with_seizure(report.sections['findings']['impression']) return ABSTAIN_VAL elif 'narrative' in report.sections: # fall back to look in the findings ky = 'narrative' if 'summary' in report.sections[ky]: # fall back to look for a summary instead return abnormal_interp_with_seizure(report.sections[ky]['summary']) if 'impression' in report.sections[ky]: return abnormal_interp_with_seizure(report.sections[ky]['impression']) return ABSTAIN_VAL else: return ABSTAIN_VAL def lf_findall_interp_with_seizure(report): """ Check if interpretation sections are abnormal, then look for words indicating a seizure """ if 'interpretation' in report.sections.keys(): interpretation = report.sections['interpretation'] interp_text = interpretation['text'] return abnormal_interp_with_seizure(interp_text) else: candtext = get_section_with_name(CANDIDATE_INTERPS_LOWER, report) if candtext: return abnormal_interp_with_seizure(candtext) else: return ABSTAIN_VAL def lf_findall_abnl_interp_without_seizure(report): """ Check if interpretation sections are abnormal, then look for words indicating NO seizure """ if 'interpretation' in report.sections.keys(): interpretation = report.sections['interpretation'] interp_text = interpretation['text'] if abnormal_interp_test(interp_text): if NOSEIZURE_PHRASE_RE.search(interp_text): return NO_SEIZURE_VAL else: return ABSTAIN_VAL else: return ABSTAIN_VAL else: candtext = get_section_with_name(CANDIDATE_INTERPS_LOWER, report) if candtext: if abnormal_interp_test(candtext): if NOSEIZURE_PHRASE_RE.search(candtext): return NO_SEIZURE_VAL else: return ABSTAIN_VAL else: return ABSTAIN_VAL else: return ABSTAIN_VAL def lf_abnl_interp_negexsp_seizure(report): """ Check if top interpretation section is abnormal and if so, use negex to find indications that there is no seizure """ for topkey in CANDIDATE_INTERPS_LOWER: if topkey in report.sections.keys(): interpretation = report.sections[topkey] interp_text = interpretation['text'] return eval_interp_with_negex(interp_text) return ABSTAIN_VAL def lf_findall_interp_negex_seizure(report): """ Check if lower sections have abnormal text and if so, use negex to find indications of no seizure """ candtext = get_section_with_name(CANDIDATE_INTERPS_LOWER, report) if candtext: return eval_interp_with_negex(candtext) else: return ABSTAIN_VAL def lf_seizure_section(report): """ Checking to see if there is a 'seizure' section in the report """ if 'findings' in report.sections.keys(): seizure_keys = [key for key in report.sections['findings'].keys() if 'seizure' in key ] if not seizure_keys: return ABSTAIN_VAL else: for ky in seizure_keys: seizure_text = report.sections['findings'][ky] if 'None' in seizure_text: return NO_SEIZURE_VAL elif 'Many' in seizure_text: return SEIZURE_VAL elif len(seizure_text.split()) > 30: return SEIZURE_VAL else: return NO_SEIZURE_VAL else: return ABSTAIN_VAL def lf_impression_section_negative(report): """ Getting impression section, checking for specific terms """ impression_words = ['impression','interpretation','comments'] impression = get_section_with_name(impression_words, report) reg_normal = ['no epileptiform', 'absence of epileptiform', 'not epileptiform', 'normal EEG', 'normal aEEG','benign','non-specific','nonepileptic','idiopathic', 'no seizures','EEG is normal','normal study'] if any([re.search(reg, impression, re.IGNORECASE) for reg in reg_normal] ): return NO_SEIZURE_VAL else: return ABSTAIN_VAL def lf_impression_section_positive(report): """ Getting impression section, checking for specific terms """ impression_words = ['impression','interpretation','comments'] impression = get_section_with_name(impression_words, report) reg_abnormal = ['status epilepticus','spasms','abnormal continuous', 'tonic','subclinical','spike-wave', 'markedly abnormal'] if any([re.search(reg, impression, re.IGNORECASE) for reg in reg_abnormal] ): return SEIZURE_VAL else: return ABSTAIN_VAL def lf_spikes_in_impression(report): """ Checking for indications of spikes in the impression section """ impression_words = ['impression','interpretation','comments'] impression = get_section_with_name(impression_words, report) if re.search('spike',impression,re.IGNORECASE): return SEIZURE_VAL else: return ABSTAIN_VAL def lf_extreme_words_in_impression(report): """ Checking for words indicating extreme events in the impression section """ impression_words = ['impression','interpretation','comments'] impression = get_section_with_name(impression_words, report) reg_abnormal = ['excessive','frequent'] if any([re.search(reg, impression, re.IGNORECASE) for reg in reg_abnormal] ): return SEIZURE_VAL else: return ABSTAIN_VAL
cross-modal-ws-demo-master
lfs/lfs_eeg.py
import re # Setting LF output values ABSTAIN_VAL = 0 ABNORMAL_VAL = 1 NORMAL_VAL = -1 ###################################################################################################### ##### HELPFUL REGEXES AND ONTOLOGIES ###################################################################################################### reg_equivocation = re.compile('unlikely|likely|suggests|questionable|concerning|possibly|potentially|could represent|may represent|may relate|cannot exclude|can\'t exclude|may be',re.IGNORECASE) ###################################################################################################### ##### LABELING FUNCTIONS (LFs) ###################################################################################################### def LF_no_degenerative(report): """ Checking for degenerative change """ r = re.compile('No significant degenerative change',re.IGNORECASE) for s in report.report_text.text.split("."): if r.search(s): return NORMAL_VAL return ABSTAIN_VAL def LF_degen_spine(report): """ Checking for degenerative spine """ reg_01 = re.compile('degen',re.IGNORECASE) reg_02 = re.compile('spine',re.IGNORECASE) for s in report.report_text.text.split("."): if reg_01.search(s) and reg_02.search(s): return ABNORMAL_VAL return ABSTAIN_VAL def LF_fracture_general(report): reg_pos = re.compile('fracture',re.IGNORECASE) reg_neg = re.compile('(No|without|resolution)\\s([a-zA-Z0-9\-,_]*\\s){0,10}fracture',re.IGNORECASE) for s in report.report_text.text.split("."): if reg_pos.search(s) and (not reg_neg.search(s)) and (not reg_equivocation.search(s)): return ABNORMAL_VAL return ABSTAIN_VAL def LF_fracture_1(report): reg_pos = re.compile('(linear|curvilinear)\\slucency',re.IGNORECASE) reg_neg = re.compile('(No|without|resolution)\\s([a-zA-Z0-9\-,_]*\\s){0,10}fracture',re.IGNORECASE) for s in report.report_text.text.split("."): if reg_pos.search(s) and (not reg_neg.search(s)) and (not reg_equivocation.search(s)): return ABNORMAL_VAL return ABSTAIN_VAL def LF_fracture_2(report): reg_pos = re.compile('(impaction|distraction|diastasis|displaced|foreshortened|angulation|rotation)',re.IGNORECASE) reg_neg = re.compile('(No|without|resolution)\\s([a-zA-Z0-9\-,_]*\\s){0,10}fracture',re.IGNORECASE) for s in report.report_text.text.split("."): if reg_pos.search(s) and (not reg_neg.search(s)) and (not reg_equivocation.search(s)): return ABNORMAL_VAL return ABSTAIN_VAL def LF_fracture_3(report): reg_pos = re.compile('(transverse|oblique)',re.IGNORECASE) reg_neg = re.compile('(No|without|resolution)\\s([a-zA-Z0-9\-,_]*\\s){0,10}fracture',re.IGNORECASE) for s in report.report_text.text.split("."): if reg_pos.search(s) and (not reg_neg.search(s)) and (not reg_equivocation.search(s)): return ABNORMAL_VAL return ABSTAIN_VAL def LF_lesion_1(report): reg_pos = re.compile('(moth-eaten|permeative|chondroid|ground-glass|lucent|sclerotic)',re.IGNORECASE) reg_neg = re.compile('(No|without|resolution)\\s([a-zA-Z0-9\-,_]*\\s){0,10}(lesion|tumor|mass)',re.IGNORECASE) for s in report.report_text.text.split("."): if reg_pos.search(s) and (not reg_neg.search(s)) and (not reg_equivocation.search(s)): return ABNORMAL_VAL return ABSTAIN_VAL def LF_lesion_2(report): reg_pos = re.compile('(margin|circumscribed|indistinct)',re.IGNORECASE) reg_neg = re.compile('(No|without|resolution)\\s([a-zA-Z0-9\-,_]*\\s){0,10}(lesion|tumor|mass)',re.IGNORECASE) for s in report.report_text.text.split("."): if reg_pos.search(s) and (not reg_neg.search(s)) and (not reg_equivocation.search(s)): return ABNORMAL_VAL return ABSTAIN_VAL def LF_lesion_3(report): reg_pos = re.compile('(non-linear|lucency)',re.IGNORECASE) reg_neg = re.compile('(No|without|resolution)\\s([a-zA-Z0-9\-,_]*\\s){0,10}(lesion|tumor|mass)',re.IGNORECASE) for s in report.report_text.text.split("."): if reg_pos.search(s) and (not reg_neg.search(s)) and (not reg_equivocation.search(s)): return ABNORMAL_VAL return ABSTAIN_VAL def LF_surgical(report): """ Checking for post-surgical change """ reg_01 = re.compile('surgical',re.IGNORECASE) for s in report.report_text.text.split("."): if reg_01.search(s): return ABNORMAL_VAL return ABSTAIN_VAL def LF_no_significant(c): """ Checking for indications of negligible issues """ report = c.report_text.text report = report[:report.find("SUMMARY:")] if "no significant" in report.lower()\ or "no immediate" in report.lower()\ or "demonstrate no" in report.lower(): return NORMAL_VAL else: return ABSTAIN_VAL def LF_no_evidence(c): """ Checking for evidence of fracture """ if "no evidence of fracture" in c.report_text.text.lower(): return NORMAL_VAL else: return ABSTAIN_VAL def LF_report_length(c): """ Separating based on report length """ long_cut = 600 short_cut = 500 if len(c.report_text.text) < short_cut: return NORMAL_VAL elif len(c.report_text.text) > long_cut: return ABNORMAL_VAL else : return ABSTAIN_VAL def LF_negative_quantifiers_in_report(c): """ Searching for indications of multiple or sever pathologies """ negative_quantifiers = ["severe", "multiple"] return ABNORMAL_VAL if any(word in c.report_text.text.lower() \ for word in negative_quantifiers) else ABSTAIN_VAL def LF_disease_in_report(c): """ Checking for word "disease" """ return ABNORMAL_VAL if "disease" in c.report_text.text.lower() else ABSTAIN_VAL def LF_positive_disease_term(report): """ Checking for positive disease term """ categories = ['normal','opacity','cardiomegaly','calcinosis', 'lung/hypoinflation','calcified granuloma', 'thoracic vertebrae/degenerative','lung/hyperdistention', 'spine/degenerative','catheters, indwelling', 'granulomatous disease','nodule','surgical instruments', 'scoliosis', 'osteophyte', 'spondylosis','fractures, bone'] for idx in range(1,len(categories)): reg_pos = re.compile(categories[idx],re.IGNORECASE) reg_neg = re.compile('(No|without|resolution)\\s([a-zA-Z0-9\-,_]*\\s){0,10}'+categories[idx],re.IGNORECASE) for s in report.report_text.text.split("."): if reg_pos.search(s) and (not reg_neg.search(s)) and (not reg_equivocation.search(s)): return ABNORMAL_VAL return ABSTAIN_VAL def LF_consistency_in_report(c): """ Checking for the words 'clear', 'no', 'normal', 'free', 'midline' in findings section of the report """ words_indicating_normalcy = ['clear', 'no', 'normal', 'unremarkable', 'preserved', 'mild'] report = c.report_text.text findings = report sents = findings.split('.') num_sents_without_normal = 0 for sent in sents: sent = sent.lower() if not any(word in sent for word in words_indicating_normalcy): num_sents_without_normal += 1 elif 'not' in sent: num_sents_without_normal += 1 if len(sents) - num_sents_without_normal < 2: return ABNORMAL_VAL else: return ABSTAIN_VAL def LF_screw(c): """ Checking if a screw is mentioned """ return ABNORMAL_VAL if "screw" in c.report_text.text.lower() else ABSTAIN_VAL
cross-modal-ws-demo-master
lfs/lfs_msk.py
import re # Setting LF output values ABSTAIN_VAL = 0 ABNORMAL_VAL = 1 NORMAL_VAL = -1 ###################################################################################################### ##### HELPFUL REGEXES AND ONTOLOGIES ###################################################################################################### # Equivocation terms equiv_str = 'unlikely|likely|suggests|questionable|concerning|possibly|potentially|could represent|may represent|may relate|cannot exclude|can\'t exclude|may be' equiv_lst = equiv_str.split('|') reg_equivocation = re.compile(equiv_str,re.IGNORECASE) # Terms indicating followup required followup_terms = ["followup","referred", "paged", "contacted","contact"] # Things rarely mentioned unless they exist... abnormal_disease_terms = ["opacity", "cardiomegaly","hypoinflation","hyperdistention",\ "edema", "nodule", "fracture",\ "emphysema","empyema","dissection","pneumomediastinum",\ "pneumoperitineum","widening of the mediastinum","abcess",\ "hemorrhage","malpositioned","greater than",\ "asymmetric","urgent","mediastinal shift","Fleischner","foreign body"\ "differential"] # Longer phrases indicating normalcy normal_words_and_phrases = ["no acute cardiopulmonary","no significant interval change",\ "cardiomediastinal silhouette is within normal limits","without evidence of ",\ "no pleural effusion or pneumothorax","without evidence of","gross"] # Words indicating normalcy words_indicating_normalcy = ['clear', 'no', 'normal', 'unremarkable', 'free', 'midline','without evidence of','absent','gross'] # Disease categories categories = ['normal','opacity','cardiomegaly','calcinosis', 'lung/hypoinflation','calcified granuloma', 'thoracic vertebrae/degenerative','lung/hyperdistention', 'spine/degenerative','catheters, indwelling', 'granulomatous disease','nodule','surgical instruments', 'scoliosis', 'osteophyte', 'spondylosis','fractures, bone'] # Words with negative inflection negative_inflection_words = ["but", "however", "otherwise",equiv_str] ###################################################################################################### ##### LABELING FUNCTIONS (LFs) ###################################################################################################### def LF_report_length(c): """ Separating by report length """ short_cutoff = 425 long_cutoff = 700 ln = len(c.report_text.text) if ln<short_cutoff: return NORMAL_VAL elif ln>long_cutoff: return ABNORMAL_VAL else: return ABSTAIN_VAL def LF_equivocation(c): """ Checking for equivocation """ return ABNORMAL_VAL if any(word in c.report_text.text \ for word in equiv_lst) else ABSTAIN_VAL def LF_negative_inflection_words_in_report(c): """ Checking for negative inflection words """ return ABNORMAL_VAL if any(word in c.report_text.text \ for word in negative_inflection_words) else ABSTAIN_VAL def LF_is_seen_or_noted_in_report(c): """ Checking for indications of a phenomenology """ return ABNORMAL_VAL if any(word in c.report_text.text \ for word in ["seen", "noted","observed"]) else ABSTAIN_VAL def LF_disease_in_report(c): """ Checking for mentions of disease """ return ABNORMAL_VAL if "disease" in c.report_text.text else ABSTAIN_VAL def LF_recommend_in_report(c): """ Checking for recommended followup """ return ABNORMAL_VAL if "recommend" in c.report_text.text else ABSTAIN_VAL def LF_mm_in_report(c): """ Checking for anything that was measured """ return ABNORMAL_VAL if any(word in c.report_text.text \ for word in ["mm", "cm","millimeter","centimeter"]) else ABSTAIN_VAL def LF_abnormal_disease_terms_in_report(c): """ Checking for abnormal disease terms """ if any(mesh in c.report_text.text for mesh in abnormal_disease_terms): return ABNORMAL_VAL else: return ABSTAIN_VAL def LF_consistency_in_report(c): """ Checking for the words 'clear', 'no', 'normal', 'free', 'midline' in findings section of the report """ report = c.report_text.text findings = report[report.find('FINDINGS:'):] findings = findings[:findings.find('IMPRESSION:')] sents = findings.split('.') num_sents_without_normal = 0 for sent in sents: sent = sent.lower() if not any(word in sent for word in words_indicating_normalcy): num_sents_without_normal += 1 elif 'not' in sent: num_sents_without_normal += 1 norm_cut = 1 if num_sents_without_normal<norm_cut: return NORMAL_VAL elif num_sents_without_normal>norm_cut: return ABNORMAL_VAL else: return ABSTAIN_VAL def LF_gross(report): """ Checking for word "gross" """ reg_pos = re.compile('gross',re.IGNORECASE) for s in report.report_text.text.split("."): if reg_pos.search(s): return ABNORMAL_VAL return ABSTAIN_VAL def LF_normal(report): """ Checking for various standard indications of normality """ r = re.compile('No acute cardiopulmonary abnormality',re.IGNORECASE) r2 = re.compile('normal chest X-ray',re.IGNORECASE) for s in report.report_text.text.split("."): if r.search(s) or r2.search(s): # or r3.search(s) or r4.search(s): return NORMAL_VAL return ABSTAIN_VAL def LF_positive_MeshTerm(report): """ Looking for positive mesh terms """ for idx in range(1,len(categories)): reg_pos = re.compile(categories[idx],re.IGNORECASE) reg_neg = re.compile('(No|without|resolution)\\s([a-zA-Z0-9\-,_]*\\s){0,10}'+categories[idx],re.IGNORECASE) for s in report.report_text.text.split("."): if reg_pos.search(s) and (not reg_neg.search(s)) and (not reg_equivocation.search(s)): return ABNORMAL_VAL return ABSTAIN_VAL def LF_fracture(report): """ Looking for evidence of fracture """ reg_pos = re.compile('fracture',re.IGNORECASE) reg_neg = re.compile('(No|without|resolution)\\s([a-zA-Z0-9\-,_]*\\s){0,10}fracture',re.IGNORECASE) for s in report.report_text.text.split("."): if reg_pos.search(s) and (not reg_neg.search(s)) and (not reg_equivocation.search(s)): return ABNORMAL_VAL return ABSTAIN_VAL def LF_calcinosis(report): """ Looking for evidence of calcinosis """ reg_01 = re.compile('calc',re.IGNORECASE) reg_02 = re.compile('arter|aorta|muscle|tissue',re.IGNORECASE) for s in report.report_text.text.split("."): if reg_01.search(s) and reg_02.search(s): return ABNORMAL_VAL return ABSTAIN_VAL def LF_degen_spine(report): """ Looking for degenerative spinal disease """ reg_01 = re.compile('degen',re.IGNORECASE) reg_02 = re.compile('spine',re.IGNORECASE) for s in report.report_text.text.split("."): if reg_01.search(s) and reg_02.search(s): return ABNORMAL_VAL return ABSTAIN_VAL def LF_lung_hypoinflation(report): """ Looking for lung hypoinflation """ #reg_01 = re.compile('lung|pulmonary',re.IGNORECASE) reg_01 = re.compile('hypoinflation|collapse|(low|decrease|diminish)\\s([a-zA-Z0-9\-,_]*\\s){0,4}volume',re.IGNORECASE) for s in report.report_text.text.split("."): if reg_01.search(s): return ABNORMAL_VAL return ABSTAIN_VAL def LF_lung_hyperdistention(report): """ Looking for lung hyperdistention """ #reg_01 = re.compile('lung|pulmonary',re.IGNORECASE) reg_01 = re.compile('increased volume|hyperexpan|inflated',re.IGNORECASE) for s in report.report_text.text.split("."): if reg_01.search(s): return ABNORMAL_VAL return ABSTAIN_VAL def LF_catheters(report): """ Looking for mentions of catheters """ reg_01 = re.compile(' line|catheter|PICC',re.IGNORECASE) for s in report.report_text.text.split("."): if reg_01.search(s): return ABNORMAL_VAL return ABSTAIN_VAL def LF_surgical(report): """ Looking for mentions of surgical hardware """ reg_01 = re.compile('clip',re.IGNORECASE) for s in report.report_text.text.split("."): if reg_01.search(s): return ABNORMAL_VAL return ABSTAIN_VAL def LF_granuloma(report): """ Looking for instances of granuloma """ reg_01 = re.compile('granuloma',re.IGNORECASE) for s in report.report_text.text.split("."): if reg_01.search(s): return ABNORMAL_VAL return ABSTAIN_VAL
cross-modal-ws-demo-master
lfs/lfs_cxr.py
import re # Setting LF output values ABSTAIN_VAL = 0 HEMORRHAGE_VAL = 1 NO_HEMORRHAGE_VAL = -1 ###################################################################################################### ##### LABELING FUNCTIONS (LFs) ###################################################################################################### def LF_normal_V01(report): """ Checking for specific normal phrase """ r = re.compile('Normal CT of the Head',re.IGNORECASE) for s in report.report.sentences: if r.search(s.text): return NO_HEMORRHAGE_VAL return ABSTAIN_VAL def LF_normal_V02(report): """ Checking for specific normal phrase """ r = re.compile('No acute intracranial abnormality',re.IGNORECASE) for s in report.report.sentences: if r.search(s.text): return NO_HEMORRHAGE_VAL return ABSTAIN_VAL def LF_normal_V03(report): """ Checking for specific normal phrase """ r = re.compile('Normal noncontrast and postcontrast CT',re.IGNORECASE) for s in report.report.sentences: if r.search(s.text): return NO_HEMORRHAGE_VAL return ABSTAIN_VAL def LF_normal_V04(report): """ Checking for specific normal phrase """ r = re.compile('Negative acute CT of the head',re.IGNORECASE) for s in report.report.sentences: if r.search(s.text): return NO_HEMORRHAGE_VAL return ABSTAIN_VAL def LF_positive_hemorrhage(report): """ Checking for words indicating hemorrhage """ r1 = re.compile('(No|without|resolution)\\s([\S]*\\s){0,10}(hemorrhage)',re.IGNORECASE) r = re.compile('hemorrhage',re.IGNORECASE) for s in report.report.sentences: if r.search(s.text) and (not r1.search(s.text)): return HEMORRHAGE_VAL return ABSTAIN_VAL def LF_positive_hematoma(report): """ Checking for words indicating hematoma """ r1 = re.compile('(No|without|resolution|scalp|subgaleal)\\s([\S]*\\s){0,10}(hematoma)',re.IGNORECASE) r = re.compile('hematoma',re.IGNORECASE) for s in report.report.sentences: if r.search(s.text) and (not r1.search(s.text)): return HEMORRHAGE_VAL return ABSTAIN_VAL def LF_hemorrhage_hi_cover(report): """ Checking for both hemorrhage and hematoma """ if LF_positive_hemorrhage(report) == 0 and LF_positive_hematoma(report) == 0: return NO_HEMORRHAGE_VAL return HEMORRHAGE_VAL
cross-modal-ws-demo-master
lfs/lfs_hct.py
import os, requests, sys, unittest sys.path.insert(1, os.path.join(sys.path[0], '..')) import cPickle from snorkel.parser import * ROOT = os.environ['SNORKELHOME'] class TestParsers(unittest.TestCase): @classmethod def setUpClass(cls): cls.sp = SentenceParser() @classmethod def tearDownClass(cls): cls.sp._kill_pserver() def test_parser_1(self): """Tests the XMLDocParser and SentenceParser subclasses""" # Load correct parses with open(ROOT + '/test/data/CDR_TestSet_docs.pkl', 'rb') as f: gold_docs = cPickle.load(f) with open(ROOT + '/test/data/CDR_TestSet_sents.pkl', 'rb') as f: gold_sents = cPickle.load(f) # Set up the doc parser xml_parser = XMLDocParser( path=ROOT + '/test/data/CDR_TestSet.xml', doc='.//document', text='.//passage/text/text()', id='.//id/text()', keep_xml_tree=False) sent_parser = SentenceParser() corpus = Corpus(xml_parser, sent_parser, max_docs=20) print len(corpus.get_docs()) print len(corpus.get_sentences()) self.assertEqual(corpus.get_docs(), gold_docs) self.assertEqual(corpus.get_sentences(), gold_sents) if __name__ == '__main__': unittest.main()
ddbiolib-master
test/parser_tests.py
""" Bioinformatics Tools for Data Programming ================================== ddioblib is a library for creating and interaction with onotologies to create forms for weak supervision for machine learning systems like DeepDive and Snorkel See http://deepdive.stanford.edu/ for more information """ __version__ = "0.10.dev"
ddbiolib-master
ddbiolib/__init__.py
from .serialization import *
ddbiolib-master
ddbiolib/parsers/__init__.py
import os import sys import glob import codecs import cPickle import numpy as np ################################################# # Parser Serializers ################################################# class SerializedParser(object): def __init__(self,parser,encoding="utf-8"): '''Interface for persisting mark-up data generated by parser object Parameters ---------- parser : object DDlite parser object. encoding: string, "utf-8" by default String encoding ''' self.parser = parser self.encoding = encoding self.doc_cache = {} def _write(self,sents,doc_id): raise NotImplementedError() def _read(self,doc_id): raise NotImplementedError() def parse(self,s,doc_id): '''Parse provided string or use cached version''' if doc_id in self.doc_cache: sents = self._read(doc_id) else: try: sents = [s for s in self.parser.parse(s,doc_id=doc_id)] except Exception as e: print "Fatal Parser Error {} {}".format(doc_id,e) sys.exit() self._write(sents,doc_id) self.doc_cache[doc_id] = 0 return sents class PickleSerializedParser(SerializedParser): def __init__(self,parser,rootdir): super(PickleSerializedParser, self).__init__(parser) self.rootdir = rootdir # initialize previously cached documents filelist = glob.glob("{}*.pkl".format(self.rootdir)) self.doc_cache = {n.split("/")[-1].split(".")[0]:0 for n in filelist} def _write(self,sents,doc_id): '''write pickle file to disk''' fname = "%s/%s.pkl" % (self.rootdir, doc_id) with open(fname, 'w+') as f: cPickle.dump(sents,f) def _read(self,doc_id): fname = "%s/%s.pkl" % (self.rootdir, doc_id) with open(fname, 'rb') as f: return cPickle.load(f) class TextSerializedParser(SerializedParser): '''Write results to offset indexed text file''' def __init__(self,parser,rootdir): super(TextSerializedParser, self).__init__(parser) self.idx_dtype = np.int64 self.rootdir = rootdir self._load_index() self.datfile = "{}/docs.dat".format(self.rootdir) def _load_index(self): '''Loading index of doc_id to file offsets''' fname = "{}/docs.idx".format(self.rootdir) if os.path.exists(fname): tmp = open(fname,"rU").readlines() self.doc_idx = dict([line.strip().split("\t") for line in tmp]) self.doc_idx = {uid:int(idx) for uid,idx in self.doc_idx.items()} self.doc_cache = {uid:0 for uid in self.doc_idx} else: self.doc_cache = {} self.doc_idx = {} def __del__(self): try: # store previous version if it exists fname = "{}/docs.idx".format(self.rootdir) if os.path.exists(fname): os.rename(fname,fname+".bak") # write index to disk with open(fname,"w") as f: for uid,idx in self.doc_idx.items(): f.write("{}\t{}\n".format(uid,idx)) except Exception as e: print "Error writing index to disk {}".format(e) def _write(self, sents, doc_id): with codecs.open(self.datfile,"a+",self.encoding) as f: self.doc_idx[doc_id] = f.tell() f.write("{}\n".format(sents)) def _read(self,doc_id): idx = self.doc_idx[doc_id] with codecs.open(self.datfile,"r",self.encoding) as f: f.seek(idx) return eval(f.readline()) class DatabaseSerializedParser(SerializedParser): def __init__(self, parser, host, user, database, password=""): super(DatabaseSerializedParser, self).__init__(parser) self.params = (host,user,database,password) def __getitem__(self,doc_id): '''query database''' raise NotImplementedError()
ddbiolib-master
ddbiolib/parsers/serialization.py
from .umls import * from .bioportal import * from .ctd import * from .specialist import *
ddbiolib-master
ddbiolib/ontologies/__init__.py
from .base import *
ddbiolib-master
ddbiolib/ontologies/bioportal/__init__.py
import unicodecsv def load_bioportal_dictionary(filename, ignore_case=True): '''BioPortal Ontologies http://bioportal.bioontology.org/''' reader = unicodecsv.reader(open(filename,"rb"), delimiter=',', quotechar='"', encoding='utf-8') d = [line for line in reader] dictionary = {} for line in d[1:]: #line = line.strip() if not line: continue row = dict(zip(d[0],line)) pref_label = row["Preferred Label"].lower() if ignore_case else row["Preferred Label"] dictionary[pref_label] = 1 dictionary.update({t.lower() if ignore_case else t:1 for t in row["Synonyms"].split("|")}) # HACK if "" in dictionary: del dictionary[""] return dictionary
ddbiolib-master
ddbiolib/ontologies/bioportal/base.py
from .base import *
ddbiolib-master
ddbiolib/ontologies/specialist/__init__.py
''' The SPECIALIST Lexicon "The SPECIALIST lexicon is a large syntactic lexicon of biomedical and general English, designed/developed to provide the lexical information needed for the SPECIALIST Natural Language Processing System (NLP) which includes SemRep, MetaMap, and the Lexical Tools. It is intended to be a general English lexicon that includes many biomedical terms. Coverage includes both commonly occurring English words and biomedical vocabulary from a variety of sources. These include (not limited to) MEDLINE citation records, terms in the Dorland's Illustrated Medical dictionary, the 10,000 most frequent words listed in the American Heritage Word Frequency book and the 2,000 lexical items used in the controlled definitions of Longman's Dictionary of Contemporary English. The lexicon entry for each lexical item (word or term) records the syntactic, morphological (inflection and derivation), and orthographic (spelling variants) information needed by the SPECIALIST NLP System." https://lexsrv3.nlm.nih.gov/LexSysGroup/Projects/lexicon/current/web/index.html @author: jason-fries [at] stanford [dot] edu ''' import os from ...utils import download from urllib2 import urlopen, URLError, HTTPError def download_dataset(version="2016"): '''Download SPECIALIST files. TODO: get full dataset. for now only get abbreviations''' url = "https://lexsrv3.nlm.nih.gov/LexSysGroup/Projects/lexicon/{}/release/LEX/LRABR" url = url.format(version) outfname = "{}/data/{}".format(os.path.dirname(__file__),os.path.basename(url)) if not os.path.exists(outfname): download(url,outfname) class SpecialistLexicon(object): def __init__(self): download_dataset() self._abbrv2text,self._text2abbrv = self._parse_lrabr() def _parse_lrabr(self): '''Load UMLS SPECIALIST Lexicon of abbreviations. Format: E0000048|AA|acronym|E0006859|achievement age| ''' fname = "{}/data/{}".format(os.path.dirname(__file__),"LRABR") d = [line.strip().strip("|").split("|") for line in open(fname, 'rb').readlines()] abbrv2text,text2abbrv = {},{} for row in d: uid1,abbrv,atype,uid2,text = row text = text.lower() if atype not in ["acronym","abbreviation"]: continue if abbrv not in abbrv2text: abbrv2text[abbrv] = {} if text not in text2abbrv: text2abbrv[text] = {} abbrv2text[abbrv][text] = 1 text2abbrv[text][abbrv] = 1 return abbrv2text,text2abbrv @property def abbrv2text(self): return self._abbrv2text @property def text2abbrv(self): return self._text2abbrv if __name__ == "__main__": s = SpecialistLexicon() print len(s.abbrv2text) print len(s.text2abbrv) print s.abbrv2text["AMOX"]
ddbiolib-master
ddbiolib/ontologies/specialist/base.py
# Comparative Toxicogenomics Database # http://ctdbase.org/downloads/ from .base import *
ddbiolib-master
ddbiolib/ontologies/ctd/__init__.py
import codecs def load_ctd_dictionary(filename, ignore_case=True): '''Comparative Toxicogenomics Database''' d = {} header = ['DiseaseName', 'DiseaseID', 'AltDiseaseIDs', 'Definition', 'ParentIDs', 'TreeNumbers', 'ParentTreeNumbers', 'Synonyms', 'SlimMappings'] synonyms = {} dnames = {} with codecs.open(filename,"rU","utf-8",errors="ignore") as fp: for i,line in enumerate(fp): line = line.strip() if line[0] == "#": continue row = line.split("\t") if len(row) != 9: continue row = dict(zip(header,row)) synonyms.update( dict.fromkeys(row["Synonyms"].strip().split("|"))) dnames[row["DiseaseName"].strip()] = 1 return {term.lower() if ignore_case else term:1 for term in synonyms.keys()+dnames.keys() if term}
ddbiolib-master
ddbiolib/ontologies/ctd/base.py
from collections import namedtuple DatabaseConfig = namedtuple("DatabaseConfig",["host","username","dbname","password"]) DEFAULT_UMLS_CONFIG = DatabaseConfig(host="127.0.0.1", username="umls", dbname="2014AB", password="") STANFORD_UMLS_CONFIG = DatabaseConfig(host="rocky.stanford.edu", username="umls_guest", dbname="publicUMLSsnapshot", password="umls")
ddbiolib-master
ddbiolib/ontologies/umls/config.py
import os import networkx as nx from ...utils import database class SemanticNetwork(object): """ The UMLS Semantic Network defines 133 semantic types and 54 relationships found in the UMLS Metathesaurus. There are two branches: Entity and Event https://www.ncbi.nlm.nih.gov/books/NBK9679/ """ def __init__(self, config=None): self.conn = database.MySqlConn(host=config.host, user=config.username, database=config.dbname, password=config.password) self.conn.connect() self._networks = {} self.abbrv, self.groups = self.__load_sem_groups() # load semantic group definitions def __load_sem_groups(self): '''UMLS Semantic Groups ''' module_path = os.path.dirname(__file__) fname = "%s/data/SemGroups.txt" % (module_path) abbrvs = {} isas = {} with open(fname,"rU") as f: for line in f: # format: ACTI|Activities & Behaviors|T051|Event abbrv,parent,tid,child = line.strip().split("|") abbrvs[abbrv] = parent if parent not in isas: isas[parent] = {} isas[parent][child] = 1 isas = {parent:isas[parent].keys() for parent in isas} return abbrvs,isas def __build_semantic_network(self, relation="isa", directed=True, simulate_root=True): """Load semantic network structure for a given relation.""" sql_tmpl = """SELECT C.STY_RL1,C.RL,C.STY_RL2 FROM SRSTR AS C INNER JOIN SRDEF AS A ON C.STY_RL1=A.STY_RL INNER JOIN SRDEF AS B ON C.STY_RL2=B.STY_RL WHERE A.RT='STY' AND B.RT='STY' AND C.RL='%s'""" query = sql_tmpl % (relation) results = self.conn.query(query) G = nx.DiGraph() if directed else nx.Graph() for row in results: child,_,parent = map(str,row) G.add_edge(parent,child) # Some concept graphs lack a shared root, so add one. root_nodes = [node for node in G if not G.predecessors(node)] if len(root_nodes) > 1 and simulate_root: root = "ROOT" for child in root_nodes: G.add_edge(root,child) return G def graph(self, relation="isa", directed=True, simulate_root=True): """Build a semantic network (graph) given the provided relation""" if relation not in self._networks: self._networks[relation] = self.__build_semantic_network(relation,directed) return self._networks[relation]
ddbiolib-master
ddbiolib/ontologies/umls/semantic_network.py
from .config import * from .metathesaurus import * from .semantic_network import * from .lf_factory import * from .dictionary import *
ddbiolib-master
ddbiolib/ontologies/umls/__init__.py
''' Noise-aware Dictionary Create a snapshot of all UMLS terminology, broken down by semantic type (STY) and source vocabulary (SAB). Treat these as competing experts, generating labeling functions for each @author: jason-fries [at] stanford [dot] edu ''' import os import re import bz2 import sys import glob import codecs import itertools import subprocess from functools import partial from collections import defaultdict from ...utils import database from .config import DEFAULT_UMLS_CONFIG from .metathesaurus import MetaNorm def dict_function_factory(dictionary,rvalue,name,ignore_case=True): '''Dynamically create a labeling function object''' def function_template(m): mention = " ".join(m.get_attrib_tokens('words')).lower() if ignore_case else " ".join(m.get_attrib_tokens('words')) return rvalue if mention in dictionary else 0 function_template.__name__ = name return function_template def build_umls_dictionaries(config,min_occur=1): '''Create UMLS dictionaries broken down by semantic type and source vocabulary. Term types (TTY) are used to filter out obselete terms an ''' module_path = os.path.dirname(__file__) filelist = glob.glob("{}/data/cache/*/*.txt".format(module_path)) if len(filelist) > 0: return #mn = MetaNorm() abbrv_tty = dict.fromkeys(['AA','AB','ACR']) not_term_tty = dict.fromkeys(['AA','AB','ACR','AUN']) conn = database.MySqlConn(config.host, config.username, config.dbname, config.password) conn.connect() sql_tmpl = "{}/sql_tmpl/sty_sab_dictionaries.sql".format(module_path) sql = "".join(open(sql_tmpl,"rU").readlines()) results = conn.query(sql) abbrv = defaultdict(partial(defaultdict, defaultdict)) terms = defaultdict(partial(defaultdict, defaultdict)) for row in results: text,sty,sab,tty = row sty = sty.lower().replace(" ","_") # TODO: Move to interace so that this is done on reload #text = mn.normalize(text) # normalize to remove junk characters if tty in abbrv_tty: abbrv[sty][sab][text] = 1 elif tty not in not_term_tty: terms[sty][sab][text] = 1 for sty in abbrv: for sab in abbrv[sty]: outfname = "{}/data/cache/abbrvs/{}.{}.abbrv.txt".format(module_path,sty,sab) t = sorted(abbrv[sty][sab].keys()) if len(t) < min_occur: continue with codecs.open(outfname,"w","utf-8",errors="ignore") as f: f.write("\n".join(t)) subprocess.call(["bzip2", outfname]) # compress file for sty in terms: for sab in terms[sty]: outfname = "{}/data/cache/terms/{}.{}.txt".format(module_path,sty,sab) t = sorted(terms[sty][sab].keys()) if len(t) < min_occur: continue with codecs.open(outfname,"w","utf-8",errors="ignore") as f: f.write("\n".join(t)) subprocess.call(["bzip2", outfname]) # compress file class UmlsNoiseAwareDict(object): '''Use UMLS semantic types and source vocabulary information to create labeling functions for providing supervision for tagging tasks''' def __init__(self, positive=[], negative=[], name="", rm_sab=[], rootdir=None, ignore_case=True, normalize=True): module_path = os.path.dirname(__file__) self.rootdir = rootdir if rootdir else "{}/data/cache/{}/".format(module_path,name) self.positive = [self._norm_sty_name(x) for x in positive] self.negative = [self._norm_sty_name(x) for x in negative] self.name = name self.encoding = "utf-8" self.ignore_case = ignore_case self._dictionary = self._load_dictionaries(normalize) self.rm_sab = rm_sab def _norm_sty_name(self,s): return s.lower().replace(" ","_") def _load_dictionaries(self,normalize): '''Load dictionaries base on provided positive/negative entity examples''' d = defaultdict(defaultdict) filelist = glob.glob("{}*.txt.bz2".format(self.rootdir)) mn = MetaNorm() for fpath in filelist: fname = fpath.split("/")[-1].rstrip(".txt.bz2") i = fname.index(".") sty,sab = fname[0:i], fname[i+1:].rstrip(".abbrv") dict_type = "terms" if "abbrv" not in fname else "abbrv" # skip semantic types we don't flag as postive of negative if sty not in self.positive and sty not in self.negative: continue terms = [] with bz2.BZ2File(fpath,"rb") as f: for line in f: if not line.strip(): continue try: line = line.strip().decode('utf-8') t = line.strip().lower() if self.ignore_case else line.strip() if normalize: t = mn.normalize(t) terms += [t] except: print>>sys.stderr,"Warning: unicode conversion error" if sty in d and sab in d[sty]: d[sty][sab].update(dict.fromkeys(terms)) else: d[sty][sab] = dict.fromkeys(terms) return d def get_semantic_types(self,term): '''Return all matching semantic types for this term ''' stys = {} for sty in self._dictionary: for sab in self._dictionary[sty]: if term in self._dictionary[sty][sab]: stys[sty] = stys.get(sty,0) + 1 return stys def get_dictionary(self,semantic_types=[],source_vocab=[], min_size=1): return self.dictionary(semantic_types,source_vocab, min_size) def dictionary(self, semantic_types=[], source_vocab=[], min_size=1, positive_only=True): '''Create a single dictionary building using the provided semantic types and source vocabularies. If either are None, use all available types. ''' # normalize semantic type names semantic_types = [self._norm_sty_name(x) for x in semantic_types] semantic_types = self._dictionary if not semantic_types else semantic_types sabs = list(itertools.chain.from_iterable([self._dictionary[sty].keys() for sty in self._dictionary])) source_vocab = dict.fromkeys(sabs) if not source_vocab else source_vocab # filter ontologies by size and source d = [] for sty in self._dictionary: if sty not in self.positive and positive_only: continue if sty not in semantic_types: continue for sab in self._dictionary[sty]: if sab not in source_vocab: continue if len(self._dictionary[sty][sab]) <= min_size: continue if "ears" in self._dictionary[sty][sab]: print sty,sab d += self._dictionary[sty][sab].keys() return dict.fromkeys(d) def lfs(self,min_size=0): '''Create labeling functions for each semantic type/source vocabulary''' for sty in self._dictionary: for sab in self._dictionary[sty]: if sab in self.rm_sab: continue if len(self._dictionary[sty][sab]) <= min_size: continue label = "pos" if sty in self.positive else "neg" prefix = "{}_".format(self.name) if self.name else "" func_name = "LF_{}{}_{}_{}".format(prefix,sty,sab,label) rvalue = 1 if label=="pos" else -1 yield dict_function_factory(self._dictionary[sty][sab],rvalue, func_name,self.ignore_case) if __name__ == "__main__": # create dictionary cache build_umls_dictionaries(DEFAULT_UMLS_CONFIG)
ddbiolib-master
ddbiolib/ontologies/umls/lf_factory.py
import re import os import networkx as nx from ...utils import database from .config import DEFAULT_UMLS_CONFIG from .semantic_network import SemanticNetwork class Metathesaurus(object): """ This class hides a bunch of messy SQL queries that interface with a UMLS Metathesaurus database instance, snapshots available at: https://www.nlm.nih.gov/research/umls/licensedcontent/umlsknowledgesources.html The NLM also provides a REST API for similar functionality, but since we look at global term sets, network structures, etc. its better to query from a local UMLS database instance. All source abbreviations: https://www.nlm.nih.gov/research/umls/knowledge_sources/metathesaurus/release/abbreviations.html TODO: optimize queries. make less hacky overall """ def __init__(self, config, source_vocab=[]): self.conn = database.MySqlConn(host=config.host, user=config.username, database=config.dbname, password=config.password) self.conn.connect() self.norm = MetaNorm() self.semantic_network = SemanticNetwork(config) self.source_vocab = source_vocab # source vocabularies (SAB) self._concepts = {} self._networks = {} self.term_types = None self.source_vocab_defs = None self._sql_tmpl = {} def _load_sql_tmpl(self,fname): '''Load SQL templates''' if fname in self._sql_tmpl: return self._sql_tmpl[fname] module_path = os.path.dirname(__file__) with open("{}/sql_tmpl/{}".format(module_path,fname),"rU") as f: tmpl = " ".join(f.readlines()) self._sql_tmpl[fname] = tmpl return tmpl def concept_graph(self, level="CUI", relation=["CHD"], source_vocab=[], simulate_root=True): """Build a concept graph for the target relation. The REL field contains the relation type and RELA encodes the relation attribute (e.g., may_treat, part_of). Note - relationships are incomplete and under-specified in many cases. Parameters ---------- level : string, optional (default=CUI) Define nodes as concepts (CUI) or atoms (AUI). relation : array, optional (default=["PAR","CHD"]) Relationship type. Common relation sets include heirarchical relations: PAR/CHD (parent/child) and RB/RN (related broadly/narrowly) or non-heirarchical SY/RQ (synonym). source_vocab : array, optional (default=[]) Choice of source vocabulary (SAB) impacts network structure. By default, use all UMLS source vocabularies. Useful isolated sets include: MSH, SNOMEDCT_US, RXNORM simulate_root : Some concept graphs lack a shared root node which breaks several measures. This adds a simulated root. """ # load cached graph key = "%s_%s_%s" % (level,".".join(source_vocab),".".join(relation)) if key in self._networks: return self._networks[key] # source vocabulary (override class default) sab = self._source_vocab_sql(source_vocab) if source_vocab else \ self._source_vocab_sql(self.source_vocab) sab = "" if not sab else sab + " AND" rel_types ="(%s)" % " OR ".join(["REL='%s'" % rel for rel in relation]) sql = """SELECT %s1,%s2,REL,RELA FROM MRREL WHERE %s %s;""" sql = sql % (level,level,sab,rel_types) results = self.conn.query(sql) G = nx.DiGraph() for row in results: parent,child,rel,rela = row G.add_edge(parent,child,rel=rel,attribute=rela) self._networks[key] = G return G def _source_vocab_sql(self,source_vocab): """Build source vocabulary sql""" if source_vocab: sab = " OR ".join(["SAB='%s'" % x for x in source_vocab]) sab = "(%s)" % sab else: sab = "" return sab def get_source_vocabulary_defs(self): """Return dictionary of UMLS source vocabularies descriptions.""" if self.source_vocab_defs: return self.source_vocab_defs sql = "SELECT RSAB,SON,SF,SVER,CENC FROM MRSAB" results = self.conn.query(sql) summary = {} for row in results: sab,name,key,ver,enc = row summary[sab] = summary.get(sab,[]) + [name] self.source_vocab_defs = summary return summary def get_relations_list(self, counts=False): """"Get distinct UMLS relation types and their occurrence count.""" sql = "SELECT DISTINCT(RELA),count(RELA) FROM MRREL %s GROUP BY RELA" # restrict source vocabularies if self.source_vocab: sab = " OR ".join(["SAB='%s'" % x for x in self.source_vocab]) sql = sql % ("WHERE (%s)" % sab) else: sql = sql % "" results = self.conn.query(sql) return results if counts else zip(*results)[0] def get_tty_list(self,ignore=['OAS','OAP','OAF','FN','OF', 'MTH_OF','MTH_IS','LPN','AUN']): if self.term_types: return self.term_types sql = "SELECT distinct TTY FROM MRCONSO;" results = self.conn.query(sql) ignore = dict.fromkeys(ignore) self.term_types = [tty[0] for tty in results if tty not in ignore] return self.term_types def get_semtypes_list(self, counts=False): """ Get distinct UMLS semantic types and their occurrence counts.""" sql = "SELECT DISTINCT(STY),count(STY) FROM MRSTY GROUP BY STY" results = self.conn.query(sql) return results if counts else zip(*results)[0] def match_concepts(self, s, source_vocab=[], match_substring=False): """Find exact matches to provided string and return CUI set""" if not match_substring: sql = "SELECT DISTINCT(CUI) FROM MRCONSO WHERE %s STR='%s'" else: sql = "SELECT DISTINCT(CUI) FROM MRCONSO WHERE %s STR LIKE '%s%%'" # override object default source vocabulary? if source_vocab: sab = self._source_vocab_sql(source_vocab) else: sab = self._source_vocab_sql(self.source_vocab) sab = "" if not sab else sab + " AND" sql = sql % (sab,s) results = self.conn.query(sql) return [cui[0] for cui in results] def dictionary(self, semantic_type, source_vocab=[], cui_dict=False, include_children=True, exclude_subtrees=[], term_types=[]): """Build dictionary of UMLS entities Parameters ---------- semantic_type: string Target UMLS semantic type root source_vocab: array Override object source vocabularies (SAB) used for building lexical variations dictionary. exclude_subtrees: array List of subtree root nodes to remove from ontology cui_dict: boolean Instead of strings, return dictionary of CUIs include_children: boolean Include all child nodes from target semantic type. This should always remain True term_types: array Ignore certain term types (see docs/concept_schema.txt) """ tmpl = self._load_sql_tmpl("dictionary.sql") term_types = term_types if term_types else self.get_tty_list() network = self.semantic_network.graph("isa") # exclude subtrees if include_children: children = [node for node in nx.bfs_tree(network, semantic_type)] else: children = [semantic_type] if exclude_subtrees: rm = [nx.bfs_tree(network, subtree_root).nodes() for subtree_root in exclude_subtrees] children = [node for node in children if node not in reduce(lambda x,y:x+y,rm)] children = "STY IN ({})".format(",".join(map(lambda x:"'%s'" % x, children))) # override object default source vocabulary? if source_vocab: sab = self._source_vocab_sql(source_vocab) else: sab = self._source_vocab_sql(self.source_vocab) tty = "TTY IN (%s)" % ",".join(map(lambda x:"'%s'" % x, term_types)) sql = tmpl.format(sab,tty,children) results = self.conn.query(sql) # collapse to unique strings if not cui_dict: vocab = {self.norm.normalize(row[2]):1 for row in results} if "" in vocab: del vocab[""] else: vocab = {row[0]:1 for row in results} return vocab.keys() def concept(self, cui, source_vocab=[]): """Build UMLS concept, including abbreviations, synonyms, and preferred forms.""" if cui in self._concepts: return self._concepts[cui] else: return Concept(cui, self.conn, source_vocab) def relations_on_cui(self, cui, source_vocab=[]): """Return set of relations associated with this concept.""" sql = """SELECT RUI,SL,RELA,CUI1,CUI2 FROM MRREL R WHERE %s (R.CUI1="%s" OR R.CUI2="%s") AND RELA!='NULL';""" # override object default source vocabulary? if source_vocab: sab = self._source_vocab_sql(source_vocab) else: sab = self._source_vocab_sql(self.source_vocab) sab = "" if not sab else sab + " AND" sql = sql % (sab,cui,cui) results = self.conn.query(sql) return results def relations_between_cui(self, cui1, cui2): """ Return set of relations between provided concepts TODO """ pass def relations(self, sty1, sty2, rela, source_vocab=[]): """Return set of relations between provided semantic types""" # collect descendant/child types for each semantic type network = self.semantic_network.graph("isa") sty1 = [node for node in nx.bfs_tree(network, sty1)] sty2 = [node for node in nx.bfs_tree(network, sty2)] sty1 = " OR ".join(map(lambda x:"STY='%s'" % x, sty1)) sty2 = " OR ".join(map(lambda x:"STY='%s'" % x, sty2)) # override object default source vocabulary? if source_vocab: sab = self._source_vocab_sql(source_vocab) else: sab = self._source_vocab_sql(self.source_vocab) sab = "" if not sab else sab + " AND" sql = """ SELECT DISTINCT CUI2,CUI1 FROM (SELECT * FROM MRREL WHERE RELA='%s') AS R, (SELECT L.CUI FROM MRCONSO AS L, MRSTY AS LS WHERE (%s) AND L.CUI=LS.CUI) AS LARG, (SELECT R.CUI FROM MRCONSO AS R, MRSTY AS RS WHERE (%s) AND R.CUI=RS.CUI) AS RARG WHERE %s ((LARG.CUI=CUI2) AND (RARG.CUI=CUI1));""" sql = sql % (rela,sty1,sty2,sab) results = self.conn.query(sql) return results class TextNorm(object): def __init__(self, function=lambda x:x): self.function = function def normalize(self,s): # custom normalize function s = self.function(s) return s def apply(self,s): return self.normalize(s) class MetaNorm(TextNorm): """ Normalize UMLS Metathesaurus concept strings. """ def __init__(self, function=lambda x:x): super(MetaNorm, self).__init__(function) # TTY in [OF,FN] suffixes suffixes = ['qualifier value', 'life style', 'cell structure', 'context\\-dependent category', 'inactive concept', 'navigational concept', 'lck', 'record artifact', 'core metadata concept', 'substance', 'event', 'organism', 'person', 'attribute', 'procedure', 'tumor staging', 'a', 'cell', 'chloroaniline', 'product', 'specimen', 'observable entity', 'racial group', 'si', 'namespace concept', 'environment', 'social concept', 'ras', 'special concept', 'staging scale', 'disorder', 'geographic location', 'occupation', 'ethnic group', 'body structure', 'situation', 'physical force', 'trans', 'finding', 'epoxymethano', 'linkage concept', 'assessment scale', 'metadata', 'link assertion', 'dithiocarbamates', 'foundation metadata concept', 'morphologic abnormality', 'physical object'] self.of_fn_rgx = "\(({})\)$".format("|".join(suffixes)) def normalize(self,s): """Heuristics for stripping non-essential UMLS string clutter""" s = s.replace("--"," ") s = re.sub("[(\[<].+[>)\]]$", "", s) s = re.sub("(\[brand name\]|[,]* NOS)+","", s).strip() s = s.strip().strip("_").strip(":") s = re.sub("(\[.{1}\])+","", s).strip() s = re.sub("\-RETIRED\-$","",s).strip() # normalize TTY in [OF,FN] s = re.sub(self.of_fn_rgx,"",s).strip() # custom normalize function s = self.function(s) return s class Concept(object): def __init__(self, cui, conn, source_vocab=[]): self.cui = cui self.source_vocab = source_vocab self.conn = conn # see docs/concept_schema for an explanation of these term type flags self.ignore_tty ={x:0 for x in ['OAS','OAP','OAF','OAS','FN','OF', 'MTH_OF','MTH_IS','CSN', 'PCE','N1','AUN','IS']} self.synset = {x:0 for x in ['SY','SYN','SS','VSY','USY','RSY']} self.abbrvset = {x:0 for x in ['AA','AB','ACR']} self.term_types = ",".join(["'%s'" % tty for tty in self.ignore_tty]) sql = """SELECT TTY,STR,ISPREF FROM MRCONSO WHERE CUI='%s' AND TTY NOT IN (%s)""" sql = sql % (self.cui,self.term_types) results = self.conn.query(sql) self._definition = {} self._preferred, self._terms = {},{} for row in results: tty,string,ispref = row self._terms[string] = tty def __repr__(self): return "[{}] {}".format(self.cui, self.preferred_term()[0]) def definition(self,source_vocab=[]): """There are often multiple definitions conditioned on source vocabulary.""" source_vocab = self.source_vocab if not source_vocab else source_vocab sab = "(%s)" % (" OR ".join(["SAB='%s'" % x for x in source_vocab])) sab = "" if not source_vocab else sab + " AND" sql = "SELECT DEF FROM MRDEF WHERE %s CUI='%s'" % (sab,self.cui) results = self.conn.query(sql) return results def preferred_term(self): """Preferred name. Don't know what this practically translates too since it isn't unique with concepts, atoms or source ontologies.""" sql = """SELECT STR FROM MRCONSO WHERE CUI='%s' AND STT='PF' AND ISPREF='Y' AND TS='P';""" % self.cui results = self.conn.query(sql) return [x[0] for x in results] def synonyms(self): """UMLS defines several classes of synonymy, use only subset""" return [s for s in self._terms if self._terms[s] in self.synset] def abbrvs(self): """Abbreviations and acronyms""" return [s for s in self._terms if self._terms[s] in self.abbrvset] def all_terms(self): """All unique terms linked to this concept""" return list(set(self._terms)) def print_summary(self): """Ugly function to print concept object attributes.""" print("-----------------------------") # use longest string for description definition = self.definition() if definition: definition = sorted(definition,key=lambda x:len(x[0]),reverse=1)[0][0] else: definition = "N/A" fmt = '{0:16} {1:>1}' print(fmt.format("CUI:",self.cui)) print(fmt.format("Definition:", definition)) print(fmt.format("Preferred Term:", ", ".join(self.preferred_term()))) print(fmt.format("Synonyms:", ", ".join(self.synonyms()))) print(fmt.format("Abbreviations:", ", ".join(self.abbrvs()))) print(fmt.format("TERMS:", ", ".join(self.all_terms()) )) print("-----------------------------") if __name__ == "__main__": meta = Metathesaurus(config=DEFAULT_UMLS_CONFIG) print meta.concept(cui="C0699142")
ddbiolib-master
ddbiolib/ontologies/umls/metathesaurus.py
''' UMLS Dictionary TODO: all dictionaries should be persisted in Snorkel's eventual "context" ORM interface @author: jason-fries [at] stanford [dot] edu ''' import os import re import bz2 import sys import glob import codecs import itertools from functools import partial from collections import defaultdict from .metathesaurus import TextNorm def dict_lf_factory(dictionary, rvalue, name, ignore_case=True): ''' Dynamically create a labeling function object form a dictionary ''' def func_template(m): mention = m.sentence["text"][m.sent_char_start:m.sent_char_end+1] if ignore_case: mention = mention.lower() #mention = " ".join(m.get_attrib_tokens('words')).lower() # mention = m.sentence["text"][m.sent_char_start:m.sent_char_end+1] return rvalue if mention in dictionary else 0 func_template.__name__ = name return func_template class UmlsDict(object): def __init__(self, term_type, sem_types=[], source_vocabs=[], rootdir=None, ignore_case=False, normalizer=TextNorm()): module_path = os.path.dirname(__file__) self.rootdir = rootdir if rootdir else "{}/data/cache/{}/".format(module_path,term_type) self.term_type = term_type self.sem_types = [self._norm_sty_name(s) for s in sem_types] self.source_vocabs = source_vocabs self.encoding = "utf-8" self.ignore_case = ignore_case self._dictionary = self._load_dictionaries() self.normalizer = normalizer def _norm_sty_name(self,s): return s.lower().replace(" ","_") def _load_dictionaries(self): ''' Load dictionaries ''' d = defaultdict(defaultdict) filelist = glob.glob("{}*.txt.bz2".format(self.rootdir)) for fpath in filelist: fname = fpath.split("/")[-1].rstrip(".txt.bz2") i = fname.index(".") sty,sab = fname[0:i], fname[i+1:].rstrip(".abbrv") #print sty,sab # only include specified semantic types and source vocabularies if self.sem_types and sty not in self.sem_types: continue if self.source_vocabs and sab not in self.source_vocabs: continue terms = [] with bz2.BZ2File(fpath,"rb") as f: for line in f: if not line.strip(): continue try: line = line.strip().decode('utf-8') terms += [line.strip().lower() if self.ignore_case else line.strip()] except: print>>sys.stderr,"Warning: unicode conversion error" if sty in d and sab in d[sty]: d[sty][sab].update(dict.fromkeys(terms)) else: d[sty][sab] = dict.fromkeys(terms) return d def __iter__(self): for sty in self._dictionary: for sab in self._dictionary[sty]: for term in self._dictionary[sty][sab]: t = self.normalizer.apply(term) yield t.lower() if self.ignore_case else t def __getitem__(self,key): ''' ''' d = {} key = self._norm_sty_name(key) # collapse into single dictionary by semantic type for sab in self._dictionary[key]: d.update(self._dictionary[key][sab]) # apply normalization d = {self.normalizer.apply(term).lower() if self.ignore_case else self.normalizer.apply(term):1 for term in d} return d def get_dictionary(self, sem_types=[]): ''' Collapse into single dictionary ''' d = [] sem_types = [self._norm_sty_name(s) for s in sem_types] for sty in self._dictionary: if sem_types and sty not in sem_types: continue for sab in self._dictionary[sty]: d += self._dictionary[sty][sab].keys() d = [self.normalizer.apply(term).lower() if self.ignore_case else \ self.normalizer.apply(term) for term in d] return dict.fromkeys(d) def get_lfs(self, rvalue_default, sem_types=[], rvalue_map={}, min_size=1): ''' Given a dictionary of dictionaries from the UMLS, create a set of labeling functions. ''' sem_types = [self._norm_sty_name(s) for s in sem_types] for sty in self._dictionary: if sem_types and sty not in sem_types: continue for sab in self._dictionary[sty]: if len(self._dictionary[sty][sab]) <= min_size: continue rvalue = rvalue_default if (sty,sab) not in rvalue_map else rvalue_map[(sty,sab)] label = "pos" if rvalue == 1 else "neg" prefix = "{}_".format(self.term_type) if self.term_type else "" func_name = "LF_{}{}_{}_{}".format(prefix,sty,sab,label) yield dict_lf_factory(self._dictionary[sty][sab], rvalue, func_name, self.ignore_case) # OLD class UmlsDictionary(object): def __init__(self, term_type="*", sem_types=[], source_vocabs=[], rootdir=None, ignore_case=False): '''UMLS dictionary Load cached dictionary files broken down by semantic type (sty), source vocabulary (sab), and term type (abbrvs|terms) Parameters ---------- term_type : str abbrvs|terms|*, Default * is to load both sem_types : array, optional List of semantic types to load. Default is to load all. source_vocabs : array, optional Source input vocabularies. Default is to load all. rootdir : string, optional Source directory for cached dictionaries ignore_case : boolean, optional Lowercase all text if True, default = False Attributes ---------- Examples -------- ''' module_path = os.path.dirname(__file__) self.rootdir = rootdir if rootdir else "{}/data/cache/{}/".format(module_path,term_type) self.term_type = term_type self.sem_types = [self._norm_sty_name(s) for s in sem_types] self.source_vocabs = source_vocabs self.encoding = "utf-8" self.ignore_case = ignore_case self._dictionary = self._load_dictionaries() def _norm_sty_name(self,s): return s.lower().replace(" ","_") def _load_dictionaries(self): '''Load dictionaries''' d = defaultdict(defaultdict) filelist = glob.glob("{}*.txt.bz2".format(self.rootdir)) for fpath in filelist: fname = fpath.split("/")[-1].rstrip(".txt.bz2") i = fname.index(".") sty,sab = fname[0:i], fname[i+1:].rstrip(".abbrv") # only include specified semantic types and source vocabularies if self.sem_types and sty not in self.sem_types: continue if self.source_vocabs and sab not in self.source_vocabs: continue terms = [] with bz2.BZ2File(fpath,"rb") as f: for line in f: if not line.strip(): continue try: line = line.strip().decode('utf-8') terms += [line.strip().lower() if self.ignore_case else line.strip()] except: print>>sys.stderr,"Warning: unicode conversion error" if sty in d and sab in d[sty]: d[sty][sab].update(dict.fromkeys(terms)) else: d[sty][sab] = dict.fromkeys(terms) return d def get_sem_types(self,term): '''Return all matching semantic types for this term ''' stys = {} for sty in self._dictionary: for sab in self._dictionary[sty]: if term in self._dictionary[sty][sab]: stys[sty] = stys.get(sty,0) + 1 return stys def coverage(self,terms,ignore_case=True): '''Score a list of terms by source dictionary coverage. We're not doing a set cover optimization, just returning a ranked list of percent covered by dictionary sty/sab''' scores = {} terms = [t.lower() if ignore_case else t for t in terms] for sty in self._dictionary: for sab in self._dictionary[sty]: #dictionary = [t.lower() if ignore_case else t for t in self._dictionary[sty][sab]] dictionary = self._dictionary[sty][sab] intersection = sum([1 for t in terms if t in dictionary]) if intersection > 0: scores[(sty,sab)] = intersection / float(len(terms)) return sorted(scores.items(),key=lambda x:x[1], reverse=1) def get_dictionary(self): '''Collapse into single dictionary''' # normalize semantic type names d = [[self._dictionary[sty][sab].keys() for sab in self._dictionary[sty]] for sty in self._dictionary] d = map(lambda x:list(itertools.chain.from_iterable(x)),d) return dict.fromkeys(itertools.chain.from_iterable(d)) if __name__ == "__main__": abbrvs = UmlsDictionary("abbrvs",sem_types=["Disease or Syndrome"]) terms = UmlsDictionary("terms",sem_types=["Disease or Syndrome"], source_vocabs=['SNOMEDCT_US']) d = terms.get_dictionary() print len(d)
ddbiolib-master
ddbiolib/ontologies/umls/dictionary.py
import os import sys import glob import codecs import subprocess from collections import namedtuple from ..utils import download from ..corpora import Corpus,Document,DocParser from ..parsers import PickleSerializedParser class NcbiDiseaseParser(DocParser): ''' The NCBI disease corpus is fully annotated at the mention and concept level to serve as a research resource for the biomedical natural language processing community. -- from http://www.ncbi.nlm.nih.gov/CBBresearch/Dogan/DISEASE/ 793 PubMed abstracts 6,892 disease mentions 790 unique disease concepts ''' def __init__(self, inputpath=None): super(NcbiDiseaseParser, self).__init__(inputpath, "utf-8") if not inputpath: self.inputpath = "{}/data/ncbi_disease_corpus/".format(os.path.dirname(__file__)) else: self.inputpath = inputpath self._docs = {} self._download() self._preload() def _download(self): '''If corpus files aren't available, automatically download them''' url = "http://www.ncbi.nlm.nih.gov/CBBresearch/Dogan/DISEASE/" filelist = ["NCBItrainset_corpus.zip","NCBItestset_corpus.zip","NCBIdevelopset_corpus.zip"] for fname in filelist: outfname = "{}{}".format(self.inputpath,fname) if os.path.exists(outfname): continue print("Downloading NCBI Disease Corpus dataset [{}]...".format(os.path.basename(outfname))) download(url+fname,outfname) cwd = os.getcwd() os.chdir(self.inputpath) subprocess.call(["unzip", outfname]) os.chdir(cwd) def _preload(self): '''Load corpus into memory''' Annotation = namedtuple('Annotation', ['text_type','start','end','text','mention_type']) # holdout set definitions cvdefs = {"NCBIdevelopset_corpus.txt":"development", "NCBItestset_corpus.txt":"testing", "NCBItrainset_corpus.txt":"training"} filelist = glob.glob("%s/*.txt" % self.inputpath) for fname in filelist: setname = cvdefs[fname.split("/")[-1]] documents = [] with codecs.open(fname,"rU",self.encoding) as f: doc = [] for line in f: row = line.strip() if not row and doc: documents += [doc] doc = [] elif row: row = row.split("|") if (len(row.split("|")) > 1 and row.split("|")[1] in ["t","a"]) else row.split("\t") doc += [row] documents += [doc] for doc in documents: pmid,title,abstract = doc[0][0],doc[0][2],doc[1][2] text = "%s %s" % (title, abstract) attributes = {"set":setname,"title":title,"abstract":abstract} attributes["annotations"] = [] # load annotation tuples for row in doc[2:]: pmid, start, end, mention, mention_type, duid = row start,end = int(start),int(end) text_type = "T" if end <= len(title) else "A" label = Annotation(text_type, start, end, mention, mention_type) attributes["annotations"] += [label] # warning if PMID is already loaded if pmid in self._docs: print >> sys.stderr, "WARNING: Duplicate PMID {} found".format(pmid) doc = Document(pmid,text,attributes=attributes) self._docs[pmid] = doc def __getitem__(self,key): return self._docs[key] def _load(self, filename): for pmid in self._docs: yield self._docs[pmid] def load_corpus(parser): '''Load NCBI Disease Corpus ''' # init cache directory and parsers cache_dir = "{}/data/ncbi_disease_corpus/cache/".format(os.path.dirname(__file__)) doc_parser = NcbiDiseaseParser() text_parser = PickleSerializedParser(parser,rootdir=cache_dir) # create cross-validation set information attributes = {"sets":{"testing":[],"training":[],"development":[]}} for pmid in doc_parser._docs: setname = doc_parser._docs[pmid].attributes["set"] attributes["sets"][setname] += [pmid] return Corpus(doc_parser,text_parser,attributes)
ddbiolib-master
ddbiolib/datasets/ncbi_disease.py
from .ncbi_disease import * from .ncbi_legacy import *
ddbiolib-master
ddbiolib/datasets/__init__.py
import os import sys import glob import codecs import subprocess from collections import namedtuple from ..utils import download from ..corpora import Corpus,Document,DocParser from ..parsers import PickleSerializedParser class CdrParser(DocParser): ''' The CDR disease corpus -- f 1500 PubMed abstracts X disease mentions X chemical mentions ''' def __init__(self, inputpath=None, entity_type="Disease"): super(CdrParser, self).__init__(inputpath, "utf-8") if not inputpath: self.inputpath = "{}/data/CDR.Corpus.v010516/".format(os.path.dirname(__file__)) else: self.inputpath = inputpath self._docs = {} # download CDR data if not os.path.exists(self.inputpath): self._download() self._preload(entity_type) def _download(self): print>>sys.stderr,"CDR files require a Biocreative account. See http://www.biocreative.org/accounts/register/" def _preload(self, et): '''Load entire corpus into memory''' Annotation = namedtuple('Annotation', ['text_type','start','end','text','mention_type']) cvdefs = {"CDR_DevelopmentSet.PubTator.txt":"development", "CDR_TestSet.PubTator.txt":"testing", "CDR_TrainingSet.PubTator.txt":"training"} filelist = glob.glob("%s/*.txt" % self.inputpath) for fname in filelist: setname = cvdefs[fname.split("/")[-1]] documents = [] with codecs.open(fname,"rU",self.encoding) as f: doc = [] for line in f: row = line.strip() if not row and doc: documents += [doc] doc = [] elif row: row = row.split("|") if (len(row.split("|")) > 1 and row.split("|")[1] in ["t","a"]) else row.split("\t") doc += [row] if doc: documents += [doc] for doc in documents: pmid,title,abstract = doc[0][0],doc[0][2],doc[1][2] text = "%s %s" % (title, abstract) attributes = {"set":setname,"title":title,"abstract":abstract} attributes["annotations"] = [] # load annotation tuples for row in doc[2:]: # relation # ---------------------------- if len(row) <= 4:# or row[4] == "Chemical": pmid,rela,m1,m2 = row continue # entity # ---------------------------- if len(row) == 6: pmid, start, end, mention, mention_type, duid = row norm_names = [] elif len(row) == 7: pmid, start, end, mention, mention_type, duid, norm_names = row duid = duid.split("|") start,end = int(start),int(end) text_type = "T" if end <= len(title) else "A" if mention_type != et: continue label = Annotation(text_type, start, end, mention, mention_type) attributes["annotations"] += [label] doc = Document(pmid,text,attributes=attributes) self._docs[pmid] = doc def __getitem__(self,key): return self._docs[key] def _load(self, filename): for pmid in self._docs: yield self._docs[pmid] def load_corpus(parser,entity_type="Disease"): '''Load CDR Disease Corpus ''' # init cache directory and parsers cache_dir = "{}/data/CDR.Corpus.v010516/cache/".format(os.path.dirname(__file__)) doc_parser = CdrParser(entity_type=entity_type) text_parser = PickleSerializedParser(parser,rootdir=cache_dir) # create cross-validation set information attributes = {"sets":{"testing":[],"training":[],"development":[]}} for pmid in doc_parser._docs: setname = doc_parser._docs[pmid].attributes["set"] attributes["sets"][setname]+= [pmid] return Corpus(doc_parser,text_parser,attributes)
ddbiolib-master
ddbiolib/datasets/cdr.py
''' DEPRICATED Include only for backwards compatibility with TACL experiments ''' import os import re import sys import glob import codecs import cPickle import operator import itertools import numpy as np from collections import namedtuple Annotation = namedtuple('Annotation', ['text_type','start','end','text','mention_type']) CdrAnnotation = namedtuple('Annotation', ['text_type','start','end','text','mention_type', "mesh_ids", "mesh_names"]) Document = namedtuple('Document',['doc_id','title','body','sentences']) class Corpus(object): def __init__(self, path, parser, encoding="utf-8"): self.path = path self.parser = parser self.encoding = encoding def _get_files(self): if os.path.isfile(self.path): return [self.path] elif os.path.isdir(self.path): return [os.path.join(self.path, f) for f in os.listdir(self.path)] else: return glob.glob(self.path) class PlainTextCorpus(Corpus): def __init__(self, path, parser, cache_path=None): ''' PubMed abstracts corpus. File format assumed to be PMID title body ''' super(PlainTextCorpus, self).__init__(path, parser) self.documents = {} self._load_files() self.cache_path = cache_path def __iter__(self): for pmid in self.documents: yield self.__getitem__(pmid) def __getitem__(self, uid): pkl_file = "%s/%s.pkl" % (self.cache_path, uid) # load cached parse if it exists if os.path.exists(pkl_file): with open(pkl_file, 'rb') as f: self.documents[uid] = cPickle.load(f) else: sentences = [s for s in self.parser.parse(self.documents[uid]["text"])] self.documents[uid]["sentences"] = sentences with open(pkl_file, 'w+') as f: cPickle.dump(self.documents[uid], f) return self.documents[uid] def _load_files(self): filelist = glob.glob("{}/*.txt".format(self.path)) for fname in filelist: uid = fname.split("/").rstrip(".txt") self.documents[uid] = {} self.documents[uid]["text"] = "".join(codecs.open(self.path,"r").readlines()) def overlaps(a,b): return len(set(a).intersection(b)) != 0 def unescape_penn_treebank(words): '''Replace PennTreeBank tags and other CoreNLP modifications. This is pretty much a hack. ''' repl = dict([('-LRB-',u'('), ('-RRB-',u')'), ('-LCB-',u'{'), ('-RCB-',u'}'),("`",u"'"), ('-LSB-',u'['),('-RSB-',u']')]) #,("``",'"'),("''",'"') words = [repl[w] if w in repl else w for w in words] # deal with quotation marks rm = False for i in range(0,len(words)): if words[i] == "``": rm = True words[i] = '"' if rm and words[i] == "''": words[i] = '"' rm = False return words class NcbiDiseaseCorpus(Corpus): '''The NCBI disease corpus is fully annotated at the mention and concept level to serve as a research resource for the biomedical natural language processing community. -- from http://www.ncbi.nlm.nih.gov/CBBresearch/Dogan/DISEASE/ 793 PubMed abstracts 6,892 disease mentions 790 unique disease concepts ''' def __init__(self, path, parser, cache_path="/tmp/"): super(NcbiDiseaseCorpus, self).__init__(path, parser) self.path = path self.cv = {"training":{},"development":{},"testing":{}} self.documents = {} self.annotations = {} self._load_files() self.cache_path = cache_path def __getitem__(self,pmid): """Use PMID as key and load parsed document object""" pkl_file = "%s/%s.pkl" % (self.cache_path, pmid) # load cached parse if it exists if os.path.exists(pkl_file): with open(pkl_file, 'rb') as f: self.documents[pmid] = cPickle.load(f) else: self.documents[pmid]["title"] = self.documents[pmid]["title"] self.documents[pmid]["body"] = self.documents[pmid]["body"] # align gold annotations title = self.documents[pmid]["title"] body = self.documents[pmid]["body"] doc_str = "%s %s" % (title,body) self.documents[pmid]["sentences"] = [s for s in self.parser.parse(doc_str,doc_id=pmid)] self.documents[pmid]["tags"] = [] if pmid in self.annotations: self.documents[pmid]["tags"] = self._label(self.annotations[pmid],self.documents[pmid]["sentences"]) else: self.documents[pmid]["tags"] += [[] for _ in range(len(self.documents[pmid]["sentences"]))] with open(pkl_file, 'w+') as f: cPickle.dump(self.documents[pmid], f) return self.documents[pmid] def _ground_truth(self,doc_ids): '''Build ground truth (doc_id,sent_id,char_offset) mentions''' ground_truth = [] for pmid in doc_ids: doc = self.__getitem__(pmid)["sentences"] labels = self.__getitem__(pmid)["tags"] for sent_id in range(0,len(doc)): for tag in labels[sent_id]: # assess ground truth on token label = tag[0] # gold standard annotation text span = tag[-1] char_idx = doc[sent_id].char_offsets[span[0]] char_span = tuple([char_idx, char_idx+len(label)]) ground_truth += [(pmid, sent_id, tuple(range(*span)), char_span, label.replace(" ",""))] #ground_truth += [(pmid, sent_id, tuple(range(*span)),label.replace(" ",""))] return ground_truth def gold_labels(self,candidates): '''Given a set of candidates, generate -1,1 labels using internal gold label data''' doc_ids = {c.doc_id:1 for c in candidates} true_labels = set(self._ground_truth(doc_ids)) gold = [0] * len(candidates) for idx,c in enumerate(candidates): text = "".join([c.words[i] for i in c.idxs]) char_span = [c.char_offsets[i] for i in c.idxs] char_span = (char_span[0], char_span[-1] + len(c.words[c.idxs[-1]])) char_span = tuple(char_span) mention = (c.doc_id, c.sent_id, tuple(c.idxs), char_span, text) #mention = (c.doc_id, c.sent_id, tuple(c.idxs), text) gold[idx] = 1 if mention in true_labels else -1 return np.array(gold) def score(self, candidates, prediction, doc_ids=None): '''Given a set of candidates, compute true precision, recall, f1 using gold labeled benchmark data (this includes non-candidate entities, which aren't captured by ddlite metrics). If holdout (a list of document PMIDs) is provided, us that as the document collection for scoring. ''' print "Candidates N:{}".format(len(candidates)) # create doc set from candidate pool or a provided doc_id set doc_ids = {c.doc_id:1 for c in candidates} if not doc_ids else dict.fromkeys(doc_ids) # compute original document character offsets for each mention mentions = {} for i,c in enumerate(candidates): if c.doc_id not in doc_ids: continue if prediction[i] != 1: continue mentions[self.getkey(c)] = 1 # score mentions = set(mentions.keys()) true_labels = set(self._ground_truth(doc_ids)) tp = true_labels.intersection(mentions) fp = mentions.difference(tp) fn = true_labels.difference(tp) print "-----------------------------" print "TP:{} FP:{} FN:{} True_N:{}".format(len(tp),len(fp),len(fn),len(true_labels)) print "-----------------------------" r = len(tp) / float(len(true_labels)) p = len(tp) / float(len(tp) + len(fp)) f1 = 2.0 * (p * r) / (p + r) return {"precision":p, "recall":r,"f1":f1, "tp":len(tp), "fp":len(fp), "fn":len(fn)} def classification_errors(self, candidates, prediction, doc_ids=None): # create doc set from candidate pool or a provided doc_id set doc_ids = {c.doc_id:1 for c in candidates} if not doc_ids else dict.fromkeys(doc_ids) # compute original document character offsets for each mention mentions = {} for i,c in enumerate(candidates): if c.doc_id not in doc_ids: continue if prediction[i] != 1: continue mentions[self.getkey(c)] = 1 #score mentions = set(mentions.keys()) true_labels = set(self._ground_truth(doc_ids)) tp = true_labels.intersection(mentions) fp = mentions.difference(tp) fn = true_labels.difference(tp) return (tp,fp,fn) def _label_index(self,doc_ids): '''Ground truth annotation index''' label_idx = {} for pmid in doc_ids: label_idx[pmid] = {} doc = self.__getitem__(pmid) for sentence,tags in zip(doc["sentences"],doc["tags"]): if sentence.sent_id not in label_idx[pmid]: label_idx[pmid][sentence.sent_id] = {} for text,offset in tags: label_idx[pmid][sentence.sent_id][offset] = text return label_idx def _candidate_index(self,candidates): candidate_idx = {} for i,c in enumerate(candidates): if c.doc_id not in candidate_idx: candidate_idx[c.doc_id] = {} if c.sent_id not in candidate_idx[c.doc_id]: candidate_idx[c.doc_id][c.sent_id] = {} span = (min(c.idxs),max(c.idxs)+1) candidate_idx[c.doc_id][c.sent_id][span] = c return candidate_idx def match(self, label, candidates, c_index=None, partial=True): ''' ''' m = [] c_index = self._candidate_index(candidates) if not c_index else c_index doc_id,sent_id,idxs,_,_ = label if doc_id in c_index and sent_id in c_index[doc_id]: lspan = (min(idxs),max(idxs)+1) if lspan in c_index[doc_id][sent_id]: m += [c_index[doc_id][sent_id][lspan]] if partial: for cspan in c_index[doc_id][sent_id]: if overlaps(range(*lspan),range(*cspan)) and lspan!=cspan: m += [c_index[doc_id][sent_id][cspan]] return m def getkey(self,c): '''Generate unique key for mention so that our evaluation can use set semantics''' mention = unescape_penn_treebank(c.mention()) txt = " ".join(mention) char_span = [c.char_offsets[i] for i in c.idxs] #char_span = (min(char_span),min(char_span)+len(txt)) char_span = (min(char_span), max(char_span) + len(mention[-1])) return (c.doc_id, c.sent_id, tuple(c.idxs), char_span, "".join(mention)) def force_longest_match(self, candidates, probability, doc_ids=None): '''Only use longest correct match for any set of overlapping or adjoining mentions''' c_index = self._candidate_index(candidates) true_labels = set(self._ground_truth(doc_ids)) pred_idx = {self.getkey(c):i for i,c in enumerate(candidates)} mapping = {} for label in true_labels: mapping[label] = self.match(label,candidates,c_index) for label in mapping: lengths = [len(c.mention()) for c in mapping[label]] proba = [probability[pred_idx[self.getkey(c)]] for c in mapping[label]] scores = zip(proba,lengths,mapping[label]) scores = [c for p,l,c, in sorted(zip(proba,lengths,mapping[label]),reverse=1) if p > 0.499] if not scores: continue mapping[label].remove(scores[0]) probability[pred_idx[self.getkey(scores[0])]] = 1 for c in mapping[label]: probability[pred_idx[self.getkey(c)]] = -1 def error_analysis_v1(self, candidates, prediction, doc_ids=None): c_index = self._candidate_index(candidates) true_labels = set(self._ground_truth(doc_ids)) mapping,claimed = {},{} for label in true_labels: # NOTE: candidates can touch multiple labels mapping[label] = self.match(label,candidates,c_index) claimed.update({self.getkey(c):1 for c in mapping[label]}) #pred_idx = {self.getkey(c):prediction[i] for i,c in enumerate(candidates)} def error_analysis(self, candidates, prediction, doc_ids=None): c_index = self._candidate_index(candidates) l_index = self._label_index(doc_ids) true_labels = set(self._ground_truth(doc_ids)) mapping,claimed = {},{} for label in true_labels: # NOTE: candidates can touch multiple labels mapping[label] = self.match(label,candidates,c_index) claimed.update({self.getkey(c):1 for c in mapping[label]}) partial,complete = [],[] for label in true_labels: matches = self.match(label, candidates, c_index) mentions = [" ".join(c.mention()) for c in mapping[label]] # true label doc_id,sent_id,idxs,char_span,_ = label span = (min(idxs),max(idxs)+1) mtext = l_index[doc_id][sent_id][span] # partial match if mtext not in mentions and len(matches) != 0: partial += [list(label)[0:-1] + [mtext]] # missed entirely elif mtext not in mentions: complete += [list(label)[0:-1] + [mtext]] return (partial,complete) ''' print "-----------------------------------" print "FN: Partial Matches" print "-----------------------------------" print len(partial) for item in partial: print item print "-----------------------------------" print "FN: Complete Misses" print "-----------------------------------" print len(complete) for item in complete: print item ''' def conll(self,doc_ids): '''Export docs to CoNLL format''' outstr = [] for doc_id in doc_ids: doc = self.__getitem__(doc_id) tagged = zip(doc["sentences"], doc["tags"]) for sentence,labels in tagged: # create label index idx = {} for term,(i,j) in labels: if i not in idx: idx[i] = {} idx[i][term] = j # fix overlapping gold entity spans (due to tokenziation errors) words = sentence.words tags = [u'O'] * len(words) for i in idx: for label in idx[i]: bio2 = [u"<B-DISEASE>"] bio2 += [u"<I-DISEASE>"] * (len(label.split())-1) tags[i:idx[i][label]] = bio2 s = zip(words,tags) for word,tag in s: outstr += [u"{} {}".format(word,tag)] outstr += [u""] return "\n".join(outstr) def _label(self,annotations,sentences): '''Convert annotations from NCBI offsets to parsed token offsets. NOTE: This isn't perfect, since tokenization can fail to correctly split some tags. ''' tags = [[] for i,_ in enumerate(sentences)] sents = {min(sent.char_offsets):sent for sent in sentences} sent_offsets = sorted(sents) for label in annotations: # find target sentence for i in range(len(sent_offsets)): start = sent_offsets[i] end = sents[start].char_offsets[-1] + 1 # determine span match (assume potentially overlapping spans) if label.start >= start and label.start <= end: span = [label.start, label.start + len(label.text)] idx = len(sents[start].words)-1 for j in range(0,len(sents[start].words)-1): if span[0] >= sents[start].char_offsets[j] and span[0] < sents[start].char_offsets[j+1]: idx = j break s_start = idx s_end = len(sents[start].words) for j in range(idx,len(sents[start].words)): if span[1] > sents[start].char_offsets[j]: s_end = j + 1 else: break tags[i] += [ (label.text, (s_start,s_end)) ] return tags def __iter__(self): for pmid in self.documents: yield self.__getitem__(pmid) def _load_files(self): ''' ''' cvdefs = {"NCBIdevelopset_corpus.txt":"development", "NCBItestset_corpus.txt":"testing", "NCBItrainset_corpus.txt":"training"} filelist = glob.glob("%s/*.txt" % self.path) for fname in filelist: setname = cvdefs[fname.split("/")[-1]] documents = [] with codecs.open(fname,"rU",self.encoding) as f: doc = [] for line in f: row = line.strip() if not row and doc: documents += [doc] doc = [] elif row: row = row.split("|") if (len(row.split("|")) > 1 and row.split("|")[1] in ["t","a"]) else row.split("\t") doc += [row] documents += [doc] for doc in documents: pmid,title,body = doc[0][0],doc[0][2],doc[1][2] if pmid in self.documents: print "Warning: duplicate {} PMID {}".format(setname,pmid) self.cv[setname][pmid] = 1 self.documents[pmid] = {"title":title,"body":body} doc_str = "%s %s" % (title, body) for row in doc[2:]: pmid, start, end, text, mention_type, duid = row start = int(start) end = int(end) # title or abstract mention? text_type = "T" if end <= len(title) else "A" if pmid not in self.annotations: self.annotations[pmid] = [] label = Annotation(text_type, start, end, text, mention_type) self.annotations[pmid] += [label] # validate there are no duplicate annotations labels = [ map(lambda x:(pmid,x), self.annotations[pmid]) for pmid in self.cv[setname]] labels = list(itertools.chain.from_iterable(labels)) print setname,len(labels)
ddbiolib-master
ddbiolib/datasets/ncbi_legacy.py
ddbiolib-master
ddbiolib/datasets/chemdner.py
import psycopg2 import mysql.connector class DatabaseI(object): '''Simple database wrapper. This mostly mirrors psycopg2 / mysql.connector functionality with some assurances built in for closing connections upon object destruction. TODO: check if this is actually required''' def __init__(self, host, user, database, password="", encoding='latin1'): self.host = host self.user = user self.password = password self.database = database self.encoding = encoding self.conn = None def connect(self): raise NotImplementedError() def closed(self): return False def cursor(self): raise NotImplementedError() def query(self, sql): raise NotImplementedError() def __enter__(self): return self def __exit__(self, _type, value, traceback): pass def __del__(self): pass class PostgresSqlConn(DatabaseI): def connect(self): '''Generate a connection to a PostgreSQL database. ''' conn_string = "host='%s' database='%s'" % (self.host, self.database) self.conn = psycopg2.connect(conn_string) self.conn.set_client_encoding(self.encoding) def closed(self): return self.conn.closed def cursor(self): return self.conn.cursor() def __exit__(self, _type, value, traceback): if not self.closed(): self.conn.close() def __del__(self): if not self.closed(): self.conn.close() class MySqlConn(DatabaseI): def connect(self): '''Generate a connection to a MySQL database. ''' #self.conn.set_client_encoding(self.encoding) self.conn = mysql.connector.connect(user=self.user, host=self.host, password=self.password, database=self.database) def closed(self): '''TODO -- don't think this function is correct''' #print(self.conn) #for x in self.conn.__dict__: # print x return self.conn def cursor(self): return self.conn.cursor() def query(self, sql): cursor = self.conn.cursor() cursor.execute(sql) return [row for row in cursor.fetchall()] def __exit__(self, _type, value, traceback): if not self.closed(): print("exiting") self.conn.close() def __del__(self): if not self.closed(): self.conn.close()
ddbiolib-master
ddbiolib/utils/database.py
from .base import * from .database import *
ddbiolib-master
ddbiolib/utils/__init__.py
import os from urllib2 import urlopen, URLError, HTTPError def download(url,outfname): try: data = urlopen(url) with open(outfname, "wb") as f: f.write(data.read()) except HTTPError, e: print "HTTP Error:", e.code, url except URLError, e: print "URL Error:", e.reason, url def unescape_penn_treebank(words): '''Replace PennTreeBank tags and other CoreNLP modifications. This is pretty much a hack. ''' repl = dict([('-LRB-',u'('), ('-RRB-',u')'), ('-LCB-',u'{'), ('-RCB-',u'}'),("`",u"'"), ('-LSB-',u'['),('-RSB-',u']')]) #,("``",'"'),("''",'"') words = [repl[w] if w in repl else w for w in words] # deal with quotation marks rm = False for i in range(0,len(words)): if words[i] == "``": rm = True words[i] = '"' if rm and words[i] == "''": words[i] = '"' rm = False return words
ddbiolib-master
ddbiolib/utils/base.py
#from .base import *from .base import *z from .base_snorkel import *
ddbiolib-master
ddbiolib/versioning/__init__.py
''' Snorkel Candidate Version ''' import os import sys import glob import hashlib import cPickle from datetime import datetime def dict2str(d): '''Convert dictionary to tuple pair string''' return str(d).encode("utf-8",errors="ignore") def checksum(s): '''Create checksum for input object''' if type(s) is dict: s = dict2str(s) elif type(s) in [list,tuple]: s = "|".join(sorted(list(s))) m = hashlib.md5() m.update(s) return m.hexdigest() def cands2str(candidates): '''Convert DeepDive Relations object to string''' convert = lambda x:x.encode("utf-8",errors="ignore") rela_func = lambda x:["{}:{}".format(x.sentence["doc_id"], x.sentence["sent_id"])] + map(convert,x.mention1("words")) + map(convert,x.mention2("words")) entity_func = lambda x:["{}:{}".format(x.sentence["doc_id"], x.sentence["sent_id"])] + map(convert,x.get_span()) get_row = rela_func if str(type(candidates)) == "Relations" else entity_func # create string versions of candidates s = [":".join(get_row(c)) for c in candidates] return "|".join(sorted(s)) class CandidateVersioner(object): '''Create unique version ID for candidate set while saving to disk''' def __init__(self, rootdir, prefix="", dicts={}): self.rootdir = rootdir self.prefix = prefix self.dicts = dicts self._candidates = {} self.filename = None self.checksum = None def snapshot(self, name, candidates): self._candidates[name] = candidates def save(self): '''Save checksummed version of candidate set. This computes checksums based on dictionaries, input documents, and final candidate set''' candidates = reduce(lambda x,y:x+y, self._candidates.values()) manifest = self._checksums(candidates, self.dicts) # dump candidates and log file ctype = "RELATIONS." if str(type(self._candidates)) == "Relations" else "ENTITIES." prefix = self.prefix + "." if self.prefix else "" self.filename = "{}/{}{}{}".format(self.rootdir,prefix,ctype,manifest["uid"]) cPickle.dump(self._candidates, open("{}.pkl".format(self.filename),"w")) self._write_log(self.filename,manifest) self.checksum = manifest["uid"] def load(self,checksum): filelist = glob.glob("{}*{}.pkl".format(self.rootdir,checksum)) if len(filelist) > 1: print>>sys.stderr,"Warning: multiple matching checksums" elif not len(filelist): print>>sys.stderr,"Error: snapshot not found" return {} fname = filelist[0] self._candidates = cPickle.load(open(fname,"rb")) self.filename = fname.strip(".pkl") self.checksum = checksum return self._candidates def _checksums(self, candidates, dicts): '''Compute MD5 checksums for all assets used to create this candidate set''' manifest = {} # dictionary checksums for name,d in dicts.items(): manifest["dictionary:{}".format(name)] = checksum(d) # doc and candidate checksum doc_ids = sorted(set([c.sentence["doc_id"] for c in candidates])) manifest["doc_ids"] = checksum(doc_ids) manifest["candidates"] = checksum(cands2str(candidates)) # some count data about candidates manifest["num_docs"] = len(doc_ids) manifest["num_candidates"] = len(candidates) # create unique checksum ID _,values = zip(*sorted(manifest.items())) values = map(str,values) manifest["uid"] = checksum(reduce(lambda x,y:x+y,values)) return manifest def _write_log(self,filename,manifest): # write checksums to text file ts = datetime.now() outfile = "{}.checksums".format(filename) with open(outfile,'w') as f: f.write("{0:<22}{1:^11}{2:<32}\n".format("ts","=",str(ts))) for key,value in sorted(manifest.items()): f.write("{0:<22}{1:^11}{2:<32}\n".format(key,"=",value))
ddbiolib-master
ddbiolib/versioning/base_snorkel.py
import os import random import hashlib from datetime import datetime from ddlite import * def dict2str(d): '''Convert dictionary to tuple pair string''' return str(d).encode("utf-8",errors="ignore") def checksum(s): '''Create checksum for input object''' if type(s) is dict: s = dict2str(s) elif type(s) in [list,tuple]: s = "|".join(sorted(list(s))) m = hashlib.md5() m.update(s) return m.hexdigest() def cands2str(candidates): '''Convert DeepDive Relations object to string''' convert = lambda x:x.encode("utf-8",errors="ignore") rela_func = lambda x:["{}:{}".format(x.doc_id, x.sent_id)] + map(convert,x.mention1("words")) + map(convert,x.mention2("words")) entity_func = lambda x:["{}:{}".format(x.doc_id, x.sent_id)] + map(convert,x.mention("words")) get_row = rela_func if type(candidates) is Relations else entity_func # create string versions of candidates s = [":".join(get_row(c)) for c in candidates] return "|".join(sorted(s)) class CandidateVersioner(object): '''Create unique version ID for candidate set while saving to disk''' def __init__(self,rootdir,prefix=""): self.rootdir = rootdir self.prefix = prefix self.filename = None def dump_candidates(self, candidates, dicts): '''Save checksummed version of candidate set. This computes checksums based on dictionaries, input documents, and final candidate set''' manifest = self._checksums(candidates, dicts) # dump candidates and log file ctype = "RELATIONS." if type(candidates) is Relations else "ENTITIES." prefix = self.prefix + "." if self.prefix else "" self.filename = "{}/{}{}{}".format(self.rootdir,prefix,ctype,manifest["uid"]) candidates.dump_candidates("{}.pkl".format(self.filename)) self._write_log(self.filename,manifest) def _checksums(self, candidates, dicts): '''Compute MD5 checksums for all assets used to create this candidate set''' manifest = {} # dictionary checksums for name,d in dicts.items(): manifest["dictionary:{}".format(name)] = checksum(d) # doc and candidate checksum doc_ids = sorted(set([c.doc_id for c in candidates])) manifest["doc_ids"] = checksum(doc_ids) manifest["candidates"] = checksum(cands2str(candidates)) # some count data about candidates manifest["num_docs"] = len(doc_ids) manifest["num_candidates"] = len(candidates) # create unique checksum ID _,values = zip(*sorted(manifest.items())) values = map(str,values) manifest["uid"] = checksum(reduce(lambda x,y:x+y,values)) return manifest def _write_log(self,filename,manifest): # write checksums to text file ts = datetime.now() outfile = "{}.checksums".format(filename) with open(outfile,'w') as f: f.write("{0:<22}{1:^11}{2:<32}\n".format("ts","=",str(ts))) for key,value in sorted(manifest.items()): f.write("{0:<22}{1:^11}{2:<32}\n".format(key,"=",value))
ddbiolib-master
ddbiolib/versioning/base.py
from .base import * from .doc_parsers import * from .utils import *
ddbiolib-master
ddbiolib/corpora/__init__.py
import re # Originally from http://effbot.org/zone/unicode-gremlins.htm # Replaced definitions to conform to: # ftp://ftp.unicode.org/Public/MAPPINGS/VENDORS/MICSFT/WINDOWS/CP1250.TXT # http://www.microsoft.com/typography/unicode/1252.htm cp1252 = { u"\x80": u"\u20AC", # EURO SIGN u"\x81": u"", # UNDEFINED u"\x82": u"\u201A", # SINGLE LOW-9 QUOTATION MARK u"\x83": u"", # UNDEFINED u"\x84": u"\u201E", # DOUBLE LOW-9 QUOTATION MARK u"\x85": u"\u2026", # HORIZONTAL ELLIPSIS u"\x86": u"\u2020", # DAGGER u"\x87": u"\u2021", # DOUBLE DAGGER u"\x88": u"", # UNDEFINED u"\x89": u"\u2030", # PER MILLE SIGN u"\x8A": u"\u0160", # LATIN CAPITAL LETTER S WITH CARON u"\x8B": u"\u2039", # SINGLE LEFT-POINTING ANGLE QUOTATION MARK u"\x8C": u"\u015A", # LATIN CAPITAL LETTER S WITH ACUTE u"\x8D": u"\u0164", # LATIN CAPITAL LETTER T WITH CARON u"\x8E": u"\u017D", #LATIN CAPITAL LETTER Z WITH CARON u"\x8F": u"\u0179", # LATIN CAPITAL LETTER Z WITH ACUTE u"\x90": u"", # UNDEFINED u"\x91": u"\u2018", # LEFT SINGLE QUOTATION MARK u"\x92": u"\u2019", # RIGHT SINGLE QUOTATION MARK u"\x93": u"\u201C", # LEFT DOUBLE QUOTATION MARK u"\x94": u"\u201D", # RIGHT DOUBLE QUOTATION MARK u"\x95": u"\u2022", # BULLET u"\x96": u"\u2013", # EN DASH u"\x97": u"\u2014", # EM DASH u"\x98": u"", # UNDEFINED u"\x99": u"\u2122", # TRADE MARK SIGN u"\x9A": u"\u0161", # LATIN SMALL LETTER S WITH CARON u"\x9B": u"\u203A", # SINGLE RIGHT-POINTING ANGLE QUOTATION MARK u"\x9C": u"\u015B", # LATIN SMALL LETTER S WITH ACUTE u"\x9D": u"\u0165", # LATIN SMALL LETTER T WITH CARON u"\x9E": u"\u017E", # LATIN SMALL LETTER Z WITH CARON u"\x9F": u"\u017A", # LATIN SMALL LETTER Z WITH ACUTE } def kill_gremlins(text): # map cp1252 gremlins to real unicode characters if re.search(u"[\x80-\x9f]", text): def fixup(m): s = m.group(0) return cp1252.get(s, s) if isinstance(text, type("")): # make sure we have a unicode string text = unicode(text, "iso-8859-1") text = re.sub(u"[\x80-\x9f]", fixup, text) # remove ASCII control chars return text def rm_ascii_control_chars(t): return re.sub(u"[\x00-\x1F]|[\x7F]", u"", t) def to_conll(corpus, labels, label_key, doc_ids=None): ''' Given a corpus and label key, generate a CoNLL format document ''' # index labels by doc/sent idx = {} for l in labels: doc_id = l.sentence["doc_id"] sent_id = l.sentence["sent_id"] if doc_id not in idx: idx[doc_id] = {} if sent_id not in idx[doc_id]: idx[doc_id][sent_id] = [] idx[doc_id][sent_id] += [l.idxs] n = 0 sentences = [] for doc in corpus: if doc_ids and doc.doc_id not in doc_ids: continue for i,sent in enumerate(doc.sentences): tags = len(sent.words) * ['O'] if sent.doc_id in idx and i in idx[sent.doc_id]: labels = idx[sent.doc_id][i] for lbl in labels: t = [u"B-{}".format(label_key)] t += [u"I-{}".format(label_key)] * (len(lbl)-1) tags[min(lbl):max(lbl)+1] = t n += 1 # HACK unicode whitespace character fix (for conlleval script compatibility) words = map(lambda x:x.replace(u'\xa0',u'_'), sent.words) sentences += [zip(words,tags) ] outstr = [] for sent in sentences: outstr += ["\n".join(map(lambda x: u"{} {}".format(*x),sent))] outstr += [""] print n return "\n".join(outstr)
ddbiolib-master
ddbiolib/corpora/utils.py